var Oi = Object.defineProperty, Ri = Object.defineProperties var Li = Object.getOwnPropertyDescriptors var eo = Object.getOwnPropertySymbols var Co = Object.prototype.hasOwnProperty, So = Object.prototype.propertyIsEnumerable var Eo = (e, t, r) => t in e ? Oi(e, t, { enumerable: !0, configurable: !0, writable: !0, value: r }) : (e[t] = r), ar = (e, t) => { for (var r in t || (t = {})) Co.call(t, r) && Eo(e, r, t[r]) if (eo) for (var r of eo(t)) So.call(t, r) && Eo(e, r, t[r]) return e }, pr = (e, t) => Ri(e, Li(t)) var To = (e, t) => { var r = {} for (var o in e) Co.call(e, o) && t.indexOf(o) < 0 && (r[o] = e[o]) if (e != null && eo) for (var o of eo(e)) t.indexOf(o) < 0 && So.call(e, o) && (r[o] = e[o]) return r } function __vite_legacy_guard() { import('data:text/javascript,') } const p$1 = function () { const t = document.createElement('link').relList if (t && t.supports && t.supports('modulepreload')) return for (const n of document.querySelectorAll('link[rel="modulepreload"]')) o(n) new MutationObserver(n => { for (const a of n) if (a.type === 'childList') for (const l of a.addedNodes) l.tagName === 'LINK' && l.rel === 'modulepreload' && o(l) }).observe(document, { childList: !0, subtree: !0 }) function r(n) { const a = {} return ( n.integrity && (a.integrity = n.integrity), n.referrerpolicy && (a.referrerPolicy = n.referrerpolicy), n.crossorigin === 'use-credentials' ? (a.credentials = 'include') : n.crossorigin === 'anonymous' ? (a.credentials = 'omit') : (a.credentials = 'same-origin'), a ) } function o(n) { if (n.ep) return n.ep = !0 const a = r(n) fetch(n.href, a) } } p$1() function makeMap(e, t) { const r = Object.create(null), o = e.split(',') for (let n = 0; n < o.length; n++) r[o[n]] = !0 return t ? n => !!r[n.toLowerCase()] : n => !!r[n] } const specialBooleanAttrs = 'itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly', isSpecialBooleanAttr = makeMap(specialBooleanAttrs) function includeBooleanAttr(e) { return !!e || e === '' } function normalizeStyle(e) { if (isArray$7(e)) { const t = {} for (let r = 0; r < e.length; r++) { const o = e[r], n = isString$2(o) ? parseStringStyle(o) : normalizeStyle(o) if (n) for (const a in n) t[a] = n[a] } return t } else { if (isString$2(e)) return e if (isObject$2(e)) return e } } const listDelimiterRE = /;(?![^(]*\))/g, propertyDelimiterRE = /:(.+)/ function parseStringStyle(e) { const t = {} return ( e.split(listDelimiterRE).forEach(r => { if (r) { const o = r.split(propertyDelimiterRE) o.length > 1 && (t[o[0].trim()] = o[1].trim()) } }), t ) } function normalizeClass(e) { let t = '' if (isString$2(e)) t = e else if (isArray$7(e)) for (let r = 0; r < e.length; r++) { const o = normalizeClass(e[r]) o && (t += o + ' ') } else if (isObject$2(e)) for (const r in e) e[r] && (t += r + ' ') return t.trim() } function normalizeProps(e) { if (!e) return null let { class: t, style: r } = e return ( t && !isString$2(t) && (e.class = normalizeClass(t)), r && (e.style = normalizeStyle(r)), e ) } function looseCompareArrays(e, t) { if (e.length !== t.length) return !1 let r = !0 for (let o = 0; r && o < e.length; o++) r = looseEqual(e[o], t[o]) return r } function looseEqual(e, t) { if (e === t) return !0 let r = isDate$2(e), o = isDate$2(t) if (r || o) return r && o ? e.getTime() === t.getTime() : !1 if (((r = isSymbol$2(e)), (o = isSymbol$2(t)), r || o)) return e === t if (((r = isArray$7(e)), (o = isArray$7(t)), r || o)) return r && o ? looseCompareArrays(e, t) : !1 if (((r = isObject$2(e)), (o = isObject$2(t)), r || o)) { if (!r || !o) return !1 const n = Object.keys(e).length, a = Object.keys(t).length if (n !== a) return !1 for (const l in e) { const s = e.hasOwnProperty(l), c = t.hasOwnProperty(l) if ((s && !c) || (!s && c) || !looseEqual(e[l], t[l])) return !1 } } return String(e) === String(t) } function looseIndexOf(e, t) { return e.findIndex(r => looseEqual(r, t)) } const toDisplayString = e => isString$2(e) ? e : e == null ? '' : isArray$7(e) || (isObject$2(e) && (e.toString === objectToString$3 || !isFunction$1(e.toString))) ? JSON.stringify(e, replacer, 2) : String(e), replacer = (e, t) => t && t.__v_isRef ? replacer(e, t.value) : isMap$3(t) ? { [`Map(${t.size})`]: [...t.entries()].reduce( (r, [o, n]) => ((r[`${o} =>`] = n), r), {} ) } : isSet$3(t) ? { [`Set(${t.size})`]: [...t.values()] } : isObject$2(t) && !isArray$7(t) && !isPlainObject$2(t) ? String(t) : t, EMPTY_OBJ = {}, EMPTY_ARR = [], NOOP = () => {}, NO = () => !1, onRE = /^on[^a-z]/, isOn = e => onRE.test(e), isModelListener = e => e.startsWith('onUpdate:'), extend$1 = Object.assign, remove = (e, t) => { const r = e.indexOf(t) r > -1 && e.splice(r, 1) }, hasOwnProperty$d = Object.prototype.hasOwnProperty, hasOwn$2 = (e, t) => hasOwnProperty$d.call(e, t), isArray$7 = Array.isArray, isMap$3 = e => toTypeString(e) === '[object Map]', isSet$3 = e => toTypeString(e) === '[object Set]', isDate$2 = e => toTypeString(e) === '[object Date]', isFunction$1 = e => typeof e == 'function', isString$2 = e => typeof e == 'string', isSymbol$2 = e => typeof e == 'symbol', isObject$2 = e => e !== null && typeof e == 'object', isPromise = e => isObject$2(e) && isFunction$1(e.then) && isFunction$1(e.catch), objectToString$3 = Object.prototype.toString, toTypeString = e => objectToString$3.call(e), toRawType = e => toTypeString(e).slice(8, -1), isPlainObject$2 = e => toTypeString(e) === '[object Object]', isIntegerKey = e => isString$2(e) && e !== 'NaN' && e[0] !== '-' && '' + parseInt(e, 10) === e, isReservedProp = makeMap( ',key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted' ), cacheStringFunction = e => { const t = Object.create(null) return r => t[r] || (t[r] = e(r)) }, camelizeRE = /-(\w)/g, camelize = cacheStringFunction(e => e.replace(camelizeRE, (t, r) => (r ? r.toUpperCase() : '')) ), hyphenateRE = /\B([A-Z])/g, hyphenate = cacheStringFunction(e => e.replace(hyphenateRE, '-$1').toLowerCase() ), capitalize = cacheStringFunction(e => e.charAt(0).toUpperCase() + e.slice(1)), toHandlerKey = cacheStringFunction(e => (e ? `on${capitalize(e)}` : '')), hasChanged = (e, t) => !Object.is(e, t), invokeArrayFns = (e, t) => { for (let r = 0; r < e.length; r++) e[r](t) }, def = (e, t, r) => { Object.defineProperty(e, t, { configurable: !0, enumerable: !1, value: r }) }, toNumber$1 = e => { const t = parseFloat(e) return isNaN(t) ? e : t } let _globalThis const getGlobalThis = () => _globalThis || (_globalThis = typeof globalThis != 'undefined' ? globalThis : typeof self != 'undefined' ? self : typeof window != 'undefined' ? window : typeof global != 'undefined' ? global : {}) let activeEffectScope class EffectScope { constructor(t = !1) { ;(this.active = !0), (this.effects = []), (this.cleanups = []), !t && activeEffectScope && ((this.parent = activeEffectScope), (this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push( this ) - 1)) } run(t) { if (this.active) { const r = activeEffectScope try { return (activeEffectScope = this), t() } finally { activeEffectScope = r } } } on() { activeEffectScope = this } off() { activeEffectScope = this.parent } stop(t) { if (this.active) { let r, o for (r = 0, o = this.effects.length; r < o; r++) this.effects[r].stop() for (r = 0, o = this.cleanups.length; r < o; r++) this.cleanups[r]() if (this.scopes) for (r = 0, o = this.scopes.length; r < o; r++) this.scopes[r].stop(!0) if (this.parent && !t) { const n = this.parent.scopes.pop() n && n !== this && ((this.parent.scopes[this.index] = n), (n.index = this.index)) } this.active = !1 } } } function effectScope(e) { return new EffectScope(e) } function recordEffectScope(e, t = activeEffectScope) { t && t.active && t.effects.push(e) } function getCurrentScope() { return activeEffectScope } function onScopeDispose(e) { activeEffectScope && activeEffectScope.cleanups.push(e) } const createDep = e => { const t = new Set(e) return (t.w = 0), (t.n = 0), t }, wasTracked = e => (e.w & trackOpBit) > 0, newTracked = e => (e.n & trackOpBit) > 0, initDepMarkers = ({ deps: e }) => { if (e.length) for (let t = 0; t < e.length; t++) e[t].w |= trackOpBit }, finalizeDepMarkers = e => { const { deps: t } = e if (t.length) { let r = 0 for (let o = 0; o < t.length; o++) { const n = t[o] wasTracked(n) && !newTracked(n) ? n.delete(e) : (t[r++] = n), (n.w &= ~trackOpBit), (n.n &= ~trackOpBit) } t.length = r } }, targetMap = new WeakMap() let effectTrackDepth = 0, trackOpBit = 1 const maxMarkerBits = 30 let activeEffect const ITERATE_KEY = Symbol(''), MAP_KEY_ITERATE_KEY = Symbol('') class ReactiveEffect { constructor(t, r = null, o) { ;(this.fn = t), (this.scheduler = r), (this.active = !0), (this.deps = []), (this.parent = void 0), recordEffectScope(this, o) } run() { if (!this.active) return this.fn() let t = activeEffect, r = shouldTrack for (; t; ) { if (t === this) return t = t.parent } try { return ( (this.parent = activeEffect), (activeEffect = this), (shouldTrack = !0), (trackOpBit = 1 << ++effectTrackDepth), effectTrackDepth <= maxMarkerBits ? initDepMarkers(this) : cleanupEffect(this), this.fn() ) } finally { effectTrackDepth <= maxMarkerBits && finalizeDepMarkers(this), (trackOpBit = 1 << --effectTrackDepth), (activeEffect = this.parent), (shouldTrack = r), (this.parent = void 0), this.deferStop && this.stop() } } stop() { activeEffect === this ? (this.deferStop = !0) : this.active && (cleanupEffect(this), this.onStop && this.onStop(), (this.active = !1)) } } function cleanupEffect(e) { const { deps: t } = e if (t.length) { for (let r = 0; r < t.length; r++) t[r].delete(e) t.length = 0 } } let shouldTrack = !0 const trackStack = [] function pauseTracking() { trackStack.push(shouldTrack), (shouldTrack = !1) } function resetTracking() { const e = trackStack.pop() shouldTrack = e === void 0 ? !0 : e } function track(e, t, r) { if (shouldTrack && activeEffect) { let o = targetMap.get(e) o || targetMap.set(e, (o = new Map())) let n = o.get(r) n || o.set(r, (n = createDep())), trackEffects(n) } } function trackEffects(e, t) { let r = !1 effectTrackDepth <= maxMarkerBits ? newTracked(e) || ((e.n |= trackOpBit), (r = !wasTracked(e))) : (r = !e.has(activeEffect)), r && (e.add(activeEffect), activeEffect.deps.push(e)) } function trigger(e, t, r, o, n, a) { const l = targetMap.get(e) if (!l) return let s = [] if (t === 'clear') s = [...l.values()] else if (r === 'length' && isArray$7(e)) l.forEach((c, d) => { ;(d === 'length' || d >= o) && s.push(c) }) else switch ((r !== void 0 && s.push(l.get(r)), t)) { case 'add': isArray$7(e) ? isIntegerKey(r) && s.push(l.get('length')) : (s.push(l.get(ITERATE_KEY)), isMap$3(e) && s.push(l.get(MAP_KEY_ITERATE_KEY))) break case 'delete': isArray$7(e) || (s.push(l.get(ITERATE_KEY)), isMap$3(e) && s.push(l.get(MAP_KEY_ITERATE_KEY))) break case 'set': isMap$3(e) && s.push(l.get(ITERATE_KEY)) break } if (s.length === 1) s[0] && triggerEffects(s[0]) else { const c = [] for (const d of s) d && c.push(...d) triggerEffects(createDep(c)) } } function triggerEffects(e, t) { const r = isArray$7(e) ? e : [...e] for (const o of r) o.computed && triggerEffect(o) for (const o of r) o.computed || triggerEffect(o) } function triggerEffect(e, t) { ;(e !== activeEffect || e.allowRecurse) && (e.scheduler ? e.scheduler() : e.run()) } const isNonTrackableKeys = makeMap('__proto__,__v_isRef,__isVue'), builtInSymbols = new Set( Object.getOwnPropertyNames(Symbol) .filter(e => e !== 'arguments' && e !== 'caller') .map(e => Symbol[e]) .filter(isSymbol$2) ), get$1 = createGetter(), shallowGet = createGetter(!1, !0), readonlyGet = createGetter(!0), arrayInstrumentations = createArrayInstrumentations() function createArrayInstrumentations() { const e = {} return ( ['includes', 'indexOf', 'lastIndexOf'].forEach(t => { e[t] = function (...r) { const o = toRaw(this) for (let a = 0, l = this.length; a < l; a++) track(o, 'get', a + '') const n = o[t](...r) return n === -1 || n === !1 ? o[t](...r.map(toRaw)) : n } }), ['push', 'pop', 'shift', 'unshift', 'splice'].forEach(t => { e[t] = function (...r) { pauseTracking() const o = toRaw(this)[t].apply(this, r) return resetTracking(), o } }), e ) } function createGetter(e = !1, t = !1) { return function (o, n, a) { if (n === '__v_isReactive') return !e if (n === '__v_isReadonly') return e if (n === '__v_isShallow') return t if ( n === '__v_raw' && a === (e ? t ? shallowReadonlyMap : readonlyMap : t ? shallowReactiveMap : reactiveMap ).get(o) ) return o const l = isArray$7(o) if (!e && l && hasOwn$2(arrayInstrumentations, n)) return Reflect.get(arrayInstrumentations, n, a) const s = Reflect.get(o, n, a) return (isSymbol$2(n) ? builtInSymbols.has(n) : isNonTrackableKeys(n)) || (e || track(o, 'get', n), t) ? s : isRef(s) ? l && isIntegerKey(n) ? s : s.value : isObject$2(s) ? e ? readonly(s) : reactive(s) : s } } const set$1 = createSetter(), shallowSet = createSetter(!0) function createSetter(e = !1) { return function (r, o, n, a) { let l = r[o] if (isReadonly(l) && isRef(l) && !isRef(n)) return !1 if ( !e && !isReadonly(n) && (isShallow(n) || ((n = toRaw(n)), (l = toRaw(l))), !isArray$7(r) && isRef(l) && !isRef(n)) ) return (l.value = n), !0 const s = isArray$7(r) && isIntegerKey(o) ? Number(o) < r.length : hasOwn$2(r, o), c = Reflect.set(r, o, n, a) return ( r === toRaw(a) && (s ? hasChanged(n, l) && trigger(r, 'set', o, n) : trigger(r, 'add', o, n)), c ) } } function deleteProperty(e, t) { const r = hasOwn$2(e, t) e[t] const o = Reflect.deleteProperty(e, t) return o && r && trigger(e, 'delete', t, void 0), o } function has$4(e, t) { const r = Reflect.has(e, t) return (!isSymbol$2(t) || !builtInSymbols.has(t)) && track(e, 'has', t), r } function ownKeys$1(e) { return ( track(e, 'iterate', isArray$7(e) ? 'length' : ITERATE_KEY), Reflect.ownKeys(e) ) } const mutableHandlers = { get: get$1, set: set$1, deleteProperty, has: has$4, ownKeys: ownKeys$1 }, readonlyHandlers = { get: readonlyGet, set(e, t) { return !0 }, deleteProperty(e, t) { return !0 } }, shallowReactiveHandlers = extend$1({}, mutableHandlers, { get: shallowGet, set: shallowSet }), toShallow = e => e, getProto$1 = e => Reflect.getPrototypeOf(e) function get$1$1(e, t, r = !1, o = !1) { e = e.__v_raw const n = toRaw(e), a = toRaw(t) r || (t !== a && track(n, 'get', t), track(n, 'get', a)) const { has: l } = getProto$1(n), s = o ? toShallow : r ? toReadonly : toReactive if (l.call(n, t)) return s(e.get(t)) if (l.call(n, a)) return s(e.get(a)) e !== n && e.get(t) } function has$1$1(e, t = !1) { const r = this.__v_raw, o = toRaw(r), n = toRaw(e) return ( t || (e !== n && track(o, 'has', e), track(o, 'has', n)), e === n ? r.has(e) : r.has(e) || r.has(n) ) } function size(e, t = !1) { return ( (e = e.__v_raw), !t && track(toRaw(e), 'iterate', ITERATE_KEY), Reflect.get(e, 'size', e) ) } function add(e) { e = toRaw(e) const t = toRaw(this) return ( getProto$1(t).has.call(t, e) || (t.add(e), trigger(t, 'add', e, e)), this ) } function set$1$1(e, t) { t = toRaw(t) const r = toRaw(this), { has: o, get: n } = getProto$1(r) let a = o.call(r, e) a || ((e = toRaw(e)), (a = o.call(r, e))) const l = n.call(r, e) return ( r.set(e, t), a ? hasChanged(t, l) && trigger(r, 'set', e, t) : trigger(r, 'add', e, t), this ) } function deleteEntry(e) { const t = toRaw(this), { has: r, get: o } = getProto$1(t) let n = r.call(t, e) n || ((e = toRaw(e)), (n = r.call(t, e))), o && o.call(t, e) const a = t.delete(e) return n && trigger(t, 'delete', e, void 0), a } function clear() { const e = toRaw(this), t = e.size !== 0, r = e.clear() return t && trigger(e, 'clear', void 0, void 0), r } function createForEach(e, t) { return function (o, n) { const a = this, l = a.__v_raw, s = toRaw(l), c = t ? toShallow : e ? toReadonly : toReactive return ( !e && track(s, 'iterate', ITERATE_KEY), l.forEach((d, u) => o.call(n, c(d), c(u), a)) ) } } function createIterableMethod(e, t, r) { return function (...o) { const n = this.__v_raw, a = toRaw(n), l = isMap$3(a), s = e === 'entries' || (e === Symbol.iterator && l), c = e === 'keys' && l, d = n[e](...o), u = r ? toShallow : t ? toReadonly : toReactive return ( !t && track(a, 'iterate', c ? MAP_KEY_ITERATE_KEY : ITERATE_KEY), { next() { const { value: m, done: f } = d.next() return f ? { value: m, done: f } : { value: s ? [u(m[0]), u(m[1])] : u(m), done: f } }, [Symbol.iterator]() { return this } } ) } } function createReadonlyMethod(e) { return function (...t) { return e === 'delete' ? !1 : this } } function createInstrumentations() { const e = { get(a) { return get$1$1(this, a) }, get size() { return size(this) }, has: has$1$1, add, set: set$1$1, delete: deleteEntry, clear, forEach: createForEach(!1, !1) }, t = { get(a) { return get$1$1(this, a, !1, !0) }, get size() { return size(this) }, has: has$1$1, add, set: set$1$1, delete: deleteEntry, clear, forEach: createForEach(!1, !0) }, r = { get(a) { return get$1$1(this, a, !0) }, get size() { return size(this, !0) }, has(a) { return has$1$1.call(this, a, !0) }, add: createReadonlyMethod('add'), set: createReadonlyMethod('set'), delete: createReadonlyMethod('delete'), clear: createReadonlyMethod('clear'), forEach: createForEach(!0, !1) }, o = { get(a) { return get$1$1(this, a, !0, !0) }, get size() { return size(this, !0) }, has(a) { return has$1$1.call(this, a, !0) }, add: createReadonlyMethod('add'), set: createReadonlyMethod('set'), delete: createReadonlyMethod('delete'), clear: createReadonlyMethod('clear'), forEach: createForEach(!0, !0) } return ( ['keys', 'values', 'entries', Symbol.iterator].forEach(a => { ;(e[a] = createIterableMethod(a, !1, !1)), (r[a] = createIterableMethod(a, !0, !1)), (t[a] = createIterableMethod(a, !1, !0)), (o[a] = createIterableMethod(a, !0, !0)) }), [e, r, t, o] ) } const [ mutableInstrumentations, readonlyInstrumentations, shallowInstrumentations, shallowReadonlyInstrumentations ] = createInstrumentations() function createInstrumentationGetter(e, t) { const r = t ? e ? shallowReadonlyInstrumentations : shallowInstrumentations : e ? readonlyInstrumentations : mutableInstrumentations return (o, n, a) => n === '__v_isReactive' ? !e : n === '__v_isReadonly' ? e : n === '__v_raw' ? o : Reflect.get(hasOwn$2(r, n) && n in o ? r : o, n, a) } const mutableCollectionHandlers = { get: createInstrumentationGetter(!1, !1) }, shallowCollectionHandlers = { get: createInstrumentationGetter(!1, !0) }, readonlyCollectionHandlers = { get: createInstrumentationGetter(!0, !1) }, reactiveMap = new WeakMap(), shallowReactiveMap = new WeakMap(), readonlyMap = new WeakMap(), shallowReadonlyMap = new WeakMap() function targetTypeMap(e) { switch (e) { case 'Object': case 'Array': return 1 case 'Map': case 'Set': case 'WeakMap': case 'WeakSet': return 2 default: return 0 } } function getTargetType(e) { return e.__v_skip || !Object.isExtensible(e) ? 0 : targetTypeMap(toRawType(e)) } function reactive(e) { return isReadonly(e) ? e : createReactiveObject( e, !1, mutableHandlers, mutableCollectionHandlers, reactiveMap ) } function shallowReactive(e) { return createReactiveObject( e, !1, shallowReactiveHandlers, shallowCollectionHandlers, shallowReactiveMap ) } function readonly(e) { return createReactiveObject( e, !0, readonlyHandlers, readonlyCollectionHandlers, readonlyMap ) } function createReactiveObject(e, t, r, o, n) { if (!isObject$2(e) || (e.__v_raw && !(t && e.__v_isReactive))) return e const a = n.get(e) if (a) return a const l = getTargetType(e) if (l === 0) return e const s = new Proxy(e, l === 2 ? o : r) return n.set(e, s), s } function isReactive(e) { return isReadonly(e) ? isReactive(e.__v_raw) : !!(e && e.__v_isReactive) } function isReadonly(e) { return !!(e && e.__v_isReadonly) } function isShallow(e) { return !!(e && e.__v_isShallow) } function isProxy(e) { return isReactive(e) || isReadonly(e) } function toRaw(e) { const t = e && e.__v_raw return t ? toRaw(t) : e } function markRaw(e) { return def(e, '__v_skip', !0), e } const toReactive = e => (isObject$2(e) ? reactive(e) : e), toReadonly = e => (isObject$2(e) ? readonly(e) : e) function trackRefValue(e) { shouldTrack && activeEffect && ((e = toRaw(e)), trackEffects(e.dep || (e.dep = createDep()))) } function triggerRefValue(e, t) { ;(e = toRaw(e)), e.dep && triggerEffects(e.dep) } function isRef(e) { return !!(e && e.__v_isRef === !0) } function ref(e) { return createRef(e, !1) } function shallowRef(e) { return createRef(e, !0) } function createRef(e, t) { return isRef(e) ? e : new RefImpl(e, t) } class RefImpl { constructor(t, r) { ;(this.__v_isShallow = r), (this.dep = void 0), (this.__v_isRef = !0), (this._rawValue = r ? t : toRaw(t)), (this._value = r ? t : toReactive(t)) } get value() { return trackRefValue(this), this._value } set value(t) { ;(t = this.__v_isShallow ? t : toRaw(t)), hasChanged(t, this._rawValue) && ((this._rawValue = t), (this._value = this.__v_isShallow ? t : toReactive(t)), triggerRefValue(this)) } } function triggerRef(e) { triggerRefValue(e) } function unref(e) { return isRef(e) ? e.value : e } const shallowUnwrapHandlers = { get: (e, t, r) => unref(Reflect.get(e, t, r)), set: (e, t, r, o) => { const n = e[t] return isRef(n) && !isRef(r) ? ((n.value = r), !0) : Reflect.set(e, t, r, o) } } function proxyRefs(e) { return isReactive(e) ? e : new Proxy(e, shallowUnwrapHandlers) } function toRefs(e) { const t = isArray$7(e) ? new Array(e.length) : {} for (const r in e) t[r] = toRef(e, r) return t } class ObjectRefImpl { constructor(t, r, o) { ;(this._object = t), (this._key = r), (this._defaultValue = o), (this.__v_isRef = !0) } get value() { const t = this._object[this._key] return t === void 0 ? this._defaultValue : t } set value(t) { this._object[this._key] = t } } function toRef(e, t, r) { const o = e[t] return isRef(o) ? o : new ObjectRefImpl(e, t, r) } class ComputedRefImpl { constructor(t, r, o, n) { ;(this._setter = r), (this.dep = void 0), (this.__v_isRef = !0), (this._dirty = !0), (this.effect = new ReactiveEffect(t, () => { this._dirty || ((this._dirty = !0), triggerRefValue(this)) })), (this.effect.computed = this), (this.effect.active = this._cacheable = !n), (this.__v_isReadonly = o) } get value() { const t = toRaw(this) return ( trackRefValue(t), (t._dirty || !t._cacheable) && ((t._dirty = !1), (t._value = t.effect.run())), t._value ) } set value(t) { this._setter(t) } } function computed$1(e, t, r = !1) { let o, n const a = isFunction$1(e) return ( a ? ((o = e), (n = NOOP)) : ((o = e.get), (n = e.set)), new ComputedRefImpl(o, n, a || !n, r) ) } const stack = [] function warn(e, ...t) { pauseTracking() const r = stack.length ? stack[stack.length - 1].component : null, o = r && r.appContext.config.warnHandler, n = getComponentTrace() if (o) callWithErrorHandling(o, r, 11, [ e + t.join(''), r && r.proxy, n.map(({ vnode: a }) => `at <${formatComponentName(r, a.type)}>`).join(` `), n ]) else { const a = [`[Vue warn]: ${e}`, ...t] n.length && a.push( ` `, ...formatTrace(n) ), console.warn(...a) } resetTracking() } function getComponentTrace() { let e = stack[stack.length - 1] if (!e) return [] const t = [] for (; e; ) { const r = t[0] r && r.vnode === e ? r.recurseCount++ : t.push({ vnode: e, recurseCount: 0 }) const o = e.component && e.component.parent e = o && o.vnode } return t } function formatTrace(e) { const t = [] return ( e.forEach((r, o) => { t.push( ...(o === 0 ? [] : [ ` ` ]), ...formatTraceEntry(r) ) }), t ) } function formatTraceEntry({ vnode: e, recurseCount: t }) { const r = t > 0 ? `... (${t} recursive calls)` : '', o = e.component ? e.component.parent == null : !1, n = ` at <${formatComponentName(e.component, e.type, o)}`, a = '>' + r return e.props ? [n, ...formatProps(e.props), a] : [n + a] } function formatProps(e) { const t = [], r = Object.keys(e) return ( r.slice(0, 3).forEach(o => { t.push(...formatProp(o, e[o])) }), r.length > 3 && t.push(' ...'), t ) } function formatProp(e, t, r) { return isString$2(t) ? ((t = JSON.stringify(t)), r ? t : [`${e}=${t}`]) : typeof t == 'number' || typeof t == 'boolean' || t == null ? r ? t : [`${e}=${t}`] : isRef(t) ? ((t = formatProp(e, toRaw(t.value), !0)), r ? t : [`${e}=Ref<`, t, '>']) : isFunction$1(t) ? [`${e}=fn${t.name ? `<${t.name}>` : ''}`] : ((t = toRaw(t)), r ? t : [`${e}=`, t]) } function callWithErrorHandling(e, t, r, o) { let n try { n = o ? e(...o) : e() } catch (a) { handleError(a, t, r) } return n } function callWithAsyncErrorHandling(e, t, r, o) { if (isFunction$1(e)) { const a = callWithErrorHandling(e, t, r, o) return ( a && isPromise(a) && a.catch(l => { handleError(l, t, r) }), a ) } const n = [] for (let a = 0; a < e.length; a++) n.push(callWithAsyncErrorHandling(e[a], t, r, o)) return n } function handleError(e, t, r, o = !0) { const n = t ? t.vnode : null if (t) { let a = t.parent const l = t.proxy, s = r for (; a; ) { const d = a.ec if (d) { for (let u = 0; u < d.length; u++) if (d[u](e, l, s) === !1) return } a = a.parent } const c = t.appContext.config.errorHandler if (c) { callWithErrorHandling(c, null, 10, [e, l, s]) return } } logError(e, r, n, o) } function logError(e, t, r, o = !0) { console.error(e) } let isFlushing = !1, isFlushPending = !1 const queue = [] let flushIndex = 0 const pendingPreFlushCbs = [] let activePreFlushCbs = null, preFlushIndex = 0 const pendingPostFlushCbs = [] let activePostFlushCbs = null, postFlushIndex = 0 const resolvedPromise = Promise.resolve() let currentFlushPromise = null, currentPreFlushParentJob = null function nextTick(e) { const t = currentFlushPromise || resolvedPromise return e ? t.then(this ? e.bind(this) : e) : t } function findInsertionIndex(e) { let t = flushIndex + 1, r = queue.length for (; t < r; ) { const o = (t + r) >>> 1 getId(queue[o]) < e ? (t = o + 1) : (r = o) } return t } function queueJob(e) { ;(!queue.length || !queue.includes( e, isFlushing && e.allowRecurse ? flushIndex + 1 : flushIndex )) && e !== currentPreFlushParentJob && (e.id == null ? queue.push(e) : queue.splice(findInsertionIndex(e.id), 0, e), queueFlush()) } function queueFlush() { !isFlushing && !isFlushPending && ((isFlushPending = !0), (currentFlushPromise = resolvedPromise.then(flushJobs))) } function invalidateJob(e) { const t = queue.indexOf(e) t > flushIndex && queue.splice(t, 1) } function queueCb(e, t, r, o) { isArray$7(e) ? r.push(...e) : (!t || !t.includes(e, e.allowRecurse ? o + 1 : o)) && r.push(e), queueFlush() } function queuePreFlushCb(e) { queueCb(e, activePreFlushCbs, pendingPreFlushCbs, preFlushIndex) } function queuePostFlushCb(e) { queueCb(e, activePostFlushCbs, pendingPostFlushCbs, postFlushIndex) } function flushPreFlushCbs(e, t = null) { if (pendingPreFlushCbs.length) { for ( currentPreFlushParentJob = t, activePreFlushCbs = [...new Set(pendingPreFlushCbs)], pendingPreFlushCbs.length = 0, preFlushIndex = 0; preFlushIndex < activePreFlushCbs.length; preFlushIndex++ ) activePreFlushCbs[preFlushIndex]() ;(activePreFlushCbs = null), (preFlushIndex = 0), (currentPreFlushParentJob = null), flushPreFlushCbs(e, t) } } function flushPostFlushCbs(e) { if ((flushPreFlushCbs(), pendingPostFlushCbs.length)) { const t = [...new Set(pendingPostFlushCbs)] if (((pendingPostFlushCbs.length = 0), activePostFlushCbs)) { activePostFlushCbs.push(...t) return } for ( activePostFlushCbs = t, activePostFlushCbs.sort((r, o) => getId(r) - getId(o)), postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++ ) activePostFlushCbs[postFlushIndex]() ;(activePostFlushCbs = null), (postFlushIndex = 0) } } const getId = e => (e.id == null ? 1 / 0 : e.id) function flushJobs(e) { ;(isFlushPending = !1), (isFlushing = !0), flushPreFlushCbs(e), queue.sort((r, o) => getId(r) - getId(o)) const t = NOOP try { for (flushIndex = 0; flushIndex < queue.length; flushIndex++) { const r = queue[flushIndex] r && r.active !== !1 && callWithErrorHandling(r, null, 14) } } finally { ;(flushIndex = 0), (queue.length = 0), flushPostFlushCbs(), (isFlushing = !1), (currentFlushPromise = null), (queue.length || pendingPreFlushCbs.length || pendingPostFlushCbs.length) && flushJobs(e) } } function emit$1(e, t, ...r) { if (e.isUnmounted) return const o = e.vnode.props || EMPTY_OBJ let n = r const a = t.startsWith('update:'), l = a && t.slice(7) if (l && l in o) { const u = `${l === 'modelValue' ? 'model' : l}Modifiers`, { number: m, trim: f } = o[u] || EMPTY_OBJ f && (n = r.map(_ => _.trim())), m && (n = r.map(toNumber$1)) } let s, c = o[(s = toHandlerKey(t))] || o[(s = toHandlerKey(camelize(t)))] !c && a && (c = o[(s = toHandlerKey(hyphenate(t)))]), c && callWithAsyncErrorHandling(c, e, 6, n) const d = o[s + 'Once'] if (d) { if (!e.emitted) e.emitted = {} else if (e.emitted[s]) return ;(e.emitted[s] = !0), callWithAsyncErrorHandling(d, e, 6, n) } } function normalizeEmitsOptions(e, t, r = !1) { const o = t.emitsCache, n = o.get(e) if (n !== void 0) return n const a = e.emits let l = {}, s = !1 if (!isFunction$1(e)) { const c = d => { const u = normalizeEmitsOptions(d, t, !0) u && ((s = !0), extend$1(l, u)) } !r && t.mixins.length && t.mixins.forEach(c), e.extends && c(e.extends), e.mixins && e.mixins.forEach(c) } return !a && !s ? (o.set(e, null), null) : (isArray$7(a) ? a.forEach(c => (l[c] = null)) : extend$1(l, a), o.set(e, l), l) } function isEmitListener(e, t) { return !e || !isOn(t) ? !1 : ((t = t.slice(2).replace(/Once$/, '')), hasOwn$2(e, t[0].toLowerCase() + t.slice(1)) || hasOwn$2(e, hyphenate(t)) || hasOwn$2(e, t)) } let currentRenderingInstance = null, currentScopeId = null function setCurrentRenderingInstance(e) { const t = currentRenderingInstance return ( (currentRenderingInstance = e), (currentScopeId = (e && e.type.__scopeId) || null), t ) } function withCtx(e, t = currentRenderingInstance, r) { if (!t || e._n) return e const o = (...n) => { o._d && setBlockTracking(-1) const a = setCurrentRenderingInstance(t), l = e(...n) return setCurrentRenderingInstance(a), o._d && setBlockTracking(1), l } return (o._n = !0), (o._c = !0), (o._d = !0), o } function markAttrsAccessed() {} function renderComponentRoot(e) { const { type: t, vnode: r, proxy: o, withProxy: n, props: a, propsOptions: [l], slots: s, attrs: c, emit: d, render: u, renderCache: m, data: f, setupState: _, ctx: b, inheritAttrs: v } = e let k, g const x = setCurrentRenderingInstance(e) try { if (r.shapeFlag & 4) { const w = n || o ;(k = normalizeVNode(u.call(w, w, m, a, _, f, b))), (g = c) } else { const w = t ;(k = normalizeVNode( w.length > 1 ? w(a, { attrs: c, slots: s, emit: d }) : w(a, null) )), (g = t.props ? c : getFunctionalFallthrough(c)) } } catch (w) { ;(blockStack.length = 0), handleError(w, e, 1), (k = createVNode(Comment)) } let y = k if (g && v !== !1) { const w = Object.keys(g), { shapeFlag: S } = y w.length && S & 7 && (l && w.some(isModelListener) && (g = filterModelListeners(g, l)), (y = cloneVNode(y, g))) } return ( r.dirs && ((y = cloneVNode(y)), (y.dirs = y.dirs ? y.dirs.concat(r.dirs) : r.dirs)), r.transition && (y.transition = r.transition), (k = y), setCurrentRenderingInstance(x), k ) } const getFunctionalFallthrough = e => { let t for (const r in e) (r === 'class' || r === 'style' || isOn(r)) && ((t || (t = {}))[r] = e[r]) return t }, filterModelListeners = (e, t) => { const r = {} for (const o in e) (!isModelListener(o) || !(o.slice(9) in t)) && (r[o] = e[o]) return r } function shouldUpdateComponent(e, t, r) { const { props: o, children: n, component: a } = e, { props: l, children: s, patchFlag: c } = t, d = a.emitsOptions if (t.dirs || t.transition) return !0 if (r && c >= 0) { if (c & 1024) return !0 if (c & 16) return o ? hasPropsChanged(o, l, d) : !!l if (c & 8) { const u = t.dynamicProps for (let m = 0; m < u.length; m++) { const f = u[m] if (l[f] !== o[f] && !isEmitListener(d, f)) return !0 } } } else return (n || s) && (!s || !s.$stable) ? !0 : o === l ? !1 : o ? l ? hasPropsChanged(o, l, d) : !0 : !!l return !1 } function hasPropsChanged(e, t, r) { const o = Object.keys(t) if (o.length !== Object.keys(e).length) return !0 for (let n = 0; n < o.length; n++) { const a = o[n] if (t[a] !== e[a] && !isEmitListener(r, a)) return !0 } return !1 } function updateHOCHostEl({ vnode: e, parent: t }, r) { for (; t && t.subTree === e; ) ((e = t.vnode).el = r), (t = t.parent) } const isSuspense = e => e.__isSuspense function queueEffectWithSuspense(e, t) { t && t.pendingBranch ? isArray$7(e) ? t.effects.push(...e) : t.effects.push(e) : queuePostFlushCb(e) } function provide(e, t) { if (currentInstance) { let r = currentInstance.provides const o = currentInstance.parent && currentInstance.parent.provides o === r && (r = currentInstance.provides = Object.create(o)), (r[e] = t) } } function inject(e, t, r = !1) { const o = currentInstance || currentRenderingInstance if (o) { const n = o.parent == null ? o.vnode.appContext && o.vnode.appContext.provides : o.parent.provides if (n && e in n) return n[e] if (arguments.length > 1) return r && isFunction$1(t) ? t.call(o.proxy) : t } } function watchEffect(e, t) { return doWatch(e, null, t) } const INITIAL_WATCHER_VALUE = {} function watch(e, t, r) { return doWatch(e, t, r) } function doWatch( e, t, { immediate: r, deep: o, flush: n, onTrack: a, onTrigger: l } = EMPTY_OBJ ) { const s = currentInstance let c, d = !1, u = !1 if ( (isRef(e) ? ((c = () => e.value), (d = isShallow(e))) : isReactive(e) ? ((c = () => e), (o = !0)) : isArray$7(e) ? ((u = !0), (d = e.some(g => isReactive(g) || isShallow(g))), (c = () => e.map(g => { if (isRef(g)) return g.value if (isReactive(g)) return traverse(g) if (isFunction$1(g)) return callWithErrorHandling(g, s, 2) }))) : isFunction$1(e) ? t ? (c = () => callWithErrorHandling(e, s, 2)) : (c = () => { if (!(s && s.isUnmounted)) return m && m(), callWithAsyncErrorHandling(e, s, 3, [f]) }) : (c = NOOP), t && o) ) { const g = c c = () => traverse(g()) } let m, f = g => { m = k.onStop = () => { callWithErrorHandling(g, s, 4) } } if (isInSSRComponentSetup) return ( (f = NOOP), t ? r && callWithAsyncErrorHandling(t, s, 3, [c(), u ? [] : void 0, f]) : c(), NOOP ) let _ = u ? [] : INITIAL_WATCHER_VALUE const b = () => { if (!!k.active) if (t) { const g = k.run() ;(o || d || (u ? g.some((x, y) => hasChanged(x, _[y])) : hasChanged(g, _))) && (m && m(), callWithAsyncErrorHandling(t, s, 3, [ g, _ === INITIAL_WATCHER_VALUE ? void 0 : _, f ]), (_ = g)) } else k.run() } b.allowRecurse = !!t let v n === 'sync' ? (v = b) : n === 'post' ? (v = () => queuePostRenderEffect(b, s && s.suspense)) : (v = () => queuePreFlushCb(b)) const k = new ReactiveEffect(c, v) return ( t ? r ? b() : (_ = k.run()) : n === 'post' ? queuePostRenderEffect(k.run.bind(k), s && s.suspense) : k.run(), () => { k.stop(), s && s.scope && remove(s.scope.effects, k) } ) } function instanceWatch(e, t, r) { const o = this.proxy, n = isString$2(e) ? e.includes('.') ? createPathGetter(o, e) : () => o[e] : e.bind(o, o) let a isFunction$1(t) ? (a = t) : ((a = t.handler), (r = t)) const l = currentInstance setCurrentInstance(this) const s = doWatch(n, a.bind(o), r) return l ? setCurrentInstance(l) : unsetCurrentInstance(), s } function createPathGetter(e, t) { const r = t.split('.') return () => { let o = e for (let n = 0; n < r.length && o; n++) o = o[r[n]] return o } } function traverse(e, t) { if (!isObject$2(e) || e.__v_skip || ((t = t || new Set()), t.has(e))) return e if ((t.add(e), isRef(e))) traverse(e.value, t) else if (isArray$7(e)) for (let r = 0; r < e.length; r++) traverse(e[r], t) else if (isSet$3(e) || isMap$3(e)) e.forEach(r => { traverse(r, t) }) else if (isPlainObject$2(e)) for (const r in e) traverse(e[r], t) return e } function useTransitionState() { const e = { isMounted: !1, isLeaving: !1, isUnmounting: !1, leavingVNodes: new Map() } return ( onMounted(() => { e.isMounted = !0 }), onBeforeUnmount(() => { e.isUnmounting = !0 }), e ) } const TransitionHookValidator = [Function, Array], BaseTransitionImpl = { name: 'BaseTransition', props: { mode: String, appear: Boolean, persisted: Boolean, onBeforeEnter: TransitionHookValidator, onEnter: TransitionHookValidator, onAfterEnter: TransitionHookValidator, onEnterCancelled: TransitionHookValidator, onBeforeLeave: TransitionHookValidator, onLeave: TransitionHookValidator, onAfterLeave: TransitionHookValidator, onLeaveCancelled: TransitionHookValidator, onBeforeAppear: TransitionHookValidator, onAppear: TransitionHookValidator, onAfterAppear: TransitionHookValidator, onAppearCancelled: TransitionHookValidator }, setup(e, { slots: t }) { const r = getCurrentInstance(), o = useTransitionState() let n return () => { const a = t.default && getTransitionRawChildren(t.default(), !0) if (!a || !a.length) return let l = a[0] if (a.length > 1) { for (const v of a) if (v.type !== Comment) { l = v break } } const s = toRaw(e), { mode: c } = s if (o.isLeaving) return emptyPlaceholder(l) const d = getKeepAliveChild(l) if (!d) return emptyPlaceholder(l) const u = resolveTransitionHooks(d, s, o, r) setTransitionHooks(d, u) const m = r.subTree, f = m && getKeepAliveChild(m) let _ = !1 const { getTransitionKey: b } = d.type if (b) { const v = b() n === void 0 ? (n = v) : v !== n && ((n = v), (_ = !0)) } if (f && f.type !== Comment && (!isSameVNodeType(d, f) || _)) { const v = resolveTransitionHooks(f, s, o, r) if ((setTransitionHooks(f, v), c === 'out-in')) return ( (o.isLeaving = !0), (v.afterLeave = () => { ;(o.isLeaving = !1), r.update() }), emptyPlaceholder(l) ) c === 'in-out' && d.type !== Comment && (v.delayLeave = (k, g, x) => { const y = getLeavingNodesForType(o, f) ;(y[String(f.key)] = f), (k._leaveCb = () => { g(), (k._leaveCb = void 0), delete u.delayedLeave }), (u.delayedLeave = x) }) } return l } } }, BaseTransition = BaseTransitionImpl function getLeavingNodesForType(e, t) { const { leavingVNodes: r } = e let o = r.get(t.type) return o || ((o = Object.create(null)), r.set(t.type, o)), o } function resolveTransitionHooks(e, t, r, o) { const { appear: n, mode: a, persisted: l = !1, onBeforeEnter: s, onEnter: c, onAfterEnter: d, onEnterCancelled: u, onBeforeLeave: m, onLeave: f, onAfterLeave: _, onLeaveCancelled: b, onBeforeAppear: v, onAppear: k, onAfterAppear: g, onAppearCancelled: x } = t, y = String(e.key), w = getLeavingNodesForType(r, e), S = ($, F) => { $ && callWithAsyncErrorHandling($, o, 9, F) }, T = ($, F) => { const Y = F[1] S($, F), isArray$7($) ? $.every(ae => ae.length <= 1) && Y() : $.length <= 1 && Y() }, A = { mode: a, persisted: l, beforeEnter($) { let F = s if (!r.isMounted) if (n) F = v || s else return $._leaveCb && $._leaveCb(!0) const Y = w[y] Y && isSameVNodeType(e, Y) && Y.el._leaveCb && Y.el._leaveCb(), S(F, [$]) }, enter($) { let F = c, Y = d, ae = u if (!r.isMounted) if (n) (F = k || c), (Y = g || d), (ae = x || u) else return let re = !1 const ie = ($._enterCb = oe => { re || ((re = !0), oe ? S(ae, [$]) : S(Y, [$]), A.delayedLeave && A.delayedLeave(), ($._enterCb = void 0)) }) F ? T(F, [$, ie]) : ie() }, leave($, F) { const Y = String(e.key) if (($._enterCb && $._enterCb(!0), r.isUnmounting)) return F() S(m, [$]) let ae = !1 const re = ($._leaveCb = ie => { ae || ((ae = !0), F(), ie ? S(b, [$]) : S(_, [$]), ($._leaveCb = void 0), w[Y] === e && delete w[Y]) }) ;(w[Y] = e), f ? T(f, [$, re]) : re() }, clone($) { return resolveTransitionHooks($, t, r, o) } } return A } function emptyPlaceholder(e) { if (isKeepAlive(e)) return (e = cloneVNode(e)), (e.children = null), e } function getKeepAliveChild(e) { return isKeepAlive(e) ? (e.children ? e.children[0] : void 0) : e } function setTransitionHooks(e, t) { e.shapeFlag & 6 && e.component ? setTransitionHooks(e.component.subTree, t) : e.shapeFlag & 128 ? ((e.ssContent.transition = t.clone(e.ssContent)), (e.ssFallback.transition = t.clone(e.ssFallback))) : (e.transition = t) } function getTransitionRawChildren(e, t = !1, r) { let o = [], n = 0 for (let a = 0; a < e.length; a++) { let l = e[a] const s = r == null ? l.key : String(r) + String(l.key != null ? l.key : a) l.type === Fragment ? (l.patchFlag & 128 && n++, (o = o.concat(getTransitionRawChildren(l.children, t, s)))) : (t || l.type !== Comment) && o.push(s != null ? cloneVNode(l, { key: s }) : l) } if (n > 1) for (let a = 0; a < o.length; a++) o[a].patchFlag = -2 return o } function defineComponent(e) { return isFunction$1(e) ? { setup: e, name: e.name } : e } const isAsyncWrapper = e => !!e.type.__asyncLoader, isKeepAlive = e => e.type.__isKeepAlive function onActivated(e, t) { registerKeepAliveHook(e, 'a', t) } function onDeactivated(e, t) { registerKeepAliveHook(e, 'da', t) } function registerKeepAliveHook(e, t, r = currentInstance) { const o = e.__wdc || (e.__wdc = () => { let n = r for (; n; ) { if (n.isDeactivated) return n = n.parent } return e() }) if ((injectHook(t, o, r), r)) { let n = r.parent for (; n && n.parent; ) isKeepAlive(n.parent.vnode) && injectToKeepAliveRoot(o, t, r, n), (n = n.parent) } } function injectToKeepAliveRoot(e, t, r, o) { const n = injectHook(t, e, o, !0) onUnmounted(() => { remove(o[t], n) }, r) } function injectHook(e, t, r = currentInstance, o = !1) { if (r) { const n = r[e] || (r[e] = []), a = t.__weh || (t.__weh = (...l) => { if (r.isUnmounted) return pauseTracking(), setCurrentInstance(r) const s = callWithAsyncErrorHandling(t, r, e, l) return unsetCurrentInstance(), resetTracking(), s }) return o ? n.unshift(a) : n.push(a), a } } const createHook = e => (t, r = currentInstance) => (!isInSSRComponentSetup || e === 'sp') && injectHook(e, t, r), onBeforeMount = createHook('bm'), onMounted = createHook('m'), onBeforeUpdate = createHook('bu'), onUpdated = createHook('u'), onBeforeUnmount = createHook('bum'), onUnmounted = createHook('um'), onServerPrefetch = createHook('sp'), onRenderTriggered = createHook('rtg'), onRenderTracked = createHook('rtc') function onErrorCaptured(e, t = currentInstance) { injectHook('ec', e, t) } function withDirectives(e, t) { const r = currentRenderingInstance if (r === null) return e const o = getExposeProxy(r) || r.proxy, n = e.dirs || (e.dirs = []) for (let a = 0; a < t.length; a++) { let [l, s, c, d = EMPTY_OBJ] = t[a] isFunction$1(l) && (l = { mounted: l, updated: l }), l.deep && traverse(s), n.push({ dir: l, instance: o, value: s, oldValue: void 0, arg: c, modifiers: d }) } return e } function invokeDirectiveHook(e, t, r, o) { const n = e.dirs, a = t && t.dirs for (let l = 0; l < n.length; l++) { const s = n[l] a && (s.oldValue = a[l].value) let c = s.dir[o] c && (pauseTracking(), callWithAsyncErrorHandling(c, r, 8, [e.el, s, e, t]), resetTracking()) } } const COMPONENTS = 'components', DIRECTIVES = 'directives' function resolveComponent(e, t) { return resolveAsset(COMPONENTS, e, !0, t) || e } const NULL_DYNAMIC_COMPONENT = Symbol() function resolveDynamicComponent(e) { return isString$2(e) ? resolveAsset(COMPONENTS, e, !1) || e : e || NULL_DYNAMIC_COMPONENT } function resolveDirective(e) { return resolveAsset(DIRECTIVES, e) } function resolveAsset(e, t, r = !0, o = !1) { const n = currentRenderingInstance || currentInstance if (n) { const a = n.type if (e === COMPONENTS) { const s = getComponentName(a, !1) if (s && (s === t || s === camelize(t) || s === capitalize(camelize(t)))) return a } const l = resolve(n[e] || a[e], t) || resolve(n.appContext[e], t) return !l && o ? a : l } } function resolve(e, t) { return e && (e[t] || e[camelize(t)] || e[capitalize(camelize(t))]) } function renderList(e, t, r, o) { let n const a = r && r[o] if (isArray$7(e) || isString$2(e)) { n = new Array(e.length) for (let l = 0, s = e.length; l < s; l++) n[l] = t(e[l], l, void 0, a && a[l]) } else if (typeof e == 'number') { n = new Array(e) for (let l = 0; l < e; l++) n[l] = t(l + 1, l, void 0, a && a[l]) } else if (isObject$2(e)) if (e[Symbol.iterator]) n = Array.from(e, (l, s) => t(l, s, void 0, a && a[s])) else { const l = Object.keys(e) n = new Array(l.length) for (let s = 0, c = l.length; s < c; s++) { const d = l[s] n[s] = t(e[d], d, s, a && a[s]) } } else n = [] return r && (r[o] = n), n } function createSlots(e, t) { for (let r = 0; r < t.length; r++) { const o = t[r] if (isArray$7(o)) for (let n = 0; n < o.length; n++) e[o[n].name] = o[n].fn else o && (e[o.name] = o.fn) } return e } function renderSlot(e, t, r = {}, o, n) { if ( currentRenderingInstance.isCE || (currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.isCE) ) return createVNode('slot', t === 'default' ? null : { name: t }, o && o()) let a = e[t] a && a._c && (a._d = !1), openBlock() const l = a && ensureValidVNode(a(r)), s = createBlock( Fragment, { key: r.key || `_${t}` }, l || (o ? o() : []), l && e._ === 1 ? 64 : -2 ) return ( !n && s.scopeId && (s.slotScopeIds = [s.scopeId + '-s']), a && a._c && (a._d = !0), s ) } function ensureValidVNode(e) { return e.some(t => isVNode(t) ? !( t.type === Comment || (t.type === Fragment && !ensureValidVNode(t.children)) ) : !0 ) ? e : null } const getPublicInstance = e => e ? isStatefulComponent(e) ? getExposeProxy(e) || e.proxy : getPublicInstance(e.parent) : null, publicPropertiesMap = extend$1(Object.create(null), { $: e => e, $el: e => e.vnode.el, $data: e => e.data, $props: e => e.props, $attrs: e => e.attrs, $slots: e => e.slots, $refs: e => e.refs, $parent: e => getPublicInstance(e.parent), $root: e => getPublicInstance(e.root), $emit: e => e.emit, $options: e => resolveMergedOptions(e), $forceUpdate: e => e.f || (e.f = () => queueJob(e.update)), $nextTick: e => e.n || (e.n = nextTick.bind(e.proxy)), $watch: e => instanceWatch.bind(e) }), PublicInstanceProxyHandlers = { get({ _: e }, t) { const { ctx: r, setupState: o, data: n, props: a, accessCache: l, type: s, appContext: c } = e let d if (t[0] !== '$') { const _ = l[t] if (_ !== void 0) switch (_) { case 1: return o[t] case 2: return n[t] case 4: return r[t] case 3: return a[t] } else { if (o !== EMPTY_OBJ && hasOwn$2(o, t)) return (l[t] = 1), o[t] if (n !== EMPTY_OBJ && hasOwn$2(n, t)) return (l[t] = 2), n[t] if ((d = e.propsOptions[0]) && hasOwn$2(d, t)) return (l[t] = 3), a[t] if (r !== EMPTY_OBJ && hasOwn$2(r, t)) return (l[t] = 4), r[t] shouldCacheAccess && (l[t] = 0) } } const u = publicPropertiesMap[t] let m, f if (u) return t === '$attrs' && track(e, 'get', t), u(e) if ((m = s.__cssModules) && (m = m[t])) return m if (r !== EMPTY_OBJ && hasOwn$2(r, t)) return (l[t] = 4), r[t] if (((f = c.config.globalProperties), hasOwn$2(f, t))) return f[t] }, set({ _: e }, t, r) { const { data: o, setupState: n, ctx: a } = e return n !== EMPTY_OBJ && hasOwn$2(n, t) ? ((n[t] = r), !0) : o !== EMPTY_OBJ && hasOwn$2(o, t) ? ((o[t] = r), !0) : hasOwn$2(e.props, t) || (t[0] === '$' && t.slice(1) in e) ? !1 : ((a[t] = r), !0) }, has( { _: { data: e, setupState: t, accessCache: r, ctx: o, appContext: n, propsOptions: a } }, l ) { let s return ( !!r[l] || (e !== EMPTY_OBJ && hasOwn$2(e, l)) || (t !== EMPTY_OBJ && hasOwn$2(t, l)) || ((s = a[0]) && hasOwn$2(s, l)) || hasOwn$2(o, l) || hasOwn$2(publicPropertiesMap, l) || hasOwn$2(n.config.globalProperties, l) ) }, defineProperty(e, t, r) { return ( r.get != null ? (e._.accessCache[t] = 0) : hasOwn$2(r, 'value') && this.set(e, t, r.value, null), Reflect.defineProperty(e, t, r) ) } } let shouldCacheAccess = !0 function applyOptions(e) { const t = resolveMergedOptions(e), r = e.proxy, o = e.ctx ;(shouldCacheAccess = !1), t.beforeCreate && callHook$1(t.beforeCreate, e, 'bc') const { data: n, computed: a, methods: l, watch: s, provide: c, inject: d, created: u, beforeMount: m, mounted: f, beforeUpdate: _, updated: b, activated: v, deactivated: k, beforeDestroy: g, beforeUnmount: x, destroyed: y, unmounted: w, render: S, renderTracked: T, renderTriggered: A, errorCaptured: $, serverPrefetch: F, expose: Y, inheritAttrs: ae, components: re, directives: ie, filters: oe } = t if ( (d && resolveInjections(d, o, null, e.appContext.config.unwrapInjectedRef), l) ) for (const z in l) { const M = l[z] isFunction$1(M) && (o[z] = M.bind(r)) } if (n) { const z = n.call(r, r) isObject$2(z) && (e.data = reactive(z)) } if (((shouldCacheAccess = !0), a)) for (const z in a) { const M = a[z], L = isFunction$1(M) ? M.bind(r, r) : isFunction$1(M.get) ? M.get.bind(r, r) : NOOP, pe = !isFunction$1(M) && isFunction$1(M.set) ? M.set.bind(r) : NOOP, ue = computed({ get: L, set: pe }) Object.defineProperty(o, z, { enumerable: !0, configurable: !0, get: () => ue.value, set: Ie => (ue.value = Ie) }) } if (s) for (const z in s) createWatcher(s[z], o, r, z) if (c) { const z = isFunction$1(c) ? c.call(r) : c Reflect.ownKeys(z).forEach(M => { provide(M, z[M]) }) } u && callHook$1(u, e, 'c') function V(z, M) { isArray$7(M) ? M.forEach(L => z(L.bind(r))) : M && z(M.bind(r)) } if ( (V(onBeforeMount, m), V(onMounted, f), V(onBeforeUpdate, _), V(onUpdated, b), V(onActivated, v), V(onDeactivated, k), V(onErrorCaptured, $), V(onRenderTracked, T), V(onRenderTriggered, A), V(onBeforeUnmount, x), V(onUnmounted, w), V(onServerPrefetch, F), isArray$7(Y)) ) if (Y.length) { const z = e.exposed || (e.exposed = {}) Y.forEach(M => { Object.defineProperty(z, M, { get: () => r[M], set: L => (r[M] = L) }) }) } else e.exposed || (e.exposed = {}) S && e.render === NOOP && (e.render = S), ae != null && (e.inheritAttrs = ae), re && (e.components = re), ie && (e.directives = ie) } function resolveInjections(e, t, r = NOOP, o = !1) { isArray$7(e) && (e = normalizeInject(e)) for (const n in e) { const a = e[n] let l isObject$2(a) ? 'default' in a ? (l = inject(a.from || n, a.default, !0)) : (l = inject(a.from || n)) : (l = inject(a)), isRef(l) && o ? Object.defineProperty(t, n, { enumerable: !0, configurable: !0, get: () => l.value, set: s => (l.value = s) }) : (t[n] = l) } } function callHook$1(e, t, r) { callWithAsyncErrorHandling( isArray$7(e) ? e.map(o => o.bind(t.proxy)) : e.bind(t.proxy), t, r ) } function createWatcher(e, t, r, o) { const n = o.includes('.') ? createPathGetter(r, o) : () => r[o] if (isString$2(e)) { const a = t[e] isFunction$1(a) && watch(n, a) } else if (isFunction$1(e)) watch(n, e.bind(r)) else if (isObject$2(e)) if (isArray$7(e)) e.forEach(a => createWatcher(a, t, r, o)) else { const a = isFunction$1(e.handler) ? e.handler.bind(r) : t[e.handler] isFunction$1(a) && watch(n, a, e) } } function resolveMergedOptions(e) { const t = e.type, { mixins: r, extends: o } = t, { mixins: n, optionsCache: a, config: { optionMergeStrategies: l } } = e.appContext, s = a.get(t) let c return ( s ? (c = s) : !n.length && !r && !o ? (c = t) : ((c = {}), n.length && n.forEach(d => mergeOptions$1(c, d, l, !0)), mergeOptions$1(c, t, l)), a.set(t, c), c ) } function mergeOptions$1(e, t, r, o = !1) { const { mixins: n, extends: a } = t a && mergeOptions$1(e, a, r, !0), n && n.forEach(l => mergeOptions$1(e, l, r, !0)) for (const l in t) if (!(o && l === 'expose')) { const s = internalOptionMergeStrats[l] || (r && r[l]) e[l] = s ? s(e[l], t[l]) : t[l] } return e } const internalOptionMergeStrats = { data: mergeDataFn, props: mergeObjectOptions, emits: mergeObjectOptions, methods: mergeObjectOptions, computed: mergeObjectOptions, beforeCreate: mergeAsArray, created: mergeAsArray, beforeMount: mergeAsArray, mounted: mergeAsArray, beforeUpdate: mergeAsArray, updated: mergeAsArray, beforeDestroy: mergeAsArray, beforeUnmount: mergeAsArray, destroyed: mergeAsArray, unmounted: mergeAsArray, activated: mergeAsArray, deactivated: mergeAsArray, errorCaptured: mergeAsArray, serverPrefetch: mergeAsArray, components: mergeObjectOptions, directives: mergeObjectOptions, watch: mergeWatchOptions, provide: mergeDataFn, inject: mergeInject } function mergeDataFn(e, t) { return t ? e ? function () { return extend$1( isFunction$1(e) ? e.call(this, this) : e, isFunction$1(t) ? t.call(this, this) : t ) } : t : e } function mergeInject(e, t) { return mergeObjectOptions(normalizeInject(e), normalizeInject(t)) } function normalizeInject(e) { if (isArray$7(e)) { const t = {} for (let r = 0; r < e.length; r++) t[e[r]] = e[r] return t } return e } function mergeAsArray(e, t) { return e ? [...new Set([].concat(e, t))] : t } function mergeObjectOptions(e, t) { return e ? extend$1(extend$1(Object.create(null), e), t) : t } function mergeWatchOptions(e, t) { if (!e) return t if (!t) return e const r = extend$1(Object.create(null), e) for (const o in t) r[o] = mergeAsArray(e[o], t[o]) return r } function initProps(e, t, r, o = !1) { const n = {}, a = {} def(a, InternalObjectKey, 1), (e.propsDefaults = Object.create(null)), setFullProps(e, t, n, a) for (const l in e.propsOptions[0]) l in n || (n[l] = void 0) r ? (e.props = o ? n : shallowReactive(n)) : e.type.props ? (e.props = n) : (e.props = a), (e.attrs = a) } function updateProps(e, t, r, o) { const { props: n, attrs: a, vnode: { patchFlag: l } } = e, s = toRaw(n), [c] = e.propsOptions let d = !1 if ((o || l > 0) && !(l & 16)) { if (l & 8) { const u = e.vnode.dynamicProps for (let m = 0; m < u.length; m++) { let f = u[m] if (isEmitListener(e.emitsOptions, f)) continue const _ = t[f] if (c) if (hasOwn$2(a, f)) _ !== a[f] && ((a[f] = _), (d = !0)) else { const b = camelize(f) n[b] = resolvePropValue(c, s, b, _, e, !1) } else _ !== a[f] && ((a[f] = _), (d = !0)) } } } else { setFullProps(e, t, n, a) && (d = !0) let u for (const m in s) (!t || (!hasOwn$2(t, m) && ((u = hyphenate(m)) === m || !hasOwn$2(t, u)))) && (c ? r && (r[m] !== void 0 || r[u] !== void 0) && (n[m] = resolvePropValue(c, s, m, void 0, e, !0)) : delete n[m]) if (a !== s) for (const m in a) (!t || (!hasOwn$2(t, m) && !0)) && (delete a[m], (d = !0)) } d && trigger(e, 'set', '$attrs') } function setFullProps(e, t, r, o) { const [n, a] = e.propsOptions let l = !1, s if (t) for (let c in t) { if (isReservedProp(c)) continue const d = t[c] let u n && hasOwn$2(n, (u = camelize(c))) ? !a || !a.includes(u) ? (r[u] = d) : ((s || (s = {}))[u] = d) : isEmitListener(e.emitsOptions, c) || ((!(c in o) || d !== o[c]) && ((o[c] = d), (l = !0))) } if (a) { const c = toRaw(r), d = s || EMPTY_OBJ for (let u = 0; u < a.length; u++) { const m = a[u] r[m] = resolvePropValue(n, c, m, d[m], e, !hasOwn$2(d, m)) } } return l } function resolvePropValue(e, t, r, o, n, a) { const l = e[r] if (l != null) { const s = hasOwn$2(l, 'default') if (s && o === void 0) { const c = l.default if (l.type !== Function && isFunction$1(c)) { const { propsDefaults: d } = n r in d ? (o = d[r]) : (setCurrentInstance(n), (o = d[r] = c.call(null, t)), unsetCurrentInstance()) } else o = c } l[0] && (a && !s ? (o = !1) : l[1] && (o === '' || o === hyphenate(r)) && (o = !0)) } return o } function normalizePropsOptions(e, t, r = !1) { const o = t.propsCache, n = o.get(e) if (n) return n const a = e.props, l = {}, s = [] let c = !1 if (!isFunction$1(e)) { const u = m => { c = !0 const [f, _] = normalizePropsOptions(m, t, !0) extend$1(l, f), _ && s.push(..._) } !r && t.mixins.length && t.mixins.forEach(u), e.extends && u(e.extends), e.mixins && e.mixins.forEach(u) } if (!a && !c) return o.set(e, EMPTY_ARR), EMPTY_ARR if (isArray$7(a)) for (let u = 0; u < a.length; u++) { const m = camelize(a[u]) validatePropName(m) && (l[m] = EMPTY_OBJ) } else if (a) for (const u in a) { const m = camelize(u) if (validatePropName(m)) { const f = a[u], _ = (l[m] = isArray$7(f) || isFunction$1(f) ? { type: f } : f) if (_) { const b = getTypeIndex(Boolean, _.type), v = getTypeIndex(String, _.type) ;(_[0] = b > -1), (_[1] = v < 0 || b < v), (b > -1 || hasOwn$2(_, 'default')) && s.push(m) } } } const d = [l, s] return o.set(e, d), d } function validatePropName(e) { return e[0] !== '$' } function getType(e) { const t = e && e.toString().match(/^\s*function (\w+)/) return t ? t[1] : e === null ? 'null' : '' } function isSameType(e, t) { return getType(e) === getType(t) } function getTypeIndex(e, t) { return isArray$7(t) ? t.findIndex(r => isSameType(r, e)) : isFunction$1(t) && isSameType(t, e) ? 0 : -1 } const isInternalKey = e => e[0] === '_' || e === '$stable', normalizeSlotValue = e => isArray$7(e) ? e.map(normalizeVNode) : [normalizeVNode(e)], normalizeSlot$1 = (e, t, r) => { if (t._n) return t const o = withCtx((...n) => normalizeSlotValue(t(...n)), r) return (o._c = !1), o }, normalizeObjectSlots = (e, t, r) => { const o = e._ctx for (const n in e) { if (isInternalKey(n)) continue const a = e[n] if (isFunction$1(a)) t[n] = normalizeSlot$1(n, a, o) else if (a != null) { const l = normalizeSlotValue(a) t[n] = () => l } } }, normalizeVNodeSlots = (e, t) => { const r = normalizeSlotValue(t) e.slots.default = () => r }, initSlots = (e, t) => { if (e.vnode.shapeFlag & 32) { const r = t._ r ? ((e.slots = toRaw(t)), def(t, '_', r)) : normalizeObjectSlots(t, (e.slots = {})) } else (e.slots = {}), t && normalizeVNodeSlots(e, t) def(e.slots, InternalObjectKey, 1) }, updateSlots = (e, t, r) => { const { vnode: o, slots: n } = e let a = !0, l = EMPTY_OBJ if (o.shapeFlag & 32) { const s = t._ s ? r && s === 1 ? (a = !1) : (extend$1(n, t), !r && s === 1 && delete n._) : ((a = !t.$stable), normalizeObjectSlots(t, n)), (l = t) } else t && (normalizeVNodeSlots(e, t), (l = { default: 1 })) if (a) for (const s in n) !isInternalKey(s) && !(s in l) && delete n[s] } function createAppContext() { return { app: null, config: { isNativeTag: NO, performance: !1, globalProperties: {}, optionMergeStrategies: {}, errorHandler: void 0, warnHandler: void 0, compilerOptions: {} }, mixins: [], components: {}, directives: {}, provides: Object.create(null), optionsCache: new WeakMap(), propsCache: new WeakMap(), emitsCache: new WeakMap() } } let uid = 0 function createAppAPI(e, t) { return function (o, n = null) { isFunction$1(o) || (o = Object.assign({}, o)), n != null && !isObject$2(n) && (n = null) const a = createAppContext(), l = new Set() let s = !1 const c = (a.app = { _uid: uid++, _component: o, _props: n, _container: null, _context: a, _instance: null, version, get config() { return a.config }, set config(d) {}, use(d, ...u) { return ( l.has(d) || (d && isFunction$1(d.install) ? (l.add(d), d.install(c, ...u)) : isFunction$1(d) && (l.add(d), d(c, ...u))), c ) }, mixin(d) { return a.mixins.includes(d) || a.mixins.push(d), c }, component(d, u) { return u ? ((a.components[d] = u), c) : a.components[d] }, directive(d, u) { return u ? ((a.directives[d] = u), c) : a.directives[d] }, mount(d, u, m) { if (!s) { const f = createVNode(o, n) return ( (f.appContext = a), u && t ? t(f, d) : e(f, d, m), (s = !0), (c._container = d), (d.__vue_app__ = c), getExposeProxy(f.component) || f.component.proxy ) } }, unmount() { s && (e(null, c._container), delete c._container.__vue_app__) }, provide(d, u) { return (a.provides[d] = u), c } }) return c } } function setRef(e, t, r, o, n = !1) { if (isArray$7(e)) { e.forEach((f, _) => setRef(f, t && (isArray$7(t) ? t[_] : t), r, o, n)) return } if (isAsyncWrapper(o) && !n) return const a = o.shapeFlag & 4 ? getExposeProxy(o.component) || o.component.proxy : o.el, l = n ? null : a, { i: s, r: c } = e, d = t && t.r, u = s.refs === EMPTY_OBJ ? (s.refs = {}) : s.refs, m = s.setupState if ( (d != null && d !== c && (isString$2(d) ? ((u[d] = null), hasOwn$2(m, d) && (m[d] = null)) : isRef(d) && (d.value = null)), isFunction$1(c)) ) callWithErrorHandling(c, s, 12, [l, u]) else { const f = isString$2(c), _ = isRef(c) if (f || _) { const b = () => { if (e.f) { const v = f ? u[c] : c.value n ? isArray$7(v) && remove(v, a) : isArray$7(v) ? v.includes(a) || v.push(a) : f ? ((u[c] = [a]), hasOwn$2(m, c) && (m[c] = u[c])) : ((c.value = [a]), e.k && (u[e.k] = c.value)) } else f ? ((u[c] = l), hasOwn$2(m, c) && (m[c] = l)) : _ && ((c.value = l), e.k && (u[e.k] = l)) } l ? ((b.id = -1), queuePostRenderEffect(b, r)) : b() } } } const queuePostRenderEffect = queueEffectWithSuspense function createRenderer(e) { return baseCreateRenderer(e) } function baseCreateRenderer(e, t) { const r = getGlobalThis() r.__VUE__ = !0 const { insert: o, remove: n, patchProp: a, createElement: l, createText: s, createComment: c, setText: d, setElementText: u, parentNode: m, nextSibling: f, setScopeId: _ = NOOP, cloneNode: b, insertStaticContent: v } = e, k = ( D, de, Ce, Ne = null, Ve = null, Et = null, Lt = !1, Ue = null, kt = !!de.dynamicChildren ) => { if (D === de) return D && !isSameVNodeType(D, de) && ((Ne = $e(D)), Pt(D, Ve, Et, !0), (D = null)), de.patchFlag === -2 && ((kt = !1), (de.dynamicChildren = null)) const { type: qe, ref: ir, shapeFlag: he } = de switch (qe) { case Text: g(D, de, Ce, Ne) break case Comment: x(D, de, Ce, Ne) break case Static: D == null && y(de, Ce, Ne, Lt) break case Fragment: ie(D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) break default: he & 1 ? T(D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) : he & 6 ? oe(D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) : (he & 64 || he & 128) && qe.process(D, de, Ce, Ne, Ve, Et, Lt, Ue, kt, or) } ir != null && Ve && setRef(ir, D && D.ref, Et, de || D, !de) }, g = (D, de, Ce, Ne) => { if (D == null) o((de.el = s(de.children)), Ce, Ne) else { const Ve = (de.el = D.el) de.children !== D.children && d(Ve, de.children) } }, x = (D, de, Ce, Ne) => { D == null ? o((de.el = c(de.children || '')), Ce, Ne) : (de.el = D.el) }, y = (D, de, Ce, Ne) => { ;[D.el, D.anchor] = v(D.children, de, Ce, Ne, D.el, D.anchor) }, w = ({ el: D, anchor: de }, Ce, Ne) => { let Ve for (; D && D !== de; ) (Ve = f(D)), o(D, Ce, Ne), (D = Ve) o(de, Ce, Ne) }, S = ({ el: D, anchor: de }) => { let Ce for (; D && D !== de; ) (Ce = f(D)), n(D), (D = Ce) n(de) }, T = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) => { ;(Lt = Lt || de.type === 'svg'), D == null ? A(de, Ce, Ne, Ve, Et, Lt, Ue, kt) : Y(D, de, Ve, Et, Lt, Ue, kt) }, A = (D, de, Ce, Ne, Ve, Et, Lt, Ue) => { let kt, qe const { type: ir, props: he, shapeFlag: At, transition: nr, patchFlag: cr, dirs: Fe } = D if (D.el && b !== void 0 && cr === -1) kt = D.el = b(D.el) else { if ( ((kt = D.el = l(D.type, Et, he && he.is, he)), At & 8 ? u(kt, D.children) : At & 16 && F( D.children, kt, null, Ne, Ve, Et && ir !== 'foreignObject', Lt, Ue ), Fe && invokeDirectiveHook(D, null, Ne, 'created'), he) ) { for (const ur in he) ur !== 'value' && !isReservedProp(ur) && a(kt, ur, null, he[ur], Et, D.children, Ne, Ve, xe) 'value' in he && a(kt, 'value', null, he.value), (qe = he.onVnodeBeforeMount) && invokeVNodeHook(qe, Ne, D) } $(kt, D, D.scopeId, Lt, Ne) } Fe && invokeDirectiveHook(D, null, Ne, 'beforeMount') const lr = (!Ve || (Ve && !Ve.pendingBranch)) && nr && !nr.persisted lr && nr.beforeEnter(kt), o(kt, de, Ce), ((qe = he && he.onVnodeMounted) || lr || Fe) && queuePostRenderEffect(() => { qe && invokeVNodeHook(qe, Ne, D), lr && nr.enter(kt), Fe && invokeDirectiveHook(D, null, Ne, 'mounted') }, Ve) }, $ = (D, de, Ce, Ne, Ve) => { if ((Ce && _(D, Ce), Ne)) for (let Et = 0; Et < Ne.length; Et++) _(D, Ne[Et]) if (Ve) { let Et = Ve.subTree if (de === Et) { const Lt = Ve.vnode $(D, Lt, Lt.scopeId, Lt.slotScopeIds, Ve.parent) } } }, F = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt = 0) => { for (let qe = kt; qe < D.length; qe++) { const ir = (D[qe] = Ue ? cloneIfMounted(D[qe]) : normalizeVNode(D[qe])) k(null, ir, de, Ce, Ne, Ve, Et, Lt, Ue) } }, Y = (D, de, Ce, Ne, Ve, Et, Lt) => { const Ue = (de.el = D.el) let { patchFlag: kt, dynamicChildren: qe, dirs: ir } = de kt |= D.patchFlag & 16 const he = D.props || EMPTY_OBJ, At = de.props || EMPTY_OBJ let nr Ce && toggleRecurse(Ce, !1), (nr = At.onVnodeBeforeUpdate) && invokeVNodeHook(nr, Ce, de, D), ir && invokeDirectiveHook(de, D, Ce, 'beforeUpdate'), Ce && toggleRecurse(Ce, !0) const cr = Ve && de.type !== 'foreignObject' if ( (qe ? ae(D.dynamicChildren, qe, Ue, Ce, Ne, cr, Et) : Lt || L(D, de, Ue, null, Ce, Ne, cr, Et, !1), kt > 0) ) { if (kt & 16) re(Ue, de, he, At, Ce, Ne, Ve) else if ( (kt & 2 && he.class !== At.class && a(Ue, 'class', null, At.class, Ve), kt & 4 && a(Ue, 'style', he.style, At.style, Ve), kt & 8) ) { const Fe = de.dynamicProps for (let lr = 0; lr < Fe.length; lr++) { const ur = Fe[lr], _r = he[ur], Sr = At[ur] ;(Sr !== _r || ur === 'value') && a(Ue, ur, _r, Sr, Ve, D.children, Ce, Ne, xe) } } kt & 1 && D.children !== de.children && u(Ue, de.children) } else !Lt && qe == null && re(Ue, de, he, At, Ce, Ne, Ve) ;((nr = At.onVnodeUpdated) || ir) && queuePostRenderEffect(() => { nr && invokeVNodeHook(nr, Ce, de, D), ir && invokeDirectiveHook(de, D, Ce, 'updated') }, Ne) }, ae = (D, de, Ce, Ne, Ve, Et, Lt) => { for (let Ue = 0; Ue < de.length; Ue++) { const kt = D[Ue], qe = de[Ue], ir = kt.el && (kt.type === Fragment || !isSameVNodeType(kt, qe) || kt.shapeFlag & 70) ? m(kt.el) : Ce k(kt, qe, ir, null, Ne, Ve, Et, Lt, !0) } }, re = (D, de, Ce, Ne, Ve, Et, Lt) => { if (Ce !== Ne) { for (const Ue in Ne) { if (isReservedProp(Ue)) continue const kt = Ne[Ue], qe = Ce[Ue] kt !== qe && Ue !== 'value' && a(D, Ue, qe, kt, Lt, de.children, Ve, Et, xe) } if (Ce !== EMPTY_OBJ) for (const Ue in Ce) !isReservedProp(Ue) && !(Ue in Ne) && a(D, Ue, Ce[Ue], null, Lt, de.children, Ve, Et, xe) 'value' in Ne && a(D, 'value', Ce.value, Ne.value) } }, ie = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) => { const qe = (de.el = D ? D.el : s('')), ir = (de.anchor = D ? D.anchor : s('')) let { patchFlag: he, dynamicChildren: At, slotScopeIds: nr } = de nr && (Ue = Ue ? Ue.concat(nr) : nr), D == null ? (o(qe, Ce, Ne), o(ir, Ce, Ne), F(de.children, Ce, ir, Ve, Et, Lt, Ue, kt)) : he > 0 && he & 64 && At && D.dynamicChildren ? (ae(D.dynamicChildren, At, Ce, Ve, Et, Lt, Ue), (de.key != null || (Ve && de === Ve.subTree)) && traverseStaticChildren(D, de, !0)) : L(D, de, Ce, ir, Ve, Et, Lt, Ue, kt) }, oe = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) => { ;(de.slotScopeIds = Ue), D == null ? de.shapeFlag & 512 ? Ve.ctx.activate(de, Ce, Ne, Lt, kt) : j(de, Ce, Ne, Ve, Et, Lt, kt) : V(D, de, kt) }, j = (D, de, Ce, Ne, Ve, Et, Lt) => { const Ue = (D.component = createComponentInstance(D, Ne, Ve)) if ( (isKeepAlive(D) && (Ue.ctx.renderer = or), setupComponent(Ue), Ue.asyncDep) ) { if ((Ve && Ve.registerDep(Ue, z), !D.el)) { const kt = (Ue.subTree = createVNode(Comment)) x(null, kt, de, Ce) } return } z(Ue, D, de, Ce, Ve, Et, Lt) }, V = (D, de, Ce) => { const Ne = (de.component = D.component) if (shouldUpdateComponent(D, de, Ce)) if (Ne.asyncDep && !Ne.asyncResolved) { M(Ne, de, Ce) return } else (Ne.next = de), invalidateJob(Ne.update), Ne.update() else (de.el = D.el), (Ne.vnode = de) }, z = (D, de, Ce, Ne, Ve, Et, Lt) => { const Ue = () => { if (D.isMounted) { let { next: ir, bu: he, u: At, parent: nr, vnode: cr } = D, Fe = ir, lr toggleRecurse(D, !1), ir ? ((ir.el = cr.el), M(D, ir, Lt)) : (ir = cr), he && invokeArrayFns(he), (lr = ir.props && ir.props.onVnodeBeforeUpdate) && invokeVNodeHook(lr, nr, ir, cr), toggleRecurse(D, !0) const ur = renderComponentRoot(D), _r = D.subTree ;(D.subTree = ur), k(_r, ur, m(_r.el), $e(_r), D, Ve, Et), (ir.el = ur.el), Fe === null && updateHOCHostEl(D, ur.el), At && queuePostRenderEffect(At, Ve), (lr = ir.props && ir.props.onVnodeUpdated) && queuePostRenderEffect(() => invokeVNodeHook(lr, nr, ir, cr), Ve) } else { let ir const { el: he, props: At } = de, { bm: nr, m: cr, parent: Fe } = D, lr = isAsyncWrapper(de) if ( (toggleRecurse(D, !1), nr && invokeArrayFns(nr), !lr && (ir = At && At.onVnodeBeforeMount) && invokeVNodeHook(ir, Fe, de), toggleRecurse(D, !0), he && tr) ) { const ur = () => { ;(D.subTree = renderComponentRoot(D)), tr(he, D.subTree, D, Ve, null) } lr ? de.type.__asyncLoader().then(() => !D.isUnmounted && ur()) : ur() } else { const ur = (D.subTree = renderComponentRoot(D)) k(null, ur, Ce, Ne, D, Ve, Et), (de.el = ur.el) } if ( (cr && queuePostRenderEffect(cr, Ve), !lr && (ir = At && At.onVnodeMounted)) ) { const ur = de queuePostRenderEffect(() => invokeVNodeHook(ir, Fe, ur), Ve) } ;(de.shapeFlag & 256 || (Fe && isAsyncWrapper(Fe.vnode) && Fe.vnode.shapeFlag & 256)) && D.a && queuePostRenderEffect(D.a, Ve), (D.isMounted = !0), (de = Ce = Ne = null) } }, kt = (D.effect = new ReactiveEffect(Ue, () => queueJob(qe), D.scope)), qe = (D.update = () => kt.run()) ;(qe.id = D.uid), toggleRecurse(D, !0), qe() }, M = (D, de, Ce) => { de.component = D const Ne = D.vnode.props ;(D.vnode = de), (D.next = null), updateProps(D, de.props, Ne, Ce), updateSlots(D, de.children, Ce), pauseTracking(), flushPreFlushCbs(void 0, D.update), resetTracking() }, L = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt = !1) => { const qe = D && D.children, ir = D ? D.shapeFlag : 0, he = de.children, { patchFlag: At, shapeFlag: nr } = de if (At > 0) { if (At & 128) { ue(qe, he, Ce, Ne, Ve, Et, Lt, Ue, kt) return } else if (At & 256) { pe(qe, he, Ce, Ne, Ve, Et, Lt, Ue, kt) return } } nr & 8 ? (ir & 16 && xe(qe, Ve, Et), he !== qe && u(Ce, he)) : ir & 16 ? nr & 16 ? ue(qe, he, Ce, Ne, Ve, Et, Lt, Ue, kt) : xe(qe, Ve, Et, !0) : (ir & 8 && u(Ce, ''), nr & 16 && F(he, Ce, Ne, Ve, Et, Lt, Ue, kt)) }, pe = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) => { ;(D = D || EMPTY_ARR), (de = de || EMPTY_ARR) const qe = D.length, ir = de.length, he = Math.min(qe, ir) let At for (At = 0; At < he; At++) { const nr = (de[At] = kt ? cloneIfMounted(de[At]) : normalizeVNode(de[At])) k(D[At], nr, Ce, null, Ve, Et, Lt, Ue, kt) } qe > ir ? xe(D, Ve, Et, !0, !1, he) : F(de, Ce, Ne, Ve, Et, Lt, Ue, kt, he) }, ue = (D, de, Ce, Ne, Ve, Et, Lt, Ue, kt) => { let qe = 0 const ir = de.length let he = D.length - 1, At = ir - 1 for (; qe <= he && qe <= At; ) { const nr = D[qe], cr = (de[qe] = kt ? cloneIfMounted(de[qe]) : normalizeVNode(de[qe])) if (isSameVNodeType(nr, cr)) k(nr, cr, Ce, null, Ve, Et, Lt, Ue, kt) else break qe++ } for (; qe <= he && qe <= At; ) { const nr = D[he], cr = (de[At] = kt ? cloneIfMounted(de[At]) : normalizeVNode(de[At])) if (isSameVNodeType(nr, cr)) k(nr, cr, Ce, null, Ve, Et, Lt, Ue, kt) else break he--, At-- } if (qe > he) { if (qe <= At) { const nr = At + 1, cr = nr < ir ? de[nr].el : Ne for (; qe <= At; ) k( null, (de[qe] = kt ? cloneIfMounted(de[qe]) : normalizeVNode(de[qe])), Ce, cr, Ve, Et, Lt, Ue, kt ), qe++ } } else if (qe > At) for (; qe <= he; ) Pt(D[qe], Ve, Et, !0), qe++ else { const nr = qe, cr = qe, Fe = new Map() for (qe = cr; qe <= At; qe++) { const yr = (de[qe] = kt ? cloneIfMounted(de[qe]) : normalizeVNode(de[qe])) yr.key != null && Fe.set(yr.key, qe) } let lr, ur = 0 const _r = At - cr + 1 let Sr = !1, Lr = 0 const br = new Array(_r) for (qe = 0; qe < _r; qe++) br[qe] = 0 for (qe = nr; qe <= he; qe++) { const yr = D[qe] if (ur >= _r) { Pt(yr, Ve, Et, !0) continue } let kr if (yr.key != null) kr = Fe.get(yr.key) else for (lr = cr; lr <= At; lr++) if (br[lr - cr] === 0 && isSameVNodeType(yr, de[lr])) { kr = lr break } kr === void 0 ? Pt(yr, Ve, Et, !0) : ((br[kr - cr] = qe + 1), kr >= Lr ? (Lr = kr) : (Sr = !0), k(yr, de[kr], Ce, null, Ve, Et, Lt, Ue, kt), ur++) } const Tr = Sr ? getSequence(br) : EMPTY_ARR for (lr = Tr.length - 1, qe = _r - 1; qe >= 0; qe--) { const yr = cr + qe, kr = de[yr], Dr = yr + 1 < ir ? de[yr + 1].el : Ne br[qe] === 0 ? k(null, kr, Ce, Dr, Ve, Et, Lt, Ue, kt) : Sr && (lr < 0 || qe !== Tr[lr] ? Ie(kr, Ce, Dr, 2) : lr--) } } }, Ie = (D, de, Ce, Ne, Ve = null) => { const { el: Et, type: Lt, transition: Ue, children: kt, shapeFlag: qe } = D if (qe & 6) { Ie(D.component.subTree, de, Ce, Ne) return } if (qe & 128) { D.suspense.move(de, Ce, Ne) return } if (qe & 64) { Lt.move(D, de, Ce, or) return } if (Lt === Fragment) { o(Et, de, Ce) for (let he = 0; he < kt.length; he++) Ie(kt[he], de, Ce, Ne) o(D.anchor, de, Ce) return } if (Lt === Static) { w(D, de, Ce) return } if (Ne !== 2 && qe & 1 && Ue) if (Ne === 0) Ue.beforeEnter(Et), o(Et, de, Ce), queuePostRenderEffect(() => Ue.enter(Et), Ve) else { const { leave: he, delayLeave: At, afterLeave: nr } = Ue, cr = () => o(Et, de, Ce), Fe = () => { he(Et, () => { cr(), nr && nr() }) } At ? At(Et, cr, Fe) : Fe() } else o(Et, de, Ce) }, Pt = (D, de, Ce, Ne = !1, Ve = !1) => { const { type: Et, props: Lt, ref: Ue, children: kt, dynamicChildren: qe, shapeFlag: ir, patchFlag: he, dirs: At } = D if ((Ue != null && setRef(Ue, null, Ce, D, !0), ir & 256)) { de.ctx.deactivate(D) return } const nr = ir & 1 && At, cr = !isAsyncWrapper(D) let Fe if ( (cr && (Fe = Lt && Lt.onVnodeBeforeUnmount) && invokeVNodeHook(Fe, de, D), ir & 6) ) Oe(D.component, Ce, Ne) else { if (ir & 128) { D.suspense.unmount(Ce, Ne) return } nr && invokeDirectiveHook(D, null, de, 'beforeUnmount'), ir & 64 ? D.type.remove(D, de, Ce, Ve, or, Ne) : qe && (Et !== Fragment || (he > 0 && he & 64)) ? xe(qe, de, Ce, !1, !0) : ((Et === Fragment && he & 384) || (!Ve && ir & 16)) && xe(kt, de, Ce), Ne && rr(D) } ;((cr && (Fe = Lt && Lt.onVnodeUnmounted)) || nr) && queuePostRenderEffect(() => { Fe && invokeVNodeHook(Fe, de, D), nr && invokeDirectiveHook(D, null, de, 'unmounted') }, Ce) }, rr = D => { const { type: de, el: Ce, anchor: Ne, transition: Ve } = D if (de === Fragment) { _e(Ce, Ne) return } if (de === Static) { S(D) return } const Et = () => { n(Ce), Ve && !Ve.persisted && Ve.afterLeave && Ve.afterLeave() } if (D.shapeFlag & 1 && Ve && !Ve.persisted) { const { leave: Lt, delayLeave: Ue } = Ve, kt = () => Lt(Ce, Et) Ue ? Ue(D.el, Et, kt) : kt() } else Et() }, _e = (D, de) => { let Ce for (; D !== de; ) (Ce = f(D)), n(D), (D = Ce) n(de) }, Oe = (D, de, Ce) => { const { bum: Ne, scope: Ve, update: Et, subTree: Lt, um: Ue } = D Ne && invokeArrayFns(Ne), Ve.stop(), Et && ((Et.active = !1), Pt(Lt, D, de, Ce)), Ue && queuePostRenderEffect(Ue, de), queuePostRenderEffect(() => { D.isUnmounted = !0 }, de), de && de.pendingBranch && !de.isUnmounted && D.asyncDep && !D.asyncResolved && D.suspenseId === de.pendingId && (de.deps--, de.deps === 0 && de.resolve()) }, xe = (D, de, Ce, Ne = !1, Ve = !1, Et = 0) => { for (let Lt = Et; Lt < D.length; Lt++) Pt(D[Lt], de, Ce, Ne, Ve) }, $e = D => D.shapeFlag & 6 ? $e(D.component.subTree) : D.shapeFlag & 128 ? D.suspense.next() : f(D.anchor || D.el), jt = (D, de, Ce) => { D == null ? de._vnode && Pt(de._vnode, null, null, !0) : k(de._vnode || null, D, de, null, null, null, Ce), flushPostFlushCbs(), (de._vnode = D) }, or = { p: k, um: Pt, m: Ie, r: rr, mt: j, mc: F, pc: L, pbc: ae, n: $e, o: e } let er, tr return ( t && ([er, tr] = t(or)), { render: jt, hydrate: er, createApp: createAppAPI(jt, er) } ) } function toggleRecurse({ effect: e, update: t }, r) { e.allowRecurse = t.allowRecurse = r } function traverseStaticChildren(e, t, r = !1) { const o = e.children, n = t.children if (isArray$7(o) && isArray$7(n)) for (let a = 0; a < o.length; a++) { const l = o[a] let s = n[a] s.shapeFlag & 1 && !s.dynamicChildren && ((s.patchFlag <= 0 || s.patchFlag === 32) && ((s = n[a] = cloneIfMounted(n[a])), (s.el = l.el)), r || traverseStaticChildren(l, s)) } } function getSequence(e) { const t = e.slice(), r = [0] let o, n, a, l, s const c = e.length for (o = 0; o < c; o++) { const d = e[o] if (d !== 0) { if (((n = r[r.length - 1]), e[n] < d)) { ;(t[o] = n), r.push(o) continue } for (a = 0, l = r.length - 1; a < l; ) (s = (a + l) >> 1), e[r[s]] < d ? (a = s + 1) : (l = s) d < e[r[a]] && (a > 0 && (t[o] = r[a - 1]), (r[a] = o)) } } for (a = r.length, l = r[a - 1]; a-- > 0; ) (r[a] = l), (l = t[l]) return r } const isTeleport = e => e.__isTeleport, isTeleportDisabled = e => e && (e.disabled || e.disabled === ''), isTargetSVG = e => typeof SVGElement != 'undefined' && e instanceof SVGElement, resolveTarget = (e, t) => { const r = e && e.to return isString$2(r) ? (t ? t(r) : null) : r }, TeleportImpl = { __isTeleport: !0, process(e, t, r, o, n, a, l, s, c, d) { const { mc: u, pc: m, pbc: f, o: { insert: _, querySelector: b, createText: v, createComment: k } } = d, g = isTeleportDisabled(t.props) let { shapeFlag: x, children: y, dynamicChildren: w } = t if (e == null) { const S = (t.el = v('')), T = (t.anchor = v('')) _(S, r, o), _(T, r, o) const A = (t.target = resolveTarget(t.props, b)), $ = (t.targetAnchor = v('')) A && (_($, A), (l = l || isTargetSVG(A))) const F = (Y, ae) => { x & 16 && u(y, Y, ae, n, a, l, s, c) } g ? F(r, T) : A && F(A, $) } else { t.el = e.el const S = (t.anchor = e.anchor), T = (t.target = e.target), A = (t.targetAnchor = e.targetAnchor), $ = isTeleportDisabled(e.props), F = $ ? r : T, Y = $ ? S : A if ( ((l = l || isTargetSVG(T)), w ? (f(e.dynamicChildren, w, F, n, a, l, s), traverseStaticChildren(e, t, !0)) : c || m(e, t, F, Y, n, a, l, s, !1), g) ) $ || moveTeleport(t, r, S, d, 1) else if ((t.props && t.props.to) !== (e.props && e.props.to)) { const ae = (t.target = resolveTarget(t.props, b)) ae && moveTeleport(t, ae, null, d, 0) } else $ && moveTeleport(t, T, A, d, 1) } }, remove(e, t, r, o, { um: n, o: { remove: a } }, l) { const { shapeFlag: s, children: c, anchor: d, targetAnchor: u, target: m, props: f } = e if ((m && a(u), (l || !isTeleportDisabled(f)) && (a(d), s & 16))) for (let _ = 0; _ < c.length; _++) { const b = c[_] n(b, t, r, !0, !!b.dynamicChildren) } }, move: moveTeleport, hydrate: hydrateTeleport } function moveTeleport(e, t, r, { o: { insert: o }, m: n }, a = 2) { a === 0 && o(e.targetAnchor, t, r) const { el: l, anchor: s, shapeFlag: c, children: d, props: u } = e, m = a === 2 if ((m && o(l, t, r), (!m || isTeleportDisabled(u)) && c & 16)) for (let f = 0; f < d.length; f++) n(d[f], t, r, 2) m && o(s, t, r) } function hydrateTeleport( e, t, r, o, n, a, { o: { nextSibling: l, parentNode: s, querySelector: c } }, d ) { const u = (t.target = resolveTarget(t.props, c)) if (u) { const m = u._lpa || u.firstChild if (t.shapeFlag & 16) if (isTeleportDisabled(t.props)) (t.anchor = d(l(e), t, s(e), r, o, n, a)), (t.targetAnchor = m) else { t.anchor = l(e) let f = m for (; f; ) if ( ((f = l(f)), f && f.nodeType === 8 && f.data === 'teleport anchor') ) { ;(t.targetAnchor = f), (u._lpa = t.targetAnchor && l(t.targetAnchor)) break } d(m, t, u, r, o, n, a) } } return t.anchor && l(t.anchor) } const Teleport = TeleportImpl, Fragment = Symbol(void 0), Text = Symbol(void 0), Comment = Symbol(void 0), Static = Symbol(void 0), blockStack = [] let currentBlock = null function openBlock(e = !1) { blockStack.push((currentBlock = e ? null : [])) } function closeBlock() { blockStack.pop(), (currentBlock = blockStack[blockStack.length - 1] || null) } let isBlockTreeEnabled = 1 function setBlockTracking(e) { isBlockTreeEnabled += e } function setupBlock(e) { return ( (e.dynamicChildren = isBlockTreeEnabled > 0 ? currentBlock || EMPTY_ARR : null), closeBlock(), isBlockTreeEnabled > 0 && currentBlock && currentBlock.push(e), e ) } function createElementBlock(e, t, r, o, n, a) { return setupBlock(createBaseVNode(e, t, r, o, n, a, !0)) } function createBlock(e, t, r, o, n) { return setupBlock(createVNode(e, t, r, o, n, !0)) } function isVNode(e) { return e ? e.__v_isVNode === !0 : !1 } function isSameVNodeType(e, t) { return e.type === t.type && e.key === t.key } const InternalObjectKey = '__vInternal', normalizeKey = ({ key: e }) => (e != null ? e : null), normalizeRef = ({ ref: e, ref_key: t, ref_for: r }) => e != null ? isString$2(e) || isRef(e) || isFunction$1(e) ? { i: currentRenderingInstance, r: e, k: t, f: !!r } : e : null function createBaseVNode( e, t = null, r = null, o = 0, n = null, a = e === Fragment ? 0 : 1, l = !1, s = !1 ) { const c = { __v_isVNode: !0, __v_skip: !0, type: e, props: t, key: t && normalizeKey(t), ref: t && normalizeRef(t), scopeId: currentScopeId, slotScopeIds: null, children: r, component: null, suspense: null, ssContent: null, ssFallback: null, dirs: null, transition: null, el: null, anchor: null, target: null, targetAnchor: null, staticCount: 0, shapeFlag: a, patchFlag: o, dynamicProps: n, dynamicChildren: null, appContext: null } return ( s ? (normalizeChildren(c, r), a & 128 && e.normalize(c)) : r && (c.shapeFlag |= isString$2(r) ? 8 : 16), isBlockTreeEnabled > 0 && !l && currentBlock && (c.patchFlag > 0 || a & 6) && c.patchFlag !== 32 && currentBlock.push(c), c ) } const createVNode = _createVNode function _createVNode(e, t = null, r = null, o = 0, n = null, a = !1) { if (((!e || e === NULL_DYNAMIC_COMPONENT) && (e = Comment), isVNode(e))) { const s = cloneVNode(e, t, !0) return ( r && normalizeChildren(s, r), isBlockTreeEnabled > 0 && !a && currentBlock && (s.shapeFlag & 6 ? (currentBlock[currentBlock.indexOf(e)] = s) : currentBlock.push(s)), (s.patchFlag |= -2), s ) } if ((isClassComponent(e) && (e = e.__vccOpts), t)) { t = guardReactiveProps(t) let { class: s, style: c } = t s && !isString$2(s) && (t.class = normalizeClass(s)), isObject$2(c) && (isProxy(c) && !isArray$7(c) && (c = extend$1({}, c)), (t.style = normalizeStyle(c))) } const l = isString$2(e) ? 1 : isSuspense(e) ? 128 : isTeleport(e) ? 64 : isObject$2(e) ? 4 : isFunction$1(e) ? 2 : 0 return createBaseVNode(e, t, r, o, n, l, a, !0) } function guardReactiveProps(e) { return e ? (isProxy(e) || InternalObjectKey in e ? extend$1({}, e) : e) : null } function cloneVNode(e, t, r = !1) { const { props: o, ref: n, patchFlag: a, children: l } = e, s = t ? mergeProps(o || {}, t) : o return { __v_isVNode: !0, __v_skip: !0, type: e.type, props: s, key: s && normalizeKey(s), ref: t && t.ref ? r && n ? isArray$7(n) ? n.concat(normalizeRef(t)) : [n, normalizeRef(t)] : normalizeRef(t) : n, scopeId: e.scopeId, slotScopeIds: e.slotScopeIds, children: l, target: e.target, targetAnchor: e.targetAnchor, staticCount: e.staticCount, shapeFlag: e.shapeFlag, patchFlag: t && e.type !== Fragment ? (a === -1 ? 16 : a | 16) : a, dynamicProps: e.dynamicProps, dynamicChildren: e.dynamicChildren, appContext: e.appContext, dirs: e.dirs, transition: e.transition, component: e.component, suspense: e.suspense, ssContent: e.ssContent && cloneVNode(e.ssContent), ssFallback: e.ssFallback && cloneVNode(e.ssFallback), el: e.el, anchor: e.anchor } } function createTextVNode(e = ' ', t = 0) { return createVNode(Text, null, e, t) } function createStaticVNode(e, t) { const r = createVNode(Static, null, e) return (r.staticCount = t), r } function createCommentVNode(e = '', t = !1) { return t ? (openBlock(), createBlock(Comment, null, e)) : createVNode(Comment, null, e) } function normalizeVNode(e) { return e == null || typeof e == 'boolean' ? createVNode(Comment) : isArray$7(e) ? createVNode(Fragment, null, e.slice()) : typeof e == 'object' ? cloneIfMounted(e) : createVNode(Text, null, String(e)) } function cloneIfMounted(e) { return e.el === null || e.memo ? e : cloneVNode(e) } function normalizeChildren(e, t) { let r = 0 const { shapeFlag: o } = e if (t == null) t = null else if (isArray$7(t)) r = 16 else if (typeof t == 'object') if (o & 65) { const n = t.default n && (n._c && (n._d = !1), normalizeChildren(e, n()), n._c && (n._d = !0)) return } else { r = 32 const n = t._ !n && !(InternalObjectKey in t) ? (t._ctx = currentRenderingInstance) : n === 3 && currentRenderingInstance && (currentRenderingInstance.slots._ === 1 ? (t._ = 1) : ((t._ = 2), (e.patchFlag |= 1024))) } else isFunction$1(t) ? ((t = { default: t, _ctx: currentRenderingInstance }), (r = 32)) : ((t = String(t)), o & 64 ? ((r = 16), (t = [createTextVNode(t)])) : (r = 8)) ;(e.children = t), (e.shapeFlag |= r) } function mergeProps(...e) { const t = {} for (let r = 0; r < e.length; r++) { const o = e[r] for (const n in o) if (n === 'class') t.class !== o.class && (t.class = normalizeClass([t.class, o.class])) else if (n === 'style') t.style = normalizeStyle([t.style, o.style]) else if (isOn(n)) { const a = t[n], l = o[n] l && a !== l && !(isArray$7(a) && a.includes(l)) && (t[n] = a ? [].concat(a, l) : l) } else n !== '' && (t[n] = o[n]) } return t } function invokeVNodeHook(e, t, r, o = null) { callWithAsyncErrorHandling(e, t, 7, [r, o]) } const emptyAppContext = createAppContext() let uid$1 = 0 function createComponentInstance(e, t, r) { const o = e.type, n = (t ? t.appContext : e.appContext) || emptyAppContext, a = { uid: uid$1++, vnode: e, type: o, parent: t, appContext: n, root: null, next: null, subTree: null, effect: null, update: null, scope: new EffectScope(!0), render: null, proxy: null, exposed: null, exposeProxy: null, withProxy: null, provides: t ? t.provides : Object.create(n.provides), accessCache: null, renderCache: [], components: null, directives: null, propsOptions: normalizePropsOptions(o, n), emitsOptions: normalizeEmitsOptions(o, n), emit: null, emitted: null, propsDefaults: EMPTY_OBJ, inheritAttrs: o.inheritAttrs, ctx: EMPTY_OBJ, data: EMPTY_OBJ, props: EMPTY_OBJ, attrs: EMPTY_OBJ, slots: EMPTY_OBJ, refs: EMPTY_OBJ, setupState: EMPTY_OBJ, setupContext: null, suspense: r, suspenseId: r ? r.pendingId : 0, asyncDep: null, asyncResolved: !1, isMounted: !1, isUnmounted: !1, isDeactivated: !1, bc: null, c: null, bm: null, m: null, bu: null, u: null, um: null, bum: null, da: null, a: null, rtg: null, rtc: null, ec: null, sp: null } return ( (a.ctx = { _: a }), (a.root = t ? t.root : a), (a.emit = emit$1.bind(null, a)), e.ce && e.ce(a), a ) } let currentInstance = null const getCurrentInstance = () => currentInstance || currentRenderingInstance, setCurrentInstance = e => { ;(currentInstance = e), e.scope.on() }, unsetCurrentInstance = () => { currentInstance && currentInstance.scope.off(), (currentInstance = null) } function isStatefulComponent(e) { return e.vnode.shapeFlag & 4 } let isInSSRComponentSetup = !1 function setupComponent(e, t = !1) { isInSSRComponentSetup = t const { props: r, children: o } = e.vnode, n = isStatefulComponent(e) initProps(e, r, n, t), initSlots(e, o) const a = n ? setupStatefulComponent(e, t) : void 0 return (isInSSRComponentSetup = !1), a } function setupStatefulComponent(e, t) { const r = e.type ;(e.accessCache = Object.create(null)), (e.proxy = markRaw(new Proxy(e.ctx, PublicInstanceProxyHandlers))) const { setup: o } = r if (o) { const n = (e.setupContext = o.length > 1 ? createSetupContext(e) : null) setCurrentInstance(e), pauseTracking() const a = callWithErrorHandling(o, e, 0, [e.props, n]) if ((resetTracking(), unsetCurrentInstance(), isPromise(a))) { if ((a.then(unsetCurrentInstance, unsetCurrentInstance), t)) return a .then(l => { handleSetupResult(e, l, t) }) .catch(l => { handleError(l, e, 0) }) e.asyncDep = a } else handleSetupResult(e, a, t) } else finishComponentSetup(e, t) } function handleSetupResult(e, t, r) { isFunction$1(t) ? e.type.__ssrInlineRender ? (e.ssrRender = t) : (e.render = t) : isObject$2(t) && (e.setupState = proxyRefs(t)), finishComponentSetup(e, r) } let compile function finishComponentSetup(e, t, r) { const o = e.type if (!e.render) { if (!t && compile && !o.render) { const n = o.template if (n) { const { isCustomElement: a, compilerOptions: l } = e.appContext.config, { delimiters: s, compilerOptions: c } = o, d = extend$1(extend$1({ isCustomElement: a, delimiters: s }, l), c) o.render = compile(n, d) } } e.render = o.render || NOOP } setCurrentInstance(e), pauseTracking(), applyOptions(e), resetTracking(), unsetCurrentInstance() } function createAttrsProxy(e) { return new Proxy(e.attrs, { get(t, r) { return track(e, 'get', '$attrs'), t[r] } }) } function createSetupContext(e) { const t = o => { e.exposed = o || {} } let r return { get attrs() { return r || (r = createAttrsProxy(e)) }, slots: e.slots, emit: e.emit, expose: t } } function getExposeProxy(e) { if (e.exposed) return ( e.exposeProxy || (e.exposeProxy = new Proxy(proxyRefs(markRaw(e.exposed)), { get(t, r) { if (r in t) return t[r] if (r in publicPropertiesMap) return publicPropertiesMap[r](e) } })) ) } const classifyRE = /(?:^|[-_])(\w)/g, classify = e => e.replace(classifyRE, t => t.toUpperCase()).replace(/[-_]/g, '') function getComponentName(e, t = !0) { return isFunction$1(e) ? e.displayName || e.name : e.name || (t && e.__name) } function formatComponentName(e, t, r = !1) { let o = getComponentName(t) if (!o && t.__file) { const n = t.__file.match(/([^/\\]+)\.\w+$/) n && (o = n[1]) } if (!o && e && e.parent) { const n = a => { for (const l in a) if (a[l] === t) return l } o = n(e.components || e.parent.type.components) || n(e.appContext.components) } return o ? classify(o) : r ? 'App' : 'Anonymous' } function isClassComponent(e) { return isFunction$1(e) && '__vccOpts' in e } const computed = (e, t) => computed$1(e, t, isInSSRComponentSetup) function useSlots() { return getContext().slots } function useAttrs$1() { return getContext().attrs } function getContext() { const e = getCurrentInstance() return e.setupContext || (e.setupContext = createSetupContext(e)) } function h(e, t, r) { const o = arguments.length return o === 2 ? isObject$2(t) && !isArray$7(t) ? isVNode(t) ? createVNode(e, null, [t]) : createVNode(e, t) : createVNode(e, null, t) : (o > 3 ? (r = Array.prototype.slice.call(arguments, 2)) : o === 3 && isVNode(r) && (r = [r]), createVNode(e, t, r)) } const version = '3.2.37', svgNS = 'http://www.w3.org/2000/svg', doc = typeof document != 'undefined' ? document : null, templateContainer = doc && doc.createElement('template'), nodeOps = { insert: (e, t, r) => { t.insertBefore(e, r || null) }, remove: e => { const t = e.parentNode t && t.removeChild(e) }, createElement: (e, t, r, o) => { const n = t ? doc.createElementNS(svgNS, e) : doc.createElement(e, r ? { is: r } : void 0) return ( e === 'select' && o && o.multiple != null && n.setAttribute('multiple', o.multiple), n ) }, createText: e => doc.createTextNode(e), createComment: e => doc.createComment(e), setText: (e, t) => { e.nodeValue = t }, setElementText: (e, t) => { e.textContent = t }, parentNode: e => e.parentNode, nextSibling: e => e.nextSibling, querySelector: e => doc.querySelector(e), setScopeId(e, t) { e.setAttribute(t, '') }, cloneNode(e) { const t = e.cloneNode(!0) return '_value' in e && (t._value = e._value), t }, insertStaticContent(e, t, r, o, n, a) { const l = r ? r.previousSibling : t.lastChild if (n && (n === a || n.nextSibling)) for ( ; t.insertBefore(n.cloneNode(!0), r), !(n === a || !(n = n.nextSibling)); ); else { templateContainer.innerHTML = o ? `${e}` : e const s = templateContainer.content if (o) { const c = s.firstChild for (; c.firstChild; ) s.appendChild(c.firstChild) s.removeChild(c) } t.insertBefore(s, r) } return [ l ? l.nextSibling : t.firstChild, r ? r.previousSibling : t.lastChild ] } } function patchClass(e, t, r) { const o = e._vtc o && (t = (t ? [t, ...o] : [...o]).join(' ')), t == null ? e.removeAttribute('class') : r ? e.setAttribute('class', t) : (e.className = t) } function patchStyle(e, t, r) { const o = e.style, n = isString$2(r) if (r && !n) { for (const a in r) setStyle(o, a, r[a]) if (t && !isString$2(t)) for (const a in t) r[a] == null && setStyle(o, a, '') } else { const a = o.display n ? t !== r && (o.cssText = r) : t && e.removeAttribute('style'), '_vod' in e && (o.display = a) } } const importantRE = /\s*!important$/ function setStyle(e, t, r) { if (isArray$7(r)) r.forEach(o => setStyle(e, t, o)) else if ((r == null && (r = ''), t.startsWith('--'))) e.setProperty(t, r) else { const o = autoPrefix(e, t) importantRE.test(r) ? e.setProperty(hyphenate(o), r.replace(importantRE, ''), 'important') : (e[o] = r) } } const prefixes = ['Webkit', 'Moz', 'ms'], prefixCache = {} function autoPrefix(e, t) { const r = prefixCache[t] if (r) return r let o = camelize(t) if (o !== 'filter' && o in e) return (prefixCache[t] = o) o = capitalize(o) for (let n = 0; n < prefixes.length; n++) { const a = prefixes[n] + o if (a in e) return (prefixCache[t] = a) } return t } const xlinkNS = 'http://www.w3.org/1999/xlink' function patchAttr(e, t, r, o, n) { if (o && t.startsWith('xlink:')) r == null ? e.removeAttributeNS(xlinkNS, t.slice(6, t.length)) : e.setAttributeNS(xlinkNS, t, r) else { const a = isSpecialBooleanAttr(t) r == null || (a && !includeBooleanAttr(r)) ? e.removeAttribute(t) : e.setAttribute(t, a ? '' : r) } } function patchDOMProp(e, t, r, o, n, a, l) { if (t === 'innerHTML' || t === 'textContent') { o && l(o, n, a), (e[t] = r == null ? '' : r) return } if (t === 'value' && e.tagName !== 'PROGRESS' && !e.tagName.includes('-')) { e._value = r const c = r == null ? '' : r ;(e.value !== c || e.tagName === 'OPTION') && (e.value = c), r == null && e.removeAttribute(t) return } let s = !1 if (r === '' || r == null) { const c = typeof e[t] c === 'boolean' ? (r = includeBooleanAttr(r)) : r == null && c === 'string' ? ((r = ''), (s = !0)) : c === 'number' && ((r = 0), (s = !0)) } try { e[t] = r } catch {} s && e.removeAttribute(t) } const [_getNow, skipTimestampCheck] = (() => { let e = Date.now, t = !1 if (typeof window != 'undefined') { Date.now() > document.createEvent('Event').timeStamp && (e = performance.now.bind(performance)) const r = navigator.userAgent.match(/firefox\/(\d+)/i) t = !!(r && Number(r[1]) <= 53) } return [e, t] })() let cachedNow = 0 const p = Promise.resolve(), reset = () => { cachedNow = 0 }, getNow = () => cachedNow || (p.then(reset), (cachedNow = _getNow())) function addEventListener(e, t, r, o) { e.addEventListener(t, r, o) } function removeEventListener(e, t, r, o) { e.removeEventListener(t, r, o) } function patchEvent(e, t, r, o, n = null) { const a = e._vei || (e._vei = {}), l = a[t] if (o && l) l.value = o else { const [s, c] = parseName(t) if (o) { const d = (a[t] = createInvoker(o, n)) addEventListener(e, s, d, c) } else l && (removeEventListener(e, s, l, c), (a[t] = void 0)) } } const optionsModifierRE = /(?:Once|Passive|Capture)$/ function parseName(e) { let t if (optionsModifierRE.test(e)) { t = {} let r for (; (r = e.match(optionsModifierRE)); ) (e = e.slice(0, e.length - r[0].length)), (t[r[0].toLowerCase()] = !0) } return [hyphenate(e.slice(2)), t] } function createInvoker(e, t) { const r = o => { const n = o.timeStamp || _getNow() ;(skipTimestampCheck || n >= r.attached - 1) && callWithAsyncErrorHandling( patchStopImmediatePropagation(o, r.value), t, 5, [o] ) } return (r.value = e), (r.attached = getNow()), r } function patchStopImmediatePropagation(e, t) { if (isArray$7(t)) { const r = e.stopImmediatePropagation return ( (e.stopImmediatePropagation = () => { r.call(e), (e._stopped = !0) }), t.map(o => n => !n._stopped && o && o(n)) ) } else return t } const nativeOnRE = /^on[a-z]/, patchProp = (e, t, r, o, n = !1, a, l, s, c) => { t === 'class' ? patchClass(e, o, n) : t === 'style' ? patchStyle(e, r, o) : isOn(t) ? isModelListener(t) || patchEvent(e, t, r, o, l) : ( t[0] === '.' ? ((t = t.slice(1)), !0) : t[0] === '^' ? ((t = t.slice(1)), !1) : shouldSetAsProp(e, t, o, n) ) ? patchDOMProp(e, t, o, a, l, s, c) : (t === 'true-value' ? (e._trueValue = o) : t === 'false-value' && (e._falseValue = o), patchAttr(e, t, o, n)) } function shouldSetAsProp(e, t, r, o) { return o ? !!( t === 'innerHTML' || t === 'textContent' || (t in e && nativeOnRE.test(t) && isFunction$1(r)) ) : t === 'spellcheck' || t === 'draggable' || t === 'translate' || t === 'form' || (t === 'list' && e.tagName === 'INPUT') || (t === 'type' && e.tagName === 'TEXTAREA') || (nativeOnRE.test(t) && isString$2(r)) ? !1 : t in e } const TRANSITION = 'transition', ANIMATION = 'animation', Transition = (e, { slots: t }) => h(BaseTransition, resolveTransitionProps(e), t) Transition.displayName = 'Transition' const DOMTransitionPropsValidators = { name: String, type: String, css: { type: Boolean, default: !0 }, duration: [String, Number, Object], enterFromClass: String, enterActiveClass: String, enterToClass: String, appearFromClass: String, appearActiveClass: String, appearToClass: String, leaveFromClass: String, leaveActiveClass: String, leaveToClass: String }, TransitionPropsValidators = (Transition.props = extend$1( {}, BaseTransition.props, DOMTransitionPropsValidators )), callHook = (e, t = []) => { isArray$7(e) ? e.forEach(r => r(...t)) : e && e(...t) }, hasExplicitCallback = e => e ? (isArray$7(e) ? e.some(t => t.length > 1) : e.length > 1) : !1 function resolveTransitionProps(e) { const t = {} for (const re in e) re in DOMTransitionPropsValidators || (t[re] = e[re]) if (e.css === !1) return t const { name: r = 'v', type: o, duration: n, enterFromClass: a = `${r}-enter-from`, enterActiveClass: l = `${r}-enter-active`, enterToClass: s = `${r}-enter-to`, appearFromClass: c = a, appearActiveClass: d = l, appearToClass: u = s, leaveFromClass: m = `${r}-leave-from`, leaveActiveClass: f = `${r}-leave-active`, leaveToClass: _ = `${r}-leave-to` } = e, b = normalizeDuration(n), v = b && b[0], k = b && b[1], { onBeforeEnter: g, onEnter: x, onEnterCancelled: y, onLeave: w, onLeaveCancelled: S, onBeforeAppear: T = g, onAppear: A = x, onAppearCancelled: $ = y } = t, F = (re, ie, oe) => { removeTransitionClass(re, ie ? u : s), removeTransitionClass(re, ie ? d : l), oe && oe() }, Y = (re, ie) => { ;(re._isLeaving = !1), removeTransitionClass(re, m), removeTransitionClass(re, _), removeTransitionClass(re, f), ie && ie() }, ae = re => (ie, oe) => { const j = re ? A : x, V = () => F(ie, re, oe) callHook(j, [ie, V]), nextFrame(() => { removeTransitionClass(ie, re ? c : a), addTransitionClass(ie, re ? u : s), hasExplicitCallback(j) || whenTransitionEnds(ie, o, v, V) }) } return extend$1(t, { onBeforeEnter(re) { callHook(g, [re]), addTransitionClass(re, a), addTransitionClass(re, l) }, onBeforeAppear(re) { callHook(T, [re]), addTransitionClass(re, c), addTransitionClass(re, d) }, onEnter: ae(!1), onAppear: ae(!0), onLeave(re, ie) { re._isLeaving = !0 const oe = () => Y(re, ie) addTransitionClass(re, m), forceReflow(), addTransitionClass(re, f), nextFrame(() => { !re._isLeaving || (removeTransitionClass(re, m), addTransitionClass(re, _), hasExplicitCallback(w) || whenTransitionEnds(re, o, k, oe)) }), callHook(w, [re, oe]) }, onEnterCancelled(re) { F(re, !1), callHook(y, [re]) }, onAppearCancelled(re) { F(re, !0), callHook($, [re]) }, onLeaveCancelled(re) { Y(re), callHook(S, [re]) } }) } function normalizeDuration(e) { if (e == null) return null if (isObject$2(e)) return [NumberOf(e.enter), NumberOf(e.leave)] { const t = NumberOf(e) return [t, t] } } function NumberOf(e) { return toNumber$1(e) } function addTransitionClass(e, t) { t.split(/\s+/).forEach(r => r && e.classList.add(r)), (e._vtc || (e._vtc = new Set())).add(t) } function removeTransitionClass(e, t) { t.split(/\s+/).forEach(o => o && e.classList.remove(o)) const { _vtc: r } = e r && (r.delete(t), r.size || (e._vtc = void 0)) } function nextFrame(e) { requestAnimationFrame(() => { requestAnimationFrame(e) }) } let endId = 0 function whenTransitionEnds(e, t, r, o) { const n = (e._endId = ++endId), a = () => { n === e._endId && o() } if (r) return setTimeout(a, r) const { type: l, timeout: s, propCount: c } = getTransitionInfo(e, t) if (!l) return o() const d = l + 'end' let u = 0 const m = () => { e.removeEventListener(d, f), a() }, f = _ => { _.target === e && ++u >= c && m() } setTimeout(() => { u < c && m() }, s + 1), e.addEventListener(d, f) } function getTransitionInfo(e, t) { const r = window.getComputedStyle(e), o = b => (r[b] || '').split(', '), n = o(TRANSITION + 'Delay'), a = o(TRANSITION + 'Duration'), l = getTimeout(n, a), s = o(ANIMATION + 'Delay'), c = o(ANIMATION + 'Duration'), d = getTimeout(s, c) let u = null, m = 0, f = 0 t === TRANSITION ? l > 0 && ((u = TRANSITION), (m = l), (f = a.length)) : t === ANIMATION ? d > 0 && ((u = ANIMATION), (m = d), (f = c.length)) : ((m = Math.max(l, d)), (u = m > 0 ? (l > d ? TRANSITION : ANIMATION) : null), (f = u ? (u === TRANSITION ? a.length : c.length) : 0)) const _ = u === TRANSITION && /\b(transform|all)(,|$)/.test(r[TRANSITION + 'Property']) return { type: u, timeout: m, propCount: f, hasTransform: _ } } function getTimeout(e, t) { for (; e.length < t.length; ) e = e.concat(e) return Math.max(...t.map((r, o) => toMs(r) + toMs(e[o]))) } function toMs(e) { return Number(e.slice(0, -1).replace(',', '.')) * 1e3 } function forceReflow() { return document.body.offsetHeight } const positionMap = new WeakMap(), newPositionMap = new WeakMap(), TransitionGroupImpl = { name: 'TransitionGroup', props: extend$1({}, TransitionPropsValidators, { tag: String, moveClass: String }), setup(e, { slots: t }) { const r = getCurrentInstance(), o = useTransitionState() let n, a return ( onUpdated(() => { if (!n.length) return const l = e.moveClass || `${e.name || 'v'}-move` if (!hasCSSTransform(n[0].el, r.vnode.el, l)) return n.forEach(callPendingCbs), n.forEach(recordPosition) const s = n.filter(applyTranslation) forceReflow(), s.forEach(c => { const d = c.el, u = d.style addTransitionClass(d, l), (u.transform = u.webkitTransform = u.transitionDuration = '') const m = (d._moveCb = f => { ;(f && f.target !== d) || ((!f || /transform$/.test(f.propertyName)) && (d.removeEventListener('transitionend', m), (d._moveCb = null), removeTransitionClass(d, l))) }) d.addEventListener('transitionend', m) }) }), () => { const l = toRaw(e), s = resolveTransitionProps(l) let c = l.tag || Fragment ;(n = a), (a = t.default ? getTransitionRawChildren(t.default()) : []) for (let d = 0; d < a.length; d++) { const u = a[d] u.key != null && setTransitionHooks(u, resolveTransitionHooks(u, s, o, r)) } if (n) for (let d = 0; d < n.length; d++) { const u = n[d] setTransitionHooks(u, resolveTransitionHooks(u, s, o, r)), positionMap.set(u, u.el.getBoundingClientRect()) } return createVNode(c, null, a) } ) } }, TransitionGroup = TransitionGroupImpl function callPendingCbs(e) { const t = e.el t._moveCb && t._moveCb(), t._enterCb && t._enterCb() } function recordPosition(e) { newPositionMap.set(e, e.el.getBoundingClientRect()) } function applyTranslation(e) { const t = positionMap.get(e), r = newPositionMap.get(e), o = t.left - r.left, n = t.top - r.top if (o || n) { const a = e.el.style return ( (a.transform = a.webkitTransform = `translate(${o}px,${n}px)`), (a.transitionDuration = '0s'), e ) } } function hasCSSTransform(e, t, r) { const o = e.cloneNode() e._vtc && e._vtc.forEach(l => { l.split(/\s+/).forEach(s => s && o.classList.remove(s)) }), r.split(/\s+/).forEach(l => l && o.classList.add(l)), (o.style.display = 'none') const n = t.nodeType === 1 ? t : t.parentNode n.appendChild(o) const { hasTransform: a } = getTransitionInfo(o) return n.removeChild(o), a } const getModelAssigner = e => { const t = e.props['onUpdate:modelValue'] || !1 return isArray$7(t) ? r => invokeArrayFns(t, r) : t } function onCompositionStart(e) { e.target.composing = !0 } function onCompositionEnd(e) { const t = e.target t.composing && ((t.composing = !1), t.dispatchEvent(new Event('input'))) } const vModelText = { created(e, { modifiers: { lazy: t, trim: r, number: o } }, n) { e._assign = getModelAssigner(n) const a = o || (n.props && n.props.type === 'number') addEventListener(e, t ? 'change' : 'input', l => { if (l.target.composing) return let s = e.value r && (s = s.trim()), a && (s = toNumber$1(s)), e._assign(s) }), r && addEventListener(e, 'change', () => { e.value = e.value.trim() }), t || (addEventListener(e, 'compositionstart', onCompositionStart), addEventListener(e, 'compositionend', onCompositionEnd), addEventListener(e, 'change', onCompositionEnd)) }, mounted(e, { value: t }) { e.value = t == null ? '' : t }, beforeUpdate( e, { value: t, modifiers: { lazy: r, trim: o, number: n } }, a ) { if ( ((e._assign = getModelAssigner(a)), e.composing || (document.activeElement === e && e.type !== 'range' && (r || (o && e.value.trim() === t) || ((n || e.type === 'number') && toNumber$1(e.value) === t)))) ) return const l = t == null ? '' : t e.value !== l && (e.value = l) } }, vModelCheckbox = { deep: !0, created(e, t, r) { ;(e._assign = getModelAssigner(r)), addEventListener(e, 'change', () => { const o = e._modelValue, n = getValue$2(e), a = e.checked, l = e._assign if (isArray$7(o)) { const s = looseIndexOf(o, n), c = s !== -1 if (a && !c) l(o.concat(n)) else if (!a && c) { const d = [...o] d.splice(s, 1), l(d) } } else if (isSet$3(o)) { const s = new Set(o) a ? s.add(n) : s.delete(n), l(s) } else l(getCheckboxValue(e, a)) }) }, mounted: setChecked, beforeUpdate(e, t, r) { ;(e._assign = getModelAssigner(r)), setChecked(e, t, r) } } function setChecked(e, { value: t, oldValue: r }, o) { ;(e._modelValue = t), isArray$7(t) ? (e.checked = looseIndexOf(t, o.props.value) > -1) : isSet$3(t) ? (e.checked = t.has(o.props.value)) : t !== r && (e.checked = looseEqual(t, getCheckboxValue(e, !0))) } const vModelRadio = { created(e, { value: t }, r) { ;(e.checked = looseEqual(t, r.props.value)), (e._assign = getModelAssigner(r)), addEventListener(e, 'change', () => { e._assign(getValue$2(e)) }) }, beforeUpdate(e, { value: t, oldValue: r }, o) { ;(e._assign = getModelAssigner(o)), t !== r && (e.checked = looseEqual(t, o.props.value)) } } function getValue$2(e) { return '_value' in e ? e._value : e.value } function getCheckboxValue(e, t) { const r = t ? '_trueValue' : '_falseValue' return r in e ? e[r] : t } const systemModifiers = ['ctrl', 'shift', 'alt', 'meta'], modifierGuards = { stop: e => e.stopPropagation(), prevent: e => e.preventDefault(), self: e => e.target !== e.currentTarget, ctrl: e => !e.ctrlKey, shift: e => !e.shiftKey, alt: e => !e.altKey, meta: e => !e.metaKey, left: e => 'button' in e && e.button !== 0, middle: e => 'button' in e && e.button !== 1, right: e => 'button' in e && e.button !== 2, exact: (e, t) => systemModifiers.some(r => e[`${r}Key`] && !t.includes(r)) }, withModifiers = (e, t) => (r, ...o) => { for (let n = 0; n < t.length; n++) { const a = modifierGuards[t[n]] if (a && a(r, t)) return } return e(r, ...o) }, keyNames = { esc: 'escape', space: ' ', up: 'arrow-up', left: 'arrow-left', right: 'arrow-right', down: 'arrow-down', delete: 'backspace' }, withKeys = (e, t) => r => { if (!('key' in r)) return const o = hyphenate(r.key) if (t.some(n => n === o || keyNames[n] === o)) return e(r) }, vShow = { beforeMount(e, { value: t }, { transition: r }) { ;(e._vod = e.style.display === 'none' ? '' : e.style.display), r && t ? r.beforeEnter(e) : setDisplay(e, t) }, mounted(e, { value: t }, { transition: r }) { r && t && r.enter(e) }, updated(e, { value: t, oldValue: r }, { transition: o }) { !t != !r && (o ? t ? (o.beforeEnter(e), setDisplay(e, !0), o.enter(e)) : o.leave(e, () => { setDisplay(e, !1) }) : setDisplay(e, t)) }, beforeUnmount(e, { value: t }) { setDisplay(e, t) } } function setDisplay(e, t) { e.style.display = t ? e._vod : 'none' } const rendererOptions = extend$1({ patchProp }, nodeOps) let renderer function ensureRenderer() { return renderer || (renderer = createRenderer(rendererOptions)) } const render = (...e) => { ensureRenderer().render(...e) }, createApp = (...e) => { const t = ensureRenderer().createApp(...e), { mount: r } = t return ( (t.mount = o => { const n = normalizeContainer(o) if (!n) return const a = t._component !isFunction$1(a) && !a.render && !a.template && (a.template = n.innerHTML), (n.innerHTML = '') const l = r(n, !1, n instanceof SVGElement) return ( n instanceof Element && (n.removeAttribute('v-cloak'), n.setAttribute('data-v-app', '')), l ) }), t ) } function normalizeContainer(e) { return isString$2(e) ? document.querySelector(e) : e } const footerSection = '_footerSection_1ojeb_1', footerInfo = '_footerInfo_1ojeb_6', width1200 = '_width1200_1ojeb_11', attention = '_attention_1ojeb_25', friendShip = '_friendShip_1ojeb_42', lineWrap = '_lineWrap_1ojeb_47', itemWrap = '_itemWrap_1ojeb_50', friendshipItem = '_friendshipItem_1ojeb_55', hotLine = '_hotLine_1ojeb_68', footerCoptyright = '_footerCoptyright_1ojeb_80', whileLogo$1 = '_whileLogo_1ojeb_94', codeImg = '_codeImg_1ojeb_98', qrcode = '_qrcode_1ojeb_30' var classes$2 = { footerSection, footerInfo, width1200, attention, 'qrcode-item': '_qrcode-item_1ojeb_30', friendShip, lineWrap, itemWrap, friendshipItem, hotLine, footerCoptyright, whileLogo: whileLogo$1, codeImg, qrcode }, whileLogo = './assets/whileLogo.dd29ed45.png', studentCode = './assets/studentCode.bc813c41.png', teacherCode = './assets/teacherCode.23f4130b.png', ColFooter = defineComponent({ name: 'col-footer', setup() { return () => createVNode(Fragment, null, [ createVNode('div', null, [ createVNode('div', { class: classes$2.footerSection }, [ createVNode('div', { class: classes$2.footerInfo }, [ createVNode('div', { class: classes$2.width1200 }, [ createVNode('div', { class: classes$2.attention }, [ createVNode('div', { class: classes$2.qrcode }, [ createVNode( 'div', { class: classes$2.qrcodeItem, style: 'padding-right:50px' }, [ createVNode( 'img', { class: classes$2.whileLogo, src: whileLogo, width: '142px', height: '65px', alt: '' }, null ) ] ) ]), createVNode('div', { class: classes$2.qrcode }, [ createVNode('div', { class: classes$2.qrcodeItem }, [ createVNode( 'img', { class: classes$2.codeImg, src: studentCode, width: '74px', height: '74px' }, null ), createVNode('p', null, [ createTextVNode('\u9177\u4E50\u79C0') ]) ]) ]), createVNode('div', { class: classes$2.qrcode }, [ createVNode('div', { class: classes$2.qrcodeItem }, [ createVNode( 'img', { class: classes$2.codeImg, src: teacherCode, width: '74px', height: '74px' }, null ), createVNode('p', null, [ createTextVNode('\u9177\u4E50\u79C0\u5B66\u9662') ]) ]) ]) ]), createVNode('div', { class: classes$2.friendShip }, [ createVNode('div', { class: classes$2.hotLine }, [ createVNode('h2', null, [ createTextVNode('\u54A8\u8BE2\u70ED\u7EBF') ]), createVNode('p', null, [ createTextVNode('400 - 8851569'), createVNode('span', null, [ createTextVNode( '\uFF08\u5468\u4E00\u81F3\u5468\u4E94 09:00~21:00\uFF09' ) ]) ]) ]), createVNode('div', { class: classes$2.lineWrap }, [ createVNode('h2', null, [ createTextVNode('\u53CB\u60C5\u94FE\u63A5') ]), createVNode('div', { class: classes$2.itemWrap }, [ createVNode( 'div', { class: classes$2.friendshipItem }, [ createVNode( 'a', { target: 'view_window', href: 'http://www.chnmusic.org/' }, [ createTextVNode( '\u4E2D\u56FD\u97F3\u4E50\u5BB6\u534F\u4F1A' ) ] ) ] ), createVNode( 'div', { class: classes$2.friendshipItem }, [ createVNode( 'a', { target: 'view_window', href: 'https://www.cnorch.com/leaderInfo/list?leaderType=2' }, [ createTextVNode( '\u4E2D\u56FD\u97F3\u534F\u7BA1\u4E50\u5B66\u4F1A\u4F4E\u97F3\u94DC\u7BA1\u4E13\u4E1A\u59D4\u5458\u4F1A' ) ] ) ] ) ]) ]) ]) ]) ]), createVNode('div', { class: classes$2.footerCoptyright }, [ createVNode('div', { class: classes$2.width1200 }, [ createVNode('p', null, [ createTextVNode( 'Copyright \xA9 2021 \u6B66\u6C49\u9177\u4E50\u79C0\u7F51\u7EDC\u79D1\u6280\u6709\u9650\u516C\u53F8' ), createVNode('br', null, null), createTextVNode(' All Rights Reserved.'), ' ', createVNode( 'a', { target: '_blank', href: 'https://beian.miit.gov.cn/' }, [createTextVNode('\u9102ICP\u59072021020787\u53F7-1')] ) ]) ]) ]) ]) ]) ]) } }), freeGlobal = typeof global == 'object' && global && global.Object === Object && global, freeGlobal$1 = freeGlobal, freeSelf = typeof self == 'object' && self && self.Object === Object && self, root = freeGlobal$1 || freeSelf || Function('return this')(), root$1 = root, Symbol$1 = root$1.Symbol, Symbol$2 = Symbol$1, objectProto$f = Object.prototype, hasOwnProperty$c = objectProto$f.hasOwnProperty, nativeObjectToString$1 = objectProto$f.toString, symToStringTag$1 = Symbol$2 ? Symbol$2.toStringTag : void 0 function getRawTag(e) { var t = hasOwnProperty$c.call(e, symToStringTag$1), r = e[symToStringTag$1] try { e[symToStringTag$1] = void 0 var o = !0 } catch {} var n = nativeObjectToString$1.call(e) return o && (t ? (e[symToStringTag$1] = r) : delete e[symToStringTag$1]), n } var objectProto$e = Object.prototype, nativeObjectToString = objectProto$e.toString function objectToString$2(e) { return nativeObjectToString.call(e) } var nullTag = '[object Null]', undefinedTag = '[object Undefined]', symToStringTag = Symbol$2 ? Symbol$2.toStringTag : void 0 function baseGetTag(e) { return e == null ? e === void 0 ? undefinedTag : nullTag : symToStringTag && symToStringTag in Object(e) ? getRawTag(e) : objectToString$2(e) } function isObjectLike$1(e) { return e != null && typeof e == 'object' } var symbolTag$3 = '[object Symbol]' function isSymbol$1(e) { return ( typeof e == 'symbol' || (isObjectLike$1(e) && baseGetTag(e) == symbolTag$3) ) } function arrayMap(e, t) { for (var r = -1, o = e == null ? 0 : e.length, n = Array(o); ++r < o; ) n[r] = t(e[r], r, e) return n } var isArray$5 = Array.isArray, isArray$6 = isArray$5, INFINITY$1 = 1 / 0, symbolProto$2 = Symbol$2 ? Symbol$2.prototype : void 0, symbolToString = symbolProto$2 ? symbolProto$2.toString : void 0 function baseToString(e) { if (typeof e == 'string') return e if (isArray$6(e)) return arrayMap(e, baseToString) + '' if (isSymbol$1(e)) return symbolToString ? symbolToString.call(e) : '' var t = e + '' return t == '0' && 1 / e == -INFINITY$1 ? '-0' : t } var reWhitespace = /\s/ function trimmedEndIndex(e) { for (var t = e.length; t-- && reWhitespace.test(e.charAt(t)); ); return t } var reTrimStart = /^\s+/ function baseTrim(e) { return e && e.slice(0, trimmedEndIndex(e) + 1).replace(reTrimStart, '') } function isObject$1(e) { var t = typeof e return e != null && (t == 'object' || t == 'function') } var NAN = 0 / 0, reIsBadHex = /^[-+]0x[0-9a-f]+$/i, reIsBinary = /^0b[01]+$/i, reIsOctal = /^0o[0-7]+$/i, freeParseInt = parseInt function toNumber(e) { if (typeof e == 'number') return e if (isSymbol$1(e)) return NAN if (isObject$1(e)) { var t = typeof e.valueOf == 'function' ? e.valueOf() : e e = isObject$1(t) ? t + '' : t } if (typeof e != 'string') return e === 0 ? e : +e e = baseTrim(e) var r = reIsBinary.test(e) return r || reIsOctal.test(e) ? freeParseInt(e.slice(2), r ? 2 : 8) : reIsBadHex.test(e) ? NAN : +e } var asyncTag = '[object AsyncFunction]', funcTag$2 = '[object Function]', genTag$1 = '[object GeneratorFunction]', proxyTag = '[object Proxy]' function isFunction(e) { if (!isObject$1(e)) return !1 var t = baseGetTag(e) return t == funcTag$2 || t == genTag$1 || t == asyncTag || t == proxyTag } var coreJsData = root$1['__core-js_shared__'], coreJsData$1 = coreJsData, maskSrcKey = (function () { var e = /[^.]+$/.exec( (coreJsData$1 && coreJsData$1.keys && coreJsData$1.keys.IE_PROTO) || '' ) return e ? 'Symbol(src)_1.' + e : '' })() function isMasked(e) { return !!maskSrcKey && maskSrcKey in e } var funcProto$2 = Function.prototype, funcToString$2 = funcProto$2.toString function toSource(e) { if (e != null) { try { return funcToString$2.call(e) } catch {} try { return e + '' } catch {} } return '' } var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, reIsHostCtor = /^\[object .+?Constructor\]$/, funcProto$1 = Function.prototype, objectProto$d = Object.prototype, funcToString$1 = funcProto$1.toString, hasOwnProperty$b = objectProto$d.hasOwnProperty, reIsNative = RegExp( '^' + funcToString$1 .call(hasOwnProperty$b) .replace(reRegExpChar, '\\$&') .replace( /hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?' ) + '$' ) function baseIsNative(e) { if (!isObject$1(e) || isMasked(e)) return !1 var t = isFunction(e) ? reIsNative : reIsHostCtor return t.test(toSource(e)) } function getValue$1(e, t) { return e == null ? void 0 : e[t] } function getNative(e, t) { var r = getValue$1(e, t) return baseIsNative(r) ? r : void 0 } var WeakMap$1 = getNative(root$1, 'WeakMap'), WeakMap$2 = WeakMap$1, objectCreate = Object.create, baseCreate = (function () { function e() {} return function (t) { if (!isObject$1(t)) return {} if (objectCreate) return objectCreate(t) e.prototype = t var r = new e() return (e.prototype = void 0), r } })(), baseCreate$1 = baseCreate function copyArray(e, t) { var r = -1, o = e.length for (t || (t = Array(o)); ++r < o; ) t[r] = e[r] return t } var defineProperty = (function () { try { var e = getNative(Object, 'defineProperty') return e({}, '', {}), e } catch {} })(), defineProperty$1 = defineProperty function arrayEach(e, t) { for ( var r = -1, o = e == null ? 0 : e.length; ++r < o && t(e[r], r, e) !== !1; ); return e } var MAX_SAFE_INTEGER$1 = 9007199254740991, reIsUint = /^(?:0|[1-9]\d*)$/ function isIndex(e, t) { var r = typeof e return ( (t = t == null ? MAX_SAFE_INTEGER$1 : t), !!t && (r == 'number' || (r != 'symbol' && reIsUint.test(e))) && e > -1 && e % 1 == 0 && e < t ) } function baseAssignValue(e, t, r) { t == '__proto__' && defineProperty$1 ? defineProperty$1(e, t, { configurable: !0, enumerable: !0, value: r, writable: !0 }) : (e[t] = r) } function eq(e, t) { return e === t || (e !== e && t !== t) } var objectProto$c = Object.prototype, hasOwnProperty$a = objectProto$c.hasOwnProperty function assignValue(e, t, r) { var o = e[t] ;(!(hasOwnProperty$a.call(e, t) && eq(o, r)) || (r === void 0 && !(t in e))) && baseAssignValue(e, t, r) } function copyObject(e, t, r, o) { var n = !r r || (r = {}) for (var a = -1, l = t.length; ++a < l; ) { var s = t[a], c = o ? o(r[s], e[s], s, r, e) : void 0 c === void 0 && (c = e[s]), n ? baseAssignValue(r, s, c) : assignValue(r, s, c) } return r } var MAX_SAFE_INTEGER = 9007199254740991 function isLength(e) { return typeof e == 'number' && e > -1 && e % 1 == 0 && e <= MAX_SAFE_INTEGER } function isArrayLike(e) { return e != null && isLength(e.length) && !isFunction(e) } var objectProto$b = Object.prototype function isPrototype(e) { var t = e && e.constructor, r = (typeof t == 'function' && t.prototype) || objectProto$b return e === r } function baseTimes(e, t) { for (var r = -1, o = Array(e); ++r < e; ) o[r] = t(r) return o } var argsTag$3 = '[object Arguments]' function baseIsArguments(e) { return isObjectLike$1(e) && baseGetTag(e) == argsTag$3 } var objectProto$a = Object.prototype, hasOwnProperty$9 = objectProto$a.hasOwnProperty, propertyIsEnumerable$1 = objectProto$a.propertyIsEnumerable, isArguments = baseIsArguments( (function () { return arguments })() ) ? baseIsArguments : function (e) { return ( isObjectLike$1(e) && hasOwnProperty$9.call(e, 'callee') && !propertyIsEnumerable$1.call(e, 'callee') ) }, isArguments$1 = isArguments function stubFalse() { return !1 } var freeExports$2 = typeof exports == 'object' && exports && !exports.nodeType && exports, freeModule$2 = freeExports$2 && typeof module == 'object' && module && !module.nodeType && module, moduleExports$2 = freeModule$2 && freeModule$2.exports === freeExports$2, Buffer$1 = moduleExports$2 ? root$1.Buffer : void 0, nativeIsBuffer = Buffer$1 ? Buffer$1.isBuffer : void 0, isBuffer$1 = nativeIsBuffer || stubFalse, isBuffer$2 = isBuffer$1, argsTag$2 = '[object Arguments]', arrayTag$2 = '[object Array]', boolTag$3 = '[object Boolean]', dateTag$3 = '[object Date]', errorTag$2 = '[object Error]', funcTag$1 = '[object Function]', mapTag$5 = '[object Map]', numberTag$3 = '[object Number]', objectTag$4 = '[object Object]', regexpTag$3 = '[object RegExp]', setTag$5 = '[object Set]', stringTag$3 = '[object String]', weakMapTag$2 = '[object WeakMap]', arrayBufferTag$3 = '[object ArrayBuffer]', dataViewTag$4 = '[object DataView]', float32Tag$2 = '[object Float32Array]', float64Tag$2 = '[object Float64Array]', int8Tag$2 = '[object Int8Array]', int16Tag$2 = '[object Int16Array]', int32Tag$2 = '[object Int32Array]', uint8Tag$2 = '[object Uint8Array]', uint8ClampedTag$2 = '[object Uint8ClampedArray]', uint16Tag$2 = '[object Uint16Array]', uint32Tag$2 = '[object Uint32Array]', typedArrayTags = {} typedArrayTags[float32Tag$2] = typedArrayTags[float64Tag$2] = typedArrayTags[int8Tag$2] = typedArrayTags[int16Tag$2] = typedArrayTags[int32Tag$2] = typedArrayTags[uint8Tag$2] = typedArrayTags[uint8ClampedTag$2] = typedArrayTags[uint16Tag$2] = typedArrayTags[uint32Tag$2] = !0 typedArrayTags[argsTag$2] = typedArrayTags[arrayTag$2] = typedArrayTags[arrayBufferTag$3] = typedArrayTags[boolTag$3] = typedArrayTags[dataViewTag$4] = typedArrayTags[dateTag$3] = typedArrayTags[errorTag$2] = typedArrayTags[funcTag$1] = typedArrayTags[mapTag$5] = typedArrayTags[numberTag$3] = typedArrayTags[objectTag$4] = typedArrayTags[regexpTag$3] = typedArrayTags[setTag$5] = typedArrayTags[stringTag$3] = typedArrayTags[weakMapTag$2] = !1 function baseIsTypedArray(e) { return ( isObjectLike$1(e) && isLength(e.length) && !!typedArrayTags[baseGetTag(e)] ) } function baseUnary(e) { return function (t) { return e(t) } } var freeExports$1 = typeof exports == 'object' && exports && !exports.nodeType && exports, freeModule$1 = freeExports$1 && typeof module == 'object' && module && !module.nodeType && module, moduleExports$1 = freeModule$1 && freeModule$1.exports === freeExports$1, freeProcess = moduleExports$1 && freeGlobal$1.process, nodeUtil = (function () { try { var e = freeModule$1 && freeModule$1.require && freeModule$1.require('util').types return ( e || (freeProcess && freeProcess.binding && freeProcess.binding('util')) ) } catch {} })(), nodeUtil$1 = nodeUtil, nodeIsTypedArray = nodeUtil$1 && nodeUtil$1.isTypedArray, isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray, isTypedArray$1 = isTypedArray, objectProto$9 = Object.prototype, hasOwnProperty$8 = objectProto$9.hasOwnProperty function arrayLikeKeys(e, t) { var r = isArray$6(e), o = !r && isArguments$1(e), n = !r && !o && isBuffer$2(e), a = !r && !o && !n && isTypedArray$1(e), l = r || o || n || a, s = l ? baseTimes(e.length, String) : [], c = s.length for (var d in e) (t || hasOwnProperty$8.call(e, d)) && !( l && (d == 'length' || (n && (d == 'offset' || d == 'parent')) || (a && (d == 'buffer' || d == 'byteLength' || d == 'byteOffset')) || isIndex(d, c)) ) && s.push(d) return s } function overArg$1(e, t) { return function (r) { return e(t(r)) } } var nativeKeys = overArg$1(Object.keys, Object), nativeKeys$1 = nativeKeys, objectProto$8 = Object.prototype, hasOwnProperty$7 = objectProto$8.hasOwnProperty function baseKeys(e) { if (!isPrototype(e)) return nativeKeys$1(e) var t = [] for (var r in Object(e)) hasOwnProperty$7.call(e, r) && r != 'constructor' && t.push(r) return t } function keys(e) { return isArrayLike(e) ? arrayLikeKeys(e) : baseKeys(e) } function nativeKeysIn(e) { var t = [] if (e != null) for (var r in Object(e)) t.push(r) return t } var objectProto$7 = Object.prototype, hasOwnProperty$6 = objectProto$7.hasOwnProperty function baseKeysIn(e) { if (!isObject$1(e)) return nativeKeysIn(e) var t = isPrototype(e), r = [] for (var o in e) (o == 'constructor' && (t || !hasOwnProperty$6.call(e, o))) || r.push(o) return r } function keysIn(e) { return isArrayLike(e) ? arrayLikeKeys(e, !0) : baseKeysIn(e) } var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, reIsPlainProp = /^\w*$/ function isKey(e, t) { if (isArray$6(e)) return !1 var r = typeof e return r == 'number' || r == 'symbol' || r == 'boolean' || e == null || isSymbol$1(e) ? !0 : reIsPlainProp.test(e) || !reIsDeepProp.test(e) || (t != null && e in Object(t)) } var nativeCreate = getNative(Object, 'create'), nativeCreate$1 = nativeCreate function hashClear() { ;(this.__data__ = nativeCreate$1 ? nativeCreate$1(null) : {}), (this.size = 0) } function hashDelete(e) { var t = this.has(e) && delete this.__data__[e] return (this.size -= t ? 1 : 0), t } var HASH_UNDEFINED$2 = '__lodash_hash_undefined__', objectProto$6 = Object.prototype, hasOwnProperty$5 = objectProto$6.hasOwnProperty function hashGet(e) { var t = this.__data__ if (nativeCreate$1) { var r = t[e] return r === HASH_UNDEFINED$2 ? void 0 : r } return hasOwnProperty$5.call(t, e) ? t[e] : void 0 } var objectProto$5 = Object.prototype, hasOwnProperty$4 = objectProto$5.hasOwnProperty function hashHas(e) { var t = this.__data__ return nativeCreate$1 ? t[e] !== void 0 : hasOwnProperty$4.call(t, e) } var HASH_UNDEFINED$1 = '__lodash_hash_undefined__' function hashSet(e, t) { var r = this.__data__ return ( (this.size += this.has(e) ? 0 : 1), (r[e] = nativeCreate$1 && t === void 0 ? HASH_UNDEFINED$1 : t), this ) } function Hash(e) { var t = -1, r = e == null ? 0 : e.length for (this.clear(); ++t < r; ) { var o = e[t] this.set(o[0], o[1]) } } Hash.prototype.clear = hashClear Hash.prototype.delete = hashDelete Hash.prototype.get = hashGet Hash.prototype.has = hashHas Hash.prototype.set = hashSet function listCacheClear() { ;(this.__data__ = []), (this.size = 0) } function assocIndexOf(e, t) { for (var r = e.length; r--; ) if (eq(e[r][0], t)) return r return -1 } var arrayProto = Array.prototype, splice = arrayProto.splice function listCacheDelete(e) { var t = this.__data__, r = assocIndexOf(t, e) if (r < 0) return !1 var o = t.length - 1 return r == o ? t.pop() : splice.call(t, r, 1), --this.size, !0 } function listCacheGet(e) { var t = this.__data__, r = assocIndexOf(t, e) return r < 0 ? void 0 : t[r][1] } function listCacheHas(e) { return assocIndexOf(this.__data__, e) > -1 } function listCacheSet(e, t) { var r = this.__data__, o = assocIndexOf(r, e) return o < 0 ? (++this.size, r.push([e, t])) : (r[o][1] = t), this } function ListCache(e) { var t = -1, r = e == null ? 0 : e.length for (this.clear(); ++t < r; ) { var o = e[t] this.set(o[0], o[1]) } } ListCache.prototype.clear = listCacheClear ListCache.prototype.delete = listCacheDelete ListCache.prototype.get = listCacheGet ListCache.prototype.has = listCacheHas ListCache.prototype.set = listCacheSet var Map$1 = getNative(root$1, 'Map'), Map$2 = Map$1 function mapCacheClear() { ;(this.size = 0), (this.__data__ = { hash: new Hash(), map: new (Map$2 || ListCache)(), string: new Hash() }) } function isKeyable(e) { var t = typeof e return t == 'string' || t == 'number' || t == 'symbol' || t == 'boolean' ? e !== '__proto__' : e === null } function getMapData(e, t) { var r = e.__data__ return isKeyable(t) ? r[typeof t == 'string' ? 'string' : 'hash'] : r.map } function mapCacheDelete(e) { var t = getMapData(this, e).delete(e) return (this.size -= t ? 1 : 0), t } function mapCacheGet(e) { return getMapData(this, e).get(e) } function mapCacheHas(e) { return getMapData(this, e).has(e) } function mapCacheSet(e, t) { var r = getMapData(this, e), o = r.size return r.set(e, t), (this.size += r.size == o ? 0 : 1), this } function MapCache$1(e) { var t = -1, r = e == null ? 0 : e.length for (this.clear(); ++t < r; ) { var o = e[t] this.set(o[0], o[1]) } } MapCache$1.prototype.clear = mapCacheClear MapCache$1.prototype.delete = mapCacheDelete MapCache$1.prototype.get = mapCacheGet MapCache$1.prototype.has = mapCacheHas MapCache$1.prototype.set = mapCacheSet var FUNC_ERROR_TEXT$2 = 'Expected a function' function memoize(e, t) { if (typeof e != 'function' || (t != null && typeof t != 'function')) throw new TypeError(FUNC_ERROR_TEXT$2) var r = function () { var o = arguments, n = t ? t.apply(this, o) : o[0], a = r.cache if (a.has(n)) return a.get(n) var l = e.apply(this, o) return (r.cache = a.set(n, l) || a), l } return (r.cache = new (memoize.Cache || MapCache$1)()), r } memoize.Cache = MapCache$1 var MAX_MEMOIZE_SIZE = 500 function memoizeCapped(e) { var t = memoize(e, function (o) { return r.size === MAX_MEMOIZE_SIZE && r.clear(), o }), r = t.cache return t } var rePropName$1 = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g, reEscapeChar$1 = /\\(\\)?/g, stringToPath$1 = memoizeCapped(function (e) { var t = [] return ( e.charCodeAt(0) === 46 && t.push(''), e.replace(rePropName$1, function (r, o, n, a) { t.push(n ? a.replace(reEscapeChar$1, '$1') : o || r) }), t ) }), stringToPath$2 = stringToPath$1 function toString$1(e) { return e == null ? '' : baseToString(e) } function castPath(e, t) { return isArray$6(e) ? e : isKey(e, t) ? [e] : stringToPath$2(toString$1(e)) } var INFINITY = 1 / 0 function toKey(e) { if (typeof e == 'string' || isSymbol$1(e)) return e var t = e + '' return t == '0' && 1 / e == -INFINITY ? '-0' : t } function baseGet(e, t) { t = castPath(t, e) for (var r = 0, o = t.length; e != null && r < o; ) e = e[toKey(t[r++])] return r && r == o ? e : void 0 } function get(e, t, r) { var o = e == null ? void 0 : baseGet(e, t) return o === void 0 ? r : o } function arrayPush(e, t) { for (var r = -1, o = t.length, n = e.length; ++r < o; ) e[n + r] = t[r] return e } var getPrototype$1 = overArg$1(Object.getPrototypeOf, Object), getPrototype$2 = getPrototype$1 function castArray() { if (!arguments.length) return [] var e = arguments[0] return isArray$6(e) ? e : [e] } function stackClear() { ;(this.__data__ = new ListCache()), (this.size = 0) } function stackDelete(e) { var t = this.__data__, r = t.delete(e) return (this.size = t.size), r } function stackGet(e) { return this.__data__.get(e) } function stackHas(e) { return this.__data__.has(e) } var LARGE_ARRAY_SIZE = 200 function stackSet(e, t) { var r = this.__data__ if (r instanceof ListCache) { var o = r.__data__ if (!Map$2 || o.length < LARGE_ARRAY_SIZE - 1) return o.push([e, t]), (this.size = ++r.size), this r = this.__data__ = new MapCache$1(o) } return r.set(e, t), (this.size = r.size), this } function Stack(e) { var t = (this.__data__ = new ListCache(e)) this.size = t.size } Stack.prototype.clear = stackClear Stack.prototype.delete = stackDelete Stack.prototype.get = stackGet Stack.prototype.has = stackHas Stack.prototype.set = stackSet function baseAssign(e, t) { return e && copyObject(t, keys(t), e) } function baseAssignIn(e, t) { return e && copyObject(t, keysIn(t), e) } var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports, freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module, moduleExports = freeModule && freeModule.exports === freeExports, Buffer = moduleExports ? root$1.Buffer : void 0, allocUnsafe = Buffer ? Buffer.allocUnsafe : void 0 function cloneBuffer(e, t) { if (t) return e.slice() var r = e.length, o = allocUnsafe ? allocUnsafe(r) : new e.constructor(r) return e.copy(o), o } function arrayFilter(e, t) { for (var r = -1, o = e == null ? 0 : e.length, n = 0, a = []; ++r < o; ) { var l = e[r] t(l, r, e) && (a[n++] = l) } return a } function stubArray() { return [] } var objectProto$4 = Object.prototype, propertyIsEnumerable = objectProto$4.propertyIsEnumerable, nativeGetSymbols$1 = Object.getOwnPropertySymbols, getSymbols = nativeGetSymbols$1 ? function (e) { return e == null ? [] : ((e = Object(e)), arrayFilter(nativeGetSymbols$1(e), function (t) { return propertyIsEnumerable.call(e, t) })) } : stubArray, getSymbols$1 = getSymbols function copySymbols(e, t) { return copyObject(e, getSymbols$1(e), t) } var nativeGetSymbols = Object.getOwnPropertySymbols, getSymbolsIn = nativeGetSymbols ? function (e) { for (var t = []; e; ) arrayPush(t, getSymbols$1(e)), (e = getPrototype$2(e)) return t } : stubArray, getSymbolsIn$1 = getSymbolsIn function copySymbolsIn(e, t) { return copyObject(e, getSymbolsIn$1(e), t) } function baseGetAllKeys(e, t, r) { var o = t(e) return isArray$6(e) ? o : arrayPush(o, r(e)) } function getAllKeys(e) { return baseGetAllKeys(e, keys, getSymbols$1) } function getAllKeysIn(e) { return baseGetAllKeys(e, keysIn, getSymbolsIn$1) } var DataView$1 = getNative(root$1, 'DataView'), DataView$2 = DataView$1, Promise$1 = getNative(root$1, 'Promise'), Promise$2 = Promise$1, Set$1 = getNative(root$1, 'Set'), Set$2 = Set$1, mapTag$4 = '[object Map]', objectTag$3 = '[object Object]', promiseTag = '[object Promise]', setTag$4 = '[object Set]', weakMapTag$1 = '[object WeakMap]', dataViewTag$3 = '[object DataView]', dataViewCtorString = toSource(DataView$2), mapCtorString = toSource(Map$2), promiseCtorString = toSource(Promise$2), setCtorString = toSource(Set$2), weakMapCtorString = toSource(WeakMap$2), getTag = baseGetTag ;((DataView$2 && getTag(new DataView$2(new ArrayBuffer(1))) != dataViewTag$3) || (Map$2 && getTag(new Map$2()) != mapTag$4) || (Promise$2 && getTag(Promise$2.resolve()) != promiseTag) || (Set$2 && getTag(new Set$2()) != setTag$4) || (WeakMap$2 && getTag(new WeakMap$2()) != weakMapTag$1)) && (getTag = function (e) { var t = baseGetTag(e), r = t == objectTag$3 ? e.constructor : void 0, o = r ? toSource(r) : '' if (o) switch (o) { case dataViewCtorString: return dataViewTag$3 case mapCtorString: return mapTag$4 case promiseCtorString: return promiseTag case setCtorString: return setTag$4 case weakMapCtorString: return weakMapTag$1 } return t }) var getTag$1 = getTag, objectProto$3 = Object.prototype, hasOwnProperty$3 = objectProto$3.hasOwnProperty function initCloneArray(e) { var t = e.length, r = new e.constructor(t) return ( t && typeof e[0] == 'string' && hasOwnProperty$3.call(e, 'index') && ((r.index = e.index), (r.input = e.input)), r ) } var Uint8Array$1 = root$1.Uint8Array, Uint8Array$2 = Uint8Array$1 function cloneArrayBuffer(e) { var t = new e.constructor(e.byteLength) return new Uint8Array$2(t).set(new Uint8Array$2(e)), t } function cloneDataView(e, t) { var r = t ? cloneArrayBuffer(e.buffer) : e.buffer return new e.constructor(r, e.byteOffset, e.byteLength) } var reFlags = /\w*$/ function cloneRegExp(e) { var t = new e.constructor(e.source, reFlags.exec(e)) return (t.lastIndex = e.lastIndex), t } var symbolProto$1 = Symbol$2 ? Symbol$2.prototype : void 0, symbolValueOf$1 = symbolProto$1 ? symbolProto$1.valueOf : void 0 function cloneSymbol(e) { return symbolValueOf$1 ? Object(symbolValueOf$1.call(e)) : {} } function cloneTypedArray(e, t) { var r = t ? cloneArrayBuffer(e.buffer) : e.buffer return new e.constructor(r, e.byteOffset, e.length) } var boolTag$2 = '[object Boolean]', dateTag$2 = '[object Date]', mapTag$3 = '[object Map]', numberTag$2 = '[object Number]', regexpTag$2 = '[object RegExp]', setTag$3 = '[object Set]', stringTag$2 = '[object String]', symbolTag$2 = '[object Symbol]', arrayBufferTag$2 = '[object ArrayBuffer]', dataViewTag$2 = '[object DataView]', float32Tag$1 = '[object Float32Array]', float64Tag$1 = '[object Float64Array]', int8Tag$1 = '[object Int8Array]', int16Tag$1 = '[object Int16Array]', int32Tag$1 = '[object Int32Array]', uint8Tag$1 = '[object Uint8Array]', uint8ClampedTag$1 = '[object Uint8ClampedArray]', uint16Tag$1 = '[object Uint16Array]', uint32Tag$1 = '[object Uint32Array]' function initCloneByTag(e, t, r) { var o = e.constructor switch (t) { case arrayBufferTag$2: return cloneArrayBuffer(e) case boolTag$2: case dateTag$2: return new o(+e) case dataViewTag$2: return cloneDataView(e, r) case float32Tag$1: case float64Tag$1: case int8Tag$1: case int16Tag$1: case int32Tag$1: case uint8Tag$1: case uint8ClampedTag$1: case uint16Tag$1: case uint32Tag$1: return cloneTypedArray(e, r) case mapTag$3: return new o() case numberTag$2: case stringTag$2: return new o(e) case regexpTag$2: return cloneRegExp(e) case setTag$3: return new o() case symbolTag$2: return cloneSymbol(e) } } function initCloneObject(e) { return typeof e.constructor == 'function' && !isPrototype(e) ? baseCreate$1(getPrototype$2(e)) : {} } var mapTag$2 = '[object Map]' function baseIsMap(e) { return isObjectLike$1(e) && getTag$1(e) == mapTag$2 } var nodeIsMap = nodeUtil$1 && nodeUtil$1.isMap, isMap$1 = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap, isMap$2 = isMap$1, setTag$2 = '[object Set]' function baseIsSet(e) { return isObjectLike$1(e) && getTag$1(e) == setTag$2 } var nodeIsSet = nodeUtil$1 && nodeUtil$1.isSet, isSet$1 = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet, isSet$2 = isSet$1, CLONE_DEEP_FLAG = 1, CLONE_FLAT_FLAG = 2, CLONE_SYMBOLS_FLAG$1 = 4, argsTag$1 = '[object Arguments]', arrayTag$1 = '[object Array]', boolTag$1 = '[object Boolean]', dateTag$1 = '[object Date]', errorTag$1 = '[object Error]', funcTag = '[object Function]', genTag = '[object GeneratorFunction]', mapTag$1 = '[object Map]', numberTag$1 = '[object Number]', objectTag$2 = '[object Object]', regexpTag$1 = '[object RegExp]', setTag$1 = '[object Set]', stringTag$1 = '[object String]', symbolTag$1 = '[object Symbol]', weakMapTag = '[object WeakMap]', arrayBufferTag$1 = '[object ArrayBuffer]', dataViewTag$1 = '[object DataView]', float32Tag = '[object Float32Array]', float64Tag = '[object Float64Array]', int8Tag = '[object Int8Array]', int16Tag = '[object Int16Array]', int32Tag = '[object Int32Array]', uint8Tag = '[object Uint8Array]', uint8ClampedTag = '[object Uint8ClampedArray]', uint16Tag = '[object Uint16Array]', uint32Tag = '[object Uint32Array]', cloneableTags = {} cloneableTags[argsTag$1] = cloneableTags[arrayTag$1] = cloneableTags[arrayBufferTag$1] = cloneableTags[dataViewTag$1] = cloneableTags[boolTag$1] = cloneableTags[dateTag$1] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag$1] = cloneableTags[numberTag$1] = cloneableTags[objectTag$2] = cloneableTags[regexpTag$1] = cloneableTags[setTag$1] = cloneableTags[stringTag$1] = cloneableTags[symbolTag$1] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = !0 cloneableTags[errorTag$1] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = !1 function baseClone(e, t, r, o, n, a) { var l, s = t & CLONE_DEEP_FLAG, c = t & CLONE_FLAT_FLAG, d = t & CLONE_SYMBOLS_FLAG$1 if ((r && (l = n ? r(e, o, n, a) : r(e)), l !== void 0)) return l if (!isObject$1(e)) return e var u = isArray$6(e) if (u) { if (((l = initCloneArray(e)), !s)) return copyArray(e, l) } else { var m = getTag$1(e), f = m == funcTag || m == genTag if (isBuffer$2(e)) return cloneBuffer(e, s) if (m == objectTag$2 || m == argsTag$1 || (f && !n)) { if (((l = c || f ? {} : initCloneObject(e)), !s)) return c ? copySymbolsIn(e, baseAssignIn(l, e)) : copySymbols(e, baseAssign(l, e)) } else { if (!cloneableTags[m]) return n ? e : {} l = initCloneByTag(e, m, s) } } a || (a = new Stack()) var _ = a.get(e) if (_) return _ a.set(e, l), isSet$2(e) ? e.forEach(function (k) { l.add(baseClone(k, t, r, k, e, a)) }) : isMap$2(e) && e.forEach(function (k, g) { l.set(g, baseClone(k, t, r, g, e, a)) }) var b = d ? (c ? getAllKeysIn : getAllKeys) : c ? keysIn : keys, v = u ? void 0 : b(e) return ( arrayEach(v || e, function (k, g) { v && ((g = k), (k = e[g])), assignValue(l, g, baseClone(k, t, r, g, e, a)) }), l ) } var CLONE_SYMBOLS_FLAG = 4 function clone(e) { return baseClone(e, CLONE_SYMBOLS_FLAG) } var HASH_UNDEFINED = '__lodash_hash_undefined__' function setCacheAdd(e) { return this.__data__.set(e, HASH_UNDEFINED), this } function setCacheHas(e) { return this.__data__.has(e) } function SetCache(e) { var t = -1, r = e == null ? 0 : e.length for (this.__data__ = new MapCache$1(); ++t < r; ) this.add(e[t]) } SetCache.prototype.add = SetCache.prototype.push = setCacheAdd SetCache.prototype.has = setCacheHas function arraySome(e, t) { for (var r = -1, o = e == null ? 0 : e.length; ++r < o; ) if (t(e[r], r, e)) return !0 return !1 } function cacheHas(e, t) { return e.has(t) } var COMPARE_PARTIAL_FLAG$3 = 1, COMPARE_UNORDERED_FLAG$1 = 2 function equalArrays(e, t, r, o, n, a) { var l = r & COMPARE_PARTIAL_FLAG$3, s = e.length, c = t.length if (s != c && !(l && c > s)) return !1 var d = a.get(e), u = a.get(t) if (d && u) return d == t && u == e var m = -1, f = !0, _ = r & COMPARE_UNORDERED_FLAG$1 ? new SetCache() : void 0 for (a.set(e, t), a.set(t, e); ++m < s; ) { var b = e[m], v = t[m] if (o) var k = l ? o(v, b, m, t, e, a) : o(b, v, m, e, t, a) if (k !== void 0) { if (k) continue f = !1 break } if (_) { if ( !arraySome(t, function (g, x) { if (!cacheHas(_, x) && (b === g || n(b, g, r, o, a))) return _.push(x) }) ) { f = !1 break } } else if (!(b === v || n(b, v, r, o, a))) { f = !1 break } } return a.delete(e), a.delete(t), f } function mapToArray(e) { var t = -1, r = Array(e.size) return ( e.forEach(function (o, n) { r[++t] = [n, o] }), r ) } function setToArray(e) { var t = -1, r = Array(e.size) return ( e.forEach(function (o) { r[++t] = o }), r ) } var COMPARE_PARTIAL_FLAG$2 = 1, COMPARE_UNORDERED_FLAG = 2, boolTag = '[object Boolean]', dateTag = '[object Date]', errorTag = '[object Error]', mapTag = '[object Map]', numberTag = '[object Number]', regexpTag = '[object RegExp]', setTag = '[object Set]', stringTag = '[object String]', symbolTag = '[object Symbol]', arrayBufferTag = '[object ArrayBuffer]', dataViewTag = '[object DataView]', symbolProto = Symbol$2 ? Symbol$2.prototype : void 0, symbolValueOf = symbolProto ? symbolProto.valueOf : void 0 function equalByTag(e, t, r, o, n, a, l) { switch (r) { case dataViewTag: if (e.byteLength != t.byteLength || e.byteOffset != t.byteOffset) return !1 ;(e = e.buffer), (t = t.buffer) case arrayBufferTag: return !( e.byteLength != t.byteLength || !a(new Uint8Array$2(e), new Uint8Array$2(t)) ) case boolTag: case dateTag: case numberTag: return eq(+e, +t) case errorTag: return e.name == t.name && e.message == t.message case regexpTag: case stringTag: return e == t + '' case mapTag: var s = mapToArray case setTag: var c = o & COMPARE_PARTIAL_FLAG$2 if ((s || (s = setToArray), e.size != t.size && !c)) return !1 var d = l.get(e) if (d) return d == t ;(o |= COMPARE_UNORDERED_FLAG), l.set(e, t) var u = equalArrays(s(e), s(t), o, n, a, l) return l.delete(e), u case symbolTag: if (symbolValueOf) return symbolValueOf.call(e) == symbolValueOf.call(t) } return !1 } var COMPARE_PARTIAL_FLAG$1 = 1, objectProto$2 = Object.prototype, hasOwnProperty$2 = objectProto$2.hasOwnProperty function equalObjects(e, t, r, o, n, a) { var l = r & COMPARE_PARTIAL_FLAG$1, s = getAllKeys(e), c = s.length, d = getAllKeys(t), u = d.length if (c != u && !l) return !1 for (var m = c; m--; ) { var f = s[m] if (!(l ? f in t : hasOwnProperty$2.call(t, f))) return !1 } var _ = a.get(e), b = a.get(t) if (_ && b) return _ == t && b == e var v = !0 a.set(e, t), a.set(t, e) for (var k = l; ++m < c; ) { f = s[m] var g = e[f], x = t[f] if (o) var y = l ? o(x, g, f, t, e, a) : o(g, x, f, e, t, a) if (!(y === void 0 ? g === x || n(g, x, r, o, a) : y)) { v = !1 break } k || (k = f == 'constructor') } if (v && !k) { var w = e.constructor, S = t.constructor w != S && 'constructor' in e && 'constructor' in t && !( typeof w == 'function' && w instanceof w && typeof S == 'function' && S instanceof S ) && (v = !1) } return a.delete(e), a.delete(t), v } var COMPARE_PARTIAL_FLAG = 1, argsTag = '[object Arguments]', arrayTag = '[object Array]', objectTag$1 = '[object Object]', objectProto$1 = Object.prototype, hasOwnProperty$1 = objectProto$1.hasOwnProperty function baseIsEqualDeep(e, t, r, o, n, a) { var l = isArray$6(e), s = isArray$6(t), c = l ? arrayTag : getTag$1(e), d = s ? arrayTag : getTag$1(t) ;(c = c == argsTag ? objectTag$1 : c), (d = d == argsTag ? objectTag$1 : d) var u = c == objectTag$1, m = d == objectTag$1, f = c == d if (f && isBuffer$2(e)) { if (!isBuffer$2(t)) return !1 ;(l = !0), (u = !1) } if (f && !u) return ( a || (a = new Stack()), l || isTypedArray$1(e) ? equalArrays(e, t, r, o, n, a) : equalByTag(e, t, c, r, o, n, a) ) if (!(r & COMPARE_PARTIAL_FLAG)) { var _ = u && hasOwnProperty$1.call(e, '__wrapped__'), b = m && hasOwnProperty$1.call(t, '__wrapped__') if (_ || b) { var v = _ ? e.value() : e, k = b ? t.value() : t return a || (a = new Stack()), n(v, k, r, o, a) } } return f ? (a || (a = new Stack()), equalObjects(e, t, r, o, n, a)) : !1 } function baseIsEqual(e, t, r, o, n) { return e === t ? !0 : e == null || t == null || (!isObjectLike$1(e) && !isObjectLike$1(t)) ? e !== e && t !== t : baseIsEqualDeep(e, t, r, o, baseIsEqual, n) } var now = function () { return root$1.Date.now() }, now$1 = now, FUNC_ERROR_TEXT$1 = 'Expected a function', nativeMax = Math.max, nativeMin = Math.min function debounce(e, t, r) { var o, n, a, l, s, c, d = 0, u = !1, m = !1, f = !0 if (typeof e != 'function') throw new TypeError(FUNC_ERROR_TEXT$1) ;(t = toNumber(t) || 0), isObject$1(r) && ((u = !!r.leading), (m = 'maxWait' in r), (a = m ? nativeMax(toNumber(r.maxWait) || 0, t) : a), (f = 'trailing' in r ? !!r.trailing : f)) function _(T) { var A = o, $ = n return (o = n = void 0), (d = T), (l = e.apply($, A)), l } function b(T) { return (d = T), (s = setTimeout(g, t)), u ? _(T) : l } function v(T) { var A = T - c, $ = T - d, F = t - A return m ? nativeMin(F, a - $) : F } function k(T) { var A = T - c, $ = T - d return c === void 0 || A >= t || A < 0 || (m && $ >= a) } function g() { var T = now$1() if (k(T)) return x(T) s = setTimeout(g, v(T)) } function x(T) { return (s = void 0), f && o ? _(T) : ((o = n = void 0), l) } function y() { s !== void 0 && clearTimeout(s), (d = 0), (o = c = n = s = void 0) } function w() { return s === void 0 ? l : x(now$1()) } function S() { var T = now$1(), A = k(T) if (((o = arguments), (n = this), (c = T), A)) { if (s === void 0) return b(c) if (m) return clearTimeout(s), (s = setTimeout(g, t)), _(c) } return s === void 0 && (s = setTimeout(g, t)), l } return (S.cancel = y), (S.flush = w), S } function fromPairs(e) { for (var t = -1, r = e == null ? 0 : e.length, o = {}; ++t < r; ) { var n = e[t] o[n[0]] = n[1] } return o } function isEqual(e, t) { return baseIsEqual(e, t) } function isNil(e) { return e == null } function baseSet(e, t, r, o) { if (!isObject$1(e)) return e t = castPath(t, e) for (var n = -1, a = t.length, l = a - 1, s = e; s != null && ++n < a; ) { var c = toKey(t[n]), d = r if (c === '__proto__' || c === 'constructor' || c === 'prototype') return e if (n != l) { var u = s[c] ;(d = o ? o(u, c, s) : void 0), d === void 0 && (d = isObject$1(u) ? u : isIndex(t[n + 1]) ? [] : {}) } assignValue(s, c, d), (s = s[c]) } return e } function set(e, t, r) { return e == null ? e : baseSet(e, t, r) } var FUNC_ERROR_TEXT = 'Expected a function' function throttle(e, t, r) { var o = !0, n = !0 if (typeof e != 'function') throw new TypeError(FUNC_ERROR_TEXT) return ( isObject$1(r) && ((o = 'leading' in r ? !!r.leading : o), (n = 'trailing' in r ? !!r.trailing : n)), debounce(e, t, { leading: o, maxWait: t, trailing: n }) ) } const FOCUSABLE_ELEMENT_SELECTORS = 'a[href],button:not([disabled]),button:not([hidden]),:not([tabindex="-1"]),input:not([disabled]),input:not([type="hidden"]),select:not([disabled]),textarea:not([disabled])', isVisible = e => getComputedStyle(e).position === 'fixed' ? !1 : e.offsetParent !== null, obtainAllFocusableElements$1 = e => Array.from(e.querySelectorAll(FOCUSABLE_ELEMENT_SELECTORS)).filter( t => isFocusable(t) && isVisible(t) ), isFocusable = e => { if ( e.tabIndex > 0 || (e.tabIndex === 0 && e.getAttribute('tabIndex') !== null) ) return !0 if (e.disabled) return !1 switch (e.nodeName) { case 'A': return !!e.href && e.rel !== 'ignore' case 'INPUT': return !(e.type === 'hidden' || e.type === 'file') case 'BUTTON': case 'SELECT': case 'TEXTAREA': return !0 default: return !1 } }, on$1 = (e, t, r, o = !1) => { e && t && r && (e == null || e.addEventListener(t, r, o)) }, off = (e, t, r, o = !1) => { e && t && r && (e == null || e.removeEventListener(t, r, o)) }, once = (e, t, r) => { const o = function (...n) { r && r.apply(this, n), off(e, t, o) } on$1(e, t, o) }, composeEventHandlers = (e, t, { checkForDefaultPrevented: r = !0 } = {}) => n => { const a = e == null ? void 0 : e(n) if (r === !1 || !a) return t == null ? void 0 : t(n) }, whenMouse = e => t => t.pointerType === 'mouse' ? e(t) : void 0 var __defProp$8 = Object.defineProperty, __defProps$5 = Object.defineProperties, __getOwnPropDescs$5 = Object.getOwnPropertyDescriptors, __getOwnPropSymbols$a = Object.getOwnPropertySymbols, __hasOwnProp$a = Object.prototype.hasOwnProperty, __propIsEnum$a = Object.prototype.propertyIsEnumerable, __defNormalProp$8 = (e, t, r) => t in e ? __defProp$8(e, t, { enumerable: !0, configurable: !0, writable: !0, value: r }) : (e[t] = r), __spreadValues$8 = (e, t) => { for (var r in t || (t = {})) __hasOwnProp$a.call(t, r) && __defNormalProp$8(e, r, t[r]) if (__getOwnPropSymbols$a) for (var r of __getOwnPropSymbols$a(t)) __propIsEnum$a.call(t, r) && __defNormalProp$8(e, r, t[r]) return e }, __spreadProps$5 = (e, t) => __defProps$5(e, __getOwnPropDescs$5(t)) function computedEager(e, t) { var r const o = shallowRef() return ( watchEffect(() => { o.value = e() }, __spreadProps$5(__spreadValues$8({}, t), { flush: (r = t == null ? void 0 : t.flush) != null ? r : 'sync' })), readonly(o) ) } function tryOnScopeDispose(e) { return getCurrentScope() ? (onScopeDispose(e), !0) : !1 } var _a const isClient = typeof window != 'undefined', isBoolean$1 = e => typeof e == 'boolean', isNumber$1 = e => typeof e == 'number', isString$1 = e => typeof e == 'string', noop$1 = () => {} isClient && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent) function createFilterWrapper(e, t) { function r(...o) { e(() => t.apply(this, o), { fn: t, thisArg: this, args: o }) } return r } function debounceFilter(e, t = {}) { let r, o return a => { const l = unref(e), s = unref(t.maxWait) if ((r && clearTimeout(r), l <= 0 || (s !== void 0 && s <= 0))) return o && (clearTimeout(o), (o = null)), a() s && !o && (o = setTimeout(() => { r && clearTimeout(r), (o = null), a() }, s)), (r = setTimeout(() => { o && clearTimeout(o), (o = null), a() }, l)) } } function throttleFilter(e, t = !0, r = !0) { let o = 0, n, a = !0 const l = () => { n && (clearTimeout(n), (n = void 0)) } return c => { const d = unref(e), u = Date.now() - o if ((l(), d <= 0)) return (o = Date.now()), c() u > d && (r || !a) ? ((o = Date.now()), c()) : t && (n = setTimeout(() => { ;(o = Date.now()), (a = !0), l(), c() }, d)), !r && !n && (n = setTimeout(() => (a = !0), d)), (a = !1) } } function useDebounceFn(e, t = 200, r = {}) { return createFilterWrapper(debounceFilter(t, r), e) } function refDebounced(e, t = 200, r = {}) { if (t <= 0) return e const o = ref(e.value), n = useDebounceFn( () => { o.value = e.value }, t, r ) return watch(e, () => n()), o } function useThrottleFn(e, t = 200, r = !0, o = !0) { return createFilterWrapper(throttleFilter(t, r, o), e) } function useTimeoutFn(e, t, r = {}) { const { immediate: o = !0 } = r, n = ref(!1) let a = null function l() { a && (clearTimeout(a), (a = null)) } function s() { ;(n.value = !1), l() } function c(...d) { l(), (n.value = !0), (a = setTimeout(() => { ;(n.value = !1), (a = null), e(...d) }, unref(t))) } return ( o && ((n.value = !0), isClient && c()), tryOnScopeDispose(s), { isPending: n, start: c, stop: s } ) } function unrefElement(e) { var t const r = unref(e) return (t = r == null ? void 0 : r.$el) != null ? t : r } const defaultWindow = isClient ? window : void 0, defaultDocument = isClient ? window.document : void 0 function useEventListener(...e) { let t, r, o, n if ( (isString$1(e[0]) ? (([r, o, n] = e), (t = defaultWindow)) : ([t, r, o, n] = e), !t) ) return noop$1 let a = noop$1 const l = watch( () => unrefElement(t), c => { a(), c && (c.addEventListener(r, o, n), (a = () => { c.removeEventListener(r, o, n), (a = noop$1) })) }, { immediate: !0, flush: 'post' } ), s = () => { l(), a() } return tryOnScopeDispose(s), s } function onClickOutside(e, t, r = {}) { const { window: o = defaultWindow, ignore: n, capture: a = !0 } = r if (!o) return const l = ref(!0) let s const c = m => { o.clearTimeout(s) const f = unrefElement(e), _ = m.composedPath() !f || f === m.target || _.includes(f) || !l.value || (n && n.length > 0 && n.some(b => { const v = unrefElement(b) return v && (m.target === v || _.includes(v)) })) || t(m) }, d = [ useEventListener(o, 'click', c, { passive: !0, capture: a }), useEventListener( o, 'pointerdown', m => { const f = unrefElement(e) l.value = !!f && !m.composedPath().includes(f) }, { passive: !0 } ), useEventListener( o, 'pointerup', m => { s = o.setTimeout(() => c(m), 50) }, { passive: !0 } ) ] return () => d.forEach(m => m()) } const _global = typeof globalThis != 'undefined' ? globalThis : typeof window != 'undefined' ? window : typeof global != 'undefined' ? global : typeof self != 'undefined' ? self : {}, globalKey = '__vueuse_ssr_handlers__' _global[globalKey] = _global[globalKey] || {} _global[globalKey] function useDocumentVisibility({ document: e = defaultDocument } = {}) { if (!e) return ref('visible') const t = ref(e.visibilityState) return ( useEventListener(e, 'visibilitychange', () => { t.value = e.visibilityState }), t ) } var __getOwnPropSymbols$c = Object.getOwnPropertySymbols, __hasOwnProp$c = Object.prototype.hasOwnProperty, __propIsEnum$c = Object.prototype.propertyIsEnumerable, __objRest$2 = (e, t) => { var r = {} for (var o in e) __hasOwnProp$c.call(e, o) && t.indexOf(o) < 0 && (r[o] = e[o]) if (e != null && __getOwnPropSymbols$c) for (var o of __getOwnPropSymbols$c(e)) t.indexOf(o) < 0 && __propIsEnum$c.call(e, o) && (r[o] = e[o]) return r } function useResizeObserver(e, t, r = {}) { const o = r, { window: n = defaultWindow } = o, a = __objRest$2(o, ['window']) let l const s = n && 'ResizeObserver' in n, c = () => { l && (l.disconnect(), (l = void 0)) }, d = watch( () => unrefElement(e), m => { c(), s && n && m && ((l = new ResizeObserver(t)), l.observe(m, a)) }, { immediate: !0, flush: 'post' } ), u = () => { c(), d() } return tryOnScopeDispose(u), { isSupported: s, stop: u } } var SwipeDirection ;(function (e) { ;(e.UP = 'UP'), (e.RIGHT = 'RIGHT'), (e.DOWN = 'DOWN'), (e.LEFT = 'LEFT'), (e.NONE = 'NONE') })(SwipeDirection || (SwipeDirection = {})) function useWindowFocus({ window: e = defaultWindow } = {}) { if (!e) return ref(!1) const t = ref(e.document.hasFocus()) return ( useEventListener(e, 'blur', () => { t.value = !1 }), useEventListener(e, 'focus', () => { t.value = !0 }), t ) } const isInContainer = (e, t) => { if (!isClient || !e || !t) return !1 const r = e.getBoundingClientRect() let o return ( t instanceof Element ? (o = t.getBoundingClientRect()) : (o = { top: 0, right: window.innerWidth, bottom: window.innerHeight, left: 0 }), r.top < o.bottom && r.bottom > o.top && r.right > o.left && r.left < o.right ) }, isUndefined = e => e === void 0, isEmpty$1 = e => (!e && e !== 0) || (isArray$7(e) && e.length === 0) || (isObject$2(e) && !Object.keys(e).length), isElement$1 = e => typeof Element == 'undefined' ? !1 : e instanceof Element, keysOf = e => Object.keys(e), entriesOf = e => Object.entries(e), getProp = (e, t, r) => ({ get value() { return get(e, t, r) }, set value(o) { set(e, t, o) } }) class ElementPlusError extends Error { constructor(t) { super(t), (this.name = 'ElementPlusError') } } function throwError(e, t) { throw new ElementPlusError(`[${e}] ${t}`) } function debugWarn(e, t) {} const classNameToArray = (e = '') => e.split(' ').filter(t => !!t.trim()), hasClass = (e, t) => { if (!e || !t) return !1 if (t.includes(' ')) throw new Error('className should not contain space.') return e.classList.contains(t) }, addClass = (e, t) => { !e || !t.trim() || e.classList.add(...classNameToArray(t)) }, removeClass = (e, t) => { !e || !t.trim() || e.classList.remove(...classNameToArray(t)) }, getStyle = (e, t) => { var r if (!isClient || !e || !t) return '' let o = camelize(t) o === 'float' && (o = 'cssFloat') try { const n = e.style[o] if (n) return n const a = (r = document.defaultView) == null ? void 0 : r.getComputedStyle(e, '') return a ? a[o] : '' } catch { return e.style[o] } } function addUnit(e, t = 'px') { if (!e) return '' if (isString$2(e)) return e if (isNumber$1(e)) return `${e}${t}` } const isScroll = (e, t) => { if (!isClient) return !1 const r = { undefined: 'overflow', true: 'overflow-y', false: 'overflow-x' }[String(t)], o = getStyle(e, r) return ['scroll', 'auto', 'overlay'].some(n => o.includes(n)) }, getScrollContainer = (e, t) => { if (!isClient) return let r = e for (; r; ) { if ([window, document, document.documentElement].includes(r)) return window if (isScroll(r, t)) return r r = r.parentNode } return r } let scrollBarWidth const getScrollBarWidth = () => { var e if (!isClient) return 0 if (scrollBarWidth !== void 0) return scrollBarWidth const t = document.createElement('div') ;(t.className = 'el-scrollbar__wrap'), (t.style.visibility = 'hidden'), (t.style.width = '100px'), (t.style.position = 'absolute'), (t.style.top = '-9999px'), document.body.appendChild(t) const r = t.offsetWidth t.style.overflow = 'scroll' const o = document.createElement('div') ;(o.style.width = '100%'), t.appendChild(o) const n = o.offsetWidth return ( (e = t.parentNode) == null || e.removeChild(t), (scrollBarWidth = r - n), scrollBarWidth ) } function scrollIntoView(e, t) { if (!isClient) return if (!t) { e.scrollTop = 0 return } const r = [] let o = t.offsetParent for (; o !== null && e !== o && e.contains(o); ) r.push(o), (o = o.offsetParent) const n = t.offsetTop + r.reduce((c, d) => c + d.offsetTop, 0), a = n + t.offsetHeight, l = e.scrollTop, s = l + e.clientHeight n < l ? (e.scrollTop = n) : a > s && (e.scrollTop = a - e.clientHeight) } /*! Element Plus Icons Vue v2.0.5 */ var export_helper_default = (e, t) => { let r = e.__vccOpts || e for (let [o, n] of t) r[o] = n return r }, _sfc_main$E = { name: 'AddLocation' }, _hoisted_1$g = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2$6 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 896h448q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_3$2 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M800 416a288 288 0 1 0-576 0c0 118.144 94.528 272.128 288 456.576C705.472 688.128 800 534.144 800 416zM512 960C277.312 746.688 160 565.312 160 416a352 352 0 0 1 704 0c0 149.312-117.312 330.688-352 544z' }, null, -1 ), _hoisted_4 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 384h96a32 32 0 1 1 0 64h-96v96a32 32 0 0 1-64 0v-96h-96a32 32 0 0 1 0-64h96v-96a32 32 0 0 1 64 0v96z' }, null, -1 ), _hoisted_5 = [_hoisted_2$6, _hoisted_3$2, _hoisted_4] function _sfc_render$h(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1$g, _hoisted_5) } var add_location_default = export_helper_default(_sfc_main$E, [ ['render', _sfc_render$h], ['__file', 'add-location.vue'] ]), _sfc_main2 = { name: 'Aim' }, _hoisted_12 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_22 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_32 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 96a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V128a32 32 0 0 1 32-32zm0 576a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V704a32 32 0 0 1 32-32zM96 512a32 32 0 0 1 32-32h192a32 32 0 0 1 0 64H128a32 32 0 0 1-32-32zm576 0a32 32 0 0 1 32-32h192a32 32 0 1 1 0 64H704a32 32 0 0 1-32-32z' }, null, -1 ), _hoisted_42 = [_hoisted_22, _hoisted_32] function _sfc_render2(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_12, _hoisted_42) } var aim_default = export_helper_default(_sfc_main2, [ ['render', _sfc_render2], ['__file', 'aim.vue'] ]), _sfc_main3 = { name: 'AlarmClock' }, _hoisted_13 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_23 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 832a320 320 0 1 0 0-640 320 320 0 0 0 0 640zm0 64a384 384 0 1 1 0-768 384 384 0 0 1 0 768z' }, null, -1 ), _hoisted_33 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm292.288 824.576 55.424 32-48 83.136a32 32 0 1 1-55.424-32l48-83.136zm439.424 0-55.424 32 48 83.136a32 32 0 1 0 55.424-32l-48-83.136zM512 512h160a32 32 0 1 1 0 64H480a32 32 0 0 1-32-32V320a32 32 0 0 1 64 0v192zM90.496 312.256A160 160 0 0 1 312.32 90.496l-46.848 46.848a96 96 0 0 0-128 128L90.56 312.256zm835.264 0A160 160 0 0 0 704 90.496l46.848 46.848a96 96 0 0 1 128 128l46.912 46.912z' }, null, -1 ), _hoisted_43 = [_hoisted_23, _hoisted_33] function _sfc_render3(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_13, _hoisted_43) } var alarm_clock_default = export_helper_default(_sfc_main3, [ ['render', _sfc_render3], ['__file', 'alarm-clock.vue'] ]), _sfc_main4 = { name: 'Apple' }, _hoisted_14 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_24 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M599.872 203.776a189.44 189.44 0 0 1 64.384-4.672l2.624.128c31.168 1.024 51.2 4.096 79.488 16.32 37.632 16.128 74.496 45.056 111.488 89.344 96.384 115.264 82.752 372.8-34.752 521.728-7.68 9.728-32 41.6-30.72 39.936a426.624 426.624 0 0 1-30.08 35.776c-31.232 32.576-65.28 49.216-110.08 50.048-31.36.64-53.568-5.312-84.288-18.752l-6.528-2.88c-20.992-9.216-30.592-11.904-47.296-11.904-18.112 0-28.608 2.88-51.136 12.672l-6.464 2.816c-28.416 12.224-48.32 18.048-76.16 19.2-74.112 2.752-116.928-38.08-180.672-132.16-96.64-142.08-132.608-349.312-55.04-486.4 46.272-81.92 129.92-133.632 220.672-135.04 32.832-.576 60.288 6.848 99.648 22.72 27.136 10.88 34.752 13.76 37.376 14.272 16.256-20.16 27.776-36.992 34.56-50.24 13.568-26.304 27.2-59.968 40.704-100.8a32 32 0 1 1 60.8 20.224c-12.608 37.888-25.408 70.4-38.528 97.664zm-51.52 78.08c-14.528 17.792-31.808 37.376-51.904 58.816a32 32 0 1 1-46.72-43.776l12.288-13.248c-28.032-11.2-61.248-26.688-95.68-26.112-70.4 1.088-135.296 41.6-171.648 105.792C121.6 492.608 176 684.16 247.296 788.992c34.816 51.328 76.352 108.992 130.944 106.944 52.48-2.112 72.32-34.688 135.872-34.688 63.552 0 81.28 34.688 136.96 33.536 56.448-1.088 75.776-39.04 126.848-103.872 107.904-136.768 107.904-362.752 35.776-449.088-72.192-86.272-124.672-84.096-151.68-85.12-41.472-4.288-81.6 12.544-113.664 25.152z' }, null, -1 ), _hoisted_34 = [_hoisted_24] function _sfc_render4(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_14, _hoisted_34) } var apple_default = export_helper_default(_sfc_main4, [ ['render', _sfc_render4], ['__file', 'apple.vue'] ]), _sfc_main5 = { name: 'ArrowDownBold' }, _hoisted_15 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_25 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M104.704 338.752a64 64 0 0 1 90.496 0l316.8 316.8 316.8-316.8a64 64 0 0 1 90.496 90.496L557.248 791.296a64 64 0 0 1-90.496 0L104.704 429.248a64 64 0 0 1 0-90.496z' }, null, -1 ), _hoisted_35 = [_hoisted_25] function _sfc_render5(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_15, _hoisted_35) } var arrow_down_bold_default = export_helper_default(_sfc_main5, [ ['render', _sfc_render5], ['__file', 'arrow-down-bold.vue'] ]), _sfc_main6 = { name: 'ArrowDown' }, _hoisted_16 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_26 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M831.872 340.864 512 652.672 192.128 340.864a30.592 30.592 0 0 0-42.752 0 29.12 29.12 0 0 0 0 41.6L489.664 714.24a32 32 0 0 0 44.672 0l340.288-331.712a29.12 29.12 0 0 0 0-41.728 30.592 30.592 0 0 0-42.752 0z' }, null, -1 ), _hoisted_36 = [_hoisted_26] function _sfc_render6(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_16, _hoisted_36) } var arrow_down_default = export_helper_default(_sfc_main6, [ ['render', _sfc_render6], ['__file', 'arrow-down.vue'] ]), _sfc_main7 = { name: 'ArrowLeftBold' }, _hoisted_17 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_27 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M685.248 104.704a64 64 0 0 1 0 90.496L368.448 512l316.8 316.8a64 64 0 0 1-90.496 90.496L232.704 557.248a64 64 0 0 1 0-90.496l362.048-362.048a64 64 0 0 1 90.496 0z' }, null, -1 ), _hoisted_37 = [_hoisted_27] function _sfc_render7(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_17, _hoisted_37) } var arrow_left_bold_default = export_helper_default(_sfc_main7, [ ['render', _sfc_render7], ['__file', 'arrow-left-bold.vue'] ]), _sfc_main8 = { name: 'ArrowLeft' }, _hoisted_18 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_28 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M609.408 149.376 277.76 489.6a32 32 0 0 0 0 44.672l331.648 340.352a29.12 29.12 0 0 0 41.728 0 30.592 30.592 0 0 0 0-42.752L339.264 511.936l311.872-319.872a30.592 30.592 0 0 0 0-42.688 29.12 29.12 0 0 0-41.728 0z' }, null, -1 ), _hoisted_38 = [_hoisted_28] function _sfc_render8(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_18, _hoisted_38) } var arrow_left_default = export_helper_default(_sfc_main8, [ ['render', _sfc_render8], ['__file', 'arrow-left.vue'] ]), _sfc_main9 = { name: 'ArrowRightBold' }, _hoisted_19 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_29 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M338.752 104.704a64 64 0 0 0 0 90.496l316.8 316.8-316.8 316.8a64 64 0 0 0 90.496 90.496l362.048-362.048a64 64 0 0 0 0-90.496L429.248 104.704a64 64 0 0 0-90.496 0z' }, null, -1 ), _hoisted_39 = [_hoisted_29] function _sfc_render9(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_19, _hoisted_39) } var arrow_right_bold_default = export_helper_default(_sfc_main9, [ ['render', _sfc_render9], ['__file', 'arrow-right-bold.vue'] ]), _sfc_main10 = { name: 'ArrowRight' }, _hoisted_110 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_210 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M340.864 149.312a30.592 30.592 0 0 0 0 42.752L652.736 512 340.864 831.872a30.592 30.592 0 0 0 0 42.752 29.12 29.12 0 0 0 41.728 0L714.24 534.336a32 32 0 0 0 0-44.672L382.592 149.376a29.12 29.12 0 0 0-41.728 0z' }, null, -1 ), _hoisted_310 = [_hoisted_210] function _sfc_render10(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_110, _hoisted_310) } var arrow_right_default = export_helper_default(_sfc_main10, [ ['render', _sfc_render10], ['__file', 'arrow-right.vue'] ]), _sfc_main11 = { name: 'ArrowUpBold' }, _hoisted_111 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_211 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M104.704 685.248a64 64 0 0 0 90.496 0l316.8-316.8 316.8 316.8a64 64 0 0 0 90.496-90.496L557.248 232.704a64 64 0 0 0-90.496 0L104.704 594.752a64 64 0 0 0 0 90.496z' }, null, -1 ), _hoisted_311 = [_hoisted_211] function _sfc_render11(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_111, _hoisted_311) } var arrow_up_bold_default = export_helper_default(_sfc_main11, [ ['render', _sfc_render11], ['__file', 'arrow-up-bold.vue'] ]), _sfc_main12 = { name: 'ArrowUp' }, _hoisted_112 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_212 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm488.832 344.32-339.84 356.672a32 32 0 0 0 0 44.16l.384.384a29.44 29.44 0 0 0 42.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0 0 42.688 0l.384-.384a32 32 0 0 0 0-44.16L535.168 344.32a32 32 0 0 0-46.336 0z' }, null, -1 ), _hoisted_312 = [_hoisted_212] function _sfc_render12(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_112, _hoisted_312) } var arrow_up_default = export_helper_default(_sfc_main12, [ ['render', _sfc_render12], ['__file', 'arrow-up.vue'] ]), _sfc_main13 = { name: 'Avatar' }, _hoisted_113 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_213 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M628.736 528.896A416 416 0 0 1 928 928H96a415.872 415.872 0 0 1 299.264-399.104L512 704l116.736-175.104zM720 304a208 208 0 1 1-416 0 208 208 0 0 1 416 0z' }, null, -1 ), _hoisted_313 = [_hoisted_213] function _sfc_render13(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_113, _hoisted_313) } var avatar_default = export_helper_default(_sfc_main13, [ ['render', _sfc_render13], ['__file', 'avatar.vue'] ]), _sfc_main14 = { name: 'Back' }, _hoisted_114 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_214 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 480h640a32 32 0 1 1 0 64H224a32 32 0 0 1 0-64z' }, null, -1 ), _hoisted_314 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm237.248 512 265.408 265.344a32 32 0 0 1-45.312 45.312l-288-288a32 32 0 0 1 0-45.312l288-288a32 32 0 1 1 45.312 45.312L237.248 512z' }, null, -1 ), _hoisted_44 = [_hoisted_214, _hoisted_314] function _sfc_render14(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_114, _hoisted_44) } var back_default = export_helper_default(_sfc_main14, [ ['render', _sfc_render14], ['__file', 'back.vue'] ]), _sfc_main15 = { name: 'Baseball' }, _hoisted_115 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_215 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M195.2 828.8a448 448 0 1 1 633.6-633.6 448 448 0 0 1-633.6 633.6zm45.248-45.248a384 384 0 1 0 543.104-543.104 384 384 0 0 0-543.104 543.104z' }, null, -1 ), _hoisted_315 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M497.472 96.896c22.784 4.672 44.416 9.472 64.896 14.528a256.128 256.128 0 0 0 350.208 350.208c5.056 20.48 9.856 42.112 14.528 64.896A320.128 320.128 0 0 1 497.472 96.896zM108.48 491.904a320.128 320.128 0 0 1 423.616 423.68c-23.04-3.648-44.992-7.424-65.728-11.52a256.128 256.128 0 0 0-346.496-346.432 1736.64 1736.64 0 0 1-11.392-65.728z' }, null, -1 ), _hoisted_45 = [_hoisted_215, _hoisted_315] function _sfc_render15(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_115, _hoisted_45) } var baseball_default = export_helper_default(_sfc_main15, [ ['render', _sfc_render15], ['__file', 'baseball.vue'] ]), _sfc_main16 = { name: 'Basketball' }, _hoisted_116 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_216 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M778.752 788.224a382.464 382.464 0 0 0 116.032-245.632 256.512 256.512 0 0 0-241.728-13.952 762.88 762.88 0 0 1 125.696 259.584zm-55.04 44.224a699.648 699.648 0 0 0-125.056-269.632 256.128 256.128 0 0 0-56.064 331.968 382.72 382.72 0 0 0 181.12-62.336zm-254.08 61.248A320.128 320.128 0 0 1 557.76 513.6a715.84 715.84 0 0 0-48.192-48.128 320.128 320.128 0 0 1-379.264 88.384 382.4 382.4 0 0 0 110.144 229.696 382.4 382.4 0 0 0 229.184 110.08zM129.28 481.088a256.128 256.128 0 0 0 331.072-56.448 699.648 699.648 0 0 0-268.8-124.352 382.656 382.656 0 0 0-62.272 180.8zm106.56-235.84a762.88 762.88 0 0 1 258.688 125.056 256.512 256.512 0 0 0-13.44-241.088A382.464 382.464 0 0 0 235.84 245.248zm318.08-114.944c40.576 89.536 37.76 193.92-8.448 281.344a779.84 779.84 0 0 1 66.176 66.112 320.832 320.832 0 0 1 282.112-8.128 382.4 382.4 0 0 0-110.144-229.12 382.4 382.4 0 0 0-229.632-110.208zM828.8 828.8a448 448 0 1 1-633.6-633.6 448 448 0 0 1 633.6 633.6z' }, null, -1 ), _hoisted_316 = [_hoisted_216] function _sfc_render16(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_116, _hoisted_316) } var basketball_default = export_helper_default(_sfc_main16, [ ['render', _sfc_render16], ['__file', 'basketball.vue'] ]), _sfc_main17 = { name: 'BellFilled' }, _hoisted_117 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_217 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 832a128 128 0 0 1-256 0h256zm192-64H134.4a38.4 38.4 0 0 1 0-76.8H192V448c0-154.88 110.08-284.16 256.32-313.6a64 64 0 1 1 127.36 0A320.128 320.128 0 0 1 832 448v243.2h57.6a38.4 38.4 0 0 1 0 76.8H832z' }, null, -1 ), _hoisted_317 = [_hoisted_217] function _sfc_render17(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_117, _hoisted_317) } var bell_filled_default = export_helper_default(_sfc_main17, [ ['render', _sfc_render17], ['__file', 'bell-filled.vue'] ]), _sfc_main18 = { name: 'Bell' }, _hoisted_118 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_218 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a64 64 0 0 1 64 64v64H448v-64a64 64 0 0 1 64-64z' }, null, -1 ), _hoisted_318 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 768h512V448a256 256 0 1 0-512 0v320zm256-640a320 320 0 0 1 320 320v384H192V448a320 320 0 0 1 320-320z' }, null, -1 ), _hoisted_46 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M96 768h832q32 0 32 32t-32 32H96q-32 0-32-32t32-32zm352 128h128a64 64 0 0 1-128 0z' }, null, -1 ), _hoisted_52 = [_hoisted_218, _hoisted_318, _hoisted_46] function _sfc_render18(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_118, _hoisted_52) } var bell_default = export_helper_default(_sfc_main18, [ ['render', _sfc_render18], ['__file', 'bell.vue'] ]), _sfc_main19 = { name: 'Bicycle' }, _hoisted_119 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_219 = createStaticVNode( '', 5 ), _hoisted_7 = [_hoisted_219] function _sfc_render19(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_119, _hoisted_7) } var bicycle_default = export_helper_default(_sfc_main19, [ ['render', _sfc_render19], ['__file', 'bicycle.vue'] ]), _sfc_main20 = { name: 'BottomLeft' }, _hoisted_120 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_220 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 768h416a32 32 0 1 1 0 64H224a32 32 0 0 1-32-32V352a32 32 0 0 1 64 0v416z' }, null, -1 ), _hoisted_319 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M246.656 822.656a32 32 0 0 1-45.312-45.312l544-544a32 32 0 0 1 45.312 45.312l-544 544z' }, null, -1 ), _hoisted_47 = [_hoisted_220, _hoisted_319] function _sfc_render20(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_120, _hoisted_47) } var bottom_left_default = export_helper_default(_sfc_main20, [ ['render', _sfc_render20], ['__file', 'bottom-left.vue'] ]), _sfc_main21 = { name: 'BottomRight' }, _hoisted_121 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_221 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 768a32 32 0 1 0 0 64h448a32 32 0 0 0 32-32V352a32 32 0 0 0-64 0v416H352z' }, null, -1 ), _hoisted_320 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M777.344 822.656a32 32 0 0 0 45.312-45.312l-544-544a32 32 0 0 0-45.312 45.312l544 544z' }, null, -1 ), _hoisted_48 = [_hoisted_221, _hoisted_320] function _sfc_render21(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_121, _hoisted_48) } var bottom_right_default = export_helper_default(_sfc_main21, [ ['render', _sfc_render21], ['__file', 'bottom-right.vue'] ]), _sfc_main22 = { name: 'Bottom' }, _hoisted_122 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_222 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 805.888V168a32 32 0 1 0-64 0v637.888L246.656 557.952a30.72 30.72 0 0 0-45.312 0 35.52 35.52 0 0 0 0 48.064l288 306.048a30.72 30.72 0 0 0 45.312 0l288-306.048a35.52 35.52 0 0 0 0-48 30.72 30.72 0 0 0-45.312 0L544 805.824z' }, null, -1 ), _hoisted_321 = [_hoisted_222] function _sfc_render22(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_122, _hoisted_321) } var bottom_default = export_helper_default(_sfc_main22, [ ['render', _sfc_render22], ['__file', 'bottom.vue'] ]), _sfc_main23 = { name: 'Bowl' }, _hoisted_123 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_223 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M714.432 704a351.744 351.744 0 0 0 148.16-256H161.408a351.744 351.744 0 0 0 148.16 256h404.864zM288 766.592A415.68 415.68 0 0 1 96 416a32 32 0 0 1 32-32h768a32 32 0 0 1 32 32 415.68 415.68 0 0 1-192 350.592V832a64 64 0 0 1-64 64H352a64 64 0 0 1-64-64v-65.408zM493.248 320h-90.496l254.4-254.4a32 32 0 1 1 45.248 45.248L493.248 320zm187.328 0h-128l269.696-155.712a32 32 0 0 1 32 55.424L680.576 320zM352 768v64h320v-64H352z' }, null, -1 ), _hoisted_322 = [_hoisted_223] function _sfc_render23(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_123, _hoisted_322) } var bowl_default = export_helper_default(_sfc_main23, [ ['render', _sfc_render23], ['__file', 'bowl.vue'] ]), _sfc_main24 = { name: 'Box' }, _hoisted_124 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_224 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M317.056 128 128 344.064V896h768V344.064L706.944 128H317.056zm-14.528-64h418.944a32 32 0 0 1 24.064 10.88l206.528 236.096A32 32 0 0 1 960 332.032V928a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V332.032a32 32 0 0 1 7.936-21.12L278.4 75.008A32 32 0 0 1 302.528 64z' }, null, -1 ), _hoisted_323 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M64 320h896v64H64z' }, null, -1 ), _hoisted_49 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 327.872V640h128V327.872L526.08 128h-28.16L448 327.872zM448 64h128l64 256v352a32 32 0 0 1-32 32H416a32 32 0 0 1-32-32V320l64-256z' }, null, -1 ), _hoisted_53 = [_hoisted_224, _hoisted_323, _hoisted_49] function _sfc_render24(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_124, _hoisted_53) } var box_default = export_helper_default(_sfc_main24, [ ['render', _sfc_render24], ['__file', 'box.vue'] ]), _sfc_main25 = { name: 'Briefcase' }, _hoisted_125 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_225 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M320 320V128h384v192h192v192H128V320h192zM128 576h768v320H128V576zm256-256h256.064V192H384v128z' }, null, -1 ), _hoisted_324 = [_hoisted_225] function _sfc_render25(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_125, _hoisted_324) } var briefcase_default = export_helper_default(_sfc_main25, [ ['render', _sfc_render25], ['__file', 'briefcase.vue'] ]), _sfc_main26 = { name: 'BrushFilled' }, _hoisted_126 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_226 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M608 704v160a96 96 0 0 1-192 0V704h-96a128 128 0 0 1-128-128h640a128 128 0 0 1-128 128h-96zM192 512V128.064h640V512H192z' }, null, -1 ), _hoisted_325 = [_hoisted_226] function _sfc_render26(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_126, _hoisted_325) } var brush_filled_default = export_helper_default(_sfc_main26, [ ['render', _sfc_render26], ['__file', 'brush-filled.vue'] ]), _sfc_main27 = { name: 'Brush' }, _hoisted_127 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_227 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M896 448H128v192a64 64 0 0 0 64 64h192v192h256V704h192a64 64 0 0 0 64-64V448zm-770.752-64c0-47.552 5.248-90.24 15.552-128 14.72-54.016 42.496-107.392 83.2-160h417.28l-15.36 70.336L736 96h211.2c-24.832 42.88-41.92 96.256-51.2 160a663.872 663.872 0 0 0-6.144 128H960v256a128 128 0 0 1-128 128H704v160a32 32 0 0 1-32 32H352a32 32 0 0 1-32-32V768H192A128 128 0 0 1 64 640V384h61.248zm64 0h636.544c-2.048-45.824.256-91.584 6.848-137.216 4.48-30.848 10.688-59.776 18.688-86.784h-96.64l-221.12 141.248L561.92 160H256.512c-25.856 37.888-43.776 75.456-53.952 112.832-8.768 32.064-13.248 69.12-13.312 111.168z' }, null, -1 ), _hoisted_326 = [_hoisted_227] function _sfc_render27(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_127, _hoisted_326) } var brush_default = export_helper_default(_sfc_main27, [ ['render', _sfc_render27], ['__file', 'brush.vue'] ]), _sfc_main28 = { name: 'Burger' }, _hoisted_128 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_228 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 512a32 32 0 0 0-32 32v64a32 32 0 0 0 30.08 32H864a32 32 0 0 0 32-32v-64a32 32 0 0 0-32-32H160zm736-58.56A96 96 0 0 1 960 544v64a96 96 0 0 1-51.968 85.312L855.36 833.6a96 96 0 0 1-89.856 62.272H258.496A96 96 0 0 1 168.64 833.6l-52.608-140.224A96 96 0 0 1 64 608v-64a96 96 0 0 1 64-90.56V448a384 384 0 1 1 768 5.44zM832 448a320 320 0 0 0-640 0h640zM512 704H188.352l40.192 107.136a32 32 0 0 0 29.952 20.736h507.008a32 32 0 0 0 29.952-20.736L835.648 704H512z' }, null, -1 ), _hoisted_327 = [_hoisted_228] function _sfc_render28(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_128, _hoisted_327) } var burger_default = export_helper_default(_sfc_main28, [ ['render', _sfc_render28], ['__file', 'burger.vue'] ]), _sfc_main29 = { name: 'Calendar' }, _hoisted_129 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_229 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 384v512h768V192H768v32a32 32 0 1 1-64 0v-32H320v32a32 32 0 0 1-64 0v-32H128v128h768v64H128zm192-256h384V96a32 32 0 1 1 64 0v32h160a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h160V96a32 32 0 0 1 64 0v32zm-32 384h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64zm0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64zm192-192h64a32 32 0 0 1 0 64h-64a32 32 0 0 1 0-64zm0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64zm192-192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64zm0 192h64a32 32 0 1 1 0 64h-64a32 32 0 1 1 0-64z' }, null, -1 ), _hoisted_328 = [_hoisted_229] function _sfc_render29(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_129, _hoisted_328) } var calendar_default = export_helper_default(_sfc_main29, [ ['render', _sfc_render29], ['__file', 'calendar.vue'] ]), _sfc_main30 = { name: 'CameraFilled' }, _hoisted_130 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_230 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 224a64 64 0 0 0-64 64v512a64 64 0 0 0 64 64h704a64 64 0 0 0 64-64V288a64 64 0 0 0-64-64H748.416l-46.464-92.672A64 64 0 0 0 644.736 96H379.328a64 64 0 0 0-57.216 35.392L275.776 224H160zm352 435.2a115.2 115.2 0 1 0 0-230.4 115.2 115.2 0 0 0 0 230.4zm0 140.8a256 256 0 1 1 0-512 256 256 0 0 1 0 512z' }, null, -1 ), _hoisted_329 = [_hoisted_230] function _sfc_render30(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_130, _hoisted_329) } var camera_filled_default = export_helper_default(_sfc_main30, [ ['render', _sfc_render30], ['__file', 'camera-filled.vue'] ]), _sfc_main31 = { name: 'Camera' }, _hoisted_131 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_231 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M896 256H128v576h768V256zm-199.424-64-32.064-64h-304.96l-32 64h369.024zM96 192h160l46.336-92.608A64 64 0 0 1 359.552 64h304.96a64 64 0 0 1 57.216 35.328L768.192 192H928a32 32 0 0 1 32 32v640a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V224a32 32 0 0 1 32-32zm416 512a160 160 0 1 0 0-320 160 160 0 0 0 0 320zm0 64a224 224 0 1 1 0-448 224 224 0 0 1 0 448z' }, null, -1 ), _hoisted_330 = [_hoisted_231] function _sfc_render31(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_131, _hoisted_330) } var camera_default = export_helper_default(_sfc_main31, [ ['render', _sfc_render31], ['__file', 'camera.vue'] ]), _sfc_main32 = { name: 'CaretBottom' }, _hoisted_132 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_232 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm192 384 320 384 320-384z' }, null, -1 ), _hoisted_331 = [_hoisted_232] function _sfc_render32(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_132, _hoisted_331) } var caret_bottom_default = export_helper_default(_sfc_main32, [ ['render', _sfc_render32], ['__file', 'caret-bottom.vue'] ]), _sfc_main33 = { name: 'CaretLeft' }, _hoisted_133 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_233 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M672 192 288 511.936 672 832z' }, null, -1 ), _hoisted_332 = [_hoisted_233] function _sfc_render33(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_133, _hoisted_332) } var caret_left_default = export_helper_default(_sfc_main33, [ ['render', _sfc_render33], ['__file', 'caret-left.vue'] ]), _sfc_main34 = { name: 'CaretRight' }, _hoisted_134 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_234 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 192v640l384-320.064z' }, null, -1 ), _hoisted_333 = [_hoisted_234] function _sfc_render34(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_134, _hoisted_333) } var caret_right_default = export_helper_default(_sfc_main34, [ ['render', _sfc_render34], ['__file', 'caret-right.vue'] ]), _sfc_main35 = { name: 'CaretTop' }, _hoisted_135 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_235 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 320 192 704h639.936z' }, null, -1 ), _hoisted_334 = [_hoisted_235] function _sfc_render35(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_135, _hoisted_334) } var caret_top_default = export_helper_default(_sfc_main35, [ ['render', _sfc_render35], ['__file', 'caret-top.vue'] ]), _sfc_main36 = { name: 'Cellphone' }, _hoisted_136 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_236 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 128a64 64 0 0 0-64 64v640a64 64 0 0 0 64 64h512a64 64 0 0 0 64-64V192a64 64 0 0 0-64-64H256zm0-64h512a128 128 0 0 1 128 128v640a128 128 0 0 1-128 128H256a128 128 0 0 1-128-128V192A128 128 0 0 1 256 64zm128 128h256a32 32 0 1 1 0 64H384a32 32 0 0 1 0-64zm128 640a64 64 0 1 1 0-128 64 64 0 0 1 0 128z' }, null, -1 ), _hoisted_335 = [_hoisted_236] function _sfc_render36(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_136, _hoisted_335) } var cellphone_default = export_helper_default(_sfc_main36, [ ['render', _sfc_render36], ['__file', 'cellphone.vue'] ]), _sfc_main37 = { name: 'ChatDotRound' }, _hoisted_137 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_237 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm174.72 855.68 135.296-45.12 23.68 11.84C388.096 849.536 448.576 864 512 864c211.84 0 384-166.784 384-352S723.84 160 512 160 128 326.784 128 512c0 69.12 24.96 139.264 70.848 199.232l22.08 28.8-46.272 115.584zm-45.248 82.56A32 32 0 0 1 89.6 896l58.368-145.92C94.72 680.32 64 596.864 64 512 64 299.904 256 96 512 96s448 203.904 448 416-192 416-448 416a461.056 461.056 0 0 1-206.912-48.384l-175.616 58.56z' }, null, -1 ), _hoisted_336 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 563.2a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4zm192 0a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4zm-384 0a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4z' }, null, -1 ), _hoisted_410 = [_hoisted_237, _hoisted_336] function _sfc_render37(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_137, _hoisted_410) } var chat_dot_round_default = export_helper_default(_sfc_main37, [ ['render', _sfc_render37], ['__file', 'chat-dot-round.vue'] ]), _sfc_main38 = { name: 'ChatDotSquare' }, _hoisted_138 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_238 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M273.536 736H800a64 64 0 0 0 64-64V256a64 64 0 0 0-64-64H224a64 64 0 0 0-64 64v570.88L273.536 736zM296 800 147.968 918.4A32 32 0 0 1 96 893.44V256a128 128 0 0 1 128-128h576a128 128 0 0 1 128 128v416a128 128 0 0 1-128 128H296z' }, null, -1 ), _hoisted_337 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 499.2a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4zm192 0a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4zm-384 0a51.2 51.2 0 1 1 0-102.4 51.2 51.2 0 0 1 0 102.4z' }, null, -1 ), _hoisted_411 = [_hoisted_238, _hoisted_337] function _sfc_render38(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_138, _hoisted_411) } var chat_dot_square_default = export_helper_default(_sfc_main38, [ ['render', _sfc_render38], ['__file', 'chat-dot-square.vue'] ]), _sfc_main39 = { name: 'ChatLineRound' }, _hoisted_139 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_239 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm174.72 855.68 135.296-45.12 23.68 11.84C388.096 849.536 448.576 864 512 864c211.84 0 384-166.784 384-352S723.84 160 512 160 128 326.784 128 512c0 69.12 24.96 139.264 70.848 199.232l22.08 28.8-46.272 115.584zm-45.248 82.56A32 32 0 0 1 89.6 896l58.368-145.92C94.72 680.32 64 596.864 64 512 64 299.904 256 96 512 96s448 203.904 448 416-192 416-448 416a461.056 461.056 0 0 1-206.912-48.384l-175.616 58.56z' }, null, -1 ), _hoisted_338 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 576h320q32 0 32 32t-32 32H352q-32 0-32-32t32-32zm32-192h256q32 0 32 32t-32 32H384q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_412 = [_hoisted_239, _hoisted_338] function _sfc_render39(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_139, _hoisted_412) } var chat_line_round_default = export_helper_default(_sfc_main39, [ ['render', _sfc_render39], ['__file', 'chat-line-round.vue'] ]), _sfc_main40 = { name: 'ChatLineSquare' }, _hoisted_140 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_240 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 826.88 273.536 736H800a64 64 0 0 0 64-64V256a64 64 0 0 0-64-64H224a64 64 0 0 0-64 64v570.88zM296 800 147.968 918.4A32 32 0 0 1 96 893.44V256a128 128 0 0 1 128-128h576a128 128 0 0 1 128 128v416a128 128 0 0 1-128 128H296z' }, null, -1 ), _hoisted_339 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 512h320q32 0 32 32t-32 32H352q-32 0-32-32t32-32zm0-192h320q32 0 32 32t-32 32H352q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_413 = [_hoisted_240, _hoisted_339] function _sfc_render40(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_140, _hoisted_413) } var chat_line_square_default = export_helper_default(_sfc_main40, [ ['render', _sfc_render40], ['__file', 'chat-line-square.vue'] ]), _sfc_main41 = { name: 'ChatRound' }, _hoisted_141 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_241 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm174.72 855.68 130.048-43.392 23.424 11.392C382.4 849.984 444.352 864 512 864c223.744 0 384-159.872 384-352 0-192.832-159.104-352-384-352S128 319.168 128 512a341.12 341.12 0 0 0 69.248 204.288l21.632 28.8-44.16 110.528zm-45.248 82.56A32 32 0 0 1 89.6 896l56.512-141.248A405.12 405.12 0 0 1 64 512C64 299.904 235.648 96 512 96s448 203.904 448 416-173.44 416-448 416c-79.68 0-150.848-17.152-211.712-46.72l-170.88 56.96z' }, null, -1 ), _hoisted_340 = [_hoisted_241] function _sfc_render41(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_141, _hoisted_340) } var chat_round_default = export_helper_default(_sfc_main41, [ ['render', _sfc_render41], ['__file', 'chat-round.vue'] ]), _sfc_main42 = { name: 'ChatSquare' }, _hoisted_142 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_242 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M273.536 736H800a64 64 0 0 0 64-64V256a64 64 0 0 0-64-64H224a64 64 0 0 0-64 64v570.88L273.536 736zM296 800 147.968 918.4A32 32 0 0 1 96 893.44V256a128 128 0 0 1 128-128h576a128 128 0 0 1 128 128v416a128 128 0 0 1-128 128H296z' }, null, -1 ), _hoisted_341 = [_hoisted_242] function _sfc_render42(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_142, _hoisted_341) } var chat_square_default = export_helper_default(_sfc_main42, [ ['render', _sfc_render42], ['__file', 'chat-square.vue'] ]), _sfc_main43 = { name: 'Check' }, _hoisted_143 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_243 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M406.656 706.944 195.84 496.256a32 32 0 1 0-45.248 45.248l256 256 512-512a32 32 0 0 0-45.248-45.248L406.592 706.944z' }, null, -1 ), _hoisted_342 = [_hoisted_243] function _sfc_render43(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_143, _hoisted_342) } var check_default = export_helper_default(_sfc_main43, [ ['render', _sfc_render43], ['__file', 'check.vue'] ]), _sfc_main44 = { name: 'Checked' }, _hoisted_144 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_244 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 192h160v736H160V192h160.064v64H704v-64zM311.616 537.28l-45.312 45.248L447.36 763.52l316.8-316.8-45.312-45.184L447.36 673.024 311.616 537.28zM384 192V96h256v96H384z' }, null, -1 ), _hoisted_343 = [_hoisted_244] function _sfc_render44(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_144, _hoisted_343) } var checked_default = export_helper_default(_sfc_main44, [ ['render', _sfc_render44], ['__file', 'checked.vue'] ]), _sfc_main45 = { name: 'Cherry' }, _hoisted_145 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_245 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M261.056 449.6c13.824-69.696 34.88-128.96 63.36-177.728 23.744-40.832 61.12-88.64 112.256-143.872H320a32 32 0 0 1 0-64h384a32 32 0 1 1 0 64H554.752c14.912 39.168 41.344 86.592 79.552 141.76 47.36 68.48 84.8 106.752 106.304 114.304a224 224 0 1 1-84.992 14.784c-22.656-22.912-47.04-53.76-73.92-92.608-38.848-56.128-67.008-105.792-84.352-149.312-55.296 58.24-94.528 107.52-117.76 147.2-23.168 39.744-41.088 88.768-53.568 147.072a224.064 224.064 0 1 1-64.96-1.6zM288 832a160 160 0 1 0 0-320 160 160 0 0 0 0 320zm448-64a160 160 0 1 0 0-320 160 160 0 0 0 0 320z' }, null, -1 ), _hoisted_344 = [_hoisted_245] function _sfc_render45(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_145, _hoisted_344) } var cherry_default = export_helper_default(_sfc_main45, [ ['render', _sfc_render45], ['__file', 'cherry.vue'] ]), _sfc_main46 = { name: 'Chicken' }, _hoisted_146 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_246 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M349.952 716.992 478.72 588.16a106.688 106.688 0 0 1-26.176-19.072 106.688 106.688 0 0 1-19.072-26.176L304.704 671.744c.768 3.072 1.472 6.144 2.048 9.216l2.048 31.936 31.872 1.984c3.136.64 6.208 1.28 9.28 2.112zm57.344 33.152a128 128 0 1 1-216.32 114.432l-1.92-32-32-1.92a128 128 0 1 1 114.432-216.32L416.64 469.248c-2.432-101.44 58.112-239.104 149.056-330.048 107.328-107.328 231.296-85.504 316.8 0 85.44 85.44 107.328 209.408 0 316.8-91.008 90.88-228.672 151.424-330.112 149.056L407.296 750.08zm90.496-226.304c49.536 49.536 233.344-7.04 339.392-113.088 78.208-78.208 63.232-163.072 0-226.304-63.168-63.232-148.032-78.208-226.24 0C504.896 290.496 448.32 474.368 497.792 523.84zM244.864 708.928a64 64 0 1 0-59.84 59.84l56.32-3.52 3.52-56.32zm8.064 127.68a64 64 0 1 0 59.84-59.84l-56.32 3.52-3.52 56.32z' }, null, -1 ), _hoisted_345 = [_hoisted_246] function _sfc_render46(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_146, _hoisted_345) } var chicken_default = export_helper_default(_sfc_main46, [ ['render', _sfc_render46], ['__file', 'chicken.vue'] ]), _sfc_main47 = { name: 'CircleCheckFilled' }, _hoisted_147 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_247 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336L456.192 600.384z' }, null, -1 ), _hoisted_346 = [_hoisted_247] function _sfc_render47(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_147, _hoisted_346) } var circle_check_filled_default = export_helper_default(_sfc_main47, [ ['render', _sfc_render47], ['__file', 'circle-check-filled.vue'] ]), _sfc_main48 = { name: 'CircleCheck' }, _hoisted_148 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_248 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_347 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M745.344 361.344a32 32 0 0 1 45.312 45.312l-288 288a32 32 0 0 1-45.312 0l-160-160a32 32 0 1 1 45.312-45.312L480 626.752l265.344-265.408z' }, null, -1 ), _hoisted_414 = [_hoisted_248, _hoisted_347] function _sfc_render48(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_148, _hoisted_414) } var circle_check_default = export_helper_default(_sfc_main48, [ ['render', _sfc_render48], ['__file', 'circle-check.vue'] ]), _sfc_main49 = { name: 'CircleCloseFilled' }, _hoisted_149 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_249 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 393.664L407.936 353.6a38.4 38.4 0 1 0-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1 0 54.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1 0 54.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 1 0-54.336-54.336L512 457.664z' }, null, -1 ), _hoisted_348 = [_hoisted_249] function _sfc_render49(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_149, _hoisted_348) } var circle_close_filled_default = export_helper_default(_sfc_main49, [ ['render', _sfc_render49], ['__file', 'circle-close-filled.vue'] ]), _sfc_main50 = { name: 'CircleClose' }, _hoisted_150 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_250 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm466.752 512-90.496-90.496a32 32 0 0 1 45.248-45.248L512 466.752l90.496-90.496a32 32 0 1 1 45.248 45.248L557.248 512l90.496 90.496a32 32 0 1 1-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 0 1-45.248-45.248L466.752 512z' }, null, -1 ), _hoisted_349 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_415 = [_hoisted_250, _hoisted_349] function _sfc_render50(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_150, _hoisted_415) } var circle_close_default = export_helper_default(_sfc_main50, [ ['render', _sfc_render50], ['__file', 'circle-close.vue'] ]), _sfc_main51 = { name: 'CirclePlusFilled' }, _hoisted_151 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_251 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm-38.4 409.6H326.4a38.4 38.4 0 1 0 0 76.8h147.2v147.2a38.4 38.4 0 0 0 76.8 0V550.4h147.2a38.4 38.4 0 0 0 0-76.8H550.4V326.4a38.4 38.4 0 1 0-76.8 0v147.2z' }, null, -1 ), _hoisted_350 = [_hoisted_251] function _sfc_render51(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_151, _hoisted_350) } var circle_plus_filled_default = export_helper_default(_sfc_main51, [ ['render', _sfc_render51], ['__file', 'circle-plus-filled.vue'] ]), _sfc_main52 = { name: 'CirclePlus' }, _hoisted_152 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_252 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 480h320a32 32 0 1 1 0 64H352a32 32 0 0 1 0-64z' }, null, -1 ), _hoisted_351 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 672V352a32 32 0 1 1 64 0v320a32 32 0 0 1-64 0z' }, null, -1 ), _hoisted_416 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_54 = [_hoisted_252, _hoisted_351, _hoisted_416] function _sfc_render52(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_152, _hoisted_54) } var circle_plus_default = export_helper_default(_sfc_main52, [ ['render', _sfc_render52], ['__file', 'circle-plus.vue'] ]), _sfc_main53 = { name: 'Clock' }, _hoisted_153 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_253 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_352 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 256a32 32 0 0 1 32 32v256a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_417 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 512h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_55 = [_hoisted_253, _hoisted_352, _hoisted_417] function _sfc_render53(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_153, _hoisted_55) } var clock_default = export_helper_default(_sfc_main53, [ ['render', _sfc_render53], ['__file', 'clock.vue'] ]), _sfc_main54 = { name: 'CloseBold' }, _hoisted_154 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_254 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M195.2 195.2a64 64 0 0 1 90.496 0L512 421.504 738.304 195.2a64 64 0 0 1 90.496 90.496L602.496 512 828.8 738.304a64 64 0 0 1-90.496 90.496L512 602.496 285.696 828.8a64 64 0 0 1-90.496-90.496L421.504 512 195.2 285.696a64 64 0 0 1 0-90.496z' }, null, -1 ), _hoisted_353 = [_hoisted_254] function _sfc_render54(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_154, _hoisted_353) } var close_bold_default = export_helper_default(_sfc_main54, [ ['render', _sfc_render54], ['__file', 'close-bold.vue'] ]), _sfc_main55 = { name: 'Close' }, _hoisted_155 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_255 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M764.288 214.592 512 466.88 259.712 214.592a31.936 31.936 0 0 0-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1 0 45.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0 0 45.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 1 0-45.12-45.184z' }, null, -1 ), _hoisted_354 = [_hoisted_255] function _sfc_render55(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_155, _hoisted_354) } var close_default = export_helper_default(_sfc_main55, [ ['render', _sfc_render55], ['__file', 'close.vue'] ]), _sfc_main56 = { name: 'Cloudy' }, _hoisted_156 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_256 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M598.4 831.872H328.192a256 256 0 0 1-34.496-510.528A352 352 0 1 1 598.4 831.872zm-271.36-64h272.256a288 288 0 1 0-248.512-417.664L335.04 381.44l-34.816 3.584a192 192 0 0 0 26.88 382.848z' }, null, -1 ), _hoisted_355 = [_hoisted_256] function _sfc_render56(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_156, _hoisted_355) } var cloudy_default = export_helper_default(_sfc_main56, [ ['render', _sfc_render56], ['__file', 'cloudy.vue'] ]), _sfc_main57 = { name: 'CoffeeCup' }, _hoisted_157 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_257 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 192a192 192 0 1 1-8 383.808A256.128 256.128 0 0 1 512 768H320A256 256 0 0 1 64 512V160a32 32 0 0 1 32-32h640a32 32 0 0 1 32 32v32zm0 64v256a128 128 0 1 0 0-256zM96 832h640a32 32 0 1 1 0 64H96a32 32 0 1 1 0-64zm32-640v320a192 192 0 0 0 192 192h192a192 192 0 0 0 192-192V192H128z' }, null, -1 ), _hoisted_356 = [_hoisted_257] function _sfc_render57(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_157, _hoisted_356) } var coffee_cup_default = export_helper_default(_sfc_main57, [ ['render', _sfc_render57], ['__file', 'coffee-cup.vue'] ]), _sfc_main58 = { name: 'Coffee' }, _hoisted_158 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_258 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M822.592 192h14.272a32 32 0 0 1 31.616 26.752l21.312 128A32 32 0 0 1 858.24 384h-49.344l-39.04 546.304A32 32 0 0 1 737.92 960H285.824a32 32 0 0 1-32-29.696L214.912 384H165.76a32 32 0 0 1-31.552-37.248l21.312-128A32 32 0 0 1 187.136 192h14.016l-6.72-93.696A32 32 0 0 1 226.368 64h571.008a32 32 0 0 1 31.936 34.304L822.592 192zm-64.128 0 4.544-64H260.736l4.544 64h493.184zm-548.16 128H820.48l-10.688-64H214.208l-10.688 64h6.784zm68.736 64 36.544 512H708.16l36.544-512H279.04z' }, null, -1 ), _hoisted_357 = [_hoisted_258] function _sfc_render58(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_158, _hoisted_357) } var coffee_default = export_helper_default(_sfc_main58, [ ['render', _sfc_render58], ['__file', 'coffee.vue'] ]), _sfc_main59 = { name: 'Coin' }, _hoisted_159 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_259 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm161.92 580.736 29.888 58.88C171.328 659.776 160 681.728 160 704c0 82.304 155.328 160 352 160s352-77.696 352-160c0-22.272-11.392-44.16-31.808-64.32l30.464-58.432C903.936 615.808 928 657.664 928 704c0 129.728-188.544 224-416 224S96 833.728 96 704c0-46.592 24.32-88.576 65.92-123.264z' }, null, -1 ), _hoisted_358 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm161.92 388.736 29.888 58.88C171.328 467.84 160 489.792 160 512c0 82.304 155.328 160 352 160s352-77.696 352-160c0-22.272-11.392-44.16-31.808-64.32l30.464-58.432C903.936 423.808 928 465.664 928 512c0 129.728-188.544 224-416 224S96 641.728 96 512c0-46.592 24.32-88.576 65.92-123.264z' }, null, -1 ), _hoisted_418 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 544c-227.456 0-416-94.272-416-224S284.544 96 512 96s416 94.272 416 224-188.544 224-416 224zm0-64c196.672 0 352-77.696 352-160S708.672 160 512 160s-352 77.696-352 160 155.328 160 352 160z' }, null, -1 ), _hoisted_56 = [_hoisted_259, _hoisted_358, _hoisted_418] function _sfc_render59(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_159, _hoisted_56) } var coin_default = export_helper_default(_sfc_main59, [ ['render', _sfc_render59], ['__file', 'coin.vue'] ]), _sfc_main60 = { name: 'ColdDrink' }, _hoisted_160 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_260 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 64a192 192 0 1 1-69.952 370.88L480 725.376V896h96a32 32 0 1 1 0 64H320a32 32 0 1 1 0-64h96V725.376L76.8 273.536a64 64 0 0 1-12.8-38.4v-10.688a32 32 0 0 1 32-32h71.808l-65.536-83.84a32 32 0 0 1 50.432-39.424l96.256 123.264h337.728A192.064 192.064 0 0 1 768 64zM656.896 192.448H800a32 32 0 0 1 32 32v10.624a64 64 0 0 1-12.8 38.4l-80.448 107.2a128 128 0 1 0-81.92-188.16v-.064zm-357.888 64 129.472 165.76a32 32 0 0 1-50.432 39.36l-160.256-205.12H144l304 404.928 304-404.928H299.008z' }, null, -1 ), _hoisted_359 = [_hoisted_260] function _sfc_render60(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_160, _hoisted_359) } var cold_drink_default = export_helper_default(_sfc_main60, [ ['render', _sfc_render60], ['__file', 'cold-drink.vue'] ]), _sfc_main61 = { name: 'CollectionTag' }, _hoisted_161 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_261 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 128v698.88l196.032-156.864a96 96 0 0 1 119.936 0L768 826.816V128H256zm-32-64h576a32 32 0 0 1 32 32v797.44a32 32 0 0 1-51.968 24.96L531.968 720a32 32 0 0 0-39.936 0L243.968 918.4A32 32 0 0 1 192 893.44V96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_360 = [_hoisted_261] function _sfc_render61(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_161, _hoisted_360) } var collection_tag_default = export_helper_default(_sfc_main61, [ ['render', _sfc_render61], ['__file', 'collection-tag.vue'] ]), _sfc_main62 = { name: 'Collection' }, _hoisted_162 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_262 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 736h640V128H256a64 64 0 0 0-64 64v544zm64-672h608a32 32 0 0 1 32 32v672a32 32 0 0 1-32 32H160l-32 57.536V192A128 128 0 0 1 256 64z' }, null, -1 ), _hoisted_361 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M240 800a48 48 0 1 0 0 96h592v-96H240zm0-64h656v160a64 64 0 0 1-64 64H240a112 112 0 0 1 0-224zm144-608v250.88l96-76.8 96 76.8V128H384zm-64-64h320v381.44a32 32 0 0 1-51.968 24.96L480 384l-108.032 86.4A32 32 0 0 1 320 445.44V64z' }, null, -1 ), _hoisted_419 = [_hoisted_262, _hoisted_361] function _sfc_render62(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_162, _hoisted_419) } var collection_default = export_helper_default(_sfc_main62, [ ['render', _sfc_render62], ['__file', 'collection.vue'] ]), _sfc_main63 = { name: 'Comment' }, _hoisted_163 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_263 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M736 504a56 56 0 1 1 0-112 56 56 0 0 1 0 112zm-224 0a56 56 0 1 1 0-112 56 56 0 0 1 0 112zm-224 0a56 56 0 1 1 0-112 56 56 0 0 1 0 112zM128 128v640h192v160l224-160h352V128H128z' }, null, -1 ), _hoisted_362 = [_hoisted_263] function _sfc_render63(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_163, _hoisted_362) } var comment_default = export_helper_default(_sfc_main63, [ ['render', _sfc_render63], ['__file', 'comment.vue'] ]), _sfc_main64 = { name: 'Compass' }, _hoisted_164 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_264 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_363 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M725.888 315.008C676.48 428.672 624 513.28 568.576 568.64c-55.424 55.424-139.968 107.904-253.568 157.312a12.8 12.8 0 0 1-16.896-16.832c49.536-113.728 102.016-198.272 157.312-253.632 55.36-55.296 139.904-107.776 253.632-157.312a12.8 12.8 0 0 1 16.832 16.832z' }, null, -1 ), _hoisted_420 = [_hoisted_264, _hoisted_363] function _sfc_render64(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_164, _hoisted_420) } var compass_default = export_helper_default(_sfc_main64, [ ['render', _sfc_render64], ['__file', 'compass.vue'] ]), _sfc_main65 = { name: 'Connection' }, _hoisted_165 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_265 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 384v64H448a128 128 0 0 0-128 128v128a128 128 0 0 0 128 128h320a128 128 0 0 0 128-128V576a128 128 0 0 0-64-110.848V394.88c74.56 26.368 128 97.472 128 181.056v128a192 192 0 0 1-192 192H448a192 192 0 0 1-192-192V576a192 192 0 0 1 192-192h192z' }, null, -1 ), _hoisted_364 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 640v-64h192a128 128 0 0 0 128-128V320a128 128 0 0 0-128-128H256a128 128 0 0 0-128 128v128a128 128 0 0 0 64 110.848v70.272A192.064 192.064 0 0 1 64 448V320a192 192 0 0 1 192-192h320a192 192 0 0 1 192 192v128a192 192 0 0 1-192 192H384z' }, null, -1 ), _hoisted_421 = [_hoisted_265, _hoisted_364] function _sfc_render65(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_165, _hoisted_421) } var connection_default = export_helper_default(_sfc_main65, [ ['render', _sfc_render65], ['__file', 'connection.vue'] ]), _sfc_main66 = { name: 'Coordinate' }, _hoisted_166 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_266 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 512h64v320h-64z' }, null, -1 ), _hoisted_365 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 896h640a64 64 0 0 0-64-64H256a64 64 0 0 0-64 64zm64-128h512a128 128 0 0 1 128 128v64H128v-64a128 128 0 0 1 128-128zm256-256a192 192 0 1 0 0-384 192 192 0 0 0 0 384zm0 64a256 256 0 1 1 0-512 256 256 0 0 1 0 512z' }, null, -1 ), _hoisted_422 = [_hoisted_266, _hoisted_365] function _sfc_render66(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_166, _hoisted_422) } var coordinate_default = export_helper_default(_sfc_main66, [ ['render', _sfc_render66], ['__file', 'coordinate.vue'] ]), _sfc_main67 = { name: 'CopyDocument' }, _hoisted_167 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_267 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 832a128 128 0 0 1-128 128H192A128 128 0 0 1 64 832V384a128 128 0 0 1 128-128v64a64 64 0 0 0-64 64v448a64 64 0 0 0 64 64h448a64 64 0 0 0 64-64h64z' }, null, -1 ), _hoisted_366 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 128a64 64 0 0 0-64 64v448a64 64 0 0 0 64 64h448a64 64 0 0 0 64-64V192a64 64 0 0 0-64-64H384zm0-64h448a128 128 0 0 1 128 128v448a128 128 0 0 1-128 128H384a128 128 0 0 1-128-128V192A128 128 0 0 1 384 64z' }, null, -1 ), _hoisted_423 = [_hoisted_267, _hoisted_366] function _sfc_render67(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_167, _hoisted_423) } var copy_document_default = export_helper_default(_sfc_main67, [ ['render', _sfc_render67], ['__file', 'copy-document.vue'] ]), _sfc_main68 = { name: 'Cpu' }, _hoisted_168 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_268 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M320 256a64 64 0 0 0-64 64v384a64 64 0 0 0 64 64h384a64 64 0 0 0 64-64V320a64 64 0 0 0-64-64H320zm0-64h384a128 128 0 0 1 128 128v384a128 128 0 0 1-128 128H320a128 128 0 0 1-128-128V320a128 128 0 0 1 128-128z' }, null, -1 ), _hoisted_367 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a32 32 0 0 1 32 32v128h-64V96a32 32 0 0 1 32-32zm160 0a32 32 0 0 1 32 32v128h-64V96a32 32 0 0 1 32-32zm-320 0a32 32 0 0 1 32 32v128h-64V96a32 32 0 0 1 32-32zm160 896a32 32 0 0 1-32-32V800h64v128a32 32 0 0 1-32 32zm160 0a32 32 0 0 1-32-32V800h64v128a32 32 0 0 1-32 32zm-320 0a32 32 0 0 1-32-32V800h64v128a32 32 0 0 1-32 32zM64 512a32 32 0 0 1 32-32h128v64H96a32 32 0 0 1-32-32zm0-160a32 32 0 0 1 32-32h128v64H96a32 32 0 0 1-32-32zm0 320a32 32 0 0 1 32-32h128v64H96a32 32 0 0 1-32-32zm896-160a32 32 0 0 1-32 32H800v-64h128a32 32 0 0 1 32 32zm0-160a32 32 0 0 1-32 32H800v-64h128a32 32 0 0 1 32 32zm0 320a32 32 0 0 1-32 32H800v-64h128a32 32 0 0 1 32 32z' }, null, -1 ), _hoisted_424 = [_hoisted_268, _hoisted_367] function _sfc_render68(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_168, _hoisted_424) } var cpu_default = export_helper_default(_sfc_main68, [ ['render', _sfc_render68], ['__file', 'cpu.vue'] ]), _sfc_main69 = { name: 'CreditCard' }, _hoisted_169 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_269 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M896 324.096c0-42.368-2.496-55.296-9.536-68.48a52.352 52.352 0 0 0-22.144-22.08c-13.12-7.04-26.048-9.536-68.416-9.536H228.096c-42.368 0-55.296 2.496-68.48 9.536a52.352 52.352 0 0 0-22.08 22.144c-7.04 13.12-9.536 26.048-9.536 68.416v375.808c0 42.368 2.496 55.296 9.536 68.48a52.352 52.352 0 0 0 22.144 22.08c13.12 7.04 26.048 9.536 68.416 9.536h567.808c42.368 0 55.296-2.496 68.48-9.536a52.352 52.352 0 0 0 22.08-22.144c7.04-13.12 9.536-26.048 9.536-68.416V324.096zm64 0v375.808c0 57.088-5.952 77.76-17.088 98.56-11.136 20.928-27.52 37.312-48.384 48.448-20.864 11.136-41.6 17.088-98.56 17.088H228.032c-57.088 0-77.76-5.952-98.56-17.088a116.288 116.288 0 0 1-48.448-48.384c-11.136-20.864-17.088-41.6-17.088-98.56V324.032c0-57.088 5.952-77.76 17.088-98.56 11.136-20.928 27.52-37.312 48.384-48.448 20.864-11.136 41.6-17.088 98.56-17.088H795.84c57.088 0 77.76 5.952 98.56 17.088 20.928 11.136 37.312 27.52 48.448 48.384 11.136 20.864 17.088 41.6 17.088 98.56z' }, null, -1 ), _hoisted_368 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M64 320h896v64H64v-64zm0 128h896v64H64v-64zm128 192h256v64H192z' }, null, -1 ), _hoisted_425 = [_hoisted_269, _hoisted_368] function _sfc_render69(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_169, _hoisted_425) } var credit_card_default = export_helper_default(_sfc_main69, [ ['render', _sfc_render69], ['__file', 'credit-card.vue'] ]), _sfc_main70 = { name: 'Crop' }, _hoisted_170 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_270 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 768h672a32 32 0 1 1 0 64H224a32 32 0 0 1-32-32V96a32 32 0 0 1 64 0v672z' }, null, -1 ), _hoisted_369 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 224v704a32 32 0 1 1-64 0V256H96a32 32 0 0 1 0-64h704a32 32 0 0 1 32 32z' }, null, -1 ), _hoisted_426 = [_hoisted_270, _hoisted_369] function _sfc_render70(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_170, _hoisted_426) } var crop_default = export_helper_default(_sfc_main70, [ ['render', _sfc_render70], ['__file', 'crop.vue'] ]), _sfc_main71 = { name: 'DArrowLeft' }, _hoisted_171 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_271 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M529.408 149.376a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L259.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L197.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224zm256 0a29.12 29.12 0 0 1 41.728 0 30.592 30.592 0 0 1 0 42.688L515.264 511.936l311.872 319.936a30.592 30.592 0 0 1-.512 43.264 29.12 29.12 0 0 1-41.216-.512L453.76 534.272a32 32 0 0 1 0-44.672l331.648-340.224z' }, null, -1 ), _hoisted_370 = [_hoisted_271] function _sfc_render71(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_171, _hoisted_370) } var d_arrow_left_default = export_helper_default(_sfc_main71, [ ['render', _sfc_render71], ['__file', 'd-arrow-left.vue'] ]), _sfc_main72 = { name: 'DArrowRight' }, _hoisted_172 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_272 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M452.864 149.312a29.12 29.12 0 0 1 41.728.064L826.24 489.664a32 32 0 0 1 0 44.672L494.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L764.736 512 452.864 192a30.592 30.592 0 0 1 0-42.688zm-256 0a29.12 29.12 0 0 1 41.728.064L570.24 489.664a32 32 0 0 1 0 44.672L238.592 874.624a29.12 29.12 0 0 1-41.728 0 30.592 30.592 0 0 1 0-42.752L508.736 512 196.864 192a30.592 30.592 0 0 1 0-42.688z' }, null, -1 ), _hoisted_371 = [_hoisted_272] function _sfc_render72(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_172, _hoisted_371) } var d_arrow_right_default = export_helper_default(_sfc_main72, [ ['render', _sfc_render72], ['__file', 'd-arrow-right.vue'] ]), _sfc_main73 = { name: 'DCaret' }, _hoisted_173 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_273 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm512 128 288 320H224l288-320zM224 576h576L512 896 224 576z' }, null, -1 ), _hoisted_372 = [_hoisted_273] function _sfc_render73(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_173, _hoisted_372) } var d_caret_default = export_helper_default(_sfc_main73, [ ['render', _sfc_render73], ['__file', 'd-caret.vue'] ]), _sfc_main74 = { name: 'DataAnalysis' }, _hoisted_174 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_274 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm665.216 768 110.848 192h-73.856L591.36 768H433.024L322.176 960H248.32l110.848-192H160a32 32 0 0 1-32-32V192H64a32 32 0 0 1 0-64h896a32 32 0 1 1 0 64h-64v544a32 32 0 0 1-32 32H665.216zM832 192H192v512h640V192zM352 448a32 32 0 0 1 32 32v64a32 32 0 0 1-64 0v-64a32 32 0 0 1 32-32zm160-64a32 32 0 0 1 32 32v128a32 32 0 0 1-64 0V416a32 32 0 0 1 32-32zm160-64a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V352a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_373 = [_hoisted_274] function _sfc_render74(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_174, _hoisted_373) } var data_analysis_default = export_helper_default(_sfc_main74, [ ['render', _sfc_render74], ['__file', 'data-analysis.vue'] ]), _sfc_main75 = { name: 'DataBoard' }, _hoisted_175 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_275 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M32 128h960v64H32z' }, null, -1 ), _hoisted_374 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 192v512h640V192H192zm-64-64h768v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V128z' }, null, -1 ), _hoisted_427 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M322.176 960H248.32l144.64-250.56 55.424 32L322.176 960zm453.888 0h-73.856L576 741.44l55.424-32L776.064 960z' }, null, -1 ), _hoisted_57 = [_hoisted_275, _hoisted_374, _hoisted_427] function _sfc_render75(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_175, _hoisted_57) } var data_board_default = export_helper_default(_sfc_main75, [ ['render', _sfc_render75], ['__file', 'data-board.vue'] ]), _sfc_main76 = { name: 'DataLine' }, _hoisted_176 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_276 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M359.168 768H160a32 32 0 0 1-32-32V192H64a32 32 0 0 1 0-64h896a32 32 0 1 1 0 64h-64v544a32 32 0 0 1-32 32H665.216l110.848 192h-73.856L591.36 768H433.024L322.176 960H248.32l110.848-192zM832 192H192v512h640V192zM342.656 534.656a32 32 0 1 1-45.312-45.312L444.992 341.76l125.44 94.08L679.04 300.032a32 32 0 1 1 49.92 39.936L581.632 524.224 451.008 426.24 342.656 534.592z' }, null, -1 ), _hoisted_375 = [_hoisted_276] function _sfc_render76(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_176, _hoisted_375) } var data_line_default = export_helper_default(_sfc_main76, [ ['render', _sfc_render76], ['__file', 'data-line.vue'] ]), _sfc_main77 = { name: 'DeleteFilled' }, _hoisted_177 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_277 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 192V95.936a32 32 0 0 1 32-32h256a32 32 0 0 1 32 32V192h256a32 32 0 1 1 0 64H96a32 32 0 0 1 0-64h256zm64 0h192v-64H416v64zM192 960a32 32 0 0 1-32-32V256h704v672a32 32 0 0 1-32 32H192zm224-192a32 32 0 0 0 32-32V416a32 32 0 0 0-64 0v320a32 32 0 0 0 32 32zm192 0a32 32 0 0 0 32-32V416a32 32 0 0 0-64 0v320a32 32 0 0 0 32 32z' }, null, -1 ), _hoisted_376 = [_hoisted_277] function _sfc_render77(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_177, _hoisted_376) } var delete_filled_default = export_helper_default(_sfc_main77, [ ['render', _sfc_render77], ['__file', 'delete-filled.vue'] ]), _sfc_main78 = { name: 'DeleteLocation' }, _hoisted_178 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_278 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 896h448q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_377 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M800 416a288 288 0 1 0-576 0c0 118.144 94.528 272.128 288 456.576C705.472 688.128 800 534.144 800 416zM512 960C277.312 746.688 160 565.312 160 416a352 352 0 0 1 704 0c0 149.312-117.312 330.688-352 544z' }, null, -1 ), _hoisted_428 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 384h256q32 0 32 32t-32 32H384q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_58 = [_hoisted_278, _hoisted_377, _hoisted_428] function _sfc_render78(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_178, _hoisted_58) } var delete_location_default = export_helper_default(_sfc_main78, [ ['render', _sfc_render78], ['__file', 'delete-location.vue'] ]), _sfc_main79 = { name: 'Delete' }, _hoisted_179 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_279 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 256H96a32 32 0 0 1 0-64h256V95.936a32 32 0 0 1 32-32h256a32 32 0 0 1 32 32V192h256a32 32 0 1 1 0 64h-64v672a32 32 0 0 1-32 32H192a32 32 0 0 1-32-32V256zm448-64v-64H416v64h192zM224 896h576V256H224v640zm192-128a32 32 0 0 1-32-32V416a32 32 0 0 1 64 0v320a32 32 0 0 1-32 32zm192 0a32 32 0 0 1-32-32V416a32 32 0 0 1 64 0v320a32 32 0 0 1-32 32z' }, null, -1 ), _hoisted_378 = [_hoisted_279] function _sfc_render79(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_179, _hoisted_378) } var delete_default = export_helper_default(_sfc_main79, [ ['render', _sfc_render79], ['__file', 'delete.vue'] ]), _sfc_main80 = { name: 'Dessert' }, _hoisted_180 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_280 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 416v-48a144 144 0 0 1 168.64-141.888 224.128 224.128 0 0 1 430.72 0A144 144 0 0 1 896 368v48a384 384 0 0 1-352 382.72V896h-64v-97.28A384 384 0 0 1 128 416zm287.104-32.064h193.792a143.808 143.808 0 0 1 58.88-132.736 160.064 160.064 0 0 0-311.552 0 143.808 143.808 0 0 1 58.88 132.8zm-72.896 0a72 72 0 1 0-140.48 0h140.48zm339.584 0h140.416a72 72 0 1 0-140.48 0zM512 736a320 320 0 0 0 318.4-288.064H193.6A320 320 0 0 0 512 736zM384 896.064h256a32 32 0 1 1 0 64H384a32 32 0 1 1 0-64z' }, null, -1 ), _hoisted_379 = [_hoisted_280] function _sfc_render80(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_180, _hoisted_379) } var dessert_default = export_helper_default(_sfc_main80, [ ['render', _sfc_render80], ['__file', 'dessert.vue'] ]), _sfc_main81 = { name: 'Discount' }, _hoisted_181 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_281 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 704h576V318.336L552.512 115.84a64 64 0 0 0-81.024 0L224 318.336V704zm0 64v128h576V768H224zM593.024 66.304l259.2 212.096A32 32 0 0 1 864 303.168V928a32 32 0 0 1-32 32H192a32 32 0 0 1-32-32V303.168a32 32 0 0 1 11.712-24.768l259.2-212.096a128 128 0 0 1 162.112 0z' }, null, -1 ), _hoisted_380 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 448a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_429 = [_hoisted_281, _hoisted_380] function _sfc_render81(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_181, _hoisted_429) } var discount_default = export_helper_default(_sfc_main81, [ ['render', _sfc_render81], ['__file', 'discount.vue'] ]), _sfc_main82 = { name: 'DishDot' }, _hoisted_182 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_282 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm384.064 274.56.064-50.688A128 128 0 0 1 512.128 96c70.528 0 127.68 57.152 127.68 127.68v50.752A448.192 448.192 0 0 1 955.392 768H68.544A448.192 448.192 0 0 1 384 274.56zM96 832h832a32 32 0 1 1 0 64H96a32 32 0 1 1 0-64zm32-128h768a384 384 0 1 0-768 0zm447.808-448v-32.32a63.68 63.68 0 0 0-63.68-63.68 64 64 0 0 0-64 63.936V256h127.68z' }, null, -1 ), _hoisted_381 = [_hoisted_282] function _sfc_render82(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_182, _hoisted_381) } var dish_dot_default = export_helper_default(_sfc_main82, [ ['render', _sfc_render82], ['__file', 'dish-dot.vue'] ]), _sfc_main83 = { name: 'Dish' }, _hoisted_183 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_283 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 257.152V192h-96a32 32 0 0 1 0-64h256a32 32 0 1 1 0 64h-96v65.152A448 448 0 0 1 955.52 768H68.48A448 448 0 0 1 480 257.152zM128 704h768a384 384 0 1 0-768 0zM96 832h832a32 32 0 1 1 0 64H96a32 32 0 1 1 0-64z' }, null, -1 ), _hoisted_382 = [_hoisted_283] function _sfc_render83(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_183, _hoisted_382) } var dish_default = export_helper_default(_sfc_main83, [ ['render', _sfc_render83], ['__file', 'dish.vue'] ]), _sfc_main84 = { name: 'DocumentAdd' }, _hoisted_184 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_284 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 384H576V128H192v768h640V384zm-26.496-64L640 154.496V320h165.504zM160 64h480l256 256v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm320 512V448h64v128h128v64H544v128h-64V640H352v-64h128z' }, null, -1 ), _hoisted_383 = [_hoisted_284] function _sfc_render84(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_184, _hoisted_383) } var document_add_default = export_helper_default(_sfc_main84, [ ['render', _sfc_render84], ['__file', 'document-add.vue'] ]), _sfc_main85 = { name: 'DocumentChecked' }, _hoisted_185 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_285 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M805.504 320 640 154.496V320h165.504zM832 384H576V128H192v768h640V384zM160 64h480l256 256v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm318.4 582.144 180.992-180.992L704.64 510.4 478.4 736.64 320 578.304l45.248-45.312L478.4 646.144z' }, null, -1 ), _hoisted_384 = [_hoisted_285] function _sfc_render85(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_185, _hoisted_384) } var document_checked_default = export_helper_default(_sfc_main85, [ ['render', _sfc_render85], ['__file', 'document-checked.vue'] ]), _sfc_main86 = { name: 'DocumentCopy' }, _hoisted_186 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_286 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 320v576h576V320H128zm-32-64h640a32 32 0 0 1 32 32v640a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V288a32 32 0 0 1 32-32zM960 96v704a32 32 0 0 1-32 32h-96v-64h64V128H384v64h-64V96a32 32 0 0 1 32-32h576a32 32 0 0 1 32 32zM256 672h320v64H256v-64zm0-192h320v64H256v-64z' }, null, -1 ), _hoisted_385 = [_hoisted_286] function _sfc_render86(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_186, _hoisted_385) } var document_copy_default = export_helper_default(_sfc_main86, [ ['render', _sfc_render86], ['__file', 'document-copy.vue'] ]), _sfc_main87 = { name: 'DocumentDelete' }, _hoisted_187 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_287 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M805.504 320 640 154.496V320h165.504zM832 384H576V128H192v768h640V384zM160 64h480l256 256v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm308.992 546.304-90.496-90.624 45.248-45.248 90.56 90.496 90.496-90.432 45.248 45.248-90.496 90.56 90.496 90.496-45.248 45.248-90.496-90.496-90.56 90.496-45.248-45.248 90.496-90.496z' }, null, -1 ), _hoisted_386 = [_hoisted_287] function _sfc_render87(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_187, _hoisted_386) } var document_delete_default = export_helper_default(_sfc_main87, [ ['render', _sfc_render87], ['__file', 'document-delete.vue'] ]), _sfc_main88 = { name: 'DocumentRemove' }, _hoisted_188 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_288 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M805.504 320 640 154.496V320h165.504zM832 384H576V128H192v768h640V384zM160 64h480l256 256v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm192 512h320v64H352v-64z' }, null, -1 ), _hoisted_387 = [_hoisted_288] function _sfc_render88(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_188, _hoisted_387) } var document_remove_default = export_helper_default(_sfc_main88, [ ['render', _sfc_render88], ['__file', 'document-remove.vue'] ]), _sfc_main89 = { name: 'Document' }, _hoisted_189 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_289 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 384H576V128H192v768h640V384zm-26.496-64L640 154.496V320h165.504zM160 64h480l256 256v608a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm160 448h384v64H320v-64zm0-192h160v64H320v-64zm0 384h384v64H320v-64z' }, null, -1 ), _hoisted_388 = [_hoisted_289] function _sfc_render89(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_189, _hoisted_388) } var document_default = export_helper_default(_sfc_main89, [ ['render', _sfc_render89], ['__file', 'document.vue'] ]), _sfc_main90 = { name: 'Download' }, _hoisted_190 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_290 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 832h704a32 32 0 1 1 0 64H160a32 32 0 1 1 0-64zm384-253.696 236.288-236.352 45.248 45.248L508.8 704 192 387.2l45.248-45.248L480 584.704V128h64v450.304z' }, null, -1 ), _hoisted_389 = [_hoisted_290] function _sfc_render90(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_190, _hoisted_389) } var download_default = export_helper_default(_sfc_main90, [ ['render', _sfc_render90], ['__file', 'download.vue'] ]), _sfc_main91 = { name: 'Drizzling' }, _hoisted_191 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_291 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm739.328 291.328-35.2-6.592-12.8-33.408a192.064 192.064 0 0 0-365.952 23.232l-9.92 40.896-41.472 7.04a176.32 176.32 0 0 0-146.24 173.568c0 97.28 78.72 175.936 175.808 175.936h400a192 192 0 0 0 35.776-380.672zM959.552 480a256 256 0 0 1-256 256h-400A239.808 239.808 0 0 1 63.744 496.192a240.32 240.32 0 0 1 199.488-236.8 256.128 256.128 0 0 1 487.872-30.976A256.064 256.064 0 0 1 959.552 480zM288 800h64v64h-64v-64zm192 0h64v64h-64v-64zm-96 96h64v64h-64v-64zm192 0h64v64h-64v-64zm96-96h64v64h-64v-64z' }, null, -1 ), _hoisted_390 = [_hoisted_291] function _sfc_render91(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_191, _hoisted_390) } var drizzling_default = export_helper_default(_sfc_main91, [ ['render', _sfc_render91], ['__file', 'drizzling.vue'] ]), _sfc_main92 = { name: 'EditPen' }, _hoisted_192 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_292 = createBaseVNode( 'path', { d: 'm199.04 672.64 193.984 112 224-387.968-193.92-112-224 388.032zm-23.872 60.16 32.896 148.288 144.896-45.696L175.168 732.8zM455.04 229.248l193.92 112 56.704-98.112-193.984-112-56.64 98.112zM104.32 708.8l384-665.024 304.768 175.936L409.152 884.8h.064l-248.448 78.336L104.32 708.8zm384 254.272v-64h448v64h-448z', fill: 'currentColor' }, null, -1 ), _hoisted_391 = [_hoisted_292] function _sfc_render92(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_192, _hoisted_391) } var edit_pen_default = export_helper_default(_sfc_main92, [ ['render', _sfc_render92], ['__file', 'edit-pen.vue'] ]), _sfc_main93 = { name: 'Edit' }, _hoisted_193 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_293 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 512a32 32 0 1 1 64 0v352a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h352a32 32 0 0 1 0 64H192v640h640V512z' }, null, -1 ), _hoisted_392 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm469.952 554.24 52.8-7.552L847.104 222.4a32 32 0 1 0-45.248-45.248L477.44 501.44l-7.552 52.8zm422.4-422.4a96 96 0 0 1 0 135.808l-331.84 331.84a32 32 0 0 1-18.112 9.088L436.8 623.68a32 32 0 0 1-36.224-36.224l15.104-105.6a32 32 0 0 1 9.024-18.112l331.904-331.84a96 96 0 0 1 135.744 0z' }, null, -1 ), _hoisted_430 = [_hoisted_293, _hoisted_392] function _sfc_render93(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_193, _hoisted_430) } var edit_default = export_helper_default(_sfc_main93, [ ['render', _sfc_render93], ['__file', 'edit.vue'] ]), _sfc_main94 = { name: 'ElemeFilled' }, _hoisted_194 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_294 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M176 64h672c61.824 0 112 50.176 112 112v672a112 112 0 0 1-112 112H176A112 112 0 0 1 64 848V176c0-61.824 50.176-112 112-112zm150.528 173.568c-152.896 99.968-196.544 304.064-97.408 456.96a330.688 330.688 0 0 0 456.96 96.64c9.216-5.888 17.6-11.776 25.152-18.56a18.24 18.24 0 0 0 4.224-24.32L700.352 724.8a47.552 47.552 0 0 0-65.536-14.272A234.56 234.56 0 0 1 310.592 641.6C240 533.248 271.104 387.968 379.456 316.48a234.304 234.304 0 0 1 276.352 15.168c1.664.832 2.56 2.56 3.392 4.224 5.888 8.384 3.328 19.328-5.12 25.216L456.832 489.6a47.552 47.552 0 0 0-14.336 65.472l16 24.384c5.888 8.384 16.768 10.88 25.216 5.056l308.224-199.936a19.584 19.584 0 0 0 6.72-23.488v-.896c-4.992-9.216-10.048-17.6-15.104-26.88-99.968-151.168-304.064-194.88-456.96-95.744zM786.88 504.704l-62.208 40.32c-8.32 5.888-10.88 16.768-4.992 25.216L760 632.32c5.888 8.448 16.768 11.008 25.152 5.12l31.104-20.16a55.36 55.36 0 0 0 16-76.48l-20.224-31.04a19.52 19.52 0 0 0-25.152-5.12z' }, null, -1 ), _hoisted_393 = [_hoisted_294] function _sfc_render94(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_194, _hoisted_393) } var eleme_filled_default = export_helper_default(_sfc_main94, [ ['render', _sfc_render94], ['__file', 'eleme-filled.vue'] ]), _sfc_main95 = { name: 'Eleme' }, _hoisted_195 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_295 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M300.032 188.8c174.72-113.28 408-63.36 522.24 109.44 5.76 10.56 11.52 20.16 17.28 30.72v.96a22.4 22.4 0 0 1-7.68 26.88l-352.32 228.48c-9.6 6.72-22.08 3.84-28.8-5.76l-18.24-27.84a54.336 54.336 0 0 1 16.32-74.88l225.6-146.88c9.6-6.72 12.48-19.2 5.76-28.8-.96-1.92-1.92-3.84-3.84-4.8a267.84 267.84 0 0 0-315.84-17.28c-123.84 81.6-159.36 247.68-78.72 371.52a268.096 268.096 0 0 0 370.56 78.72 54.336 54.336 0 0 1 74.88 16.32l17.28 26.88c5.76 9.6 3.84 21.12-4.8 27.84-8.64 7.68-18.24 14.4-28.8 21.12a377.92 377.92 0 0 1-522.24-110.4c-113.28-174.72-63.36-408 111.36-522.24zm526.08 305.28a22.336 22.336 0 0 1 28.8 5.76l23.04 35.52a63.232 63.232 0 0 1-18.24 87.36l-35.52 23.04c-9.6 6.72-22.08 3.84-28.8-5.76l-46.08-71.04c-6.72-9.6-3.84-22.08 5.76-28.8l71.04-46.08z' }, null, -1 ), _hoisted_394 = [_hoisted_295] function _sfc_render95(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_195, _hoisted_394) } var eleme_default = export_helper_default(_sfc_main95, [ ['render', _sfc_render95], ['__file', 'eleme.vue'] ]), _sfc_main96 = { name: 'ElementPlus' }, _hoisted_196 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_296 = createBaseVNode( 'path', { d: 'M839.7 734.7c0 33.3-17.9 41-17.9 41S519.7 949.8 499.2 960c-10.2 5.1-20.5 5.1-30.7 0 0 0-314.9-184.3-325.1-192-5.1-5.1-10.2-12.8-12.8-20.5V368.6c0-17.9 20.5-28.2 20.5-28.2L466 158.6c12.8-5.1 25.6-5.1 38.4 0 0 0 279 161.3 309.8 179.2 17.9 7.7 28.2 25.6 25.6 46.1-.1-5-.1 317.5-.1 350.8zM714.2 371.2c-64-35.8-217.6-125.4-217.6-125.4-7.7-5.1-20.5-5.1-30.7 0L217.6 389.1s-17.9 10.2-17.9 23v297c0 5.1 5.1 12.8 7.7 17.9 7.7 5.1 256 148.5 256 148.5 7.7 5.1 17.9 5.1 25.6 0 15.4-7.7 250.9-145.9 250.9-145.9s12.8-5.1 12.8-30.7v-74.2l-276.5 169v-64c0-17.9 7.7-30.7 20.5-46.1L745 535c5.1-7.7 10.2-20.5 10.2-30.7v-66.6l-279 169v-69.1c0-15.4 5.1-30.7 17.9-38.4l220.1-128zM919 135.7c0-5.1-5.1-7.7-7.7-7.7h-58.9V66.6c0-5.1-5.1-5.1-10.2-5.1l-30.7 5.1c-5.1 0-5.1 2.6-5.1 5.1V128h-56.3c-5.1 0-5.1 5.1-7.7 5.1v38.4h69.1v64c0 5.1 5.1 5.1 10.2 5.1l30.7-5.1c5.1 0 5.1-2.6 5.1-5.1v-56.3h64l-2.5-38.4z', fill: 'currentColor' }, null, -1 ), _hoisted_395 = [_hoisted_296] function _sfc_render96(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_196, _hoisted_395) } var element_plus_default = export_helper_default(_sfc_main96, [ ['render', _sfc_render96], ['__file', 'element-plus.vue'] ]), _sfc_main97 = { name: 'Expand' }, _hoisted_197 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_297 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192h768v128H128V192zm0 256h512v128H128V448zm0 256h768v128H128V704zm576-352 192 160-192 128V352z' }, null, -1 ), _hoisted_396 = [_hoisted_297] function _sfc_render97(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_197, _hoisted_396) } var expand_default = export_helper_default(_sfc_main97, [ ['render', _sfc_render97], ['__file', 'expand.vue'] ]), _sfc_main98 = { name: 'Failed' }, _hoisted_198 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_298 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm557.248 608 135.744-135.744-45.248-45.248-135.68 135.744-135.808-135.68-45.248 45.184L466.752 608l-135.68 135.68 45.184 45.312L512 653.248l135.744 135.744 45.248-45.248L557.312 608zM704 192h160v736H160V192h160v64h384v-64zm-320 0V96h256v96H384z' }, null, -1 ), _hoisted_397 = [_hoisted_298] function _sfc_render98(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_198, _hoisted_397) } var failed_default = export_helper_default(_sfc_main98, [ ['render', _sfc_render98], ['__file', 'failed.vue'] ]), _sfc_main99 = { name: 'Female' }, _hoisted_199 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_299 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 640a256 256 0 1 0 0-512 256 256 0 0 0 0 512zm0 64a320 320 0 1 1 0-640 320 320 0 0 1 0 640z' }, null, -1 ), _hoisted_398 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 640q32 0 32 32v256q0 32-32 32t-32-32V672q0-32 32-32z' }, null, -1 ), _hoisted_431 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 800h320q32 0 32 32t-32 32H352q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_59 = [_hoisted_299, _hoisted_398, _hoisted_431] function _sfc_render99(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_199, _hoisted_59) } var female_default = export_helper_default(_sfc_main99, [ ['render', _sfc_render99], ['__file', 'female.vue'] ]), _sfc_main100 = { name: 'Files' }, _hoisted_1100 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2100 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 384v448h768V384H128zm-32-64h832a32 32 0 0 1 32 32v512a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V352a32 32 0 0 1 32-32zm64-128h704v64H160zm96-128h512v64H256z' }, null, -1 ), _hoisted_399 = [_hoisted_2100] function _sfc_render100(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1100, _hoisted_399) } var files_default = export_helper_default(_sfc_main100, [ ['render', _sfc_render100], ['__file', 'files.vue'] ]), _sfc_main101 = { name: 'Film' }, _hoisted_1101 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2101 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 160v704h704V160H160zm-32-64h768a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H128a32 32 0 0 1-32-32V128a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3100 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M320 288V128h64v352h256V128h64v160h160v64H704v128h160v64H704v128h160v64H704v160h-64V544H384v352h-64V736H128v-64h192V544H128v-64h192V352H128v-64h192z' }, null, -1 ), _hoisted_432 = [_hoisted_2101, _hoisted_3100] function _sfc_render101(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1101, _hoisted_432) } var film_default = export_helper_default(_sfc_main101, [ ['render', _sfc_render101], ['__file', 'film.vue'] ]), _sfc_main102 = { name: 'Filter' }, _hoisted_1102 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2102 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 523.392V928a32 32 0 0 0 46.336 28.608l192-96A32 32 0 0 0 640 832V523.392l280.768-343.104a32 32 0 1 0-49.536-40.576l-288 352A32 32 0 0 0 576 512v300.224l-128 64V512a32 32 0 0 0-7.232-20.288L195.52 192H704a32 32 0 1 0 0-64H128a32 32 0 0 0-24.768 52.288L384 523.392z' }, null, -1 ), _hoisted_3101 = [_hoisted_2102] function _sfc_render102(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1102, _hoisted_3101) } var filter_default = export_helper_default(_sfc_main102, [ ['render', _sfc_render102], ['__file', 'filter.vue'] ]), _sfc_main103 = { name: 'Finished' }, _hoisted_1103 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2103 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M280.768 753.728 691.456 167.04a32 32 0 1 1 52.416 36.672L314.24 817.472a32 32 0 0 1-45.44 7.296l-230.4-172.8a32 32 0 0 1 38.4-51.2l203.968 152.96zM736 448a32 32 0 1 1 0-64h192a32 32 0 1 1 0 64H736zM608 640a32 32 0 0 1 0-64h319.936a32 32 0 1 1 0 64H608zM480 832a32 32 0 1 1 0-64h447.936a32 32 0 1 1 0 64H480z' }, null, -1 ), _hoisted_3102 = [_hoisted_2103] function _sfc_render103(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1103, _hoisted_3102) } var finished_default = export_helper_default(_sfc_main103, [ ['render', _sfc_render103], ['__file', 'finished.vue'] ]), _sfc_main104 = { name: 'FirstAidKit' }, _hoisted_1104 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2104 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 256a64 64 0 0 0-64 64v448a64 64 0 0 0 64 64h640a64 64 0 0 0 64-64V320a64 64 0 0 0-64-64H192zm0-64h640a128 128 0 0 1 128 128v448a128 128 0 0 1-128 128H192A128 128 0 0 1 64 768V320a128 128 0 0 1 128-128z' }, null, -1 ), _hoisted_3103 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 512h96a32 32 0 0 1 0 64h-96v96a32 32 0 0 1-64 0v-96h-96a32 32 0 0 1 0-64h96v-96a32 32 0 0 1 64 0v96zM352 128v64h320v-64H352zm-32-64h384a32 32 0 0 1 32 32v128a32 32 0 0 1-32 32H320a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_433 = [_hoisted_2104, _hoisted_3103] function _sfc_render104(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1104, _hoisted_433) } var first_aid_kit_default = export_helper_default(_sfc_main104, [ ['render', _sfc_render104], ['__file', 'first-aid-kit.vue'] ]), _sfc_main105 = { name: 'Flag' }, _hoisted_1105 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2105 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 128h608L736 384l160 256H288v320h-96V64h96v64z' }, null, -1 ), _hoisted_3104 = [_hoisted_2105] function _sfc_render105(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1105, _hoisted_3104) } var flag_default = export_helper_default(_sfc_main105, [ ['render', _sfc_render105], ['__file', 'flag.vue'] ]), _sfc_main106 = { name: 'Fold' }, _hoisted_1106 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2106 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M896 192H128v128h768V192zm0 256H384v128h512V448zm0 256H128v128h768V704zM320 384 128 512l192 128V384z' }, null, -1 ), _hoisted_3105 = [_hoisted_2106] function _sfc_render106(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1106, _hoisted_3105) } var fold_default = export_helper_default(_sfc_main106, [ ['render', _sfc_render106], ['__file', 'fold.vue'] ]), _sfc_main107 = { name: 'FolderAdd' }, _hoisted_1107 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2107 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192v640h768V320H485.76L357.504 192H128zm-32-64h287.872l128.384 128H928a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32zm384 416V416h64v128h128v64H544v128h-64V608H352v-64h128z' }, null, -1 ), _hoisted_3106 = [_hoisted_2107] function _sfc_render107(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1107, _hoisted_3106) } var folder_add_default = export_helper_default(_sfc_main107, [ ['render', _sfc_render107], ['__file', 'folder-add.vue'] ]), _sfc_main108 = { name: 'FolderChecked' }, _hoisted_1108 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2108 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192v640h768V320H485.76L357.504 192H128zm-32-64h287.872l128.384 128H928a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32zm414.08 502.144 180.992-180.992L736.32 494.4 510.08 720.64l-158.4-158.336 45.248-45.312L510.08 630.144z' }, null, -1 ), _hoisted_3107 = [_hoisted_2108] function _sfc_render108(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1108, _hoisted_3107) } var folder_checked_default = export_helper_default(_sfc_main108, [ ['render', _sfc_render108], ['__file', 'folder-checked.vue'] ]), _sfc_main109 = { name: 'FolderDelete' }, _hoisted_1109 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2109 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192v640h768V320H485.76L357.504 192H128zm-32-64h287.872l128.384 128H928a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32zm370.752 448-90.496-90.496 45.248-45.248L512 530.752l90.496-90.496 45.248 45.248L557.248 576l90.496 90.496-45.248 45.248L512 621.248l-90.496 90.496-45.248-45.248L466.752 576z' }, null, -1 ), _hoisted_3108 = [_hoisted_2109] function _sfc_render109(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1109, _hoisted_3108) } var folder_delete_default = export_helper_default(_sfc_main109, [ ['render', _sfc_render109], ['__file', 'folder-delete.vue'] ]), _sfc_main110 = { name: 'FolderOpened' }, _hoisted_1110 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2110 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M878.08 448H241.92l-96 384h636.16l96-384zM832 384v-64H485.76L357.504 192H128v448l57.92-231.744A32 32 0 0 1 216.96 384H832zm-24.96 512H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h287.872l128.384 128H864a32 32 0 0 1 32 32v96h23.04a32 32 0 0 1 31.04 39.744l-112 448A32 32 0 0 1 807.04 896z' }, null, -1 ), _hoisted_3109 = [_hoisted_2110] function _sfc_render110(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1110, _hoisted_3109) } var folder_opened_default = export_helper_default(_sfc_main110, [ ['render', _sfc_render110], ['__file', 'folder-opened.vue'] ]), _sfc_main111 = { name: 'FolderRemove' }, _hoisted_1111 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2111 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192v640h768V320H485.76L357.504 192H128zm-32-64h287.872l128.384 128H928a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32zm256 416h320v64H352v-64z' }, null, -1 ), _hoisted_3110 = [_hoisted_2111] function _sfc_render111(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1111, _hoisted_3110) } var folder_remove_default = export_helper_default(_sfc_main111, [ ['render', _sfc_render111], ['__file', 'folder-remove.vue'] ]), _sfc_main112 = { name: 'Folder' }, _hoisted_1112 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2112 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 192v640h768V320H485.76L357.504 192H128zm-32-64h287.872l128.384 128H928a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3111 = [_hoisted_2112] function _sfc_render112(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1112, _hoisted_3111) } var folder_default = export_helper_default(_sfc_main112, [ ['render', _sfc_render112], ['__file', 'folder.vue'] ]), _sfc_main113 = { name: 'Food' }, _hoisted_1113 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2113 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 352.576V352a288 288 0 0 1 491.072-204.224 192 192 0 0 1 274.24 204.48 64 64 0 0 1 57.216 74.24C921.6 600.512 850.048 710.656 736 756.992V800a96 96 0 0 1-96 96H384a96 96 0 0 1-96-96v-43.008c-114.048-46.336-185.6-156.48-214.528-330.496A64 64 0 0 1 128 352.64zm64-.576h64a160 160 0 0 1 320 0h64a224 224 0 0 0-448 0zm128 0h192a96 96 0 0 0-192 0zm439.424 0h68.544A128.256 128.256 0 0 0 704 192c-15.36 0-29.952 2.688-43.52 7.616 11.328 18.176 20.672 37.76 27.84 58.304A64.128 64.128 0 0 1 759.424 352zM672 768H352v32a32 32 0 0 0 32 32h256a32 32 0 0 0 32-32v-32zm-342.528-64h365.056c101.504-32.64 165.76-124.928 192.896-288H136.576c27.136 163.072 91.392 255.36 192.896 288z' }, null, -1 ), _hoisted_3112 = [_hoisted_2113] function _sfc_render113(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1113, _hoisted_3112) } var food_default = export_helper_default(_sfc_main113, [ ['render', _sfc_render113], ['__file', 'food.vue'] ]), _sfc_main114 = { name: 'Football' }, _hoisted_1114 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2114 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 960a448 448 0 1 1 0-896 448 448 0 0 1 0 896zm0-64a384 384 0 1 0 0-768 384 384 0 0 0 0 768z' }, null, -1 ), _hoisted_3113 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M186.816 268.288c16-16.384 31.616-31.744 46.976-46.08 17.472 30.656 39.808 58.112 65.984 81.28l-32.512 56.448a385.984 385.984 0 0 1-80.448-91.648zm653.696-5.312a385.92 385.92 0 0 1-83.776 96.96l-32.512-56.384a322.923 322.923 0 0 0 68.48-85.76c15.552 14.08 31.488 29.12 47.808 45.184zM465.984 445.248l11.136-63.104a323.584 323.584 0 0 0 69.76 0l11.136 63.104a387.968 387.968 0 0 1-92.032 0zm-62.72-12.8A381.824 381.824 0 0 1 320 396.544l32-55.424a319.885 319.885 0 0 0 62.464 27.712l-11.2 63.488zm300.8-35.84a381.824 381.824 0 0 1-83.328 35.84l-11.2-63.552A319.885 319.885 0 0 0 672 341.184l32 55.424zm-520.768 364.8a385.92 385.92 0 0 1 83.968-97.28l32.512 56.32c-26.88 23.936-49.856 52.352-67.52 84.032-16-13.44-32.32-27.712-48.96-43.072zm657.536.128a1442.759 1442.759 0 0 1-49.024 43.072 321.408 321.408 0 0 0-67.584-84.16l32.512-56.32c33.216 27.456 61.696 60.352 84.096 97.408zM465.92 578.752a387.968 387.968 0 0 1 92.032 0l-11.136 63.104a323.584 323.584 0 0 0-69.76 0l-11.136-63.104zm-62.72 12.8 11.2 63.552a319.885 319.885 0 0 0-62.464 27.712L320 627.392a381.824 381.824 0 0 1 83.264-35.84zm300.8 35.84-32 55.424a318.272 318.272 0 0 0-62.528-27.712l11.2-63.488c29.44 8.64 57.28 20.736 83.264 35.776z' }, null, -1 ), _hoisted_434 = [_hoisted_2114, _hoisted_3113] function _sfc_render114(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1114, _hoisted_434) } var football_default = export_helper_default(_sfc_main114, [ ['render', _sfc_render114], ['__file', 'football.vue'] ]), _sfc_main115 = { name: 'ForkSpoon' }, _hoisted_1115 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2115 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 410.304V96a32 32 0 0 1 64 0v314.304a96 96 0 0 0 64-90.56V96a32 32 0 0 1 64 0v223.744a160 160 0 0 1-128 156.8V928a32 32 0 1 1-64 0V476.544a160 160 0 0 1-128-156.8V96a32 32 0 0 1 64 0v223.744a96 96 0 0 0 64 90.56zM672 572.48C581.184 552.128 512 446.848 512 320c0-141.44 85.952-256 192-256s192 114.56 192 256c0 126.848-69.184 232.128-160 252.48V928a32 32 0 1 1-64 0V572.48zM704 512c66.048 0 128-82.56 128-192s-61.952-192-128-192-128 82.56-128 192 61.952 192 128 192z' }, null, -1 ), _hoisted_3114 = [_hoisted_2115] function _sfc_render115(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1115, _hoisted_3114) } var fork_spoon_default = export_helper_default(_sfc_main115, [ ['render', _sfc_render115], ['__file', 'fork-spoon.vue'] ]), _sfc_main116 = { name: 'Fries' }, _hoisted_1116 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2116 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M608 224v-64a32 32 0 0 0-64 0v336h26.88A64 64 0 0 0 608 484.096V224zm101.12 160A64 64 0 0 0 672 395.904V384h64V224a32 32 0 1 0-64 0v160h37.12zm74.88 0a92.928 92.928 0 0 1 91.328 110.08l-60.672 323.584A96 96 0 0 1 720.32 896H303.68a96 96 0 0 1-94.336-78.336L148.672 494.08A92.928 92.928 0 0 1 240 384h-16V224a96 96 0 0 1 188.608-25.28A95.744 95.744 0 0 1 480 197.44V160a96 96 0 0 1 188.608-25.28A96 96 0 0 1 800 224v160h-16zM670.784 512a128 128 0 0 1-99.904 48H453.12a128 128 0 0 1-99.84-48H352v-1.536a128.128 128.128 0 0 1-9.984-14.976L314.88 448H240a28.928 28.928 0 0 0-28.48 34.304L241.088 640h541.824l29.568-157.696A28.928 28.928 0 0 0 784 448h-74.88l-27.136 47.488A132.405 132.405 0 0 1 672 510.464V512h-1.216zM480 288a32 32 0 0 0-64 0v196.096A64 64 0 0 0 453.12 496H480V288zm-128 96V224a32 32 0 0 0-64 0v160h64-37.12A64 64 0 0 1 352 395.904zm-98.88 320 19.072 101.888A32 32 0 0 0 303.68 832h416.64a32 32 0 0 0 31.488-26.112L770.88 704H253.12z' }, null, -1 ), _hoisted_3115 = [_hoisted_2116] function _sfc_render116(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1116, _hoisted_3115) } var fries_default = export_helper_default(_sfc_main116, [ ['render', _sfc_render116], ['__file', 'fries.vue'] ]), _sfc_main117 = { name: 'FullScreen' }, _hoisted_1117 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2117 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm160 96.064 192 .192a32 32 0 0 1 0 64l-192-.192V352a32 32 0 0 1-64 0V96h64v.064zm0 831.872V928H96V672a32 32 0 1 1 64 0v191.936l192-.192a32 32 0 1 1 0 64l-192 .192zM864 96.064V96h64v256a32 32 0 1 1-64 0V160.064l-192 .192a32 32 0 1 1 0-64l192-.192zm0 831.872-192-.192a32 32 0 0 1 0-64l192 .192V672a32 32 0 1 1 64 0v256h-64v-.064z' }, null, -1 ), _hoisted_3116 = [_hoisted_2117] function _sfc_render117(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1117, _hoisted_3116) } var full_screen_default = export_helper_default(_sfc_main117, [ ['render', _sfc_render117], ['__file', 'full-screen.vue'] ]), _sfc_main118 = { name: 'GobletFull' }, _hoisted_1118 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2118 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 320h512c0-78.592-12.608-142.4-36.928-192h-434.24C269.504 192.384 256 256.256 256 320zm503.936 64H264.064a256.128 256.128 0 0 0 495.872 0zM544 638.4V896h96a32 32 0 1 1 0 64H384a32 32 0 1 1 0-64h96V638.4A320 320 0 0 1 192 320c0-85.632 21.312-170.944 64-256h512c42.688 64.32 64 149.632 64 256a320 320 0 0 1-288 318.4z' }, null, -1 ), _hoisted_3117 = [_hoisted_2118] function _sfc_render118(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1118, _hoisted_3117) } var goblet_full_default = export_helper_default(_sfc_main118, [ ['render', _sfc_render118], ['__file', 'goblet-full.vue'] ]), _sfc_main119 = { name: 'GobletSquareFull' }, _hoisted_1119 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2119 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 270.912c10.048 6.72 22.464 14.912 28.992 18.624a220.16 220.16 0 0 0 114.752 30.72c30.592 0 49.408-9.472 91.072-41.152l.64-.448c52.928-40.32 82.368-55.04 132.288-54.656 55.552.448 99.584 20.8 142.72 57.408l1.536 1.28V128H256v142.912zm.96 76.288C266.368 482.176 346.88 575.872 512 576c157.44.064 237.952-85.056 253.248-209.984a952.32 952.32 0 0 1-40.192-35.712c-32.704-27.776-63.36-41.92-101.888-42.24-31.552-.256-50.624 9.28-93.12 41.6l-.576.448c-52.096 39.616-81.024 54.208-129.792 54.208-54.784 0-100.48-13.376-142.784-37.056zM480 638.848C250.624 623.424 192 442.496 192 319.68V96a32 32 0 0 1 32-32h576a32 32 0 0 1 32 32v224c0 122.816-58.624 303.68-288 318.912V896h96a32 32 0 1 1 0 64H384a32 32 0 1 1 0-64h96V638.848z' }, null, -1 ), _hoisted_3118 = [_hoisted_2119] function _sfc_render119(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1119, _hoisted_3118) } var goblet_square_full_default = export_helper_default(_sfc_main119, [ ['render', _sfc_render119], ['__file', 'goblet-square-full.vue'] ]), _sfc_main120 = { name: 'GobletSquare' }, _hoisted_1120 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2120 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 638.912V896h96a32 32 0 1 1 0 64H384a32 32 0 1 1 0-64h96V638.848C250.624 623.424 192 442.496 192 319.68V96a32 32 0 0 1 32-32h576a32 32 0 0 1 32 32v224c0 122.816-58.624 303.68-288 318.912zM256 319.68c0 149.568 80 256.192 256 256.256C688.128 576 768 469.568 768 320V128H256v191.68z' }, null, -1 ), _hoisted_3119 = [_hoisted_2120] function _sfc_render120(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1120, _hoisted_3119) } var goblet_square_default = export_helper_default(_sfc_main120, [ ['render', _sfc_render120], ['__file', 'goblet-square.vue'] ]), _sfc_main121 = { name: 'Goblet' }, _hoisted_1121 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2121 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 638.4V896h96a32 32 0 1 1 0 64H384a32 32 0 1 1 0-64h96V638.4A320 320 0 0 1 192 320c0-85.632 21.312-170.944 64-256h512c42.688 64.32 64 149.632 64 256a320 320 0 0 1-288 318.4zM256 320a256 256 0 1 0 512 0c0-78.592-12.608-142.4-36.928-192h-434.24C269.504 192.384 256 256.256 256 320z' }, null, -1 ), _hoisted_3120 = [_hoisted_2121] function _sfc_render121(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1121, _hoisted_3120) } var goblet_default = export_helper_default(_sfc_main121, [ ['render', _sfc_render121], ['__file', 'goblet.vue'] ]), _sfc_main122 = { name: 'GoodsFilled' }, _hoisted_1122 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2122 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 352h640l64 544H128l64-544zm128 224h64V448h-64v128zm320 0h64V448h-64v128zM384 288h-64a192 192 0 1 1 384 0h-64a128 128 0 1 0-256 0z' }, null, -1 ), _hoisted_3121 = [_hoisted_2122] function _sfc_render122(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1122, _hoisted_3121) } var goods_filled_default = export_helper_default(_sfc_main122, [ ['render', _sfc_render122], ['__file', 'goods-filled.vue'] ]), _sfc_main123 = { name: 'Goods' }, _hoisted_1123 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2123 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M320 288v-22.336C320 154.688 405.504 64 512 64s192 90.688 192 201.664v22.4h131.072a32 32 0 0 1 31.808 28.8l57.6 576a32 32 0 0 1-31.808 35.2H131.328a32 32 0 0 1-31.808-35.2l57.6-576a32 32 0 0 1 31.808-28.8H320zm64 0h256v-22.336C640 189.248 582.272 128 512 128c-70.272 0-128 61.248-128 137.664v22.4zm-64 64H217.92l-51.2 512h690.56l-51.264-512H704v96a32 32 0 1 1-64 0v-96H384v96a32 32 0 0 1-64 0v-96z' }, null, -1 ), _hoisted_3122 = [_hoisted_2123] function _sfc_render123(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1123, _hoisted_3122) } var goods_default = export_helper_default(_sfc_main123, [ ['render', _sfc_render123], ['__file', 'goods.vue'] ]), _sfc_main124 = { name: 'Grape' }, _hoisted_1124 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2124 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 195.2a160 160 0 0 1 96 60.8 160 160 0 1 1 146.24 254.976 160 160 0 0 1-128 224 160 160 0 1 1-292.48 0 160 160 0 0 1-128-224A160 160 0 1 1 384 256a160 160 0 0 1 96-60.8V128h-64a32 32 0 0 1 0-64h192a32 32 0 0 1 0 64h-64v67.2zM512 448a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm-256 0a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm128 224a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm128 224a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm128-224a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm128-224a96 96 0 1 0 0-192 96 96 0 0 0 0 192z' }, null, -1 ), _hoisted_3123 = [_hoisted_2124] function _sfc_render124(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1124, _hoisted_3123) } var grape_default = export_helper_default(_sfc_main124, [ ['render', _sfc_render124], ['__file', 'grape.vue'] ]), _sfc_main125 = { name: 'Grid' }, _hoisted_1125 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2125 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 384v256H384V384h256zm64 0h192v256H704V384zm-64 512H384V704h256v192zm64 0V704h192v192H704zm-64-768v192H384V128h256zm64 0h192v192H704V128zM320 384v256H128V384h192zm0 512H128V704h192v192zm0-768v192H128V128h192z' }, null, -1 ), _hoisted_3124 = [_hoisted_2125] function _sfc_render125(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1125, _hoisted_3124) } var grid_default = export_helper_default(_sfc_main125, [ ['render', _sfc_render125], ['__file', 'grid.vue'] ]), _sfc_main126 = { name: 'Guide' }, _hoisted_1126 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2126 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 608h-64V416h64v192zm0 160v160a32 32 0 0 1-32 32H416a32 32 0 0 1-32-32V768h64v128h128V768h64zM384 608V416h64v192h-64zm256-352h-64V128H448v128h-64V96a32 32 0 0 1 32-32h192a32 32 0 0 1 32 32v160z' }, null, -1 ), _hoisted_3125 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm220.8 256-71.232 80 71.168 80H768V256H220.8zm-14.4-64H800a32 32 0 0 1 32 32v224a32 32 0 0 1-32 32H206.4a32 32 0 0 1-23.936-10.752l-99.584-112a32 32 0 0 1 0-42.496l99.584-112A32 32 0 0 1 206.4 192zm678.784 496-71.104 80H266.816V608h547.2l71.168 80zm-56.768-144H234.88a32 32 0 0 0-32 32v224a32 32 0 0 0 32 32h593.6a32 32 0 0 0 23.936-10.752l99.584-112a32 32 0 0 0 0-42.496l-99.584-112A32 32 0 0 0 828.48 544z' }, null, -1 ), _hoisted_435 = [_hoisted_2126, _hoisted_3125] function _sfc_render126(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1126, _hoisted_435) } var guide_default = export_helper_default(_sfc_main126, [ ['render', _sfc_render126], ['__file', 'guide.vue'] ]), _sfc_main127 = { name: 'Headset' }, _hoisted_1127 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2127 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M896 529.152V512a384 384 0 1 0-768 0v17.152A128 128 0 0 1 320 640v128a128 128 0 1 1-256 0V512a448 448 0 1 1 896 0v256a128 128 0 1 1-256 0V640a128 128 0 0 1 192-110.848zM896 640a64 64 0 0 0-128 0v128a64 64 0 0 0 128 0V640zm-768 0v128a64 64 0 0 0 128 0V640a64 64 0 1 0-128 0z' }, null, -1 ), _hoisted_3126 = [_hoisted_2127] function _sfc_render127(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1127, _hoisted_3126) } var headset_default = export_helper_default(_sfc_main127, [ ['render', _sfc_render127], ['__file', 'headset.vue'] ]), _sfc_main128 = { name: 'HelpFilled' }, _hoisted_1128 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2128 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M926.784 480H701.312A192.512 192.512 0 0 0 544 322.688V97.216A416.064 416.064 0 0 1 926.784 480zm0 64A416.064 416.064 0 0 1 544 926.784V701.312A192.512 192.512 0 0 0 701.312 544h225.472zM97.28 544h225.472A192.512 192.512 0 0 0 480 701.312v225.472A416.064 416.064 0 0 1 97.216 544zm0-64A416.064 416.064 0 0 1 480 97.216v225.472A192.512 192.512 0 0 0 322.688 480H97.216z' }, null, -1 ), _hoisted_3127 = [_hoisted_2128] function _sfc_render128(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1128, _hoisted_3127) } var help_filled_default = export_helper_default(_sfc_main128, [ ['render', _sfc_render128], ['__file', 'help-filled.vue'] ]), _sfc_main129 = { name: 'Help' }, _hoisted_1129 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2129 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm759.936 805.248-90.944-91.008A254.912 254.912 0 0 1 512 768a254.912 254.912 0 0 1-156.992-53.76l-90.944 91.008A382.464 382.464 0 0 0 512 896c94.528 0 181.12-34.176 247.936-90.752zm45.312-45.312A382.464 382.464 0 0 0 896 512c0-94.528-34.176-181.12-90.752-247.936l-91.008 90.944C747.904 398.4 768 452.864 768 512c0 59.136-20.096 113.6-53.76 156.992l91.008 90.944zm-45.312-541.184A382.464 382.464 0 0 0 512 128c-94.528 0-181.12 34.176-247.936 90.752l90.944 91.008A254.912 254.912 0 0 1 512 256c59.136 0 113.6 20.096 156.992 53.76l90.944-91.008zm-541.184 45.312A382.464 382.464 0 0 0 128 512c0 94.528 34.176 181.12 90.752 247.936l91.008-90.944A254.912 254.912 0 0 1 256 512c0-59.136 20.096-113.6 53.76-156.992l-91.008-90.944zm417.28 394.496a194.56 194.56 0 0 0 22.528-22.528C686.912 602.56 704 559.232 704 512a191.232 191.232 0 0 0-67.968-146.56A191.296 191.296 0 0 0 512 320a191.232 191.232 0 0 0-146.56 67.968C337.088 421.44 320 464.768 320 512a191.232 191.232 0 0 0 67.968 146.56C421.44 686.912 464.768 704 512 704c47.296 0 90.56-17.088 124.032-45.44zM512 960a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_3128 = [_hoisted_2129] function _sfc_render129(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1129, _hoisted_3128) } var help_default = export_helper_default(_sfc_main129, [ ['render', _sfc_render129], ['__file', 'help.vue'] ]), _sfc_main130 = { name: 'Hide' }, _hoisted_1130 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2130 = createBaseVNode( 'path', { d: 'M876.8 156.8c0-9.6-3.2-16-9.6-22.4-6.4-6.4-12.8-9.6-22.4-9.6-9.6 0-16 3.2-22.4 9.6L736 220.8c-64-32-137.6-51.2-224-60.8-160 16-288 73.6-377.6 176C44.8 438.4 0 496 0 512s48 73.6 134.4 176c22.4 25.6 44.8 48 73.6 67.2l-86.4 89.6c-6.4 6.4-9.6 12.8-9.6 22.4 0 9.6 3.2 16 9.6 22.4 6.4 6.4 12.8 9.6 22.4 9.6 9.6 0 16-3.2 22.4-9.6l704-710.4c3.2-6.4 6.4-12.8 6.4-22.4Zm-646.4 528c-76.8-70.4-128-128-153.6-172.8 28.8-48 80-105.6 153.6-172.8C304 272 400 230.4 512 224c64 3.2 124.8 19.2 176 44.8l-54.4 54.4C598.4 300.8 560 288 512 288c-64 0-115.2 22.4-160 64s-64 96-64 160c0 48 12.8 89.6 35.2 124.8L256 707.2c-9.6-6.4-19.2-16-25.6-22.4Zm140.8-96c-12.8-22.4-19.2-48-19.2-76.8 0-44.8 16-83.2 48-112 32-28.8 67.2-48 112-48 28.8 0 54.4 6.4 73.6 19.2L371.2 588.8ZM889.599 336c-12.8-16-28.8-28.8-41.6-41.6l-48 48c73.6 67.2 124.8 124.8 150.4 169.6-28.8 48-80 105.6-153.6 172.8-73.6 67.2-172.8 108.8-284.8 115.2-51.2-3.2-99.2-12.8-140.8-28.8l-48 48c57.6 22.4 118.4 38.4 188.8 44.8 160-16 288-73.6 377.6-176C979.199 585.6 1024 528 1024 512s-48.001-73.6-134.401-176Z', fill: 'currentColor' }, null, -1 ), _hoisted_3129 = createBaseVNode( 'path', { d: 'M511.998 672c-12.8 0-25.6-3.2-38.4-6.4l-51.2 51.2c28.8 12.8 57.6 19.2 89.6 19.2 64 0 115.2-22.4 160-64 41.6-41.6 64-96 64-160 0-32-6.4-64-19.2-89.6l-51.2 51.2c3.2 12.8 6.4 25.6 6.4 38.4 0 44.8-16 83.2-48 112-32 28.8-67.2 48-112 48Z', fill: 'currentColor' }, null, -1 ), _hoisted_436 = [_hoisted_2130, _hoisted_3129] function _sfc_render130(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1130, _hoisted_436) } var hide_default = export_helper_default(_sfc_main130, [ ['render', _sfc_render130], ['__file', 'hide.vue'] ]), _sfc_main131 = { name: 'Histogram' }, _hoisted_1131 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2131 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M416 896V128h192v768H416zm-288 0V448h192v448H128zm576 0V320h192v576H704z' }, null, -1 ), _hoisted_3130 = [_hoisted_2131] function _sfc_render131(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1131, _hoisted_3130) } var histogram_default = export_helper_default(_sfc_main131, [ ['render', _sfc_render131], ['__file', 'histogram.vue'] ]), _sfc_main132 = { name: 'HomeFilled' }, _hoisted_1132 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2132 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 128 128 447.936V896h255.936V640H640v256h255.936V447.936z' }, null, -1 ), _hoisted_3131 = [_hoisted_2132] function _sfc_render132(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1132, _hoisted_3131) } var home_filled_default = export_helper_default(_sfc_main132, [ ['render', _sfc_render132], ['__file', 'home-filled.vue'] ]), _sfc_main133 = { name: 'HotWater' }, _hoisted_1133 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2133 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M273.067 477.867h477.866V409.6H273.067v68.267zm0 68.266v51.2A187.733 187.733 0 0 0 460.8 785.067h102.4a187.733 187.733 0 0 0 187.733-187.734v-51.2H273.067zm-34.134-204.8h546.134a34.133 34.133 0 0 1 34.133 34.134v221.866a256 256 0 0 1-256 256H460.8a256 256 0 0 1-256-256V375.467a34.133 34.133 0 0 1 34.133-34.134zM512 34.133a34.133 34.133 0 0 1 34.133 34.134v170.666a34.133 34.133 0 0 1-68.266 0V68.267A34.133 34.133 0 0 1 512 34.133zM375.467 102.4a34.133 34.133 0 0 1 34.133 34.133v102.4a34.133 34.133 0 0 1-68.267 0v-102.4a34.133 34.133 0 0 1 34.134-34.133zm273.066 0a34.133 34.133 0 0 1 34.134 34.133v102.4a34.133 34.133 0 1 1-68.267 0v-102.4a34.133 34.133 0 0 1 34.133-34.133zM170.667 921.668h682.666a34.133 34.133 0 1 1 0 68.267H170.667a34.133 34.133 0 1 1 0-68.267z' }, null, -1 ), _hoisted_3132 = [_hoisted_2133] function _sfc_render133(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1133, _hoisted_3132) } var hot_water_default = export_helper_default(_sfc_main133, [ ['render', _sfc_render133], ['__file', 'hot-water.vue'] ]), _sfc_main134 = { name: 'House' }, _hoisted_1134 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2134 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 413.952V896h640V413.952L512 147.328 192 413.952zM139.52 374.4l352-293.312a32 32 0 0 1 40.96 0l352 293.312A32 32 0 0 1 896 398.976V928a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V398.976a32 32 0 0 1 11.52-24.576z' }, null, -1 ), _hoisted_3133 = [_hoisted_2134] function _sfc_render134(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1134, _hoisted_3133) } var house_default = export_helper_default(_sfc_main134, [ ['render', _sfc_render134], ['__file', 'house.vue'] ]), _sfc_main135 = { name: 'IceCreamRound' }, _hoisted_1135 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2135 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm308.352 489.344 226.304 226.304a32 32 0 0 0 45.248 0L783.552 512A192 192 0 1 0 512 240.448L308.352 444.16a32 32 0 0 0 0 45.248zm135.744 226.304L308.352 851.392a96 96 0 0 1-135.744-135.744l135.744-135.744-45.248-45.248a96 96 0 0 1 0-135.808L466.752 195.2A256 256 0 0 1 828.8 557.248L625.152 760.96a96 96 0 0 1-135.808 0l-45.248-45.248zM398.848 670.4 353.6 625.152 217.856 760.896a32 32 0 0 0 45.248 45.248L398.848 670.4zm248.96-384.64a32 32 0 0 1 0 45.248L466.624 512a32 32 0 1 1-45.184-45.248l180.992-181.056a32 32 0 0 1 45.248 0zm90.496 90.496a32 32 0 0 1 0 45.248L557.248 602.496A32 32 0 1 1 512 557.248l180.992-180.992a32 32 0 0 1 45.312 0z' }, null, -1 ), _hoisted_3134 = [_hoisted_2135] function _sfc_render135(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1135, _hoisted_3134) } var ice_cream_round_default = export_helper_default(_sfc_main135, [ ['render', _sfc_render135], ['__file', 'ice-cream-round.vue'] ]), _sfc_main136 = { name: 'IceCreamSquare' }, _hoisted_1136 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2136 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M416 640h256a32 32 0 0 0 32-32V160a32 32 0 0 0-32-32H352a32 32 0 0 0-32 32v448a32 32 0 0 0 32 32h64zm192 64v160a96 96 0 0 1-192 0V704h-64a96 96 0 0 1-96-96V160a96 96 0 0 1 96-96h320a96 96 0 0 1 96 96v448a96 96 0 0 1-96 96h-64zm-64 0h-64v160a32 32 0 1 0 64 0V704z' }, null, -1 ), _hoisted_3135 = [_hoisted_2136] function _sfc_render136(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1136, _hoisted_3135) } var ice_cream_square_default = export_helper_default(_sfc_main136, [ ['render', _sfc_render136], ['__file', 'ice-cream-square.vue'] ]), _sfc_main137 = { name: 'IceCream' }, _hoisted_1137 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2137 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128.64 448a208 208 0 0 1 193.536-191.552 224 224 0 0 1 445.248 15.488A208.128 208.128 0 0 1 894.784 448H896L548.8 983.68a32 32 0 0 1-53.248.704L128 448h.64zm64.256 0h286.208a144 144 0 0 0-286.208 0zm351.36 0h286.272a144 144 0 0 0-286.272 0zm-294.848 64 271.808 396.608L778.24 512H249.408zM511.68 352.64a207.872 207.872 0 0 1 189.184-96.192 160 160 0 0 0-314.752 5.632c52.608 12.992 97.28 46.08 125.568 90.56z' }, null, -1 ), _hoisted_3136 = [_hoisted_2137] function _sfc_render137(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1137, _hoisted_3136) } var ice_cream_default = export_helper_default(_sfc_main137, [ ['render', _sfc_render137], ['__file', 'ice-cream.vue'] ]), _sfc_main138 = { name: 'IceDrink' }, _hoisted_1138 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2138 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 448v128h239.68l16.064-128H512zm-64 0H256.256l16.064 128H448V448zm64-255.36V384h247.744A256.128 256.128 0 0 0 512 192.64zm-64 8.064A256.448 256.448 0 0 0 264.256 384H448V200.704zm64-72.064A320.128 320.128 0 0 1 825.472 384H896a32 32 0 1 1 0 64h-64v1.92l-56.96 454.016A64 64 0 0 1 711.552 960H312.448a64 64 0 0 1-63.488-56.064L192 449.92V448h-64a32 32 0 0 1 0-64h70.528A320.384 320.384 0 0 1 448 135.04V96a96 96 0 0 1 96-96h128a32 32 0 1 1 0 64H544a32 32 0 0 0-32 32v32.64zM743.68 640H280.32l32.128 256h399.104l32.128-256z' }, null, -1 ), _hoisted_3137 = [_hoisted_2138] function _sfc_render138(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1138, _hoisted_3137) } var ice_drink_default = export_helper_default(_sfc_main138, [ ['render', _sfc_render138], ['__file', 'ice-drink.vue'] ]), _sfc_main139 = { name: 'IceTea' }, _hoisted_1139 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2139 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M197.696 259.648a320.128 320.128 0 0 1 628.608 0A96 96 0 0 1 896 352v64a96 96 0 0 1-71.616 92.864l-49.408 395.072A64 64 0 0 1 711.488 960H312.512a64 64 0 0 1-63.488-56.064l-49.408-395.072A96 96 0 0 1 128 416v-64a96 96 0 0 1 69.696-92.352zM264.064 256h495.872a256.128 256.128 0 0 0-495.872 0zm495.424 256H264.512l48 384h398.976l48-384zM224 448h576a32 32 0 0 0 32-32v-64a32 32 0 0 0-32-32H224a32 32 0 0 0-32 32v64a32 32 0 0 0 32 32zm160 192h64v64h-64v-64zm192 64h64v64h-64v-64zm-128 64h64v64h-64v-64zm64-192h64v64h-64v-64z' }, null, -1 ), _hoisted_3138 = [_hoisted_2139] function _sfc_render139(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1139, _hoisted_3138) } var ice_tea_default = export_helper_default(_sfc_main139, [ ['render', _sfc_render139], ['__file', 'ice-tea.vue'] ]), _sfc_main140 = { name: 'InfoFilled' }, _hoisted_1140 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2140 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896.064A448 448 0 0 1 512 64zm67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344zM590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 0 1-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 0 1 7.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z' }, null, -1 ), _hoisted_3139 = [_hoisted_2140] function _sfc_render140(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1140, _hoisted_3139) } var info_filled_default = export_helper_default(_sfc_main140, [ ['render', _sfc_render140], ['__file', 'info-filled.vue'] ]), _sfc_main141 = { name: 'Iphone' }, _hoisted_1141 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2141 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 768v96.064a64 64 0 0 0 64 64h448a64 64 0 0 0 64-64V768H224zm0-64h576V160a64 64 0 0 0-64-64H288a64 64 0 0 0-64 64v544zm32 288a96 96 0 0 1-96-96V128a96 96 0 0 1 96-96h512a96 96 0 0 1 96 96v768a96 96 0 0 1-96 96H256zm304-144a48 48 0 1 1-96 0 48 48 0 0 1 96 0z' }, null, -1 ), _hoisted_3140 = [_hoisted_2141] function _sfc_render141(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1141, _hoisted_3140) } var iphone_default = export_helper_default(_sfc_main141, [ ['render', _sfc_render141], ['__file', 'iphone.vue'] ]), _sfc_main142 = { name: 'Key' }, _hoisted_1142 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2142 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 456.064V96a32 32 0 0 1 32-32.064L672 64a32 32 0 0 1 0 64H512v128h160a32 32 0 0 1 0 64H512v128a256 256 0 1 1-64 8.064zM512 896a192 192 0 1 0 0-384 192 192 0 0 0 0 384z' }, null, -1 ), _hoisted_3141 = [_hoisted_2142] function _sfc_render142(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1142, _hoisted_3141) } var key_default = export_helper_default(_sfc_main142, [ ['render', _sfc_render142], ['__file', 'key.vue'] ]), _sfc_main143 = { name: 'KnifeFork' }, _hoisted_1143 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2143 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 410.56V96a32 32 0 0 1 64 0v314.56A96 96 0 0 0 384 320V96a32 32 0 0 1 64 0v224a160 160 0 0 1-128 156.8V928a32 32 0 1 1-64 0V476.8A160 160 0 0 1 128 320V96a32 32 0 0 1 64 0v224a96 96 0 0 0 64 90.56zm384-250.24V544h126.72c-3.328-78.72-12.928-147.968-28.608-207.744-14.336-54.528-46.848-113.344-98.112-175.872zM640 608v320a32 32 0 1 1-64 0V64h64c85.312 89.472 138.688 174.848 160 256 21.312 81.152 32 177.152 32 288H640z' }, null, -1 ), _hoisted_3142 = [_hoisted_2143] function _sfc_render143(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1143, _hoisted_3142) } var knife_fork_default = export_helper_default(_sfc_main143, [ ['render', _sfc_render143], ['__file', 'knife-fork.vue'] ]), _sfc_main144 = { name: 'Lightning' }, _hoisted_1144 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2144 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 671.36v64.128A239.808 239.808 0 0 1 63.744 496.192a240.32 240.32 0 0 1 199.488-236.8 256.128 256.128 0 0 1 487.872-30.976A256.064 256.064 0 0 1 736 734.016v-64.768a192 192 0 0 0 3.328-377.92l-35.2-6.592-12.8-33.408a192.064 192.064 0 0 0-365.952 23.232l-9.92 40.896-41.472 7.04a176.32 176.32 0 0 0-146.24 173.568c0 91.968 70.464 167.36 160.256 175.232z' }, null, -1 ), _hoisted_3143 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M416 736a32 32 0 0 1-27.776-47.872l128-224a32 32 0 1 1 55.552 31.744L471.168 672H608a32 32 0 0 1 27.776 47.872l-128 224a32 32 0 1 1-55.68-31.744L552.96 736H416z' }, null, -1 ), _hoisted_437 = [_hoisted_2144, _hoisted_3143] function _sfc_render144(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1144, _hoisted_437) } var lightning_default = export_helper_default(_sfc_main144, [ ['render', _sfc_render144], ['__file', 'lightning.vue'] ]), _sfc_main145 = { name: 'Link' }, _hoisted_1145 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2145 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M715.648 625.152 670.4 579.904l90.496-90.56c75.008-74.944 85.12-186.368 22.656-248.896-62.528-62.464-173.952-52.352-248.96 22.656L444.16 353.6l-45.248-45.248 90.496-90.496c100.032-99.968 251.968-110.08 339.456-22.656 87.488 87.488 77.312 239.424-22.656 339.456l-90.496 90.496zm-90.496 90.496-90.496 90.496C434.624 906.112 282.688 916.224 195.2 828.8c-87.488-87.488-77.312-239.424 22.656-339.456l90.496-90.496 45.248 45.248-90.496 90.56c-75.008 74.944-85.12 186.368-22.656 248.896 62.528 62.464 173.952 52.352 248.96-22.656l90.496-90.496 45.248 45.248zm0-362.048 45.248 45.248L398.848 670.4 353.6 625.152 625.152 353.6z' }, null, -1 ), _hoisted_3144 = [_hoisted_2145] function _sfc_render145(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1145, _hoisted_3144) } var link_default = export_helper_default(_sfc_main145, [ ['render', _sfc_render145], ['__file', 'link.vue'] ]), _sfc_main146 = { name: 'List' }, _hoisted_1146 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2146 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 192h160v736H160V192h160v64h384v-64zM288 512h448v-64H288v64zm0 256h448v-64H288v64zm96-576V96h256v96H384z' }, null, -1 ), _hoisted_3145 = [_hoisted_2146] function _sfc_render146(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1146, _hoisted_3145) } var list_default = export_helper_default(_sfc_main146, [ ['render', _sfc_render146], ['__file', 'list.vue'] ]), _sfc_main147 = { name: 'Loading' }, _hoisted_1147 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2147 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a32 32 0 0 1 32 32v192a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32zm0 640a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V736a32 32 0 0 1 32-32zm448-192a32 32 0 0 1-32 32H736a32 32 0 1 1 0-64h192a32 32 0 0 1 32 32zm-640 0a32 32 0 0 1-32 32H96a32 32 0 0 1 0-64h192a32 32 0 0 1 32 32zM195.2 195.2a32 32 0 0 1 45.248 0L376.32 331.008a32 32 0 0 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm452.544 452.544a32 32 0 0 1 45.248 0L828.8 783.552a32 32 0 0 1-45.248 45.248L647.744 692.992a32 32 0 0 1 0-45.248zM828.8 195.264a32 32 0 0 1 0 45.184L692.992 376.32a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0zm-452.544 452.48a32 32 0 0 1 0 45.248L240.448 828.8a32 32 0 0 1-45.248-45.248l135.808-135.808a32 32 0 0 1 45.248 0z' }, null, -1 ), _hoisted_3146 = [_hoisted_2147] function _sfc_render147(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1147, _hoisted_3146) } var loading_default = export_helper_default(_sfc_main147, [ ['render', _sfc_render147], ['__file', 'loading.vue'] ]), _sfc_main148 = { name: 'LocationFilled' }, _hoisted_1148 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2148 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 928c23.936 0 117.504-68.352 192.064-153.152C803.456 661.888 864 535.808 864 416c0-189.632-155.84-320-352-320S160 226.368 160 416c0 120.32 60.544 246.4 159.936 359.232C394.432 859.84 488 928 512 928zm0-435.2a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 140.8a204.8 204.8 0 1 1 0-409.6 204.8 204.8 0 0 1 0 409.6z' }, null, -1 ), _hoisted_3147 = [_hoisted_2148] function _sfc_render148(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1148, _hoisted_3147) } var location_filled_default = export_helper_default(_sfc_main148, [ ['render', _sfc_render148], ['__file', 'location-filled.vue'] ]), _sfc_main149 = { name: 'LocationInformation' }, _hoisted_1149 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2149 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 896h448q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_3148 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M800 416a288 288 0 1 0-576 0c0 118.144 94.528 272.128 288 456.576C705.472 688.128 800 534.144 800 416zM512 960C277.312 746.688 160 565.312 160 416a352 352 0 0 1 704 0c0 149.312-117.312 330.688-352 544z' }, null, -1 ), _hoisted_438 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 512a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm0 64a160 160 0 1 1 0-320 160 160 0 0 1 0 320z' }, null, -1 ), _hoisted_510 = [_hoisted_2149, _hoisted_3148, _hoisted_438] function _sfc_render149(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1149, _hoisted_510) } var location_information_default = export_helper_default(_sfc_main149, [ ['render', _sfc_render149], ['__file', 'location-information.vue'] ]), _sfc_main150 = { name: 'Location' }, _hoisted_1150 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2150 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M800 416a288 288 0 1 0-576 0c0 118.144 94.528 272.128 288 456.576C705.472 688.128 800 534.144 800 416zM512 960C277.312 746.688 160 565.312 160 416a352 352 0 0 1 704 0c0 149.312-117.312 330.688-352 544z' }, null, -1 ), _hoisted_3149 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 512a96 96 0 1 0 0-192 96 96 0 0 0 0 192zm0 64a160 160 0 1 1 0-320 160 160 0 0 1 0 320z' }, null, -1 ), _hoisted_439 = [_hoisted_2150, _hoisted_3149] function _sfc_render150(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1150, _hoisted_439) } var location_default = export_helper_default(_sfc_main150, [ ['render', _sfc_render150], ['__file', 'location.vue'] ]), _sfc_main151 = { name: 'Lock' }, _hoisted_1151 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2151 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 448a32 32 0 0 0-32 32v384a32 32 0 0 0 32 32h576a32 32 0 0 0 32-32V480a32 32 0 0 0-32-32H224zm0-64h576a96 96 0 0 1 96 96v384a96 96 0 0 1-96 96H224a96 96 0 0 1-96-96V480a96 96 0 0 1 96-96z' }, null, -1 ), _hoisted_3150 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 544a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V576a32 32 0 0 1 32-32zm192-160v-64a192 192 0 1 0-384 0v64h384zM512 64a256 256 0 0 1 256 256v128H256V320A256 256 0 0 1 512 64z' }, null, -1 ), _hoisted_440 = [_hoisted_2151, _hoisted_3150] function _sfc_render151(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1151, _hoisted_440) } var lock_default = export_helper_default(_sfc_main151, [ ['render', _sfc_render151], ['__file', 'lock.vue'] ]), _sfc_main152 = { name: 'Lollipop' }, _hoisted_1152 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2152 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M513.28 448a64 64 0 1 1 76.544 49.728A96 96 0 0 0 768 448h64a160 160 0 0 1-320 0h1.28zm-126.976-29.696a256 256 0 1 0 43.52-180.48A256 256 0 0 1 832 448h-64a192 192 0 0 0-381.696-29.696zm105.664 249.472L285.696 874.048a96 96 0 0 1-135.68-135.744l206.208-206.272a320 320 0 1 1 135.744 135.744zm-54.464-36.032a321.92 321.92 0 0 1-45.248-45.248L195.2 783.552a32 32 0 1 0 45.248 45.248l197.056-197.12z' }, null, -1 ), _hoisted_3151 = [_hoisted_2152] function _sfc_render152(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1152, _hoisted_3151) } var lollipop_default = export_helper_default(_sfc_main152, [ ['render', _sfc_render152], ['__file', 'lollipop.vue'] ]), _sfc_main153 = { name: 'MagicStick' }, _hoisted_1153 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2153 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64h64v192h-64V64zm0 576h64v192h-64V640zM160 480v-64h192v64H160zm576 0v-64h192v64H736zM249.856 199.04l45.248-45.184L430.848 289.6 385.6 334.848 249.856 199.104zM657.152 606.4l45.248-45.248 135.744 135.744-45.248 45.248L657.152 606.4zM114.048 923.2 68.8 877.952l316.8-316.8 45.248 45.248-316.8 316.8zM702.4 334.848 657.152 289.6l135.744-135.744 45.248 45.248L702.4 334.848z' }, null, -1 ), _hoisted_3152 = [_hoisted_2153] function _sfc_render153(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1153, _hoisted_3152) } var magic_stick_default = export_helper_default(_sfc_main153, [ ['render', _sfc_render153], ['__file', 'magic-stick.vue'] ]), _sfc_main154 = { name: 'Magnet' }, _hoisted_1154 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2154 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 320V192H704v320a192 192 0 1 1-384 0V192H192v128h128v64H192v128a320 320 0 0 0 640 0V384H704v-64h128zM640 512V128h256v384a384 384 0 1 1-768 0V128h256v384a128 128 0 1 0 256 0z' }, null, -1 ), _hoisted_3153 = [_hoisted_2154] function _sfc_render154(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1154, _hoisted_3153) } var magnet_default = export_helper_default(_sfc_main154, [ ['render', _sfc_render154], ['__file', 'magnet.vue'] ]), _sfc_main155 = { name: 'Male' }, _hoisted_1155 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2155 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M399.5 849.5a225 225 0 1 0 0-450 225 225 0 0 0 0 450zm0 56.25a281.25 281.25 0 1 1 0-562.5 281.25 281.25 0 0 1 0 562.5zm253.125-787.5h225q28.125 0 28.125 28.125T877.625 174.5h-225q-28.125 0-28.125-28.125t28.125-28.125z' }, null, -1 ), _hoisted_3154 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M877.625 118.25q28.125 0 28.125 28.125v225q0 28.125-28.125 28.125T849.5 371.375v-225q0-28.125 28.125-28.125z' }, null, -1 ), _hoisted_441 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M604.813 458.9 565.1 419.131l292.613-292.668 39.825 39.824z' }, null, -1 ), _hoisted_511 = [_hoisted_2155, _hoisted_3154, _hoisted_441] function _sfc_render155(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1155, _hoisted_511) } var male_default = export_helper_default(_sfc_main155, [ ['render', _sfc_render155], ['__file', 'male.vue'] ]), _sfc_main156 = { name: 'Management' }, _hoisted_1156 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2156 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M576 128v288l96-96 96 96V128h128v768H320V128h256zm-448 0h128v768H128V128z' }, null, -1 ), _hoisted_3155 = [_hoisted_2156] function _sfc_render156(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1156, _hoisted_3155) } var management_default = export_helper_default(_sfc_main156, [ ['render', _sfc_render156], ['__file', 'management.vue'] ]), _sfc_main157 = { name: 'MapLocation' }, _hoisted_1157 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2157 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M800 416a288 288 0 1 0-576 0c0 118.144 94.528 272.128 288 456.576C705.472 688.128 800 534.144 800 416zM512 960C277.312 746.688 160 565.312 160 416a352 352 0 0 1 704 0c0 149.312-117.312 330.688-352 544z' }, null, -1 ), _hoisted_3156 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 448a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256zm345.6 192L960 960H672v-64H352v64H64l102.4-256h691.2zm-68.928 0H235.328l-76.8 192h706.944l-76.8-192z' }, null, -1 ), _hoisted_442 = [_hoisted_2157, _hoisted_3156] function _sfc_render157(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1157, _hoisted_442) } var map_location_default = export_helper_default(_sfc_main157, [ ['render', _sfc_render157], ['__file', 'map-location.vue'] ]), _sfc_main158 = { name: 'Medal' }, _hoisted_1158 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2158 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a256 256 0 1 0 0-512 256 256 0 0 0 0 512zm0 64a320 320 0 1 1 0-640 320 320 0 0 1 0 640z' }, null, -1 ), _hoisted_3157 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M576 128H448v200a286.72 286.72 0 0 1 64-8c19.52 0 40.832 2.688 64 8V128zm64 0v219.648c24.448 9.088 50.56 20.416 78.4 33.92L757.44 128H640zm-256 0H266.624l39.04 253.568c27.84-13.504 53.888-24.832 78.336-33.92V128zM229.312 64h565.376a32 32 0 0 1 31.616 36.864L768 480c-113.792-64-199.104-96-256-96-56.896 0-142.208 32-256 96l-58.304-379.136A32 32 0 0 1 229.312 64z' }, null, -1 ), _hoisted_443 = [_hoisted_2158, _hoisted_3157] function _sfc_render158(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1158, _hoisted_443) } var medal_default = export_helper_default(_sfc_main158, [ ['render', _sfc_render158], ['__file', 'medal.vue'] ]), _sfc_main159 = { name: 'Menu' }, _hoisted_1159 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2159 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 448a32 32 0 0 1-32-32V160.064a32 32 0 0 1 32-32h256a32 32 0 0 1 32 32V416a32 32 0 0 1-32 32H160zm448 0a32 32 0 0 1-32-32V160.064a32 32 0 0 1 32-32h255.936a32 32 0 0 1 32 32V416a32 32 0 0 1-32 32H608zM160 896a32 32 0 0 1-32-32V608a32 32 0 0 1 32-32h256a32 32 0 0 1 32 32v256a32 32 0 0 1-32 32H160zm448 0a32 32 0 0 1-32-32V608a32 32 0 0 1 32-32h255.936a32 32 0 0 1 32 32v256a32 32 0 0 1-32 32H608z' }, null, -1 ), _hoisted_3158 = [_hoisted_2159] function _sfc_render159(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1159, _hoisted_3158) } var menu_default = export_helper_default(_sfc_main159, [ ['render', _sfc_render159], ['__file', 'menu.vue'] ]), _sfc_main160 = { name: 'MessageBox' }, _hoisted_1160 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2160 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 384h448v64H288v-64zm96-128h256v64H384v-64zM131.456 512H384v128h256V512h252.544L721.856 192H302.144L131.456 512zM896 576H704v128H320V576H128v256h768V576zM275.776 128h472.448a32 32 0 0 1 28.608 17.664l179.84 359.552A32 32 0 0 1 960 519.552V864a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V519.552a32 32 0 0 1 3.392-14.336l179.776-359.552A32 32 0 0 1 275.776 128z' }, null, -1 ), _hoisted_3159 = [_hoisted_2160] function _sfc_render160(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1160, _hoisted_3159) } var message_box_default = export_helper_default(_sfc_main160, [ ['render', _sfc_render160], ['__file', 'message-box.vue'] ]), _sfc_main161 = { name: 'Message' }, _hoisted_1161 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2161 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 224v512a64 64 0 0 0 64 64h640a64 64 0 0 0 64-64V224H128zm0-64h768a64 64 0 0 1 64 64v512a128 128 0 0 1-128 128H192A128 128 0 0 1 64 736V224a64 64 0 0 1 64-64z' }, null, -1 ), _hoisted_3160 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M904 224 656.512 506.88a192 192 0 0 1-289.024 0L120 224h784zm-698.944 0 210.56 240.704a128 128 0 0 0 192.704 0L818.944 224H205.056z' }, null, -1 ), _hoisted_444 = [_hoisted_2161, _hoisted_3160] function _sfc_render161(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1161, _hoisted_444) } var message_default = export_helper_default(_sfc_main161, [ ['render', _sfc_render161], ['__file', 'message.vue'] ]), _sfc_main162 = { name: 'Mic' }, _hoisted_1162 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2162 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 704h160a64 64 0 0 0 64-64v-32h-96a32 32 0 0 1 0-64h96v-96h-96a32 32 0 0 1 0-64h96v-96h-96a32 32 0 0 1 0-64h96v-32a64 64 0 0 0-64-64H384a64 64 0 0 0-64 64v32h96a32 32 0 0 1 0 64h-96v96h96a32 32 0 0 1 0 64h-96v96h96a32 32 0 0 1 0 64h-96v32a64 64 0 0 0 64 64h96zm64 64v128h192a32 32 0 1 1 0 64H288a32 32 0 1 1 0-64h192V768h-96a128 128 0 0 1-128-128V192A128 128 0 0 1 384 64h256a128 128 0 0 1 128 128v448a128 128 0 0 1-128 128h-96z' }, null, -1 ), _hoisted_3161 = [_hoisted_2162] function _sfc_render162(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1162, _hoisted_3161) } var mic_default = export_helper_default(_sfc_main162, [ ['render', _sfc_render162], ['__file', 'mic.vue'] ]), _sfc_main163 = { name: 'Microphone' }, _hoisted_1163 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2163 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 128a128 128 0 0 0-128 128v256a128 128 0 1 0 256 0V256a128 128 0 0 0-128-128zm0-64a192 192 0 0 1 192 192v256a192 192 0 1 1-384 0V256A192 192 0 0 1 512 64zm-32 832v-64a288 288 0 0 1-288-288v-32a32 32 0 0 1 64 0v32a224 224 0 0 0 224 224h64a224 224 0 0 0 224-224v-32a32 32 0 1 1 64 0v32a288 288 0 0 1-288 288v64h64a32 32 0 1 1 0 64H416a32 32 0 1 1 0-64h64z' }, null, -1 ), _hoisted_3162 = [_hoisted_2163] function _sfc_render163(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1163, _hoisted_3162) } var microphone_default = export_helper_default(_sfc_main163, [ ['render', _sfc_render163], ['__file', 'microphone.vue'] ]), _sfc_main164 = { name: 'MilkTea' }, _hoisted_1164 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2164 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M416 128V96a96 96 0 0 1 96-96h128a32 32 0 1 1 0 64H512a32 32 0 0 0-32 32v32h320a96 96 0 0 1 11.712 191.296l-39.68 581.056A64 64 0 0 1 708.224 960H315.776a64 64 0 0 1-63.872-59.648l-39.616-581.056A96 96 0 0 1 224 128h192zM276.48 320l39.296 576h392.448l4.8-70.784a224.064 224.064 0 0 1 30.016-439.808L747.52 320H276.48zM224 256h576a32 32 0 1 0 0-64H224a32 32 0 0 0 0 64zm493.44 503.872 21.12-309.12a160 160 0 0 0-21.12 309.12z' }, null, -1 ), _hoisted_3163 = [_hoisted_2164] function _sfc_render164(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1164, _hoisted_3163) } var milk_tea_default = export_helper_default(_sfc_main164, [ ['render', _sfc_render164], ['__file', 'milk-tea.vue'] ]), _sfc_main165 = { name: 'Minus' }, _hoisted_1165 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2165 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 544h768a32 32 0 1 0 0-64H128a32 32 0 0 0 0 64z' }, null, -1 ), _hoisted_3164 = [_hoisted_2165] function _sfc_render165(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1165, _hoisted_3164) } var minus_default = export_helper_default(_sfc_main165, [ ['render', _sfc_render165], ['__file', 'minus.vue'] ]), _sfc_main166 = { name: 'Money' }, _hoisted_1166 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2166 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 640v192h640V384H768v-64h150.976c14.272 0 19.456 1.472 24.64 4.288a29.056 29.056 0 0 1 12.16 12.096c2.752 5.184 4.224 10.368 4.224 24.64v493.952c0 14.272-1.472 19.456-4.288 24.64a29.056 29.056 0 0 1-12.096 12.16c-5.184 2.752-10.368 4.224-24.64 4.224H233.024c-14.272 0-19.456-1.472-24.64-4.288a29.056 29.056 0 0 1-12.16-12.096c-2.688-5.184-4.224-10.368-4.224-24.576V640h64z' }, null, -1 ), _hoisted_3165 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 192H128v448h640V192zm64-22.976v493.952c0 14.272-1.472 19.456-4.288 24.64a29.056 29.056 0 0 1-12.096 12.16c-5.184 2.752-10.368 4.224-24.64 4.224H105.024c-14.272 0-19.456-1.472-24.64-4.288a29.056 29.056 0 0 1-12.16-12.096C65.536 682.432 64 677.248 64 663.04V169.024c0-14.272 1.472-19.456 4.288-24.64a29.056 29.056 0 0 1 12.096-12.16C85.568 129.536 90.752 128 104.96 128h685.952c14.272 0 19.456 1.472 24.64 4.288a29.056 29.056 0 0 1 12.16 12.096c2.752 5.184 4.224 10.368 4.224 24.64z' }, null, -1 ), _hoisted_445 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 576a160 160 0 1 1 0-320 160 160 0 0 1 0 320zm0-64a96 96 0 1 0 0-192 96 96 0 0 0 0 192z' }, null, -1 ), _hoisted_512 = [_hoisted_2166, _hoisted_3165, _hoisted_445] function _sfc_render166(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1166, _hoisted_512) } var money_default = export_helper_default(_sfc_main166, [ ['render', _sfc_render166], ['__file', 'money.vue'] ]), _sfc_main167 = { name: 'Monitor' }, _hoisted_1167 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2167 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 768v128h192a32 32 0 1 1 0 64H288a32 32 0 1 1 0-64h192V768H192A128 128 0 0 1 64 640V256a128 128 0 0 1 128-128h640a128 128 0 0 1 128 128v384a128 128 0 0 1-128 128H544zM192 192a64 64 0 0 0-64 64v384a64 64 0 0 0 64 64h640a64 64 0 0 0 64-64V256a64 64 0 0 0-64-64H192z' }, null, -1 ), _hoisted_3166 = [_hoisted_2167] function _sfc_render167(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1167, _hoisted_3166) } var monitor_default = export_helper_default(_sfc_main167, [ ['render', _sfc_render167], ['__file', 'monitor.vue'] ]), _sfc_main168 = { name: 'MoonNight' }, _hoisted_1168 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2168 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 512a448 448 0 0 1 215.872-383.296A384 384 0 0 0 213.76 640h188.8A448.256 448.256 0 0 1 384 512zM171.136 704a448 448 0 0 1 636.992-575.296A384 384 0 0 0 499.328 704h-328.32z' }, null, -1 ), _hoisted_3167 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M32 640h960q32 0 32 32t-32 32H32q-32 0-32-32t32-32zm128 128h384a32 32 0 1 1 0 64H160a32 32 0 1 1 0-64zm160 127.68 224 .256a32 32 0 0 1 32 32V928a32 32 0 0 1-32 32l-224-.384a32 32 0 0 1-32-32v-.064a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_446 = [_hoisted_2168, _hoisted_3167] function _sfc_render168(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1168, _hoisted_446) } var moon_night_default = export_helper_default(_sfc_main168, [ ['render', _sfc_render168], ['__file', 'moon-night.vue'] ]), _sfc_main169 = { name: 'Moon' }, _hoisted_1169 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2169 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M240.448 240.448a384 384 0 1 0 559.424 525.696 448 448 0 0 1-542.016-542.08 390.592 390.592 0 0 0-17.408 16.384zm181.056 362.048a384 384 0 0 0 525.632 16.384A448 448 0 1 1 405.056 76.8a384 384 0 0 0 16.448 525.696z' }, null, -1 ), _hoisted_3168 = [_hoisted_2169] function _sfc_render169(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1169, _hoisted_3168) } var moon_default = export_helper_default(_sfc_main169, [ ['render', _sfc_render169], ['__file', 'moon.vue'] ]), _sfc_main170 = { name: 'MoreFilled' }, _hoisted_1170 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2170 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M176 416a112 112 0 1 1 0 224 112 112 0 0 1 0-224zm336 0a112 112 0 1 1 0 224 112 112 0 0 1 0-224zm336 0a112 112 0 1 1 0 224 112 112 0 0 1 0-224z' }, null, -1 ), _hoisted_3169 = [_hoisted_2170] function _sfc_render170(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1170, _hoisted_3169) } var more_filled_default = export_helper_default(_sfc_main170, [ ['render', _sfc_render170], ['__file', 'more-filled.vue'] ]), _sfc_main171 = { name: 'More' }, _hoisted_1171 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2171 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M176 416a112 112 0 1 0 0 224 112 112 0 0 0 0-224m0 64a48 48 0 1 1 0 96 48 48 0 0 1 0-96zm336-64a112 112 0 1 1 0 224 112 112 0 0 1 0-224zm0 64a48 48 0 1 0 0 96 48 48 0 0 0 0-96zm336-64a112 112 0 1 1 0 224 112 112 0 0 1 0-224zm0 64a48 48 0 1 0 0 96 48 48 0 0 0 0-96z' }, null, -1 ), _hoisted_3170 = [_hoisted_2171] function _sfc_render171(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1171, _hoisted_3170) } var more_default = export_helper_default(_sfc_main171, [ ['render', _sfc_render171], ['__file', 'more.vue'] ]), _sfc_main172 = { name: 'MostlyCloudy' }, _hoisted_1172 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2172 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M737.216 357.952 704 349.824l-11.776-32a192.064 192.064 0 0 0-367.424 23.04l-8.96 39.04-39.04 8.96A192.064 192.064 0 0 0 320 768h368a207.808 207.808 0 0 0 207.808-208 208.32 208.32 0 0 0-158.592-202.048zm15.168-62.208A272.32 272.32 0 0 1 959.744 560a271.808 271.808 0 0 1-271.552 272H320a256 256 0 0 1-57.536-505.536 256.128 256.128 0 0 1 489.92-30.72z' }, null, -1 ), _hoisted_3171 = [_hoisted_2172] function _sfc_render172(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1172, _hoisted_3171) } var mostly_cloudy_default = export_helper_default(_sfc_main172, [ ['render', _sfc_render172], ['__file', 'mostly-cloudy.vue'] ]), _sfc_main173 = { name: 'Mouse' }, _hoisted_1173 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2173 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M438.144 256c-68.352 0-92.736 4.672-117.76 18.112-20.096 10.752-35.52 26.176-46.272 46.272C260.672 345.408 256 369.792 256 438.144v275.712c0 68.352 4.672 92.736 18.112 117.76 10.752 20.096 26.176 35.52 46.272 46.272C345.408 891.328 369.792 896 438.144 896h147.712c68.352 0 92.736-4.672 117.76-18.112 20.096-10.752 35.52-26.176 46.272-46.272C763.328 806.592 768 782.208 768 713.856V438.144c0-68.352-4.672-92.736-18.112-117.76a110.464 110.464 0 0 0-46.272-46.272C678.592 260.672 654.208 256 585.856 256H438.144zm0-64h147.712c85.568 0 116.608 8.96 147.904 25.6 31.36 16.768 55.872 41.344 72.576 72.64C823.104 321.536 832 352.576 832 438.08v275.84c0 85.504-8.96 116.544-25.6 147.84a174.464 174.464 0 0 1-72.64 72.576C702.464 951.104 671.424 960 585.92 960H438.08c-85.504 0-116.544-8.96-147.84-25.6a174.464 174.464 0 0 1-72.64-72.704c-16.768-31.296-25.664-62.336-25.664-147.84v-275.84c0-85.504 8.96-116.544 25.6-147.84a174.464 174.464 0 0 1 72.768-72.576c31.232-16.704 62.272-25.6 147.776-25.6z' }, null, -1 ), _hoisted_3172 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 320q32 0 32 32v128q0 32-32 32t-32-32V352q0-32 32-32zm32-96a32 32 0 0 1-64 0v-64a32 32 0 0 0-32-32h-96a32 32 0 0 1 0-64h96a96 96 0 0 1 96 96v64z' }, null, -1 ), _hoisted_447 = [_hoisted_2173, _hoisted_3172] function _sfc_render173(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1173, _hoisted_447) } var mouse_default = export_helper_default(_sfc_main173, [ ['render', _sfc_render173], ['__file', 'mouse.vue'] ]), _sfc_main174 = { name: 'Mug' }, _hoisted_1174 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2174 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M736 800V160H160v640a64 64 0 0 0 64 64h448a64 64 0 0 0 64-64zm64-544h63.552a96 96 0 0 1 96 96v224a96 96 0 0 1-96 96H800v128a128 128 0 0 1-128 128H224A128 128 0 0 1 96 800V128a32 32 0 0 1 32-32h640a32 32 0 0 1 32 32v128zm0 64v288h63.552a32 32 0 0 0 32-32V352a32 32 0 0 0-32-32H800z' }, null, -1 ), _hoisted_3173 = [_hoisted_2174] function _sfc_render174(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1174, _hoisted_3173) } var mug_default = export_helper_default(_sfc_main174, [ ['render', _sfc_render174], ['__file', 'mug.vue'] ]), _sfc_main175 = { name: 'MuteNotification' }, _hoisted_1175 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2175 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm241.216 832 63.616-64H768V448c0-42.368-10.24-82.304-28.48-117.504l46.912-47.232C815.36 331.392 832 387.84 832 448v320h96a32 32 0 1 1 0 64H241.216zm-90.24 0H96a32 32 0 1 1 0-64h96V448a320.128 320.128 0 0 1 256-313.6V128a64 64 0 1 1 128 0v6.4a319.552 319.552 0 0 1 171.648 97.088l-45.184 45.44A256 256 0 0 0 256 448v278.336L151.04 832zM448 896h128a64 64 0 0 1-128 0z' }, null, -1 ), _hoisted_3174 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M150.72 859.072a32 32 0 0 1-45.44-45.056l704-708.544a32 32 0 0 1 45.44 45.056l-704 708.544z' }, null, -1 ), _hoisted_448 = [_hoisted_2175, _hoisted_3174] function _sfc_render175(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1175, _hoisted_448) } var mute_notification_default = export_helper_default(_sfc_main175, [ ['render', _sfc_render175], ['__file', 'mute-notification.vue'] ]), _sfc_main176 = { name: 'Mute' }, _hoisted_1176 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2176 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm412.16 592.128-45.44 45.44A191.232 191.232 0 0 1 320 512V256a192 192 0 1 1 384 0v44.352l-64 64V256a128 128 0 1 0-256 0v256c0 30.336 10.56 58.24 28.16 80.128zm51.968 38.592A128 128 0 0 0 640 512v-57.152l64-64V512a192 192 0 0 1-287.68 166.528l47.808-47.808zM314.88 779.968l46.144-46.08A222.976 222.976 0 0 0 480 768h64a224 224 0 0 0 224-224v-32a32 32 0 1 1 64 0v32a288 288 0 0 1-288 288v64h64a32 32 0 1 1 0 64H416a32 32 0 1 1 0-64h64v-64c-61.44 0-118.4-19.2-165.12-52.032zM266.752 737.6A286.976 286.976 0 0 1 192 544v-32a32 32 0 0 1 64 0v32c0 56.832 21.184 108.8 56.064 148.288L266.752 737.6z' }, null, -1 ), _hoisted_3175 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M150.72 859.072a32 32 0 0 1-45.44-45.056l704-708.544a32 32 0 0 1 45.44 45.056l-704 708.544z' }, null, -1 ), _hoisted_449 = [_hoisted_2176, _hoisted_3175] function _sfc_render176(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1176, _hoisted_449) } var mute_default = export_helper_default(_sfc_main176, [ ['render', _sfc_render176], ['__file', 'mute.vue'] ]), _sfc_main177 = { name: 'NoSmoking' }, _hoisted_1177 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2177 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M440.256 576H256v128h56.256l-64 64H224a32 32 0 0 1-32-32V544a32 32 0 0 1 32-32h280.256l-64 64zm143.488 128H704V583.744L775.744 512H928a32 32 0 0 1 32 32v192a32 32 0 0 1-32 32H519.744l64-64zM768 576v128h128V576H768zm-29.696-207.552 45.248 45.248-497.856 497.856-45.248-45.248zM256 64h64v320h-64zM128 192h64v192h-64zM64 512h64v256H64z' }, null, -1 ), _hoisted_3176 = [_hoisted_2177] function _sfc_render177(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1177, _hoisted_3176) } var no_smoking_default = export_helper_default(_sfc_main177, [ ['render', _sfc_render177], ['__file', 'no-smoking.vue'] ]), _sfc_main178 = { name: 'Notebook' }, _hoisted_1178 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2178 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 128v768h640V128H192zm-32-64h704a32 32 0 0 1 32 32v832a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3177 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M672 128h64v768h-64zM96 192h128q32 0 32 32t-32 32H96q-32 0-32-32t32-32zm0 192h128q32 0 32 32t-32 32H96q-32 0-32-32t32-32zm0 192h128q32 0 32 32t-32 32H96q-32 0-32-32t32-32zm0 192h128q32 0 32 32t-32 32H96q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_450 = [_hoisted_2178, _hoisted_3177] function _sfc_render178(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1178, _hoisted_450) } var notebook_default = export_helper_default(_sfc_main178, [ ['render', _sfc_render178], ['__file', 'notebook.vue'] ]), _sfc_main179 = { name: 'Notification' }, _hoisted_1179 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2179 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 128v64H256a64 64 0 0 0-64 64v512a64 64 0 0 0 64 64h512a64 64 0 0 0 64-64V512h64v256a128 128 0 0 1-128 128H256a128 128 0 0 1-128-128V256a128 128 0 0 1 128-128h256z' }, null, -1 ), _hoisted_3178 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 384a128 128 0 1 0 0-256 128 128 0 0 0 0 256zm0 64a192 192 0 1 1 0-384 192 192 0 0 1 0 384z' }, null, -1 ), _hoisted_451 = [_hoisted_2179, _hoisted_3178] function _sfc_render179(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1179, _hoisted_451) } var notification_default = export_helper_default(_sfc_main179, [ ['render', _sfc_render179], ['__file', 'notification.vue'] ]), _sfc_main180 = { name: 'Odometer' }, _hoisted_1180 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2180 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_3179 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 512a320 320 0 1 1 640 0 32 32 0 1 1-64 0 256 256 0 1 0-512 0 32 32 0 0 1-64 0z' }, null, -1 ), _hoisted_452 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M570.432 627.84A96 96 0 1 1 509.568 608l60.992-187.776A32 32 0 1 1 631.424 440l-60.992 187.776zM502.08 734.464a32 32 0 1 0 19.84-60.928 32 32 0 0 0-19.84 60.928z' }, null, -1 ), _hoisted_513 = [_hoisted_2180, _hoisted_3179, _hoisted_452] function _sfc_render180(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1180, _hoisted_513) } var odometer_default = export_helper_default(_sfc_main180, [ ['render', _sfc_render180], ['__file', 'odometer.vue'] ]), _sfc_main181 = { name: 'OfficeBuilding' }, _hoisted_1181 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2181 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 128v704h384V128H192zm-32-64h448a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3180 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 256h256v64H256v-64zm0 192h256v64H256v-64zm0 192h256v64H256v-64zm384-128h128v64H640v-64zm0 128h128v64H640v-64zM64 832h896v64H64v-64z' }, null, -1 ), _hoisted_453 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 384v448h192V384H640zm-32-64h256a32 32 0 0 1 32 32v512a32 32 0 0 1-32 32H608a32 32 0 0 1-32-32V352a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_514 = [_hoisted_2181, _hoisted_3180, _hoisted_453] function _sfc_render181(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1181, _hoisted_514) } var office_building_default = export_helper_default(_sfc_main181, [ ['render', _sfc_render181], ['__file', 'office-building.vue'] ]), _sfc_main182 = { name: 'Open' }, _hoisted_1182 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2182 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M329.956 257.138a254.862 254.862 0 0 0 0 509.724h364.088a254.862 254.862 0 0 0 0-509.724H329.956zm0-72.818h364.088a327.68 327.68 0 1 1 0 655.36H329.956a327.68 327.68 0 1 1 0-655.36z' }, null, -1 ), _hoisted_3181 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M694.044 621.227a109.227 109.227 0 1 0 0-218.454 109.227 109.227 0 0 0 0 218.454zm0 72.817a182.044 182.044 0 1 1 0-364.088 182.044 182.044 0 0 1 0 364.088z' }, null, -1 ), _hoisted_454 = [_hoisted_2182, _hoisted_3181] function _sfc_render182(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1182, _hoisted_454) } var open_default = export_helper_default(_sfc_main182, [ ['render', _sfc_render182], ['__file', 'open.vue'] ]), _sfc_main183 = { name: 'Operation' }, _hoisted_1183 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2183 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M389.44 768a96.064 96.064 0 0 1 181.12 0H896v64H570.56a96.064 96.064 0 0 1-181.12 0H128v-64h261.44zm192-288a96.064 96.064 0 0 1 181.12 0H896v64H762.56a96.064 96.064 0 0 1-181.12 0H128v-64h453.44zm-320-288a96.064 96.064 0 0 1 181.12 0H896v64H442.56a96.064 96.064 0 0 1-181.12 0H128v-64h133.44z' }, null, -1 ), _hoisted_3182 = [_hoisted_2183] function _sfc_render183(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1183, _hoisted_3182) } var operation_default = export_helper_default(_sfc_main183, [ ['render', _sfc_render183], ['__file', 'operation.vue'] ]), _sfc_main184 = { name: 'Opportunity' }, _hoisted_1184 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2184 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 960v-64h192.064v64H384zm448-544a350.656 350.656 0 0 1-128.32 271.424C665.344 719.04 640 763.776 640 813.504V832H320v-14.336c0-48-19.392-95.36-57.216-124.992a351.552 351.552 0 0 1-128.448-344.256c25.344-136.448 133.888-248.128 269.76-276.48A352.384 352.384 0 0 1 832 416zm-544 32c0-132.288 75.904-224 192-224v-64c-154.432 0-256 122.752-256 288h64z' }, null, -1 ), _hoisted_3183 = [_hoisted_2184] function _sfc_render184(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1184, _hoisted_3183) } var opportunity_default = export_helper_default(_sfc_main184, [ ['render', _sfc_render184], ['__file', 'opportunity.vue'] ]), _sfc_main185 = { name: 'Orange' }, _hoisted_1185 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2185 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 894.72a382.336 382.336 0 0 0 215.936-89.472L577.024 622.272c-10.24 6.016-21.248 10.688-33.024 13.696v258.688zm261.248-134.784A382.336 382.336 0 0 0 894.656 544H635.968c-3.008 11.776-7.68 22.848-13.696 33.024l182.976 182.912zM894.656 480a382.336 382.336 0 0 0-89.408-215.936L622.272 446.976c6.016 10.24 10.688 21.248 13.696 33.024h258.688zm-134.72-261.248A382.336 382.336 0 0 0 544 129.344v258.688c11.776 3.008 22.848 7.68 33.024 13.696l182.912-182.976zM480 129.344a382.336 382.336 0 0 0-215.936 89.408l182.912 182.976c10.24-6.016 21.248-10.688 33.024-13.696V129.344zm-261.248 134.72A382.336 382.336 0 0 0 129.344 480h258.688c3.008-11.776 7.68-22.848 13.696-33.024L218.752 264.064zM129.344 544a382.336 382.336 0 0 0 89.408 215.936l182.976-182.912A127.232 127.232 0 0 1 388.032 544H129.344zm134.72 261.248A382.336 382.336 0 0 0 480 894.656V635.968a127.232 127.232 0 0 1-33.024-13.696L264.064 805.248zM512 960a448 448 0 1 1 0-896 448 448 0 0 1 0 896zm0-384a64 64 0 1 0 0-128 64 64 0 0 0 0 128z' }, null, -1 ), _hoisted_3184 = [_hoisted_2185] function _sfc_render185(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1185, _hoisted_3184) } var orange_default = export_helper_default(_sfc_main185, [ ['render', _sfc_render185], ['__file', 'orange.vue'] ]), _sfc_main186 = { name: 'Paperclip' }, _hoisted_1186 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2186 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M602.496 240.448A192 192 0 1 1 874.048 512l-316.8 316.8A256 256 0 0 1 195.2 466.752L602.496 59.456l45.248 45.248L240.448 512A192 192 0 0 0 512 783.552l316.8-316.8a128 128 0 1 0-181.056-181.056L353.6 579.904a32 32 0 1 0 45.248 45.248l294.144-294.144 45.312 45.248L444.096 670.4a96 96 0 1 1-135.744-135.744l294.144-294.208z' }, null, -1 ), _hoisted_3185 = [_hoisted_2186] function _sfc_render186(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1186, _hoisted_3185) } var paperclip_default = export_helper_default(_sfc_main186, [ ['render', _sfc_render186], ['__file', 'paperclip.vue'] ]), _sfc_main187 = { name: 'PartlyCloudy' }, _hoisted_1187 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2187 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M598.4 895.872H328.192a256 256 0 0 1-34.496-510.528A352 352 0 1 1 598.4 895.872zm-271.36-64h272.256a288 288 0 1 0-248.512-417.664L335.04 445.44l-34.816 3.584a192 192 0 0 0 26.88 382.848z' }, null, -1 ), _hoisted_3186 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M139.84 501.888a256 256 0 1 1 417.856-277.12c-17.728 2.176-38.208 8.448-61.504 18.816A192 192 0 1 0 189.12 460.48a6003.84 6003.84 0 0 0-49.28 41.408z' }, null, -1 ), _hoisted_455 = [_hoisted_2187, _hoisted_3186] function _sfc_render187(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1187, _hoisted_455) } var partly_cloudy_default = export_helper_default(_sfc_main187, [ ['render', _sfc_render187], ['__file', 'partly-cloudy.vue'] ]), _sfc_main188 = { name: 'Pear' }, _hoisted_1188 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2188 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M542.336 258.816a443.255 443.255 0 0 0-9.024 25.088 32 32 0 1 1-60.8-20.032l1.088-3.328a162.688 162.688 0 0 0-122.048 131.392l-17.088 102.72-20.736 15.36C256.192 552.704 224 610.88 224 672c0 120.576 126.4 224 288 224s288-103.424 288-224c0-61.12-32.192-119.296-89.728-161.92l-20.736-15.424-17.088-102.72a162.688 162.688 0 0 0-130.112-133.12zm-40.128-66.56c7.936-15.552 16.576-30.08 25.92-43.776 23.296-33.92 49.408-59.776 78.528-77.12a32 32 0 1 1 32.704 55.04c-20.544 12.224-40.064 31.552-58.432 58.304a316.608 316.608 0 0 0-9.792 15.104 226.688 226.688 0 0 1 164.48 181.568l12.8 77.248C819.456 511.36 864 587.392 864 672c0 159.04-157.568 288-352 288S160 831.04 160 672c0-84.608 44.608-160.64 115.584-213.376l12.8-77.248a226.624 226.624 0 0 1 213.76-189.184z' }, null, -1 ), _hoisted_3187 = [_hoisted_2188] function _sfc_render188(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1188, _hoisted_3187) } var pear_default = export_helper_default(_sfc_main188, [ ['render', _sfc_render188], ['__file', 'pear.vue'] ]), _sfc_main189 = { name: 'PhoneFilled' }, _hoisted_1189 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2189 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M199.232 125.568 90.624 379.008a32 32 0 0 0 6.784 35.2l512.384 512.384a32 32 0 0 0 35.2 6.784l253.44-108.608a32 32 0 0 0 10.048-52.032L769.6 633.92a32 32 0 0 0-36.928-5.952l-130.176 65.088-271.488-271.552 65.024-130.176a32 32 0 0 0-5.952-36.928L251.2 115.52a32 32 0 0 0-51.968 10.048z' }, null, -1 ), _hoisted_3188 = [_hoisted_2189] function _sfc_render189(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1189, _hoisted_3188) } var phone_filled_default = export_helper_default(_sfc_main189, [ ['render', _sfc_render189], ['__file', 'phone-filled.vue'] ]), _sfc_main190 = { name: 'Phone' }, _hoisted_1190 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2190 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M79.36 432.256 591.744 944.64a32 32 0 0 0 35.2 6.784l253.44-108.544a32 32 0 0 0 9.984-52.032l-153.856-153.92a32 32 0 0 0-36.928-6.016l-69.888 34.944L358.08 394.24l35.008-69.888a32 32 0 0 0-5.952-36.928L233.152 133.568a32 32 0 0 0-52.032 10.048L72.512 397.056a32 32 0 0 0 6.784 35.2zm60.48-29.952 81.536-190.08L325.568 316.48l-24.64 49.216-20.608 41.216 32.576 32.64 271.552 271.552 32.64 32.64 41.216-20.672 49.28-24.576 104.192 104.128-190.08 81.472L139.84 402.304zM512 320v-64a256 256 0 0 1 256 256h-64a192 192 0 0 0-192-192zm0-192V64a448 448 0 0 1 448 448h-64a384 384 0 0 0-384-384z' }, null, -1 ), _hoisted_3189 = [_hoisted_2190] function _sfc_render190(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1190, _hoisted_3189) } var phone_default = export_helper_default(_sfc_main190, [ ['render', _sfc_render190], ['__file', 'phone.vue'] ]), _sfc_main191 = { name: 'PictureFilled' }, _hoisted_1191 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2191 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M96 896a32 32 0 0 1-32-32V160a32 32 0 0 1 32-32h832a32 32 0 0 1 32 32v704a32 32 0 0 1-32 32H96zm315.52-228.48-68.928-68.928a32 32 0 0 0-45.248 0L128 768.064h778.688l-242.112-290.56a32 32 0 0 0-49.216 0L458.752 665.408a32 32 0 0 1-47.232 2.112zM256 384a96 96 0 1 0 192.064-.064A96 96 0 0 0 256 384z' }, null, -1 ), _hoisted_3190 = [_hoisted_2191] function _sfc_render191(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1191, _hoisted_3190) } var picture_filled_default = export_helper_default(_sfc_main191, [ ['render', _sfc_render191], ['__file', 'picture-filled.vue'] ]), _sfc_main192 = { name: 'PictureRounded' }, _hoisted_1192 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2192 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 128a384 384 0 1 0 0 768 384 384 0 0 0 0-768zm0-64a448 448 0 1 1 0 896 448 448 0 0 1 0-896z' }, null, -1 ), _hoisted_3191 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 288q64 0 64 64t-64 64q-64 0-64-64t64-64zM214.656 790.656l-45.312-45.312 185.664-185.6a96 96 0 0 1 123.712-10.24l138.24 98.688a32 32 0 0 0 39.872-2.176L906.688 422.4l42.624 47.744L699.52 693.696a96 96 0 0 1-119.808 6.592l-138.24-98.752a32 32 0 0 0-41.152 3.456l-185.664 185.6z' }, null, -1 ), _hoisted_456 = [_hoisted_2192, _hoisted_3191] function _sfc_render192(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1192, _hoisted_456) } var picture_rounded_default = export_helper_default(_sfc_main192, [ ['render', _sfc_render192], ['__file', 'picture-rounded.vue'] ]), _sfc_main193 = { name: 'Picture' }, _hoisted_1193 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2193 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 160v704h704V160H160zm-32-64h768a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H128a32 32 0 0 1-32-32V128a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3192 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 288q64 0 64 64t-64 64q-64 0-64-64t64-64zM185.408 876.992l-50.816-38.912L350.72 556.032a96 96 0 0 1 134.592-17.856l1.856 1.472 122.88 99.136a32 32 0 0 0 44.992-4.864l216-269.888 49.92 39.936-215.808 269.824-.256.32a96 96 0 0 1-135.04 14.464l-122.88-99.072-.64-.512a32 32 0 0 0-44.8 5.952L185.408 876.992z' }, null, -1 ), _hoisted_457 = [_hoisted_2193, _hoisted_3192] function _sfc_render193(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1193, _hoisted_457) } var picture_default = export_helper_default(_sfc_main193, [ ['render', _sfc_render193], ['__file', 'picture.vue'] ]), _sfc_main194 = { name: 'PieChart' }, _hoisted_1194 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2194 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 68.48v64.832A384.128 384.128 0 0 0 512 896a384.128 384.128 0 0 0 378.688-320h64.768A448.128 448.128 0 0 1 64 512 448.128 448.128 0 0 1 448 68.48z' }, null, -1 ), _hoisted_3193 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M576 97.28V448h350.72A384.064 384.064 0 0 0 576 97.28zM512 64V33.152A448 448 0 0 1 990.848 512H512V64z' }, null, -1 ), _hoisted_458 = [_hoisted_2194, _hoisted_3193] function _sfc_render194(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1194, _hoisted_458) } var pie_chart_default = export_helper_default(_sfc_main194, [ ['render', _sfc_render194], ['__file', 'pie-chart.vue'] ]), _sfc_main195 = { name: 'Place' }, _hoisted_1195 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2195 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 512a192 192 0 1 0 0-384 192 192 0 0 0 0 384zm0 64a256 256 0 1 1 0-512 256 256 0 0 1 0 512z' }, null, -1 ), _hoisted_3194 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 512a32 32 0 0 1 32 32v256a32 32 0 1 1-64 0V544a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_459 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 649.088v64.96C269.76 732.352 192 771.904 192 800c0 37.696 139.904 96 320 96s320-58.304 320-96c0-28.16-77.76-67.648-192-85.952v-64.96C789.12 671.04 896 730.368 896 800c0 88.32-171.904 160-384 160s-384-71.68-384-160c0-69.696 106.88-128.96 256-150.912z' }, null, -1 ), _hoisted_515 = [_hoisted_2195, _hoisted_3194, _hoisted_459] function _sfc_render195(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1195, _hoisted_515) } var place_default = export_helper_default(_sfc_main195, [ ['render', _sfc_render195], ['__file', 'place.vue'] ]), _sfc_main196 = { name: 'Platform' }, _hoisted_1196 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2196 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 832v-64h128v64h192v64H256v-64h192zM128 704V128h768v576H128z' }, null, -1 ), _hoisted_3195 = [_hoisted_2196] function _sfc_render196(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1196, _hoisted_3195) } var platform_default = export_helper_default(_sfc_main196, [ ['render', _sfc_render196], ['__file', 'platform.vue'] ]), _sfc_main197 = { name: 'Plus' }, _hoisted_1197 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2197 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 480V128a32 32 0 0 1 64 0v352h352a32 32 0 1 1 0 64H544v352a32 32 0 1 1-64 0V544H128a32 32 0 0 1 0-64h352z' }, null, -1 ), _hoisted_3196 = [_hoisted_2197] function _sfc_render197(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1197, _hoisted_3196) } var plus_default = export_helper_default(_sfc_main197, [ ['render', _sfc_render197], ['__file', 'plus.vue'] ]), _sfc_main198 = { name: 'Pointer' }, _hoisted_1198 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2198 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M511.552 128c-35.584 0-64.384 28.8-64.384 64.448v516.48L274.048 570.88a94.272 94.272 0 0 0-112.896-3.456 44.416 44.416 0 0 0-8.96 62.208L332.8 870.4A64 64 0 0 0 384 896h512V575.232a64 64 0 0 0-45.632-61.312l-205.952-61.76A96 96 0 0 1 576 360.192V192.448C576 156.8 547.2 128 511.552 128zM359.04 556.8l24.128 19.2V192.448a128.448 128.448 0 1 1 256.832 0v167.744a32 32 0 0 0 22.784 30.656l206.016 61.76A128 128 0 0 1 960 575.232V896a64 64 0 0 1-64 64H384a128 128 0 0 1-102.4-51.2L101.056 668.032A108.416 108.416 0 0 1 128 512.512a158.272 158.272 0 0 1 185.984 8.32L359.04 556.8z' }, null, -1 ), _hoisted_3197 = [_hoisted_2198] function _sfc_render198(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1198, _hoisted_3197) } var pointer_default = export_helper_default(_sfc_main198, [ ['render', _sfc_render198], ['__file', 'pointer.vue'] ]), _sfc_main199 = { name: 'Position' }, _hoisted_1199 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2199 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm249.6 417.088 319.744 43.072 39.168 310.272L845.12 178.88 249.6 417.088zm-129.024 47.168a32 32 0 0 1-7.68-61.44l777.792-311.04a32 32 0 0 1 41.6 41.6l-310.336 775.68a32 32 0 0 1-61.44-7.808L512 516.992l-391.424-52.736z' }, null, -1 ), _hoisted_3198 = [_hoisted_2199] function _sfc_render199(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1199, _hoisted_3198) } var position_default = export_helper_default(_sfc_main199, [ ['render', _sfc_render199], ['__file', 'position.vue'] ]), _sfc_main200 = { name: 'Postcard' }, _hoisted_1200 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2200 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 224a32 32 0 0 0-32 32v512a32 32 0 0 0 32 32h704a32 32 0 0 0 32-32V256a32 32 0 0 0-32-32H160zm0-64h704a96 96 0 0 1 96 96v512a96 96 0 0 1-96 96H160a96 96 0 0 1-96-96V256a96 96 0 0 1 96-96z' }, null, -1 ), _hoisted_3199 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 320a64 64 0 1 1 0 128 64 64 0 0 1 0-128zM288 448h256q32 0 32 32t-32 32H288q-32 0-32-32t32-32zm0 128h256q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_460 = [_hoisted_2200, _hoisted_3199] function _sfc_render200(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1200, _hoisted_460) } var postcard_default = export_helper_default(_sfc_main200, [ ['render', _sfc_render200], ['__file', 'postcard.vue'] ]), _sfc_main201 = { name: 'Pouring' }, _hoisted_1201 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2201 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm739.328 291.328-35.2-6.592-12.8-33.408a192.064 192.064 0 0 0-365.952 23.232l-9.92 40.896-41.472 7.04a176.32 176.32 0 0 0-146.24 173.568c0 97.28 78.72 175.936 175.808 175.936h400a192 192 0 0 0 35.776-380.672zM959.552 480a256 256 0 0 1-256 256h-400A239.808 239.808 0 0 1 63.744 496.192a240.32 240.32 0 0 1 199.488-236.8 256.128 256.128 0 0 1 487.872-30.976A256.064 256.064 0 0 1 959.552 480zM224 800a32 32 0 0 1 32 32v96a32 32 0 1 1-64 0v-96a32 32 0 0 1 32-32zm192 0a32 32 0 0 1 32 32v96a32 32 0 1 1-64 0v-96a32 32 0 0 1 32-32zm192 0a32 32 0 0 1 32 32v96a32 32 0 1 1-64 0v-96a32 32 0 0 1 32-32zm192 0a32 32 0 0 1 32 32v96a32 32 0 1 1-64 0v-96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3200 = [_hoisted_2201] function _sfc_render201(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1201, _hoisted_3200) } var pouring_default = export_helper_default(_sfc_main201, [ ['render', _sfc_render201], ['__file', 'pouring.vue'] ]), _sfc_main202 = { name: 'Present' }, _hoisted_1202 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2202 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 896V640H192v-64h288V320H192v576h288zm64 0h288V320H544v256h288v64H544v256zM128 256h768v672a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V256z' }, null, -1 ), _hoisted_3201 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M96 256h832q32 0 32 32t-32 32H96q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_461 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M416 256a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_516 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M608 256a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_6 = [_hoisted_2202, _hoisted_3201, _hoisted_461, _hoisted_516] function _sfc_render202(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1202, _hoisted_6) } var present_default = export_helper_default(_sfc_main202, [ ['render', _sfc_render202], ['__file', 'present.vue'] ]), _sfc_main203 = { name: 'PriceTag' }, _hoisted_1203 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2203 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 318.336V896h576V318.336L552.512 115.84a64 64 0 0 0-81.024 0L224 318.336zM593.024 66.304l259.2 212.096A32 32 0 0 1 864 303.168V928a32 32 0 0 1-32 32H192a32 32 0 0 1-32-32V303.168a32 32 0 0 1 11.712-24.768l259.2-212.096a128 128 0 0 1 162.112 0z' }, null, -1 ), _hoisted_3202 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 448a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_462 = [_hoisted_2203, _hoisted_3202] function _sfc_render203(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1203, _hoisted_462) } var price_tag_default = export_helper_default(_sfc_main203, [ ['render', _sfc_render203], ['__file', 'price-tag.vue'] ]), _sfc_main204 = { name: 'Printer' }, _hoisted_1204 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2204 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 768H105.024c-14.272 0-19.456-1.472-24.64-4.288a29.056 29.056 0 0 1-12.16-12.096C65.536 746.432 64 741.248 64 727.04V379.072c0-42.816 4.48-58.304 12.8-73.984 8.384-15.616 20.672-27.904 36.288-36.288 15.68-8.32 31.168-12.8 73.984-12.8H256V64h512v192h68.928c42.816 0 58.304 4.48 73.984 12.8 15.616 8.384 27.904 20.672 36.288 36.288 8.32 15.68 12.8 31.168 12.8 73.984v347.904c0 14.272-1.472 19.456-4.288 24.64a29.056 29.056 0 0 1-12.096 12.16c-5.184 2.752-10.368 4.224-24.64 4.224H768v192H256V768zm64-192v320h384V576H320zm-64 128V512h512v192h128V379.072c0-29.376-1.408-36.48-5.248-43.776a23.296 23.296 0 0 0-10.048-10.048c-7.232-3.84-14.4-5.248-43.776-5.248H187.072c-29.376 0-36.48 1.408-43.776 5.248a23.296 23.296 0 0 0-10.048 10.048c-3.84 7.232-5.248 14.4-5.248 43.776V704h128zm64-448h384V128H320v128zm-64 128h64v64h-64v-64zm128 0h64v64h-64v-64z' }, null, -1 ), _hoisted_3203 = [_hoisted_2204] function _sfc_render204(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1204, _hoisted_3203) } var printer_default = export_helper_default(_sfc_main204, [ ['render', _sfc_render204], ['__file', 'printer.vue'] ]), _sfc_main205 = { name: 'Promotion' }, _hoisted_1205 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2205 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm64 448 832-320-128 704-446.08-243.328L832 192 242.816 545.472 64 448zm256 512V657.024L512 768 320 960z' }, null, -1 ), _hoisted_3204 = [_hoisted_2205] function _sfc_render205(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1205, _hoisted_3204) } var promotion_default = export_helper_default(_sfc_main205, [ ['render', _sfc_render205], ['__file', 'promotion.vue'] ]), _sfc_main206 = { name: 'QuestionFilled' }, _hoisted_1206 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2206 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm23.744 191.488c-52.096 0-92.928 14.784-123.2 44.352-30.976 29.568-45.76 70.4-45.76 122.496h80.256c0-29.568 5.632-52.8 17.6-68.992 13.376-19.712 35.2-28.864 66.176-28.864 23.936 0 42.944 6.336 56.32 19.712 12.672 13.376 19.712 31.68 19.712 54.912 0 17.6-6.336 34.496-19.008 49.984l-8.448 9.856c-45.76 40.832-73.216 70.4-82.368 89.408-9.856 19.008-14.08 42.24-14.08 68.992v9.856h80.96v-9.856c0-16.896 3.52-31.68 10.56-45.76 6.336-12.672 15.488-24.64 28.16-35.2 33.792-29.568 54.208-48.576 60.544-55.616 16.896-22.528 26.048-51.392 26.048-86.592 0-42.944-14.08-76.736-42.24-101.376-28.16-25.344-65.472-37.312-111.232-37.312zm-12.672 406.208a54.272 54.272 0 0 0-38.72 14.784 49.408 49.408 0 0 0-15.488 38.016c0 15.488 4.928 28.16 15.488 38.016A54.848 54.848 0 0 0 523.072 768c15.488 0 28.16-4.928 38.72-14.784a51.52 51.52 0 0 0 16.192-38.72 51.968 51.968 0 0 0-15.488-38.016 55.936 55.936 0 0 0-39.424-14.784z' }, null, -1 ), _hoisted_3205 = [_hoisted_2206] function _sfc_render206(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1206, _hoisted_3205) } var question_filled_default = export_helper_default(_sfc_main206, [ ['render', _sfc_render206], ['__file', 'question-filled.vue'] ]), _sfc_main207 = { name: 'Rank' }, _hoisted_1207 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2207 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm186.496 544 41.408 41.344a32 32 0 1 1-45.248 45.312l-96-96a32 32 0 0 1 0-45.312l96-96a32 32 0 1 1 45.248 45.312L186.496 480h290.816V186.432l-41.472 41.472a32 32 0 1 1-45.248-45.184l96-96.128a32 32 0 0 1 45.312 0l96 96.064a32 32 0 0 1-45.248 45.184l-41.344-41.28V480H832l-41.344-41.344a32 32 0 0 1 45.248-45.312l96 96a32 32 0 0 1 0 45.312l-96 96a32 32 0 0 1-45.248-45.312L832 544H541.312v293.44l41.344-41.28a32 32 0 1 1 45.248 45.248l-96 96a32 32 0 0 1-45.312 0l-96-96a32 32 0 1 1 45.312-45.248l41.408 41.408V544H186.496z' }, null, -1 ), _hoisted_3206 = [_hoisted_2207] function _sfc_render207(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1207, _hoisted_3206) } var rank_default = export_helper_default(_sfc_main207, [ ['render', _sfc_render207], ['__file', 'rank.vue'] ]), _sfc_main208 = { name: 'ReadingLamp' }, _hoisted_1208 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2208 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 896h320q32 0 32 32t-32 32H352q-32 0-32-32t32-32zm-44.672-768-99.52 448h608.384l-99.52-448H307.328zm-25.6-64h460.608a32 32 0 0 1 31.232 25.088l113.792 512A32 32 0 0 1 856.128 640H167.872a32 32 0 0 1-31.232-38.912l113.792-512A32 32 0 0 1 281.664 64z' }, null, -1 ), _hoisted_3207 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M672 576q32 0 32 32v128q0 32-32 32t-32-32V608q0-32 32-32zm-192-.064h64V960h-64z' }, null, -1 ), _hoisted_463 = [_hoisted_2208, _hoisted_3207] function _sfc_render208(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1208, _hoisted_463) } var reading_lamp_default = export_helper_default(_sfc_main208, [ ['render', _sfc_render208], ['__file', 'reading-lamp.vue'] ]), _sfc_main209 = { name: 'Reading' }, _hoisted_1209 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2209 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm512 863.36 384-54.848v-638.72L525.568 222.72a96 96 0 0 1-27.136 0L128 169.792v638.72l384 54.848zM137.024 106.432l370.432 52.928a32 32 0 0 0 9.088 0l370.432-52.928A64 64 0 0 1 960 169.792v638.72a64 64 0 0 1-54.976 63.36l-388.48 55.488a32 32 0 0 1-9.088 0l-388.48-55.488A64 64 0 0 1 64 808.512v-638.72a64 64 0 0 1 73.024-63.36z' }, null, -1 ), _hoisted_3208 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 192h64v704h-64z' }, null, -1 ), _hoisted_464 = [_hoisted_2209, _hoisted_3208] function _sfc_render209(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1209, _hoisted_464) } var reading_default = export_helper_default(_sfc_main209, [ ['render', _sfc_render209], ['__file', 'reading.vue'] ]), _sfc_main210 = { name: 'RefreshLeft' }, _hoisted_1210 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2210 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M289.088 296.704h92.992a32 32 0 0 1 0 64H232.96a32 32 0 0 1-32-32V179.712a32 32 0 0 1 64 0v50.56a384 384 0 0 1 643.84 282.88 384 384 0 0 1-383.936 384 384 384 0 0 1-384-384h64a320 320 0 1 0 640 0 320 320 0 0 0-555.712-216.448z' }, null, -1 ), _hoisted_3209 = [_hoisted_2210] function _sfc_render210(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1210, _hoisted_3209) } var refresh_left_default = export_helper_default(_sfc_main210, [ ['render', _sfc_render210], ['__file', 'refresh-left.vue'] ]), _sfc_main211 = { name: 'RefreshRight' }, _hoisted_1211 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2211 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M784.512 230.272v-50.56a32 32 0 1 1 64 0v149.056a32 32 0 0 1-32 32H667.52a32 32 0 1 1 0-64h92.992A320 320 0 1 0 524.8 833.152a320 320 0 0 0 320-320h64a384 384 0 0 1-384 384 384 384 0 0 1-384-384 384 384 0 0 1 643.712-282.88z' }, null, -1 ), _hoisted_3210 = [_hoisted_2211] function _sfc_render211(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1211, _hoisted_3210) } var refresh_right_default = export_helper_default(_sfc_main211, [ ['render', _sfc_render211], ['__file', 'refresh-right.vue'] ]), _sfc_main212 = { name: 'Refresh' }, _hoisted_1212 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2212 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M771.776 794.88A384 384 0 0 1 128 512h64a320 320 0 0 0 555.712 216.448H654.72a32 32 0 1 1 0-64h149.056a32 32 0 0 1 32 32v148.928a32 32 0 1 1-64 0v-50.56zM276.288 295.616h92.992a32 32 0 0 1 0 64H220.16a32 32 0 0 1-32-32V178.56a32 32 0 0 1 64 0v50.56A384 384 0 0 1 896.128 512h-64a320 320 0 0 0-555.776-216.384z' }, null, -1 ), _hoisted_3211 = [_hoisted_2212] function _sfc_render212(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1212, _hoisted_3211) } var refresh_default = export_helper_default(_sfc_main212, [ ['render', _sfc_render212], ['__file', 'refresh.vue'] ]), _sfc_main213 = { name: 'Refrigerator' }, _hoisted_1213 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2213 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 448h512V160a32 32 0 0 0-32-32H288a32 32 0 0 0-32 32v288zm0 64v352a32 32 0 0 0 32 32h448a32 32 0 0 0 32-32V512H256zm32-448h448a96 96 0 0 1 96 96v704a96 96 0 0 1-96 96H288a96 96 0 0 1-96-96V160a96 96 0 0 1 96-96zm32 224h64v96h-64v-96zm0 288h64v96h-64v-96z' }, null, -1 ), _hoisted_3212 = [_hoisted_2213] function _sfc_render213(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1213, _hoisted_3212) } var refrigerator_default = export_helper_default(_sfc_main213, [ ['render', _sfc_render213], ['__file', 'refrigerator.vue'] ]), _sfc_main214 = { name: 'RemoveFilled' }, _hoisted_1214 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2214 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zM288 512a38.4 38.4 0 0 0 38.4 38.4h371.2a38.4 38.4 0 0 0 0-76.8H326.4A38.4 38.4 0 0 0 288 512z' }, null, -1 ), _hoisted_3213 = [_hoisted_2214] function _sfc_render214(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1214, _hoisted_3213) } var remove_filled_default = export_helper_default(_sfc_main214, [ ['render', _sfc_render214], ['__file', 'remove-filled.vue'] ]), _sfc_main215 = { name: 'Remove' }, _hoisted_1215 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2215 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 480h320a32 32 0 1 1 0 64H352a32 32 0 0 1 0-64z' }, null, -1 ), _hoisted_3214 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_465 = [_hoisted_2215, _hoisted_3214] function _sfc_render215(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1215, _hoisted_465) } var remove_default = export_helper_default(_sfc_main215, [ ['render', _sfc_render215], ['__file', 'remove.vue'] ]), _sfc_main216 = { name: 'Right' }, _hoisted_1216 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2216 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M754.752 480H160a32 32 0 1 0 0 64h594.752L521.344 777.344a32 32 0 0 0 45.312 45.312l288-288a32 32 0 0 0 0-45.312l-288-288a32 32 0 1 0-45.312 45.312L754.752 480z' }, null, -1 ), _hoisted_3215 = [_hoisted_2216] function _sfc_render216(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1216, _hoisted_3215) } var right_default = export_helper_default(_sfc_main216, [ ['render', _sfc_render216], ['__file', 'right.vue'] ]), _sfc_main217 = { name: 'ScaleToOriginal' }, _hoisted_1217 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2217 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M813.176 180.706a60.235 60.235 0 0 1 60.236 60.235v481.883a60.235 60.235 0 0 1-60.236 60.235H210.824a60.235 60.235 0 0 1-60.236-60.235V240.94a60.235 60.235 0 0 1 60.236-60.235h602.352zm0-60.235H210.824A120.47 120.47 0 0 0 90.353 240.94v481.883a120.47 120.47 0 0 0 120.47 120.47h602.353a120.47 120.47 0 0 0 120.471-120.47V240.94a120.47 120.47 0 0 0-120.47-120.47zm-120.47 180.705a30.118 30.118 0 0 0-30.118 30.118v301.177a30.118 30.118 0 0 0 60.236 0V331.294a30.118 30.118 0 0 0-30.118-30.118zm-361.412 0a30.118 30.118 0 0 0-30.118 30.118v301.177a30.118 30.118 0 1 0 60.236 0V331.294a30.118 30.118 0 0 0-30.118-30.118zM512 361.412a30.118 30.118 0 0 0-30.118 30.117v30.118a30.118 30.118 0 0 0 60.236 0V391.53A30.118 30.118 0 0 0 512 361.412zM512 512a30.118 30.118 0 0 0-30.118 30.118v30.117a30.118 30.118 0 0 0 60.236 0v-30.117A30.118 30.118 0 0 0 512 512z' }, null, -1 ), _hoisted_3216 = [_hoisted_2217] function _sfc_render217(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1217, _hoisted_3216) } var scale_to_original_default = export_helper_default(_sfc_main217, [ ['render', _sfc_render217], ['__file', 'scale-to-original.vue'] ]), _sfc_main218 = { name: 'School' }, _hoisted_1218 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2218 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 128v704h576V128H224zm-32-64h640a32 32 0 0 1 32 32v768a32 32 0 0 1-32 32H192a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3217 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M64 832h896v64H64zm256-640h128v96H320z' }, null, -1 ), _hoisted_466 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 832h256v-64a128 128 0 1 0-256 0v64zm128-256a192 192 0 0 1 192 192v128H320V768a192 192 0 0 1 192-192zM320 384h128v96H320zm256-192h128v96H576zm0 192h128v96H576z' }, null, -1 ), _hoisted_517 = [_hoisted_2218, _hoisted_3217, _hoisted_466] function _sfc_render218(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1218, _hoisted_517) } var school_default = export_helper_default(_sfc_main218, [ ['render', _sfc_render218], ['__file', 'school.vue'] ]), _sfc_main219 = { name: 'Scissor' }, _hoisted_1219 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2219 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm512.064 578.368-106.88 152.768a160 160 0 1 1-23.36-78.208L472.96 522.56 196.864 128.256a32 32 0 1 1 52.48-36.736l393.024 561.344a160 160 0 1 1-23.36 78.208l-106.88-152.704zm54.4-189.248 208.384-297.6a32 32 0 0 1 52.48 36.736l-221.76 316.672-39.04-55.808zm-376.32 425.856a96 96 0 1 0 110.144-157.248 96 96 0 0 0-110.08 157.248zm643.84 0a96 96 0 1 0-110.08-157.248 96 96 0 0 0 110.08 157.248z' }, null, -1 ), _hoisted_3218 = [_hoisted_2219] function _sfc_render219(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1219, _hoisted_3218) } var scissor_default = export_helper_default(_sfc_main219, [ ['render', _sfc_render219], ['__file', 'scissor.vue'] ]), _sfc_main220 = { name: 'Search' }, _hoisted_1220 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2220 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm795.904 750.72 124.992 124.928a32 32 0 0 1-45.248 45.248L750.656 795.904a416 416 0 1 1 45.248-45.248zM480 832a352 352 0 1 0 0-704 352 352 0 0 0 0 704z' }, null, -1 ), _hoisted_3219 = [_hoisted_2220] function _sfc_render220(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1220, _hoisted_3219) } var search_default = export_helper_default(_sfc_main220, [ ['render', _sfc_render220], ['__file', 'search.vue'] ]), _sfc_main221 = { name: 'Select' }, _hoisted_1221 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2221 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M77.248 415.04a64 64 0 0 1 90.496 0l226.304 226.304L846.528 188.8a64 64 0 1 1 90.56 90.496l-543.04 543.04-316.8-316.8a64 64 0 0 1 0-90.496z' }, null, -1 ), _hoisted_3220 = [_hoisted_2221] function _sfc_render221(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1221, _hoisted_3220) } var select_default = export_helper_default(_sfc_main221, [ ['render', _sfc_render221], ['__file', 'select.vue'] ]), _sfc_main222 = { name: 'Sell' }, _hoisted_1222 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2222 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 288h131.072a32 32 0 0 1 31.808 28.8L886.4 512h-64.384l-16-160H704v96a32 32 0 1 1-64 0v-96H384v96a32 32 0 0 1-64 0v-96H217.92l-51.2 512H512v64H131.328a32 32 0 0 1-31.808-35.2l57.6-576a32 32 0 0 1 31.808-28.8H320v-22.336C320 154.688 405.504 64 512 64s192 90.688 192 201.664v22.4zm-64 0v-22.336C640 189.248 582.272 128 512 128c-70.272 0-128 61.248-128 137.664v22.4h256zm201.408 483.84L768 698.496V928a32 32 0 1 1-64 0V698.496l-73.344 73.344a32 32 0 1 1-45.248-45.248l128-128a32 32 0 0 1 45.248 0l128 128a32 32 0 1 1-45.248 45.248z' }, null, -1 ), _hoisted_3221 = [_hoisted_2222] function _sfc_render222(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1222, _hoisted_3221) } var sell_default = export_helper_default(_sfc_main222, [ ['render', _sfc_render222], ['__file', 'sell.vue'] ]), _sfc_main223 = { name: 'SemiSelect' }, _hoisted_1223 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2223 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 448h768q64 0 64 64t-64 64H128q-64 0-64-64t64-64z' }, null, -1 ), _hoisted_3222 = [_hoisted_2223] function _sfc_render223(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1223, _hoisted_3222) } var semi_select_default = export_helper_default(_sfc_main223, [ ['render', _sfc_render223], ['__file', 'semi-select.vue'] ]), _sfc_main224 = { name: 'Service' }, _hoisted_1224 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2224 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M864 409.6a192 192 0 0 1-37.888 349.44A256.064 256.064 0 0 1 576 960h-96a32 32 0 1 1 0-64h96a192.064 192.064 0 0 0 181.12-128H736a32 32 0 0 1-32-32V416a32 32 0 0 1 32-32h32c10.368 0 20.544.832 30.528 2.432a288 288 0 0 0-573.056 0A193.235 193.235 0 0 1 256 384h32a32 32 0 0 1 32 32v320a32 32 0 0 1-32 32h-32a192 192 0 0 1-96-358.4 352 352 0 0 1 704 0zM256 448a128 128 0 1 0 0 256V448zm640 128a128 128 0 0 0-128-128v256a128 128 0 0 0 128-128z' }, null, -1 ), _hoisted_3223 = [_hoisted_2224] function _sfc_render224(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1224, _hoisted_3223) } var service_default = export_helper_default(_sfc_main224, [ ['render', _sfc_render224], ['__file', 'service.vue'] ]), _sfc_main225 = { name: 'SetUp' }, _hoisted_1225 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2225 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 160a64 64 0 0 0-64 64v576a64 64 0 0 0 64 64h576a64 64 0 0 0 64-64V224a64 64 0 0 0-64-64H224zm0-64h576a128 128 0 0 1 128 128v576a128 128 0 0 1-128 128H224A128 128 0 0 1 96 800V224A128 128 0 0 1 224 96z' }, null, -1 ), _hoisted_3224 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 416a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_467 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 320h256q32 0 32 32t-32 32H480q-32 0-32-32t32-32zm160 416a64 64 0 1 0 0-128 64 64 0 0 0 0 128zm0 64a128 128 0 1 1 0-256 128 128 0 0 1 0 256z' }, null, -1 ), _hoisted_518 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 640h256q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_62 = [_hoisted_2225, _hoisted_3224, _hoisted_467, _hoisted_518] function _sfc_render225(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1225, _hoisted_62) } var set_up_default = export_helper_default(_sfc_main225, [ ['render', _sfc_render225], ['__file', 'set-up.vue'] ]), _sfc_main226 = { name: 'Setting' }, _hoisted_1226 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2226 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M600.704 64a32 32 0 0 1 30.464 22.208l35.2 109.376c14.784 7.232 28.928 15.36 42.432 24.512l112.384-24.192a32 32 0 0 1 34.432 15.36L944.32 364.8a32 32 0 0 1-4.032 37.504l-77.12 85.12a357.12 357.12 0 0 1 0 49.024l77.12 85.248a32 32 0 0 1 4.032 37.504l-88.704 153.6a32 32 0 0 1-34.432 15.296L708.8 803.904c-13.44 9.088-27.648 17.28-42.368 24.512l-35.264 109.376A32 32 0 0 1 600.704 960H423.296a32 32 0 0 1-30.464-22.208L357.696 828.48a351.616 351.616 0 0 1-42.56-24.64l-112.32 24.256a32 32 0 0 1-34.432-15.36L79.68 659.2a32 32 0 0 1 4.032-37.504l77.12-85.248a357.12 357.12 0 0 1 0-48.896l-77.12-85.248A32 32 0 0 1 79.68 364.8l88.704-153.6a32 32 0 0 1 34.432-15.296l112.32 24.256c13.568-9.152 27.776-17.408 42.56-24.64l35.2-109.312A32 32 0 0 1 423.232 64H600.64zm-23.424 64H446.72l-36.352 113.088-24.512 11.968a294.113 294.113 0 0 0-34.816 20.096l-22.656 15.36-116.224-25.088-65.28 113.152 79.68 88.192-1.92 27.136a293.12 293.12 0 0 0 0 40.192l1.92 27.136-79.808 88.192 65.344 113.152 116.224-25.024 22.656 15.296a294.113 294.113 0 0 0 34.816 20.096l24.512 11.968L446.72 896h130.688l36.48-113.152 24.448-11.904a288.282 288.282 0 0 0 34.752-20.096l22.592-15.296 116.288 25.024 65.28-113.152-79.744-88.192 1.92-27.136a293.12 293.12 0 0 0 0-40.256l-1.92-27.136 79.808-88.128-65.344-113.152-116.288 24.96-22.592-15.232a287.616 287.616 0 0 0-34.752-20.096l-24.448-11.904L577.344 128zM512 320a192 192 0 1 1 0 384 192 192 0 0 1 0-384zm0 64a128 128 0 1 0 0 256 128 128 0 0 0 0-256z' }, null, -1 ), _hoisted_3225 = [_hoisted_2226] function _sfc_render226(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1226, _hoisted_3225) } var setting_default = export_helper_default(_sfc_main226, [ ['render', _sfc_render226], ['__file', 'setting.vue'] ]), _sfc_main227 = { name: 'Share' }, _hoisted_1227 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2227 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm679.872 348.8-301.76 188.608a127.808 127.808 0 0 1 5.12 52.16l279.936 104.96a128 128 0 1 1-22.464 59.904l-279.872-104.96a128 128 0 1 1-16.64-166.272l301.696-188.608a128 128 0 1 1 33.92 54.272z' }, null, -1 ), _hoisted_3226 = [_hoisted_2227] function _sfc_render227(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1227, _hoisted_3226) } var share_default = export_helper_default(_sfc_main227, [ ['render', _sfc_render227], ['__file', 'share.vue'] ]), _sfc_main228 = { name: 'Ship' }, _hoisted_1228 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2228 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 386.88V448h405.568a32 32 0 0 1 30.72 40.768l-76.48 267.968A192 192 0 0 1 687.168 896H336.832a192 192 0 0 1-184.64-139.264L75.648 488.768A32 32 0 0 1 106.368 448H448V117.888a32 32 0 0 1 47.36-28.096l13.888 7.616L512 96v2.88l231.68 126.4a32 32 0 0 1-2.048 57.216L512 386.88zm0-70.272 144.768-65.792L512 171.84v144.768zM512 512H148.864l18.24 64H856.96l18.24-64H512zM185.408 640l28.352 99.2A128 128 0 0 0 336.832 832h350.336a128 128 0 0 0 123.072-92.8l28.352-99.2H185.408z' }, null, -1 ), _hoisted_3227 = [_hoisted_2228] function _sfc_render228(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1228, _hoisted_3227) } var ship_default = export_helper_default(_sfc_main228, [ ['render', _sfc_render228], ['__file', 'ship.vue'] ]), _sfc_main229 = { name: 'Shop' }, _hoisted_1229 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2229 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 704h64v192H256V704h64v64h384v-64zm188.544-152.192C894.528 559.616 896 567.616 896 576a96 96 0 1 1-192 0 96 96 0 1 1-192 0 96 96 0 1 1-192 0 96 96 0 1 1-192 0c0-8.384 1.408-16.384 3.392-24.192L192 128h640l60.544 423.808z' }, null, -1 ), _hoisted_3228 = [_hoisted_2229] function _sfc_render229(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1229, _hoisted_3228) } var shop_default = export_helper_default(_sfc_main229, [ ['render', _sfc_render229], ['__file', 'shop.vue'] ]), _sfc_main230 = { name: 'ShoppingBag' }, _hoisted_1230 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2230 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 320v96a32 32 0 0 1-32 32h-32V320H384v128h-32a32 32 0 0 1-32-32v-96H192v576h640V320H704zm-384-64a192 192 0 1 1 384 0h160a32 32 0 0 1 32 32v640a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V288a32 32 0 0 1 32-32h160zm64 0h256a128 128 0 1 0-256 0z' }, null, -1 ), _hoisted_3229 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 704h640v64H192z' }, null, -1 ), _hoisted_468 = [_hoisted_2230, _hoisted_3229] function _sfc_render230(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1230, _hoisted_468) } var shopping_bag_default = export_helper_default(_sfc_main230, [ ['render', _sfc_render230], ['__file', 'shopping-bag.vue'] ]), _sfc_main231 = { name: 'ShoppingCartFull' }, _hoisted_1231 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2231 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M432 928a48 48 0 1 1 0-96 48 48 0 0 1 0 96zm320 0a48 48 0 1 1 0-96 48 48 0 0 1 0 96zM96 128a32 32 0 0 1 0-64h160a32 32 0 0 1 31.36 25.728L320.64 256H928a32 32 0 0 1 31.296 38.72l-96 448A32 32 0 0 1 832 768H384a32 32 0 0 1-31.36-25.728L229.76 128H96zm314.24 576h395.904l82.304-384H333.44l76.8 384z' }, null, -1 ), _hoisted_3230 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M699.648 256 608 145.984 516.352 256h183.296zm-140.8-151.04a64 64 0 0 1 98.304 0L836.352 320H379.648l179.2-215.04z' }, null, -1 ), _hoisted_469 = [_hoisted_2231, _hoisted_3230] function _sfc_render231(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1231, _hoisted_469) } var shopping_cart_full_default = export_helper_default(_sfc_main231, [ ['render', _sfc_render231], ['__file', 'shopping-cart-full.vue'] ]), _sfc_main232 = { name: 'ShoppingCart' }, _hoisted_1232 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2232 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M432 928a48 48 0 1 1 0-96 48 48 0 0 1 0 96zm320 0a48 48 0 1 1 0-96 48 48 0 0 1 0 96zM96 128a32 32 0 0 1 0-64h160a32 32 0 0 1 31.36 25.728L320.64 256H928a32 32 0 0 1 31.296 38.72l-96 448A32 32 0 0 1 832 768H384a32 32 0 0 1-31.36-25.728L229.76 128H96zm314.24 576h395.904l82.304-384H333.44l76.8 384z' }, null, -1 ), _hoisted_3231 = [_hoisted_2232] function _sfc_render232(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1232, _hoisted_3231) } var shopping_cart_default = export_helper_default(_sfc_main232, [ ['render', _sfc_render232], ['__file', 'shopping-cart.vue'] ]), _sfc_main233 = { name: 'Smoking' }, _hoisted_1233 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2233 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 576v128h640V576H256zm-32-64h704a32 32 0 0 1 32 32v192a32 32 0 0 1-32 32H224a32 32 0 0 1-32-32V544a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3232 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 576h64v128h-64zM256 64h64v320h-64zM128 192h64v192h-64zM64 512h64v256H64z' }, null, -1 ), _hoisted_470 = [_hoisted_2233, _hoisted_3232] function _sfc_render233(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1233, _hoisted_470) } var smoking_default = export_helper_default(_sfc_main233, [ ['render', _sfc_render233], ['__file', 'smoking.vue'] ]), _sfc_main234 = { name: 'Soccer' }, _hoisted_1234 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2234 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M418.496 871.04 152.256 604.8c-16.512 94.016-2.368 178.624 42.944 224 44.928 44.928 129.344 58.752 223.296 42.24zm72.32-18.176a573.056 573.056 0 0 0 224.832-137.216 573.12 573.12 0 0 0 137.216-224.832L533.888 171.84a578.56 578.56 0 0 0-227.52 138.496A567.68 567.68 0 0 0 170.432 532.48l320.384 320.384zM871.04 418.496c16.512-93.952 2.688-178.368-42.24-223.296-44.544-44.544-128.704-58.048-222.592-41.536L871.04 418.496zM149.952 874.048c-112.96-112.96-88.832-408.96 111.168-608.96C461.056 65.152 760.96 36.928 874.048 149.952c113.024 113.024 86.784 411.008-113.152 610.944-199.936 199.936-497.92 226.112-610.944 113.152zm452.544-497.792 22.656-22.656a32 32 0 0 1 45.248 45.248l-22.656 22.656 45.248 45.248A32 32 0 1 1 647.744 512l-45.248-45.248L557.248 512l45.248 45.248a32 32 0 1 1-45.248 45.248L512 557.248l-45.248 45.248L512 647.744a32 32 0 1 1-45.248 45.248l-45.248-45.248-22.656 22.656a32 32 0 1 1-45.248-45.248l22.656-22.656-45.248-45.248A32 32 0 1 1 376.256 512l45.248 45.248L466.752 512l-45.248-45.248a32 32 0 1 1 45.248-45.248L512 466.752l45.248-45.248L512 376.256a32 32 0 0 1 45.248-45.248l45.248 45.248z' }, null, -1 ), _hoisted_3233 = [_hoisted_2234] function _sfc_render234(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1234, _hoisted_3233) } var soccer_default = export_helper_default(_sfc_main234, [ ['render', _sfc_render234], ['__file', 'soccer.vue'] ]), _sfc_main235 = { name: 'SoldOut' }, _hoisted_1235 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2235 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 288h131.072a32 32 0 0 1 31.808 28.8L886.4 512h-64.384l-16-160H704v96a32 32 0 1 1-64 0v-96H384v96a32 32 0 0 1-64 0v-96H217.92l-51.2 512H512v64H131.328a32 32 0 0 1-31.808-35.2l57.6-576a32 32 0 0 1 31.808-28.8H320v-22.336C320 154.688 405.504 64 512 64s192 90.688 192 201.664v22.4zm-64 0v-22.336C640 189.248 582.272 128 512 128c-70.272 0-128 61.248-128 137.664v22.4h256zm201.408 476.16a32 32 0 1 1 45.248 45.184l-128 128a32 32 0 0 1-45.248 0l-128-128a32 32 0 1 1 45.248-45.248L704 837.504V608a32 32 0 1 1 64 0v229.504l73.408-73.408z' }, null, -1 ), _hoisted_3234 = [_hoisted_2235] function _sfc_render235(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1235, _hoisted_3234) } var sold_out_default = export_helper_default(_sfc_main235, [ ['render', _sfc_render235], ['__file', 'sold-out.vue'] ]), _sfc_main236 = { name: 'SortDown' }, _hoisted_1236 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2236 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M576 96v709.568L333.312 562.816A32 32 0 1 0 288 608l297.408 297.344A32 32 0 0 0 640 882.688V96a32 32 0 0 0-64 0z' }, null, -1 ), _hoisted_3235 = [_hoisted_2236] function _sfc_render236(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1236, _hoisted_3235) } var sort_down_default = export_helper_default(_sfc_main236, [ ['render', _sfc_render236], ['__file', 'sort-down.vue'] ]), _sfc_main237 = { name: 'SortUp' }, _hoisted_1237 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2237 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 141.248V928a32 32 0 1 0 64 0V218.56l242.688 242.688A32 32 0 1 0 736 416L438.592 118.656A32 32 0 0 0 384 141.248z' }, null, -1 ), _hoisted_3236 = [_hoisted_2237] function _sfc_render237(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1237, _hoisted_3236) } var sort_up_default = export_helper_default(_sfc_main237, [ ['render', _sfc_render237], ['__file', 'sort-up.vue'] ]), _sfc_main238 = { name: 'Sort' }, _hoisted_1238 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2238 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 96a32 32 0 0 1 64 0v786.752a32 32 0 0 1-54.592 22.656L95.936 608a32 32 0 0 1 0-45.312h.128a32 32 0 0 1 45.184 0L384 805.632V96zm192 45.248a32 32 0 0 1 54.592-22.592L928.064 416a32 32 0 0 1 0 45.312h-.128a32 32 0 0 1-45.184 0L640 218.496V928a32 32 0 1 1-64 0V141.248z' }, null, -1 ), _hoisted_3237 = [_hoisted_2238] function _sfc_render238(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1238, _hoisted_3237) } var sort_default = export_helper_default(_sfc_main238, [ ['render', _sfc_render238], ['__file', 'sort.vue'] ]), _sfc_main239 = { name: 'Stamp' }, _hoisted_1239 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2239 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M624 475.968V640h144a128 128 0 0 1 128 128H128a128 128 0 0 1 128-128h144V475.968a192 192 0 1 1 224 0zM128 896v-64h768v64H128z' }, null, -1 ), _hoisted_3238 = [_hoisted_2239] function _sfc_render239(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1239, _hoisted_3238) } var stamp_default = export_helper_default(_sfc_main239, [ ['render', _sfc_render239], ['__file', 'stamp.vue'] ]), _sfc_main240 = { name: 'StarFilled' }, _hoisted_1240 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2240 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M283.84 867.84 512 747.776l228.16 119.936a6.4 6.4 0 0 0 9.28-6.72l-43.52-254.08 184.512-179.904a6.4 6.4 0 0 0-3.52-10.88l-255.104-37.12L517.76 147.904a6.4 6.4 0 0 0-11.52 0L392.192 379.072l-255.104 37.12a6.4 6.4 0 0 0-3.52 10.88L318.08 606.976l-43.584 254.08a6.4 6.4 0 0 0 9.28 6.72z' }, null, -1 ), _hoisted_3239 = [_hoisted_2240] function _sfc_render240(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1240, _hoisted_3239) } var star_filled_default = export_helper_default(_sfc_main240, [ ['render', _sfc_render240], ['__file', 'star-filled.vue'] ]), _sfc_main241 = { name: 'Star' }, _hoisted_1241 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2241 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm512 747.84 228.16 119.936a6.4 6.4 0 0 0 9.28-6.72l-43.52-254.08 184.512-179.904a6.4 6.4 0 0 0-3.52-10.88l-255.104-37.12L517.76 147.904a6.4 6.4 0 0 0-11.52 0L392.192 379.072l-255.104 37.12a6.4 6.4 0 0 0-3.52 10.88L318.08 606.976l-43.584 254.08a6.4 6.4 0 0 0 9.28 6.72L512 747.84zM313.6 924.48a70.4 70.4 0 0 1-102.144-74.24l37.888-220.928L88.96 472.96A70.4 70.4 0 0 1 128 352.896l221.76-32.256 99.2-200.96a70.4 70.4 0 0 1 126.208 0l99.2 200.96 221.824 32.256a70.4 70.4 0 0 1 39.04 120.064L774.72 629.376l37.888 220.928a70.4 70.4 0 0 1-102.144 74.24L512 820.096l-198.4 104.32z' }, null, -1 ), _hoisted_3240 = [_hoisted_2241] function _sfc_render241(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1241, _hoisted_3240) } var star_default = export_helper_default(_sfc_main241, [ ['render', _sfc_render241], ['__file', 'star.vue'] ]), _sfc_main242 = { name: 'Stopwatch' }, _hoisted_1242 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2242 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a384 384 0 1 0 0-768 384 384 0 0 0 0 768zm0 64a448 448 0 1 1 0-896 448 448 0 0 1 0 896z' }, null, -1 ), _hoisted_3241 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M672 234.88c-39.168 174.464-80 298.624-122.688 372.48-64 110.848-202.624 30.848-138.624-80C453.376 453.44 540.48 355.968 672 234.816z' }, null, -1 ), _hoisted_471 = [_hoisted_2242, _hoisted_3241] function _sfc_render242(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1242, _hoisted_471) } var stopwatch_default = export_helper_default(_sfc_main242, [ ['render', _sfc_render242], ['__file', 'stopwatch.vue'] ]), _sfc_main243 = { name: 'SuccessFilled' }, _hoisted_1243 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2243 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm-55.808 536.384-99.52-99.584a38.4 38.4 0 1 0-54.336 54.336l126.72 126.72a38.272 38.272 0 0 0 54.336 0l262.4-262.464a38.4 38.4 0 1 0-54.272-54.336L456.192 600.384z' }, null, -1 ), _hoisted_3242 = [_hoisted_2243] function _sfc_render243(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1243, _hoisted_3242) } var success_filled_default = export_helper_default(_sfc_main243, [ ['render', _sfc_render243], ['__file', 'success-filled.vue'] ]), _sfc_main244 = { name: 'Sugar' }, _hoisted_1244 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2244 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm801.728 349.184 4.48 4.48a128 128 0 0 1 0 180.992L534.656 806.144a128 128 0 0 1-181.056 0l-4.48-4.48-19.392 109.696a64 64 0 0 1-108.288 34.176L78.464 802.56a64 64 0 0 1 34.176-108.288l109.76-19.328-4.544-4.544a128 128 0 0 1 0-181.056l271.488-271.488a128 128 0 0 1 181.056 0l4.48 4.48 19.392-109.504a64 64 0 0 1 108.352-34.048l142.592 143.04a64 64 0 0 1-34.24 108.16l-109.248 19.2zm-548.8 198.72h447.168v2.24l60.8-60.8a63.808 63.808 0 0 0 18.752-44.416h-426.88l-89.664 89.728a64.064 64.064 0 0 0-10.24 13.248zm0 64c2.752 4.736 6.144 9.152 10.176 13.248l135.744 135.744a64 64 0 0 0 90.496 0L638.4 611.904H252.928zm490.048-230.976L625.152 263.104a64 64 0 0 0-90.496 0L416.768 380.928h326.208zM123.712 757.312l142.976 142.976 24.32-137.6a25.6 25.6 0 0 0-29.696-29.632l-137.6 24.256zm633.6-633.344-24.32 137.472a25.6 25.6 0 0 0 29.632 29.632l137.28-24.064-142.656-143.04z' }, null, -1 ), _hoisted_3243 = [_hoisted_2244] function _sfc_render244(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1244, _hoisted_3243) } var sugar_default = export_helper_default(_sfc_main244, [ ['render', _sfc_render244], ['__file', 'sugar.vue'] ]), _sfc_main245 = { name: 'Suitcase' }, _hoisted_1245 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2245 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 384h768v-64a64 64 0 0 0-64-64H192a64 64 0 0 0-64 64v64zm0 64v320a64 64 0 0 0 64 64h640a64 64 0 0 0 64-64V448H128zm64-256h640a128 128 0 0 1 128 128v448a128 128 0 0 1-128 128H192A128 128 0 0 1 64 768V320a128 128 0 0 1 128-128z' }, null, -1 ), _hoisted_3244 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M384 128v64h256v-64H384zm0-64h256a64 64 0 0 1 64 64v64a64 64 0 0 1-64 64H384a64 64 0 0 1-64-64v-64a64 64 0 0 1 64-64z' }, null, -1 ), _hoisted_472 = [_hoisted_2245, _hoisted_3244] function _sfc_render245(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1245, _hoisted_472) } var suitcase_default = export_helper_default(_sfc_main245, [ ['render', _sfc_render245], ['__file', 'suitcase.vue'] ]), _sfc_main246 = { name: 'Sunny' }, _hoisted_1246 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2246 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 704a192 192 0 1 0 0-384 192 192 0 0 0 0 384zm0 64a256 256 0 1 1 0-512 256 256 0 0 1 0 512zm0-704a32 32 0 0 1 32 32v64a32 32 0 0 1-64 0V96a32 32 0 0 1 32-32zm0 768a32 32 0 0 1 32 32v64a32 32 0 1 1-64 0v-64a32 32 0 0 1 32-32zM195.2 195.2a32 32 0 0 1 45.248 0l45.248 45.248a32 32 0 1 1-45.248 45.248L195.2 240.448a32 32 0 0 1 0-45.248zm543.104 543.104a32 32 0 0 1 45.248 0l45.248 45.248a32 32 0 0 1-45.248 45.248l-45.248-45.248a32 32 0 0 1 0-45.248zM64 512a32 32 0 0 1 32-32h64a32 32 0 0 1 0 64H96a32 32 0 0 1-32-32zm768 0a32 32 0 0 1 32-32h64a32 32 0 1 1 0 64h-64a32 32 0 0 1-32-32zM195.2 828.8a32 32 0 0 1 0-45.248l45.248-45.248a32 32 0 0 1 45.248 45.248L240.448 828.8a32 32 0 0 1-45.248 0zm543.104-543.104a32 32 0 0 1 0-45.248l45.248-45.248a32 32 0 0 1 45.248 45.248l-45.248 45.248a32 32 0 0 1-45.248 0z' }, null, -1 ), _hoisted_3245 = [_hoisted_2246] function _sfc_render246(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1246, _hoisted_3245) } var sunny_default = export_helper_default(_sfc_main246, [ ['render', _sfc_render246], ['__file', 'sunny.vue'] ]), _sfc_main247 = { name: 'Sunrise' }, _hoisted_1247 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2247 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M32 768h960a32 32 0 1 1 0 64H32a32 32 0 1 1 0-64zm129.408-96a352 352 0 0 1 701.184 0h-64.32a288 288 0 0 0-572.544 0h-64.32zM512 128a32 32 0 0 1 32 32v96a32 32 0 0 1-64 0v-96a32 32 0 0 1 32-32zm407.296 168.704a32 32 0 0 1 0 45.248l-67.84 67.84a32 32 0 1 1-45.248-45.248l67.84-67.84a32 32 0 0 1 45.248 0zm-814.592 0a32 32 0 0 1 45.248 0l67.84 67.84a32 32 0 1 1-45.248 45.248l-67.84-67.84a32 32 0 0 1 0-45.248z' }, null, -1 ), _hoisted_3246 = [_hoisted_2247] function _sfc_render247(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1247, _hoisted_3246) } var sunrise_default = export_helper_default(_sfc_main247, [ ['render', _sfc_render247], ['__file', 'sunrise.vue'] ]), _sfc_main248 = { name: 'Sunset' }, _hoisted_1248 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2248 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M82.56 640a448 448 0 1 1 858.88 0h-67.2a384 384 0 1 0-724.288 0H82.56zM32 704h960q32 0 32 32t-32 32H32q-32 0-32-32t32-32zm256 128h448q32 0 32 32t-32 32H288q-32 0-32-32t32-32z' }, null, -1 ), _hoisted_3247 = [_hoisted_2248] function _sfc_render248(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1248, _hoisted_3247) } var sunset_default = export_helper_default(_sfc_main248, [ ['render', _sfc_render248], ['__file', 'sunset.vue'] ]), _sfc_main249 = { name: 'SwitchButton' }, _hoisted_1249 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2249 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M352 159.872V230.4a352 352 0 1 0 320 0v-70.528A416.128 416.128 0 0 1 512 960a416 416 0 0 1-160-800.128z' }, null, -1 ), _hoisted_3248 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64q32 0 32 32v320q0 32-32 32t-32-32V96q0-32 32-32z' }, null, -1 ), _hoisted_473 = [_hoisted_2249, _hoisted_3248] function _sfc_render249(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1249, _hoisted_473) } var switch_button_default = export_helper_default(_sfc_main249, [ ['render', _sfc_render249], ['__file', 'switch-button.vue'] ]), _sfc_main250 = { name: 'Switch' }, _hoisted_1250 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2250 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M118.656 438.656a32 32 0 0 1 0-45.248L416 96l4.48-3.776A32 32 0 0 1 461.248 96l3.712 4.48a32.064 32.064 0 0 1-3.712 40.832L218.56 384H928a32 32 0 1 1 0 64H141.248a32 32 0 0 1-22.592-9.344zM64 608a32 32 0 0 1 32-32h786.752a32 32 0 0 1 22.656 54.592L608 928l-4.48 3.776a32.064 32.064 0 0 1-40.832-49.024L805.632 640H96a32 32 0 0 1-32-32z' }, null, -1 ), _hoisted_3249 = [_hoisted_2250] function _sfc_render250(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1250, _hoisted_3249) } var switch_default = export_helper_default(_sfc_main250, [ ['render', _sfc_render250], ['__file', 'switch.vue'] ]), _sfc_main251 = { name: 'TakeawayBox' }, _hoisted_1251 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2251 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M832 384H192v448h640V384zM96 320h832V128H96v192zm800 64v480a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V384H64a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32h896a32 32 0 0 1 32 32v256a32 32 0 0 1-32 32h-64zM416 512h192a32 32 0 0 1 0 64H416a32 32 0 0 1 0-64z' }, null, -1 ), _hoisted_3250 = [_hoisted_2251] function _sfc_render251(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1251, _hoisted_3250) } var takeaway_box_default = export_helper_default(_sfc_main251, [ ['render', _sfc_render251], ['__file', 'takeaway-box.vue'] ]), _sfc_main252 = { name: 'Ticket' }, _hoisted_1252 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2252 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 832H64V640a128 128 0 1 0 0-256V192h576v160h64V192h256v192a128 128 0 1 0 0 256v192H704V672h-64v160zm0-416v192h64V416h-64z' }, null, -1 ), _hoisted_3251 = [_hoisted_2252] function _sfc_render252(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1252, _hoisted_3251) } var ticket_default = export_helper_default(_sfc_main252, [ ['render', _sfc_render252], ['__file', 'ticket.vue'] ]), _sfc_main253 = { name: 'Tickets' }, _hoisted_1253 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2253 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M192 128v768h640V128H192zm-32-64h704a32 32 0 0 1 32 32v832a32 32 0 0 1-32 32H160a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32zm160 448h384v64H320v-64zm0-192h192v64H320v-64zm0 384h384v64H320v-64z' }, null, -1 ), _hoisted_3252 = [_hoisted_2253] function _sfc_render253(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1253, _hoisted_3252) } var tickets_default = export_helper_default(_sfc_main253, [ ['render', _sfc_render253], ['__file', 'tickets.vue'] ]), _sfc_main254 = { name: 'Timer' }, _hoisted_1254 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2254 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 896a320 320 0 1 0 0-640 320 320 0 0 0 0 640zm0 64a384 384 0 1 1 0-768 384 384 0 0 1 0 768z' }, null, -1 ), _hoisted_3253 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 320a32 32 0 0 1 32 32l-.512 224a32 32 0 1 1-64 0L480 352a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_474 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M448 576a64 64 0 1 0 128 0 64 64 0 1 0-128 0zm96-448v128h-64V128h-96a32 32 0 0 1 0-64h256a32 32 0 1 1 0 64h-96z' }, null, -1 ), _hoisted_519 = [_hoisted_2254, _hoisted_3253, _hoisted_474] function _sfc_render254(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1254, _hoisted_519) } var timer_default = export_helper_default(_sfc_main254, [ ['render', _sfc_render254], ['__file', 'timer.vue'] ]), _sfc_main255 = { name: 'ToiletPaper' }, _hoisted_1255 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2255 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M595.2 128H320a192 192 0 0 0-192 192v576h384V352c0-90.496 32.448-171.2 83.2-224zM736 64c123.712 0 224 128.96 224 288S859.712 640 736 640H576v320H64V320A256 256 0 0 1 320 64h416zM576 352v224h160c84.352 0 160-97.28 160-224s-75.648-224-160-224-160 97.28-160 224z' }, null, -1 ), _hoisted_3254 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M736 448c-35.328 0-64-43.008-64-96s28.672-96 64-96 64 43.008 64 96-28.672 96-64 96z' }, null, -1 ), _hoisted_475 = [_hoisted_2255, _hoisted_3254] function _sfc_render255(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1255, _hoisted_475) } var toilet_paper_default = export_helper_default(_sfc_main255, [ ['render', _sfc_render255], ['__file', 'toilet-paper.vue'] ]), _sfc_main256 = { name: 'Tools' }, _hoisted_1256 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2256 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M764.416 254.72a351.68 351.68 0 0 1 86.336 149.184H960v192.064H850.752a351.68 351.68 0 0 1-86.336 149.312l54.72 94.72-166.272 96-54.592-94.72a352.64 352.64 0 0 1-172.48 0L371.136 936l-166.272-96 54.72-94.72a351.68 351.68 0 0 1-86.336-149.312H64v-192h109.248a351.68 351.68 0 0 1 86.336-149.312L204.8 160l166.208-96h.192l54.656 94.592a352.64 352.64 0 0 1 172.48 0L652.8 64h.128L819.2 160l-54.72 94.72zM704 499.968a192 192 0 1 0-384 0 192 192 0 0 0 384 0z' }, null, -1 ), _hoisted_3255 = [_hoisted_2256] function _sfc_render256(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1256, _hoisted_3255) } var tools_default = export_helper_default(_sfc_main256, [ ['render', _sfc_render256], ['__file', 'tools.vue'] ]), _sfc_main257 = { name: 'TopLeft' }, _hoisted_1257 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2257 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M256 256h416a32 32 0 1 0 0-64H224a32 32 0 0 0-32 32v448a32 32 0 0 0 64 0V256z' }, null, -1 ), _hoisted_3256 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M246.656 201.344a32 32 0 0 0-45.312 45.312l544 544a32 32 0 0 0 45.312-45.312l-544-544z' }, null, -1 ), _hoisted_476 = [_hoisted_2257, _hoisted_3256] function _sfc_render257(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1257, _hoisted_476) } var top_left_default = export_helper_default(_sfc_main257, [ ['render', _sfc_render257], ['__file', 'top-left.vue'] ]), _sfc_main258 = { name: 'TopRight' }, _hoisted_1258 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2258 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M768 256H353.6a32 32 0 1 1 0-64H800a32 32 0 0 1 32 32v448a32 32 0 0 1-64 0V256z' }, null, -1 ), _hoisted_3257 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M777.344 201.344a32 32 0 0 1 45.312 45.312l-544 544a32 32 0 0 1-45.312-45.312l544-544z' }, null, -1 ), _hoisted_477 = [_hoisted_2258, _hoisted_3257] function _sfc_render258(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1258, _hoisted_477) } var top_right_default = export_helper_default(_sfc_main258, [ ['render', _sfc_render258], ['__file', 'top-right.vue'] ]), _sfc_main259 = { name: 'Top' }, _hoisted_1259 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2259 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M572.235 205.282v600.365a30.118 30.118 0 1 1-60.235 0V205.282L292.382 438.633a28.913 28.913 0 0 1-42.646 0 33.43 33.43 0 0 1 0-45.236l271.058-288.045a28.913 28.913 0 0 1 42.647 0L834.5 393.397a33.43 33.43 0 0 1 0 45.176 28.913 28.913 0 0 1-42.647 0l-219.618-233.23z' }, null, -1 ), _hoisted_3258 = [_hoisted_2259] function _sfc_render259(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1259, _hoisted_3258) } var top_default = export_helper_default(_sfc_main259, [ ['render', _sfc_render259], ['__file', 'top.vue'] ]), _sfc_main260 = { name: 'TrendCharts' }, _hoisted_1260 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2260 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 896V128h768v768H128zm291.712-327.296 128 102.4 180.16-201.792-47.744-42.624-139.84 156.608-128-102.4-180.16 201.792 47.744 42.624 139.84-156.608zM816 352a48 48 0 1 0-96 0 48 48 0 0 0 96 0z' }, null, -1 ), _hoisted_3259 = [_hoisted_2260] function _sfc_render260(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1260, _hoisted_3259) } var trend_charts_default = export_helper_default(_sfc_main260, [ ['render', _sfc_render260], ['__file', 'trend-charts.vue'] ]), _sfc_main261 = { name: 'Trophy' }, _hoisted_1261 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2261 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 896V702.08A256.256 256.256 0 0 1 264.064 512h-32.64a96 96 0 0 1-91.968-68.416L93.632 290.88a76.8 76.8 0 0 1 73.6-98.88H256V96a32 32 0 0 1 32-32h448a32 32 0 0 1 32 32v96h88.768a76.8 76.8 0 0 1 73.6 98.88L884.48 443.52A96 96 0 0 1 792.576 512h-32.64A256.256 256.256 0 0 1 544 702.08V896h128a32 32 0 1 1 0 64H352a32 32 0 1 1 0-64h128zm224-448V128H320v320a192 192 0 1 0 384 0zm64 0h24.576a32 32 0 0 0 30.656-22.784l45.824-152.768A12.8 12.8 0 0 0 856.768 256H768v192zm-512 0V256h-88.768a12.8 12.8 0 0 0-12.288 16.448l45.824 152.768A32 32 0 0 0 231.424 448H256z' }, null, -1 ), _hoisted_3260 = [_hoisted_2261] function _sfc_render261(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1261, _hoisted_3260) } var trophy_default = export_helper_default(_sfc_main261, [ ['render', _sfc_render261], ['__file', 'trophy.vue'] ]), _sfc_main262 = { name: 'TurnOff' }, _hoisted_1262 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2262 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M329.956 257.138a254.862 254.862 0 0 0 0 509.724h364.088a254.862 254.862 0 0 0 0-509.724H329.956zm0-72.818h364.088a327.68 327.68 0 1 1 0 655.36H329.956a327.68 327.68 0 1 1 0-655.36z' }, null, -1 ), _hoisted_3261 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M329.956 621.227a109.227 109.227 0 1 0 0-218.454 109.227 109.227 0 0 0 0 218.454zm0 72.817a182.044 182.044 0 1 1 0-364.088 182.044 182.044 0 0 1 0 364.088z' }, null, -1 ), _hoisted_478 = [_hoisted_2262, _hoisted_3261] function _sfc_render262(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1262, _hoisted_478) } var turn_off_default = export_helper_default(_sfc_main262, [ ['render', _sfc_render262], ['__file', 'turn-off.vue'] ]), _sfc_main263 = { name: 'Umbrella' }, _hoisted_1263 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2263 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M320 768a32 32 0 1 1 64 0 64 64 0 0 0 128 0V512H64a448 448 0 1 1 896 0H576v256a128 128 0 1 1-256 0zm570.688-320a384.128 384.128 0 0 0-757.376 0h757.376z' }, null, -1 ), _hoisted_3262 = [_hoisted_2263] function _sfc_render263(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1263, _hoisted_3262) } var umbrella_default = export_helper_default(_sfc_main263, [ ['render', _sfc_render263], ['__file', 'umbrella.vue'] ]), _sfc_main264 = { name: 'Unlock' }, _hoisted_1264 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2264 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M224 448a32 32 0 0 0-32 32v384a32 32 0 0 0 32 32h576a32 32 0 0 0 32-32V480a32 32 0 0 0-32-32H224zm0-64h576a96 96 0 0 1 96 96v384a96 96 0 0 1-96 96H224a96 96 0 0 1-96-96V480a96 96 0 0 1 96-96z' }, null, -1 ), _hoisted_3263 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 544a32 32 0 0 1 32 32v192a32 32 0 1 1-64 0V576a32 32 0 0 1 32-32zm178.304-295.296A192.064 192.064 0 0 0 320 320v64h352l96 38.4V448H256V320a256 256 0 0 1 493.76-95.104l-59.456 23.808z' }, null, -1 ), _hoisted_479 = [_hoisted_2264, _hoisted_3263] function _sfc_render264(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1264, _hoisted_479) } var unlock_default = export_helper_default(_sfc_main264, [ ['render', _sfc_render264], ['__file', 'unlock.vue'] ]), _sfc_main265 = { name: 'UploadFilled' }, _hoisted_1265 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2265 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M544 864V672h128L512 480 352 672h128v192H320v-1.6c-5.376.32-10.496 1.6-16 1.6A240 240 0 0 1 64 624c0-123.136 93.12-223.488 212.608-237.248A239.808 239.808 0 0 1 512 192a239.872 239.872 0 0 1 235.456 194.752c119.488 13.76 212.48 114.112 212.48 237.248a240 240 0 0 1-240 240c-5.376 0-10.56-1.28-16-1.6v1.6H544z' }, null, -1 ), _hoisted_3264 = [_hoisted_2265] function _sfc_render265(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1265, _hoisted_3264) } var upload_filled_default = export_helper_default(_sfc_main265, [ ['render', _sfc_render265], ['__file', 'upload-filled.vue'] ]), _sfc_main266 = { name: 'Upload' }, _hoisted_1266 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2266 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 832h704a32 32 0 1 1 0 64H160a32 32 0 1 1 0-64zm384-578.304V704h-64V247.296L237.248 490.048 192 444.8 508.8 128l316.8 316.8-45.312 45.248L544 253.696z' }, null, -1 ), _hoisted_3265 = [_hoisted_2266] function _sfc_render266(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1266, _hoisted_3265) } var upload_default = export_helper_default(_sfc_main266, [ ['render', _sfc_render266], ['__file', 'upload.vue'] ]), _sfc_main267 = { name: 'UserFilled' }, _hoisted_1267 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2267 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M288 320a224 224 0 1 0 448 0 224 224 0 1 0-448 0zm544 608H160a32 32 0 0 1-32-32v-96a160 160 0 0 1 160-160h448a160 160 0 0 1 160 160v96a32 32 0 0 1-32 32z' }, null, -1 ), _hoisted_3266 = [_hoisted_2267] function _sfc_render267(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1267, _hoisted_3266) } var user_filled_default = export_helper_default(_sfc_main267, [ ['render', _sfc_render267], ['__file', 'user-filled.vue'] ]), _sfc_main268 = { name: 'User' }, _hoisted_1268 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2268 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 512a192 192 0 1 0 0-384 192 192 0 0 0 0 384zm0 64a256 256 0 1 1 0-512 256 256 0 0 1 0 512zm320 320v-96a96 96 0 0 0-96-96H288a96 96 0 0 0-96 96v96a32 32 0 1 1-64 0v-96a160 160 0 0 1 160-160h448a160 160 0 0 1 160 160v96a32 32 0 1 1-64 0z' }, null, -1 ), _hoisted_3267 = [_hoisted_2268] function _sfc_render268(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1268, _hoisted_3267) } var user_default = export_helper_default(_sfc_main268, [ ['render', _sfc_render268], ['__file', 'user.vue'] ]), _sfc_main269 = { name: 'Van' }, _hoisted_1269 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2269 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128.896 736H96a32 32 0 0 1-32-32V224a32 32 0 0 1 32-32h576a32 32 0 0 1 32 32v96h164.544a32 32 0 0 1 31.616 27.136l54.144 352A32 32 0 0 1 922.688 736h-91.52a144 144 0 1 1-286.272 0H415.104a144 144 0 1 1-286.272 0zm23.36-64a143.872 143.872 0 0 1 239.488 0H568.32c17.088-25.6 42.24-45.376 71.744-55.808V256H128v416h24.256zm655.488 0h77.632l-19.648-128H704v64.896A144 144 0 0 1 807.744 672zm48.128-192-14.72-96H704v96h151.872zM688 832a80 80 0 1 0 0-160 80 80 0 0 0 0 160zm-416 0a80 80 0 1 0 0-160 80 80 0 0 0 0 160z' }, null, -1 ), _hoisted_3268 = [_hoisted_2269] function _sfc_render269(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1269, _hoisted_3268) } var van_default = export_helper_default(_sfc_main269, [ ['render', _sfc_render269], ['__file', 'van.vue'] ]), _sfc_main270 = { name: 'VideoCameraFilled' }, _hoisted_1270 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2270 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm768 576 192-64v320l-192-64v96a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V480a32 32 0 0 1 32-32h640a32 32 0 0 1 32 32v96zM192 768v64h384v-64H192zm192-480a160 160 0 0 1 320 0 160 160 0 0 1-320 0zm64 0a96 96 0 1 0 192.064-.064A96 96 0 0 0 448 288zm-320 32a128 128 0 1 1 256.064.064A128 128 0 0 1 128 320zm64 0a64 64 0 1 0 128 0 64 64 0 0 0-128 0z' }, null, -1 ), _hoisted_3269 = [_hoisted_2270] function _sfc_render270(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1270, _hoisted_3269) } var video_camera_filled_default = export_helper_default(_sfc_main270, [ ['render', _sfc_render270], ['__file', 'video-camera-filled.vue'] ]), _sfc_main271 = { name: 'VideoCamera' }, _hoisted_1271 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2271 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 768V256H128v512h576zm64-416 192-96v512l-192-96v128a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V224a32 32 0 0 1 32-32h640a32 32 0 0 1 32 32v128zm0 71.552v176.896l128 64V359.552l-128 64zM192 320h192v64H192v-64z' }, null, -1 ), _hoisted_3270 = [_hoisted_2271] function _sfc_render271(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1271, _hoisted_3270) } var video_camera_default = export_helper_default(_sfc_main271, [ ['render', _sfc_render271], ['__file', 'video-camera.vue'] ]), _sfc_main272 = { name: 'VideoPause' }, _hoisted_1272 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2272 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 832a384 384 0 0 0 0-768 384 384 0 0 0 0 768zm-96-544q32 0 32 32v256q0 32-32 32t-32-32V384q0-32 32-32zm192 0q32 0 32 32v256q0 32-32 32t-32-32V384q0-32 32-32z' }, null, -1 ), _hoisted_3271 = [_hoisted_2272] function _sfc_render272(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1272, _hoisted_3271) } var video_pause_default = export_helper_default(_sfc_main272, [ ['render', _sfc_render272], ['__file', 'video-pause.vue'] ]), _sfc_main273 = { name: 'VideoPlay' }, _hoisted_1273 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2273 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 832a384 384 0 0 0 0-768 384 384 0 0 0 0 768zm-48-247.616L668.608 512 464 375.616v272.768zm10.624-342.656 249.472 166.336a48 48 0 0 1 0 79.872L474.624 718.272A48 48 0 0 1 400 678.336V345.6a48 48 0 0 1 74.624-39.936z' }, null, -1 ), _hoisted_3272 = [_hoisted_2273] function _sfc_render273(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1273, _hoisted_3272) } var video_play_default = export_helper_default(_sfc_main273, [ ['render', _sfc_render273], ['__file', 'video-play.vue'] ]), _sfc_main274 = { name: 'View' }, _hoisted_1274 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2274 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352zm0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 1 1 0 448 224 224 0 0 1 0-448zm0 64a160.192 160.192 0 0 0-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160z' }, null, -1 ), _hoisted_3273 = [_hoisted_2274] function _sfc_render274(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1274, _hoisted_3273) } var view_default = export_helper_default(_sfc_main274, [ ['render', _sfc_render274], ['__file', 'view.vue'] ]), _sfc_main275 = { name: 'WalletFilled' }, _hoisted_1275 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2275 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M688 512a112 112 0 1 0 0 224h208v160H128V352h768v160H688zm32 160h-32a48 48 0 0 1 0-96h32a48 48 0 0 1 0 96zm-80-544 128 160H384l256-160z' }, null, -1 ), _hoisted_3274 = [_hoisted_2275] function _sfc_render275(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1275, _hoisted_3274) } var wallet_filled_default = export_helper_default(_sfc_main275, [ ['render', _sfc_render275], ['__file', 'wallet-filled.vue'] ]), _sfc_main276 = { name: 'Wallet' }, _hoisted_1276 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2276 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M640 288h-64V128H128v704h384v32a32 32 0 0 0 32 32H96a32 32 0 0 1-32-32V96a32 32 0 0 1 32-32h512a32 32 0 0 1 32 32v192z' }, null, -1 ), _hoisted_3275 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M128 320v512h768V320H128zm-32-64h832a32 32 0 0 1 32 32v576a32 32 0 0 1-32 32H96a32 32 0 0 1-32-32V288a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_480 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M704 640a64 64 0 1 1 0-128 64 64 0 0 1 0 128z' }, null, -1 ), _hoisted_520 = [_hoisted_2276, _hoisted_3275, _hoisted_480] function _sfc_render276(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1276, _hoisted_520) } var wallet_default = export_helper_default(_sfc_main276, [ ['render', _sfc_render276], ['__file', 'wallet.vue'] ]), _sfc_main277 = { name: 'WarningFilled' }, _hoisted_1277 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2277 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 192a58.432 58.432 0 0 0-58.24 63.744l23.36 256.384a35.072 35.072 0 0 0 69.76 0l23.296-256.384A58.432 58.432 0 0 0 512 256zm0 512a51.2 51.2 0 1 0 0-102.4 51.2 51.2 0 0 0 0 102.4z' }, null, -1 ), _hoisted_3276 = [_hoisted_2277] function _sfc_render277(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1277, _hoisted_3276) } var warning_filled_default = export_helper_default(_sfc_main277, [ ['render', _sfc_render277], ['__file', 'warning-filled.vue'] ]), _sfc_main278 = { name: 'Warning' }, _hoisted_1278 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2278 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 64a448 448 0 1 1 0 896 448 448 0 0 1 0-896zm0 832a384 384 0 0 0 0-768 384 384 0 0 0 0 768zm48-176a48 48 0 1 1-96 0 48 48 0 0 1 96 0zm-48-464a32 32 0 0 1 32 32v288a32 32 0 0 1-64 0V288a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_3277 = [_hoisted_2278] function _sfc_render278(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1278, _hoisted_3277) } var warning_default = export_helper_default(_sfc_main278, [ ['render', _sfc_render278], ['__file', 'warning.vue'] ]), _sfc_main279 = { name: 'Watch' }, _hoisted_1279 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2279 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M512 768a256 256 0 1 0 0-512 256 256 0 0 0 0 512zm0 64a320 320 0 1 1 0-640 320 320 0 0 1 0 640z' }, null, -1 ), _hoisted_3278 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 352a32 32 0 0 1 32 32v160a32 32 0 0 1-64 0V384a32 32 0 0 1 32-32z' }, null, -1 ), _hoisted_481 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M480 512h128q32 0 32 32t-32 32H480q-32 0-32-32t32-32zm128-256V128H416v128h-64V64h320v192h-64zM416 768v128h192V768h64v192H352V768h64z' }, null, -1 ), _hoisted_521 = [_hoisted_2279, _hoisted_3278, _hoisted_481] function _sfc_render279(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1279, _hoisted_521) } var watch_default = export_helper_default(_sfc_main279, [ ['render', _sfc_render279], ['__file', 'watch.vue'] ]), _sfc_main280 = { name: 'Watermelon' }, _hoisted_1280 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2280 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm683.072 600.32-43.648 162.816-61.824-16.512 53.248-198.528L576 493.248l-158.4 158.4-45.248-45.248 158.4-158.4-55.616-55.616-198.528 53.248-16.512-61.824 162.816-43.648L282.752 200A384 384 0 0 0 824 741.248L683.072 600.32zm231.552 141.056a448 448 0 1 1-632-632l632 632z' }, null, -1 ), _hoisted_3279 = [_hoisted_2280] function _sfc_render280(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1280, _hoisted_3279) } var watermelon_default = export_helper_default(_sfc_main280, [ ['render', _sfc_render280], ['__file', 'watermelon.vue'] ]), _sfc_main281 = { name: 'WindPower' }, _hoisted_1281 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2281 = createBaseVNode( 'path', { fill: 'currentColor', d: 'M160 64q32 0 32 32v832q0 32-32 32t-32-32V96q0-32 32-32zm416 354.624 128-11.584V168.96l-128-11.52v261.12zm-64 5.824V151.552L320 134.08V160h-64V64l616.704 56.064A96 96 0 0 1 960 215.68v144.64a96 96 0 0 1-87.296 95.616L256 512V224h64v217.92l192-17.472zm256-23.232 98.88-8.96A32 32 0 0 0 896 360.32V215.68a32 32 0 0 0-29.12-31.872l-98.88-8.96v226.368z' }, null, -1 ), _hoisted_3280 = [_hoisted_2281] function _sfc_render281(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1281, _hoisted_3280) } var wind_power_default = export_helper_default(_sfc_main281, [ ['render', _sfc_render281], ['__file', 'wind-power.vue'] ]), _sfc_main282 = { name: 'ZoomIn' }, _hoisted_1282 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2282 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm795.904 750.72 124.992 124.928a32 32 0 0 1-45.248 45.248L750.656 795.904a416 416 0 1 1 45.248-45.248zM480 832a352 352 0 1 0 0-704 352 352 0 0 0 0 704zm-32-384v-96a32 32 0 0 1 64 0v96h96a32 32 0 0 1 0 64h-96v96a32 32 0 0 1-64 0v-96h-96a32 32 0 0 1 0-64h96z' }, null, -1 ), _hoisted_3281 = [_hoisted_2282] function _sfc_render282(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1282, _hoisted_3281) } var zoom_in_default = export_helper_default(_sfc_main282, [ ['render', _sfc_render282], ['__file', 'zoom-in.vue'] ]), _sfc_main283 = { name: 'ZoomOut' }, _hoisted_1283 = { viewBox: '0 0 1024 1024', xmlns: 'http://www.w3.org/2000/svg' }, _hoisted_2283 = createBaseVNode( 'path', { fill: 'currentColor', d: 'm795.904 750.72 124.992 124.928a32 32 0 0 1-45.248 45.248L750.656 795.904a416 416 0 1 1 45.248-45.248zM480 832a352 352 0 1 0 0-704 352 352 0 0 0 0 704zM352 448h256a32 32 0 0 1 0 64H352a32 32 0 0 1 0-64z' }, null, -1 ), _hoisted_3282 = [_hoisted_2283] function _sfc_render283(e, t, r, o, n, a) { return openBlock(), createElementBlock('svg', _hoisted_1283, _hoisted_3282) } var zoom_out_default = export_helper_default(_sfc_main283, [ ['render', _sfc_render283], ['__file', 'zoom-out.vue'] ]), ElementPlusIconsVue = Object.freeze( Object.defineProperty( { __proto__: null, AddLocation: add_location_default, Aim: aim_default, AlarmClock: alarm_clock_default, Apple: apple_default, ArrowDown: arrow_down_default, ArrowDownBold: arrow_down_bold_default, ArrowLeft: arrow_left_default, ArrowLeftBold: arrow_left_bold_default, ArrowRight: arrow_right_default, ArrowRightBold: arrow_right_bold_default, ArrowUp: arrow_up_default, ArrowUpBold: arrow_up_bold_default, Avatar: avatar_default, Back: back_default, Baseball: baseball_default, Basketball: basketball_default, Bell: bell_default, BellFilled: bell_filled_default, Bicycle: bicycle_default, Bottom: bottom_default, BottomLeft: bottom_left_default, BottomRight: bottom_right_default, Bowl: bowl_default, Box: box_default, Briefcase: briefcase_default, Brush: brush_default, BrushFilled: brush_filled_default, Burger: burger_default, Calendar: calendar_default, Camera: camera_default, CameraFilled: camera_filled_default, CaretBottom: caret_bottom_default, CaretLeft: caret_left_default, CaretRight: caret_right_default, CaretTop: caret_top_default, Cellphone: cellphone_default, ChatDotRound: chat_dot_round_default, ChatDotSquare: chat_dot_square_default, ChatLineRound: chat_line_round_default, ChatLineSquare: chat_line_square_default, ChatRound: chat_round_default, ChatSquare: chat_square_default, Check: check_default, Checked: checked_default, Cherry: cherry_default, Chicken: chicken_default, CircleCheck: circle_check_default, CircleCheckFilled: circle_check_filled_default, CircleClose: circle_close_default, CircleCloseFilled: circle_close_filled_default, CirclePlus: circle_plus_default, CirclePlusFilled: circle_plus_filled_default, Clock: clock_default, Close: close_default, CloseBold: close_bold_default, Cloudy: cloudy_default, Coffee: coffee_default, CoffeeCup: coffee_cup_default, Coin: coin_default, ColdDrink: cold_drink_default, Collection: collection_default, CollectionTag: collection_tag_default, Comment: comment_default, Compass: compass_default, Connection: connection_default, Coordinate: coordinate_default, CopyDocument: copy_document_default, Cpu: cpu_default, CreditCard: credit_card_default, Crop: crop_default, DArrowLeft: d_arrow_left_default, DArrowRight: d_arrow_right_default, DCaret: d_caret_default, DataAnalysis: data_analysis_default, DataBoard: data_board_default, DataLine: data_line_default, Delete: delete_default, DeleteFilled: delete_filled_default, DeleteLocation: delete_location_default, Dessert: dessert_default, Discount: discount_default, Dish: dish_default, DishDot: dish_dot_default, Document: document_default, DocumentAdd: document_add_default, DocumentChecked: document_checked_default, DocumentCopy: document_copy_default, DocumentDelete: document_delete_default, DocumentRemove: document_remove_default, Download: download_default, Drizzling: drizzling_default, Edit: edit_default, EditPen: edit_pen_default, Eleme: eleme_default, ElemeFilled: eleme_filled_default, ElementPlus: element_plus_default, Expand: expand_default, Failed: failed_default, Female: female_default, Files: files_default, Film: film_default, Filter: filter_default, Finished: finished_default, FirstAidKit: first_aid_kit_default, Flag: flag_default, Fold: fold_default, Folder: folder_default, FolderAdd: folder_add_default, FolderChecked: folder_checked_default, FolderDelete: folder_delete_default, FolderOpened: folder_opened_default, FolderRemove: folder_remove_default, Food: food_default, Football: football_default, ForkSpoon: fork_spoon_default, Fries: fries_default, FullScreen: full_screen_default, Goblet: goblet_default, GobletFull: goblet_full_default, GobletSquare: goblet_square_default, GobletSquareFull: goblet_square_full_default, Goods: goods_default, GoodsFilled: goods_filled_default, Grape: grape_default, Grid: grid_default, Guide: guide_default, Headset: headset_default, Help: help_default, HelpFilled: help_filled_default, Hide: hide_default, Histogram: histogram_default, HomeFilled: home_filled_default, HotWater: hot_water_default, House: house_default, IceCream: ice_cream_default, IceCreamRound: ice_cream_round_default, IceCreamSquare: ice_cream_square_default, IceDrink: ice_drink_default, IceTea: ice_tea_default, InfoFilled: info_filled_default, Iphone: iphone_default, Key: key_default, KnifeFork: knife_fork_default, Lightning: lightning_default, Link: link_default, List: list_default, Loading: loading_default, Location: location_default, LocationFilled: location_filled_default, LocationInformation: location_information_default, Lock: lock_default, Lollipop: lollipop_default, MagicStick: magic_stick_default, Magnet: magnet_default, Male: male_default, Management: management_default, MapLocation: map_location_default, Medal: medal_default, Menu: menu_default, Message: message_default, MessageBox: message_box_default, Mic: mic_default, Microphone: microphone_default, MilkTea: milk_tea_default, Minus: minus_default, Money: money_default, Monitor: monitor_default, Moon: moon_default, MoonNight: moon_night_default, More: more_default, MoreFilled: more_filled_default, MostlyCloudy: mostly_cloudy_default, Mouse: mouse_default, Mug: mug_default, Mute: mute_default, MuteNotification: mute_notification_default, NoSmoking: no_smoking_default, Notebook: notebook_default, Notification: notification_default, Odometer: odometer_default, OfficeBuilding: office_building_default, Open: open_default, Operation: operation_default, Opportunity: opportunity_default, Orange: orange_default, Paperclip: paperclip_default, PartlyCloudy: partly_cloudy_default, Pear: pear_default, Phone: phone_default, PhoneFilled: phone_filled_default, Picture: picture_default, PictureFilled: picture_filled_default, PictureRounded: picture_rounded_default, PieChart: pie_chart_default, Place: place_default, Platform: platform_default, Plus: plus_default, Pointer: pointer_default, Position: position_default, Postcard: postcard_default, Pouring: pouring_default, Present: present_default, PriceTag: price_tag_default, Printer: printer_default, Promotion: promotion_default, QuestionFilled: question_filled_default, Rank: rank_default, Reading: reading_default, ReadingLamp: reading_lamp_default, Refresh: refresh_default, RefreshLeft: refresh_left_default, RefreshRight: refresh_right_default, Refrigerator: refrigerator_default, Remove: remove_default, RemoveFilled: remove_filled_default, Right: right_default, ScaleToOriginal: scale_to_original_default, School: school_default, Scissor: scissor_default, Search: search_default, Select: select_default, Sell: sell_default, SemiSelect: semi_select_default, Service: service_default, SetUp: set_up_default, Setting: setting_default, Share: share_default, Ship: ship_default, Shop: shop_default, ShoppingBag: shopping_bag_default, ShoppingCart: shopping_cart_default, ShoppingCartFull: shopping_cart_full_default, Smoking: smoking_default, Soccer: soccer_default, SoldOut: sold_out_default, Sort: sort_default, SortDown: sort_down_default, SortUp: sort_up_default, Stamp: stamp_default, Star: star_default, StarFilled: star_filled_default, Stopwatch: stopwatch_default, SuccessFilled: success_filled_default, Sugar: sugar_default, Suitcase: suitcase_default, Sunny: sunny_default, Sunrise: sunrise_default, Sunset: sunset_default, Switch: switch_default, SwitchButton: switch_button_default, TakeawayBox: takeaway_box_default, Ticket: ticket_default, Tickets: tickets_default, Timer: timer_default, ToiletPaper: toilet_paper_default, Tools: tools_default, Top: top_default, TopLeft: top_left_default, TopRight: top_right_default, TrendCharts: trend_charts_default, Trophy: trophy_default, TurnOff: turn_off_default, Umbrella: umbrella_default, Unlock: unlock_default, Upload: upload_default, UploadFilled: upload_filled_default, User: user_default, UserFilled: user_filled_default, Van: van_default, VideoCamera: video_camera_default, VideoCameraFilled: video_camera_filled_default, VideoPause: video_pause_default, VideoPlay: video_play_default, View: view_default, Wallet: wallet_default, WalletFilled: wallet_filled_default, Warning: warning_default, WarningFilled: warning_filled_default, Watch: watch_default, Watermelon: watermelon_default, WindPower: wind_power_default, ZoomIn: zoom_in_default, ZoomOut: zoom_out_default }, Symbol.toStringTag, { value: 'Module' } ) ) const epPropKey = '__epPropKey', definePropType = e => e, isEpProp = e => isObject$2(e) && !!e[epPropKey], buildProp = (e, t) => { if (!isObject$2(e) || isEpProp(e)) return e const { values: r, required: o, default: n, type: a, validator: l } = e, c = { type: a, required: !!o, validator: r || l ? d => { let u = !1, m = [] if ( (r && ((m = Array.from(r)), hasOwn$2(e, 'default') && m.push(n), u || (u = m.includes(d))), l && (u || (u = l(d))), !u && m.length > 0) ) { const f = [...new Set(m)] .map(_ => JSON.stringify(_)) .join(', ') warn( `Invalid prop: validation failed${ t ? ` for prop "${t}"` : '' }. Expected one of [${f}], got value ${JSON.stringify(d)}.` ) } return u } : void 0, [epPropKey]: !0 } return hasOwn$2(e, 'default') && (c.default = n), c }, buildProps = e => fromPairs(Object.entries(e).map(([t, r]) => [t, buildProp(r, t)])), iconPropType = definePropType([String, Object, Function]), CloseComponents = { Close: close_default }, TypeComponents = { Close: close_default, SuccessFilled: success_filled_default, InfoFilled: info_filled_default, WarningFilled: warning_filled_default, CircleCloseFilled: circle_close_filled_default }, TypeComponentsMap = { success: success_filled_default, warning: warning_filled_default, error: circle_close_filled_default, info: info_filled_default }, ValidateComponentsMap = { validating: loading_default, success: circle_check_default, error: circle_close_default }, withInstall = (e, t) => { if ( ((e.install = r => { for (const o of [e, ...Object.values(t != null ? t : {})]) r.component(o.name, o) }), t) ) for (const [r, o] of Object.entries(t)) e[r] = o return e }, withInstallFunction = (e, t) => ( (e.install = r => { ;(e._context = r._context), (r.config.globalProperties[t] = e) }), e ), withNoopInstall = e => ((e.install = NOOP), e), composeRefs = (...e) => t => { e.forEach(r => { isFunction$1(r) ? r(t) : (r.value = t) }) }, EVENT_CODE = { tab: 'Tab', enter: 'Enter', space: 'Space', left: 'ArrowLeft', up: 'ArrowUp', right: 'ArrowRight', down: 'ArrowDown', esc: 'Escape', delete: 'Delete', backspace: 'Backspace', numpadEnter: 'NumpadEnter', pageUp: 'PageUp', pageDown: 'PageDown', home: 'Home', end: 'End' }, UPDATE_MODEL_EVENT = 'update:modelValue', CHANGE_EVENT = 'change', componentSizes = ['', 'default', 'small', 'large'], componentSizeMap = { large: 40, default: 32, small: 24 }, isValidComponentSize = e => ['', ...componentSizes].includes(e) var PatchFlags = (e => ( (e[(e.TEXT = 1)] = 'TEXT'), (e[(e.CLASS = 2)] = 'CLASS'), (e[(e.STYLE = 4)] = 'STYLE'), (e[(e.PROPS = 8)] = 'PROPS'), (e[(e.FULL_PROPS = 16)] = 'FULL_PROPS'), (e[(e.HYDRATE_EVENTS = 32)] = 'HYDRATE_EVENTS'), (e[(e.STABLE_FRAGMENT = 64)] = 'STABLE_FRAGMENT'), (e[(e.KEYED_FRAGMENT = 128)] = 'KEYED_FRAGMENT'), (e[(e.UNKEYED_FRAGMENT = 256)] = 'UNKEYED_FRAGMENT'), (e[(e.NEED_PATCH = 512)] = 'NEED_PATCH'), (e[(e.DYNAMIC_SLOTS = 1024)] = 'DYNAMIC_SLOTS'), (e[(e.HOISTED = -1)] = 'HOISTED'), (e[(e.BAIL = -2)] = 'BAIL'), e ))(PatchFlags || {}) const isFirefox = () => isClient && /firefox/i.test(window.navigator.userAgent), isKorean = e => /([(\uAC00-\uD7AF)|(\u3130-\u318F)])+/gi.test(e), generateId = () => Math.floor(Math.random() * 1e4), mutable = e => e, DEFAULT_EXCLUDE_KEYS = ['class', 'style'], LISTENER_PREFIX = /^on[A-Z]/, useAttrs = (e = {}) => { const { excludeListeners: t = !1, excludeKeys: r } = e, o = computed(() => ((r == null ? void 0 : r.value) || []).concat(DEFAULT_EXCLUDE_KEYS) ), n = getCurrentInstance() return computed( n ? () => { var a return fromPairs( Object.entries((a = n.proxy) == null ? void 0 : a.$attrs).filter( ([l]) => !o.value.includes(l) && !(t && LISTENER_PREFIX.test(l)) ) ) } : () => ({}) ) }, buttonGroupContextKey = Symbol('buttonGroupContextKey'), configProviderContextKey = Symbol(), dialogInjectionKey = Symbol('dialogInjectionKey'), formContextKey = Symbol('formContextKey'), formItemContextKey = Symbol('formItemContextKey'), rowContextKey = Symbol('rowContextKey'), scrollbarContextKey = Symbol('scrollbarContextKey'), tabsRootContextKey = Symbol('tabsRootContextKey'), POPPER_INJECTION_KEY = Symbol('popper'), POPPER_CONTENT_INJECTION_KEY = Symbol('popperContent'), useProp = e => { const t = getCurrentInstance() return computed(() => { var r, o return (o = ((r = t.proxy) == null ? void 0 : r.$props)[e]) != null ? o : void 0 }) }, globalConfig = ref() function useGlobalConfig(e, t = void 0) { const r = getCurrentInstance() ? inject(configProviderContextKey, globalConfig) : globalConfig return e ? computed(() => { var o, n return (n = (o = r.value) == null ? void 0 : o[e]) != null ? n : t }) : r } const provideGlobalConfig = (e, t, r = !1) => { var o const n = !!getCurrentInstance(), a = n ? useGlobalConfig() : void 0, l = (o = t == null ? void 0 : t.provide) != null ? o : n ? provide : void 0 if (!l) return const s = computed(() => { const c = unref(e) return a != null && a.value ? mergeConfig(a.value, c) : c }) return ( l(configProviderContextKey, s), (r || !globalConfig.value) && (globalConfig.value = s.value), s ) }, mergeConfig = (e, t) => { var r const o = [...new Set([...keysOf(e), ...keysOf(t)])], n = {} for (const a of o) n[a] = (r = t[a]) != null ? r : e[a] return n }, useSizeProp = buildProp({ type: String, values: componentSizes, required: !1 }), useSize = (e, t = {}) => { const r = ref(void 0), o = t.prop ? r : useProp('size'), n = t.global ? r : useGlobalConfig('size'), a = t.form ? { size: void 0 } : inject(formContextKey, void 0), l = t.formItem ? { size: void 0 } : inject(formItemContextKey, void 0) return computed( () => o.value || unref(e) || (l == null ? void 0 : l.size) || (a == null ? void 0 : a.size) || n.value || '' ) }, useDisabled = e => { const t = useProp('disabled'), r = inject(formContextKey, void 0) return computed( () => t.value || unref(e) || (r == null ? void 0 : r.disabled) || !1 ) }, useDeprecated = ( { from: e, replacement: t, scope: r, version: o, ref: n, type: a = 'API' }, l ) => { watch( () => unref(l), s => {}, { immediate: !0 } ) }, useDraggable = (e, t, r) => { let o = { offsetX: 0, offsetY: 0 } const n = s => { const c = s.clientX, d = s.clientY, { offsetX: u, offsetY: m } = o, f = e.value.getBoundingClientRect(), _ = f.left, b = f.top, v = f.width, k = f.height, g = document.documentElement.clientWidth, x = document.documentElement.clientHeight, y = -_ + u, w = -b + m, S = g - _ - v + u, T = x - b - k + m, A = F => { const Y = Math.min(Math.max(u + F.clientX - c, y), S), ae = Math.min(Math.max(m + F.clientY - d, w), T) ;(o = { offsetX: Y, offsetY: ae }), (e.value.style.transform = `translate(${addUnit(Y)}, ${addUnit( ae )})`) }, $ = () => { document.removeEventListener('mousemove', A), document.removeEventListener('mouseup', $) } document.addEventListener('mousemove', A), document.addEventListener('mouseup', $) }, a = () => { t.value && e.value && t.value.addEventListener('mousedown', n) }, l = () => { t.value && e.value && t.value.removeEventListener('mousedown', n) } onMounted(() => { watchEffect(() => { r.value ? a() : l() }) }), onBeforeUnmount(() => { l() }) }, defaultIdInjection = { prefix: Math.floor(Math.random() * 1e4), current: 0 }, ID_INJECTION_KEY = Symbol('elIdInjection'), useId = e => { const t = inject(ID_INJECTION_KEY, defaultIdInjection) return computed(() => unref(e) || `el-id-${t.prefix}-${t.current++}`) }, useFormItem = () => { const e = inject(formContextKey, void 0), t = inject(formItemContextKey, void 0) return { form: e, formItem: t } }, useFormItemInputId = ( e, { formItemContext: t, disableIdGeneration: r, disableIdManagement: o } ) => { r || (r = ref(!1)), o || (o = ref(!1)) const n = ref() let a const l = computed(() => { var s return !!( !e.label && t && t.inputIds && ((s = t.inputIds) == null ? void 0 : s.length) <= 1 ) }) return ( onMounted(() => { a = watch( [toRef(e, 'id'), r], ([s, c]) => { const d = s != null ? s : c ? void 0 : useId().value d !== n.value && (t != null && t.removeInputId && (n.value && t.removeInputId(n.value), !(o != null && o.value) && !c && d && t.addInputId(d)), (n.value = d)) }, { immediate: !0 } ) }), onUnmounted(() => { a && a(), t != null && t.removeInputId && n.value && t.removeInputId(n.value) }), { isLabeledByFormItem: l, inputId: n } ) } var English = { name: 'en', el: { colorpicker: { confirm: 'OK', clear: 'Clear', defaultLabel: 'color picker', description: 'current color is {color}. press enter to select a new color.' }, datepicker: { now: 'Now', today: 'Today', cancel: 'Cancel', clear: 'Clear', confirm: 'OK', dateTablePrompt: 'Use the arrow keys and enter to select the day of the month', monthTablePrompt: 'Use the arrow keys and enter to select the month', yearTablePrompt: 'Use the arrow keys and enter to select the year', selectedDate: 'Selected date', selectDate: 'Select date', selectTime: 'Select time', startDate: 'Start Date', startTime: 'Start Time', endDate: 'End Date', endTime: 'End Time', prevYear: 'Previous Year', nextYear: 'Next Year', prevMonth: 'Previous Month', nextMonth: 'Next Month', year: '', month1: 'January', month2: 'February', month3: 'March', month4: 'April', month5: 'May', month6: 'June', month7: 'July', month8: 'August', month9: 'September', month10: 'October', month11: 'November', month12: 'December', week: 'week', weeks: { sun: 'Sun', mon: 'Mon', tue: 'Tue', wed: 'Wed', thu: 'Thu', fri: 'Fri', sat: 'Sat' }, weeksFull: { sun: 'Sunday', mon: 'Monday', tue: 'Tuesday', wed: 'Wednesday', thu: 'Thursday', fri: 'Friday', sat: 'Saturday' }, months: { jan: 'Jan', feb: 'Feb', mar: 'Mar', apr: 'Apr', may: 'May', jun: 'Jun', jul: 'Jul', aug: 'Aug', sep: 'Sep', oct: 'Oct', nov: 'Nov', dec: 'Dec' } }, inputNumber: { decrease: 'decrease number', increase: 'increase number' }, select: { loading: 'Loading', noMatch: 'No matching data', noData: 'No data', placeholder: 'Select' }, dropdown: { toggleDropdown: 'Toggle Dropdown' }, cascader: { noMatch: 'No matching data', loading: 'Loading', placeholder: 'Select', noData: 'No data' }, pagination: { goto: 'Go to', pagesize: '/page', total: 'Total {total}', pageClassifier: '', deprecationWarning: 'Deprecated usages detected, please refer to the el-pagination documentation for more details' }, dialog: { close: 'Close this dialog' }, drawer: { close: 'Close this dialog' }, messagebox: { title: 'Message', confirm: 'OK', cancel: 'Cancel', error: 'Illegal input', close: 'Close this dialog' }, upload: { deleteTip: 'press delete to remove', delete: 'Delete', preview: 'Preview', continue: 'Continue' }, slider: { defaultLabel: 'slider between {min} and {max}', defaultRangeStartLabel: 'pick start value', defaultRangeEndLabel: 'pick end value' }, table: { emptyText: 'No Data', confirmFilter: 'Confirm', resetFilter: 'Reset', clearFilter: 'All', sumText: 'Sum' }, tree: { emptyText: 'No Data' }, transfer: { noMatch: 'No matching data', noData: 'No data', titles: ['List 1', 'List 2'], filterPlaceholder: 'Enter keyword', noCheckedFormat: '{total} items', hasCheckedFormat: '{checked}/{total} checked' }, image: { error: 'FAILED' }, pageHeader: { title: 'Back' }, popconfirm: { confirmButtonText: 'Yes', cancelButtonText: 'No' } } } const buildTranslator = e => (t, r) => translate(t, r, unref(e)), translate = (e, t, r) => get(r, e, e).replace(/\{(\w+)\}/g, (o, n) => { var a return `${(a = t == null ? void 0 : t[n]) != null ? a : `{${n}}`}` }), buildLocaleContext = e => { const t = computed(() => unref(e).name), r = isRef(e) ? e : ref(e) return { lang: t, locale: r, t: buildTranslator(e) } }, useLocale = () => { const e = useGlobalConfig('locale') return buildLocaleContext(computed(() => e.value || English)) }, useLockscreen = e => { if ( (isRef(e) || throwError( '[useLockscreen]', 'You need to pass a ref param to this function' ), !isClient || hasClass(document.body, 'el-popup-parent--hidden')) ) return let t = 0, r = !1, o = '0', n = 0 const a = () => { removeClass(document.body, 'el-popup-parent--hidden'), r && (document.body.style.paddingRight = o) } watch(e, l => { if (!l) { a() return } ;(r = !hasClass(document.body, 'el-popup-parent--hidden')), r && ((o = document.body.style.paddingRight), (n = Number.parseInt(getStyle(document.body, 'paddingRight'), 10))), (t = getScrollBarWidth()) const s = document.documentElement.clientHeight < document.body.scrollHeight, c = getStyle(document.body, 'overflowY') t > 0 && (s || c === 'scroll') && r && (document.body.style.paddingRight = `${n + t}px`), addClass(document.body, 'el-popup-parent--hidden') }), onScopeDispose(() => a()) }, _prop = buildProp({ type: definePropType(Boolean), default: null }), _event = buildProp({ type: definePropType(Function) }), createModelToggleComposable = e => { const t = `update:${e}`, r = `onUpdate:${e}`, o = [t], n = { [e]: _prop, [r]: _event } return { useModelToggle: ({ indicator: l, toggleReason: s, shouldHideWhenRouteChanges: c, shouldProceed: d, onShow: u, onHide: m }) => { const f = getCurrentInstance(), { emit: _ } = f, b = f.props, v = computed(() => isFunction$1(b[r])), k = computed(() => b[e] === null), g = A => { l.value !== !0 && ((l.value = !0), s && (s.value = A), isFunction$1(u) && u(A)) }, x = A => { l.value !== !1 && ((l.value = !1), s && (s.value = A), isFunction$1(m) && m(A)) }, y = A => { if (b.disabled === !0 || (isFunction$1(d) && !d())) return const $ = v.value && isClient $ && _(t, !0), (k.value || !$) && g(A) }, w = A => { if (b.disabled === !0 || !isClient) return const $ = v.value && isClient $ && _(t, !1), (k.value || !$) && x(A) }, S = A => { !isBoolean$1(A) || (b.disabled && A ? v.value && _(t, !1) : l.value !== A && (A ? g() : x())) }, T = () => { l.value ? w() : y() } return ( watch(() => b[e], S), c && f.appContext.config.globalProperties.$route !== void 0 && watch( () => ar({}, f.proxy.$route), () => { c.value && l.value && w() } ), onMounted(() => { S(b[e]) }), { hide: w, show: y, toggle: T } ) }, useModelToggleProps: n, useModelToggleEmits: o } }, useRestoreActive = (e, t) => { let r watch( () => e.value, o => { var n, a o ? ((r = document.activeElement), isRef(t) && ((a = (n = t.value).focus) == null || a.call(n))) : r.focus() } ) }, useSameTarget = e => { if (!e) return { onClick: NOOP, onMousedown: NOOP, onMouseup: NOOP } let t = !1, r = !1 return { onClick: l => { t && r && e(l), (t = r = !1) }, onMousedown: l => { t = l.target === l.currentTarget }, onMouseup: l => { r = l.target === l.currentTarget } } } function useTimeout() { let e const t = (o, n) => { r(), (e = window.setTimeout(o, n)) }, r = () => window.clearTimeout(e) return tryOnScopeDispose(() => r()), { registerTimeout: t, cancelTimeout: r } } let registeredEscapeHandlers = [] const useEscapeKeydown = e => { const t = r => { const o = r o.key === EVENT_CODE.esc && registeredEscapeHandlers.forEach(n => n(o)) } onMounted(() => { registeredEscapeHandlers.length === 0 && document.addEventListener('keydown', t), isClient && registeredEscapeHandlers.push(e) }), onBeforeUnmount(() => { ;(registeredEscapeHandlers = registeredEscapeHandlers.filter( r => r !== e )), registeredEscapeHandlers.length === 0 && isClient && document.removeEventListener('keydown', t) }) } let cachedContainer const POPPER_CONTAINER_ID = `el-popper-container-${generateId()}`, POPPER_CONTAINER_SELECTOR = `#${POPPER_CONTAINER_ID}`, createContainer = () => { const e = document.createElement('div') return (e.id = POPPER_CONTAINER_ID), document.body.appendChild(e), e }, usePopperContainer = () => { onBeforeMount(() => { !isClient || ((!cachedContainer || !document.body.querySelector(POPPER_CONTAINER_SELECTOR)) && (cachedContainer = createContainer())) }) }, useDelayedToggleProps = buildProps({ showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 } }), useDelayedToggle = ({ showAfter: e, hideAfter: t, open: r, close: o }) => { const { registerTimeout: n } = useTimeout() return { onOpen: s => { n(() => { r(s) }, unref(e)) }, onClose: s => { n(() => { o(s) }, unref(t)) } } }, FORWARD_REF_INJECTION_KEY = Symbol('elForwardRef'), useForwardRef = e => { provide(FORWARD_REF_INJECTION_KEY, { setForwardRef: r => { e.value = r } }) }, useForwardRefDirective = e => ({ mounted(t) { e(t) }, updated(t) { e(t) }, unmounted() { e(null) } }), defaultNamespace = 'el', statePrefix = 'is-', _bem = (e, t, r, o, n) => { let a = `${e}-${t}` return r && (a += `-${r}`), o && (a += `__${o}`), n && (a += `--${n}`), a }, useNamespace = e => { const t = useGlobalConfig('namespace'), r = computed(() => t.value || defaultNamespace) return { namespace: r, b: (v = '') => _bem(unref(r), e, v, '', ''), e: v => (v ? _bem(unref(r), e, '', v, '') : ''), m: v => (v ? _bem(unref(r), e, '', '', v) : ''), be: (v, k) => (v && k ? _bem(unref(r), e, v, k, '') : ''), em: (v, k) => (v && k ? _bem(unref(r), e, '', v, k) : ''), bm: (v, k) => (v && k ? _bem(unref(r), e, v, '', k) : ''), bem: (v, k, g) => (v && k && g ? _bem(unref(r), e, v, k, g) : ''), is: (v, ...k) => { const g = k.length >= 1 ? k[0] : !0 return v && g ? `${statePrefix}${v}` : '' }, cssVar: v => { const k = {} for (const g in v) k[`--${r.value}-${g}`] = v[g] return k }, cssVarName: v => `--${r.value}-${v}`, cssVarBlock: v => { const k = {} for (const g in v) k[`--${r.value}-${e}-${g}`] = v[g] return k }, cssVarBlockName: v => `--${r.value}-${e}-${v}` } }, zIndex = ref(0), useZIndex = () => { const e = useGlobalConfig('zIndex', 2e3), t = computed(() => e.value + zIndex.value) return { initialZIndex: e, currentZIndex: t, nextZIndex: () => (zIndex.value++, t.value) } } function useCursor(e) { const t = ref() function r() { if (e.value == null) return const { selectionStart: n, selectionEnd: a, value: l } = e.value if (n == null || a == null) return const s = l.slice(0, Math.max(0, n)), c = l.slice(Math.max(0, a)) t.value = { selectionStart: n, selectionEnd: a, value: l, beforeTxt: s, afterTxt: c } } function o() { if (e.value == null || t.value == null) return const { value: n } = e.value, { beforeTxt: a, afterTxt: l, selectionStart: s } = t.value if (a == null || l == null || s == null) return let c = n.length if (n.endsWith(l)) c = n.length - l.length else if (n.startsWith(a)) c = a.length else { const d = a[s - 1], u = n.indexOf(d, s - 1) u !== -1 && (c = u + 1) } e.value.setSelectionRange(c, c) } return [r, o] } var _export_sfc$1 = (e, t) => { const r = e.__vccOpts || e for (const [o, n] of t) r[o] = n return r } const iconProps = buildProps({ size: { type: definePropType([Number, String]) }, color: { type: String } }), __default__$k = { name: 'ElIcon', inheritAttrs: !1 }, _sfc_main$D = defineComponent( pr(ar({}, __default__$k), { props: iconProps, setup(e) { const t = e, r = useNamespace('icon'), o = computed(() => !t.size && !t.color ? {} : { fontSize: isUndefined(t.size) ? void 0 : addUnit(t.size), '--color': t.color } ) return (n, a) => ( openBlock(), createElementBlock( 'i', mergeProps({ class: unref(r).b(), style: unref(o) }, n.$attrs), [renderSlot(n.$slots, 'default')], 16 ) ) } }) ) var Icon = _export_sfc$1(_sfc_main$D, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/icon/src/icon.vue' ] ]) const ElIcon = withInstall(Icon) let hiddenTextarea const HIDDEN_STYLE = ` height:0 !important; visibility:hidden !important; overflow:hidden !important; position:absolute !important; z-index:-1000 !important; top:0 !important; right:0 !important; `, CONTEXT_STYLE = [ 'letter-spacing', 'line-height', 'padding-top', 'padding-bottom', 'font-family', 'font-weight', 'font-size', 'text-rendering', 'text-transform', 'width', 'text-indent', 'padding-left', 'padding-right', 'border-width', 'box-sizing' ] function calculateNodeStyling(e) { const t = window.getComputedStyle(e), r = t.getPropertyValue('box-sizing'), o = Number.parseFloat(t.getPropertyValue('padding-bottom')) + Number.parseFloat(t.getPropertyValue('padding-top')), n = Number.parseFloat(t.getPropertyValue('border-bottom-width')) + Number.parseFloat(t.getPropertyValue('border-top-width')) return { contextStyle: CONTEXT_STYLE.map(l => `${l}:${t.getPropertyValue(l)}`).join( ';' ), paddingSize: o, borderSize: n, boxSizing: r } } function calcTextareaHeight(e, t = 1, r) { var o hiddenTextarea || ((hiddenTextarea = document.createElement('textarea')), document.body.appendChild(hiddenTextarea)) const { paddingSize: n, borderSize: a, boxSizing: l, contextStyle: s } = calculateNodeStyling(e) hiddenTextarea.setAttribute('style', `${s};${HIDDEN_STYLE}`), (hiddenTextarea.value = e.value || e.placeholder || '') let c = hiddenTextarea.scrollHeight const d = {} l === 'border-box' ? (c = c + a) : l === 'content-box' && (c = c - n), (hiddenTextarea.value = '') const u = hiddenTextarea.scrollHeight - n if (isNumber$1(t)) { let m = u * t l === 'border-box' && (m = m + n + a), (c = Math.max(m, c)), (d.minHeight = `${m}px`) } if (isNumber$1(r)) { let m = u * r l === 'border-box' && (m = m + n + a), (c = Math.min(m, c)) } return ( (d.height = `${c}px`), (o = hiddenTextarea.parentNode) == null || o.removeChild(hiddenTextarea), (hiddenTextarea = void 0), d ) } const inputProps = buildProps({ id: { type: String, default: void 0 }, size: useSizeProp, disabled: Boolean, modelValue: { type: definePropType([String, Number, Object]), default: '' }, type: { type: String, default: 'text' }, resize: { type: String, values: ['none', 'both', 'horizontal', 'vertical'] }, autosize: { type: definePropType([Boolean, Object]), default: !1 }, autocomplete: { type: String, default: 'off' }, formatter: { type: Function }, parser: { type: Function }, placeholder: { type: String }, form: { type: String, default: '' }, readonly: { type: Boolean, default: !1 }, clearable: { type: Boolean, default: !1 }, showPassword: { type: Boolean, default: !1 }, showWordLimit: { type: Boolean, default: !1 }, suffixIcon: { type: iconPropType, default: '' }, prefixIcon: { type: iconPropType, default: '' }, containerRole: { type: String, default: void 0 }, label: { type: String, default: void 0 }, tabindex: { type: [String, Number], default: 0 }, validateEvent: { type: Boolean, default: !0 }, inputStyle: { type: definePropType([Object, Array, String]), default: () => mutable({}) } }), inputEmits = { [UPDATE_MODEL_EVENT]: e => isString$2(e), input: e => isString$2(e), change: e => isString$2(e), focus: e => e instanceof FocusEvent, blur: e => e instanceof FocusEvent, clear: () => !0, mouseleave: e => e instanceof MouseEvent, mouseenter: e => e instanceof MouseEvent, keydown: e => e instanceof Event, compositionstart: e => e instanceof CompositionEvent, compositionupdate: e => e instanceof CompositionEvent, compositionend: e => e instanceof CompositionEvent }, _hoisted_1$f = ['role'], _hoisted_2$5 = [ 'id', 'type', 'disabled', 'formatter', 'parser', 'readonly', 'autocomplete', 'tabindex', 'aria-label', 'placeholder' ], _hoisted_3$1 = [ 'id', 'tabindex', 'disabled', 'readonly', 'autocomplete', 'aria-label', 'placeholder' ], __default__$j = { name: 'ElInput', inheritAttrs: !1 }, _sfc_main$C = defineComponent( pr(ar({}, __default__$j), { props: inputProps, emits: inputEmits, setup(e, { expose: t, emit: r }) { const o = e, n = { suffix: 'append', prefix: 'prepend' }, a = getCurrentInstance(), l = useAttrs$1(), s = useSlots(), c = computed(() => { const he = {} return ( o.containerRole === 'combobox' && ((he['aria-haspopup'] = l['aria-haspopup']), (he['aria-owns'] = l['aria-owns']), (he['aria-expanded'] = l['aria-expanded'])), he ) }), d = useAttrs({ excludeKeys: computed(() => Object.keys(c.value)) }), { form: u, formItem: m } = useFormItem(), { inputId: f } = useFormItemInputId(o, { formItemContext: m }), _ = useSize(), b = useDisabled(), v = useNamespace('input'), k = useNamespace('textarea'), g = shallowRef(), x = shallowRef(), y = ref(!1), w = ref(!1), S = ref(!1), T = ref(!1), A = ref(), $ = shallowRef(o.inputStyle), F = computed(() => g.value || x.value), Y = computed(() => { var he return (he = u == null ? void 0 : u.statusIcon) != null ? he : !1 }), ae = computed(() => (m == null ? void 0 : m.validateState) || ''), re = computed(() => ValidateComponentsMap[ae.value]), ie = computed(() => (T.value ? view_default : hide_default)), oe = computed(() => [l.style, o.inputStyle]), j = computed(() => [o.inputStyle, $.value, { resize: o.resize }]), V = computed(() => (isNil(o.modelValue) ? '' : String(o.modelValue))), z = computed( () => o.clearable && !b.value && !o.readonly && !!V.value && (y.value || w.value) ), M = computed( () => o.showPassword && !b.value && !o.readonly && !!V.value && (!!V.value || y.value) ), L = computed( () => o.showWordLimit && !!d.value.maxlength && (o.type === 'text' || o.type === 'textarea') && !b.value && !o.readonly && !o.showPassword ), pe = computed(() => Array.from(V.value).length), ue = computed( () => !!L.value && pe.value > Number(d.value.maxlength) ), Ie = computed( () => !!s.suffix || !!o.suffixIcon || z.value || o.showPassword || L.value || (!!ae.value && Y.value) ), [Pt, rr] = useCursor(g) useResizeObserver(x, he => { if (!L.value || o.resize !== 'both') return const At = he[0], { width: nr } = At.contentRect A.value = { right: `calc(100% - ${nr + 15 + 6}px)` } }) const _e = () => { const { type: he, autosize: At } = o if (!(!isClient || he !== 'textarea')) if (At) { const nr = isObject$2(At) ? At.minRows : void 0, cr = isObject$2(At) ? At.maxRows : void 0 $.value = ar({}, calcTextareaHeight(x.value, nr, cr)) } else $.value = { minHeight: calcTextareaHeight(x.value).minHeight } }, Oe = () => { const he = F.value !he || he.value === V.value || (he.value = V.value) }, xe = he => { const { el: At } = a.vnode if (!At) return const cr = Array.from(At.querySelectorAll(`.${v.e(he)}`)).find( lr => lr.parentNode === At ) if (!cr) return const Fe = n[he] s[Fe] ? (cr.style.transform = `translateX(${ he === 'suffix' ? '-' : '' }${At.querySelector(`.${v.be('group', Fe)}`).offsetWidth}px)`) : cr.removeAttribute('style') }, $e = () => { xe('prefix'), xe('suffix') }, jt = async he => { Pt() let { value: At } = he.target o.formatter && ((At = o.parser ? o.parser(At) : At), (At = o.formatter(At))), !S.value && At !== V.value && (r(UPDATE_MODEL_EVENT, At), r('input', At), await nextTick(), Oe(), rr()) }, or = he => { r('change', he.target.value) }, er = he => { r('compositionstart', he), (S.value = !0) }, tr = he => { var At r('compositionupdate', he) const nr = (At = he.target) == null ? void 0 : At.value, cr = nr[nr.length - 1] || '' S.value = !isKorean(cr) }, D = he => { r('compositionend', he), S.value && ((S.value = !1), jt(he)) }, de = () => { ;(T.value = !T.value), Ce() }, Ce = async () => { var he await nextTick(), (he = F.value) == null || he.focus() }, Ne = () => { var he return (he = F.value) == null ? void 0 : he.blur() }, Ve = he => { ;(y.value = !0), r('focus', he) }, Et = he => { var At ;(y.value = !1), r('blur', he), o.validateEvent && ((At = m == null ? void 0 : m.validate) == null || At.call(m, 'blur').catch(nr => void 0)) }, Lt = he => { ;(w.value = !1), r('mouseleave', he) }, Ue = he => { ;(w.value = !0), r('mouseenter', he) }, kt = he => { r('keydown', he) }, qe = () => { var he ;(he = F.value) == null || he.select() }, ir = () => { r(UPDATE_MODEL_EVENT, ''), r('change', ''), r('clear'), r('input', '') } return ( watch( () => o.modelValue, () => { var he nextTick(() => _e()), o.validateEvent && ((he = m == null ? void 0 : m.validate) == null || he.call(m, 'change').catch(At => void 0)) } ), watch(V, () => Oe()), watch( () => o.type, async () => { await nextTick(), Oe(), _e(), $e() } ), onMounted(async () => { !o.formatter && o.parser, Oe(), $e(), await nextTick(), _e() }), onUpdated(async () => { await nextTick(), $e() }), t({ input: g, textarea: x, ref: F, textareaStyle: j, autosize: toRef(o, 'autosize'), focus: Ce, blur: Ne, select: qe, clear: ir, resizeTextarea: _e }), (he, At) => withDirectives( (openBlock(), createElementBlock( 'div', mergeProps(unref(c), { class: [ he.type === 'textarea' ? unref(k).b() : unref(v).b(), unref(v).m(unref(_)), unref(v).is('disabled', unref(b)), unref(v).is('exceed', unref(ue)), { [unref(v).b('group')]: he.$slots.prepend || he.$slots.append, [unref(v).bm('group', 'append')]: he.$slots.append, [unref(v).bm('group', 'prepend')]: he.$slots.prepend, [unref(v).m('prefix')]: he.$slots.prefix || he.prefixIcon, [unref(v).m('suffix')]: he.$slots.suffix || he.suffixIcon || he.clearable || he.showPassword, [unref(v).bm('suffix', 'password-clear')]: unref(z) && unref(M) }, he.$attrs.class ], style: unref(oe), role: he.containerRole, onMouseenter: Ue, onMouseleave: Lt }), [ createCommentVNode(' input '), he.type !== 'textarea' ? (openBlock(), createElementBlock( Fragment, { key: 0 }, [ createCommentVNode(' prepend slot '), he.$slots.prepend ? (openBlock(), createElementBlock( 'div', { key: 0, class: normalizeClass( unref(v).be('group', 'prepend') ) }, [renderSlot(he.$slots, 'prepend')], 2 )) : createCommentVNode('v-if', !0), createBaseVNode( 'div', { class: normalizeClass([ unref(v).e('wrapper'), unref(v).is('focus', y.value) ]) }, [ createCommentVNode(' prefix slot '), he.$slots.prefix || he.prefixIcon ? (openBlock(), createElementBlock( 'span', { key: 0, class: normalizeClass( unref(v).e('prefix') ) }, [ createBaseVNode( 'span', { class: normalizeClass( unref(v).e('prefix-inner') ) }, [ renderSlot(he.$slots, 'prefix'), he.prefixIcon ? (openBlock(), createBlock( unref(ElIcon), { key: 0, class: normalizeClass( unref(v).e('icon') ) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( he.prefixIcon ) )) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0) ], 2 ) ], 2 )) : createCommentVNode('v-if', !0), createBaseVNode( 'input', mergeProps( { id: unref(f), ref_key: 'input', ref: g, class: unref(v).e('inner') }, unref(d), { type: he.showPassword ? T.value ? 'text' : 'password' : he.type, disabled: unref(b), formatter: he.formatter, parser: he.parser, readonly: he.readonly, autocomplete: he.autocomplete, tabindex: he.tabindex, 'aria-label': he.label, placeholder: he.placeholder, style: he.inputStyle, onCompositionstart: er, onCompositionupdate: tr, onCompositionend: D, onInput: jt, onFocus: Ve, onBlur: Et, onChange: or, onKeydown: kt } ), null, 16, _hoisted_2$5 ), createCommentVNode(' suffix slot '), unref(Ie) ? (openBlock(), createElementBlock( 'span', { key: 1, class: normalizeClass( unref(v).e('suffix') ) }, [ createBaseVNode( 'span', { class: normalizeClass( unref(v).e('suffix-inner') ) }, [ !unref(z) || !unref(M) || !unref(L) ? (openBlock(), createElementBlock( Fragment, { key: 0 }, [ renderSlot( he.$slots, 'suffix' ), he.suffixIcon ? (openBlock(), createBlock( unref(ElIcon), { key: 0, class: normalizeClass( unref(v).e('icon') ) }, { default: withCtx( () => [ (openBlock(), createBlock( resolveDynamicComponent( he.suffixIcon ) )) ] ), _: 1 }, 8, ['class'] )) : createCommentVNode( 'v-if', !0 ) ], 64 )) : createCommentVNode('v-if', !0), unref(z) ? (openBlock(), createBlock( unref(ElIcon), { key: 1, class: normalizeClass([ unref(v).e('icon'), unref(v).e('clear') ]), onMousedown: At[0] || (At[0] = withModifiers(() => {}, [ 'prevent' ])), onClick: ir }, { default: withCtx(() => [ createVNode( unref( circle_close_default ) ) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0), unref(M) ? (openBlock(), createBlock( unref(ElIcon), { key: 2, class: normalizeClass([ unref(v).e('icon'), unref(v).e('password') ]), onClick: de }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( unref(ie) ) )) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0), unref(L) ? (openBlock(), createElementBlock( 'span', { key: 3, class: normalizeClass( unref(v).e('count') ) }, [ createBaseVNode( 'span', { class: normalizeClass( unref(v).e( 'count-inner' ) ) }, toDisplayString(unref(pe)) + ' / ' + toDisplayString( unref(d).maxlength ), 3 ) ], 2 )) : createCommentVNode('v-if', !0), unref(ae) && unref(re) && unref(Y) ? (openBlock(), createBlock( unref(ElIcon), { key: 4, class: normalizeClass([ unref(v).e('icon'), unref(v).e('validateIcon'), unref(v).is( 'loading', unref(ae) === 'validating' ) ]) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( unref(re) ) )) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0) ], 2 ) ], 2 )) : createCommentVNode('v-if', !0) ], 2 ), createCommentVNode(' append slot '), he.$slots.append ? (openBlock(), createElementBlock( 'div', { key: 1, class: normalizeClass( unref(v).be('group', 'append') ) }, [renderSlot(he.$slots, 'append')], 2 )) : createCommentVNode('v-if', !0) ], 64 )) : (openBlock(), createElementBlock( Fragment, { key: 1 }, [ createCommentVNode(' textarea '), createBaseVNode( 'textarea', mergeProps( { id: unref(f), ref_key: 'textarea', ref: x, class: unref(k).e('inner') }, unref(d), { tabindex: he.tabindex, disabled: unref(b), readonly: he.readonly, autocomplete: he.autocomplete, style: unref(j), 'aria-label': he.label, placeholder: he.placeholder, onCompositionstart: er, onCompositionupdate: tr, onCompositionend: D, onInput: jt, onFocus: Ve, onBlur: Et, onChange: or, onKeydown: kt } ), null, 16, _hoisted_3$1 ), unref(L) ? (openBlock(), createElementBlock( 'span', { key: 0, style: normalizeStyle(A.value), class: normalizeClass(unref(v).e('count')) }, toDisplayString(unref(pe)) + ' / ' + toDisplayString(unref(d).maxlength), 7 )) : createCommentVNode('v-if', !0) ], 64 )) ], 16, _hoisted_1$f )), [[vShow, he.type !== 'hidden']] ) ) } }) ) var Input = _export_sfc$1(_sfc_main$C, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/input/src/input.vue' ] ]) const ElInput = withInstall(Input), GAP = 4, BAR_MAP = { vertical: { offset: 'offsetHeight', scroll: 'scrollTop', scrollSize: 'scrollHeight', size: 'height', key: 'vertical', axis: 'Y', client: 'clientY', direction: 'top' }, horizontal: { offset: 'offsetWidth', scroll: 'scrollLeft', scrollSize: 'scrollWidth', size: 'width', key: 'horizontal', axis: 'X', client: 'clientX', direction: 'left' } }, renderThumbStyle = ({ move: e, size: t, bar: r }) => ({ [r.size]: t, transform: `translate${r.axis}(${e}%)` }), thumbProps = buildProps({ vertical: Boolean, size: String, move: Number, ratio: { type: Number, required: !0 }, always: Boolean }), _sfc_main$B = defineComponent({ __name: 'thumb', props: thumbProps, setup(e) { const t = e, r = 'Thumb', o = inject(scrollbarContextKey), n = useNamespace('scrollbar') o || throwError(r, 'can not inject scrollbar context') const a = ref(), l = ref(), s = ref({}), c = ref(!1) let d = !1, u = !1, m = isClient ? document.onselectstart : null const f = computed(() => BAR_MAP[t.vertical ? 'vertical' : 'horizontal']), _ = computed(() => renderThumbStyle({ size: t.size, move: t.move, bar: f.value }) ), b = computed( () => a.value[f.value.offset] ** 2 / o.wrapElement[f.value.scrollSize] / t.ratio / l.value[f.value.offset] ), v = A => { var $ if ((A.stopPropagation(), A.ctrlKey || [1, 2].includes(A.button))) return ;($ = window.getSelection()) == null || $.removeAllRanges(), g(A) const F = A.currentTarget !F || (s.value[f.value.axis] = F[f.value.offset] - (A[f.value.client] - F.getBoundingClientRect()[f.value.direction])) }, k = A => { if (!l.value || !a.value || !o.wrapElement) return const $ = Math.abs( A.target.getBoundingClientRect()[f.value.direction] - A[f.value.client] ), F = l.value[f.value.offset] / 2, Y = (($ - F) * 100 * b.value) / a.value[f.value.offset] o.wrapElement[f.value.scroll] = (Y * o.wrapElement[f.value.scrollSize]) / 100 }, g = A => { A.stopImmediatePropagation(), (d = !0), document.addEventListener('mousemove', x), document.addEventListener('mouseup', y), (m = document.onselectstart), (document.onselectstart = () => !1) }, x = A => { if (!a.value || !l.value || d === !1) return const $ = s.value[f.value.axis] if (!$) return const F = (a.value.getBoundingClientRect()[f.value.direction] - A[f.value.client]) * -1, Y = l.value[f.value.offset] - $, ae = ((F - Y) * 100 * b.value) / a.value[f.value.offset] o.wrapElement[f.value.scroll] = (ae * o.wrapElement[f.value.scrollSize]) / 100 }, y = () => { ;(d = !1), (s.value[f.value.axis] = 0), document.removeEventListener('mousemove', x), document.removeEventListener('mouseup', y), T(), u && (c.value = !1) }, w = () => { ;(u = !1), (c.value = !!t.size) }, S = () => { ;(u = !0), (c.value = d) } onBeforeUnmount(() => { T(), document.removeEventListener('mouseup', y) }) const T = () => { document.onselectstart !== m && (document.onselectstart = m) } return ( useEventListener(toRef(o, 'scrollbarElement'), 'mousemove', w), useEventListener(toRef(o, 'scrollbarElement'), 'mouseleave', S), (A, $) => ( openBlock(), createBlock( Transition, { name: unref(n).b('fade'), persisted: '' }, { default: withCtx(() => [ withDirectives( createBaseVNode( 'div', { ref_key: 'instance', ref: a, class: normalizeClass([ unref(n).e('bar'), unref(n).is(unref(f).key) ]), onMousedown: k }, [ createBaseVNode( 'div', { ref_key: 'thumb', ref: l, class: normalizeClass(unref(n).e('thumb')), style: normalizeStyle(unref(_)), onMousedown: v }, null, 38 ) ], 34 ), [[vShow, A.always || c.value]] ) ]), _: 1 }, 8, ['name'] ) ) ) } }) var Thumb = _export_sfc$1(_sfc_main$B, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/thumb.vue' ] ]) const barProps = buildProps({ always: { type: Boolean, default: !0 }, width: String, height: String, ratioX: { type: Number, default: 1 }, ratioY: { type: Number, default: 1 } }), _sfc_main$A = defineComponent({ __name: 'bar', props: barProps, setup(e, { expose: t }) { const r = e, o = ref(0), n = ref(0) return ( t({ handleScroll: l => { if (l) { const s = l.offsetHeight - GAP, c = l.offsetWidth - GAP ;(n.value = ((l.scrollTop * 100) / s) * r.ratioY), (o.value = ((l.scrollLeft * 100) / c) * r.ratioX) } } }), (l, s) => ( openBlock(), createElementBlock( Fragment, null, [ createVNode( Thumb, { move: o.value, ratio: l.ratioX, size: l.width, always: l.always }, null, 8, ['move', 'ratio', 'size', 'always'] ), createVNode( Thumb, { move: n.value, ratio: l.ratioY, size: l.height, vertical: '', always: l.always }, null, 8, ['move', 'ratio', 'size', 'always'] ) ], 64 ) ) ) } }) var Bar = _export_sfc$1(_sfc_main$A, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/bar.vue' ] ]) const scrollbarProps = buildProps({ height: { type: [String, Number], default: '' }, maxHeight: { type: [String, Number], default: '' }, native: Boolean, wrapStyle: { type: definePropType([String, Object, Array]), default: '' }, wrapClass: { type: [String, Array], default: '' }, viewClass: { type: [String, Array], default: '' }, viewStyle: { type: [String, Array, Object], default: '' }, noresize: Boolean, tag: { type: String, default: 'div' }, always: Boolean, minSize: { type: Number, default: 20 } }), scrollbarEmits = { scroll: ({ scrollTop: e, scrollLeft: t }) => isNumber$1(e) && isNumber$1(t) }, __default__$i = { name: 'ElScrollbar' }, _sfc_main$z = defineComponent( pr(ar({}, __default__$i), { props: scrollbarProps, emits: scrollbarEmits, setup(e, { expose: t, emit: r }) { const o = e, n = useNamespace('scrollbar') let a, l const s = ref(), c = ref(), d = ref(), u = ref('0'), m = ref('0'), f = ref(), _ = ref(1), b = ref(1), v = computed(() => { const S = {} return ( o.height && (S.height = addUnit(o.height)), o.maxHeight && (S.maxHeight = addUnit(o.maxHeight)), [o.wrapStyle, S] ) }), k = () => { var S c.value && ((S = f.value) == null || S.handleScroll(c.value), r('scroll', { scrollTop: c.value.scrollTop, scrollLeft: c.value.scrollLeft })) } function g(S, T) { isObject$2(S) ? c.value.scrollTo(S) : isNumber$1(S) && isNumber$1(T) && c.value.scrollTo(S, T) } const x = S => { !isNumber$1(S) || (c.value.scrollTop = S) }, y = S => { !isNumber$1(S) || (c.value.scrollLeft = S) }, w = () => { if (!c.value) return const S = c.value.offsetHeight - GAP, T = c.value.offsetWidth - GAP, A = S ** 2 / c.value.scrollHeight, $ = T ** 2 / c.value.scrollWidth, F = Math.max(A, o.minSize), Y = Math.max($, o.minSize) ;(_.value = A / (S - A) / (F / (S - F))), (b.value = $ / (T - $) / (Y / (T - Y))), (m.value = F + GAP < S ? `${F}px` : ''), (u.value = Y + GAP < T ? `${Y}px` : '') } return ( watch( () => o.noresize, S => { S ? (a == null || a(), l == null || l()) : (({ stop: a } = useResizeObserver(d, w)), (l = useEventListener('resize', w))) }, { immediate: !0 } ), watch( () => [o.maxHeight, o.height], () => { o.native || nextTick(() => { var S w(), c.value && ((S = f.value) == null || S.handleScroll(c.value)) }) } ), provide( scrollbarContextKey, reactive({ scrollbarElement: s, wrapElement: c }) ), onMounted(() => { o.native || nextTick(() => w()) }), onUpdated(() => w()), t({ wrap$: c, update: w, scrollTo: g, setScrollTop: x, setScrollLeft: y, handleScroll: k }), (S, T) => ( openBlock(), createElementBlock( 'div', { ref_key: 'scrollbar$', ref: s, class: normalizeClass(unref(n).b()) }, [ createBaseVNode( 'div', { ref_key: 'wrap$', ref: c, class: normalizeClass([ S.wrapClass, unref(n).e('wrap'), { [unref(n).em('wrap', 'hidden-default')]: !S.native } ]), style: normalizeStyle(unref(v)), onScroll: k }, [ (openBlock(), createBlock( resolveDynamicComponent(S.tag), { ref_key: 'resize$', ref: d, class: normalizeClass([ unref(n).e('view'), S.viewClass ]), style: normalizeStyle(S.viewStyle) }, { default: withCtx(() => [ renderSlot(S.$slots, 'default') ]), _: 3 }, 8, ['class', 'style'] )) ], 38 ), S.native ? createCommentVNode('v-if', !0) : (openBlock(), createBlock( Bar, { key: 0, ref_key: 'barRef', ref: f, height: m.value, width: u.value, always: S.always, 'ratio-x': b.value, 'ratio-y': _.value }, null, 8, ['height', 'width', 'always', 'ratio-x', 'ratio-y'] )) ], 2 ) ) ) } }) ) var Scrollbar = _export_sfc$1(_sfc_main$z, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/scrollbar/src/scrollbar.vue' ] ]) const ElScrollbar = withInstall(Scrollbar), usePopperProps = buildProps({ role: { type: String, default: 'tooltip' } }), __default__$h = { name: 'ElPopperRoot', inheritAttrs: !1 }, _sfc_main$y = defineComponent( pr(ar({}, __default__$h), { props: usePopperProps, setup(e, { expose: t }) { const r = e, o = ref(), n = ref(), a = ref(), l = ref(), s = computed(() => r.role), c = { triggerRef: o, popperInstanceRef: n, contentRef: a, referenceRef: l, role: s } return ( t(c), provide(POPPER_INJECTION_KEY, c), (d, u) => renderSlot(d.$slots, 'default') ) } }) ) var Popper = _export_sfc$1(_sfc_main$y, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/popper/src/popper.vue' ] ]) const usePopperArrowProps = buildProps({ arrowOffset: { type: Number, default: 5 } }), __default__$g = { name: 'ElPopperArrow', inheritAttrs: !1 }, _sfc_main$x = defineComponent( pr(ar({}, __default__$g), { props: usePopperArrowProps, setup(e, { expose: t }) { const r = e, o = useNamespace('popper'), { arrowOffset: n, arrowRef: a } = inject( POPPER_CONTENT_INJECTION_KEY, void 0 ) return ( watch( () => r.arrowOffset, l => { n.value = l } ), onBeforeUnmount(() => { a.value = void 0 }), t({ arrowRef: a }), (l, s) => ( openBlock(), createElementBlock( 'span', { ref_key: 'arrowRef', ref: a, class: normalizeClass(unref(o).e('arrow')), 'data-popper-arrow': '' }, null, 2 ) ) ) } }) ) var ElPopperArrow = _export_sfc$1(_sfc_main$x, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/popper/src/arrow.vue' ] ]) const NAME = 'ElOnlyChild', OnlyChild = defineComponent({ name: NAME, setup(e, { slots: t, attrs: r }) { var o const n = inject(FORWARD_REF_INJECTION_KEY), a = useForwardRefDirective( (o = n == null ? void 0 : n.setForwardRef) != null ? o : NOOP ) return () => { var l const s = (l = t.default) == null ? void 0 : l.call(t, r) if (!s || s.length > 1) return null const c = findFirstLegitChild(s) return c ? withDirectives(cloneVNode(c, r), [[a]]) : null } } }) function findFirstLegitChild(e) { if (!e) return null const t = e for (const r of t) { if (isObject$2(r)) switch (r.type) { case Comment: continue case Text: return wrapTextContent(r) case 'svg': return wrapTextContent(r) case Fragment: return findFirstLegitChild(r.children) default: return r } return wrapTextContent(r) } return null } function wrapTextContent(e) { return createVNode('span', { class: 'el-only-child__content' }, [e]) } const usePopperTriggerProps = buildProps({ virtualRef: { type: definePropType(Object) }, virtualTriggering: Boolean, onMouseenter: Function, onMouseleave: Function, onClick: Function, onKeydown: Function, onFocus: Function, onBlur: Function, onContextmenu: Function, id: String, open: Boolean }), __default__$f = { name: 'ElPopperTrigger', inheritAttrs: !1 }, _sfc_main$w = defineComponent( pr(ar({}, __default__$f), { props: usePopperTriggerProps, setup(e, { expose: t }) { const r = e, { role: o, triggerRef: n } = inject(POPPER_INJECTION_KEY, void 0) useForwardRef(n) const a = computed(() => (s.value ? r.id : void 0)), l = computed(() => { if (o && o.value === 'tooltip') return r.open && r.id ? r.id : void 0 }), s = computed(() => { if (o && o.value !== 'tooltip') return o.value }), c = computed(() => (s.value ? `${r.open}` : void 0)) let d return ( onMounted(() => { watch( () => r.virtualRef, u => { u && (n.value = unrefElement(u)) }, { immediate: !0 } ), watch( () => n.value, (u, m) => { d == null || d(), (d = void 0), isElement$1(u) && ([ 'onMouseenter', 'onMouseleave', 'onClick', 'onKeydown', 'onFocus', 'onBlur', 'onContextmenu' ].forEach(f => { var _ const b = r[f] b && (u.addEventListener(f.slice(2).toLowerCase(), b), (_ = m == null ? void 0 : m.removeEventListener) == null || _.call(m, f.slice(2).toLowerCase(), b)) }), (d = watch( [a, l, s, c], f => { ;[ 'aria-controls', 'aria-describedby', 'aria-haspopup', 'aria-expanded' ].forEach((_, b) => { isNil(f[b]) ? u.removeAttribute(_) : u.setAttribute(_, f[b]) }) }, { immediate: !0 } ))), isElement$1(m) && [ 'aria-controls', 'aria-describedby', 'aria-haspopup', 'aria-expanded' ].forEach(f => m.removeAttribute(f)) }, { immediate: !0 } ) }), onBeforeUnmount(() => { d == null || d(), (d = void 0) }), t({ triggerRef: n }), (u, m) => u.virtualTriggering ? createCommentVNode('v-if', !0) : (openBlock(), createBlock( unref(OnlyChild), mergeProps({ key: 0 }, u.$attrs, { 'aria-controls': unref(a), 'aria-describedby': unref(l), 'aria-expanded': unref(c), 'aria-haspopup': unref(s) }), { default: withCtx(() => [renderSlot(u.$slots, 'default')]), _: 3 }, 16, [ 'aria-controls', 'aria-describedby', 'aria-expanded', 'aria-haspopup' ] )) ) } }) ) var ElPopperTrigger = _export_sfc$1(_sfc_main$w, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/popper/src/trigger.vue' ] ]), E = 'top', R = 'bottom', W = 'right', P = 'left', me = 'auto', G = [E, R, W, P], U = 'start', J = 'end', Xe = 'clippingParents', je = 'viewport', K = 'popper', Ye = 'reference', De = G.reduce(function (e, t) { return e.concat([t + '-' + U, t + '-' + J]) }, []), Ee = [].concat(G, [me]).reduce(function (e, t) { return e.concat([t, t + '-' + U, t + '-' + J]) }, []), Ge = 'beforeRead', Je = 'read', Ke = 'afterRead', Qe = 'beforeMain', Ze = 'main', et = 'afterMain', tt = 'beforeWrite', nt = 'write', rt = 'afterWrite', ot = [Ge, Je, Ke, Qe, Ze, et, tt, nt, rt] function C(e) { return e ? (e.nodeName || '').toLowerCase() : null } function H(e) { if (e == null) return window if (e.toString() !== '[object Window]') { var t = e.ownerDocument return (t && t.defaultView) || window } return e } function Q(e) { var t = H(e).Element return e instanceof t || e instanceof Element } function B(e) { var t = H(e).HTMLElement return e instanceof t || e instanceof HTMLElement } function Pe(e) { if (typeof ShadowRoot == 'undefined') return !1 var t = H(e).ShadowRoot return e instanceof t || e instanceof ShadowRoot } function Mt(e) { var t = e.state Object.keys(t.elements).forEach(function (r) { var o = t.styles[r] || {}, n = t.attributes[r] || {}, a = t.elements[r] !B(a) || !C(a) || (Object.assign(a.style, o), Object.keys(n).forEach(function (l) { var s = n[l] s === !1 ? a.removeAttribute(l) : a.setAttribute(l, s === !0 ? '' : s) })) }) } function Rt(e) { var t = e.state, r = { popper: { position: t.options.strategy, left: '0', top: '0', margin: '0' }, arrow: { position: 'absolute' }, reference: {} } return ( Object.assign(t.elements.popper.style, r.popper), (t.styles = r), t.elements.arrow && Object.assign(t.elements.arrow.style, r.arrow), function () { Object.keys(t.elements).forEach(function (o) { var n = t.elements[o], a = t.attributes[o] || {}, l = Object.keys(t.styles.hasOwnProperty(o) ? t.styles[o] : r[o]), s = l.reduce(function (c, d) { return (c[d] = ''), c }, {}) !B(n) || !C(n) || (Object.assign(n.style, s), Object.keys(a).forEach(function (c) { n.removeAttribute(c) })) }) } ) } var Ae = { name: 'applyStyles', enabled: !0, phase: 'write', fn: Mt, effect: Rt, requires: ['computeStyles'] } function q(e) { return e.split('-')[0] } var X = Math.max, ve = Math.min, Z = Math.round function ee(e, t) { t === void 0 && (t = !1) var r = e.getBoundingClientRect(), o = 1, n = 1 if (B(e) && t) { var a = e.offsetHeight, l = e.offsetWidth l > 0 && (o = Z(r.width) / l || 1), a > 0 && (n = Z(r.height) / a || 1) } return { width: r.width / o, height: r.height / n, top: r.top / n, right: r.right / o, bottom: r.bottom / n, left: r.left / o, x: r.left / o, y: r.top / n } } function ke(e) { var t = ee(e), r = e.offsetWidth, o = e.offsetHeight return ( Math.abs(t.width - r) <= 1 && (r = t.width), Math.abs(t.height - o) <= 1 && (o = t.height), { x: e.offsetLeft, y: e.offsetTop, width: r, height: o } ) } function it(e, t) { var r = t.getRootNode && t.getRootNode() if (e.contains(t)) return !0 if (r && Pe(r)) { var o = t do { if (o && e.isSameNode(o)) return !0 o = o.parentNode || o.host } while (o) } return !1 } function N(e) { return H(e).getComputedStyle(e) } function Wt(e) { return ['table', 'td', 'th'].indexOf(C(e)) >= 0 } function I(e) { return ((Q(e) ? e.ownerDocument : e.document) || window.document) .documentElement } function ge(e) { return C(e) === 'html' ? e : e.assignedSlot || e.parentNode || (Pe(e) ? e.host : null) || I(e) } function at(e) { return !B(e) || N(e).position === 'fixed' ? null : e.offsetParent } function Bt(e) { var t = navigator.userAgent.toLowerCase().indexOf('firefox') !== -1, r = navigator.userAgent.indexOf('Trident') !== -1 if (r && B(e)) { var o = N(e) if (o.position === 'fixed') return null } var n = ge(e) for (Pe(n) && (n = n.host); B(n) && ['html', 'body'].indexOf(C(n)) < 0; ) { var a = N(n) if ( a.transform !== 'none' || a.perspective !== 'none' || a.contain === 'paint' || ['transform', 'perspective'].indexOf(a.willChange) !== -1 || (t && a.willChange === 'filter') || (t && a.filter && a.filter !== 'none') ) return n n = n.parentNode } return null } function se(e) { for (var t = H(e), r = at(e); r && Wt(r) && N(r).position === 'static'; ) r = at(r) return r && (C(r) === 'html' || (C(r) === 'body' && N(r).position === 'static')) ? t : r || Bt(e) || t } function Le(e) { return ['top', 'bottom'].indexOf(e) >= 0 ? 'x' : 'y' } function fe(e, t, r) { return X(e, ve(t, r)) } function St(e, t, r) { var o = fe(e, t, r) return o > r ? r : o } function st() { return { top: 0, right: 0, bottom: 0, left: 0 } } function ft(e) { return Object.assign({}, st(), e) } function ct(e, t) { return t.reduce(function (r, o) { return (r[o] = e), r }, {}) } var Tt = function (e, t) { return ( (e = typeof e == 'function' ? e(Object.assign({}, t.rects, { placement: t.placement })) : e), ft(typeof e != 'number' ? e : ct(e, G)) ) } function Ht(e) { var t, r = e.state, o = e.name, n = e.options, a = r.elements.arrow, l = r.modifiersData.popperOffsets, s = q(r.placement), c = Le(s), d = [P, W].indexOf(s) >= 0, u = d ? 'height' : 'width' if (!(!a || !l)) { var m = Tt(n.padding, r), f = ke(a), _ = c === 'y' ? E : P, b = c === 'y' ? R : W, v = r.rects.reference[u] + r.rects.reference[c] - l[c] - r.rects.popper[u], k = l[c] - r.rects.reference[c], g = se(a), x = g ? (c === 'y' ? g.clientHeight || 0 : g.clientWidth || 0) : 0, y = v / 2 - k / 2, w = m[_], S = x - f[u] - m[b], T = x / 2 - f[u] / 2 + y, A = fe(w, T, S), $ = c r.modifiersData[o] = ((t = {}), (t[$] = A), (t.centerOffset = A - T), t) } } function Ct(e) { var t = e.state, r = e.options, o = r.element, n = o === void 0 ? '[data-popper-arrow]' : o n != null && ((typeof n == 'string' && ((n = t.elements.popper.querySelector(n)), !n)) || !it(t.elements.popper, n) || (t.elements.arrow = n)) } var pt = { name: 'arrow', enabled: !0, phase: 'main', fn: Ht, effect: Ct, requires: ['popperOffsets'], requiresIfExists: ['preventOverflow'] } function te(e) { return e.split('-')[1] } var qt = { top: 'auto', right: 'auto', bottom: 'auto', left: 'auto' } function Vt(e) { var t = e.x, r = e.y, o = window, n = o.devicePixelRatio || 1 return { x: Z(t * n) / n || 0, y: Z(r * n) / n || 0 } } function ut(e) { var t, r = e.popper, o = e.popperRect, n = e.placement, a = e.variation, l = e.offsets, s = e.position, c = e.gpuAcceleration, d = e.adaptive, u = e.roundOffsets, m = e.isFixed, f = l.x, _ = f === void 0 ? 0 : f, b = l.y, v = b === void 0 ? 0 : b, k = typeof u == 'function' ? u({ x: _, y: v }) : { x: _, y: v } ;(_ = k.x), (v = k.y) var g = l.hasOwnProperty('x'), x = l.hasOwnProperty('y'), y = P, w = E, S = window if (d) { var T = se(r), A = 'clientHeight', $ = 'clientWidth' if ( (T === H(r) && ((T = I(r)), N(T).position !== 'static' && s === 'absolute' && ((A = 'scrollHeight'), ($ = 'scrollWidth'))), (T = T), n === E || ((n === P || n === W) && a === J)) ) { w = R var F = m && T === S && S.visualViewport ? S.visualViewport.height : T[A] ;(v -= F - o.height), (v *= c ? 1 : -1) } if (n === P || ((n === E || n === R) && a === J)) { y = W var Y = m && T === S && S.visualViewport ? S.visualViewport.width : T[$] ;(_ -= Y - o.width), (_ *= c ? 1 : -1) } } var ae = Object.assign({ position: s }, d && qt), re = u === !0 ? Vt({ x: _, y: v }) : { x: _, y: v } if (((_ = re.x), (v = re.y), c)) { var ie return Object.assign( {}, ae, ((ie = {}), (ie[w] = x ? '0' : ''), (ie[y] = g ? '0' : ''), (ie.transform = (S.devicePixelRatio || 1) <= 1 ? 'translate(' + _ + 'px, ' + v + 'px)' : 'translate3d(' + _ + 'px, ' + v + 'px, 0)'), ie) ) } return Object.assign( {}, ae, ((t = {}), (t[w] = x ? v + 'px' : ''), (t[y] = g ? _ + 'px' : ''), (t.transform = ''), t) ) } function Nt(e) { var t = e.state, r = e.options, o = r.gpuAcceleration, n = o === void 0 ? !0 : o, a = r.adaptive, l = a === void 0 ? !0 : a, s = r.roundOffsets, c = s === void 0 ? !0 : s, d = { placement: q(t.placement), variation: te(t.placement), popper: t.elements.popper, popperRect: t.rects.popper, gpuAcceleration: n, isFixed: t.options.strategy === 'fixed' } t.modifiersData.popperOffsets != null && (t.styles.popper = Object.assign( {}, t.styles.popper, ut( Object.assign({}, d, { offsets: t.modifiersData.popperOffsets, position: t.options.strategy, adaptive: l, roundOffsets: c }) ) )), t.modifiersData.arrow != null && (t.styles.arrow = Object.assign( {}, t.styles.arrow, ut( Object.assign({}, d, { offsets: t.modifiersData.arrow, position: 'absolute', adaptive: !1, roundOffsets: c }) ) )), (t.attributes.popper = Object.assign({}, t.attributes.popper, { 'data-popper-placement': t.placement })) } var Me = { name: 'computeStyles', enabled: !0, phase: 'beforeWrite', fn: Nt, data: {} }, ye = { passive: !0 } function It(e) { var t = e.state, r = e.instance, o = e.options, n = o.scroll, a = n === void 0 ? !0 : n, l = o.resize, s = l === void 0 ? !0 : l, c = H(t.elements.popper), d = [].concat(t.scrollParents.reference, t.scrollParents.popper) return ( a && d.forEach(function (u) { u.addEventListener('scroll', r.update, ye) }), s && c.addEventListener('resize', r.update, ye), function () { a && d.forEach(function (u) { u.removeEventListener('scroll', r.update, ye) }), s && c.removeEventListener('resize', r.update, ye) } ) } var Re = { name: 'eventListeners', enabled: !0, phase: 'write', fn: function () {}, effect: It, data: {} }, _t = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' } function be(e) { return e.replace(/left|right|bottom|top/g, function (t) { return _t[t] }) } var zt = { start: 'end', end: 'start' } function lt(e) { return e.replace(/start|end/g, function (t) { return zt[t] }) } function We(e) { var t = H(e), r = t.pageXOffset, o = t.pageYOffset return { scrollLeft: r, scrollTop: o } } function Be(e) { return ee(I(e)).left + We(e).scrollLeft } function Ft(e) { var t = H(e), r = I(e), o = t.visualViewport, n = r.clientWidth, a = r.clientHeight, l = 0, s = 0 return ( o && ((n = o.width), (a = o.height), /^((?!chrome|android).)*safari/i.test(navigator.userAgent) || ((l = o.offsetLeft), (s = o.offsetTop))), { width: n, height: a, x: l + Be(e), y: s } ) } function Ut(e) { var t, r = I(e), o = We(e), n = (t = e.ownerDocument) == null ? void 0 : t.body, a = X( r.scrollWidth, r.clientWidth, n ? n.scrollWidth : 0, n ? n.clientWidth : 0 ), l = X( r.scrollHeight, r.clientHeight, n ? n.scrollHeight : 0, n ? n.clientHeight : 0 ), s = -o.scrollLeft + Be(e), c = -o.scrollTop return ( N(n || r).direction === 'rtl' && (s += X(r.clientWidth, n ? n.clientWidth : 0) - a), { width: a, height: l, x: s, y: c } ) } function Se(e) { var t = N(e), r = t.overflow, o = t.overflowX, n = t.overflowY return /auto|scroll|overlay|hidden/.test(r + n + o) } function dt(e) { return ['html', 'body', '#document'].indexOf(C(e)) >= 0 ? e.ownerDocument.body : B(e) && Se(e) ? e : dt(ge(e)) } function ce(e, t) { var r t === void 0 && (t = []) var o = dt(e), n = o === ((r = e.ownerDocument) == null ? void 0 : r.body), a = H(o), l = n ? [a].concat(a.visualViewport || [], Se(o) ? o : []) : o, s = t.concat(l) return n ? s : s.concat(ce(ge(l))) } function Te(e) { return Object.assign({}, e, { left: e.x, top: e.y, right: e.x + e.width, bottom: e.y + e.height }) } function Xt(e) { var t = ee(e) return ( (t.top = t.top + e.clientTop), (t.left = t.left + e.clientLeft), (t.bottom = t.top + e.clientHeight), (t.right = t.left + e.clientWidth), (t.width = e.clientWidth), (t.height = e.clientHeight), (t.x = t.left), (t.y = t.top), t ) } function ht(e, t) { return t === je ? Te(Ft(e)) : Q(t) ? Xt(t) : Te(Ut(I(e))) } function Yt(e) { var t = ce(ge(e)), r = ['absolute', 'fixed'].indexOf(N(e).position) >= 0, o = r && B(e) ? se(e) : e return Q(o) ? t.filter(function (n) { return Q(n) && it(n, o) && C(n) !== 'body' }) : [] } function Gt(e, t, r) { var o = t === 'clippingParents' ? Yt(e) : [].concat(t), n = [].concat(o, [r]), a = n[0], l = n.reduce(function (s, c) { var d = ht(e, c) return ( (s.top = X(d.top, s.top)), (s.right = ve(d.right, s.right)), (s.bottom = ve(d.bottom, s.bottom)), (s.left = X(d.left, s.left)), s ) }, ht(e, a)) return ( (l.width = l.right - l.left), (l.height = l.bottom - l.top), (l.x = l.left), (l.y = l.top), l ) } function mt(e) { var t = e.reference, r = e.element, o = e.placement, n = o ? q(o) : null, a = o ? te(o) : null, l = t.x + t.width / 2 - r.width / 2, s = t.y + t.height / 2 - r.height / 2, c switch (n) { case E: c = { x: l, y: t.y - r.height } break case R: c = { x: l, y: t.y + t.height } break case W: c = { x: t.x + t.width, y: s } break case P: c = { x: t.x - r.width, y: s } break default: c = { x: t.x, y: t.y } } var d = n ? Le(n) : null if (d != null) { var u = d === 'y' ? 'height' : 'width' switch (a) { case U: c[d] = c[d] - (t[u] / 2 - r[u] / 2) break case J: c[d] = c[d] + (t[u] / 2 - r[u] / 2) break } } return c } function ne(e, t) { t === void 0 && (t = {}) var r = t, o = r.placement, n = o === void 0 ? e.placement : o, a = r.boundary, l = a === void 0 ? Xe : a, s = r.rootBoundary, c = s === void 0 ? je : s, d = r.elementContext, u = d === void 0 ? K : d, m = r.altBoundary, f = m === void 0 ? !1 : m, _ = r.padding, b = _ === void 0 ? 0 : _, v = ft(typeof b != 'number' ? b : ct(b, G)), k = u === K ? Ye : K, g = e.rects.popper, x = e.elements[f ? k : u], y = Gt(Q(x) ? x : x.contextElement || I(e.elements.popper), l, c), w = ee(e.elements.reference), S = mt({ reference: w, element: g, strategy: 'absolute', placement: n }), T = Te(Object.assign({}, g, S)), A = u === K ? T : w, $ = { top: y.top - A.top + v.top, bottom: A.bottom - y.bottom + v.bottom, left: y.left - A.left + v.left, right: A.right - y.right + v.right }, F = e.modifiersData.offset if (u === K && F) { var Y = F[n] Object.keys($).forEach(function (ae) { var re = [W, R].indexOf(ae) >= 0 ? 1 : -1, ie = [E, R].indexOf(ae) >= 0 ? 'y' : 'x' $[ae] += Y[ie] * re }) } return $ } function Jt(e, t) { t === void 0 && (t = {}) var r = t, o = r.placement, n = r.boundary, a = r.rootBoundary, l = r.padding, s = r.flipVariations, c = r.allowedAutoPlacements, d = c === void 0 ? Ee : c, u = te(o), m = u ? s ? De : De.filter(function (b) { return te(b) === u }) : G, f = m.filter(function (b) { return d.indexOf(b) >= 0 }) f.length === 0 && (f = m) var _ = f.reduce(function (b, v) { return ( (b[v] = ne(e, { placement: v, boundary: n, rootBoundary: a, padding: l })[ q(v) ]), b ) }, {}) return Object.keys(_).sort(function (b, v) { return _[b] - _[v] }) } function Kt(e) { if (q(e) === me) return [] var t = be(e) return [lt(e), t, lt(t)] } function Qt(e) { var t = e.state, r = e.options, o = e.name if (!t.modifiersData[o]._skip) { for ( var n = r.mainAxis, a = n === void 0 ? !0 : n, l = r.altAxis, s = l === void 0 ? !0 : l, c = r.fallbackPlacements, d = r.padding, u = r.boundary, m = r.rootBoundary, f = r.altBoundary, _ = r.flipVariations, b = _ === void 0 ? !0 : _, v = r.allowedAutoPlacements, k = t.options.placement, g = q(k), x = g === k, y = c || (x || !b ? [be(k)] : Kt(k)), w = [k].concat(y).reduce(function (rr, _e) { return rr.concat( q(_e) === me ? Jt(t, { placement: _e, boundary: u, rootBoundary: m, padding: d, flipVariations: b, allowedAutoPlacements: v }) : _e ) }, []), S = t.rects.reference, T = t.rects.popper, A = new Map(), $ = !0, F = w[0], Y = 0; Y < w.length; Y++ ) { var ae = w[Y], re = q(ae), ie = te(ae) === U, oe = [E, R].indexOf(re) >= 0, j = oe ? 'width' : 'height', V = ne(t, { placement: ae, boundary: u, rootBoundary: m, altBoundary: f, padding: d }), z = oe ? (ie ? W : P) : ie ? R : E S[j] > T[j] && (z = be(z)) var M = be(z), L = [] if ( (a && L.push(V[re] <= 0), s && L.push(V[z] <= 0, V[M] <= 0), L.every(function (rr) { return rr })) ) { ;(F = ae), ($ = !1) break } A.set(ae, L) } if ($) for ( var pe = b ? 3 : 1, ue = function (rr) { var _e = w.find(function (Oe) { var xe = A.get(Oe) if (xe) return xe.slice(0, rr).every(function ($e) { return $e }) }) if (_e) return (F = _e), 'break' }, Ie = pe; Ie > 0; Ie-- ) { var Pt = ue(Ie) if (Pt === 'break') break } t.placement !== F && ((t.modifiersData[o]._skip = !0), (t.placement = F), (t.reset = !0)) } } var vt = { name: 'flip', enabled: !0, phase: 'main', fn: Qt, requiresIfExists: ['offset'], data: { _skip: !1 } } function gt(e, t, r) { return ( r === void 0 && (r = { x: 0, y: 0 }), { top: e.top - t.height - r.y, right: e.right - t.width + r.x, bottom: e.bottom - t.height + r.y, left: e.left - t.width - r.x } ) } function yt(e) { return [E, W, R, P].some(function (t) { return e[t] >= 0 }) } function Zt(e) { var t = e.state, r = e.name, o = t.rects.reference, n = t.rects.popper, a = t.modifiersData.preventOverflow, l = ne(t, { elementContext: 'reference' }), s = ne(t, { altBoundary: !0 }), c = gt(l, o), d = gt(s, n, a), u = yt(c), m = yt(d) ;(t.modifiersData[r] = { referenceClippingOffsets: c, popperEscapeOffsets: d, isReferenceHidden: u, hasPopperEscaped: m }), (t.attributes.popper = Object.assign({}, t.attributes.popper, { 'data-popper-reference-hidden': u, 'data-popper-escaped': m })) } var bt = { name: 'hide', enabled: !0, phase: 'main', requiresIfExists: ['preventOverflow'], fn: Zt } function en(e, t, r) { var o = q(e), n = [P, E].indexOf(o) >= 0 ? -1 : 1, a = typeof r == 'function' ? r(Object.assign({}, t, { placement: e })) : r, l = a[0], s = a[1] return ( (l = l || 0), (s = (s || 0) * n), [P, W].indexOf(o) >= 0 ? { x: s, y: l } : { x: l, y: s } ) } function tn(e) { var t = e.state, r = e.options, o = e.name, n = r.offset, a = n === void 0 ? [0, 0] : n, l = Ee.reduce(function (u, m) { return (u[m] = en(m, t.rects, a)), u }, {}), s = l[t.placement], c = s.x, d = s.y t.modifiersData.popperOffsets != null && ((t.modifiersData.popperOffsets.x += c), (t.modifiersData.popperOffsets.y += d)), (t.modifiersData[o] = l) } var wt = { name: 'offset', enabled: !0, phase: 'main', requires: ['popperOffsets'], fn: tn } function nn(e) { var t = e.state, r = e.name t.modifiersData[r] = mt({ reference: t.rects.reference, element: t.rects.popper, strategy: 'absolute', placement: t.placement }) } var He = { name: 'popperOffsets', enabled: !0, phase: 'read', fn: nn, data: {} } function rn(e) { return e === 'x' ? 'y' : 'x' } function on(e) { var t = e.state, r = e.options, o = e.name, n = r.mainAxis, a = n === void 0 ? !0 : n, l = r.altAxis, s = l === void 0 ? !1 : l, c = r.boundary, d = r.rootBoundary, u = r.altBoundary, m = r.padding, f = r.tether, _ = f === void 0 ? !0 : f, b = r.tetherOffset, v = b === void 0 ? 0 : b, k = ne(t, { boundary: c, rootBoundary: d, padding: m, altBoundary: u }), g = q(t.placement), x = te(t.placement), y = !x, w = Le(g), S = rn(w), T = t.modifiersData.popperOffsets, A = t.rects.reference, $ = t.rects.popper, F = typeof v == 'function' ? v(Object.assign({}, t.rects, { placement: t.placement })) : v, Y = typeof F == 'number' ? { mainAxis: F, altAxis: F } : Object.assign({ mainAxis: 0, altAxis: 0 }, F), ae = t.modifiersData.offset ? t.modifiersData.offset[t.placement] : null, re = { x: 0, y: 0 } if (T) { if (a) { var ie, oe = w === 'y' ? E : P, j = w === 'y' ? R : W, V = w === 'y' ? 'height' : 'width', z = T[w], M = z + k[oe], L = z - k[j], pe = _ ? -$[V] / 2 : 0, ue = x === U ? A[V] : $[V], Ie = x === U ? -$[V] : -A[V], Pt = t.elements.arrow, rr = _ && Pt ? ke(Pt) : { width: 0, height: 0 }, _e = t.modifiersData['arrow#persistent'] ? t.modifiersData['arrow#persistent'].padding : st(), Oe = _e[oe], xe = _e[j], $e = fe(0, A[V], rr[V]), jt = y ? A[V] / 2 - pe - $e - Oe - Y.mainAxis : ue - $e - Oe - Y.mainAxis, or = y ? -A[V] / 2 + pe + $e + xe + Y.mainAxis : Ie + $e + xe + Y.mainAxis, er = t.elements.arrow && se(t.elements.arrow), tr = er ? (w === 'y' ? er.clientTop || 0 : er.clientLeft || 0) : 0, D = (ie = ae == null ? void 0 : ae[w]) != null ? ie : 0, de = z + jt - D - tr, Ce = z + or - D, Ne = fe(_ ? ve(M, de) : M, z, _ ? X(L, Ce) : L) ;(T[w] = Ne), (re[w] = Ne - z) } if (s) { var Ve, Et = w === 'x' ? E : P, Lt = w === 'x' ? R : W, Ue = T[S], kt = S === 'y' ? 'height' : 'width', qe = Ue + k[Et], ir = Ue - k[Lt], he = [E, P].indexOf(g) !== -1, At = (Ve = ae == null ? void 0 : ae[S]) != null ? Ve : 0, nr = he ? qe : Ue - A[kt] - $[kt] - At + Y.altAxis, cr = he ? Ue + A[kt] + $[kt] - At - Y.altAxis : ir, Fe = _ && he ? St(nr, Ue, cr) : fe(_ ? nr : qe, Ue, _ ? cr : ir) ;(T[S] = Fe), (re[S] = Fe - Ue) } t.modifiersData[o] = re } } var xt = { name: 'preventOverflow', enabled: !0, phase: 'main', fn: on, requiresIfExists: ['offset'] } function an(e) { return { scrollLeft: e.scrollLeft, scrollTop: e.scrollTop } } function sn(e) { return e === H(e) || !B(e) ? We(e) : an(e) } function fn(e) { var t = e.getBoundingClientRect(), r = Z(t.width) / e.offsetWidth || 1, o = Z(t.height) / e.offsetHeight || 1 return r !== 1 || o !== 1 } function cn(e, t, r) { r === void 0 && (r = !1) var o = B(t), n = B(t) && fn(t), a = I(t), l = ee(e, n), s = { scrollLeft: 0, scrollTop: 0 }, c = { x: 0, y: 0 } return ( (o || (!o && !r)) && ((C(t) !== 'body' || Se(a)) && (s = sn(t)), B(t) ? ((c = ee(t, !0)), (c.x += t.clientLeft), (c.y += t.clientTop)) : a && (c.x = Be(a))), { x: l.left + s.scrollLeft - c.x, y: l.top + s.scrollTop - c.y, width: l.width, height: l.height } ) } function pn(e) { var t = new Map(), r = new Set(), o = [] e.forEach(function (a) { t.set(a.name, a) }) function n(a) { r.add(a.name) var l = [].concat(a.requires || [], a.requiresIfExists || []) l.forEach(function (s) { if (!r.has(s)) { var c = t.get(s) c && n(c) } }), o.push(a) } return ( e.forEach(function (a) { r.has(a.name) || n(a) }), o ) } function un(e) { var t = pn(e) return ot.reduce(function (r, o) { return r.concat( t.filter(function (n) { return n.phase === o }) ) }, []) } function ln(e) { var t return function () { return ( t || (t = new Promise(function (r) { Promise.resolve().then(function () { ;(t = void 0), r(e()) }) })), t ) } } function dn(e) { var t = e.reduce(function (r, o) { var n = r[o.name] return ( (r[o.name] = n ? Object.assign({}, n, o, { options: Object.assign({}, n.options, o.options), data: Object.assign({}, n.data, o.data) }) : o), r ) }, {}) return Object.keys(t).map(function (r) { return t[r] }) } var Ot = { placement: 'bottom', modifiers: [], strategy: 'absolute' } function $t() { for (var e = arguments.length, t = new Array(e), r = 0; r < e; r++) t[r] = arguments[r] return !t.some(function (o) { return !(o && typeof o.getBoundingClientRect == 'function') }) } function we(e) { e === void 0 && (e = {}) var t = e, r = t.defaultModifiers, o = r === void 0 ? [] : r, n = t.defaultOptions, a = n === void 0 ? Ot : n return function (l, s, c) { c === void 0 && (c = a) var d = { placement: 'bottom', orderedModifiers: [], options: Object.assign({}, Ot, a), modifiersData: {}, elements: { reference: l, popper: s }, attributes: {}, styles: {} }, u = [], m = !1, f = { state: d, setOptions: function (v) { var k = typeof v == 'function' ? v(d.options) : v b(), (d.options = Object.assign({}, a, d.options, k)), (d.scrollParents = { reference: Q(l) ? ce(l) : l.contextElement ? ce(l.contextElement) : [], popper: ce(s) }) var g = un(dn([].concat(o, d.options.modifiers))) return ( (d.orderedModifiers = g.filter(function (x) { return x.enabled })), _(), f.update() ) }, forceUpdate: function () { if (!m) { var v = d.elements, k = v.reference, g = v.popper if ($t(k, g)) { ;(d.rects = { reference: cn(k, se(g), d.options.strategy === 'fixed'), popper: ke(g) }), (d.reset = !1), (d.placement = d.options.placement), d.orderedModifiers.forEach(function ($) { return (d.modifiersData[$.name] = Object.assign({}, $.data)) }) for (var x = 0; x < d.orderedModifiers.length; x++) { if (d.reset === !0) { ;(d.reset = !1), (x = -1) continue } var y = d.orderedModifiers[x], w = y.fn, S = y.options, T = S === void 0 ? {} : S, A = y.name typeof w == 'function' && (d = w({ state: d, options: T, name: A, instance: f }) || d) } } } }, update: ln(function () { return new Promise(function (v) { f.forceUpdate(), v(d) }) }), destroy: function () { b(), (m = !0) } } if (!$t(l, s)) return f f.setOptions(c).then(function (v) { !m && c.onFirstUpdate && c.onFirstUpdate(v) }) function _() { d.orderedModifiers.forEach(function (v) { var k = v.name, g = v.options, x = g === void 0 ? {} : g, y = v.effect if (typeof y == 'function') { var w = y({ state: d, name: k, instance: f, options: x }), S = function () {} u.push(w || S) } }) } function b() { u.forEach(function (v) { return v() }), (u = []) } return f } } we() var mn = [Re, He, Me, Ae] we({ defaultModifiers: mn }) var gn = [Re, He, Me, Ae, wt, vt, xt, pt, bt], yn = we({ defaultModifiers: gn }) const obtainAllFocusableElements = e => { const t = [], r = document.createTreeWalker(e, NodeFilter.SHOW_ELEMENT, { acceptNode: o => { const n = o.tagName === 'INPUT' && o.type === 'hidden' return o.disabled || o.hidden || n ? NodeFilter.FILTER_SKIP : o.tabIndex >= 0 || o === document.activeElement ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP } }) for (; r.nextNode(); ) t.push(r.currentNode) return t }, getVisibleElement = (e, t) => { for (const r of e) if (!isHidden(r, t)) return r }, isHidden = (e, t) => { if (getComputedStyle(e).visibility === 'hidden') return !0 for (; e; ) { if (t && e === t) return !1 if (getComputedStyle(e).display === 'none') return !0 e = e.parentElement } return !1 }, getEdges = e => { const t = obtainAllFocusableElements(e), r = getVisibleElement(t, e), o = getVisibleElement(t.reverse(), e) return [r, o] }, isSelectable = e => e instanceof HTMLInputElement && 'select' in e, tryFocus = (e, t) => { if (e && e.focus) { const r = document.activeElement e.focus({ preventScroll: !0 }), e !== r && isSelectable(e) && t && e.select() } } function removeFromStack(e, t) { const r = [...e], o = e.indexOf(t) return o !== -1 && r.splice(o, 1), r } const createFocusableStack = () => { let e = [] return { push: o => { const n = e[0] n && o !== n && n.pause(), (e = removeFromStack(e, o)), e.unshift(o) }, remove: o => { var n, a ;(e = removeFromStack(e, o)), (a = (n = e[0]) == null ? void 0 : n.resume) == null || a.call(n) } } }, focusFirstDescendant = (e, t = !1) => { const r = document.activeElement for (const o of e) if ((tryFocus(o, t), document.activeElement !== r)) return }, focusableStack = createFocusableStack(), FOCUS_AFTER_TRAPPED = 'focus-trap.focus-after-trapped', FOCUS_AFTER_RELEASED = 'focus-trap.focus-after-released', FOCUS_AFTER_TRAPPED_OPTS = { cancelable: !0, bubbles: !1 }, ON_TRAP_FOCUS_EVT = 'focusAfterTrapped', ON_RELEASE_FOCUS_EVT = 'focusAfterReleased', FOCUS_TRAP_INJECTION_KEY = Symbol('elFocusTrap'), _sfc_main$v = defineComponent({ name: 'ElFocusTrap', inheritAttrs: !1, props: { loop: Boolean, trapped: Boolean, focusTrapEl: Object, focusStartEl: { type: [Object, String], default: 'first' } }, emits: [ ON_TRAP_FOCUS_EVT, ON_RELEASE_FOCUS_EVT, 'focusin', 'focusout', 'focusout-prevented', 'release-requested' ], setup(e, { emit: t }) { const r = ref() let o, n useEscapeKeydown(_ => { e.trapped && !a.paused && t('release-requested', _) }) const a = { paused: !1, pause() { this.paused = !0 }, resume() { this.paused = !1 } }, l = _ => { if ((!e.loop && !e.trapped) || a.paused) return const { key: b, altKey: v, ctrlKey: k, metaKey: g, currentTarget: x, shiftKey: y } = _, { loop: w } = e, S = b === EVENT_CODE.tab && !v && !k && !g, T = document.activeElement if (S && T) { const A = x, [$, F] = getEdges(A) $ && F ? !y && T === F ? (_.preventDefault(), w && tryFocus($, !0), t('focusout-prevented')) : y && [$, A].includes(T) && (_.preventDefault(), w && tryFocus(F, !0), t('focusout-prevented')) : T === A && (_.preventDefault(), t('focusout-prevented')) } } provide(FOCUS_TRAP_INJECTION_KEY, { focusTrapRef: r, onKeydown: l }), watch( () => e.focusTrapEl, _ => { _ && (r.value = _) }, { immediate: !0 } ), watch([r], ([_], [b]) => { _ && (_.addEventListener('keydown', l), _.addEventListener('focusin', d), _.addEventListener('focusout', u)), b && (b.removeEventListener('keydown', l), b.removeEventListener('focusin', d), b.removeEventListener('focusout', u)) }) const s = _ => { t(ON_TRAP_FOCUS_EVT, _) }, c = _ => t(ON_RELEASE_FOCUS_EVT, _), d = _ => { const b = unref(r) if (!b) return const v = _.target, k = v && b.contains(v) k && t('focusin', _), !a.paused && e.trapped && (k ? (n = v) : tryFocus(n, !0)) }, u = _ => { const b = unref(r) if (!(a.paused || !b)) if (e.trapped) { const v = _.relatedTarget !isNil(v) && !b.contains(v) && setTimeout(() => { !a.paused && e.trapped && tryFocus(n, !0) }, 0) } else { const v = _.target ;(v && b.contains(v)) || t('focusout', _) } } async function m() { await nextTick() const _ = unref(r) if (_) { focusableStack.push(a) const b = document.activeElement if (((o = b), !_.contains(b))) { const k = new Event(FOCUS_AFTER_TRAPPED, FOCUS_AFTER_TRAPPED_OPTS) _.addEventListener(FOCUS_AFTER_TRAPPED, s), _.dispatchEvent(k), k.defaultPrevented || nextTick(() => { let g = e.focusStartEl isString$2(g) || (tryFocus(g), document.activeElement !== g && (g = 'first')), g === 'first' && focusFirstDescendant(obtainAllFocusableElements(_), !0), (document.activeElement === b || g === 'container') && tryFocus(_) }) } } } function f() { const _ = unref(r) if (_) { _.removeEventListener(FOCUS_AFTER_TRAPPED, s) const b = new Event(FOCUS_AFTER_RELEASED, FOCUS_AFTER_TRAPPED_OPTS) _.addEventListener(FOCUS_AFTER_RELEASED, c), _.dispatchEvent(b), b.defaultPrevented || tryFocus(o != null ? o : document.body, !0), _.removeEventListener(FOCUS_AFTER_RELEASED, s), focusableStack.remove(a) } } return ( onMounted(() => { e.trapped && m(), watch( () => e.trapped, _ => { _ ? m() : f() } ) }), onBeforeUnmount(() => { e.trapped && f() }), { onKeydown: l } ) } }) function _sfc_render$g(e, t, r, o, n, a) { return renderSlot(e.$slots, 'default', { handleKeydown: e.onKeydown }) } var ElFocusTrap = _export_sfc$1(_sfc_main$v, [ ['render', _sfc_render$g], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/focus-trap/src/focus-trap.vue' ] ]) const POSITIONING_STRATEGIES = ['fixed', 'absolute'], usePopperCoreConfigProps = buildProps({ boundariesPadding: { type: Number, default: 0 }, fallbackPlacements: { type: definePropType(Array), default: () => [] }, gpuAcceleration: { type: Boolean, default: !0 }, offset: { type: Number, default: 12 }, placement: { type: String, values: Ee, default: 'bottom' }, popperOptions: { type: definePropType(Object), default: () => ({}) }, strategy: { type: String, values: POSITIONING_STRATEGIES, default: 'absolute' } }), usePopperContentProps = buildProps( pr(ar({}, usePopperCoreConfigProps), { id: String, style: { type: definePropType([String, Array, Object]) }, className: { type: definePropType([String, Array, Object]) }, effect: { type: String, default: 'dark' }, visible: Boolean, enterable: { type: Boolean, default: !0 }, pure: Boolean, focusOnShow: { type: Boolean, default: !1 }, trapping: { type: Boolean, default: !1 }, popperClass: { type: definePropType([String, Array, Object]) }, popperStyle: { type: definePropType([String, Array, Object]) }, referenceEl: { type: definePropType(Object) }, triggerTargetEl: { type: definePropType(Object) }, stopPopperMouseEvent: { type: Boolean, default: !0 }, ariaLabel: { type: String, default: void 0 }, virtualTriggering: Boolean, zIndex: Number }) ), usePopperContentEmits = [ 'mouseenter', 'mouseleave', 'focus', 'blur', 'close' ], buildPopperOptions = (e, t) => { const { placement: r, strategy: o, popperOptions: n } = e, a = pr(ar({ placement: r, strategy: o }, n), { modifiers: genModifiers(e) }) return ( attachArrow(a, t), deriveExtraModifiers(a, n == null ? void 0 : n.modifiers), a ) }, unwrapMeasurableEl = e => { if (!!isClient) return unrefElement(e) } function genModifiers(e) { const { offset: t, gpuAcceleration: r, fallbackPlacements: o } = e return [ { name: 'offset', options: { offset: [0, t != null ? t : 12] } }, { name: 'preventOverflow', options: { padding: { top: 2, bottom: 2, left: 5, right: 5 } } }, { name: 'flip', options: { padding: 5, fallbackPlacements: o != null ? o : [] } }, { name: 'computeStyles', options: { gpuAcceleration: r, adaptive: r } } ] } function attachArrow(e, { arrowEl: t, arrowOffset: r }) { e.modifiers.push({ name: 'arrow', options: { element: t, padding: r != null ? r : 5 } }) } function deriveExtraModifiers(e, t) { t && (e.modifiers = [...e.modifiers, ...(t != null ? t : [])]) } const __default__$e = { name: 'ElPopperContent' }, _sfc_main$u = defineComponent( pr(ar({}, __default__$e), { props: usePopperContentProps, emits: usePopperContentEmits, setup(e, { expose: t, emit: r }) { const o = e, { popperInstanceRef: n, contentRef: a, triggerRef: l, role: s } = inject(POPPER_INJECTION_KEY, void 0), c = inject(formItemContextKey, void 0), { nextZIndex: d } = useZIndex(), u = useNamespace('popper'), m = ref(), f = ref('first'), _ = ref(), b = ref() provide(POPPER_CONTENT_INJECTION_KEY, { arrowRef: _, arrowOffset: b }), c && (c.addInputId || c.removeInputId) && provide( formItemContextKey, pr(ar({}, c), { addInputId: NOOP, removeInputId: NOOP }) ) const v = ref(o.zIndex || d()), k = ref(!1) let g const x = computed(() => unwrapMeasurableEl(o.referenceEl) || unref(l)), y = computed(() => [{ zIndex: unref(v) }, o.popperStyle]), w = computed(() => [ u.b(), u.is('pure', o.pure), u.is(o.effect), o.popperClass ]), S = computed(() => (s && s.value === 'dialog' ? 'false' : void 0)), T = ({ referenceEl: oe, popperContentEl: j, arrowEl: V }) => { const z = buildPopperOptions(o, { arrowEl: V, arrowOffset: unref(b) }) return yn(oe, j, z) }, A = (oe = !0) => { var j ;(j = unref(n)) == null || j.update(), oe && (v.value = o.zIndex || d()) }, $ = () => { var oe, j const V = { name: 'eventListeners', enabled: o.visible } ;(j = (oe = unref(n)) == null ? void 0 : oe.setOptions) == null || j.call(oe, z => pr(ar({}, z), { modifiers: [...(z.modifiers || []), V] }) ), A(!1), o.visible && o.focusOnShow ? (k.value = !0) : o.visible === !1 && (k.value = !1) }, F = () => { r('focus') }, Y = () => { ;(f.value = 'first'), r('blur') }, ae = oe => { var j o.visible && !k.value && (oe.relatedTarget && ((j = oe.relatedTarget) == null || j.focus()), oe.target && (f.value = oe.target), (k.value = !0)) }, re = () => { o.trapping || (k.value = !1) }, ie = () => { ;(k.value = !1), r('close') } return ( onMounted(() => { let oe watch( x, j => { var V oe == null || oe() const z = unref(n) if ( ((V = z == null ? void 0 : z.destroy) == null || V.call(z), j) ) { const M = unref(m) ;(a.value = M), (n.value = T({ referenceEl: j, popperContentEl: M, arrowEl: unref(_) })), (oe = watch( () => j.getBoundingClientRect(), () => A(), { immediate: !0 } )) } else n.value = void 0 }, { immediate: !0 } ), watch( () => o.triggerTargetEl, (j, V) => { g == null || g(), (g = void 0) const z = unref(j || m.value), M = unref(V || m.value) if (isElement$1(z)) { const { ariaLabel: L, id: pe } = toRefs(o) g = watch( [s, L, S, pe], ue => { ;['role', 'aria-label', 'aria-modal', 'id'].forEach( (Ie, Pt) => { isNil(ue[Pt]) ? z.removeAttribute(Ie) : z.setAttribute(Ie, ue[Pt]) } ) }, { immediate: !0 } ) } isElement$1(M) && ['role', 'aria-label', 'aria-modal', 'id'].forEach(L => { M.removeAttribute(L) }) }, { immediate: !0 } ), watch(() => o.visible, $, { immediate: !0 }), watch( () => buildPopperOptions(o, { arrowEl: unref(_), arrowOffset: unref(b) }), j => { var V return (V = n.value) == null ? void 0 : V.setOptions(j) } ) }), onBeforeUnmount(() => { g == null || g(), (g = void 0) }), t({ popperContentRef: m, popperInstanceRef: n, updatePopper: A, contentStyle: y }), (oe, j) => ( openBlock(), createElementBlock( 'div', { ref_key: 'popperContentRef', ref: m, style: normalizeStyle(unref(y)), class: normalizeClass(unref(w)), tabindex: '-1', onMouseenter: j[0] || (j[0] = V => oe.$emit('mouseenter', V)), onMouseleave: j[1] || (j[1] = V => oe.$emit('mouseleave', V)) }, [ createVNode( unref(ElFocusTrap), { trapped: k.value, 'trap-on-focus-in': !0, 'focus-trap-el': m.value, 'focus-start-el': f.value, onFocusAfterTrapped: F, onFocusAfterReleased: Y, onFocusin: ae, onFocusoutPrevented: re, onReleaseRequested: ie }, { default: withCtx(() => [renderSlot(oe.$slots, 'default')]), _: 3 }, 8, ['trapped', 'focus-trap-el', 'focus-start-el'] ) ], 38 ) ) ) } }) ) var ElPopperContent = _export_sfc$1(_sfc_main$u, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/popper/src/content.vue' ] ]) const ElPopper = withInstall(Popper), ns = useNamespace('tooltip'), useTooltipContentProps = buildProps( pr(ar(ar({}, useDelayedToggleProps), usePopperContentProps), { appendTo: { type: definePropType([String, Object]), default: POPPER_CONTAINER_SELECTOR }, content: { type: String, default: '' }, rawContent: { type: Boolean, default: !1 }, persistent: Boolean, ariaLabel: String, visible: { type: definePropType(Boolean), default: null }, transition: { type: String, default: `${ns.namespace.value}-fade-in-linear` }, teleported: { type: Boolean, default: !0 }, disabled: { type: Boolean } }) ), useTooltipTriggerProps = buildProps( pr(ar({}, usePopperTriggerProps), { disabled: Boolean, trigger: { type: definePropType([String, Array]), default: 'hover' }, triggerKeys: { type: definePropType(Array), default: () => [EVENT_CODE.enter, EVENT_CODE.space] } }) ), useTooltipProps = buildProps({ openDelay: { type: Number }, visibleArrow: { type: Boolean, default: void 0 }, hideAfter: { type: Number, default: 200 }, showArrow: { type: Boolean, default: !0 } }), TOOLTIP_INJECTION_KEY = Symbol('elTooltip'), _sfc_main$t = defineComponent({ name: 'ElTooltipContent', components: { ElPopperContent }, inheritAttrs: !1, props: useTooltipContentProps, setup(e) { const t = ref(null), r = ref(!1), o = ref(!1), n = ref(!1), a = ref(!1), { controlled: l, id: s, open: c, trigger: d, onClose: u, onOpen: m, onShow: f, onHide: _, onBeforeShow: b, onBeforeHide: v } = inject(TOOLTIP_INJECTION_KEY, void 0), k = computed(() => e.persistent) onBeforeUnmount(() => { a.value = !0 }) const g = computed(() => (unref(k) ? !0 : unref(c))), x = computed(() => (e.disabled ? !1 : unref(c))), y = computed(() => { var oe return (oe = e.style) != null ? oe : {} }), w = computed(() => !unref(c)), S = () => { _() }, T = () => { if (unref(l)) return !0 }, A = composeEventHandlers(T, () => { e.enterable && unref(d) === 'hover' && m() }), $ = composeEventHandlers(T, () => { unref(d) === 'hover' && u() }), F = () => { var oe, j ;(j = (oe = t.value) == null ? void 0 : oe.updatePopper) == null || j.call(oe), b == null || b() }, Y = () => { v == null || v() }, ae = () => { f(), (ie = onClickOutside( computed(() => { var oe return (oe = t.value) == null ? void 0 : oe.popperContentRef }), () => { if (unref(l)) return unref(d) !== 'hover' && u() } )) }, re = () => { e.virtualTriggering || u() } let ie return ( watch( () => unref(c), oe => { oe || ie == null || ie() }, { flush: 'post' } ), { ariaHidden: w, entering: o, leaving: n, id: s, intermediateOpen: r, contentStyle: y, contentRef: t, destroyed: a, shouldRender: g, shouldShow: x, onClose: u, open: c, onAfterShow: ae, onBeforeEnter: F, onBeforeLeave: Y, onContentEnter: A, onContentLeave: $, onTransitionLeave: S, onBlur: re } ) } }) function _sfc_render$f(e, t, r, o, n, a) { const l = resolveComponent('el-popper-content') return ( openBlock(), createBlock( Teleport, { disabled: !e.teleported, to: e.appendTo }, [ createVNode( Transition, { name: e.transition, onAfterLeave: e.onTransitionLeave, onBeforeEnter: e.onBeforeEnter, onAfterEnter: e.onAfterShow, onBeforeLeave: e.onBeforeLeave }, { default: withCtx(() => [ e.shouldRender ? withDirectives( (openBlock(), createBlock( l, mergeProps( { key: 0, id: e.id, ref: 'contentRef' }, e.$attrs, { 'aria-label': e.ariaLabel, 'aria-hidden': e.ariaHidden, 'boundaries-padding': e.boundariesPadding, 'fallback-placements': e.fallbackPlacements, 'gpu-acceleration': e.gpuAcceleration, offset: e.offset, placement: e.placement, 'popper-options': e.popperOptions, strategy: e.strategy, effect: e.effect, enterable: e.enterable, pure: e.pure, 'popper-class': e.popperClass, 'popper-style': [e.popperStyle, e.contentStyle], 'reference-el': e.referenceEl, 'trigger-target-el': e.triggerTargetEl, visible: e.shouldShow, 'z-index': e.zIndex, onMouseenter: e.onContentEnter, onMouseleave: e.onContentLeave, onBlur: e.onBlur, onClose: e.onClose } ), { default: withCtx(() => [ createCommentVNode(' Workaround bug #6378 '), e.destroyed ? createCommentVNode('v-if', !0) : renderSlot(e.$slots, 'default', { key: 0 }) ]), _: 3 }, 16, [ 'id', 'aria-label', 'aria-hidden', 'boundaries-padding', 'fallback-placements', 'gpu-acceleration', 'offset', 'placement', 'popper-options', 'strategy', 'effect', 'enterable', 'pure', 'popper-class', 'popper-style', 'reference-el', 'trigger-target-el', 'visible', 'z-index', 'onMouseenter', 'onMouseleave', 'onBlur', 'onClose' ] )), [[vShow, e.shouldShow]] ) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, [ 'name', 'onAfterLeave', 'onBeforeEnter', 'onAfterEnter', 'onBeforeLeave' ] ) ], 8, ['disabled', 'to'] ) ) } var ElTooltipContent = _export_sfc$1(_sfc_main$t, [ ['render', _sfc_render$f], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/content.vue' ] ]) const isTriggerType = (e, t) => (isArray$7(e) ? e.includes(t) : e === t), whenTrigger = (e, t, r) => o => { isTriggerType(unref(e), t) && r(o) }, _sfc_main$s = defineComponent({ name: 'ElTooltipTrigger', components: { ElPopperTrigger }, props: useTooltipTriggerProps, setup(e) { const t = useNamespace('tooltip'), { controlled: r, id: o, open: n, onOpen: a, onClose: l, onToggle: s } = inject(TOOLTIP_INJECTION_KEY, void 0), c = ref(null), d = () => { if (unref(r) || e.disabled) return !0 }, u = toRef(e, 'trigger'), m = composeEventHandlers(d, whenTrigger(u, 'hover', a)), f = composeEventHandlers(d, whenTrigger(u, 'hover', l)), _ = composeEventHandlers( d, whenTrigger(u, 'click', x => { x.button === 0 && s(x) }) ), b = composeEventHandlers(d, whenTrigger(u, 'focus', a)), v = composeEventHandlers(d, whenTrigger(u, 'focus', l)), k = composeEventHandlers( d, whenTrigger(u, 'contextmenu', x => { x.preventDefault(), s(x) }) ), g = composeEventHandlers(d, x => { const { code: y } = x e.triggerKeys.includes(y) && (x.preventDefault(), s(x)) }) return { onBlur: v, onContextMenu: k, onFocus: b, onMouseenter: m, onMouseleave: f, onClick: _, onKeydown: g, open: n, id: o, triggerRef: c, ns: t } } }) function _sfc_render$e(e, t, r, o, n, a) { const l = resolveComponent('el-popper-trigger') return ( openBlock(), createBlock( l, { id: e.id, 'virtual-ref': e.virtualRef, open: e.open, 'virtual-triggering': e.virtualTriggering, class: normalizeClass(e.ns.e('trigger')), onBlur: e.onBlur, onClick: e.onClick, onContextmenu: e.onContextMenu, onFocus: e.onFocus, onMouseenter: e.onMouseenter, onMouseleave: e.onMouseleave, onKeydown: e.onKeydown }, { default: withCtx(() => [renderSlot(e.$slots, 'default')]), _: 3 }, 8, [ 'id', 'virtual-ref', 'open', 'virtual-triggering', 'class', 'onBlur', 'onClick', 'onContextmenu', 'onFocus', 'onMouseenter', 'onMouseleave', 'onKeydown' ] ) ) } var ElTooltipTrigger = _export_sfc$1(_sfc_main$s, [ ['render', _sfc_render$e], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/trigger.vue' ] ]) const { useModelToggleProps, useModelToggle, useModelToggleEmits } = createModelToggleComposable('visible'), _sfc_main$r = defineComponent({ name: 'ElTooltip', components: { ElPopper, ElPopperArrow, ElTooltipContent, ElTooltipTrigger }, props: ar( ar( ar( ar( ar(ar({}, usePopperProps), useModelToggleProps), useTooltipContentProps ), useTooltipTriggerProps ), usePopperArrowProps ), useTooltipProps ), emits: [ ...useModelToggleEmits, 'before-show', 'before-hide', 'show', 'hide', 'open', 'close' ], setup(e, { emit: t }) { usePopperContainer() const r = computed( () => (isUndefined(e.openDelay), e.openDelay || e.showAfter) ), o = computed( () => ( isUndefined(e.visibleArrow), isBoolean$1(e.visibleArrow) ? e.visibleArrow : e.showArrow ) ), n = useId(), a = ref(null), l = ref(null), s = () => { var k const g = unref(a) g && ((k = g.popperInstanceRef) == null || k.update()) }, c = ref(!1), d = ref(void 0), { show: u, hide: m } = useModelToggle({ indicator: c, toggleReason: d }), { onOpen: f, onClose: _ } = useDelayedToggle({ showAfter: r, hideAfter: toRef(e, 'hideAfter'), open: u, close: m }), b = computed(() => isBoolean$1(e.visible)) return ( provide(TOOLTIP_INJECTION_KEY, { controlled: b, id: n, open: readonly(c), trigger: toRef(e, 'trigger'), onOpen: k => { f(k) }, onClose: k => { _(k) }, onToggle: k => { unref(c) ? _(k) : f(k) }, onShow: () => { t('show', d.value) }, onHide: () => { t('hide', d.value) }, onBeforeShow: () => { t('before-show', d.value) }, onBeforeHide: () => { t('before-hide', d.value) }, updatePopper: s }), watch( () => e.disabled, k => { k && c.value && (c.value = !1) } ), { compatShowAfter: r, compatShowArrow: o, popperRef: a, contentRef: l, open: c, hide: m, isFocusInsideContent: () => { var k, g const x = (g = (k = l.value) == null ? void 0 : k.contentRef) == null ? void 0 : g.popperContentRef return x && x.contains(document.activeElement) }, updatePopper: s, onOpen: f, onClose: _ } ) } }), _hoisted_1$e = ['innerHTML'], _hoisted_2$4 = { key: 1 } function _sfc_render$d(e, t, r, o, n, a) { const l = resolveComponent('el-tooltip-trigger'), s = resolveComponent('el-popper-arrow'), c = resolveComponent('el-tooltip-content'), d = resolveComponent('el-popper') return ( openBlock(), createBlock( d, { ref: 'popperRef', role: e.role }, { default: withCtx(() => [ createVNode( l, { disabled: e.disabled, trigger: e.trigger, 'trigger-keys': e.triggerKeys, 'virtual-ref': e.virtualRef, 'virtual-triggering': e.virtualTriggering }, { default: withCtx(() => [ e.$slots.default ? renderSlot(e.$slots, 'default', { key: 0 }) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, [ 'disabled', 'trigger', 'trigger-keys', 'virtual-ref', 'virtual-triggering' ] ), createVNode( c, { ref: 'contentRef', 'aria-label': e.ariaLabel, 'boundaries-padding': e.boundariesPadding, content: e.content, disabled: e.disabled, effect: e.effect, enterable: e.enterable, 'fallback-placements': e.fallbackPlacements, 'hide-after': e.hideAfter, 'gpu-acceleration': e.gpuAcceleration, offset: e.offset, persistent: e.persistent, 'popper-class': e.popperClass, 'popper-style': e.popperStyle, placement: e.placement, 'popper-options': e.popperOptions, pure: e.pure, 'raw-content': e.rawContent, 'reference-el': e.referenceEl, 'trigger-target-el': e.triggerTargetEl, 'show-after': e.compatShowAfter, strategy: e.strategy, teleported: e.teleported, transition: e.transition, 'virtual-triggering': e.virtualTriggering, 'z-index': e.zIndex, 'append-to': e.appendTo }, { default: withCtx(() => [ renderSlot(e.$slots, 'content', {}, () => [ e.rawContent ? (openBlock(), createElementBlock( 'span', { key: 0, innerHTML: e.content }, null, 8, _hoisted_1$e )) : (openBlock(), createElementBlock( 'span', _hoisted_2$4, toDisplayString(e.content), 1 )) ]), e.compatShowArrow ? (openBlock(), createBlock( s, { key: 0, 'arrow-offset': e.arrowOffset }, null, 8, ['arrow-offset'] )) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, [ 'aria-label', 'boundaries-padding', 'content', 'disabled', 'effect', 'enterable', 'fallback-placements', 'hide-after', 'gpu-acceleration', 'offset', 'persistent', 'popper-class', 'popper-style', 'placement', 'popper-options', 'pure', 'raw-content', 'reference-el', 'trigger-target-el', 'show-after', 'strategy', 'teleported', 'transition', 'virtual-triggering', 'z-index', 'append-to' ] ) ]), _: 3 }, 8, ['role'] ) ) } var Tooltip = _export_sfc$1(_sfc_main$r, [ ['render', _sfc_render$d], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/tooltip/src/tooltip.vue' ] ]) const ElTooltip = withInstall(Tooltip), badgeProps = buildProps({ value: { type: [String, Number], default: '' }, max: { type: Number, default: 99 }, isDot: Boolean, hidden: Boolean, type: { type: String, values: ['primary', 'success', 'warning', 'info', 'danger'], default: 'danger' } }), _hoisted_1$d = ['textContent'], __default__$d = { name: 'ElBadge' }, _sfc_main$q = defineComponent( pr(ar({}, __default__$d), { props: badgeProps, setup(e, { expose: t }) { const r = e, o = useNamespace('badge'), n = computed(() => r.isDot ? '' : isNumber$1(r.value) && isNumber$1(r.max) ? r.max < r.value ? `${r.max}+` : `${r.value}` : `${r.value}` ) return ( t({ content: n }), (a, l) => ( openBlock(), createElementBlock( 'div', { class: normalizeClass(unref(o).b()) }, [ renderSlot(a.$slots, 'default'), createVNode( Transition, { name: `${unref(o).namespace.value}-zoom-in-center`, persisted: '' }, { default: withCtx(() => [ withDirectives( createBaseVNode( 'sup', { class: normalizeClass([ unref(o).e('content'), unref(o).em('content', a.type), unref(o).is('fixed', !!a.$slots.default), unref(o).is('dot', a.isDot) ]), textContent: toDisplayString(unref(n)) }, null, 10, _hoisted_1$d ), [[vShow, !a.hidden && (unref(n) || a.isDot)]] ) ]), _: 1 }, 8, ['name'] ) ], 2 ) ) ) } }) ) var Badge = _export_sfc$1(_sfc_main$q, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/badge/src/badge.vue' ] ]) const ElBadge = withInstall(Badge), buttonTypes = [ 'default', 'primary', 'success', 'warning', 'info', 'danger', 'text', '' ], buttonNativeTypes = ['button', 'submit', 'reset'], buttonProps = buildProps({ size: useSizeProp, disabled: Boolean, type: { type: String, values: buttonTypes, default: '' }, icon: { type: iconPropType, default: '' }, nativeType: { type: String, values: buttonNativeTypes, default: 'button' }, loading: Boolean, loadingIcon: { type: iconPropType, default: () => loading_default }, plain: Boolean, text: Boolean, link: Boolean, bg: Boolean, autofocus: Boolean, round: Boolean, circle: Boolean, color: String, dark: Boolean, autoInsertSpace: { type: Boolean, default: void 0 } }), buttonEmits = { click: e => e instanceof MouseEvent } function bound01(e, t) { isOnePointZero(e) && (e = '100%') var r = isPercentage(e) return ( (e = t === 360 ? e : Math.min(t, Math.max(0, parseFloat(e)))), r && (e = parseInt(String(e * t), 10) / 100), Math.abs(e - t) < 1e-6 ? 1 : (t === 360 ? (e = (e < 0 ? (e % t) + t : e % t) / parseFloat(String(t))) : (e = (e % t) / parseFloat(String(t))), e) ) } function clamp01(e) { return Math.min(1, Math.max(0, e)) } function isOnePointZero(e) { return typeof e == 'string' && e.indexOf('.') !== -1 && parseFloat(e) === 1 } function isPercentage(e) { return typeof e == 'string' && e.indexOf('%') !== -1 } function boundAlpha(e) { return (e = parseFloat(e)), (isNaN(e) || e < 0 || e > 1) && (e = 1), e } function convertToPercentage(e) { return e <= 1 ? ''.concat(Number(e) * 100, '%') : e } function pad2(e) { return e.length === 1 ? '0' + e : String(e) } function rgbToRgb(e, t, r) { return { r: bound01(e, 255) * 255, g: bound01(t, 255) * 255, b: bound01(r, 255) * 255 } } function rgbToHsl(e, t, r) { ;(e = bound01(e, 255)), (t = bound01(t, 255)), (r = bound01(r, 255)) var o = Math.max(e, t, r), n = Math.min(e, t, r), a = 0, l = 0, s = (o + n) / 2 if (o === n) (l = 0), (a = 0) else { var c = o - n switch (((l = s > 0.5 ? c / (2 - o - n) : c / (o + n)), o)) { case e: a = (t - r) / c + (t < r ? 6 : 0) break case t: a = (r - e) / c + 2 break case r: a = (e - t) / c + 4 break } a /= 6 } return { h: a, s: l, l: s } } function hue2rgb(e, t, r) { return ( r < 0 && (r += 1), r > 1 && (r -= 1), r < 1 / 6 ? e + (t - e) * (6 * r) : r < 1 / 2 ? t : r < 2 / 3 ? e + (t - e) * (2 / 3 - r) * 6 : e ) } function hslToRgb(e, t, r) { var o, n, a if ( ((e = bound01(e, 360)), (t = bound01(t, 100)), (r = bound01(r, 100)), t === 0) ) (n = r), (a = r), (o = r) else { var l = r < 0.5 ? r * (1 + t) : r + t - r * t, s = 2 * r - l ;(o = hue2rgb(s, l, e + 1 / 3)), (n = hue2rgb(s, l, e)), (a = hue2rgb(s, l, e - 1 / 3)) } return { r: o * 255, g: n * 255, b: a * 255 } } function rgbToHsv(e, t, r) { ;(e = bound01(e, 255)), (t = bound01(t, 255)), (r = bound01(r, 255)) var o = Math.max(e, t, r), n = Math.min(e, t, r), a = 0, l = o, s = o - n, c = o === 0 ? 0 : s / o if (o === n) a = 0 else { switch (o) { case e: a = (t - r) / s + (t < r ? 6 : 0) break case t: a = (r - e) / s + 2 break case r: a = (e - t) / s + 4 break } a /= 6 } return { h: a, s: c, v: l } } function hsvToRgb(e, t, r) { ;(e = bound01(e, 360) * 6), (t = bound01(t, 100)), (r = bound01(r, 100)) var o = Math.floor(e), n = e - o, a = r * (1 - t), l = r * (1 - n * t), s = r * (1 - (1 - n) * t), c = o % 6, d = [r, l, a, a, s, r][c], u = [s, r, r, l, a, a][c], m = [a, a, s, r, r, l][c] return { r: d * 255, g: u * 255, b: m * 255 } } function rgbToHex(e, t, r, o) { var n = [ pad2(Math.round(e).toString(16)), pad2(Math.round(t).toString(16)), pad2(Math.round(r).toString(16)) ] return o && n[0].startsWith(n[0].charAt(1)) && n[1].startsWith(n[1].charAt(1)) && n[2].startsWith(n[2].charAt(1)) ? n[0].charAt(0) + n[1].charAt(0) + n[2].charAt(0) : n.join('') } function rgbaToHex(e, t, r, o, n) { var a = [ pad2(Math.round(e).toString(16)), pad2(Math.round(t).toString(16)), pad2(Math.round(r).toString(16)), pad2(convertDecimalToHex(o)) ] return n && a[0].startsWith(a[0].charAt(1)) && a[1].startsWith(a[1].charAt(1)) && a[2].startsWith(a[2].charAt(1)) && a[3].startsWith(a[3].charAt(1)) ? a[0].charAt(0) + a[1].charAt(0) + a[2].charAt(0) + a[3].charAt(0) : a.join('') } function convertDecimalToHex(e) { return Math.round(parseFloat(e) * 255).toString(16) } function convertHexToDecimal(e) { return parseIntFromHex(e) / 255 } function parseIntFromHex(e) { return parseInt(e, 16) } function numberInputToObject(e) { return { r: e >> 16, g: (e & 65280) >> 8, b: e & 255 } } var names = { aliceblue: '#f0f8ff', antiquewhite: '#faebd7', aqua: '#00ffff', aquamarine: '#7fffd4', azure: '#f0ffff', beige: '#f5f5dc', bisque: '#ffe4c4', black: '#000000', blanchedalmond: '#ffebcd', blue: '#0000ff', blueviolet: '#8a2be2', brown: '#a52a2a', burlywood: '#deb887', cadetblue: '#5f9ea0', chartreuse: '#7fff00', chocolate: '#d2691e', coral: '#ff7f50', cornflowerblue: '#6495ed', cornsilk: '#fff8dc', crimson: '#dc143c', cyan: '#00ffff', darkblue: '#00008b', darkcyan: '#008b8b', darkgoldenrod: '#b8860b', darkgray: '#a9a9a9', darkgreen: '#006400', darkgrey: '#a9a9a9', darkkhaki: '#bdb76b', darkmagenta: '#8b008b', darkolivegreen: '#556b2f', darkorange: '#ff8c00', darkorchid: '#9932cc', darkred: '#8b0000', darksalmon: '#e9967a', darkseagreen: '#8fbc8f', darkslateblue: '#483d8b', darkslategray: '#2f4f4f', darkslategrey: '#2f4f4f', darkturquoise: '#00ced1', darkviolet: '#9400d3', deeppink: '#ff1493', deepskyblue: '#00bfff', dimgray: '#696969', dimgrey: '#696969', dodgerblue: '#1e90ff', firebrick: '#b22222', floralwhite: '#fffaf0', forestgreen: '#228b22', fuchsia: '#ff00ff', gainsboro: '#dcdcdc', ghostwhite: '#f8f8ff', goldenrod: '#daa520', gold: '#ffd700', gray: '#808080', green: '#008000', greenyellow: '#adff2f', grey: '#808080', honeydew: '#f0fff0', hotpink: '#ff69b4', indianred: '#cd5c5c', indigo: '#4b0082', ivory: '#fffff0', khaki: '#f0e68c', lavenderblush: '#fff0f5', lavender: '#e6e6fa', lawngreen: '#7cfc00', lemonchiffon: '#fffacd', lightblue: '#add8e6', lightcoral: '#f08080', lightcyan: '#e0ffff', lightgoldenrodyellow: '#fafad2', lightgray: '#d3d3d3', lightgreen: '#90ee90', lightgrey: '#d3d3d3', lightpink: '#ffb6c1', lightsalmon: '#ffa07a', lightseagreen: '#20b2aa', lightskyblue: '#87cefa', lightslategray: '#778899', lightslategrey: '#778899', lightsteelblue: '#b0c4de', lightyellow: '#ffffe0', lime: '#00ff00', limegreen: '#32cd32', linen: '#faf0e6', magenta: '#ff00ff', maroon: '#800000', mediumaquamarine: '#66cdaa', mediumblue: '#0000cd', mediumorchid: '#ba55d3', mediumpurple: '#9370db', mediumseagreen: '#3cb371', mediumslateblue: '#7b68ee', mediumspringgreen: '#00fa9a', mediumturquoise: '#48d1cc', mediumvioletred: '#c71585', midnightblue: '#191970', mintcream: '#f5fffa', mistyrose: '#ffe4e1', moccasin: '#ffe4b5', navajowhite: '#ffdead', navy: '#000080', oldlace: '#fdf5e6', olive: '#808000', olivedrab: '#6b8e23', orange: '#ffa500', orangered: '#ff4500', orchid: '#da70d6', palegoldenrod: '#eee8aa', palegreen: '#98fb98', paleturquoise: '#afeeee', palevioletred: '#db7093', papayawhip: '#ffefd5', peachpuff: '#ffdab9', peru: '#cd853f', pink: '#ffc0cb', plum: '#dda0dd', powderblue: '#b0e0e6', purple: '#800080', rebeccapurple: '#663399', red: '#ff0000', rosybrown: '#bc8f8f', royalblue: '#4169e1', saddlebrown: '#8b4513', salmon: '#fa8072', sandybrown: '#f4a460', seagreen: '#2e8b57', seashell: '#fff5ee', sienna: '#a0522d', silver: '#c0c0c0', skyblue: '#87ceeb', slateblue: '#6a5acd', slategray: '#708090', slategrey: '#708090', snow: '#fffafa', springgreen: '#00ff7f', steelblue: '#4682b4', tan: '#d2b48c', teal: '#008080', thistle: '#d8bfd8', tomato: '#ff6347', turquoise: '#40e0d0', violet: '#ee82ee', wheat: '#f5deb3', white: '#ffffff', whitesmoke: '#f5f5f5', yellow: '#ffff00', yellowgreen: '#9acd32' } function inputToRGB(e) { var t = { r: 0, g: 0, b: 0 }, r = 1, o = null, n = null, a = null, l = !1, s = !1 return ( typeof e == 'string' && (e = stringInputToObject(e)), typeof e == 'object' && (isValidCSSUnit(e.r) && isValidCSSUnit(e.g) && isValidCSSUnit(e.b) ? ((t = rgbToRgb(e.r, e.g, e.b)), (l = !0), (s = String(e.r).substr(-1) === '%' ? 'prgb' : 'rgb')) : isValidCSSUnit(e.h) && isValidCSSUnit(e.s) && isValidCSSUnit(e.v) ? ((o = convertToPercentage(e.s)), (n = convertToPercentage(e.v)), (t = hsvToRgb(e.h, o, n)), (l = !0), (s = 'hsv')) : isValidCSSUnit(e.h) && isValidCSSUnit(e.s) && isValidCSSUnit(e.l) && ((o = convertToPercentage(e.s)), (a = convertToPercentage(e.l)), (t = hslToRgb(e.h, o, a)), (l = !0), (s = 'hsl')), Object.prototype.hasOwnProperty.call(e, 'a') && (r = e.a)), (r = boundAlpha(r)), { ok: l, format: e.format || s, r: Math.min(255, Math.max(t.r, 0)), g: Math.min(255, Math.max(t.g, 0)), b: Math.min(255, Math.max(t.b, 0)), a: r } ) } var CSS_INTEGER = '[-\\+]?\\d+%?', CSS_NUMBER = '[-\\+]?\\d*\\.\\d+%?', CSS_UNIT = '(?:'.concat(CSS_NUMBER, ')|(?:').concat(CSS_INTEGER, ')'), PERMISSIVE_MATCH3 = '[\\s|\\(]+(' .concat(CSS_UNIT, ')[,|\\s]+(') .concat(CSS_UNIT, ')[,|\\s]+(') .concat(CSS_UNIT, ')\\s*\\)?'), PERMISSIVE_MATCH4 = '[\\s|\\(]+(' .concat(CSS_UNIT, ')[,|\\s]+(') .concat(CSS_UNIT, ')[,|\\s]+(') .concat(CSS_UNIT, ')[,|\\s]+(') .concat(CSS_UNIT, ')\\s*\\)?'), matchers = { CSS_UNIT: new RegExp(CSS_UNIT), rgb: new RegExp('rgb' + PERMISSIVE_MATCH3), rgba: new RegExp('rgba' + PERMISSIVE_MATCH4), hsl: new RegExp('hsl' + PERMISSIVE_MATCH3), hsla: new RegExp('hsla' + PERMISSIVE_MATCH4), hsv: new RegExp('hsv' + PERMISSIVE_MATCH3), hsva: new RegExp('hsva' + PERMISSIVE_MATCH4), hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/, hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/, hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/ } function stringInputToObject(e) { if (((e = e.trim().toLowerCase()), e.length === 0)) return !1 var t = !1 if (names[e]) (e = names[e]), (t = !0) else if (e === 'transparent') return { r: 0, g: 0, b: 0, a: 0, format: 'name' } var r = matchers.rgb.exec(e) return r ? { r: r[1], g: r[2], b: r[3] } : ((r = matchers.rgba.exec(e)), r ? { r: r[1], g: r[2], b: r[3], a: r[4] } : ((r = matchers.hsl.exec(e)), r ? { h: r[1], s: r[2], l: r[3] } : ((r = matchers.hsla.exec(e)), r ? { h: r[1], s: r[2], l: r[3], a: r[4] } : ((r = matchers.hsv.exec(e)), r ? { h: r[1], s: r[2], v: r[3] } : ((r = matchers.hsva.exec(e)), r ? { h: r[1], s: r[2], v: r[3], a: r[4] } : ((r = matchers.hex8.exec(e)), r ? { r: parseIntFromHex(r[1]), g: parseIntFromHex(r[2]), b: parseIntFromHex(r[3]), a: convertHexToDecimal(r[4]), format: t ? 'name' : 'hex8' } : ((r = matchers.hex6.exec(e)), r ? { r: parseIntFromHex(r[1]), g: parseIntFromHex(r[2]), b: parseIntFromHex(r[3]), format: t ? 'name' : 'hex' } : ((r = matchers.hex4.exec(e)), r ? { r: parseIntFromHex(r[1] + r[1]), g: parseIntFromHex(r[2] + r[2]), b: parseIntFromHex(r[3] + r[3]), a: convertHexToDecimal(r[4] + r[4]), format: t ? 'name' : 'hex8' } : ((r = matchers.hex3.exec(e)), r ? { r: parseIntFromHex(r[1] + r[1]), g: parseIntFromHex(r[2] + r[2]), b: parseIntFromHex(r[3] + r[3]), format: t ? 'name' : 'hex' } : !1))))))))) } function isValidCSSUnit(e) { return Boolean(matchers.CSS_UNIT.exec(String(e))) } var TinyColor = (function () { function e(t, r) { t === void 0 && (t = ''), r === void 0 && (r = {}) var o if (t instanceof e) return t typeof t == 'number' && (t = numberInputToObject(t)), (this.originalInput = t) var n = inputToRGB(t) ;(this.originalInput = t), (this.r = n.r), (this.g = n.g), (this.b = n.b), (this.a = n.a), (this.roundA = Math.round(100 * this.a) / 100), (this.format = (o = r.format) !== null && o !== void 0 ? o : n.format), (this.gradientType = r.gradientType), this.r < 1 && (this.r = Math.round(this.r)), this.g < 1 && (this.g = Math.round(this.g)), this.b < 1 && (this.b = Math.round(this.b)), (this.isValid = n.ok) } return ( (e.prototype.isDark = function () { return this.getBrightness() < 128 }), (e.prototype.isLight = function () { return !this.isDark() }), (e.prototype.getBrightness = function () { var t = this.toRgb() return (t.r * 299 + t.g * 587 + t.b * 114) / 1e3 }), (e.prototype.getLuminance = function () { var t = this.toRgb(), r, o, n, a = t.r / 255, l = t.g / 255, s = t.b / 255 return ( a <= 0.03928 ? (r = a / 12.92) : (r = Math.pow((a + 0.055) / 1.055, 2.4)), l <= 0.03928 ? (o = l / 12.92) : (o = Math.pow((l + 0.055) / 1.055, 2.4)), s <= 0.03928 ? (n = s / 12.92) : (n = Math.pow((s + 0.055) / 1.055, 2.4)), 0.2126 * r + 0.7152 * o + 0.0722 * n ) }), (e.prototype.getAlpha = function () { return this.a }), (e.prototype.setAlpha = function (t) { return ( (this.a = boundAlpha(t)), (this.roundA = Math.round(100 * this.a) / 100), this ) }), (e.prototype.toHsv = function () { var t = rgbToHsv(this.r, this.g, this.b) return { h: t.h * 360, s: t.s, v: t.v, a: this.a } }), (e.prototype.toHsvString = function () { var t = rgbToHsv(this.r, this.g, this.b), r = Math.round(t.h * 360), o = Math.round(t.s * 100), n = Math.round(t.v * 100) return this.a === 1 ? 'hsv('.concat(r, ', ').concat(o, '%, ').concat(n, '%)') : 'hsva(' .concat(r, ', ') .concat(o, '%, ') .concat(n, '%, ') .concat(this.roundA, ')') }), (e.prototype.toHsl = function () { var t = rgbToHsl(this.r, this.g, this.b) return { h: t.h * 360, s: t.s, l: t.l, a: this.a } }), (e.prototype.toHslString = function () { var t = rgbToHsl(this.r, this.g, this.b), r = Math.round(t.h * 360), o = Math.round(t.s * 100), n = Math.round(t.l * 100) return this.a === 1 ? 'hsl('.concat(r, ', ').concat(o, '%, ').concat(n, '%)') : 'hsla(' .concat(r, ', ') .concat(o, '%, ') .concat(n, '%, ') .concat(this.roundA, ')') }), (e.prototype.toHex = function (t) { return t === void 0 && (t = !1), rgbToHex(this.r, this.g, this.b, t) }), (e.prototype.toHexString = function (t) { return t === void 0 && (t = !1), '#' + this.toHex(t) }), (e.prototype.toHex8 = function (t) { return ( t === void 0 && (t = !1), rgbaToHex(this.r, this.g, this.b, this.a, t) ) }), (e.prototype.toHex8String = function (t) { return t === void 0 && (t = !1), '#' + this.toHex8(t) }), (e.prototype.toRgb = function () { return { r: Math.round(this.r), g: Math.round(this.g), b: Math.round(this.b), a: this.a } }), (e.prototype.toRgbString = function () { var t = Math.round(this.r), r = Math.round(this.g), o = Math.round(this.b) return this.a === 1 ? 'rgb('.concat(t, ', ').concat(r, ', ').concat(o, ')') : 'rgba(' .concat(t, ', ') .concat(r, ', ') .concat(o, ', ') .concat(this.roundA, ')') }), (e.prototype.toPercentageRgb = function () { var t = function (r) { return ''.concat(Math.round(bound01(r, 255) * 100), '%') } return { r: t(this.r), g: t(this.g), b: t(this.b), a: this.a } }), (e.prototype.toPercentageRgbString = function () { var t = function (r) { return Math.round(bound01(r, 255) * 100) } return this.a === 1 ? 'rgb(' .concat(t(this.r), '%, ') .concat(t(this.g), '%, ') .concat(t(this.b), '%)') : 'rgba(' .concat(t(this.r), '%, ') .concat(t(this.g), '%, ') .concat(t(this.b), '%, ') .concat(this.roundA, ')') }), (e.prototype.toName = function () { if (this.a === 0) return 'transparent' if (this.a < 1) return !1 for ( var t = '#' + rgbToHex(this.r, this.g, this.b, !1), r = 0, o = Object.entries(names); r < o.length; r++ ) { var n = o[r], a = n[0], l = n[1] if (t === l) return a } return !1 }), (e.prototype.toString = function (t) { var r = Boolean(t) t = t != null ? t : this.format var o = !1, n = this.a < 1 && this.a >= 0, a = !r && n && (t.startsWith('hex') || t === 'name') return a ? t === 'name' && this.a === 0 ? this.toName() : this.toRgbString() : (t === 'rgb' && (o = this.toRgbString()), t === 'prgb' && (o = this.toPercentageRgbString()), (t === 'hex' || t === 'hex6') && (o = this.toHexString()), t === 'hex3' && (o = this.toHexString(!0)), t === 'hex4' && (o = this.toHex8String(!0)), t === 'hex8' && (o = this.toHex8String()), t === 'name' && (o = this.toName()), t === 'hsl' && (o = this.toHslString()), t === 'hsv' && (o = this.toHsvString()), o || this.toHexString()) }), (e.prototype.toNumber = function () { return ( (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b) ) }), (e.prototype.clone = function () { return new e(this.toString()) }), (e.prototype.lighten = function (t) { t === void 0 && (t = 10) var r = this.toHsl() return (r.l += t / 100), (r.l = clamp01(r.l)), new e(r) }), (e.prototype.brighten = function (t) { t === void 0 && (t = 10) var r = this.toRgb() return ( (r.r = Math.max(0, Math.min(255, r.r - Math.round(255 * -(t / 100))))), (r.g = Math.max(0, Math.min(255, r.g - Math.round(255 * -(t / 100))))), (r.b = Math.max(0, Math.min(255, r.b - Math.round(255 * -(t / 100))))), new e(r) ) }), (e.prototype.darken = function (t) { t === void 0 && (t = 10) var r = this.toHsl() return (r.l -= t / 100), (r.l = clamp01(r.l)), new e(r) }), (e.prototype.tint = function (t) { return t === void 0 && (t = 10), this.mix('white', t) }), (e.prototype.shade = function (t) { return t === void 0 && (t = 10), this.mix('black', t) }), (e.prototype.desaturate = function (t) { t === void 0 && (t = 10) var r = this.toHsl() return (r.s -= t / 100), (r.s = clamp01(r.s)), new e(r) }), (e.prototype.saturate = function (t) { t === void 0 && (t = 10) var r = this.toHsl() return (r.s += t / 100), (r.s = clamp01(r.s)), new e(r) }), (e.prototype.greyscale = function () { return this.desaturate(100) }), (e.prototype.spin = function (t) { var r = this.toHsl(), o = (r.h + t) % 360 return (r.h = o < 0 ? 360 + o : o), new e(r) }), (e.prototype.mix = function (t, r) { r === void 0 && (r = 50) var o = this.toRgb(), n = new e(t).toRgb(), a = r / 100, l = { r: (n.r - o.r) * a + o.r, g: (n.g - o.g) * a + o.g, b: (n.b - o.b) * a + o.b, a: (n.a - o.a) * a + o.a } return new e(l) }), (e.prototype.analogous = function (t, r) { t === void 0 && (t = 6), r === void 0 && (r = 30) var o = this.toHsl(), n = 360 / r, a = [this] for (o.h = (o.h - ((n * t) >> 1) + 720) % 360; --t; ) (o.h = (o.h + n) % 360), a.push(new e(o)) return a }), (e.prototype.complement = function () { var t = this.toHsl() return (t.h = (t.h + 180) % 360), new e(t) }), (e.prototype.monochromatic = function (t) { t === void 0 && (t = 6) for ( var r = this.toHsv(), o = r.h, n = r.s, a = r.v, l = [], s = 1 / t; t--; ) l.push(new e({ h: o, s: n, v: a })), (a = (a + s) % 1) return l }), (e.prototype.splitcomplement = function () { var t = this.toHsl(), r = t.h return [ this, new e({ h: (r + 72) % 360, s: t.s, l: t.l }), new e({ h: (r + 216) % 360, s: t.s, l: t.l }) ] }), (e.prototype.onBackground = function (t) { var r = this.toRgb(), o = new e(t).toRgb() return new e({ r: o.r + (r.r - o.r) * r.a, g: o.g + (r.g - o.g) * r.a, b: o.b + (r.b - o.b) * r.a }) }), (e.prototype.triad = function () { return this.polyad(3) }), (e.prototype.tetrad = function () { return this.polyad(4) }), (e.prototype.polyad = function (t) { for ( var r = this.toHsl(), o = r.h, n = [this], a = 360 / t, l = 1; l < t; l++ ) n.push(new e({ h: (o + l * a) % 360, s: r.s, l: r.l })) return n }), (e.prototype.equals = function (t) { return this.toRgbString() === new e(t).toRgbString() }), e ) })() function darken(e, t = 20) { return e.mix('#141414', t).toString() } function useButtonCustomStyle(e) { const t = useDisabled(), r = useNamespace('button') return computed(() => { let o = {} const n = e.color if (n) { const a = new TinyColor(n), l = e.dark ? a.tint(20).toString() : darken(a, 20) if (e.plain) (o = r.cssVarBlock({ 'bg-color': e.dark ? darken(a, 90) : a.tint(90).toString(), 'text-color': n, 'border-color': e.dark ? darken(a, 50) : a.tint(50).toString(), 'hover-text-color': `var(${r.cssVarName('color-white')})`, 'hover-bg-color': n, 'hover-border-color': n, 'active-bg-color': l, 'active-text-color': `var(${r.cssVarName('color-white')})`, 'active-border-color': l })), t.value && ((o[r.cssVarBlockName('disabled-bg-color')] = e.dark ? darken(a, 90) : a.tint(90).toString()), (o[r.cssVarBlockName('disabled-text-color')] = e.dark ? darken(a, 50) : a.tint(50).toString()), (o[r.cssVarBlockName('disabled-border-color')] = e.dark ? darken(a, 80) : a.tint(80).toString())) else { const s = e.dark ? darken(a, 30) : a.tint(30).toString(), c = a.isDark() ? `var(${r.cssVarName('color-white')})` : `var(${r.cssVarName('color-black')})` if ( ((o = r.cssVarBlock({ 'bg-color': n, 'text-color': c, 'border-color': n, 'hover-bg-color': s, 'hover-text-color': c, 'hover-border-color': s, 'active-bg-color': l, 'active-border-color': l })), t.value) ) { const d = e.dark ? darken(a, 50) : a.tint(50).toString() ;(o[r.cssVarBlockName('disabled-bg-color')] = d), (o[r.cssVarBlockName('disabled-text-color')] = e.dark ? 'rgba(255, 255, 255, 0.5)' : `var(${r.cssVarName('color-white')})`), (o[r.cssVarBlockName('disabled-border-color')] = d) } } } return o }) } const _hoisted_1$c = ['aria-disabled', 'disabled', 'autofocus', 'type'], __default__$c = { name: 'ElButton' }, _sfc_main$p = defineComponent( pr(ar({}, __default__$c), { props: buttonProps, emits: buttonEmits, setup(e, { expose: t, emit: r }) { const o = e, n = useSlots() useDeprecated( { from: 'type.text', replacement: 'type.link', version: '3.0.0', scope: 'props', ref: 'https://element-plus.org/en-US/component/button.html#button-attributes' }, computed(() => o.type === 'text') ) const a = inject(buttonGroupContextKey, void 0), l = useGlobalConfig('button'), s = useNamespace('button'), { form: c } = useFormItem(), d = useSize(computed(() => (a == null ? void 0 : a.size))), u = useDisabled(), m = ref(), f = computed(() => o.type || (a == null ? void 0 : a.type) || ''), _ = computed(() => { var g, x, y return (y = (x = o.autoInsertSpace) != null ? x : (g = l.value) == null ? void 0 : g.autoInsertSpace) != null ? y : !1 }), b = computed(() => { var g const x = (g = n.default) == null ? void 0 : g.call(n) if (_.value && (x == null ? void 0 : x.length) === 1) { const y = x[0] if ((y == null ? void 0 : y.type) === Text) { const w = y.children return /^\p{Unified_Ideograph}{2}$/u.test(w.trim()) } } return !1 }), v = useButtonCustomStyle(o), k = g => { o.nativeType === 'reset' && (c == null || c.resetFields()), r('click', g) } return ( t({ ref: m, size: d, type: f, disabled: u, shouldAddSpace: b }), (g, x) => ( openBlock(), createElementBlock( 'button', { ref_key: '_ref', ref: m, class: normalizeClass([ unref(s).b(), unref(s).m(unref(f)), unref(s).m(unref(d)), unref(s).is('disabled', unref(u)), unref(s).is('loading', g.loading), unref(s).is('plain', g.plain), unref(s).is('round', g.round), unref(s).is('circle', g.circle), unref(s).is('text', g.text), unref(s).is('link', g.link), unref(s).is('has-bg', g.bg) ]), 'aria-disabled': unref(u) || g.loading, disabled: unref(u) || g.loading, autofocus: g.autofocus, type: g.nativeType, style: normalizeStyle(unref(v)), onClick: k }, [ g.loading ? (openBlock(), createElementBlock( Fragment, { key: 0 }, [ g.$slots.loading ? renderSlot(g.$slots, 'loading', { key: 0 }) : (openBlock(), createBlock( unref(ElIcon), { key: 1, class: normalizeClass(unref(s).is('loading')) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent(g.loadingIcon) )) ]), _: 1 }, 8, ['class'] )) ], 64 )) : g.icon || g.$slots.icon ? (openBlock(), createBlock( unref(ElIcon), { key: 1 }, { default: withCtx(() => [ g.icon ? (openBlock(), createBlock(resolveDynamicComponent(g.icon), { key: 0 })) : renderSlot(g.$slots, 'icon', { key: 1 }) ]), _: 3 } )) : createCommentVNode('v-if', !0), g.$slots.default ? (openBlock(), createElementBlock( 'span', { key: 2, class: normalizeClass({ [unref(s).em('text', 'expand')]: unref(b) }) }, [renderSlot(g.$slots, 'default')], 2 )) : createCommentVNode('v-if', !0) ], 14, _hoisted_1$c ) ) ) } }) ) var Button = _export_sfc$1(_sfc_main$p, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/button/src/button.vue' ] ]) const buttonGroupProps = { size: buttonProps.size, type: buttonProps.type }, __default__$b = { name: 'ElButtonGroup' }, _sfc_main$o = defineComponent( pr(ar({}, __default__$b), { props: buttonGroupProps, setup(e) { const t = e provide( buttonGroupContextKey, reactive({ size: toRef(t, 'size'), type: toRef(t, 'type') }) ) const r = useNamespace('button') return (o, n) => ( openBlock(), createElementBlock( 'div', { class: normalizeClass(`${unref(r).b('group')}`) }, [renderSlot(o.$slots, 'default')], 2 ) ) } }) ) var ButtonGroup = _export_sfc$1(_sfc_main$o, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/button/src/button-group.vue' ] ]) const ElButton = withInstall(Button, { ButtonGroup }) withNoopInstall(ButtonGroup) var commonjsGlobal = typeof globalThis != 'undefined' ? globalThis : typeof window != 'undefined' ? window : typeof global != 'undefined' ? global : typeof self != 'undefined' ? self : {} function getAugmentedNamespace(e) { if (e.__esModule) return e var t = Object.defineProperty({}, '__esModule', { value: !0 }) return ( Object.keys(e).forEach(function (r) { var o = Object.getOwnPropertyDescriptor(e, r) Object.defineProperty( t, r, o.get ? o : { enumerable: !0, get: function () { return e[r] } } ) }), t ) } var dayjs_min = { exports: {} } ;(function (e, t) { ;(function (r, o) { e.exports = o() })(commonjsGlobal, function () { var r = 1e3, o = 6e4, n = 36e5, a = 'millisecond', l = 'second', s = 'minute', c = 'hour', d = 'day', u = 'week', m = 'month', f = 'quarter', _ = 'year', b = 'date', v = 'Invalid Date', k = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, g = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, x = { name: 'en', weekdays: 'Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday'.split('_'), months: 'January_February_March_April_May_June_July_August_September_October_November_December'.split( '_' ) }, y = function (ie, oe, j) { var V = String(ie) return !V || V.length >= oe ? ie : '' + Array(oe + 1 - V.length).join(j) + ie }, w = { s: y, z: function (ie) { var oe = -ie.utcOffset(), j = Math.abs(oe), V = Math.floor(j / 60), z = j % 60 return (oe <= 0 ? '+' : '-') + y(V, 2, '0') + ':' + y(z, 2, '0') }, m: function ie(oe, j) { if (oe.date() < j.date()) return -ie(j, oe) var V = 12 * (j.year() - oe.year()) + (j.month() - oe.month()), z = oe.clone().add(V, m), M = j - z < 0, L = oe.clone().add(V + (M ? -1 : 1), m) return +(-(V + (j - z) / (M ? z - L : L - z)) || 0) }, a: function (ie) { return ie < 0 ? Math.ceil(ie) || 0 : Math.floor(ie) }, p: function (ie) { return ( { M: m, y: _, w: u, d, D: b, h: c, m: s, s: l, ms: a, Q: f }[ie] || String(ie || '') .toLowerCase() .replace(/s$/, '') ) }, u: function (ie) { return ie === void 0 } }, S = 'en', T = {} T[S] = x var A = function (ie) { return ie instanceof ae }, $ = function ie(oe, j, V) { var z if (!oe) return S if (typeof oe == 'string') { var M = oe.toLowerCase() T[M] && (z = M), j && ((T[M] = j), (z = M)) var L = oe.split('-') if (!z && L.length > 1) return ie(L[0]) } else { var pe = oe.name ;(T[pe] = oe), (z = pe) } return !V && z && (S = z), z || (!V && S) }, F = function (ie, oe) { if (A(ie)) return ie.clone() var j = typeof oe == 'object' ? oe : {} return (j.date = ie), (j.args = arguments), new ae(j) }, Y = w ;(Y.l = $), (Y.i = A), (Y.w = function (ie, oe) { return F(ie, { locale: oe.$L, utc: oe.$u, x: oe.$x, $offset: oe.$offset }) }) var ae = (function () { function ie(j) { ;(this.$L = $(j.locale, null, !0)), this.parse(j) } var oe = ie.prototype return ( (oe.parse = function (j) { ;(this.$d = (function (V) { var z = V.date, M = V.utc if (z === null) return new Date(NaN) if (Y.u(z)) return new Date() if (z instanceof Date) return new Date(z) if (typeof z == 'string' && !/Z$/i.test(z)) { var L = z.match(k) if (L) { var pe = L[2] - 1 || 0, ue = (L[7] || '0').substring(0, 3) return M ? new Date( Date.UTC( L[1], pe, L[3] || 1, L[4] || 0, L[5] || 0, L[6] || 0, ue ) ) : new Date( L[1], pe, L[3] || 1, L[4] || 0, L[5] || 0, L[6] || 0, ue ) } } return new Date(z) })(j)), (this.$x = j.x || {}), this.init() }), (oe.init = function () { var j = this.$d ;(this.$y = j.getFullYear()), (this.$M = j.getMonth()), (this.$D = j.getDate()), (this.$W = j.getDay()), (this.$H = j.getHours()), (this.$m = j.getMinutes()), (this.$s = j.getSeconds()), (this.$ms = j.getMilliseconds()) }), (oe.$utils = function () { return Y }), (oe.isValid = function () { return this.$d.toString() !== v }), (oe.isSame = function (j, V) { var z = F(j) return this.startOf(V) <= z && z <= this.endOf(V) }), (oe.isAfter = function (j, V) { return F(j) < this.startOf(V) }), (oe.isBefore = function (j, V) { return this.endOf(V) < F(j) }), (oe.$g = function (j, V, z) { return Y.u(j) ? this[V] : this.set(z, j) }), (oe.unix = function () { return Math.floor(this.valueOf() / 1e3) }), (oe.valueOf = function () { return this.$d.getTime() }), (oe.startOf = function (j, V) { var z = this, M = !!Y.u(V) || V, L = Y.p(j), pe = function ($e, jt) { var or = Y.w( z.$u ? Date.UTC(z.$y, jt, $e) : new Date(z.$y, jt, $e), z ) return M ? or : or.endOf(d) }, ue = function ($e, jt) { return Y.w( z .toDate() [$e].apply( z.toDate('s'), (M ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(jt) ), z ) }, Ie = this.$W, Pt = this.$M, rr = this.$D, _e = 'set' + (this.$u ? 'UTC' : '') switch (L) { case _: return M ? pe(1, 0) : pe(31, 11) case m: return M ? pe(1, Pt) : pe(0, Pt + 1) case u: var Oe = this.$locale().weekStart || 0, xe = (Ie < Oe ? Ie + 7 : Ie) - Oe return pe(M ? rr - xe : rr + (6 - xe), Pt) case d: case b: return ue(_e + 'Hours', 0) case c: return ue(_e + 'Minutes', 1) case s: return ue(_e + 'Seconds', 2) case l: return ue(_e + 'Milliseconds', 3) default: return this.clone() } }), (oe.endOf = function (j) { return this.startOf(j, !1) }), (oe.$set = function (j, V) { var z, M = Y.p(j), L = 'set' + (this.$u ? 'UTC' : ''), pe = ((z = {}), (z[d] = L + 'Date'), (z[b] = L + 'Date'), (z[m] = L + 'Month'), (z[_] = L + 'FullYear'), (z[c] = L + 'Hours'), (z[s] = L + 'Minutes'), (z[l] = L + 'Seconds'), (z[a] = L + 'Milliseconds'), z)[M], ue = M === d ? this.$D + (V - this.$W) : V if (M === m || M === _) { var Ie = this.clone().set(b, 1) Ie.$d[pe](ue), Ie.init(), (this.$d = Ie.set(b, Math.min(this.$D, Ie.daysInMonth())).$d) } else pe && this.$d[pe](ue) return this.init(), this }), (oe.set = function (j, V) { return this.clone().$set(j, V) }), (oe.get = function (j) { return this[Y.p(j)]() }), (oe.add = function (j, V) { var z, M = this j = Number(j) var L = Y.p(V), pe = function (Pt) { var rr = F(M) return Y.w(rr.date(rr.date() + Math.round(Pt * j)), M) } if (L === m) return this.set(m, this.$M + j) if (L === _) return this.set(_, this.$y + j) if (L === d) return pe(1) if (L === u) return pe(7) var ue = ((z = {}), (z[s] = o), (z[c] = n), (z[l] = r), z)[L] || 1, Ie = this.$d.getTime() + j * ue return Y.w(Ie, this) }), (oe.subtract = function (j, V) { return this.add(-1 * j, V) }), (oe.format = function (j) { var V = this, z = this.$locale() if (!this.isValid()) return z.invalidDate || v var M = j || 'YYYY-MM-DDTHH:mm:ssZ', L = Y.z(this), pe = this.$H, ue = this.$m, Ie = this.$M, Pt = z.weekdays, rr = z.months, _e = function (jt, or, er, tr) { return (jt && (jt[or] || jt(V, M))) || er[or].slice(0, tr) }, Oe = function (jt) { return Y.s(pe % 12 || 12, jt, '0') }, xe = z.meridiem || function (jt, or, er) { var tr = jt < 12 ? 'AM' : 'PM' return er ? tr.toLowerCase() : tr }, $e = { YY: String(this.$y).slice(-2), YYYY: this.$y, M: Ie + 1, MM: Y.s(Ie + 1, 2, '0'), MMM: _e(z.monthsShort, Ie, rr, 3), MMMM: _e(rr, Ie), D: this.$D, DD: Y.s(this.$D, 2, '0'), d: String(this.$W), dd: _e(z.weekdaysMin, this.$W, Pt, 2), ddd: _e(z.weekdaysShort, this.$W, Pt, 3), dddd: Pt[this.$W], H: String(pe), HH: Y.s(pe, 2, '0'), h: Oe(1), hh: Oe(2), a: xe(pe, ue, !0), A: xe(pe, ue, !1), m: String(ue), mm: Y.s(ue, 2, '0'), s: String(this.$s), ss: Y.s(this.$s, 2, '0'), SSS: Y.s(this.$ms, 3, '0'), Z: L } return M.replace(g, function (jt, or) { return or || $e[jt] || L.replace(':', '') }) }), (oe.utcOffset = function () { return 15 * -Math.round(this.$d.getTimezoneOffset() / 15) }), (oe.diff = function (j, V, z) { var M, L = Y.p(V), pe = F(j), ue = (pe.utcOffset() - this.utcOffset()) * o, Ie = this - pe, Pt = Y.m(this, pe) return ( (Pt = ((M = {}), (M[_] = Pt / 12), (M[m] = Pt), (M[f] = Pt / 3), (M[u] = (Ie - ue) / 6048e5), (M[d] = (Ie - ue) / 864e5), (M[c] = Ie / n), (M[s] = Ie / o), (M[l] = Ie / r), M)[L] || Ie), z ? Pt : Y.a(Pt) ) }), (oe.daysInMonth = function () { return this.endOf(m).$D }), (oe.$locale = function () { return T[this.$L] }), (oe.locale = function (j, V) { if (!j) return this.$L var z = this.clone(), M = $(j, V, !0) return M && (z.$L = M), z }), (oe.clone = function () { return Y.w(this.$d, this) }), (oe.toDate = function () { return new Date(this.valueOf()) }), (oe.toJSON = function () { return this.isValid() ? this.toISOString() : null }), (oe.toISOString = function () { return this.$d.toISOString() }), (oe.toString = function () { return this.$d.toUTCString() }), ie ) })(), re = ae.prototype return ( (F.prototype = re), [ ['$ms', a], ['$s', l], ['$m', s], ['$H', c], ['$W', d], ['$M', m], ['$y', _], ['$D', b] ].forEach(function (ie) { re[ie[1]] = function (oe) { return this.$g(oe, ie[0], ie[1]) } }), (F.extend = function (ie, oe) { return ie.$i || (ie(oe, ae, F), (ie.$i = !0)), F }), (F.locale = $), (F.isDayjs = A), (F.unix = function (ie) { return F(1e3 * ie) }), (F.en = T[S]), (F.Ls = T), (F.p = {}), F ) }) })(dayjs_min) var dayjs = dayjs_min.exports const FOCUSABLE_CHILDREN = '_trap-focus-children', FOCUS_STACK = [], FOCUS_HANDLER = e => { if (FOCUS_STACK.length === 0) return const t = FOCUS_STACK[FOCUS_STACK.length - 1][FOCUSABLE_CHILDREN] if (t.length > 0 && e.code === EVENT_CODE.tab) { if (t.length === 1) { e.preventDefault(), document.activeElement !== t[0] && t[0].focus() return } const r = e.shiftKey, o = e.target === t[0], n = e.target === t[t.length - 1] o && r && (e.preventDefault(), t[t.length - 1].focus()), n && !r && (e.preventDefault(), t[0].focus()) } }, TrapFocus = { beforeMount(e) { ;(e[FOCUSABLE_CHILDREN] = obtainAllFocusableElements$1(e)), FOCUS_STACK.push(e), FOCUS_STACK.length <= 1 && on$1(document, 'keydown', FOCUS_HANDLER) }, updated(e) { nextTick(() => { e[FOCUSABLE_CHILDREN] = obtainAllFocusableElements$1(e) }) }, unmounted() { FOCUS_STACK.shift(), FOCUS_STACK.length === 0 && off(document, 'keydown', FOCUS_HANDLER) } }, colProps = buildProps({ tag: { type: String, default: 'div' }, span: { type: Number, default: 24 }, offset: { type: Number, default: 0 }, pull: { type: Number, default: 0 }, push: { type: Number, default: 0 }, xs: { type: definePropType([Number, Object]), default: () => mutable({}) }, sm: { type: definePropType([Number, Object]), default: () => mutable({}) }, md: { type: definePropType([Number, Object]), default: () => mutable({}) }, lg: { type: definePropType([Number, Object]), default: () => mutable({}) }, xl: { type: definePropType([Number, Object]), default: () => mutable({}) } }), __default__$a = { name: 'ElCol' }, _sfc_main$n = defineComponent( pr(ar({}, __default__$a), { props: colProps, setup(e) { const t = e, { gutter: r } = inject(rowContextKey, { gutter: computed(() => 0) }), o = useNamespace('col'), n = computed(() => { const l = {} return ( r.value && (l.paddingLeft = l.paddingRight = `${r.value / 2}px`), l ) }), a = computed(() => { const l = [] return ( ['span', 'offset', 'pull', 'push'].forEach(d => { const u = t[d] isNumber$1(u) && (d === 'span' ? l.push(o.b(`${t[d]}`)) : u > 0 && l.push(o.b(`${d}-${t[d]}`))) }), ['xs', 'sm', 'md', 'lg', 'xl'].forEach(d => { isNumber$1(t[d]) ? l.push(o.b(`${d}-${t[d]}`)) : isObject$2(t[d]) && Object.entries(t[d]).forEach(([u, m]) => { l.push( u !== 'span' ? o.b(`${d}-${u}-${m}`) : o.b(`${d}-${m}`) ) }) }), r.value && l.push(o.is('guttered')), l ) }) return (l, s) => ( openBlock(), createBlock( resolveDynamicComponent(l.tag), { class: normalizeClass([unref(o).b(), unref(a)]), style: normalizeStyle(unref(n)) }, { default: withCtx(() => [renderSlot(l.$slots, 'default')]), _: 3 }, 8, ['class', 'style'] ) ) } }) ) var Col = _export_sfc$1(_sfc_main$n, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/col/src/col.vue' ] ]) const ElCol = withInstall(Col), messageConfig = {}, configProviderProps = buildProps({ a11y: { type: Boolean, default: !0 }, locale: { type: definePropType(Object) }, size: useSizeProp, button: { type: definePropType(Object) }, experimentalFeatures: { type: definePropType(Object) }, keyboardNavigation: { type: Boolean, default: !0 }, message: { type: definePropType(Object) }, zIndex: Number, namespace: { type: String, default: 'el' } }), ConfigProvider = defineComponent({ name: 'ElConfigProvider', props: configProviderProps, setup(e, { slots: t }) { watch( () => e.message, o => { Object.assign(messageConfig, o != null ? o : {}) }, { immediate: !0, deep: !0 } ) const r = provideGlobalConfig(e) return () => renderSlot(t, 'default', { config: r == null ? void 0 : r.value }) } }), ElConfigProvider = withInstall(ConfigProvider), overlayProps = buildProps({ mask: { type: Boolean, default: !0 }, customMaskEvent: { type: Boolean, default: !1 }, overlayClass: { type: definePropType([String, Array, Object]) }, zIndex: { type: definePropType([String, Number]) } }), overlayEmits = { click: e => e instanceof MouseEvent } var Overlay = defineComponent({ name: 'ElOverlay', props: overlayProps, emits: overlayEmits, setup(e, { slots: t, emit: r }) { const o = useNamespace('overlay'), n = c => { r('click', c) }, { onClick: a, onMousedown: l, onMouseup: s } = useSameTarget(e.customMaskEvent ? void 0 : n) return () => e.mask ? createVNode( 'div', { class: [o.b(), e.overlayClass], style: { zIndex: e.zIndex }, onClick: a, onMousedown: l, onMouseup: s }, [renderSlot(t, 'default')], PatchFlags.STYLE | PatchFlags.CLASS | PatchFlags.PROPS, ['onClick', 'onMouseup', 'onMousedown'] ) : h( 'div', { class: e.overlayClass, style: { zIndex: e.zIndex, position: 'fixed', top: '0px', right: '0px', bottom: '0px', left: '0px' } }, [renderSlot(t, 'default')] ) } }) const ElOverlay = Overlay, dialogContentProps = buildProps({ center: { type: Boolean, default: !1 }, closeIcon: { type: iconPropType, default: '' }, customClass: { type: String, default: '' }, draggable: { type: Boolean, default: !1 }, fullscreen: { type: Boolean, default: !1 }, showClose: { type: Boolean, default: !0 }, title: { type: String, default: '' } }), dialogContentEmits = { close: () => !0 }, _hoisted_1$b = ['aria-label'], _hoisted_2$3 = ['id'], __default__$9 = { name: 'ElDialogContent' }, _sfc_main$m = defineComponent( pr(ar({}, __default__$9), { props: dialogContentProps, emits: dialogContentEmits, setup(e) { const t = e, { t: r } = useLocale(), { Close: o } = CloseComponents, { dialogRef: n, headerRef: a, bodyId: l, ns: s, style: c } = inject(dialogInjectionKey), { focusTrapRef: d } = inject(FOCUS_TRAP_INJECTION_KEY), u = composeRefs(d, n), m = computed(() => t.draggable) return ( useDraggable(n, a, m), (f, _) => ( openBlock(), createElementBlock( 'div', { ref: unref(u), class: normalizeClass([ unref(s).b(), unref(s).is('fullscreen', f.fullscreen), unref(s).is('draggable', unref(m)), { [unref(s).m('center')]: f.center }, f.customClass ]), style: normalizeStyle(unref(c)), tabindex: '-1', onClick: _[1] || (_[1] = withModifiers(() => {}, ['stop'])) }, [ createBaseVNode( 'header', { ref_key: 'headerRef', ref: a, class: normalizeClass(unref(s).e('header')) }, [ renderSlot(f.$slots, 'header', {}, () => [ createBaseVNode( 'span', { role: 'heading', class: normalizeClass(unref(s).e('title')) }, toDisplayString(f.title), 3 ) ]), f.showClose ? (openBlock(), createElementBlock( 'button', { key: 0, 'aria-label': unref(r)('el.dialog.close'), class: normalizeClass(unref(s).e('headerbtn')), type: 'button', onClick: _[0] || (_[0] = b => f.$emit('close')) }, [ createVNode( unref(ElIcon), { class: normalizeClass(unref(s).e('close')) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( f.closeIcon || unref(o) ) )) ]), _: 1 }, 8, ['class'] ) ], 10, _hoisted_1$b )) : createCommentVNode('v-if', !0) ], 2 ), createBaseVNode( 'div', { id: unref(l), class: normalizeClass(unref(s).e('body')) }, [renderSlot(f.$slots, 'default')], 10, _hoisted_2$3 ), f.$slots.footer ? (openBlock(), createElementBlock( 'footer', { key: 0, class: normalizeClass(unref(s).e('footer')) }, [renderSlot(f.$slots, 'footer')], 2 )) : createCommentVNode('v-if', !0) ], 6 ) ) ) } }) ) var ElDialogContent = _export_sfc$1(_sfc_main$m, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dialog/src/dialog-content.vue' ] ]) const dialogProps = buildProps( pr(ar({}, dialogContentProps), { appendToBody: { type: Boolean, default: !1 }, beforeClose: { type: definePropType(Function) }, destroyOnClose: { type: Boolean, default: !1 }, closeOnClickModal: { type: Boolean, default: !0 }, closeOnPressEscape: { type: Boolean, default: !0 }, lockScroll: { type: Boolean, default: !0 }, modal: { type: Boolean, default: !0 }, openDelay: { type: Number, default: 0 }, closeDelay: { type: Number, default: 0 }, top: { type: String }, modelValue: { type: Boolean, required: !0 }, modalClass: String, width: { type: [String, Number] }, zIndex: { type: Number }, trapFocus: { type: Boolean, default: !1 } }) ), dialogEmits = { open: () => !0, opened: () => !0, close: () => !0, closed: () => !0, [UPDATE_MODEL_EVENT]: e => isBoolean$1(e), openAutoFocus: () => !0, closeAutoFocus: () => !0 }, useDialog = (e, t) => { const o = getCurrentInstance().emit, { nextZIndex: n } = useZIndex() let a = '' const l = useId(), s = useId(), c = ref(!1), d = ref(!1), u = ref(!1), m = ref(e.zIndex || n()) let f, _ const b = computed(() => (isNumber$1(e.width) ? `${e.width}px` : e.width)), v = useGlobalConfig('namespace', defaultNamespace), k = computed(() => { const ie = {}, oe = `--${v.value}-dialog` return ( e.fullscreen || (e.top && (ie[`${oe}-margin-top`] = e.top), e.width && (ie[`${oe}-width`] = b.value)), ie ) }) function g() { o('opened') } function x() { o('closed'), o(UPDATE_MODEL_EVENT, !1), e.destroyOnClose && (u.value = !1) } function y() { o('close') } function w() { _ == null || _(), f == null || f(), e.openDelay && e.openDelay > 0 ? ({ stop: f } = useTimeoutFn(() => $(), e.openDelay)) : $() } function S() { f == null || f(), _ == null || _(), e.closeDelay && e.closeDelay > 0 ? ({ stop: _ } = useTimeoutFn(() => F(), e.closeDelay)) : F() } function T() { function ie(oe) { oe || ((d.value = !0), (c.value = !1)) } e.beforeClose ? e.beforeClose(ie) : S() } function A() { e.closeOnClickModal && T() } function $() { !isClient || (c.value = !0) } function F() { c.value = !1 } function Y() { o('openAutoFocus') } function ae() { o('closeAutoFocus') } e.lockScroll && useLockscreen(c) function re() { e.closeOnPressEscape && T() } return ( watch( () => e.modelValue, ie => { ie ? ((d.value = !1), w(), (u.value = !0), o('open'), (m.value = e.zIndex ? m.value++ : n()), nextTick(() => { t.value && (t.value.scrollTop = 0) })) : c.value && S() } ), watch( () => e.fullscreen, ie => { !t.value || (ie ? ((a = t.value.style.transform), (t.value.style.transform = '')) : (t.value.style.transform = a)) } ), onMounted(() => { e.modelValue && ((c.value = !0), (u.value = !0), w()) }), { afterEnter: g, afterLeave: x, beforeLeave: y, handleClose: T, onModalClick: A, close: S, doClose: F, onOpenAutoFocus: Y, onCloseAutoFocus: ae, onCloseRequested: re, titleId: l, bodyId: s, closed: d, style: k, rendered: u, visible: c, zIndex: m } ) }, _hoisted_1$a = ['aria-label', 'aria-labelledby', 'aria-describedby'], __default__$8 = { name: 'ElDialog' }, _sfc_main$l = defineComponent( pr(ar({}, __default__$8), { props: dialogProps, emits: dialogEmits, setup(e, { expose: t }) { const r = e, o = useSlots() useDeprecated( { scope: 'el-dialog', from: 'the title slot', replacement: 'the header slot', version: '3.0.0', ref: 'https://element-plus.org/en-US/component/dialog.html#slots' }, computed(() => !!o.title) ) const n = useNamespace('dialog'), a = ref(), l = ref(), s = ref(), { visible: c, titleId: d, bodyId: u, style: m, rendered: f, zIndex: _, afterEnter: b, afterLeave: v, beforeLeave: k, handleClose: g, onModalClick: x, onOpenAutoFocus: y, onCloseAutoFocus: w, onCloseRequested: S } = useDialog(r, a) provide(dialogInjectionKey, { dialogRef: a, headerRef: l, bodyId: u, ns: n, rendered: f, style: m }) const T = useSameTarget(x), A = computed(() => r.draggable && !r.fullscreen) return ( t({ visible: c, dialogContentRef: s }), ($, F) => ( openBlock(), createBlock( Teleport, { to: 'body', disabled: !$.appendToBody }, [ createVNode( Transition, { name: 'dialog-fade', onAfterEnter: unref(b), onAfterLeave: unref(v), onBeforeLeave: unref(k), persisted: '' }, { default: withCtx(() => [ withDirectives( createVNode( unref(ElOverlay), { 'custom-mask-event': '', mask: $.modal, 'overlay-class': $.modalClass, 'z-index': unref(_) }, { default: withCtx(() => [ createBaseVNode( 'div', { role: 'dialog', 'aria-modal': 'true', 'aria-label': $.title || void 0, 'aria-labelledby': $.title ? void 0 : unref(d), 'aria-describedby': unref(u), class: normalizeClass( `${unref(n).namespace.value}-overlay-dialog` ), onClick: F[0] || (F[0] = (...Y) => unref(T).onClick && unref(T).onClick(...Y)), onMousedown: F[1] || (F[1] = (...Y) => unref(T).onMousedown && unref(T).onMousedown(...Y)), onMouseup: F[2] || (F[2] = (...Y) => unref(T).onMouseup && unref(T).onMouseup(...Y)) }, [ createVNode( unref(ElFocusTrap), { loop: '', trapped: unref(c), 'focus-start-el': 'container', onFocusAfterTrapped: unref(y), onFocusAfterReleased: unref(w), onReleaseRequested: unref(S) }, { default: withCtx(() => [ unref(f) ? (openBlock(), createBlock( ElDialogContent, { key: 0, ref_key: 'dialogContentRef', ref: s, 'custom-class': $.customClass, center: $.center, 'close-icon': $.closeIcon, draggable: unref(A), fullscreen: $.fullscreen, 'show-close': $.showClose, style: normalizeStyle(unref(m)), title: $.title, onClose: unref(g) }, createSlots( { header: withCtx(() => [ $.$slots.title ? renderSlot( $.$slots, 'title', { key: 1 } ) : renderSlot( $.$slots, 'header', { key: 0, close: unref(g), titleId: unref(d), titleClass: unref(n).e( 'title' ) } ) ]), default: withCtx(() => [ renderSlot( $.$slots, 'default' ) ]), _: 2 }, [ $.$slots.footer ? { name: 'footer', fn: withCtx(() => [ renderSlot( $.$slots, 'footer' ) ]) } : void 0 ] ), 1032, [ 'custom-class', 'center', 'close-icon', 'draggable', 'fullscreen', 'show-close', 'style', 'title', 'onClose' ] )) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, [ 'trapped', 'onFocusAfterTrapped', 'onFocusAfterReleased', 'onReleaseRequested' ] ) ], 42, _hoisted_1$a ) ]), _: 3 }, 8, ['mask', 'overlay-class', 'z-index'] ), [[vShow, unref(c)]] ) ]), _: 3 }, 8, ['onAfterEnter', 'onAfterLeave', 'onBeforeLeave'] ) ], 8, ['disabled'] ) ) ) } }) ) var Dialog = _export_sfc$1(_sfc_main$l, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dialog/src/dialog.vue' ] ]) const ElDialog = withInstall(Dialog), _sfc_main$k = { inheritAttrs: !1 } function _sfc_render$c(e, t, r, o, n, a) { return renderSlot(e.$slots, 'default') } var Collection = _export_sfc$1(_sfc_main$k, [ ['render', _sfc_render$c], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/collection/src/collection.vue' ] ]) const _sfc_main$j = { name: 'ElCollectionItem', inheritAttrs: !1 } function _sfc_render$b(e, t, r, o, n, a) { return renderSlot(e.$slots, 'default') } var CollectionItem = _export_sfc$1(_sfc_main$j, [ ['render', _sfc_render$b], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/collection/src/collection-item.vue' ] ]) const COLLECTION_ITEM_SIGN = 'data-el-collection-item', createCollectionWithScope = e => { const t = `El${e}Collection`, r = `${t}Item`, o = Symbol(t), n = Symbol(r), a = pr(ar({}, Collection), { name: t, setup() { const s = ref(null), c = new Map() provide(o, { itemMap: c, getItems: () => { const u = unref(s) if (!u) return [] const m = Array.from( u.querySelectorAll(`[${COLLECTION_ITEM_SIGN}]`) ) return [...c.values()].sort( (_, b) => m.indexOf(_.ref) - m.indexOf(b.ref) ) }, collectionRef: s }) } }), l = pr(ar({}, CollectionItem), { name: r, setup(s, { attrs: c }) { const d = ref(null), u = inject(o, void 0) provide(n, { collectionItemRef: d }), onMounted(() => { const m = unref(d) m && u.itemMap.set(m, ar({ ref: m }, c)) }), onBeforeUnmount(() => { const m = unref(d) u.itemMap.delete(m) }) } }) return { COLLECTION_INJECTION_KEY: o, COLLECTION_ITEM_INJECTION_KEY: n, ElCollection: a, ElCollectionItem: l } }, rovingFocusGroupProps = buildProps({ style: { type: definePropType([String, Array, Object]) }, currentTabId: { type: definePropType(String) }, defaultCurrentTabId: String, loop: Boolean, dir: { type: String, values: ['ltr', 'rtl'], default: 'ltr' }, orientation: { type: definePropType(String) }, onBlur: Function, onFocus: Function, onMousedown: Function }), { ElCollection: ElCollection$1, ElCollectionItem: ElCollectionItem$1, COLLECTION_INJECTION_KEY: COLLECTION_INJECTION_KEY$1, COLLECTION_ITEM_INJECTION_KEY: COLLECTION_ITEM_INJECTION_KEY$1 } = createCollectionWithScope('RovingFocusGroup'), ROVING_FOCUS_GROUP_INJECTION_KEY = Symbol('elRovingFocusGroup'), ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY = Symbol('elRovingFocusGroupItem'), MAP_KEY_TO_FOCUS_INTENT = { ArrowLeft: 'prev', ArrowUp: 'prev', ArrowRight: 'next', ArrowDown: 'next', PageUp: 'first', Home: 'first', PageDown: 'last', End: 'last' }, getDirectionAwareKey = (e, t) => { if (t !== 'rtl') return e switch (e) { case EVENT_CODE.right: return EVENT_CODE.left case EVENT_CODE.left: return EVENT_CODE.right default: return e } }, getFocusIntent = (e, t, r) => { const o = getDirectionAwareKey(e.key, r) if ( !(t === 'vertical' && [EVENT_CODE.left, EVENT_CODE.right].includes(o)) && !(t === 'horizontal' && [EVENT_CODE.up, EVENT_CODE.down].includes(o)) ) return MAP_KEY_TO_FOCUS_INTENT[o] }, reorderArray = (e, t) => e.map((r, o) => e[(o + t) % e.length]), focusFirst = e => { const { activeElement: t } = document for (const r of e) if (r === t || (r.focus(), t !== document.activeElement)) return }, CURRENT_TAB_ID_CHANGE_EVT = 'currentTabIdChange', ENTRY_FOCUS_EVT = 'rovingFocusGroup.entryFocus', EVT_OPTS = { bubbles: !1, cancelable: !0 }, _sfc_main$i = defineComponent({ name: 'ElRovingFocusGroupImpl', inheritAttrs: !1, props: rovingFocusGroupProps, emits: [CURRENT_TAB_ID_CHANGE_EVT, 'entryFocus'], setup(e, { emit: t }) { var r const o = ref( (r = e.currentTabId || e.defaultCurrentTabId) != null ? r : null ), n = ref(!1), a = ref(!1), l = ref(null), { getItems: s } = inject(COLLECTION_INJECTION_KEY$1, void 0), c = computed(() => [{ outline: 'none' }, e.style]), d = v => { t(CURRENT_TAB_ID_CHANGE_EVT, v) }, u = () => { n.value = !0 }, m = composeEventHandlers( v => { var k ;(k = e.onMousedown) == null || k.call(e, v) }, () => { a.value = !0 } ), f = composeEventHandlers( v => { var k ;(k = e.onFocus) == null || k.call(e, v) }, v => { const k = !unref(a), { target: g, currentTarget: x } = v if (g === x && k && !unref(n)) { const y = new Event(ENTRY_FOCUS_EVT, EVT_OPTS) if ((x == null || x.dispatchEvent(y), !y.defaultPrevented)) { const w = s().filter(F => F.focusable), S = w.find(F => F.active), T = w.find(F => F.id === unref(o)), $ = [S, T, ...w].filter(Boolean).map(F => F.ref) focusFirst($) } } a.value = !1 } ), _ = composeEventHandlers( v => { var k ;(k = e.onBlur) == null || k.call(e, v) }, () => { n.value = !1 } ), b = (...v) => { t('entryFocus', ...v) } provide(ROVING_FOCUS_GROUP_INJECTION_KEY, { currentTabbedId: readonly(o), loop: toRef(e, 'loop'), tabIndex: computed(() => (unref(n) ? -1 : 0)), rovingFocusGroupRef: l, rovingFocusGroupRootStyle: c, orientation: toRef(e, 'orientation'), dir: toRef(e, 'dir'), onItemFocus: d, onItemShiftTab: u, onBlur: _, onFocus: f, onMousedown: m }), watch( () => e.currentTabId, v => { o.value = v != null ? v : null } ), onMounted(() => { const v = unref(l) on$1(v, ENTRY_FOCUS_EVT, b) }), onBeforeUnmount(() => { const v = unref(l) off(v, ENTRY_FOCUS_EVT, b) }) } }) function _sfc_render$a(e, t, r, o, n, a) { return renderSlot(e.$slots, 'default') } var ElRovingFocusGroupImpl = _export_sfc$1(_sfc_main$i, [ ['render', _sfc_render$a], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/roving-focus-group/src/roving-focus-group-impl.vue' ] ]) const _sfc_main$h = defineComponent({ name: 'ElRovingFocusGroup', components: { ElFocusGroupCollection: ElCollection$1, ElRovingFocusGroupImpl } }) function _sfc_render$9(e, t, r, o, n, a) { const l = resolveComponent('el-roving-focus-group-impl'), s = resolveComponent('el-focus-group-collection') return ( openBlock(), createBlock(s, null, { default: withCtx(() => [ createVNode( l, normalizeProps(guardReactiveProps(e.$attrs)), { default: withCtx(() => [renderSlot(e.$slots, 'default')]), _: 3 }, 16 ) ]), _: 3 }) ) } var ElRovingFocusGroup = _export_sfc$1(_sfc_main$h, [ ['render', _sfc_render$9], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/roving-focus-group/src/roving-focus-group.vue' ] ]) const _sfc_main$g = defineComponent({ components: { ElRovingFocusCollectionItem: ElCollectionItem$1 }, props: { focusable: { type: Boolean, default: !0 }, active: { type: Boolean, default: !1 } }, emits: ['mousedown', 'focus', 'keydown'], setup(e, { emit: t }) { const { currentTabbedId: r, loop: o, onItemFocus: n, onItemShiftTab: a } = inject(ROVING_FOCUS_GROUP_INJECTION_KEY, void 0), { getItems: l } = inject(COLLECTION_INJECTION_KEY$1, void 0), s = useId(), c = ref(null), d = composeEventHandlers( _ => { t('mousedown', _) }, _ => { e.focusable ? n(unref(s)) : _.preventDefault() } ), u = composeEventHandlers( _ => { t('focus', _) }, () => { n(unref(s)) } ), m = composeEventHandlers( _ => { t('keydown', _) }, _ => { const { key: b, shiftKey: v, target: k, currentTarget: g } = _ if (b === EVENT_CODE.tab && v) { a() return } if (k !== g) return const x = getFocusIntent(_) if (x) { _.preventDefault() let w = l() .filter(S => S.focusable) .map(S => S.ref) switch (x) { case 'last': { w.reverse() break } case 'prev': case 'next': { x === 'prev' && w.reverse() const S = w.indexOf(g) w = o.value ? reorderArray(w, S + 1) : w.slice(S + 1) break } } nextTick(() => { focusFirst(w) }) } } ), f = computed(() => r.value === unref(s)) return ( provide(ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY, { rovingFocusGroupItemRef: c, tabIndex: computed(() => (unref(f) ? 0 : -1)), handleMousedown: d, handleFocus: u, handleKeydown: m }), { id: s, handleKeydown: m, handleFocus: u, handleMousedown: d } ) } }) function _sfc_render$8(e, t, r, o, n, a) { const l = resolveComponent('el-roving-focus-collection-item') return ( openBlock(), createBlock( l, { id: e.id, focusable: e.focusable, active: e.active }, { default: withCtx(() => [renderSlot(e.$slots, 'default')]), _: 3 }, 8, ['id', 'focusable', 'active'] ) ) } var ElRovingFocusItem = _export_sfc$1(_sfc_main$g, [ ['render', _sfc_render$8], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/roving-focus-group/src/roving-focus-item.vue' ] ]) const dropdownProps = buildProps({ trigger: useTooltipTriggerProps.trigger, effect: pr(ar({}, useTooltipContentProps.effect), { default: 'light' }), type: { type: definePropType(String) }, placement: { type: definePropType(String), default: 'bottom' }, popperOptions: { type: definePropType(Object), default: () => ({}) }, id: String, size: { type: String, default: '' }, splitButton: Boolean, hideOnClick: { type: Boolean, default: !0 }, loop: { type: Boolean, default: !0 }, showTimeout: { type: Number, default: 150 }, hideTimeout: { type: Number, default: 150 }, tabindex: { type: definePropType([Number, String]), default: 0 }, maxHeight: { type: definePropType([Number, String]), default: '' }, popperClass: { type: String, default: '' }, disabled: { type: Boolean, default: !1 }, role: { type: String, default: 'menu' }, buttonProps: { type: definePropType(Object) } }), dropdownItemProps = buildProps({ command: { type: [Object, String, Number], default: () => ({}) }, disabled: Boolean, divided: Boolean, textValue: String, icon: { type: iconPropType } }), dropdownMenuProps = buildProps({ onKeydown: { type: definePropType(Function) } }), FIRST_KEYS = [EVENT_CODE.down, EVENT_CODE.pageDown, EVENT_CODE.home], LAST_KEYS = [EVENT_CODE.up, EVENT_CODE.pageUp, EVENT_CODE.end], FIRST_LAST_KEYS = [...FIRST_KEYS, ...LAST_KEYS], { ElCollection, ElCollectionItem, COLLECTION_INJECTION_KEY, COLLECTION_ITEM_INJECTION_KEY } = createCollectionWithScope('Dropdown'), DROPDOWN_INJECTION_KEY = Symbol('elDropdown'), { ButtonGroup: ElButtonGroup } = ElButton, _sfc_main$f = defineComponent({ name: 'ElDropdown', components: { ElButton, ElButtonGroup, ElScrollbar, ElDropdownCollection: ElCollection, ElTooltip, ElRovingFocusGroup, ElOnlyChild: OnlyChild, ElIcon, ArrowDown: arrow_down_default }, props: dropdownProps, emits: ['visible-change', 'click', 'command'], setup(e, { emit: t }) { const r = getCurrentInstance(), o = useNamespace('dropdown'), { t: n } = useLocale(), a = ref(), l = ref(), s = ref(null), c = ref(null), d = ref(null), u = ref(null), m = ref(!1), f = [EVENT_CODE.enter, EVENT_CODE.space, EVENT_CODE.down], _ = computed(() => ({ maxHeight: addUnit(e.maxHeight) })), b = computed(() => [o.m(w.value)]), v = useId().value, k = computed(() => e.id || v) function g() { x() } function x() { var oe ;(oe = s.value) == null || oe.onClose() } function y() { var oe ;(oe = s.value) == null || oe.onOpen() } const w = useSize() function S(...oe) { t('command', ...oe) } function T() {} function A() { const oe = unref(c) oe == null || oe.focus(), (u.value = null) } function $(oe) { u.value = oe } function F(oe) { m.value || (oe.preventDefault(), oe.stopImmediatePropagation()) } function Y(oe) { ;(oe == null ? void 0 : oe.type) === 'keydown' && c.value.focus(), t('visible-change', !0) } function ae() { t('visible-change', !1) } return ( provide(DROPDOWN_INJECTION_KEY, { contentRef: c, role: computed(() => e.role), triggerId: k, isUsingKeyboard: m, onItemEnter: T, onItemLeave: A }), provide('elDropdown', { instance: r, dropdownSize: w, handleClick: g, commandHandler: S, trigger: toRef(e, 'trigger'), hideOnClick: toRef(e, 'hideOnClick') }), { t: n, ns: o, scrollbar: d, wrapStyle: _, dropdownTriggerKls: b, dropdownSize: w, triggerId: k, triggerKeys: f, currentTabId: u, handleCurrentTabIdChange: $, handlerMainButtonClick: oe => { t('click', oe) }, handleEntryFocus: F, handleClose: x, handleOpen: y, handleShowTooltip: Y, handleHideTooltip: ae, onFocusAfterTrapped: oe => { var j, V oe.preventDefault(), (V = (j = c.value) == null ? void 0 : j.focus) == null || V.call(j, { preventScroll: !0 }) }, popperRef: s, contentRef: c, triggeringElementRef: a, referenceElementRef: l } ) } }) function _sfc_render$7(e, t, r, o, n, a) { var l const s = resolveComponent('el-dropdown-collection'), c = resolveComponent('el-roving-focus-group'), d = resolveComponent('el-scrollbar'), u = resolveComponent('el-only-child'), m = resolveComponent('el-tooltip'), f = resolveComponent('el-button'), _ = resolveComponent('arrow-down'), b = resolveComponent('el-icon'), v = resolveComponent('el-button-group') return ( openBlock(), createElementBlock( 'div', { class: normalizeClass([e.ns.b(), e.ns.is('disabled', e.disabled)]) }, [ createVNode( m, { ref: 'popperRef', role: e.role, effect: e.effect, 'fallback-placements': ['bottom', 'top'], 'popper-options': e.popperOptions, 'gpu-acceleration': !1, 'hide-after': e.trigger === 'hover' ? e.hideTimeout : 0, 'manual-mode': !0, placement: e.placement, 'popper-class': [e.ns.e('popper'), e.popperClass], 'reference-element': (l = e.referenceElementRef) == null ? void 0 : l.$el, trigger: e.trigger, 'trigger-keys': e.triggerKeys, 'trigger-target-el': e.contentRef, 'show-after': e.trigger === 'hover' ? e.showTimeout : 0, 'stop-popper-mouse-event': !1, 'virtual-ref': e.triggeringElementRef, 'virtual-triggering': e.splitButton, disabled: e.disabled, transition: `${e.ns.namespace.value}-zoom-in-top`, teleported: '', pure: '', persistent: '', onShow: e.handleShowTooltip, onHide: e.handleHideTooltip }, createSlots( { content: withCtx(() => [ createVNode( d, { ref: 'scrollbar', 'wrap-style': e.wrapStyle, tag: 'div', 'view-class': e.ns.e('list') }, { default: withCtx(() => [ createVNode( c, { loop: e.loop, 'current-tab-id': e.currentTabId, orientation: 'horizontal', onCurrentTabIdChange: e.handleCurrentTabIdChange, onEntryFocus: e.handleEntryFocus }, { default: withCtx(() => [ createVNode(s, null, { default: withCtx(() => [ renderSlot(e.$slots, 'dropdown') ]), _: 3 }) ]), _: 3 }, 8, [ 'loop', 'current-tab-id', 'onCurrentTabIdChange', 'onEntryFocus' ] ) ]), _: 3 }, 8, ['wrap-style', 'view-class'] ) ]), _: 2 }, [ e.splitButton ? void 0 : { name: 'default', fn: withCtx(() => [ createVNode( u, { id: e.triggerId, role: 'button', tabindex: e.tabindex }, { default: withCtx(() => [ renderSlot(e.$slots, 'default') ]), _: 3 }, 8, ['id', 'tabindex'] ) ]) } ] ), 1032, [ 'role', 'effect', 'popper-options', 'hide-after', 'placement', 'popper-class', 'reference-element', 'trigger', 'trigger-keys', 'trigger-target-el', 'show-after', 'virtual-ref', 'virtual-triggering', 'disabled', 'transition', 'onShow', 'onHide' ] ), e.splitButton ? (openBlock(), createBlock( v, { key: 0 }, { default: withCtx(() => [ createVNode( f, mergeProps({ ref: 'referenceElementRef' }, e.buttonProps, { size: e.dropdownSize, type: e.type, disabled: e.disabled, tabindex: e.tabindex, onClick: e.handlerMainButtonClick }), { default: withCtx(() => [renderSlot(e.$slots, 'default')]), _: 3 }, 16, ['size', 'type', 'disabled', 'tabindex', 'onClick'] ), createVNode( f, mergeProps( { id: e.triggerId, ref: 'triggeringElementRef' }, e.buttonProps, { role: 'button', size: e.dropdownSize, type: e.type, class: e.ns.e('caret-button'), disabled: e.disabled, tabindex: e.tabindex, 'aria-label': e.t('el.dropdown.toggleDropdown') } ), { default: withCtx(() => [ createVNode( b, { class: normalizeClass(e.ns.e('icon')) }, { default: withCtx(() => [createVNode(_)]), _: 1 }, 8, ['class'] ) ]), _: 1 }, 16, [ 'id', 'size', 'type', 'class', 'disabled', 'tabindex', 'aria-label' ] ) ]), _: 3 } )) : createCommentVNode('v-if', !0) ], 2 ) ) } var Dropdown = _export_sfc$1(_sfc_main$f, [ ['render', _sfc_render$7], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dropdown/src/dropdown.vue' ] ]) const _sfc_main$e = defineComponent({ name: 'DropdownItemImpl', components: { ElIcon }, props: dropdownItemProps, emits: ['pointermove', 'pointerleave', 'click', 'clickimpl'], setup(e, { emit: t }) { const r = useNamespace('dropdown'), { role: o } = inject(DROPDOWN_INJECTION_KEY, void 0), { collectionItemRef: n } = inject( COLLECTION_ITEM_INJECTION_KEY, void 0 ), { collectionItemRef: a } = inject( COLLECTION_ITEM_INJECTION_KEY$1, void 0 ), { rovingFocusGroupItemRef: l, tabIndex: s, handleFocus: c, handleKeydown: d, handleMousedown: u } = inject(ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY, void 0), m = composeRefs(n, a, l), f = computed(() => o.value === 'menu' ? 'menuitem' : o.value === 'navigation' ? 'link' : 'button' ), _ = composeEventHandlers(b => { const { code: v } = b if (v === EVENT_CODE.enter || v === EVENT_CODE.space) return ( b.preventDefault(), b.stopImmediatePropagation(), t('clickimpl', b), !0 ) }, d) return { ns: r, itemRef: m, dataset: { [COLLECTION_ITEM_SIGN]: '' }, role: f, tabIndex: s, handleFocus: c, handleKeydown: _, handleMousedown: u } } }), _hoisted_1$9 = ['aria-disabled', 'tabindex', 'role'] function _sfc_render$6(e, t, r, o, n, a) { const l = resolveComponent('el-icon') return ( openBlock(), createElementBlock( Fragment, null, [ e.divided ? (openBlock(), createElementBlock( 'li', mergeProps( { key: 0, role: 'separator', class: e.ns.bem('menu', 'item', 'divided') }, e.$attrs ), null, 16 )) : createCommentVNode('v-if', !0), createBaseVNode( 'li', mergeProps({ ref: e.itemRef }, ar(ar({}, e.dataset), e.$attrs), { 'aria-disabled': e.disabled, class: [e.ns.be('menu', 'item'), e.ns.is('disabled', e.disabled)], tabindex: e.tabIndex, role: e.role, onClick: t[0] || (t[0] = s => e.$emit('clickimpl', s)), onFocus: t[1] || (t[1] = (...s) => e.handleFocus && e.handleFocus(...s)), onKeydown: t[2] || (t[2] = (...s) => e.handleKeydown && e.handleKeydown(...s)), onMousedown: t[3] || (t[3] = (...s) => e.handleMousedown && e.handleMousedown(...s)), onPointermove: t[4] || (t[4] = s => e.$emit('pointermove', s)), onPointerleave: t[5] || (t[5] = s => e.$emit('pointerleave', s)) }), [ e.icon ? (openBlock(), createBlock( l, { key: 0 }, { default: withCtx(() => [ (openBlock(), createBlock(resolveDynamicComponent(e.icon))) ]), _: 1 } )) : createCommentVNode('v-if', !0), renderSlot(e.$slots, 'default') ], 16, _hoisted_1$9 ) ], 64 ) ) } var ElDropdownItemImpl = _export_sfc$1(_sfc_main$e, [ ['render', _sfc_render$6], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dropdown/src/dropdown-item-impl.vue' ] ]) const useDropdown = () => { const e = inject('elDropdown', {}), t = computed(() => (e == null ? void 0 : e.dropdownSize)) return { elDropdown: e, _elDropdownSize: t } }, _sfc_main$d = defineComponent({ name: 'ElDropdownItem', components: { ElDropdownCollectionItem: ElCollectionItem, ElRovingFocusItem, ElDropdownItemImpl }, inheritAttrs: !1, props: dropdownItemProps, emits: ['pointermove', 'pointerleave', 'click'], setup(e, { emit: t, attrs: r }) { const { elDropdown: o } = useDropdown(), n = getCurrentInstance(), a = ref(null), l = computed(() => { var _, b return (b = (_ = unref(a)) == null ? void 0 : _.textContent) != null ? b : '' }), { onItemEnter: s, onItemLeave: c } = inject( DROPDOWN_INJECTION_KEY, void 0 ), d = composeEventHandlers( _ => (t('pointermove', _), _.defaultPrevented), whenMouse(_ => { var b e.disabled ? c(_) : (s(_), _.defaultPrevented || (b = _.currentTarget) == null || b.focus()) }) ), u = composeEventHandlers( _ => (t('pointerleave', _), _.defaultPrevented), whenMouse(_ => { c(_) }) ), m = composeEventHandlers( _ => (t('click', _), _.type !== 'keydown' && _.defaultPrevented), _ => { var b, v, k if (e.disabled) { _.stopImmediatePropagation() return } ;(b = o == null ? void 0 : o.hideOnClick) != null && b.value && ((v = o.handleClick) == null || v.call(o)), (k = o.commandHandler) == null || k.call(o, e.command, n, _) } ), f = computed(() => ar(ar({}, e), r)) return { handleClick: m, handlePointerMove: d, handlePointerLeave: u, textContent: l, propsAndAttrs: f } } }) function _sfc_render$5(e, t, r, o, n, a) { var l const s = resolveComponent('el-dropdown-item-impl'), c = resolveComponent('el-roving-focus-item'), d = resolveComponent('el-dropdown-collection-item') return ( openBlock(), createBlock( d, { disabled: e.disabled, 'text-value': (l = e.textValue) != null ? l : e.textContent }, { default: withCtx(() => [ createVNode( c, { focusable: !e.disabled }, { default: withCtx(() => [ createVNode( s, mergeProps(e.propsAndAttrs, { onPointerleave: e.handlePointerLeave, onPointermove: e.handlePointerMove, onClickimpl: e.handleClick }), { default: withCtx(() => [renderSlot(e.$slots, 'default')]), _: 3 }, 16, ['onPointerleave', 'onPointermove', 'onClickimpl'] ) ]), _: 3 }, 8, ['focusable'] ) ]), _: 3 }, 8, ['disabled', 'text-value'] ) ) } var DropdownItem = _export_sfc$1(_sfc_main$d, [ ['render', _sfc_render$5], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dropdown/src/dropdown-item.vue' ] ]) const _sfc_main$c = defineComponent({ name: 'ElDropdownMenu', props: dropdownMenuProps, setup(e) { const t = useNamespace('dropdown'), { _elDropdownSize: r } = useDropdown(), o = r.value, { focusTrapRef: n, onKeydown: a } = inject( FOCUS_TRAP_INJECTION_KEY, void 0 ), { contentRef: l, role: s, triggerId: c } = inject(DROPDOWN_INJECTION_KEY, void 0), { collectionRef: d, getItems: u } = inject( COLLECTION_INJECTION_KEY, void 0 ), { rovingFocusGroupRef: m, rovingFocusGroupRootStyle: f, tabIndex: _, onBlur: b, onFocus: v, onMousedown: k } = inject(ROVING_FOCUS_GROUP_INJECTION_KEY, void 0), { collectionRef: g } = inject(COLLECTION_INJECTION_KEY$1, void 0), x = computed(() => [ t.b('menu'), t.bm('menu', o == null ? void 0 : o.value) ]), y = composeRefs(l, d, n, m, g), w = composeEventHandlers( T => { var A ;(A = e.onKeydown) == null || A.call(e, T) }, T => { const { currentTarget: A, code: $, target: F } = T if ( (A.contains(F), EVENT_CODE.tab === $ && T.stopImmediatePropagation(), T.preventDefault(), F !== unref(l) || !FIRST_LAST_KEYS.includes($)) ) return const ae = u() .filter(re => !re.disabled) .map(re => re.ref) LAST_KEYS.includes($) && ae.reverse(), focusFirst(ae) } ) return { size: o, rovingFocusGroupRootStyle: f, tabIndex: _, dropdownKls: x, role: s, triggerId: c, dropdownListWrapperRef: y, handleKeydown: T => { w(T), a(T) }, onBlur: b, onFocus: v, onMousedown: k } } }), _hoisted_1$8 = ['role', 'aria-labelledby'] function _sfc_render$4(e, t, r, o, n, a) { return ( openBlock(), createElementBlock( 'ul', { ref: e.dropdownListWrapperRef, class: normalizeClass(e.dropdownKls), style: normalizeStyle(e.rovingFocusGroupRootStyle), tabindex: -1, role: e.role, 'aria-labelledby': e.triggerId, onBlur: t[0] || (t[0] = (...l) => e.onBlur && e.onBlur(...l)), onFocus: t[1] || (t[1] = (...l) => e.onFocus && e.onFocus(...l)), onKeydown: t[2] || (t[2] = (...l) => e.handleKeydown && e.handleKeydown(...l)), onMousedown: t[3] || (t[3] = (...l) => e.onMousedown && e.onMousedown(...l)) }, [renderSlot(e.$slots, 'default')], 46, _hoisted_1$8 ) ) } var DropdownMenu = _export_sfc$1(_sfc_main$c, [ ['render', _sfc_render$4], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/dropdown/src/dropdown-menu.vue' ] ]) const ElDropdown = withInstall(Dropdown, { DropdownItem, DropdownMenu }), ElDropdownItem = withNoopInstall(DropdownItem), ElDropdownMenu = withNoopInstall(DropdownMenu), formProps = buildProps({ model: Object, rules: { type: definePropType(Object) }, labelPosition: { type: String, values: ['left', 'right', 'top'], default: 'right' }, labelWidth: { type: [String, Number], default: '' }, labelSuffix: { type: String, default: '' }, inline: Boolean, inlineMessage: Boolean, statusIcon: Boolean, showMessage: { type: Boolean, default: !0 }, size: { type: String, values: componentSizes }, disabled: Boolean, validateOnRuleChange: { type: Boolean, default: !0 }, hideRequiredAsterisk: { type: Boolean, default: !1 }, scrollToError: Boolean }), formEmits = { validate: (e, t, r) => (isArray$7(e) || isString$2(e)) && isBoolean$1(t) && isString$2(r) } function useFormLabelWidth() { const e = ref([]), t = computed(() => { if (!e.value.length) return '0' const a = Math.max(...e.value) return a ? `${a}px` : '' }) function r(a) { return e.value.indexOf(a) } function o(a, l) { if (a && l) { const s = r(l) e.value.splice(s, 1, a) } else a && e.value.push(a) } function n(a) { const l = r(a) l > -1 && e.value.splice(l, 1) } return { autoLabelWidth: t, registerLabelWidth: o, deregisterLabelWidth: n } } const filterFields = (e, t) => { const r = castArray(t) return r.length > 0 ? e.filter(o => o.prop && r.includes(o.prop)) : e }, __default__$7 = { name: 'ElForm' }, _sfc_main$b = defineComponent( pr(ar({}, __default__$7), { props: formProps, emits: formEmits, setup(e, { expose: t, emit: r }) { const o = e, n = [], a = useSize(), l = useNamespace('form'), s = computed(() => { const { labelPosition: x, inline: y } = o return [ l.b(), l.m(a.value || 'default'), { [l.m(`label-${x}`)]: x, [l.m('inline')]: y } ] }), c = x => { n.push(x) }, d = x => { x.prop && n.splice(n.indexOf(x), 1) }, u = (x = []) => { !o.model || filterFields(n, x).forEach(y => y.resetField()) }, m = (x = []) => { filterFields(n, x).forEach(y => y.clearValidate()) }, f = computed(() => !!o.model), _ = x => { if (n.length === 0) return [] const y = filterFields(n, x) return y.length ? y : [] }, b = async x => k(void 0, x), v = async (x = []) => { if (!f.value) return !1 const y = _(x) if (y.length === 0) return !0 let w = {} for (const S of y) try { await S.validate('') } catch (T) { w = ar(ar({}, w), T) } return Object.keys(w).length === 0 ? !0 : Promise.reject(w) }, k = async (x = [], y) => { const w = !isFunction$1(y) try { const S = await v(x) return S === !0 && (y == null || y(S)), S } catch (S) { const T = S return ( o.scrollToError && g(Object.keys(T)[0]), y == null || y(!1, T), w && Promise.reject(T) ) } }, g = x => { var y const w = filterFields(n, x)[0] w && ((y = w.$el) == null || y.scrollIntoView()) } return ( watch( () => o.rules, () => { o.validateOnRuleChange && b().catch(x => void 0) }, { deep: !0 } ), provide( formContextKey, reactive( ar( pr(ar({}, toRefs(o)), { emit: r, resetFields: u, clearValidate: m, validateField: k, addField: c, removeField: d }), useFormLabelWidth() ) ) ), t({ validate: b, validateField: k, resetFields: u, clearValidate: m, scrollToField: g }), (x, y) => ( openBlock(), createElementBlock( 'form', { class: normalizeClass(unref(s)) }, [renderSlot(x.$slots, 'default')], 2 ) ) ) } }) ) var Form$1 = _export_sfc$1(_sfc_main$b, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/form/src/form.vue' ] ]) function _extends() { return ( (_extends = Object.assign || function (e) { for (var t = 1; t < arguments.length; t++) { var r = arguments[t] for (var o in r) Object.prototype.hasOwnProperty.call(r, o) && (e[o] = r[o]) } return e }), _extends.apply(this, arguments) ) } function _inheritsLoose(e, t) { ;(e.prototype = Object.create(t.prototype)), (e.prototype.constructor = e), _setPrototypeOf$1(e, t) } function _getPrototypeOf$1(e) { return ( (_getPrototypeOf$1 = Object.setPrototypeOf ? Object.getPrototypeOf : function (r) { return r.__proto__ || Object.getPrototypeOf(r) }), _getPrototypeOf$1(e) ) } function _setPrototypeOf$1(e, t) { return ( (_setPrototypeOf$1 = Object.setPrototypeOf || function (o, n) { return (o.__proto__ = n), o }), _setPrototypeOf$1(e, t) ) } function _isNativeReflectConstruct$1() { if ( typeof Reflect == 'undefined' || !Reflect.construct || Reflect.construct.sham ) return !1 if (typeof Proxy == 'function') return !0 try { return ( Boolean.prototype.valueOf.call( Reflect.construct(Boolean, [], function () {}) ), !0 ) } catch { return !1 } } function _construct$1(e, t, r) { return ( _isNativeReflectConstruct$1() ? (_construct$1 = Reflect.construct) : (_construct$1 = function (n, a, l) { var s = [null] s.push.apply(s, a) var c = Function.bind.apply(n, s), d = new c() return l && _setPrototypeOf$1(d, l.prototype), d }), _construct$1.apply(null, arguments) ) } function _isNativeFunction$1(e) { return Function.toString.call(e).indexOf('[native code]') !== -1 } function _wrapNativeSuper$1(e) { var t = typeof Map == 'function' ? new Map() : void 0 return ( (_wrapNativeSuper$1 = function (o) { if (o === null || !_isNativeFunction$1(o)) return o if (typeof o != 'function') throw new TypeError( 'Super expression must either be null or a function' ) if (typeof t != 'undefined') { if (t.has(o)) return t.get(o) t.set(o, n) } function n() { return _construct$1(o, arguments, _getPrototypeOf$1(this).constructor) } return ( (n.prototype = Object.create(o.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } })), _setPrototypeOf$1(n, o) ) }), _wrapNativeSuper$1(e) ) } var formatRegExp = /%[sdj%]/g, warning = function () {} typeof process != 'undefined' && process.env function convertFieldsError(e) { if (!e || !e.length) return null var t = {} return ( e.forEach(function (r) { var o = r.field ;(t[o] = t[o] || []), t[o].push(r) }), t ) } function format(e) { for ( var t = arguments.length, r = new Array(t > 1 ? t - 1 : 0), o = 1; o < t; o++ ) r[o - 1] = arguments[o] var n = 0, a = r.length if (typeof e == 'function') return e.apply(null, r) if (typeof e == 'string') { var l = e.replace(formatRegExp, function (s) { if (s === '%%') return '%' if (n >= a) return s switch (s) { case '%s': return String(r[n++]) case '%d': return Number(r[n++]) case '%j': try { return JSON.stringify(r[n++]) } catch { return '[Circular]' } break default: return s } }) return l } return e } function isNativeStringType(e) { return ( e === 'string' || e === 'url' || e === 'hex' || e === 'email' || e === 'date' || e === 'pattern' ) } function isEmptyValue(e, t) { return !!( e == null || (t === 'array' && Array.isArray(e) && !e.length) || (isNativeStringType(t) && typeof e == 'string' && !e) ) } function asyncParallelArray(e, t, r) { var o = [], n = 0, a = e.length function l(s) { o.push.apply(o, s || []), n++, n === a && r(o) } e.forEach(function (s) { t(s, l) }) } function asyncSerialArray(e, t, r) { var o = 0, n = e.length function a(l) { if (l && l.length) { r(l) return } var s = o ;(o = o + 1), s < n ? t(e[s], a) : r([]) } a([]) } function flattenObjArr(e) { var t = [] return ( Object.keys(e).forEach(function (r) { t.push.apply(t, e[r] || []) }), t ) } var AsyncValidationError = (function (e) { _inheritsLoose(t, e) function t(r, o) { var n return ( (n = e.call(this, 'Async Validation Error') || this), (n.errors = r), (n.fields = o), n ) } return t })(_wrapNativeSuper$1(Error)) function asyncMap(e, t, r, o, n) { if (t.first) { var a = new Promise(function (f, _) { var b = function (g) { return ( o(g), g.length ? _(new AsyncValidationError(g, convertFieldsError(g))) : f(n) ) }, v = flattenObjArr(e) asyncSerialArray(v, r, b) }) return ( a.catch(function (f) { return f }), a ) } var l = t.firstFields === !0 ? Object.keys(e) : t.firstFields || [], s = Object.keys(e), c = s.length, d = 0, u = [], m = new Promise(function (f, _) { var b = function (k) { if ((u.push.apply(u, k), d++, d === c)) return ( o(u), u.length ? _(new AsyncValidationError(u, convertFieldsError(u))) : f(n) ) } s.length || (o(u), f(n)), s.forEach(function (v) { var k = e[v] l.indexOf(v) !== -1 ? asyncSerialArray(k, r, b) : asyncParallelArray(k, r, b) }) }) return ( m.catch(function (f) { return f }), m ) } function isErrorObj(e) { return !!(e && e.message !== void 0) } function getValue(e, t) { for (var r = e, o = 0; o < t.length; o++) { if (r == null) return r r = r[t[o]] } return r } function complementError(e, t) { return function (r) { var o return ( e.fullFields ? (o = getValue(t, e.fullFields)) : (o = t[r.field || e.fullField]), isErrorObj(r) ? ((r.field = r.field || e.fullField), (r.fieldValue = o), r) : { message: typeof r == 'function' ? r() : r, fieldValue: o, field: r.field || e.fullField } ) } } function deepMerge(e, t) { if (t) { for (var r in t) if (t.hasOwnProperty(r)) { var o = t[r] typeof o == 'object' && typeof e[r] == 'object' ? (e[r] = _extends({}, e[r], o)) : (e[r] = o) } } return e } var required$1 = function (t, r, o, n, a, l) { t.required && (!o.hasOwnProperty(t.field) || isEmptyValue(r, l || t.type)) && n.push(format(a.messages.required, t.fullField)) }, whitespace = function (t, r, o, n, a) { ;(/^\s+$/.test(r) || r === '') && n.push(format(a.messages.whitespace, t.fullField)) }, pattern$2 = { email: /^(([^<>()\[\]\\.,;:\s@"]+(\.[^<>()\[\]\\.,;:\s@"]+)*)|(".+"))@((\[[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}])|(([a-zA-Z\-0-9\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]+\.)+[a-zA-Z\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]{2,}))$/, url: new RegExp( '^(?!mailto:)(?:(?:http|https|ftp)://|//)(?:\\S+(?::\\S*)?@)?(?:(?:(?:[1-9]\\d?|1\\d\\d|2[01]\\d|22[0-3])(?:\\.(?:1?\\d{1,2}|2[0-4]\\d|25[0-5])){2}(?:\\.(?:[0-9]\\d?|1\\d\\d|2[0-4]\\d|25[0-4]))|(?:(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)(?:\\.(?:[a-z\\u00a1-\\uffff0-9]+-*)*[a-z\\u00a1-\\uffff0-9]+)*(?:\\.(?:[a-z\\u00a1-\\uffff]{2,})))|localhost)(?::\\d{2,5})?(?:(/|\\?|#)[^\\s]*)?$', 'i' ), hex: /^#?([a-f0-9]{6}|[a-f0-9]{3})$/i }, types = { integer: function (t) { return types.number(t) && parseInt(t, 10) === t }, float: function (t) { return types.number(t) && !types.integer(t) }, array: function (t) { return Array.isArray(t) }, regexp: function (t) { if (t instanceof RegExp) return !0 try { return !!new RegExp(t) } catch { return !1 } }, date: function (t) { return ( typeof t.getTime == 'function' && typeof t.getMonth == 'function' && typeof t.getYear == 'function' && !isNaN(t.getTime()) ) }, number: function (t) { return isNaN(t) ? !1 : typeof t == 'number' }, object: function (t) { return typeof t == 'object' && !types.array(t) }, method: function (t) { return typeof t == 'function' }, email: function (t) { return ( typeof t == 'string' && t.length <= 320 && !!t.match(pattern$2.email) ) }, url: function (t) { return ( typeof t == 'string' && t.length <= 2048 && !!t.match(pattern$2.url) ) }, hex: function (t) { return typeof t == 'string' && !!t.match(pattern$2.hex) } }, type$1 = function (t, r, o, n, a) { if (t.required && r === void 0) { required$1(t, r, o, n, a) return } var l = [ 'integer', 'float', 'array', 'regexp', 'object', 'method', 'email', 'number', 'date', 'url', 'hex' ], s = t.type l.indexOf(s) > -1 ? types[s](r) || n.push(format(a.messages.types[s], t.fullField, t.type)) : s && typeof r !== t.type && n.push(format(a.messages.types[s], t.fullField, t.type)) }, range = function (t, r, o, n, a) { var l = typeof t.len == 'number', s = typeof t.min == 'number', c = typeof t.max == 'number', d = /[\uD800-\uDBFF][\uDC00-\uDFFF]/g, u = r, m = null, f = typeof r == 'number', _ = typeof r == 'string', b = Array.isArray(r) if ((f ? (m = 'number') : _ ? (m = 'string') : b && (m = 'array'), !m)) return !1 b && (u = r.length), _ && (u = r.replace(d, '_').length), l ? u !== t.len && n.push(format(a.messages[m].len, t.fullField, t.len)) : s && !c && u < t.min ? n.push(format(a.messages[m].min, t.fullField, t.min)) : c && !s && u > t.max ? n.push(format(a.messages[m].max, t.fullField, t.max)) : s && c && (u < t.min || u > t.max) && n.push(format(a.messages[m].range, t.fullField, t.min, t.max)) }, ENUM$1 = 'enum', enumerable$1 = function (t, r, o, n, a) { ;(t[ENUM$1] = Array.isArray(t[ENUM$1]) ? t[ENUM$1] : []), t[ENUM$1].indexOf(r) === -1 && n.push(format(a.messages[ENUM$1], t.fullField, t[ENUM$1].join(', '))) }, pattern$1 = function (t, r, o, n, a) { if (t.pattern) { if (t.pattern instanceof RegExp) (t.pattern.lastIndex = 0), t.pattern.test(r) || n.push( format(a.messages.pattern.mismatch, t.fullField, r, t.pattern) ) else if (typeof t.pattern == 'string') { var l = new RegExp(t.pattern) l.test(r) || n.push(format(a.messages.pattern.mismatch, t.fullField, r, t.pattern)) } } }, rules = { required: required$1, whitespace, type: type$1, range, enum: enumerable$1, pattern: pattern$1 }, string = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r, 'string') && !t.required) return o() rules.required(t, r, n, l, a, 'string'), isEmptyValue(r, 'string') || (rules.type(t, r, n, l, a), rules.range(t, r, n, l, a), rules.pattern(t, r, n, l, a), t.whitespace === !0 && rules.whitespace(t, r, n, l, a)) } o(l) }, method = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && rules.type(t, r, n, l, a) } o(l) }, number = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if ((r === '' && (r = void 0), isEmptyValue(r) && !t.required)) return o() rules.required(t, r, n, l, a), r !== void 0 && (rules.type(t, r, n, l, a), rules.range(t, r, n, l, a)) } o(l) }, _boolean = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && rules.type(t, r, n, l, a) } o(l) }, regexp = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), isEmptyValue(r) || rules.type(t, r, n, l, a) } o(l) }, integer = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && (rules.type(t, r, n, l, a), rules.range(t, r, n, l, a)) } o(l) }, floatFn = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && (rules.type(t, r, n, l, a), rules.range(t, r, n, l, a)) } o(l) }, array = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (r == null && !t.required) return o() rules.required(t, r, n, l, a, 'array'), r != null && (rules.type(t, r, n, l, a), rules.range(t, r, n, l, a)) } o(l) }, object = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && rules.type(t, r, n, l, a) } o(l) }, ENUM = 'enum', enumerable = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a), r !== void 0 && rules[ENUM](t, r, n, l, a) } o(l) }, pattern = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r, 'string') && !t.required) return o() rules.required(t, r, n, l, a), isEmptyValue(r, 'string') || rules.pattern(t, r, n, l, a) } o(l) }, date = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r, 'date') && !t.required) return o() if ((rules.required(t, r, n, l, a), !isEmptyValue(r, 'date'))) { var c r instanceof Date ? (c = r) : (c = new Date(r)), rules.type(t, c, n, l, a), c && rules.range(t, c.getTime(), n, l, a) } } o(l) }, required = function (t, r, o, n, a) { var l = [], s = Array.isArray(r) ? 'array' : typeof r rules.required(t, r, n, l, a, s), o(l) }, type = function (t, r, o, n, a) { var l = t.type, s = [], c = t.required || (!t.required && n.hasOwnProperty(t.field)) if (c) { if (isEmptyValue(r, l) && !t.required) return o() rules.required(t, r, n, s, a, l), isEmptyValue(r, l) || rules.type(t, r, n, s, a) } o(s) }, any = function (t, r, o, n, a) { var l = [], s = t.required || (!t.required && n.hasOwnProperty(t.field)) if (s) { if (isEmptyValue(r) && !t.required) return o() rules.required(t, r, n, l, a) } o(l) }, validators = { string, method, number, boolean: _boolean, regexp, integer, float: floatFn, array, object, enum: enumerable, pattern, date, url: type, hex: type, email: type, required, any } function newMessages() { return { default: 'Validation error on field %s', required: '%s is required', enum: '%s must be one of %s', whitespace: '%s cannot be empty', date: { format: '%s date %s is invalid for format %s', parse: '%s date could not be parsed, %s is invalid ', invalid: '%s date %s is invalid' }, types: { string: '%s is not a %s', method: '%s is not a %s (function)', array: '%s is not an %s', object: '%s is not an %s', number: '%s is not a %s', date: '%s is not a %s', boolean: '%s is not a %s', integer: '%s is not an %s', float: '%s is not a %s', regexp: '%s is not a valid %s', email: '%s is not a valid %s', url: '%s is not a valid %s', hex: '%s is not a valid %s' }, string: { len: '%s must be exactly %s characters', min: '%s must be at least %s characters', max: '%s cannot be longer than %s characters', range: '%s must be between %s and %s characters' }, number: { len: '%s must equal %s', min: '%s cannot be less than %s', max: '%s cannot be greater than %s', range: '%s must be between %s and %s' }, array: { len: '%s must be exactly %s in length', min: '%s cannot be less than %s in length', max: '%s cannot be greater than %s in length', range: '%s must be between %s and %s in length' }, pattern: { mismatch: '%s value %s does not match pattern %s' }, clone: function () { var t = JSON.parse(JSON.stringify(this)) return (t.clone = this.clone), t } } } var messages = newMessages(), Schema = (function () { function e(r) { ;(this.rules = null), (this._messages = messages), this.define(r) } var t = e.prototype return ( (t.define = function (o) { var n = this if (!o) throw new Error('Cannot configure a schema with no rules') if (typeof o != 'object' || Array.isArray(o)) throw new Error('Rules must be an object') ;(this.rules = {}), Object.keys(o).forEach(function (a) { var l = o[a] n.rules[a] = Array.isArray(l) ? l : [l] }) }), (t.messages = function (o) { return ( o && (this._messages = deepMerge(newMessages(), o)), this._messages ) }), (t.validate = function (o, n, a) { var l = this n === void 0 && (n = {}), a === void 0 && (a = function () {}) var s = o, c = n, d = a if ( (typeof c == 'function' && ((d = c), (c = {})), !this.rules || Object.keys(this.rules).length === 0) ) return d && d(null, s), Promise.resolve(s) function u(v) { var k = [], g = {} function x(w) { if (Array.isArray(w)) { var S k = (S = k).concat.apply(S, w) } else k.push(w) } for (var y = 0; y < v.length; y++) x(v[y]) k.length ? ((g = convertFieldsError(k)), d(k, g)) : d(null, s) } if (c.messages) { var m = this.messages() m === messages && (m = newMessages()), deepMerge(m, c.messages), (c.messages = m) } else c.messages = this.messages() var f = {}, _ = c.keys || Object.keys(this.rules) _.forEach(function (v) { var k = l.rules[v], g = s[v] k.forEach(function (x) { var y = x typeof y.transform == 'function' && (s === o && (s = _extends({}, s)), (g = s[v] = y.transform(g))), typeof y == 'function' ? (y = { validator: y }) : (y = _extends({}, y)), (y.validator = l.getValidationMethod(y)), y.validator && ((y.field = v), (y.fullField = y.fullField || v), (y.type = l.getType(y)), (f[v] = f[v] || []), f[v].push({ rule: y, value: g, source: s, field: v })) }) }) var b = {} return asyncMap( f, c, function (v, k) { var g = v.rule, x = (g.type === 'object' || g.type === 'array') && (typeof g.fields == 'object' || typeof g.defaultField == 'object') ;(x = x && (g.required || (!g.required && v.value))), (g.field = v.field) function y(T, A) { return _extends({}, A, { fullField: g.fullField + '.' + T, fullFields: g.fullFields ? [].concat(g.fullFields, [T]) : [T] }) } function w(T) { T === void 0 && (T = []) var A = Array.isArray(T) ? T : [T] !c.suppressWarning && A.length && e.warning('async-validator:', A), A.length && g.message !== void 0 && (A = [].concat(g.message)) var $ = A.map(complementError(g, s)) if (c.first && $.length) return (b[g.field] = 1), k($) if (!x) k($) else { if (g.required && !v.value) return ( g.message !== void 0 ? ($ = [].concat(g.message).map(complementError(g, s))) : c.error && ($ = [ c.error(g, format(c.messages.required, g.field)) ]), k($) ) var F = {} g.defaultField && Object.keys(v.value).map(function (re) { F[re] = g.defaultField }), (F = _extends({}, F, v.rule.fields)) var Y = {} Object.keys(F).forEach(function (re) { var ie = F[re], oe = Array.isArray(ie) ? ie : [ie] Y[re] = oe.map(y.bind(null, re)) }) var ae = new e(Y) ae.messages(c.messages), v.rule.options && ((v.rule.options.messages = c.messages), (v.rule.options.error = c.error)), ae.validate(v.value, v.rule.options || c, function (re) { var ie = [] $ && $.length && ie.push.apply(ie, $), re && re.length && ie.push.apply(ie, re), k(ie.length ? ie : null) }) } } var S if (g.asyncValidator) S = g.asyncValidator(g, v.value, w, v.source, c) else if (g.validator) { try { S = g.validator(g, v.value, w, v.source, c) } catch (T) { console.error == null || console.error(T), setTimeout(function () { throw T }, 0), w(T.message) } S === !0 ? w() : S === !1 ? w( typeof g.message == 'function' ? g.message(g.fullField || g.field) : g.message || (g.fullField || g.field) + ' fails' ) : S instanceof Array ? w(S) : S instanceof Error && w(S.message) } S && S.then && S.then( function () { return w() }, function (T) { return w(T) } ) }, function (v) { u(v) }, s ) }), (t.getType = function (o) { if ( (o.type === void 0 && o.pattern instanceof RegExp && (o.type = 'pattern'), typeof o.validator != 'function' && o.type && !validators.hasOwnProperty(o.type)) ) throw new Error(format('Unknown rule type %s', o.type)) return o.type || 'string' }), (t.getValidationMethod = function (o) { if (typeof o.validator == 'function') return o.validator var n = Object.keys(o), a = n.indexOf('message') return ( a !== -1 && n.splice(a, 1), n.length === 1 && n[0] === 'required' ? validators.required : validators[this.getType(o)] || void 0 ) }), e ) })() Schema.register = function (t, r) { if (typeof r != 'function') throw new Error( 'Cannot register a validator by type, validator is not a function' ) validators[t] = r } Schema.warning = warning Schema.messages = messages Schema.validators = validators const formItemValidateStates = ['', 'error', 'validating', 'success'], formItemProps = buildProps({ label: String, labelWidth: { type: [String, Number], default: '' }, prop: { type: definePropType([String, Array]) }, required: { type: Boolean, default: void 0 }, rules: { type: definePropType([Object, Array]) }, error: String, validateStatus: { type: String, values: formItemValidateStates }, for: String, inlineMessage: { type: [String, Boolean], default: '' }, showMessage: { type: Boolean, default: !0 }, size: { type: String, values: componentSizes } }), COMPONENT_NAME$2 = 'ElLabelWrap' var FormLabelWrap = defineComponent({ name: COMPONENT_NAME$2, props: { isAutoWidth: Boolean, updateAll: Boolean }, setup(e, { slots: t }) { const r = inject(formContextKey, void 0) inject(formItemContextKey) || throwError( COMPONENT_NAME$2, 'usage: ' ) const n = useNamespace('form'), a = ref(), l = ref(0), s = () => { var u if ((u = a.value) != null && u.firstElementChild) { const m = window.getComputedStyle(a.value.firstElementChild).width return Math.ceil(Number.parseFloat(m)) } else return 0 }, c = (u = 'update') => { nextTick(() => { t.default && e.isAutoWidth && (u === 'update' ? (l.value = s()) : u === 'remove' && (r == null || r.deregisterLabelWidth(l.value))) }) }, d = () => c('update') return ( onMounted(() => { d() }), onBeforeUnmount(() => { c('remove') }), onUpdated(() => d()), watch(l, (u, m) => { e.updateAll && (r == null || r.registerLabelWidth(u, m)) }), useResizeObserver( computed(() => { var u, m return (m = (u = a.value) == null ? void 0 : u.firstElementChild) != null ? m : null }), d ), () => { var u, m if (!t) return null const { isAutoWidth: f } = e if (f) { const _ = r == null ? void 0 : r.autoLabelWidth, b = {} if (_ && _ !== 'auto') { const v = Math.max(0, Number.parseInt(_, 10) - l.value), k = r.labelPosition === 'left' ? 'marginRight' : 'marginLeft' v && (b[k] = `${v}px`) } return createVNode( 'div', { ref: a, class: [n.be('item', 'label-wrap')], style: b }, [(u = t.default) == null ? void 0 : u.call(t)] ) } else return createVNode(Fragment, { ref: a }, [ (m = t.default) == null ? void 0 : m.call(t) ]) } ) } }) const _hoisted_1$7 = ['role', 'aria-labelledby'], __default__$6 = { name: 'ElFormItem' }, _sfc_main$a = defineComponent( pr(ar({}, __default__$6), { props: formItemProps, setup(e, { expose: t }) { const r = e, o = useSlots(), n = inject(formContextKey, void 0), a = inject(formItemContextKey, void 0), l = useSize(void 0, { formItem: !1 }), s = useNamespace('form-item'), c = useId().value, d = ref([]), u = ref(''), m = refDebounced(u, 100), f = ref(''), _ = ref() let b, v = !1 const k = computed(() => { if ((n == null ? void 0 : n.labelPosition) === 'top') return {} const xe = addUnit( r.labelWidth || (n == null ? void 0 : n.labelWidth) || '' ) return xe ? { width: xe } : {} }), g = computed(() => { if ( (n == null ? void 0 : n.labelPosition) === 'top' || (n == null ? void 0 : n.inline) ) return {} if (!r.label && !r.labelWidth && F) return {} const xe = addUnit( r.labelWidth || (n == null ? void 0 : n.labelWidth) || '' ) return !r.label && !o.label ? { marginLeft: xe } : {} }), x = computed(() => [ s.b(), s.m(l.value), s.is('error', u.value === 'error'), s.is('validating', u.value === 'validating'), s.is('success', u.value === 'success'), s.is('required', oe.value || r.required), s.is('no-asterisk', n == null ? void 0 : n.hideRequiredAsterisk), { [s.m('feedback')]: n == null ? void 0 : n.statusIcon } ]), y = computed(() => isBoolean$1(r.inlineMessage) ? r.inlineMessage : (n == null ? void 0 : n.inlineMessage) || !1 ), w = computed(() => [ s.e('error'), { [s.em('error', 'inline')]: y.value } ]), S = computed(() => r.prop ? (isString$2(r.prop) ? r.prop : r.prop.join('.')) : '' ), T = computed(() => !!(r.label || o.label)), A = computed(() => r.for || d.value.length === 1 ? d.value[0] : void 0 ), $ = computed(() => !A.value && T.value), F = !!a, Y = computed(() => { const xe = n == null ? void 0 : n.model if (!(!xe || !r.prop)) return getProp(xe, r.prop).value }), ae = computed(() => { const xe = r.rules ? castArray(r.rules) : [], $e = n == null ? void 0 : n.rules if ($e && r.prop) { const jt = getProp($e, r.prop).value jt && xe.push(...castArray(jt)) } return ( r.required !== void 0 && xe.push({ required: !!r.required }), xe ) }), re = computed(() => ae.value.length > 0), ie = xe => ae.value .filter(jt => !jt.trigger || !xe ? !0 : Array.isArray(jt.trigger) ? jt.trigger.includes(xe) : jt.trigger === xe ) .map(er => { var tr = er, { trigger: jt } = tr, or = To(tr, ['trigger']) return or }), oe = computed(() => ae.value.some(xe => xe.required === !0)), j = computed(() => { var xe return ( m.value === 'error' && r.showMessage && ((xe = n == null ? void 0 : n.showMessage) != null ? xe : !0) ) }), V = computed( () => `${r.label || ''}${(n == null ? void 0 : n.labelSuffix) || ''}` ), z = xe => { u.value = xe }, M = xe => { var $e, jt const { errors: or, fields: er } = xe ;(!or || !er) && console.error(xe), z('error'), (f.value = or ? (jt = ($e = or == null ? void 0 : or[0]) == null ? void 0 : $e.message) != null ? jt : `${r.prop} is required` : ''), n == null || n.emit('validate', r.prop, !1, f.value) }, L = () => { z('success'), n == null || n.emit('validate', r.prop, !0, '') }, pe = async xe => { const $e = S.value return new Schema({ [$e]: xe }) .validate({ [$e]: Y.value }, { firstFields: !0 }) .then(() => (L(), !0)) .catch(or => (M(or), Promise.reject(or))) }, ue = async (xe, $e) => { if (v) return (v = !1), !1 const jt = isFunction$1($e) if (!re.value) return $e == null || $e(!1), !1 const or = ie(xe) return or.length === 0 ? ($e == null || $e(!0), !0) : (z('validating'), pe(or) .then(() => ($e == null || $e(!0), !0)) .catch(er => { const { fields: tr } = er return ( $e == null || $e(!1, tr), jt ? !1 : Promise.reject(tr) ) })) }, Ie = () => { z(''), (f.value = '') }, Pt = async () => { const xe = n == null ? void 0 : n.model if (!xe || !r.prop) return const $e = getProp(xe, r.prop) isEqual($e.value, b) || (v = !0), ($e.value = clone(b)), await nextTick(), Ie() }, rr = xe => { d.value.includes(xe) || d.value.push(xe) }, _e = xe => { d.value = d.value.filter($e => $e !== xe) } watch( () => r.error, xe => { ;(f.value = xe || ''), z(xe ? 'error' : '') }, { immediate: !0 } ), watch( () => r.validateStatus, xe => z(xe || '') ) const Oe = reactive( pr(ar({}, toRefs(r)), { $el: _, size: l, validateState: u, labelId: c, inputIds: d, isGroup: $, addInputId: rr, removeInputId: _e, resetField: Pt, clearValidate: Ie, validate: ue }) ) return ( provide(formItemContextKey, Oe), onMounted(() => { r.prop && (n == null || n.addField(Oe), (b = clone(Y.value))) }), onBeforeUnmount(() => { n == null || n.removeField(Oe) }), t({ size: l, validateMessage: f, validateState: u, validate: ue, clearValidate: Ie, resetField: Pt }), (xe, $e) => { var jt return ( openBlock(), createElementBlock( 'div', { ref_key: 'formItemRef', ref: _, class: normalizeClass(unref(x)), role: unref($) ? 'group' : void 0, 'aria-labelledby': unref($) ? unref(c) : void 0 }, [ createVNode( unref(FormLabelWrap), { 'is-auto-width': unref(k).width === 'auto', 'update-all': ((jt = unref(n)) == null ? void 0 : jt.labelWidth) === 'auto' }, { default: withCtx(() => [ unref(T) ? (openBlock(), createBlock( resolveDynamicComponent( unref(A) ? 'label' : 'div' ), { key: 0, id: unref(c), for: unref(A), class: normalizeClass(unref(s).e('label')), style: normalizeStyle(unref(k)) }, { default: withCtx(() => [ renderSlot( xe.$slots, 'label', { label: unref(V) }, () => [ createTextVNode( toDisplayString(unref(V)), 1 ) ] ) ]), _: 3 }, 8, ['id', 'for', 'class', 'style'] )) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, ['is-auto-width', 'update-all'] ), createBaseVNode( 'div', { class: normalizeClass(unref(s).e('content')), style: normalizeStyle(unref(g)) }, [ renderSlot(xe.$slots, 'default'), createVNode( Transition, { name: `${unref(s).namespace.value}-zoom-in-top` }, { default: withCtx(() => [ unref(j) ? renderSlot( xe.$slots, 'error', { key: 0, error: f.value }, () => [ createBaseVNode( 'div', { class: normalizeClass(unref(w)) }, toDisplayString(f.value), 3 ) ] ) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, ['name'] ) ], 6 ) ], 10, _hoisted_1$7 ) ) } ) } }) ) var FormItem = _export_sfc$1(_sfc_main$a, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/form/src/form-item.vue' ] ]) const ElForm = withInstall(Form$1, { FormItem }), ElFormItem = withNoopInstall(FormItem), imageViewerProps = buildProps({ urlList: { type: definePropType(Array), default: () => mutable([]) }, zIndex: { type: Number }, initialIndex: { type: Number, default: 0 }, infinite: { type: Boolean, default: !0 }, hideOnClickModal: { type: Boolean, default: !1 }, teleported: { type: Boolean, default: !1 }, closeOnPressEscape: { type: Boolean, default: !0 } }), imageViewerEmits = { close: () => !0, switch: e => typeof e == 'number' }, _hoisted_1$6 = ['src'], __default__$5 = { name: 'ElImageViewer' }, _sfc_main$9 = defineComponent( pr(ar({}, __default__$5), { props: imageViewerProps, emits: imageViewerEmits, setup(e, { emit: t }) { const r = e, o = { CONTAIN: { name: 'contain', icon: markRaw(full_screen_default) }, ORIGINAL: { name: 'original', icon: markRaw(scale_to_original_default) } }, n = isFirefox() ? 'DOMMouseScroll' : 'mousewheel', { t: a } = useLocale(), l = useNamespace('image-viewer'), { nextZIndex: s } = useZIndex(), c = ref(), d = ref([]), u = effectScope(), m = ref(!0), f = ref(r.initialIndex), _ = shallowRef(o.CONTAIN), b = ref({ scale: 1, deg: 0, offsetX: 0, offsetY: 0, enableTransition: !1 }), v = computed(() => { const { urlList: V } = r return V.length <= 1 }), k = computed(() => f.value === 0), g = computed(() => f.value === r.urlList.length - 1), x = computed(() => r.urlList[f.value]), y = computed(() => { const { scale: V, deg: z, offsetX: M, offsetY: L, enableTransition: pe } = b.value let ue = M / V, Ie = L / V switch (z % 360) { case 90: case -270: ;[ue, Ie] = [Ie, -ue] break case 180: case -180: ;[ue, Ie] = [-ue, -Ie] break case 270: case -90: ;[ue, Ie] = [-Ie, ue] break } const Pt = { transform: `scale(${V}) rotate(${z}deg) translate(${ue}px, ${Ie}px)`, transition: pe ? 'transform .3s' : '' } return ( _.value.name === o.CONTAIN.name && (Pt.maxWidth = Pt.maxHeight = '100%'), Pt ) }), w = computed(() => (isNumber$1(r.zIndex) ? r.zIndex : s())) function S() { A(), t('close') } function T() { const V = throttle(M => { switch (M.code) { case EVENT_CODE.esc: r.closeOnPressEscape && S() break case EVENT_CODE.space: re() break case EVENT_CODE.left: ie() break case EVENT_CODE.up: j('zoomIn') break case EVENT_CODE.right: oe() break case EVENT_CODE.down: j('zoomOut') break } }), z = throttle(M => { ;(M.wheelDelta ? M.wheelDelta : -M.detail) > 0 ? j('zoomIn', { zoomRate: 1.2, enableTransition: !1 }) : j('zoomOut', { zoomRate: 1.2, enableTransition: !1 }) }) u.run(() => { useEventListener(document, 'keydown', V), useEventListener(document, n, z) }) } function A() { u.stop() } function $() { m.value = !1 } function F(V) { ;(m.value = !1), (V.target.alt = a('el.image.error')) } function Y(V) { if (m.value || V.button !== 0 || !c.value) return b.value.enableTransition = !1 const { offsetX: z, offsetY: M } = b.value, L = V.pageX, pe = V.pageY, ue = throttle(Pt => { b.value = pr(ar({}, b.value), { offsetX: z + Pt.pageX - L, offsetY: M + Pt.pageY - pe }) }), Ie = useEventListener(document, 'mousemove', ue) useEventListener(document, 'mouseup', () => { Ie() }), V.preventDefault() } function ae() { b.value = { scale: 1, deg: 0, offsetX: 0, offsetY: 0, enableTransition: !1 } } function re() { if (m.value) return const V = keysOf(o), z = Object.values(o), M = _.value.name, pe = (z.findIndex(ue => ue.name === M) + 1) % V.length ;(_.value = o[V[pe]]), ae() } function ie() { if (k.value && !r.infinite) return const V = r.urlList.length f.value = (f.value - 1 + V) % V } function oe() { if (g.value && !r.infinite) return const V = r.urlList.length f.value = (f.value + 1) % V } function j(V, z = {}) { if (m.value) return const { zoomRate: M, rotateDeg: L, enableTransition: pe } = ar({ zoomRate: 1.4, rotateDeg: 90, enableTransition: !0 }, z) switch (V) { case 'zoomOut': b.value.scale > 0.2 && (b.value.scale = Number.parseFloat( (b.value.scale / M).toFixed(3) )) break case 'zoomIn': b.value.scale < 7 && (b.value.scale = Number.parseFloat( (b.value.scale * M).toFixed(3) )) break case 'clockwise': b.value.deg += L break case 'anticlockwise': b.value.deg -= L break } b.value.enableTransition = pe } return ( watch(x, () => { nextTick(() => { const V = d.value[0] ;(V != null && V.complete) || (m.value = !0) }) }), watch(f, V => { ae(), t('switch', V) }), onMounted(() => { var V, z T(), (z = (V = c.value) == null ? void 0 : V.focus) == null || z.call(V) }), (V, z) => ( openBlock(), createBlock( Teleport, { to: 'body', disabled: !V.teleported }, [ createVNode( Transition, { name: 'viewer-fade', appear: '' }, { default: withCtx(() => [ createBaseVNode( 'div', { ref_key: 'wrapper', ref: c, tabindex: -1, class: normalizeClass(unref(l).e('wrapper')), style: normalizeStyle({ zIndex: unref(w) }) }, [ createBaseVNode( 'div', { class: normalizeClass(unref(l).e('mask')), onClick: z[0] || (z[0] = withModifiers( M => V.hideOnClickModal && S(), ['self'] )) }, null, 2 ), createCommentVNode(' CLOSE '), createBaseVNode( 'span', { class: normalizeClass([ unref(l).e('btn'), unref(l).e('close') ]), onClick: S }, [ createVNode(unref(ElIcon), null, { default: withCtx(() => [ createVNode(unref(close_default)) ]), _: 1 }) ], 2 ), createCommentVNode(' ARROW '), unref(v) ? createCommentVNode('v-if', !0) : (openBlock(), createElementBlock( Fragment, { key: 0 }, [ createBaseVNode( 'span', { class: normalizeClass([ unref(l).e('btn'), unref(l).e('prev'), unref(l).is( 'disabled', !V.infinite && unref(k) ) ]), onClick: ie }, [ createVNode(unref(ElIcon), null, { default: withCtx(() => [ createVNode(unref(arrow_left_default)) ]), _: 1 }) ], 2 ), createBaseVNode( 'span', { class: normalizeClass([ unref(l).e('btn'), unref(l).e('next'), unref(l).is( 'disabled', !V.infinite && unref(g) ) ]), onClick: oe }, [ createVNode(unref(ElIcon), null, { default: withCtx(() => [ createVNode( unref(arrow_right_default) ) ]), _: 1 }) ], 2 ) ], 64 )), createCommentVNode(' ACTIONS '), createBaseVNode( 'div', { class: normalizeClass([ unref(l).e('btn'), unref(l).e('actions') ]) }, [ createBaseVNode( 'div', { class: normalizeClass( unref(l).e('actions__inner') ) }, [ createVNode( unref(ElIcon), { onClick: z[1] || (z[1] = M => j('zoomOut')) }, { default: withCtx(() => [ createVNode(unref(zoom_out_default)) ]), _: 1 } ), createVNode( unref(ElIcon), { onClick: z[2] || (z[2] = M => j('zoomIn')) }, { default: withCtx(() => [ createVNode(unref(zoom_in_default)) ]), _: 1 } ), createBaseVNode( 'i', { class: normalizeClass( unref(l).e('actions__divider') ) }, null, 2 ), createVNode( unref(ElIcon), { onClick: re }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent(unref(_).icon) )) ]), _: 1 } ), createBaseVNode( 'i', { class: normalizeClass( unref(l).e('actions__divider') ) }, null, 2 ), createVNode( unref(ElIcon), { onClick: z[3] || (z[3] = M => j('anticlockwise')) }, { default: withCtx(() => [ createVNode(unref(refresh_left_default)) ]), _: 1 } ), createVNode( unref(ElIcon), { onClick: z[4] || (z[4] = M => j('clockwise')) }, { default: withCtx(() => [ createVNode( unref(refresh_right_default) ) ]), _: 1 } ) ], 2 ) ], 2 ), createCommentVNode(' CANVAS '), createBaseVNode( 'div', { class: normalizeClass(unref(l).e('canvas')) }, [ (openBlock(!0), createElementBlock( Fragment, null, renderList(V.urlList, (M, L) => withDirectives( (openBlock(), createElementBlock( 'img', { ref_for: !0, ref: pe => (d.value[L] = pe), key: M, src: M, style: normalizeStyle(unref(y)), class: normalizeClass( unref(l).e('img') ), onLoad: $, onError: F, onMousedown: Y }, null, 46, _hoisted_1$6 )), [[vShow, L === f.value]] ) ), 128 )) ], 2 ), renderSlot(V.$slots, 'default') ], 6 ) ]), _: 3 } ) ], 8, ['disabled'] ) ) ) } }) ) var ImageViewer = _export_sfc$1(_sfc_main$9, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/image-viewer/src/image-viewer.vue' ] ]) const ElImageViewer = withInstall(ImageViewer), imageProps = buildProps({ hideOnClickModal: { type: Boolean, default: !1 }, src: { type: String, default: '' }, fit: { type: String, values: ['', 'contain', 'cover', 'fill', 'none', 'scale-down'], default: '' }, loading: { type: String, values: ['eager', 'lazy'] }, lazy: { type: Boolean, default: !1 }, scrollContainer: { type: definePropType([String, Object]) }, previewSrcList: { type: definePropType(Array), default: () => mutable([]) }, previewTeleported: { type: Boolean, default: !1 }, zIndex: { type: Number }, initialIndex: { type: Number, default: 0 }, infinite: { type: Boolean, default: !0 }, closeOnPressEscape: { type: Boolean, default: !0 } }), imageEmits = { error: e => e instanceof Event, switch: e => isNumber$1(e), close: () => !0 }, _hoisted_1$5 = ['src', 'loading'], _hoisted_2$2 = { key: 0 }, __default__$4 = { name: 'ElImage', inheritAttrs: !1 }, _sfc_main$8 = defineComponent( pr(ar({}, __default__$4), { props: imageProps, emits: imageEmits, setup(e, { emit: t }) { const r = e let o = '' const { t: n } = useLocale(), a = useNamespace('image'), l = useAttrs$1(), s = useAttrs(), c = ref(), d = ref(!1), u = ref(!0), m = ref(!1), f = ref(), _ = ref(), b = isClient && 'loading' in HTMLImageElement.prototype let v, k const g = computed(() => l.style), x = computed(() => { const { fit: z } = r return isClient && z ? { objectFit: z } : {} }), y = computed(() => { const { previewSrcList: z } = r return Array.isArray(z) && z.length > 0 }), w = computed(() => { const { previewSrcList: z, initialIndex: M } = r let L = M return M > z.length - 1 && (L = 0), L }), S = computed(() => r.loading === 'eager' ? !1 : (!b && r.loading === 'lazy') || r.lazy ), T = () => { !isClient || ((u.value = !0), (d.value = !1), (c.value = r.src)) } function A() { ;(u.value = !1), (d.value = !1) } function $(z) { ;(u.value = !1), (d.value = !0), t('error', z) } function F() { isInContainer(f.value, _.value) && (T(), re()) } const Y = useThrottleFn(F, 200) async function ae() { var z if (!isClient) return await nextTick() const { scrollContainer: M } = r isElement$1(M) ? (_.value = M) : isString$2(M) && M !== '' ? (_.value = (z = document.querySelector(M)) != null ? z : void 0) : f.value && (_.value = getScrollContainer(f.value)), _.value && ((v = useEventListener(_, 'scroll', Y)), setTimeout(() => F(), 100)) } function re() { !isClient || !_.value || !Y || (v == null || v(), (_.value = void 0)) } function ie(z) { if (!!z.ctrlKey) { if (z.deltaY < 0) return z.preventDefault(), !1 if (z.deltaY > 0) return z.preventDefault(), !1 } } function oe() { !y.value || ((k = useEventListener('wheel', ie, { passive: !1 })), (o = document.body.style.overflow), (document.body.style.overflow = 'hidden'), (m.value = !0)) } function j() { k == null || k(), (document.body.style.overflow = o), (m.value = !1), t('close') } function V(z) { t('switch', z) } return ( watch( () => r.src, () => { S.value ? ((u.value = !0), (d.value = !1), re(), ae()) : T() } ), onMounted(() => { S.value ? ae() : T() }), (z, M) => ( openBlock(), createElementBlock( 'div', { ref_key: 'container', ref: f, class: normalizeClass([unref(a).b(), z.$attrs.class]), style: normalizeStyle(unref(g)) }, [ c.value !== void 0 && !d.value ? (openBlock(), createElementBlock( 'img', mergeProps({ key: 0 }, unref(s), { src: c.value, loading: z.loading, style: unref(x), class: [ unref(a).e('inner'), unref(y) ? unref(a).e('preview') : '' ], onClick: oe, onLoad: A, onError: $ }), null, 16, _hoisted_1$5 )) : createCommentVNode('v-if', !0), u.value ? renderSlot(z.$slots, 'placeholder', { key: 1 }, () => [ createBaseVNode( 'div', { class: normalizeClass(unref(a).e('placeholder')) }, null, 2 ) ]) : d.value ? renderSlot(z.$slots, 'error', { key: 2 }, () => [ createBaseVNode( 'div', { class: normalizeClass(unref(a).e('error')) }, toDisplayString(unref(n)('el.image.error')), 3 ) ]) : createCommentVNode('v-if', !0), unref(y) ? (openBlock(), createElementBlock( Fragment, { key: 3 }, [ m.value ? (openBlock(), createBlock( unref(ElImageViewer), { key: 0, 'z-index': z.zIndex, 'initial-index': unref(w), infinite: z.infinite, 'url-list': z.previewSrcList, 'hide-on-click-modal': z.hideOnClickModal, teleported: z.previewTeleported, 'close-on-press-escape': z.closeOnPressEscape, onClose: j, onSwitch: V }, { default: withCtx(() => [ z.$slots.viewer ? (openBlock(), createElementBlock('div', _hoisted_2$2, [ renderSlot(z.$slots, 'viewer') ])) : createCommentVNode('v-if', !0) ]), _: 3 }, 8, [ 'z-index', 'initial-index', 'infinite', 'url-list', 'hide-on-click-modal', 'teleported', 'close-on-press-escape' ] )) : createCommentVNode('v-if', !0) ], 64 )) : createCommentVNode('v-if', !0) ], 6 ) ) ) } }) ) var Image$1 = _export_sfc$1(_sfc_main$8, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/image/src/image.vue' ] ]) const ElImage = withInstall(Image$1), linkProps = buildProps({ type: { type: String, values: ['primary', 'success', 'warning', 'info', 'danger', 'default'], default: 'default' }, underline: { type: Boolean, default: !0 }, disabled: { type: Boolean, default: !1 }, href: { type: String, default: '' }, icon: { type: iconPropType, default: '' } }), linkEmits = { click: e => e instanceof MouseEvent }, _hoisted_1$4 = ['href'], __default__$3 = { name: 'ElLink' }, _sfc_main$7 = defineComponent( pr(ar({}, __default__$3), { props: linkProps, emits: linkEmits, setup(e, { emit: t }) { const r = e, o = useNamespace('link') function n(a) { r.disabled || t('click', a) } return (a, l) => ( openBlock(), createElementBlock( 'a', { class: normalizeClass([ unref(o).b(), unref(o).m(a.type), unref(o).is('disabled', a.disabled), unref(o).is('underline', a.underline && !a.disabled) ]), href: a.disabled || !a.href ? void 0 : a.href, onClick: n }, [ a.icon ? (openBlock(), createBlock( unref(ElIcon), { key: 0 }, { default: withCtx(() => [ (openBlock(), createBlock(resolveDynamicComponent(a.icon))) ]), _: 1 } )) : createCommentVNode('v-if', !0), a.$slots.default ? (openBlock(), createElementBlock( 'span', { key: 1, class: normalizeClass(unref(o).e('inner')) }, [renderSlot(a.$slots, 'default')], 2 )) : createCommentVNode('v-if', !0), a.$slots.icon ? renderSlot(a.$slots, 'icon', { key: 2 }) : createCommentVNode('v-if', !0) ], 10, _hoisted_1$4 ) ) } }) ) var Link = _export_sfc$1(_sfc_main$7, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/link/src/link.vue' ] ]) const ElLink = withInstall(Link), usePopoverProps = buildProps({ trigger: useTooltipTriggerProps.trigger, placement: dropdownProps.placement, disabled: useTooltipTriggerProps.disabled, visible: useTooltipContentProps.visible, transition: useTooltipContentProps.transition, popperOptions: dropdownProps.popperOptions, tabindex: dropdownProps.tabindex, content: useTooltipContentProps.content, popperStyle: useTooltipContentProps.popperStyle, popperClass: useTooltipContentProps.popperClass, enterable: pr(ar({}, useTooltipContentProps.enterable), { default: !0 }), effect: pr(ar({}, useTooltipContentProps.effect), { default: 'light' }), teleported: useTooltipContentProps.teleported, title: String, width: { type: [String, Number], default: 150 }, offset: { type: Number, default: void 0 }, showAfter: { type: Number, default: 0 }, hideAfter: { type: Number, default: 200 }, autoClose: { type: Number, default: 0 }, showArrow: { type: Boolean, default: !0 }, persistent: { type: Boolean, default: !0 } }), emits = [ 'update:visible', 'before-enter', 'before-leave', 'after-enter', 'after-leave' ], COMPONENT_NAME$1 = 'ElPopover', _sfc_main$6 = defineComponent({ name: COMPONENT_NAME$1, components: { ElTooltip }, props: usePopoverProps, emits, setup(e, { emit: t }) { const r = useNamespace('popover'), o = ref(null), n = computed(() => { var b return (b = unref(o)) == null ? void 0 : b.popperRef }), a = computed(() => (isString$2(e.width) ? e.width : `${e.width}px`)), l = computed(() => [{ width: a.value }, e.popperStyle]), s = computed(() => [ r.b(), e.popperClass, { [r.m('plain')]: !!e.content } ]), c = computed(() => e.transition === 'el-fade-in-linear') return { ns: r, kls: s, gpuAcceleration: c, style: l, tooltipRef: o, popperRef: n, hide: () => { var b ;(b = o.value) == null || b.hide() }, beforeEnter: () => { t('before-enter') }, beforeLeave: () => { t('before-leave') }, afterEnter: () => { t('after-enter') }, afterLeave: () => { t('update:visible', !1), t('after-leave') } } } }) function _sfc_render$3(e, t, r, o, n, a) { const l = resolveComponent('el-tooltip') return ( openBlock(), createBlock( l, mergeProps({ ref: 'tooltipRef' }, e.$attrs, { trigger: e.trigger, placement: e.placement, disabled: e.disabled, visible: e.visible, transition: e.transition, 'popper-options': e.popperOptions, tabindex: e.tabindex, content: e.content, offset: e.offset, 'show-after': e.showAfter, 'hide-after': e.hideAfter, 'auto-close': e.autoClose, 'show-arrow': e.showArrow, 'aria-label': e.title, effect: e.effect, enterable: e.enterable, 'popper-class': e.kls, 'popper-style': e.style, teleported: e.teleported, persistent: e.persistent, 'gpu-acceleration': e.gpuAcceleration, onBeforeShow: e.beforeEnter, onBeforeHide: e.beforeLeave, onShow: e.afterEnter, onHide: e.afterLeave }), { content: withCtx(() => [ e.title ? (openBlock(), createElementBlock( 'div', { key: 0, class: normalizeClass(e.ns.e('title')), role: 'title' }, toDisplayString(e.title), 3 )) : createCommentVNode('v-if', !0), renderSlot(e.$slots, 'default', {}, () => [ createTextVNode(toDisplayString(e.content), 1) ]) ]), default: withCtx(() => [ e.$slots.reference ? renderSlot(e.$slots, 'reference', { key: 0 }) : createCommentVNode('v-if', !0) ]), _: 3 }, 16, [ 'trigger', 'placement', 'disabled', 'visible', 'transition', 'popper-options', 'tabindex', 'content', 'offset', 'show-after', 'hide-after', 'auto-close', 'show-arrow', 'aria-label', 'effect', 'enterable', 'popper-class', 'popper-style', 'teleported', 'persistent', 'gpu-acceleration', 'onBeforeShow', 'onBeforeHide', 'onShow', 'onHide' ] ) ) } var Popover = _export_sfc$1(_sfc_main$6, [ ['render', _sfc_render$3], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/popover/src/index.vue' ] ]) const attachEvents = (e, t) => { const r = t.arg || t.value, o = r == null ? void 0 : r.popperRef o && (o.triggerRef = e) } var PopoverDirective = { mounted(e, t) { attachEvents(e, t) }, updated(e, t) { attachEvents(e, t) } } const VPopover = 'popover' Popover.install = e => { e.component(Popover.name, Popover) } PopoverDirective.install = e => { e.directive(VPopover, PopoverDirective) } const _PopoverDirective = PopoverDirective Popover.directive = _PopoverDirective const _Popover = Popover, ElPopover = _Popover, RowJustify = [ 'start', 'center', 'end', 'space-around', 'space-between', 'space-evenly' ], RowAlign = ['top', 'middle', 'bottom'], rowProps = buildProps({ tag: { type: String, default: 'div' }, gutter: { type: Number, default: 0 }, justify: { type: String, values: RowJustify, default: 'start' }, align: { type: String, values: RowAlign, default: 'top' } }), __default__$2 = { name: 'ElRow' }, _sfc_main$5 = defineComponent( pr(ar({}, __default__$2), { props: rowProps, setup(e) { const t = e, r = useNamespace('row'), o = computed(() => t.gutter) provide(rowContextKey, { gutter: o }) const n = computed(() => { const a = {} return ( t.gutter && (a.marginRight = a.marginLeft = `-${t.gutter / 2}px`), a ) }) return (a, l) => ( openBlock(), createBlock( resolveDynamicComponent(a.tag), { class: normalizeClass([ unref(r).b(), unref(r).is(`justify-${t.justify}`, a.justify !== 'start'), unref(r).is(`align-${t.align}`, a.align !== 'top') ]), style: normalizeStyle(unref(n)) }, { default: withCtx(() => [renderSlot(a.$slots, 'default')]), _: 3 }, 8, ['class', 'style'] ) ) } }) ) var Row = _export_sfc$1(_sfc_main$5, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/row/src/row.vue' ] ]) const ElRow = withInstall(Row), tabBarProps = buildProps({ tabs: { type: definePropType(Array), default: () => mutable([]) } }), __default__$1 = { name: 'ElTabBar' }, _sfc_main$4 = defineComponent( pr(ar({}, __default__$1), { props: tabBarProps, setup(e, { expose: t }) { const r = e, o = 'ElTabBar', n = getCurrentInstance(), a = inject(tabsRootContextKey) a || throwError(o, '') const l = useNamespace('tabs'), s = ref(), c = ref(), d = () => { let m = 0, f = 0 const _ = ['top', 'bottom'].includes(a.props.tabPosition) ? 'width' : 'height', b = _ === 'width' ? 'x' : 'y' return ( r.tabs.every(v => { var k, g, x, y const w = (g = (k = n.parent) == null ? void 0 : k.refs) == null ? void 0 : g[`tab-${v.paneName}`] if (!w) return !1 if (!v.active) return !0 f = w[`client${capitalize(_)}`] const S = b === 'x' ? 'left' : 'top' m = w.getBoundingClientRect()[S] - ((y = (x = w.parentElement) == null ? void 0 : x.getBoundingClientRect()[S]) != null ? y : 0) const T = window.getComputedStyle(w) return ( _ === 'width' && (r.tabs.length > 1 && (f -= Number.parseFloat(T.paddingLeft) + Number.parseFloat(T.paddingRight)), (m += Number.parseFloat(T.paddingLeft))), !1 ) }), { [_]: `${f}px`, transform: `translate${capitalize(b)}(${m}px)` } ) }, u = () => (c.value = d()) return ( watch( () => r.tabs, async () => { await nextTick(), u() }, { immediate: !0 } ), useResizeObserver(s, () => u()), t({ ref: s, update: u }), (m, f) => ( openBlock(), createElementBlock( 'div', { ref_key: 'barRef', ref: s, class: normalizeClass([ unref(l).e('active-bar'), unref(l).is(unref(a).props.tabPosition) ]), style: normalizeStyle(c.value) }, null, 6 ) ) ) } }) ) var TabBar = _export_sfc$1(_sfc_main$4, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/tabs/src/tab-bar.vue' ] ]) const tabNavProps = buildProps({ panes: { type: definePropType(Array), default: () => mutable([]) }, currentName: { type: [String, Number], default: '' }, editable: Boolean, onTabClick: { type: definePropType(Function), default: NOOP }, onTabRemove: { type: definePropType(Function), default: NOOP }, type: { type: String, values: ['card', 'border-card', ''], default: '' }, stretch: Boolean }), COMPONENT_NAME = 'ElTabNav', TabNav = defineComponent({ name: COMPONENT_NAME, props: tabNavProps, setup(e, { expose: t }) { const r = getCurrentInstance(), o = inject(tabsRootContextKey) o || throwError(COMPONENT_NAME, '') const n = useNamespace('tabs'), a = useDocumentVisibility(), l = useWindowFocus(), s = ref(), c = ref(), d = ref(), u = ref(!1), m = ref(0), f = ref(!1), _ = ref(!0), b = computed(() => ['top', 'bottom'].includes(o.props.tabPosition) ? 'width' : 'height' ), v = computed(() => ({ transform: `translate${b.value === 'width' ? 'X' : 'Y'}(-${ m.value }px)` })), k = () => { if (!s.value) return const A = s.value[`offset${capitalize(b.value)}`], $ = m.value if (!$) return const F = $ > A ? $ - A : 0 m.value = F }, g = () => { if (!s.value || !c.value) return const A = c.value[`offset${capitalize(b.value)}`], $ = s.value[`offset${capitalize(b.value)}`], F = m.value if (A - F <= $) return const Y = A - F > $ * 2 ? F + $ : A - $ m.value = Y }, x = () => { const A = c.value if (!u.value || !d.value || !s.value || !A) return const $ = d.value.querySelector('.is-active') if (!$) return const F = s.value, Y = ['top', 'bottom'].includes(o.props.tabPosition), ae = $.getBoundingClientRect(), re = F.getBoundingClientRect(), ie = Y ? A.offsetWidth - re.width : A.offsetHeight - re.height, oe = m.value let j = oe Y ? (ae.left < re.left && (j = oe - (re.left - ae.left)), ae.right > re.right && (j = oe + ae.right - re.right)) : (ae.top < re.top && (j = oe - (re.top - ae.top)), ae.bottom > re.bottom && (j = oe + (ae.bottom - re.bottom))), (j = Math.max(j, 0)), (m.value = Math.min(j, ie)) }, y = () => { if (!c.value || !s.value) return const A = c.value[`offset${capitalize(b.value)}`], $ = s.value[`offset${capitalize(b.value)}`], F = m.value if ($ < A) { const Y = m.value ;(u.value = u.value || {}), (u.value.prev = Y), (u.value.next = Y + $ < A), A - Y < $ && (m.value = A - $) } else (u.value = !1), F > 0 && (m.value = 0) }, w = A => { const $ = A.code, { up: F, down: Y, left: ae, right: re } = EVENT_CODE if (![F, Y, ae, re].includes($)) return const ie = Array.from(A.currentTarget.querySelectorAll('[role=tab]')), oe = ie.indexOf(A.target) let j $ === ae || $ === F ? oe === 0 ? (j = ie.length - 1) : (j = oe - 1) : oe < ie.length - 1 ? (j = oe + 1) : (j = 0), ie[j].focus(), ie[j].click(), S() }, S = () => { _.value && (f.value = !0) }, T = () => (f.value = !1) return ( watch(a, A => { A === 'hidden' ? (_.value = !1) : A === 'visible' && setTimeout(() => (_.value = !0), 50) }), watch(l, A => { A ? setTimeout(() => (_.value = !0), 50) : (_.value = !1) }), useResizeObserver(d, y), onMounted(() => setTimeout(() => x(), 0)), onUpdated(() => y()), t({ scrollToActiveTab: x, removeFocus: T }), watch( () => e.panes, () => r.update(), { flush: 'post' } ), () => { const A = u.value ? [ createVNode( 'span', { class: [n.e('nav-prev'), n.is('disabled', !u.value.prev)], onClick: k }, [ createVNode(ElIcon, null, { default: () => [ createVNode(arrow_left_default, null, null) ] }) ] ), createVNode( 'span', { class: [n.e('nav-next'), n.is('disabled', !u.value.next)], onClick: g }, [ createVNode(ElIcon, null, { default: () => [ createVNode(arrow_right_default, null, null) ] }) ] ) ] : null, $ = e.panes.map((F, Y) => { var ae, re const ie = F.props.name || F.index || `${Y}`, oe = F.isClosable || e.editable F.index = `${Y}` const j = oe ? createVNode( ElIcon, { class: 'is-icon-close', onClick: M => e.onTabRemove(F, M) }, { default: () => [createVNode(close_default, null, null)] } ) : null, V = ((re = (ae = F.slots).label) == null ? void 0 : re.call(ae)) || F.props.label, z = F.active ? 0 : -1 return createVNode( 'div', { ref: `tab-${ie}`, class: [ n.e('item'), n.is(o.props.tabPosition), n.is('active', F.active), n.is('disabled', F.props.disabled), n.is('closable', oe), n.is('focus', f.value) ], id: `tab-${ie}`, key: `tab-${ie}`, 'aria-controls': `pane-${ie}`, role: 'tab', 'aria-selected': F.active, tabindex: z, onFocus: () => S(), onBlur: () => T(), onClick: M => { T(), e.onTabClick(F, ie, M) }, onKeydown: M => { oe && (M.code === EVENT_CODE.delete || M.code === EVENT_CODE.backspace) && e.onTabRemove(F, M) } }, [V, j] ) }) return createVNode( 'div', { ref: d, class: [ n.e('nav-wrap'), n.is('scrollable', !!u.value), n.is(o.props.tabPosition) ] }, [ A, createVNode('div', { class: n.e('nav-scroll'), ref: s }, [ createVNode( 'div', { class: [ n.e('nav'), n.is(o.props.tabPosition), n.is( 'stretch', e.stretch && ['top', 'bottom'].includes(o.props.tabPosition) ) ], ref: c, style: v.value, role: 'tablist', onKeydown: w }, [ e.type ? null : createVNode(TabBar, { tabs: [...e.panes] }, null), $ ] ) ]) ] ) } ) } }), tabsProps = buildProps({ type: { type: String, values: ['card', 'border-card', ''], default: '' }, activeName: { type: [String, Number], default: '' }, closable: Boolean, addable: Boolean, modelValue: { type: [String, Number], default: '' }, editable: Boolean, tabPosition: { type: String, values: ['top', 'right', 'bottom', 'left'], default: 'top' }, beforeLeave: { type: definePropType(Function), default: () => !0 }, stretch: Boolean }), isPanelName = e => isString$2(e) || isNumber$1(e), tabsEmits = { [UPDATE_MODEL_EVENT]: e => isPanelName(e), 'tab-click': (e, t) => t instanceof Event, 'tab-change': e => isPanelName(e), edit: (e, t) => ['remove', 'add'].includes(t), 'tab-remove': e => isPanelName(e), 'tab-add': () => !0 } var Tabs = defineComponent({ name: 'ElTabs', props: tabsProps, emits: tabsEmits, setup(e, { emit: t, slots: r, expose: o }) { const n = useNamespace('tabs'), a = ref(), l = reactive({}), s = ref(e.modelValue || e.activeName || '0'), c = _ => { ;(s.value = _), t(UPDATE_MODEL_EVENT, _), t('tab-change', _) }, d = async _ => { var b, v, k if (s.value !== _) try { ;(await ((b = e.beforeLeave) == null ? void 0 : b.call(e, _, s.value))) !== !1 && (c(_), (k = (v = a.value) == null ? void 0 : v.removeFocus) == null || k.call(v)) } catch {} }, u = (_, b, v) => { _.props.disabled || (d(b), t('tab-click', _, v)) }, m = (_, b) => { _.props.disabled || (b.stopPropagation(), t('edit', _.props.name, 'remove'), t('tab-remove', _.props.name)) }, f = () => { t('edit', void 0, 'add'), t('tab-add') } return ( watch( () => e.activeName, _ => d(_) ), watch( () => e.modelValue, _ => d(_) ), watch(s, async () => { var _ ;(_ = a.value) == null || _.scrollToActiveTab() }), provide(tabsRootContextKey, { props: e, currentName: s, registerPane: v => (l[v.uid] = v), unregisterPane: v => delete l[v] }), o({ currentName: s }), () => { const _ = e.editable || e.addable ? createVNode( 'span', { class: n.e('new-tab'), tabindex: '0', onClick: f, onKeydown: k => { k.code === EVENT_CODE.enter && f() } }, [ createVNode( ElIcon, { class: n.is('icon-plus') }, { default: () => [createVNode(plus_default, null, null)] } ) ] ) : null, b = createVNode( 'div', { class: [n.e('header'), n.is(e.tabPosition)] }, [ _, createVNode( TabNav, { ref: a, currentName: s.value, editable: e.editable, type: e.type, panes: Object.values(l), stretch: e.stretch, onTabClick: u, onTabRemove: m }, null ) ] ), v = createVNode('div', { class: n.e('content') }, [ renderSlot(r, 'default') ]) return createVNode( 'div', { class: [ n.b(), n.m(e.tabPosition), { [n.m('card')]: e.type === 'card', [n.m('border-card')]: e.type === 'border-card' } ] }, [...(e.tabPosition !== 'bottom' ? [b, v] : [v, b])] ) } ) } }) const tabPaneProps = buildProps({ label: { type: String, default: '' }, name: { type: [String, Number], default: '' }, closable: Boolean, disabled: Boolean, lazy: Boolean }), _hoisted_1$3 = ['id', 'aria-hidden', 'aria-labelledby'], __default__ = { name: 'ElTabPane' }, _sfc_main$3 = defineComponent( pr(ar({}, __default__), { props: tabPaneProps, setup(e) { const t = e, r = 'ElTabPane', o = getCurrentInstance(), n = useSlots(), a = inject(tabsRootContextKey) a || throwError(r, 'usage: ') const l = useNamespace('tab-pane'), s = ref(), c = computed(() => t.closable || a.props.closable), d = computedEager(() => a.currentName.value === (t.name || s.value)), u = ref(d.value), m = computed(() => t.name || s.value), f = computedEager(() => !t.lazy || u.value || d.value) watch(d, b => { b && (u.value = !0) }) const _ = reactive({ uid: o.uid, slots: n, props: t, paneName: m, active: d, index: s, isClosable: c }) return ( onMounted(() => { a.registerPane(_) }), onUnmounted(() => { a.unregisterPane(_.uid) }), (b, v) => unref(f) ? withDirectives( (openBlock(), createElementBlock( 'div', { key: 0, id: `pane-${unref(m)}`, class: normalizeClass(unref(l).b()), role: 'tabpanel', 'aria-hidden': !unref(d), 'aria-labelledby': `tab-${unref(m)}` }, [renderSlot(b.$slots, 'default')], 10, _hoisted_1$3 )), [[vShow, unref(d)]] ) : createCommentVNode('v-if', !0) ) } }) ) var TabPane = _export_sfc$1(_sfc_main$3, [ [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/tabs/src/tab-pane.vue' ] ]) const ElTabs = withInstall(Tabs, { TabPane }), ElTabPane = withNoopInstall(TabPane), messageTypes = ['success', 'info', 'warning', 'error'], messageProps = buildProps({ customClass: { type: String, default: '' }, center: { type: Boolean, default: !1 }, dangerouslyUseHTMLString: { type: Boolean, default: !1 }, duration: { type: Number, default: 3e3 }, icon: { type: iconPropType, default: '' }, id: { type: String, default: '' }, message: { type: definePropType([String, Object, Function]), default: '' }, onClose: { type: definePropType(Function), required: !1 }, showClose: { type: Boolean, default: !1 }, type: { type: String, values: messageTypes, default: 'info' }, offset: { type: Number, default: 20 }, zIndex: { type: Number, default: 0 }, grouping: { type: Boolean, default: !1 }, repeatNum: { type: Number, default: 1 } }), messageEmits = { destroy: () => !0 }, _sfc_main$2 = defineComponent({ name: 'ElMessage', components: ar({ ElBadge, ElIcon }, TypeComponents), props: messageProps, emits: messageEmits, setup(e) { const t = useNamespace('message'), r = ref(!1), o = ref(e.type ? (e.type === 'error' ? 'danger' : e.type) : 'info') let n const a = computed(() => { const f = e.type return { [t.bm('icon', f)]: f && TypeComponentsMap[f] } }), l = computed(() => e.icon || TypeComponentsMap[e.type] || ''), s = computed(() => ({ top: `${e.offset}px`, zIndex: e.zIndex })) function c() { e.duration > 0 && ({ stop: n } = useTimeoutFn(() => { r.value && u() }, e.duration)) } function d() { n == null || n() } function u() { r.value = !1 } function m({ code: f }) { f === EVENT_CODE.esc ? r.value && u() : c() } return ( onMounted(() => { c(), (r.value = !0) }), watch( () => e.repeatNum, () => { d(), c() } ), useEventListener(document, 'keydown', m), { ns: t, typeClass: a, iconComponent: l, customStyle: s, visible: r, badgeType: o, close: u, clearTimer: d, startTimer: c } ) } }), _hoisted_1$2 = ['id'], _hoisted_2$1 = ['innerHTML'] function _sfc_render$2(e, t, r, o, n, a) { const l = resolveComponent('el-badge'), s = resolveComponent('el-icon'), c = resolveComponent('close') return ( openBlock(), createBlock( Transition, { name: e.ns.b('fade'), onBeforeLeave: e.onClose, onAfterLeave: t[2] || (t[2] = d => e.$emit('destroy')), persisted: '' }, { default: withCtx(() => [ withDirectives( createBaseVNode( 'div', { id: e.id, class: normalizeClass([ e.ns.b(), { [e.ns.m(e.type)]: e.type && !e.icon }, e.ns.is('center', e.center), e.ns.is('closable', e.showClose), e.customClass ]), style: normalizeStyle(e.customStyle), role: 'alert', onMouseenter: t[0] || (t[0] = (...d) => e.clearTimer && e.clearTimer(...d)), onMouseleave: t[1] || (t[1] = (...d) => e.startTimer && e.startTimer(...d)) }, [ e.repeatNum > 1 ? (openBlock(), createBlock( l, { key: 0, value: e.repeatNum, type: e.badgeType, class: normalizeClass(e.ns.e('badge')) }, null, 8, ['value', 'type', 'class'] )) : createCommentVNode('v-if', !0), e.iconComponent ? (openBlock(), createBlock( s, { key: 1, class: normalizeClass([e.ns.e('icon'), e.typeClass]) }, { default: withCtx(() => [ (openBlock(), createBlock(resolveDynamicComponent(e.iconComponent))) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0), renderSlot(e.$slots, 'default', {}, () => [ e.dangerouslyUseHTMLString ? (openBlock(), createElementBlock( Fragment, { key: 1 }, [ createCommentVNode( " Caution here, message could've been compromised, never use user's input as message " ), createBaseVNode( 'p', { class: normalizeClass(e.ns.e('content')), innerHTML: e.message }, null, 10, _hoisted_2$1 ) ], 2112 )) : (openBlock(), createElementBlock( 'p', { key: 0, class: normalizeClass(e.ns.e('content')) }, toDisplayString(e.message), 3 )) ]), e.showClose ? (openBlock(), createBlock( s, { key: 2, class: normalizeClass(e.ns.e('closeBtn')), onClick: withModifiers(e.close, ['stop']) }, { default: withCtx(() => [createVNode(c)]), _: 1 }, 8, ['class', 'onClick'] )) : createCommentVNode('v-if', !0) ], 46, _hoisted_1$2 ), [[vShow, e.visible]] ) ]), _: 3 }, 8, ['name', 'onBeforeLeave'] ) ) } var MessageConstructor = _export_sfc$1(_sfc_main$2, [ ['render', _sfc_render$2], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/message/src/message.vue' ] ]) const instances = [] let seed = 1 const message = function (e = {}, t) { if (!isClient) return { close: () => {} } if (isNumber$1(messageConfig.max) && instances.length >= messageConfig.max) return { close: () => {} } if ( !isVNode(e) && isObject$2(e) && e.grouping && !isVNode(e.message) && instances.length ) { const m = instances.find(f => { var _, b, v return ( `${ (b = (_ = f.vm.props) == null ? void 0 : _.message) != null ? b : '' }` == `${(v = e.message) != null ? v : ''}` ) }) if (m) return ( (m.vm.component.props.repeatNum += 1), (m.vm.component.props.type = (e == null ? void 0 : e.type) || 'info'), { close: () => (u.component.proxy.visible = !1) } ) } ;(isString$2(e) || isVNode(e)) && (e = { message: e }) let r = e.offset || 20 instances.forEach(({ vm: m }) => { var f r += (((f = m.el) == null ? void 0 : f.offsetHeight) || 0) + 16 }), (r += 16) const { nextZIndex: o } = useZIndex(), n = `message_${seed++}`, a = e.onClose, l = pr(ar({ zIndex: o() }, e), { offset: r, id: n, onClose: () => { close(n, a) } }) let s = document.body isElement$1(e.appendTo) ? (s = e.appendTo) : isString$2(e.appendTo) && (s = document.querySelector(e.appendTo)), isElement$1(s) || (s = document.body) const c = document.createElement('div') c.className = `container_${n}` const d = l.message, u = createVNode( MessageConstructor, l, isFunction$1(d) ? { default: d } : isVNode(d) ? { default: () => d } : null ) return ( (u.appContext = t || message._context), (u.props.onDestroy = () => { render(null, c) }), render(u, c), instances.push({ vm: u }), s.appendChild(c.firstElementChild), { close: () => (u.component.proxy.visible = !1) } ) } messageTypes.forEach(e => { message[e] = (t = {}, r) => ( (isString$2(t) || isVNode(t)) && (t = { message: t }), message(pr(ar({}, t), { type: e }), r) ) }) function close(e, t) { const r = instances.findIndex(({ vm: l }) => e === l.component.props.id) if (r === -1) return const { vm: o } = instances[r] if (!o) return t == null || t(o) const n = o.el.offsetHeight instances.splice(r, 1) const a = instances.length if (!(a < 1)) for (let l = r; l < a; l++) { const s = Number.parseInt(instances[l].vm.el.style.top, 10) - n - 16 instances[l].vm.component.props.offset = s } } function closeAll() { var e for (let t = instances.length - 1; t >= 0; t--) { const r = instances[t].vm.component ;(e = r == null ? void 0 : r.proxy) == null || e.close() } } message.closeAll = closeAll message._context = null const ElMessage = withInstallFunction(message, '$message'), _sfc_main$1 = defineComponent({ name: 'ElMessageBox', directives: { TrapFocus }, components: ar( { ElButton, ElFocusTrap, ElInput, ElOverlay, ElIcon }, TypeComponents ), inheritAttrs: !1, props: { buttonSize: { type: String, validator: isValidComponentSize }, modal: { type: Boolean, default: !0 }, lockScroll: { type: Boolean, default: !0 }, showClose: { type: Boolean, default: !0 }, closeOnClickModal: { type: Boolean, default: !0 }, closeOnPressEscape: { type: Boolean, default: !0 }, closeOnHashChange: { type: Boolean, default: !0 }, center: Boolean, draggable: Boolean, roundButton: { default: !1, type: Boolean }, container: { type: String, default: 'body' }, boxType: { type: String, default: '' } }, emits: ['vanish', 'action'], setup(e, { emit: t }) { const { t: r } = useLocale(), o = useNamespace('message-box'), n = ref(!1), { nextZIndex: a } = useZIndex(), l = reactive({ beforeClose: null, callback: null, cancelButtonText: '', cancelButtonClass: '', confirmButtonText: '', confirmButtonClass: '', customClass: '', customStyle: {}, dangerouslyUseHTMLString: !1, distinguishCancelAndClose: !1, icon: '', inputPattern: null, inputPlaceholder: '', inputType: 'text', inputValue: null, inputValidator: null, inputErrorMessage: '', message: null, modalFade: !0, modalClass: '', showCancelButton: !1, showConfirmButton: !0, type: '', title: void 0, showInput: !1, action: '', confirmButtonLoading: !1, cancelButtonLoading: !1, confirmButtonDisabled: !1, editorErrorMessage: '', validateError: !1, zIndex: a() }), s = computed(() => { const ie = l.type return { [o.bm('icon', ie)]: ie && TypeComponentsMap[ie] } }), c = useId(), d = useId(), u = useSize( computed(() => e.buttonSize), { prop: !0, form: !0, formItem: !0 } ), m = computed(() => l.icon || TypeComponentsMap[l.type] || ''), f = computed(() => !!l.message), _ = ref(), b = ref(), v = ref(), k = ref(), g = ref(), x = computed(() => l.confirmButtonClass) watch( () => l.inputValue, async ie => { await nextTick(), e.boxType === 'prompt' && ie !== null && F() }, { immediate: !0 } ), watch( () => n.value, ie => { var oe, j ie && ((e.boxType === 'alert' || e.boxType === 'confirm') && (v.value = (j = (oe = g.value) == null ? void 0 : oe.$el) != null ? j : _.value), (l.zIndex = a())), e.boxType === 'prompt' && (ie ? nextTick().then(() => { var V k.value && k.value.$el && (v.value = (V = Y()) != null ? V : _.value) }) : ((l.editorErrorMessage = ''), (l.validateError = !1))) } ) const y = computed(() => e.draggable) useDraggable(_, b, y), onMounted(async () => { await nextTick(), e.closeOnHashChange && on$1(window, 'hashchange', w) }), onBeforeUnmount(() => { e.closeOnHashChange && off(window, 'hashchange', w) }) function w() { !n.value || ((n.value = !1), nextTick(() => { l.action && t('action', l.action) })) } const S = () => { e.closeOnClickModal && $(l.distinguishCancelAndClose ? 'close' : 'cancel') }, T = useSameTarget(S), A = ie => { if (l.inputType !== 'textarea') return ie.preventDefault(), $('confirm') }, $ = ie => { var oe ;(e.boxType === 'prompt' && ie === 'confirm' && !F()) || ((l.action = ie), l.beforeClose ? (oe = l.beforeClose) == null || oe.call(l, ie, l, w) : w()) }, F = () => { if (e.boxType === 'prompt') { const ie = l.inputPattern if (ie && !ie.test(l.inputValue || '')) return ( (l.editorErrorMessage = l.inputErrorMessage || r('el.messagebox.error')), (l.validateError = !0), !1 ) const oe = l.inputValidator if (typeof oe == 'function') { const j = oe(l.inputValue) if (j === !1) return ( (l.editorErrorMessage = l.inputErrorMessage || r('el.messagebox.error')), (l.validateError = !0), !1 ) if (typeof j == 'string') return (l.editorErrorMessage = j), (l.validateError = !0), !1 } } return (l.editorErrorMessage = ''), (l.validateError = !1), !0 }, Y = () => { const ie = k.value.$refs return ie.input || ie.textarea }, ae = () => { $('close') }, re = () => { e.closeOnPressEscape && ae() } return ( e.lockScroll && useLockscreen(n), useRestoreActive(n), pr(ar({}, toRefs(l)), { ns: o, overlayEvent: T, visible: n, hasMessage: f, typeClass: s, contentId: c, inputId: d, btnSize: u, iconComponent: m, confirmButtonClasses: x, rootRef: _, focusStartRef: v, headerRef: b, inputRef: k, confirmRef: g, doClose: w, handleClose: ae, onCloseRequested: re, handleWrapperClick: S, handleInputEnter: A, handleAction: $, t: r }) ) } }), _hoisted_1$1 = ['aria-label', 'aria-describedby'], _hoisted_2 = ['aria-label'], _hoisted_3 = ['id'] function _sfc_render$1(e, t, r, o, n, a) { const l = resolveComponent('el-icon'), s = resolveComponent('close'), c = resolveComponent('el-input'), d = resolveComponent('el-button'), u = resolveComponent('el-focus-trap'), m = resolveComponent('el-overlay') return ( openBlock(), createBlock( Transition, { name: 'fade-in-linear', onAfterLeave: t[11] || (t[11] = f => e.$emit('vanish')), persisted: '' }, { default: withCtx(() => [ withDirectives( createVNode( m, { 'z-index': e.zIndex, 'overlay-class': [e.ns.is('message-box'), e.modalClass], mask: e.modal }, { default: withCtx(() => [ createBaseVNode( 'div', { role: 'dialog', 'aria-label': e.title, 'aria-modal': 'true', 'aria-describedby': e.showInput ? void 0 : e.contentId, class: normalizeClass( `${e.ns.namespace.value}-overlay-message-box` ), onClick: t[8] || (t[8] = (...f) => e.overlayEvent.onClick && e.overlayEvent.onClick(...f)), onMousedown: t[9] || (t[9] = (...f) => e.overlayEvent.onMousedown && e.overlayEvent.onMousedown(...f)), onMouseup: t[10] || (t[10] = (...f) => e.overlayEvent.onMouseup && e.overlayEvent.onMouseup(...f)) }, [ createVNode( u, { loop: '', trapped: e.visible, 'focus-trap-el': e.rootRef, 'focus-start-el': e.focusStartRef, onReleaseRequested: e.onCloseRequested }, { default: withCtx(() => [ createBaseVNode( 'div', { ref: 'rootRef', class: normalizeClass([ e.ns.b(), e.customClass, e.ns.is('draggable', e.draggable), { [e.ns.m('center')]: e.center } ]), style: normalizeStyle(e.customStyle), tabindex: '-1', onClick: t[7] || (t[7] = withModifiers(() => {}, ['stop'])) }, [ e.title !== null && e.title !== void 0 ? (openBlock(), createElementBlock( 'div', { key: 0, ref: 'headerRef', class: normalizeClass(e.ns.e('header')) }, [ createBaseVNode( 'div', { class: normalizeClass( e.ns.e('title') ) }, [ e.iconComponent && e.center ? (openBlock(), createBlock( l, { key: 0, class: normalizeClass([ e.ns.e('status'), e.typeClass ]) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( e.iconComponent ) )) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0), createBaseVNode( 'span', null, toDisplayString(e.title), 1 ) ], 2 ), e.showClose ? (openBlock(), createElementBlock( 'button', { key: 0, type: 'button', class: normalizeClass( e.ns.e('headerbtn') ), 'aria-label': e.t( 'el.messagebox.close' ), onClick: t[0] || (t[0] = f => e.handleAction( e.distinguishCancelAndClose ? 'close' : 'cancel' )), onKeydown: t[1] || (t[1] = withKeys( withModifiers( f => e.handleAction( e.distinguishCancelAndClose ? 'close' : 'cancel' ), ['prevent'] ), ['enter'] )) }, [ createVNode( l, { class: normalizeClass( e.ns.e('close') ) }, { default: withCtx(() => [ createVNode(s) ]), _: 1 }, 8, ['class'] ) ], 42, _hoisted_2 )) : createCommentVNode('v-if', !0) ], 2 )) : createCommentVNode('v-if', !0), createBaseVNode( 'div', { id: e.contentId, class: normalizeClass(e.ns.e('content')) }, [ createBaseVNode( 'div', { class: normalizeClass( e.ns.e('container') ) }, [ e.iconComponent && !e.center && e.hasMessage ? (openBlock(), createBlock( l, { key: 0, class: normalizeClass([ e.ns.e('status'), e.typeClass ]) }, { default: withCtx(() => [ (openBlock(), createBlock( resolveDynamicComponent( e.iconComponent ) )) ]), _: 1 }, 8, ['class'] )) : createCommentVNode('v-if', !0), e.hasMessage ? (openBlock(), createElementBlock( 'div', { key: 1, class: normalizeClass( e.ns.e('message') ) }, [ renderSlot( e.$slots, 'default', {}, () => [ e.dangerouslyUseHTMLString ? (openBlock(), createBlock( resolveDynamicComponent( e.showInput ? 'label' : 'p' ), { key: 1, for: e.showInput ? e.inputId : void 0, innerHTML: e.message }, null, 8, ['for', 'innerHTML'] )) : (openBlock(), createBlock( resolveDynamicComponent( e.showInput ? 'label' : 'p' ), { key: 0, for: e.showInput ? e.inputId : void 0 }, { default: withCtx( () => [ createTextVNode( toDisplayString( e.dangerouslyUseHTMLString ? '' : e.message ), 1 ) ] ), _: 1 }, 8, ['for'] )) ] ) ], 2 )) : createCommentVNode('v-if', !0) ], 2 ), withDirectives( createBaseVNode( 'div', { class: normalizeClass(e.ns.e('input')) }, [ createVNode( c, { id: e.inputId, ref: 'inputRef', modelValue: e.inputValue, 'onUpdate:modelValue': t[2] || (t[2] = f => (e.inputValue = f)), type: e.inputType, placeholder: e.inputPlaceholder, 'aria-invalid': e.validateError, class: normalizeClass({ invalid: e.validateError }), onKeydown: withKeys( e.handleInputEnter, ['enter'] ) }, null, 8, [ 'id', 'modelValue', 'type', 'placeholder', 'aria-invalid', 'class', 'onKeydown' ] ), createBaseVNode( 'div', { class: normalizeClass( e.ns.e('errormsg') ), style: normalizeStyle({ visibility: e.editorErrorMessage ? 'visible' : 'hidden' }) }, toDisplayString( e.editorErrorMessage ), 7 ) ], 2 ), [[vShow, e.showInput]] ) ], 10, _hoisted_3 ), createBaseVNode( 'div', { class: normalizeClass(e.ns.e('btns')) }, [ e.showCancelButton ? (openBlock(), createBlock( d, { key: 0, loading: e.cancelButtonLoading, class: normalizeClass([ e.cancelButtonClass ]), round: e.roundButton, size: e.btnSize, onClick: t[3] || (t[3] = f => e.handleAction('cancel')), onKeydown: t[4] || (t[4] = withKeys( withModifiers( f => e.handleAction('cancel'), ['prevent'] ), ['enter'] )) }, { default: withCtx(() => [ createTextVNode( toDisplayString( e.cancelButtonText || e.t('el.messagebox.cancel') ), 1 ) ]), _: 1 }, 8, ['loading', 'class', 'round', 'size'] )) : createCommentVNode('v-if', !0), withDirectives( createVNode( d, { ref: 'confirmRef', type: 'primary', loading: e.confirmButtonLoading, class: normalizeClass([ e.confirmButtonClasses ]), round: e.roundButton, disabled: e.confirmButtonDisabled, size: e.btnSize, onClick: t[5] || (t[5] = f => e.handleAction('confirm')), onKeydown: t[6] || (t[6] = withKeys( withModifiers( f => e.handleAction('confirm'), ['prevent'] ), ['enter'] )) }, { default: withCtx(() => [ createTextVNode( toDisplayString( e.confirmButtonText || e.t('el.messagebox.confirm') ), 1 ) ]), _: 1 }, 8, [ 'loading', 'class', 'round', 'disabled', 'size' ] ), [[vShow, e.showConfirmButton]] ) ], 2 ) ], 6 ) ]), _: 3 }, 8, [ 'trapped', 'focus-trap-el', 'focus-start-el', 'onReleaseRequested' ] ) ], 42, _hoisted_1$1 ) ]), _: 3 }, 8, ['z-index', 'overlay-class', 'mask'] ), [[vShow, e.visible]] ) ]), _: 3 } ) ) } var MessageBoxConstructor = _export_sfc$1(_sfc_main$1, [ ['render', _sfc_render$1], [ '__file', '/home/runner/work/element-plus/element-plus/packages/components/message-box/src/index.vue' ] ]) const messageInstance = new Map(), initInstance = (e, t, r = null) => { const o = h(MessageBoxConstructor, e) return ( (o.appContext = r), render(o, t), document.body.appendChild(t.firstElementChild), o.component ) }, genContainer = () => document.createElement('div'), showMessage = (e, t) => { const r = genContainer() ;(e.onVanish = () => { render(null, r), messageInstance.delete(n) }), (e.onAction = a => { const l = messageInstance.get(n) let s e.showInput ? (s = { value: n.inputValue, action: a }) : (s = a), e.callback ? e.callback(s, o.proxy) : a === 'cancel' || a === 'close' ? e.distinguishCancelAndClose && a !== 'cancel' ? l.reject('close') : l.reject('cancel') : l.resolve(s) }) const o = initInstance(e, r, t), n = o.proxy for (const a in e) hasOwn$2(e, a) && !hasOwn$2(n.$props, a) && (n[a] = e[a]) return ( watch( () => n.message, (a, l) => { isVNode(a) ? (o.slots.default = () => [a]) : isVNode(l) && !isVNode(a) && delete o.slots.default }, { immediate: !0 } ), (n.visible = !0), n ) } function MessageBox(e, t = null) { if (!isClient) return Promise.reject() let r return ( isString$2(e) || isVNode(e) ? (e = { message: e }) : (r = e.callback), new Promise((o, n) => { const a = showMessage(e, t != null ? t : MessageBox._context) messageInstance.set(a, { options: e, callback: r, resolve: o, reject: n }) }) ) } const MESSAGE_BOX_VARIANTS = ['alert', 'confirm', 'prompt'], MESSAGE_BOX_DEFAULT_OPTS = { alert: { closeOnPressEscape: !1, closeOnClickModal: !1 }, confirm: { showCancelButton: !0 }, prompt: { showCancelButton: !0, showInput: !0 } } MESSAGE_BOX_VARIANTS.forEach(e => { MessageBox[e] = messageBoxFactory(e) }) function messageBoxFactory(e) { return (t, r, o, n) => { let a return ( isObject$2(r) ? ((o = r), (a = '')) : isUndefined(r) ? (a = '') : (a = r), MessageBox( Object.assign( ar({ title: a, message: t, type: '' }, MESSAGE_BOX_DEFAULT_OPTS[e]), o, { boxType: e } ), n ) ) } } MessageBox.close = () => { messageInstance.forEach((e, t) => { t.doClose() }), messageInstance.clear() } MessageBox._context = null const _MessageBox = MessageBox _MessageBox.install = e => { ;(_MessageBox._context = e._context), (e.config.globalProperties.$msgbox = _MessageBox), (e.config.globalProperties.$messageBox = _MessageBox), (e.config.globalProperties.$alert = _MessageBox.alert), (e.config.globalProperties.$confirm = _MessageBox.confirm), (e.config.globalProperties.$prompt = _MessageBox.prompt) } const ElMessageBox = _MessageBox var index$2 = (() => `.topNav{background:rgba(0,0,0,.2)}.logoWrap{margin-left:80px;margin-right:55px;width:113px;height:26px;cursor:pointer}.normalItem{color:#fff}.activeItem{color:#1ff0c9!important;font-weight:600}.activeItem:after{position:absolute;content:"";top:37px;left:25%;width:50%;height:3px;background-color:#1ff0c9;z-index:100;transform:scaleX(1);transition:all .5s;transform-origin:left}.activeItem:hover:after{transform:scaleX(1)}.itemCenter{position:relative;margin-right:74px;line-height:60px}.navWrap{position:fixed;width:100%;top:0px;z-index:1200}.headerSection{display:flex;flex-direction:row;align-items:center;justify-content:space-between;background-color:#383838;position:fixed;width:100%;top:0px;z-index:1200;height:60px;line-height:60px}.isdark.headerSection{background-color:#383838!important}.rightWrap{margin-right:130px}.top{background-color:rgba(0,0,0,.2)!important}.top.header-container{border-bottom:1px solid rgba(255,255,255,.2)}.wall{height:60px} `)(), logo = './assets/logo.5175680c.png', shams = function () { if ( typeof Symbol != 'function' || typeof Object.getOwnPropertySymbols != 'function' ) return !1 if (typeof Symbol.iterator == 'symbol') return !0 var t = {}, r = Symbol('test'), o = Object(r) if ( typeof r == 'string' || Object.prototype.toString.call(r) !== '[object Symbol]' || Object.prototype.toString.call(o) !== '[object Symbol]' ) return !1 var n = 42 t[r] = n for (r in t) return !1 if ( (typeof Object.keys == 'function' && Object.keys(t).length !== 0) || (typeof Object.getOwnPropertyNames == 'function' && Object.getOwnPropertyNames(t).length !== 0) ) return !1 var a = Object.getOwnPropertySymbols(t) if ( a.length !== 1 || a[0] !== r || !Object.prototype.propertyIsEnumerable.call(t, r) ) return !1 if (typeof Object.getOwnPropertyDescriptor == 'function') { var l = Object.getOwnPropertyDescriptor(t, r) if (l.value !== n || l.enumerable !== !0) return !1 } return !0 }, origSymbol = typeof Symbol != 'undefined' && Symbol, hasSymbolSham = shams, hasSymbols$1 = function () { return typeof origSymbol != 'function' || typeof Symbol != 'function' || typeof origSymbol('foo') != 'symbol' || typeof Symbol('bar') != 'symbol' ? !1 : hasSymbolSham() }, ERROR_MESSAGE = 'Function.prototype.bind called on incompatible ', slice = Array.prototype.slice, toStr$1 = Object.prototype.toString, funcType = '[object Function]', implementation$1 = function (t) { var r = this if (typeof r != 'function' || toStr$1.call(r) !== funcType) throw new TypeError(ERROR_MESSAGE + r) for ( var o = slice.call(arguments, 1), n, a = function () { if (this instanceof n) { var u = r.apply(this, o.concat(slice.call(arguments))) return Object(u) === u ? u : this } else return r.apply(t, o.concat(slice.call(arguments))) }, l = Math.max(0, r.length - o.length), s = [], c = 0; c < l; c++ ) s.push('$' + c) if ( ((n = Function( 'binder', 'return function (' + s.join(',') + '){ return binder.apply(this,arguments); }' )(a)), r.prototype) ) { var d = function () {} ;(d.prototype = r.prototype), (n.prototype = new d()), (d.prototype = null) } return n }, implementation = implementation$1, functionBind = Function.prototype.bind || implementation, bind$1 = functionBind, src$1 = bind$1.call(Function.call, Object.prototype.hasOwnProperty), undefined$1, $SyntaxError = SyntaxError, $Function = Function, $TypeError$1 = TypeError, getEvalledConstructor = function (e) { try { return $Function('"use strict"; return (' + e + ').constructor;')() } catch {} }, $gOPD = Object.getOwnPropertyDescriptor if ($gOPD) try { $gOPD({}, '') } catch { $gOPD = null } var throwTypeError = function () { throw new $TypeError$1() }, ThrowTypeError = $gOPD ? (function () { try { return arguments.callee, throwTypeError } catch { try { return $gOPD(arguments, 'callee').get } catch { return throwTypeError } } })() : throwTypeError, hasSymbols = hasSymbols$1(), getProto = Object.getPrototypeOf || function (e) { return e.__proto__ }, needsEval = {}, TypedArray = typeof Uint8Array == 'undefined' ? undefined$1 : getProto(Uint8Array), INTRINSICS = { '%AggregateError%': typeof AggregateError == 'undefined' ? undefined$1 : AggregateError, '%Array%': Array, '%ArrayBuffer%': typeof ArrayBuffer == 'undefined' ? undefined$1 : ArrayBuffer, '%ArrayIteratorPrototype%': hasSymbols ? getProto([][Symbol.iterator]()) : undefined$1, '%AsyncFromSyncIteratorPrototype%': undefined$1, '%AsyncFunction%': needsEval, '%AsyncGenerator%': needsEval, '%AsyncGeneratorFunction%': needsEval, '%AsyncIteratorPrototype%': needsEval, '%Atomics%': typeof Atomics == 'undefined' ? undefined$1 : Atomics, '%BigInt%': typeof BigInt == 'undefined' ? undefined$1 : BigInt, '%Boolean%': Boolean, '%DataView%': typeof DataView == 'undefined' ? undefined$1 : DataView, '%Date%': Date, '%decodeURI%': decodeURI, '%decodeURIComponent%': decodeURIComponent, '%encodeURI%': encodeURI, '%encodeURIComponent%': encodeURIComponent, '%Error%': Error, '%eval%': eval, '%EvalError%': EvalError, '%Float32Array%': typeof Float32Array == 'undefined' ? undefined$1 : Float32Array, '%Float64Array%': typeof Float64Array == 'undefined' ? undefined$1 : Float64Array, '%FinalizationRegistry%': typeof FinalizationRegistry == 'undefined' ? undefined$1 : FinalizationRegistry, '%Function%': $Function, '%GeneratorFunction%': needsEval, '%Int8Array%': typeof Int8Array == 'undefined' ? undefined$1 : Int8Array, '%Int16Array%': typeof Int16Array == 'undefined' ? undefined$1 : Int16Array, '%Int32Array%': typeof Int32Array == 'undefined' ? undefined$1 : Int32Array, '%isFinite%': isFinite, '%isNaN%': isNaN, '%IteratorPrototype%': hasSymbols ? getProto(getProto([][Symbol.iterator]())) : undefined$1, '%JSON%': typeof JSON == 'object' ? JSON : undefined$1, '%Map%': typeof Map == 'undefined' ? undefined$1 : Map, '%MapIteratorPrototype%': typeof Map == 'undefined' || !hasSymbols ? undefined$1 : getProto(new Map()[Symbol.iterator]()), '%Math%': Math, '%Number%': Number, '%Object%': Object, '%parseFloat%': parseFloat, '%parseInt%': parseInt, '%Promise%': typeof Promise == 'undefined' ? undefined$1 : Promise, '%Proxy%': typeof Proxy == 'undefined' ? undefined$1 : Proxy, '%RangeError%': RangeError, '%ReferenceError%': ReferenceError, '%Reflect%': typeof Reflect == 'undefined' ? undefined$1 : Reflect, '%RegExp%': RegExp, '%Set%': typeof Set == 'undefined' ? undefined$1 : Set, '%SetIteratorPrototype%': typeof Set == 'undefined' || !hasSymbols ? undefined$1 : getProto(new Set()[Symbol.iterator]()), '%SharedArrayBuffer%': typeof SharedArrayBuffer == 'undefined' ? undefined$1 : SharedArrayBuffer, '%String%': String, '%StringIteratorPrototype%': hasSymbols ? getProto(''[Symbol.iterator]()) : undefined$1, '%Symbol%': hasSymbols ? Symbol : undefined$1, '%SyntaxError%': $SyntaxError, '%ThrowTypeError%': ThrowTypeError, '%TypedArray%': TypedArray, '%TypeError%': $TypeError$1, '%Uint8Array%': typeof Uint8Array == 'undefined' ? undefined$1 : Uint8Array, '%Uint8ClampedArray%': typeof Uint8ClampedArray == 'undefined' ? undefined$1 : Uint8ClampedArray, '%Uint16Array%': typeof Uint16Array == 'undefined' ? undefined$1 : Uint16Array, '%Uint32Array%': typeof Uint32Array == 'undefined' ? undefined$1 : Uint32Array, '%URIError%': URIError, '%WeakMap%': typeof WeakMap == 'undefined' ? undefined$1 : WeakMap, '%WeakRef%': typeof WeakRef == 'undefined' ? undefined$1 : WeakRef, '%WeakSet%': typeof WeakSet == 'undefined' ? undefined$1 : WeakSet }, doEval = function e(t) { var r if (t === '%AsyncFunction%') r = getEvalledConstructor('async function () {}') else if (t === '%GeneratorFunction%') r = getEvalledConstructor('function* () {}') else if (t === '%AsyncGeneratorFunction%') r = getEvalledConstructor('async function* () {}') else if (t === '%AsyncGenerator%') { var o = e('%AsyncGeneratorFunction%') o && (r = o.prototype) } else if (t === '%AsyncIteratorPrototype%') { var n = e('%AsyncGenerator%') n && (r = getProto(n.prototype)) } return (INTRINSICS[t] = r), r }, LEGACY_ALIASES = { '%ArrayBufferPrototype%': ['ArrayBuffer', 'prototype'], '%ArrayPrototype%': ['Array', 'prototype'], '%ArrayProto_entries%': ['Array', 'prototype', 'entries'], '%ArrayProto_forEach%': ['Array', 'prototype', 'forEach'], '%ArrayProto_keys%': ['Array', 'prototype', 'keys'], '%ArrayProto_values%': ['Array', 'prototype', 'values'], '%AsyncFunctionPrototype%': ['AsyncFunction', 'prototype'], '%AsyncGenerator%': ['AsyncGeneratorFunction', 'prototype'], '%AsyncGeneratorPrototype%': [ 'AsyncGeneratorFunction', 'prototype', 'prototype' ], '%BooleanPrototype%': ['Boolean', 'prototype'], '%DataViewPrototype%': ['DataView', 'prototype'], '%DatePrototype%': ['Date', 'prototype'], '%ErrorPrototype%': ['Error', 'prototype'], '%EvalErrorPrototype%': ['EvalError', 'prototype'], '%Float32ArrayPrototype%': ['Float32Array', 'prototype'], '%Float64ArrayPrototype%': ['Float64Array', 'prototype'], '%FunctionPrototype%': ['Function', 'prototype'], '%Generator%': ['GeneratorFunction', 'prototype'], '%GeneratorPrototype%': ['GeneratorFunction', 'prototype', 'prototype'], '%Int8ArrayPrototype%': ['Int8Array', 'prototype'], '%Int16ArrayPrototype%': ['Int16Array', 'prototype'], '%Int32ArrayPrototype%': ['Int32Array', 'prototype'], '%JSONParse%': ['JSON', 'parse'], '%JSONStringify%': ['JSON', 'stringify'], '%MapPrototype%': ['Map', 'prototype'], '%NumberPrototype%': ['Number', 'prototype'], '%ObjectPrototype%': ['Object', 'prototype'], '%ObjProto_toString%': ['Object', 'prototype', 'toString'], '%ObjProto_valueOf%': ['Object', 'prototype', 'valueOf'], '%PromisePrototype%': ['Promise', 'prototype'], '%PromiseProto_then%': ['Promise', 'prototype', 'then'], '%Promise_all%': ['Promise', 'all'], '%Promise_reject%': ['Promise', 'reject'], '%Promise_resolve%': ['Promise', 'resolve'], '%RangeErrorPrototype%': ['RangeError', 'prototype'], '%ReferenceErrorPrototype%': ['ReferenceError', 'prototype'], '%RegExpPrototype%': ['RegExp', 'prototype'], '%SetPrototype%': ['Set', 'prototype'], '%SharedArrayBufferPrototype%': ['SharedArrayBuffer', 'prototype'], '%StringPrototype%': ['String', 'prototype'], '%SymbolPrototype%': ['Symbol', 'prototype'], '%SyntaxErrorPrototype%': ['SyntaxError', 'prototype'], '%TypedArrayPrototype%': ['TypedArray', 'prototype'], '%TypeErrorPrototype%': ['TypeError', 'prototype'], '%Uint8ArrayPrototype%': ['Uint8Array', 'prototype'], '%Uint8ClampedArrayPrototype%': ['Uint8ClampedArray', 'prototype'], '%Uint16ArrayPrototype%': ['Uint16Array', 'prototype'], '%Uint32ArrayPrototype%': ['Uint32Array', 'prototype'], '%URIErrorPrototype%': ['URIError', 'prototype'], '%WeakMapPrototype%': ['WeakMap', 'prototype'], '%WeakSetPrototype%': ['WeakSet', 'prototype'] }, bind = functionBind, hasOwn$1 = src$1, $concat$1 = bind.call(Function.call, Array.prototype.concat), $spliceApply = bind.call(Function.apply, Array.prototype.splice), $replace$1 = bind.call(Function.call, String.prototype.replace), $strSlice = bind.call(Function.call, String.prototype.slice), $exec = bind.call(Function.call, RegExp.prototype.exec), rePropName = /[^%.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|%$))/g, reEscapeChar = /\\(\\)?/g, stringToPath = function (t) { var r = $strSlice(t, 0, 1), o = $strSlice(t, -1) if (r === '%' && o !== '%') throw new $SyntaxError('invalid intrinsic syntax, expected closing `%`') if (o === '%' && r !== '%') throw new $SyntaxError('invalid intrinsic syntax, expected opening `%`') var n = [] return ( $replace$1(t, rePropName, function (a, l, s, c) { n[n.length] = s ? $replace$1(c, reEscapeChar, '$1') : l || a }), n ) }, getBaseIntrinsic = function (t, r) { var o = t, n if ( (hasOwn$1(LEGACY_ALIASES, o) && ((n = LEGACY_ALIASES[o]), (o = '%' + n[0] + '%')), hasOwn$1(INTRINSICS, o)) ) { var a = INTRINSICS[o] if ((a === needsEval && (a = doEval(o)), typeof a == 'undefined' && !r)) throw new $TypeError$1( 'intrinsic ' + t + ' exists, but is not available. Please file an issue!' ) return { alias: n, name: o, value: a } } throw new $SyntaxError('intrinsic ' + t + ' does not exist!') }, getIntrinsic = function (t, r) { if (typeof t != 'string' || t.length === 0) throw new $TypeError$1('intrinsic name must be a non-empty string') if (arguments.length > 1 && typeof r != 'boolean') throw new $TypeError$1('"allowMissing" argument must be a boolean') if ($exec(/^%?[^%]*%?$/g, t) === null) throw new $SyntaxError( '`%` may not be present anywhere but at the beginning and end of the intrinsic name' ) var o = stringToPath(t), n = o.length > 0 ? o[0] : '', a = getBaseIntrinsic('%' + n + '%', r), l = a.name, s = a.value, c = !1, d = a.alias d && ((n = d[0]), $spliceApply(o, $concat$1([0, 1], d))) for (var u = 1, m = !0; u < o.length; u += 1) { var f = o[u], _ = $strSlice(f, 0, 1), b = $strSlice(f, -1) if ( (_ === '"' || _ === "'" || _ === '`' || b === '"' || b === "'" || b === '`') && _ !== b ) throw new $SyntaxError( 'property names with quotes must have matching quotes' ) if ( ((f === 'constructor' || !m) && (c = !0), (n += '.' + f), (l = '%' + n + '%'), hasOwn$1(INTRINSICS, l)) ) s = INTRINSICS[l] else if (s != null) { if (!(f in s)) { if (!r) throw new $TypeError$1( 'base intrinsic for ' + t + ' exists, but the property is not available.' ) return } if ($gOPD && u + 1 >= o.length) { var v = $gOPD(s, f) ;(m = !!v), m && 'get' in v && !('originalValue' in v.get) ? (s = v.get) : (s = s[f]) } else (m = hasOwn$1(s, f)), (s = s[f]) m && !c && (INTRINSICS[l] = s) } } return s }, callBind$1 = { exports: {} } ;(function (e) { var t = functionBind, r = getIntrinsic, o = r('%Function.prototype.apply%'), n = r('%Function.prototype.call%'), a = r('%Reflect.apply%', !0) || t.call(n, o), l = r('%Object.getOwnPropertyDescriptor%', !0), s = r('%Object.defineProperty%', !0), c = r('%Math.max%') if (s) try { s({}, 'a', { value: 1 }) } catch { s = null } e.exports = function (m) { var f = a(t, n, arguments) if (l && s) { var _ = l(f, 'length') _.configurable && s(f, 'length', { value: 1 + c(0, m.length - (arguments.length - 1)) }) } return f } var d = function () { return a(t, o, arguments) } s ? s(e.exports, 'apply', { value: d }) : (e.exports.apply = d) })(callBind$1) var GetIntrinsic$1 = getIntrinsic, callBind = callBind$1.exports, $indexOf = callBind(GetIntrinsic$1('String.prototype.indexOf')), callBound$1 = function (t, r) { var o = GetIntrinsic$1(t, !!r) return typeof o == 'function' && $indexOf(t, '.prototype.') > -1 ? callBind(o) : o }, __viteBrowserExternal = {}, __viteBrowserExternal$1 = Object.freeze( Object.defineProperty( { __proto__: null, default: __viteBrowserExternal }, Symbol.toStringTag, { value: 'Module' } ) ), require$$0 = getAugmentedNamespace(__viteBrowserExternal$1), hasMap = typeof Map == 'function' && Map.prototype, mapSizeDescriptor = Object.getOwnPropertyDescriptor && hasMap ? Object.getOwnPropertyDescriptor(Map.prototype, 'size') : null, mapSize = hasMap && mapSizeDescriptor && typeof mapSizeDescriptor.get == 'function' ? mapSizeDescriptor.get : null, mapForEach = hasMap && Map.prototype.forEach, hasSet = typeof Set == 'function' && Set.prototype, setSizeDescriptor = Object.getOwnPropertyDescriptor && hasSet ? Object.getOwnPropertyDescriptor(Set.prototype, 'size') : null, setSize = hasSet && setSizeDescriptor && typeof setSizeDescriptor.get == 'function' ? setSizeDescriptor.get : null, setForEach = hasSet && Set.prototype.forEach, hasWeakMap = typeof WeakMap == 'function' && WeakMap.prototype, weakMapHas = hasWeakMap ? WeakMap.prototype.has : null, hasWeakSet = typeof WeakSet == 'function' && WeakSet.prototype, weakSetHas = hasWeakSet ? WeakSet.prototype.has : null, hasWeakRef = typeof WeakRef == 'function' && WeakRef.prototype, weakRefDeref = hasWeakRef ? WeakRef.prototype.deref : null, booleanValueOf = Boolean.prototype.valueOf, objectToString$1 = Object.prototype.toString, functionToString = Function.prototype.toString, $match = String.prototype.match, $slice = String.prototype.slice, $replace = String.prototype.replace, $toUpperCase = String.prototype.toUpperCase, $toLowerCase = String.prototype.toLowerCase, $test = RegExp.prototype.test, $concat = Array.prototype.concat, $join = Array.prototype.join, $arrSlice = Array.prototype.slice, $floor = Math.floor, bigIntValueOf = typeof BigInt == 'function' ? BigInt.prototype.valueOf : null, gOPS = Object.getOwnPropertySymbols, symToString = typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? Symbol.prototype.toString : null, hasShammedSymbols = typeof Symbol == 'function' && typeof Symbol.iterator == 'object', toStringTag = typeof Symbol == 'function' && Symbol.toStringTag && (typeof Symbol.toStringTag === hasShammedSymbols ? 'object' : 'symbol') ? Symbol.toStringTag : null, isEnumerable = Object.prototype.propertyIsEnumerable, gPO = (typeof Reflect == 'function' ? Reflect.getPrototypeOf : Object.getPrototypeOf) || ([].__proto__ === Array.prototype ? function (e) { return e.__proto__ } : null) function addNumericSeparator(e, t) { if ( e === 1 / 0 || e === -1 / 0 || e !== e || (e && e > -1e3 && e < 1e3) || $test.call(/e/, t) ) return t var r = /[0-9](?=(?:[0-9]{3})+(?![0-9]))/g if (typeof e == 'number') { var o = e < 0 ? -$floor(-e) : $floor(e) if (o !== e) { var n = String(o), a = $slice.call(t, n.length + 1) return ( $replace.call(n, r, '$&_') + '.' + $replace.call($replace.call(a, /([0-9]{3})/g, '$&_'), /_$/, '') ) } } return $replace.call(t, r, '$&_') } var utilInspect = require$$0, inspectCustom = utilInspect.custom, inspectSymbol = isSymbol(inspectCustom) ? inspectCustom : null, objectInspect = function e(t, r, o, n) { var a = r || {} if ( has$3(a, 'quoteStyle') && a.quoteStyle !== 'single' && a.quoteStyle !== 'double' ) throw new TypeError('option "quoteStyle" must be "single" or "double"') if ( has$3(a, 'maxStringLength') && (typeof a.maxStringLength == 'number' ? a.maxStringLength < 0 && a.maxStringLength !== 1 / 0 : a.maxStringLength !== null) ) throw new TypeError( 'option "maxStringLength", if provided, must be a positive integer, Infinity, or `null`' ) var l = has$3(a, 'customInspect') ? a.customInspect : !0 if (typeof l != 'boolean' && l !== 'symbol') throw new TypeError( 'option "customInspect", if provided, must be `true`, `false`, or `\'symbol\'`' ) if ( has$3(a, 'indent') && a.indent !== null && a.indent !== ' ' && !(parseInt(a.indent, 10) === a.indent && a.indent > 0) ) throw new TypeError( 'option "indent" must be "\\t", an integer > 0, or `null`' ) if (has$3(a, 'numericSeparator') && typeof a.numericSeparator != 'boolean') throw new TypeError( 'option "numericSeparator", if provided, must be `true` or `false`' ) var s = a.numericSeparator if (typeof t == 'undefined') return 'undefined' if (t === null) return 'null' if (typeof t == 'boolean') return t ? 'true' : 'false' if (typeof t == 'string') return inspectString(t, a) if (typeof t == 'number') { if (t === 0) return 1 / 0 / t > 0 ? '0' : '-0' var c = String(t) return s ? addNumericSeparator(t, c) : c } if (typeof t == 'bigint') { var d = String(t) + 'n' return s ? addNumericSeparator(t, d) : d } var u = typeof a.depth == 'undefined' ? 5 : a.depth if ( (typeof o == 'undefined' && (o = 0), o >= u && u > 0 && typeof t == 'object') ) return isArray$4(t) ? '[Array]' : '[Object]' var m = getIndent(a, o) if (typeof n == 'undefined') n = [] else if (indexOf(n, t) >= 0) return '[Circular]' function f(ie, oe, j) { if ((oe && ((n = $arrSlice.call(n)), n.push(oe)), j)) { var V = { depth: a.depth } return ( has$3(a, 'quoteStyle') && (V.quoteStyle = a.quoteStyle), e(ie, V, o + 1, n) ) } return e(ie, a, o + 1, n) } if (typeof t == 'function' && !isRegExp$1(t)) { var _ = nameOf(t), b = arrObjKeys(t, f) return ( '[Function' + (_ ? ': ' + _ : ' (anonymous)') + ']' + (b.length > 0 ? ' { ' + $join.call(b, ', ') + ' }' : '') ) } if (isSymbol(t)) { var v = hasShammedSymbols ? $replace.call(String(t), /^(Symbol\(.*\))_[^)]*$/, '$1') : symToString.call(t) return typeof t == 'object' && !hasShammedSymbols ? markBoxed(v) : v } if (isElement(t)) { for ( var k = '<' + $toLowerCase.call(String(t.nodeName)), g = t.attributes || [], x = 0; x < g.length; x++ ) k += ' ' + g[x].name + '=' + wrapQuotes(quote(g[x].value), 'double', a) return ( (k += '>'), t.childNodes && t.childNodes.length && (k += '...'), (k += ''), k ) } if (isArray$4(t)) { if (t.length === 0) return '[]' var y = arrObjKeys(t, f) return m && !singleLineValues(y) ? '[' + indentedJoin(y, m) + ']' : '[ ' + $join.call(y, ', ') + ' ]' } if (isError(t)) { var w = arrObjKeys(t, f) return !('cause' in Error.prototype) && 'cause' in t && !isEnumerable.call(t, 'cause') ? '{ [' + String(t) + '] ' + $join.call($concat.call('[cause]: ' + f(t.cause), w), ', ') + ' }' : w.length === 0 ? '[' + String(t) + ']' : '{ [' + String(t) + '] ' + $join.call(w, ', ') + ' }' } if (typeof t == 'object' && l) { if (inspectSymbol && typeof t[inspectSymbol] == 'function' && utilInspect) return utilInspect(t, { depth: u - o }) if (l !== 'symbol' && typeof t.inspect == 'function') return t.inspect() } if (isMap(t)) { var S = [] return ( mapForEach.call(t, function (ie, oe) { S.push(f(oe, t, !0) + ' => ' + f(ie, t)) }), collectionOf('Map', mapSize.call(t), S, m) ) } if (isSet(t)) { var T = [] return ( setForEach.call(t, function (ie) { T.push(f(ie, t)) }), collectionOf('Set', setSize.call(t), T, m) ) } if (isWeakMap(t)) return weakCollectionOf('WeakMap') if (isWeakSet(t)) return weakCollectionOf('WeakSet') if (isWeakRef(t)) return weakCollectionOf('WeakRef') if (isNumber(t)) return markBoxed(f(Number(t))) if (isBigInt(t)) return markBoxed(f(bigIntValueOf.call(t))) if (isBoolean(t)) return markBoxed(booleanValueOf.call(t)) if (isString(t)) return markBoxed(f(String(t))) if (!isDate$1(t) && !isRegExp$1(t)) { var A = arrObjKeys(t, f), $ = gPO ? gPO(t) === Object.prototype : t instanceof Object || t.constructor === Object, F = t instanceof Object ? '' : 'null prototype', Y = !$ && toStringTag && Object(t) === t && toStringTag in t ? $slice.call(toStr(t), 8, -1) : F ? 'Object' : '', ae = $ || typeof t.constructor != 'function' ? '' : t.constructor.name ? t.constructor.name + ' ' : '', re = ae + (Y || F ? '[' + $join.call($concat.call([], Y || [], F || []), ': ') + '] ' : '') return A.length === 0 ? re + '{}' : m ? re + '{' + indentedJoin(A, m) + '}' : re + '{ ' + $join.call(A, ', ') + ' }' } return String(t) } function wrapQuotes(e, t, r) { var o = (r.quoteStyle || t) === 'double' ? '"' : "'" return o + e + o } function quote(e) { return $replace.call(String(e), /"/g, '"') } function isArray$4(e) { return ( toStr(e) === '[object Array]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isDate$1(e) { return ( toStr(e) === '[object Date]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isRegExp$1(e) { return ( toStr(e) === '[object RegExp]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isError(e) { return ( toStr(e) === '[object Error]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isString(e) { return ( toStr(e) === '[object String]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isNumber(e) { return ( toStr(e) === '[object Number]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isBoolean(e) { return ( toStr(e) === '[object Boolean]' && (!toStringTag || !(typeof e == 'object' && toStringTag in e)) ) } function isSymbol(e) { if (hasShammedSymbols) return e && typeof e == 'object' && e instanceof Symbol if (typeof e == 'symbol') return !0 if (!e || typeof e != 'object' || !symToString) return !1 try { return symToString.call(e), !0 } catch {} return !1 } function isBigInt(e) { if (!e || typeof e != 'object' || !bigIntValueOf) return !1 try { return bigIntValueOf.call(e), !0 } catch {} return !1 } var hasOwn = Object.prototype.hasOwnProperty || function (e) { return e in this } function has$3(e, t) { return hasOwn.call(e, t) } function toStr(e) { return objectToString$1.call(e) } function nameOf(e) { if (e.name) return e.name var t = $match.call(functionToString.call(e), /^function\s*([\w$]+)/) return t ? t[1] : null } function indexOf(e, t) { if (e.indexOf) return e.indexOf(t) for (var r = 0, o = e.length; r < o; r++) if (e[r] === t) return r return -1 } function isMap(e) { if (!mapSize || !e || typeof e != 'object') return !1 try { mapSize.call(e) try { setSize.call(e) } catch { return !0 } return e instanceof Map } catch {} return !1 } function isWeakMap(e) { if (!weakMapHas || !e || typeof e != 'object') return !1 try { weakMapHas.call(e, weakMapHas) try { weakSetHas.call(e, weakSetHas) } catch { return !0 } return e instanceof WeakMap } catch {} return !1 } function isWeakRef(e) { if (!weakRefDeref || !e || typeof e != 'object') return !1 try { return weakRefDeref.call(e), !0 } catch {} return !1 } function isSet(e) { if (!setSize || !e || typeof e != 'object') return !1 try { setSize.call(e) try { mapSize.call(e) } catch { return !0 } return e instanceof Set } catch {} return !1 } function isWeakSet(e) { if (!weakSetHas || !e || typeof e != 'object') return !1 try { weakSetHas.call(e, weakSetHas) try { weakMapHas.call(e, weakMapHas) } catch { return !0 } return e instanceof WeakSet } catch {} return !1 } function isElement(e) { return !e || typeof e != 'object' ? !1 : typeof HTMLElement != 'undefined' && e instanceof HTMLElement ? !0 : typeof e.nodeName == 'string' && typeof e.getAttribute == 'function' } function inspectString(e, t) { if (e.length > t.maxStringLength) { var r = e.length - t.maxStringLength, o = '... ' + r + ' more character' + (r > 1 ? 's' : '') return inspectString($slice.call(e, 0, t.maxStringLength), t) + o } var n = $replace.call( $replace.call(e, /(['\\])/g, '\\$1'), /[\x00-\x1f]/g, lowbyte ) return wrapQuotes(n, 'single', t) } function lowbyte(e) { var t = e.charCodeAt(0), r = { 8: 'b', 9: 't', 10: 'n', 12: 'f', 13: 'r' }[t] return r ? '\\' + r : '\\x' + (t < 16 ? '0' : '') + $toUpperCase.call(t.toString(16)) } function markBoxed(e) { return 'Object(' + e + ')' } function weakCollectionOf(e) { return e + ' { ? }' } function collectionOf(e, t, r, o) { var n = o ? indentedJoin(r, o) : $join.call(r, ', ') return e + ' (' + t + ') {' + n + '}' } function singleLineValues(e) { for (var t = 0; t < e.length; t++) if ( indexOf( e[t], ` ` ) >= 0 ) return !1 return !0 } function getIndent(e, t) { var r if (e.indent === ' ') r = ' ' else if (typeof e.indent == 'number' && e.indent > 0) r = $join.call(Array(e.indent + 1), ' ') else return null return { base: r, prev: $join.call(Array(t + 1), r) } } function indentedJoin(e, t) { if (e.length === 0) return '' var r = ` ` + t.prev + t.base return ( r + $join.call(e, ',' + r) + ` ` + t.prev ) } function arrObjKeys(e, t) { var r = isArray$4(e), o = [] if (r) { o.length = e.length for (var n = 0; n < e.length; n++) o[n] = has$3(e, n) ? t(e[n], e) : '' } var a = typeof gOPS == 'function' ? gOPS(e) : [], l if (hasShammedSymbols) { l = {} for (var s = 0; s < a.length; s++) l['$' + a[s]] = a[s] } for (var c in e) !has$3(e, c) || (r && String(Number(c)) === c && c < e.length) || (hasShammedSymbols && l['$' + c] instanceof Symbol) || ($test.call(/[^\w$]/, c) ? o.push(t(c, e) + ': ' + t(e[c], e)) : o.push(c + ': ' + t(e[c], e))) if (typeof gOPS == 'function') for (var d = 0; d < a.length; d++) isEnumerable.call(e, a[d]) && o.push('[' + t(a[d]) + ']: ' + t(e[a[d]], e)) return o } var GetIntrinsic = getIntrinsic, callBound = callBound$1, inspect = objectInspect, $TypeError = GetIntrinsic('%TypeError%'), $WeakMap = GetIntrinsic('%WeakMap%', !0), $Map = GetIntrinsic('%Map%', !0), $weakMapGet = callBound('WeakMap.prototype.get', !0), $weakMapSet = callBound('WeakMap.prototype.set', !0), $weakMapHas = callBound('WeakMap.prototype.has', !0), $mapGet = callBound('Map.prototype.get', !0), $mapSet = callBound('Map.prototype.set', !0), $mapHas = callBound('Map.prototype.has', !0), listGetNode = function (e, t) { for (var r = e, o; (o = r.next) !== null; r = o) if (o.key === t) return (r.next = o.next), (o.next = e.next), (e.next = o), o }, listGet = function (e, t) { var r = listGetNode(e, t) return r && r.value }, listSet = function (e, t, r) { var o = listGetNode(e, t) o ? (o.value = r) : (e.next = { key: t, next: e.next, value: r }) }, listHas = function (e, t) { return !!listGetNode(e, t) }, sideChannel = function () { var t, r, o, n = { assert: function (a) { if (!n.has(a)) throw new $TypeError('Side channel does not contain ' + inspect(a)) }, get: function (a) { if ( $WeakMap && a && (typeof a == 'object' || typeof a == 'function') ) { if (t) return $weakMapGet(t, a) } else if ($Map) { if (r) return $mapGet(r, a) } else if (o) return listGet(o, a) }, has: function (a) { if ( $WeakMap && a && (typeof a == 'object' || typeof a == 'function') ) { if (t) return $weakMapHas(t, a) } else if ($Map) { if (r) return $mapHas(r, a) } else if (o) return listHas(o, a) return !1 }, set: function (a, l) { $WeakMap && a && (typeof a == 'object' || typeof a == 'function') ? (t || (t = new $WeakMap()), $weakMapSet(t, a, l)) : $Map ? (r || (r = new $Map()), $mapSet(r, a, l)) : (o || (o = { key: {}, next: null }), listSet(o, a, l)) } } return n }, replace = String.prototype.replace, percentTwenties = /%20/g, Format = { RFC1738: 'RFC1738', RFC3986: 'RFC3986' }, formats$3 = { default: Format.RFC3986, formatters: { RFC1738: function (e) { return replace.call(e, percentTwenties, '+') }, RFC3986: function (e) { return String(e) } }, RFC1738: Format.RFC1738, RFC3986: Format.RFC3986 }, formats$2 = formats$3, has$2 = Object.prototype.hasOwnProperty, isArray$3 = Array.isArray, hexTable = (function () { for (var e = [], t = 0; t < 256; ++t) e.push('%' + ((t < 16 ? '0' : '') + t.toString(16)).toUpperCase()) return e })(), compactQueue = function (t) { for (; t.length > 1; ) { var r = t.pop(), o = r.obj[r.prop] if (isArray$3(o)) { for (var n = [], a = 0; a < o.length; ++a) typeof o[a] != 'undefined' && n.push(o[a]) r.obj[r.prop] = n } } }, arrayToObject = function (t, r) { for ( var o = r && r.plainObjects ? Object.create(null) : {}, n = 0; n < t.length; ++n ) typeof t[n] != 'undefined' && (o[n] = t[n]) return o }, merge = function e(t, r, o) { if (!r) return t if (typeof r != 'object') { if (isArray$3(t)) t.push(r) else if (t && typeof t == 'object') ((o && (o.plainObjects || o.allowPrototypes)) || !has$2.call(Object.prototype, r)) && (t[r] = !0) else return [t, r] return t } if (!t || typeof t != 'object') return [t].concat(r) var n = t return ( isArray$3(t) && !isArray$3(r) && (n = arrayToObject(t, o)), isArray$3(t) && isArray$3(r) ? (r.forEach(function (a, l) { if (has$2.call(t, l)) { var s = t[l] s && typeof s == 'object' && a && typeof a == 'object' ? (t[l] = e(s, a, o)) : t.push(a) } else t[l] = a }), t) : Object.keys(r).reduce(function (a, l) { var s = r[l] return has$2.call(a, l) ? (a[l] = e(a[l], s, o)) : (a[l] = s), a }, n) ) }, assign$2 = function (t, r) { return Object.keys(r).reduce(function (o, n) { return (o[n] = r[n]), o }, t) }, decode$2 = function (e, t, r) { var o = e.replace(/\+/g, ' ') if (r === 'iso-8859-1') return o.replace(/%[0-9a-f]{2}/gi, unescape) try { return decodeURIComponent(o) } catch { return o } }, encode = function (t, r, o, n, a) { if (t.length === 0) return t var l = t if ( (typeof t == 'symbol' ? (l = Symbol.prototype.toString.call(t)) : typeof t != 'string' && (l = String(t)), o === 'iso-8859-1') ) return escape(l).replace(/%u[0-9a-f]{4}/gi, function (u) { return '%26%23' + parseInt(u.slice(2), 16) + '%3B' }) for (var s = '', c = 0; c < l.length; ++c) { var d = l.charCodeAt(c) if ( d === 45 || d === 46 || d === 95 || d === 126 || (d >= 48 && d <= 57) || (d >= 65 && d <= 90) || (d >= 97 && d <= 122) || (a === formats$2.RFC1738 && (d === 40 || d === 41)) ) { s += l.charAt(c) continue } if (d < 128) { s = s + hexTable[d] continue } if (d < 2048) { s = s + (hexTable[192 | (d >> 6)] + hexTable[128 | (d & 63)]) continue } if (d < 55296 || d >= 57344) { s = s + (hexTable[224 | (d >> 12)] + hexTable[128 | ((d >> 6) & 63)] + hexTable[128 | (d & 63)]) continue } ;(c += 1), (d = 65536 + (((d & 1023) << 10) | (l.charCodeAt(c) & 1023))), (s += hexTable[240 | (d >> 18)] + hexTable[128 | ((d >> 12) & 63)] + hexTable[128 | ((d >> 6) & 63)] + hexTable[128 | (d & 63)]) } return s }, compact = function (t) { for ( var r = [{ obj: { o: t }, prop: 'o' }], o = [], n = 0; n < r.length; ++n ) for ( var a = r[n], l = a.obj[a.prop], s = Object.keys(l), c = 0; c < s.length; ++c ) { var d = s[c], u = l[d] typeof u == 'object' && u !== null && o.indexOf(u) === -1 && (r.push({ obj: l, prop: d }), o.push(u)) } return compactQueue(r), t }, isRegExp = function (t) { return Object.prototype.toString.call(t) === '[object RegExp]' }, isBuffer = function (t) { return !t || typeof t != 'object' ? !1 : !!(t.constructor && t.constructor.isBuffer && t.constructor.isBuffer(t)) }, combine = function (t, r) { return [].concat(t, r) }, maybeMap = function (t, r) { if (isArray$3(t)) { for (var o = [], n = 0; n < t.length; n += 1) o.push(r(t[n])) return o } return r(t) }, utils$2 = { arrayToObject, assign: assign$2, combine, compact, decode: decode$2, encode, isBuffer, isRegExp, maybeMap, merge }, getSideChannel = sideChannel, utils$1 = utils$2, formats$1 = formats$3, has$1 = Object.prototype.hasOwnProperty, arrayPrefixGenerators = { brackets: function (t) { return t + '[]' }, comma: 'comma', indices: function (t, r) { return t + '[' + r + ']' }, repeat: function (t) { return t } }, isArray$2 = Array.isArray, split = String.prototype.split, push = Array.prototype.push, pushToArray = function (e, t) { push.apply(e, isArray$2(t) ? t : [t]) }, toISO = Date.prototype.toISOString, defaultFormat = formats$1.default, defaults$1 = { addQueryPrefix: !1, allowDots: !1, charset: 'utf-8', charsetSentinel: !1, delimiter: '&', encode: !0, encoder: utils$1.encode, encodeValuesOnly: !1, format: defaultFormat, formatter: formats$1.formatters[defaultFormat], indices: !1, serializeDate: function (t) { return toISO.call(t) }, skipNulls: !1, strictNullHandling: !1 }, isNonNullishPrimitive = function (t) { return ( typeof t == 'string' || typeof t == 'number' || typeof t == 'boolean' || typeof t == 'symbol' || typeof t == 'bigint' ) }, sentinel = {}, stringify$1 = function e(t, r, o, n, a, l, s, c, d, u, m, f, _, b, v) { for ( var k = t, g = v, x = 0, y = !1; (g = g.get(sentinel)) !== void 0 && !y; ) { var w = g.get(t) if (((x += 1), typeof w != 'undefined')) { if (w === x) throw new RangeError('Cyclic object value') y = !0 } typeof g.get(sentinel) == 'undefined' && (x = 0) } if ( (typeof s == 'function' ? (k = s(r, k)) : k instanceof Date ? (k = u(k)) : o === 'comma' && isArray$2(k) && (k = utils$1.maybeMap(k, function (M) { return M instanceof Date ? u(M) : M })), k === null) ) { if (n) return l && !_ ? l(r, defaults$1.encoder, b, 'key', m) : r k = '' } if (isNonNullishPrimitive(k) || utils$1.isBuffer(k)) { if (l) { var S = _ ? r : l(r, defaults$1.encoder, b, 'key', m) if (o === 'comma' && _) { for ( var T = split.call(String(k), ','), A = '', $ = 0; $ < T.length; ++$ ) A += ($ === 0 ? '' : ',') + f(l(T[$], defaults$1.encoder, b, 'value', m)) return [f(S) + (isArray$2(k) && T.length === 1 ? '[]' : '') + '=' + A] } return [f(S) + '=' + f(l(k, defaults$1.encoder, b, 'value', m))] } return [f(r) + '=' + f(String(k))] } var F = [] if (typeof k == 'undefined') return F var Y if (o === 'comma' && isArray$2(k)) Y = [{ value: k.length > 0 ? k.join(',') || null : void 0 }] else if (isArray$2(s)) Y = s else { var ae = Object.keys(k) Y = c ? ae.sort(c) : ae } for ( var re = o === 'comma' && isArray$2(k) && k.length === 1 ? r + '[]' : r, ie = 0; ie < Y.length; ++ie ) { var oe = Y[ie], j = typeof oe == 'object' && typeof oe.value != 'undefined' ? oe.value : k[oe] if (!(a && j === null)) { var V = isArray$2(k) ? typeof o == 'function' ? o(re, oe) : re : re + (d ? '.' + oe : '[' + oe + ']') v.set(t, x) var z = getSideChannel() z.set(sentinel, v), pushToArray(F, e(j, V, o, n, a, l, s, c, d, u, m, f, _, b, z)) } } return F }, normalizeStringifyOptions = function (t) { if (!t) return defaults$1 if ( t.encoder !== null && typeof t.encoder != 'undefined' && typeof t.encoder != 'function' ) throw new TypeError('Encoder has to be a function.') var r = t.charset || defaults$1.charset if ( typeof t.charset != 'undefined' && t.charset !== 'utf-8' && t.charset !== 'iso-8859-1' ) throw new TypeError( 'The charset option must be either utf-8, iso-8859-1, or undefined' ) var o = formats$1.default if (typeof t.format != 'undefined') { if (!has$1.call(formats$1.formatters, t.format)) throw new TypeError('Unknown format option provided.') o = t.format } var n = formats$1.formatters[o], a = defaults$1.filter return ( (typeof t.filter == 'function' || isArray$2(t.filter)) && (a = t.filter), { addQueryPrefix: typeof t.addQueryPrefix == 'boolean' ? t.addQueryPrefix : defaults$1.addQueryPrefix, allowDots: typeof t.allowDots == 'undefined' ? defaults$1.allowDots : !!t.allowDots, charset: r, charsetSentinel: typeof t.charsetSentinel == 'boolean' ? t.charsetSentinel : defaults$1.charsetSentinel, delimiter: typeof t.delimiter == 'undefined' ? defaults$1.delimiter : t.delimiter, encode: typeof t.encode == 'boolean' ? t.encode : defaults$1.encode, encoder: typeof t.encoder == 'function' ? t.encoder : defaults$1.encoder, encodeValuesOnly: typeof t.encodeValuesOnly == 'boolean' ? t.encodeValuesOnly : defaults$1.encodeValuesOnly, filter: a, format: o, formatter: n, serializeDate: typeof t.serializeDate == 'function' ? t.serializeDate : defaults$1.serializeDate, skipNulls: typeof t.skipNulls == 'boolean' ? t.skipNulls : defaults$1.skipNulls, sort: typeof t.sort == 'function' ? t.sort : null, strictNullHandling: typeof t.strictNullHandling == 'boolean' ? t.strictNullHandling : defaults$1.strictNullHandling } ) }, stringify_1 = function (e, t) { var r = e, o = normalizeStringifyOptions(t), n, a typeof o.filter == 'function' ? ((a = o.filter), (r = a('', r))) : isArray$2(o.filter) && ((a = o.filter), (n = a)) var l = [] if (typeof r != 'object' || r === null) return '' var s t && t.arrayFormat in arrayPrefixGenerators ? (s = t.arrayFormat) : t && 'indices' in t ? (s = t.indices ? 'indices' : 'repeat') : (s = 'indices') var c = arrayPrefixGenerators[s] n || (n = Object.keys(r)), o.sort && n.sort(o.sort) for (var d = getSideChannel(), u = 0; u < n.length; ++u) { var m = n[u] ;(o.skipNulls && r[m] === null) || pushToArray( l, stringify$1( r[m], m, c, o.strictNullHandling, o.skipNulls, o.encode ? o.encoder : null, o.filter, o.sort, o.allowDots, o.serializeDate, o.format, o.formatter, o.encodeValuesOnly, o.charset, d ) ) } var f = l.join(o.delimiter), _ = o.addQueryPrefix === !0 ? '?' : '' return ( o.charsetSentinel && (o.charset === 'iso-8859-1' ? (_ += 'utf8=%26%2310003%3B&') : (_ += 'utf8=%E2%9C%93&')), f.length > 0 ? _ + f : '' ) }, utils = utils$2, has = Object.prototype.hasOwnProperty, isArray$1 = Array.isArray, defaults = { allowDots: !1, allowPrototypes: !1, allowSparse: !1, arrayLimit: 20, charset: 'utf-8', charsetSentinel: !1, comma: !1, decoder: utils.decode, delimiter: '&', depth: 5, ignoreQueryPrefix: !1, interpretNumericEntities: !1, parameterLimit: 1e3, parseArrays: !0, plainObjects: !1, strictNullHandling: !1 }, interpretNumericEntities = function (e) { return e.replace(/&#(\d+);/g, function (t, r) { return String.fromCharCode(parseInt(r, 10)) }) }, parseArrayValue = function (e, t) { return e && typeof e == 'string' && t.comma && e.indexOf(',') > -1 ? e.split(',') : e }, isoSentinel = 'utf8=%26%2310003%3B', charsetSentinel = 'utf8=%E2%9C%93', parseValues = function (t, r) { var o = {}, n = r.ignoreQueryPrefix ? t.replace(/^\?/, '') : t, a = r.parameterLimit === 1 / 0 ? void 0 : r.parameterLimit, l = n.split(r.delimiter, a), s = -1, c, d = r.charset if (r.charsetSentinel) for (c = 0; c < l.length; ++c) l[c].indexOf('utf8=') === 0 && (l[c] === charsetSentinel ? (d = 'utf-8') : l[c] === isoSentinel && (d = 'iso-8859-1'), (s = c), (c = l.length)) for (c = 0; c < l.length; ++c) if (c !== s) { var u = l[c], m = u.indexOf(']='), f = m === -1 ? u.indexOf('=') : m + 1, _, b f === -1 ? ((_ = r.decoder(u, defaults.decoder, d, 'key')), (b = r.strictNullHandling ? null : '')) : ((_ = r.decoder(u.slice(0, f), defaults.decoder, d, 'key')), (b = utils.maybeMap( parseArrayValue(u.slice(f + 1), r), function (v) { return r.decoder(v, defaults.decoder, d, 'value') } ))), b && r.interpretNumericEntities && d === 'iso-8859-1' && (b = interpretNumericEntities(b)), u.indexOf('[]=') > -1 && (b = isArray$1(b) ? [b] : b), has.call(o, _) ? (o[_] = utils.combine(o[_], b)) : (o[_] = b) } return o }, parseObject = function (e, t, r, o) { for (var n = o ? t : parseArrayValue(t, r), a = e.length - 1; a >= 0; --a) { var l, s = e[a] if (s === '[]' && r.parseArrays) l = [].concat(n) else { l = r.plainObjects ? Object.create(null) : {} var c = s.charAt(0) === '[' && s.charAt(s.length - 1) === ']' ? s.slice(1, -1) : s, d = parseInt(c, 10) !r.parseArrays && c === '' ? (l = { 0: n }) : !isNaN(d) && s !== c && String(d) === c && d >= 0 && r.parseArrays && d <= r.arrayLimit ? ((l = []), (l[d] = n)) : c !== '__proto__' && (l[c] = n) } n = l } return n }, parseKeys = function (t, r, o, n) { if (!!t) { var a = o.allowDots ? t.replace(/\.([^.[]+)/g, '[$1]') : t, l = /(\[[^[\]]*])/, s = /(\[[^[\]]*])/g, c = o.depth > 0 && l.exec(a), d = c ? a.slice(0, c.index) : a, u = [] if (d) { if ( !o.plainObjects && has.call(Object.prototype, d) && !o.allowPrototypes ) return u.push(d) } for ( var m = 0; o.depth > 0 && (c = s.exec(a)) !== null && m < o.depth; ) { if ( ((m += 1), !o.plainObjects && has.call(Object.prototype, c[1].slice(1, -1)) && !o.allowPrototypes) ) return u.push(c[1]) } return c && u.push('[' + a.slice(c.index) + ']'), parseObject(u, r, o, n) } }, normalizeParseOptions = function (t) { if (!t) return defaults if ( t.decoder !== null && t.decoder !== void 0 && typeof t.decoder != 'function' ) throw new TypeError('Decoder has to be a function.') if ( typeof t.charset != 'undefined' && t.charset !== 'utf-8' && t.charset !== 'iso-8859-1' ) throw new TypeError( 'The charset option must be either utf-8, iso-8859-1, or undefined' ) var r = typeof t.charset == 'undefined' ? defaults.charset : t.charset return { allowDots: typeof t.allowDots == 'undefined' ? defaults.allowDots : !!t.allowDots, allowPrototypes: typeof t.allowPrototypes == 'boolean' ? t.allowPrototypes : defaults.allowPrototypes, allowSparse: typeof t.allowSparse == 'boolean' ? t.allowSparse : defaults.allowSparse, arrayLimit: typeof t.arrayLimit == 'number' ? t.arrayLimit : defaults.arrayLimit, charset: r, charsetSentinel: typeof t.charsetSentinel == 'boolean' ? t.charsetSentinel : defaults.charsetSentinel, comma: typeof t.comma == 'boolean' ? t.comma : defaults.comma, decoder: typeof t.decoder == 'function' ? t.decoder : defaults.decoder, delimiter: typeof t.delimiter == 'string' || utils.isRegExp(t.delimiter) ? t.delimiter : defaults.delimiter, depth: typeof t.depth == 'number' || t.depth === !1 ? +t.depth : defaults.depth, ignoreQueryPrefix: t.ignoreQueryPrefix === !0, interpretNumericEntities: typeof t.interpretNumericEntities == 'boolean' ? t.interpretNumericEntities : defaults.interpretNumericEntities, parameterLimit: typeof t.parameterLimit == 'number' ? t.parameterLimit : defaults.parameterLimit, parseArrays: t.parseArrays !== !1, plainObjects: typeof t.plainObjects == 'boolean' ? t.plainObjects : defaults.plainObjects, strictNullHandling: typeof t.strictNullHandling == 'boolean' ? t.strictNullHandling : defaults.strictNullHandling } }, parse$1 = function (e, t) { var r = normalizeParseOptions(t) if (e === '' || e === null || typeof e == 'undefined') return r.plainObjects ? Object.create(null) : {} for ( var o = typeof e == 'string' ? parseValues(e, r) : e, n = r.plainObjects ? Object.create(null) : {}, a = Object.keys(o), l = 0; l < a.length; ++l ) { var s = a[l], c = parseKeys(s, o[s], r, typeof e == 'string') n = utils.merge(n, c, r) } return r.allowSparse === !0 ? n : utils.compact(n) }, stringify = stringify_1, parse = parse$1, formats = formats$3, lib = { formats, parse, stringify }, global$1 = (typeof globalThis != 'undefined' && globalThis) || (typeof self != 'undefined' && self) || (typeof global$1 != 'undefined' && global$1), support = { searchParams: 'URLSearchParams' in global$1, iterable: 'Symbol' in global$1 && 'iterator' in Symbol, blob: 'FileReader' in global$1 && 'Blob' in global$1 && (function () { try { return new Blob(), !0 } catch { return !1 } })(), formData: 'FormData' in global$1, arrayBuffer: 'ArrayBuffer' in global$1 } function isDataView(e) { return e && DataView.prototype.isPrototypeOf(e) } if (support.arrayBuffer) var viewClasses = [ '[object Int8Array]', '[object Uint8Array]', '[object Uint8ClampedArray]', '[object Int16Array]', '[object Uint16Array]', '[object Int32Array]', '[object Uint32Array]', '[object Float32Array]', '[object Float64Array]' ], isArrayBufferView = ArrayBuffer.isView || function (e) { return e && viewClasses.indexOf(Object.prototype.toString.call(e)) > -1 } function normalizeName(e) { if ( (typeof e != 'string' && (e = String(e)), /[^a-z0-9\-#$%&'*+.^_`|~!]/i.test(e) || e === '') ) throw new TypeError('Invalid character in header field name: "' + e + '"') return e.toLowerCase() } function normalizeValue(e) { return typeof e != 'string' && (e = String(e)), e } function iteratorFor(e) { var t = { next: function () { var r = e.shift() return { done: r === void 0, value: r } } } return ( support.iterable && (t[Symbol.iterator] = function () { return t }), t ) } function Headers$1(e) { ;(this.map = {}), e instanceof Headers$1 ? e.forEach(function (t, r) { this.append(r, t) }, this) : Array.isArray(e) ? e.forEach(function (t) { this.append(t[0], t[1]) }, this) : e && Object.getOwnPropertyNames(e).forEach(function (t) { this.append(t, e[t]) }, this) } Headers$1.prototype.append = function (e, t) { ;(e = normalizeName(e)), (t = normalizeValue(t)) var r = this.map[e] this.map[e] = r ? r + ', ' + t : t } Headers$1.prototype.delete = function (e) { delete this.map[normalizeName(e)] } Headers$1.prototype.get = function (e) { return (e = normalizeName(e)), this.has(e) ? this.map[e] : null } Headers$1.prototype.has = function (e) { return this.map.hasOwnProperty(normalizeName(e)) } Headers$1.prototype.set = function (e, t) { this.map[normalizeName(e)] = normalizeValue(t) } Headers$1.prototype.forEach = function (e, t) { for (var r in this.map) this.map.hasOwnProperty(r) && e.call(t, this.map[r], r, this) } Headers$1.prototype.keys = function () { var e = [] return ( this.forEach(function (t, r) { e.push(r) }), iteratorFor(e) ) } Headers$1.prototype.values = function () { var e = [] return ( this.forEach(function (t) { e.push(t) }), iteratorFor(e) ) } Headers$1.prototype.entries = function () { var e = [] return ( this.forEach(function (t, r) { e.push([r, t]) }), iteratorFor(e) ) } support.iterable && (Headers$1.prototype[Symbol.iterator] = Headers$1.prototype.entries) function consumed(e) { if (e.bodyUsed) return Promise.reject(new TypeError('Already read')) e.bodyUsed = !0 } function fileReaderReady(e) { return new Promise(function (t, r) { ;(e.onload = function () { t(e.result) }), (e.onerror = function () { r(e.error) }) }) } function readBlobAsArrayBuffer(e) { var t = new FileReader(), r = fileReaderReady(t) return t.readAsArrayBuffer(e), r } function readBlobAsText(e) { var t = new FileReader(), r = fileReaderReady(t) return t.readAsText(e), r } function readArrayBufferAsText(e) { for ( var t = new Uint8Array(e), r = new Array(t.length), o = 0; o < t.length; o++ ) r[o] = String.fromCharCode(t[o]) return r.join('') } function bufferClone(e) { if (e.slice) return e.slice(0) var t = new Uint8Array(e.byteLength) return t.set(new Uint8Array(e)), t.buffer } function Body() { return ( (this.bodyUsed = !1), (this._initBody = function (e) { ;(this.bodyUsed = this.bodyUsed), (this._bodyInit = e), e ? typeof e == 'string' ? (this._bodyText = e) : support.blob && Blob.prototype.isPrototypeOf(e) ? (this._bodyBlob = e) : support.formData && FormData.prototype.isPrototypeOf(e) ? (this._bodyFormData = e) : support.searchParams && URLSearchParams.prototype.isPrototypeOf(e) ? (this._bodyText = e.toString()) : support.arrayBuffer && support.blob && isDataView(e) ? ((this._bodyArrayBuffer = bufferClone(e.buffer)), (this._bodyInit = new Blob([this._bodyArrayBuffer]))) : support.arrayBuffer && (ArrayBuffer.prototype.isPrototypeOf(e) || isArrayBufferView(e)) ? (this._bodyArrayBuffer = bufferClone(e)) : (this._bodyText = e = Object.prototype.toString.call(e)) : (this._bodyText = ''), this.headers.get('content-type') || (typeof e == 'string' ? this.headers.set('content-type', 'text/plain;charset=UTF-8') : this._bodyBlob && this._bodyBlob.type ? this.headers.set('content-type', this._bodyBlob.type) : support.searchParams && URLSearchParams.prototype.isPrototypeOf(e) && this.headers.set( 'content-type', 'application/x-www-form-urlencoded;charset=UTF-8' )) }), support.blob && ((this.blob = function () { var e = consumed(this) if (e) return e if (this._bodyBlob) return Promise.resolve(this._bodyBlob) if (this._bodyArrayBuffer) return Promise.resolve(new Blob([this._bodyArrayBuffer])) if (this._bodyFormData) throw new Error('could not read FormData body as blob') return Promise.resolve(new Blob([this._bodyText])) }), (this.arrayBuffer = function () { if (this._bodyArrayBuffer) { var e = consumed(this) return ( e || (ArrayBuffer.isView(this._bodyArrayBuffer) ? Promise.resolve( this._bodyArrayBuffer.buffer.slice( this._bodyArrayBuffer.byteOffset, this._bodyArrayBuffer.byteOffset + this._bodyArrayBuffer.byteLength ) ) : Promise.resolve(this._bodyArrayBuffer)) ) } else return this.blob().then(readBlobAsArrayBuffer) })), (this.text = function () { var e = consumed(this) if (e) return e if (this._bodyBlob) return readBlobAsText(this._bodyBlob) if (this._bodyArrayBuffer) return Promise.resolve(readArrayBufferAsText(this._bodyArrayBuffer)) if (this._bodyFormData) throw new Error('could not read FormData body as text') return Promise.resolve(this._bodyText) }), support.formData && (this.formData = function () { return this.text().then(decode$1) }), (this.json = function () { return this.text().then(JSON.parse) }), this ) } var methods = ['DELETE', 'GET', 'HEAD', 'OPTIONS', 'POST', 'PUT'] function normalizeMethod(e) { var t = e.toUpperCase() return methods.indexOf(t) > -1 ? t : e } function Request(e, t) { if (!(this instanceof Request)) throw new TypeError( 'Please use the "new" operator, this DOM object constructor cannot be called as a function.' ) t = t || {} var r = t.body if (e instanceof Request) { if (e.bodyUsed) throw new TypeError('Already read') ;(this.url = e.url), (this.credentials = e.credentials), t.headers || (this.headers = new Headers$1(e.headers)), (this.method = e.method), (this.mode = e.mode), (this.signal = e.signal), !r && e._bodyInit != null && ((r = e._bodyInit), (e.bodyUsed = !0)) } else this.url = String(e) if ( ((this.credentials = t.credentials || this.credentials || 'same-origin'), (t.headers || !this.headers) && (this.headers = new Headers$1(t.headers)), (this.method = normalizeMethod(t.method || this.method || 'GET')), (this.mode = t.mode || this.mode || null), (this.signal = t.signal || this.signal), (this.referrer = null), (this.method === 'GET' || this.method === 'HEAD') && r) ) throw new TypeError('Body not allowed for GET or HEAD requests') if ( (this._initBody(r), (this.method === 'GET' || this.method === 'HEAD') && (t.cache === 'no-store' || t.cache === 'no-cache')) ) { var o = /([?&])_=[^&]*/ if (o.test(this.url)) this.url = this.url.replace(o, '$1_=' + new Date().getTime()) else { var n = /\?/ this.url += (n.test(this.url) ? '&' : '?') + '_=' + new Date().getTime() } } } Request.prototype.clone = function () { return new Request(this, { body: this._bodyInit }) } function decode$1(e) { var t = new FormData() return ( e .trim() .split('&') .forEach(function (r) { if (r) { var o = r.split('='), n = o.shift().replace(/\+/g, ' '), a = o.join('=').replace(/\+/g, ' ') t.append(decodeURIComponent(n), decodeURIComponent(a)) } }), t ) } function parseHeaders(e) { var t = new Headers$1(), r = e.replace(/\r?\n[\t ]+/g, ' ') return ( r .split('\r') .map(function (o) { return o.indexOf(` `) === 0 ? o.substr(1, o.length) : o }) .forEach(function (o) { var n = o.split(':'), a = n.shift().trim() if (a) { var l = n.join(':').trim() t.append(a, l) } }), t ) } Body.call(Request.prototype) function Response(e, t) { if (!(this instanceof Response)) throw new TypeError( 'Please use the "new" operator, this DOM object constructor cannot be called as a function.' ) t || (t = {}), (this.type = 'default'), (this.status = t.status === void 0 ? 200 : t.status), (this.ok = this.status >= 200 && this.status < 300), (this.statusText = t.statusText === void 0 ? '' : '' + t.statusText), (this.headers = new Headers$1(t.headers)), (this.url = t.url || ''), this._initBody(e) } Body.call(Response.prototype) Response.prototype.clone = function () { return new Response(this._bodyInit, { status: this.status, statusText: this.statusText, headers: new Headers$1(this.headers), url: this.url }) } Response.error = function () { var e = new Response(null, { status: 0, statusText: '' }) return (e.type = 'error'), e } var redirectStatuses = [301, 302, 303, 307, 308] Response.redirect = function (e, t) { if (redirectStatuses.indexOf(t) === -1) throw new RangeError('Invalid status code') return new Response(null, { status: t, headers: { location: e } }) } var DOMException = global$1.DOMException try { new DOMException() } catch { ;(DOMException = function (t, r) { ;(this.message = t), (this.name = r) var o = Error(t) this.stack = o.stack }), (DOMException.prototype = Object.create(Error.prototype)), (DOMException.prototype.constructor = DOMException) } function fetch$1(e, t) { return new Promise(function (r, o) { var n = new Request(e, t) if (n.signal && n.signal.aborted) return o(new DOMException('Aborted', 'AbortError')) var a = new XMLHttpRequest() function l() { a.abort() } ;(a.onload = function () { var c = { status: a.status, statusText: a.statusText, headers: parseHeaders(a.getAllResponseHeaders() || '') } c.url = 'responseURL' in a ? a.responseURL : c.headers.get('X-Request-URL') var d = 'response' in a ? a.response : a.responseText setTimeout(function () { r(new Response(d, c)) }, 0) }), (a.onerror = function () { setTimeout(function () { o(new TypeError('Network request failed')) }, 0) }), (a.ontimeout = function () { setTimeout(function () { o(new TypeError('Network request failed')) }, 0) }), (a.onabort = function () { setTimeout(function () { o(new DOMException('Aborted', 'AbortError')) }, 0) }) function s(c) { try { return c === '' && global$1.location.href ? global$1.location.href : c } catch { return c } } a.open(n.method, s(n.url), !0), n.credentials === 'include' ? (a.withCredentials = !0) : n.credentials === 'omit' && (a.withCredentials = !1), 'responseType' in a && (support.blob ? (a.responseType = 'blob') : support.arrayBuffer && n.headers.get('Content-Type') && n.headers .get('Content-Type') .indexOf('application/octet-stream') !== -1 && (a.responseType = 'arraybuffer')), t && typeof t.headers == 'object' && !(t.headers instanceof Headers$1) ? Object.getOwnPropertyNames(t.headers).forEach(function (c) { a.setRequestHeader(c, normalizeValue(t.headers[c])) }) : n.headers.forEach(function (c, d) { a.setRequestHeader(d, c) }), n.signal && (n.signal.addEventListener('abort', l), (a.onreadystatechange = function () { a.readyState === 4 && n.signal.removeEventListener('abort', l) })), a.send(typeof n._bodyInit == 'undefined' ? null : n._bodyInit) }) } fetch$1.polyfill = !0 global$1.fetch || ((global$1.fetch = fetch$1), (global$1.Headers = Headers$1), (global$1.Request = Request), (global$1.Response = Response)) self.fetch.bind(self) function ownKeys(e, t) { var r = Object.keys(e) if (Object.getOwnPropertySymbols) { var o = Object.getOwnPropertySymbols(e) t && (o = o.filter(function (n) { return Object.getOwnPropertyDescriptor(e, n).enumerable })), r.push.apply(r, o) } return r } function _objectSpread2(e) { for (var t = 1; t < arguments.length; t++) { var r = arguments[t] != null ? arguments[t] : {} t % 2 ? ownKeys(Object(r), !0).forEach(function (o) { _defineProperty(e, o, r[o]) }) : Object.getOwnPropertyDescriptors ? Object.defineProperties(e, Object.getOwnPropertyDescriptors(r)) : ownKeys(Object(r)).forEach(function (o) { Object.defineProperty(e, o, Object.getOwnPropertyDescriptor(r, o)) }) } return e } function _typeof(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof = function (t) { return typeof t }) : (_typeof = function (t) { return t && typeof Symbol == 'function' && t.constructor === Symbol && t !== Symbol.prototype ? 'symbol' : typeof t }), _typeof(e) ) } function _classCallCheck(e, t) { if (!(e instanceof t)) throw new TypeError('Cannot call a class as a function') } function _defineProperties(e, t) { for (var r = 0; r < t.length; r++) { var o = t[r] ;(o.enumerable = o.enumerable || !1), (o.configurable = !0), 'value' in o && (o.writable = !0), Object.defineProperty(e, o.key, o) } } function _createClass(e, t, r) { return t && _defineProperties(e.prototype, t), r && _defineProperties(e, r), e } function _defineProperty(e, t, r) { return ( t in e ? Object.defineProperty(e, t, { value: r, enumerable: !0, configurable: !0, writable: !0 }) : (e[t] = r), e ) } function _inherits(e, t) { if (typeof t != 'function' && t !== null) throw new TypeError('Super expression must either be null or a function') ;(e.prototype = Object.create(t && t.prototype, { constructor: { value: e, writable: !0, configurable: !0 } })), t && _setPrototypeOf(e, t) } function _getPrototypeOf(e) { return ( (_getPrototypeOf = Object.setPrototypeOf ? Object.getPrototypeOf : function (r) { return r.__proto__ || Object.getPrototypeOf(r) }), _getPrototypeOf(e) ) } function _setPrototypeOf(e, t) { return ( (_setPrototypeOf = Object.setPrototypeOf || function (o, n) { return (o.__proto__ = n), o }), _setPrototypeOf(e, t) ) } function _isNativeReflectConstruct() { if ( typeof Reflect == 'undefined' || !Reflect.construct || Reflect.construct.sham ) return !1 if (typeof Proxy == 'function') return !0 try { return ( Boolean.prototype.valueOf.call( Reflect.construct(Boolean, [], function () {}) ), !0 ) } catch { return !1 } } function _construct(e, t, r) { return ( _isNativeReflectConstruct() ? (_construct = Reflect.construct) : (_construct = function (n, a, l) { var s = [null] s.push.apply(s, a) var c = Function.bind.apply(n, s), d = new c() return l && _setPrototypeOf(d, l.prototype), d }), _construct.apply(null, arguments) ) } function _isNativeFunction(e) { return Function.toString.call(e).indexOf('[native code]') !== -1 } function _wrapNativeSuper(e) { var t = typeof Map == 'function' ? new Map() : void 0 return ( (_wrapNativeSuper = function (o) { if (o === null || !_isNativeFunction(o)) return o if (typeof o != 'function') throw new TypeError( 'Super expression must either be null or a function' ) if (typeof t != 'undefined') { if (t.has(o)) return t.get(o) t.set(o, n) } function n() { return _construct(o, arguments, _getPrototypeOf(this).constructor) } return ( (n.prototype = Object.create(o.prototype, { constructor: { value: n, enumerable: !1, writable: !0, configurable: !0 } })), _setPrototypeOf(n, o) ) }), _wrapNativeSuper(e) ) } function _assertThisInitialized(e) { if (e === void 0) throw new ReferenceError( "this hasn't been initialised - super() hasn't been called" ) return e } function _possibleConstructorReturn(e, t) { if (t && (typeof t == 'object' || typeof t == 'function')) return t if (t !== void 0) throw new TypeError( 'Derived constructors may only return object or undefined' ) return _assertThisInitialized(e) } function _createSuper(e) { var t = _isNativeReflectConstruct() return function () { var o = _getPrototypeOf(e), n if (t) { var a = _getPrototypeOf(this).constructor n = Reflect.construct(o, arguments, a) } else n = o.apply(this, arguments) return _possibleConstructorReturn(this, n) } } function _toConsumableArray(e) { return ( _arrayWithoutHoles(e) || _iterableToArray(e) || _unsupportedIterableToArray(e) || _nonIterableSpread() ) } function _arrayWithoutHoles(e) { if (Array.isArray(e)) return _arrayLikeToArray(e) } function _iterableToArray(e) { if ( (typeof Symbol != 'undefined' && e[Symbol.iterator] != null) || e['@@iterator'] != null ) return Array.from(e) } function _unsupportedIterableToArray(e, t) { if (!!e) { if (typeof e == 'string') return _arrayLikeToArray(e, t) var r = Object.prototype.toString.call(e).slice(8, -1) if ( (r === 'Object' && e.constructor && (r = e.constructor.name), r === 'Map' || r === 'Set') ) return Array.from(e) if (r === 'Arguments' || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(r)) return _arrayLikeToArray(e, t) } } function _arrayLikeToArray(e, t) { ;(t == null || t > e.length) && (t = e.length) for (var r = 0, o = new Array(t); r < t; r++) o[r] = e[r] return o } function _nonIterableSpread() { throw new TypeError(`Invalid attempt to spread non-iterable instance. In order to be iterable, non-array objects must have a [Symbol.iterator]() method.`) } function compose(e) { if (!Array.isArray(e)) throw new TypeError('Middlewares must be an array!') for (var t = e.length, r = 0; r < t; r++) if (typeof e[r] != 'function') throw new TypeError('Middleware must be componsed of function') return function (n, a) { var l = -1 function s(c) { if (c <= l) return Promise.reject( new Error( 'next() should not be called multiple times in one middleware!' ) ) l = c var d = e[c] || a if (!d) return Promise.resolve() try { return Promise.resolve( d(n, function () { return s(c + 1) }) ) } catch (u) { return Promise.reject(u) } } return s(0) } } var Onion = (function () { function e(t) { if ((_classCallCheck(this, e), !Array.isArray(t))) throw new TypeError('Default middlewares must be an array!') ;(this.defaultMiddlewares = _toConsumableArray(t)), (this.middlewares = []) } return ( _createClass(e, [ { key: 'use', value: function (r) { var o = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : { global: !1, core: !1, defaultInstance: !1 }, n = !1, a = !1, l = !1 if ( (typeof o == 'number' ? (process && process.env, (n = !0), (a = !1)) : _typeof(o) === 'object' && o && ((a = o.global || !1), (n = o.core || !1), (l = o.defaultInstance || !1)), a) ) { e.globalMiddlewares.splice( e.globalMiddlewares.length - e.defaultGlobalMiddlewaresLength, 0, r ) return } if (n) { e.coreMiddlewares.splice( e.coreMiddlewares.length - e.defaultCoreMiddlewaresLength, 0, r ) return } if (l) { this.defaultMiddlewares.push(r) return } this.middlewares.push(r) } }, { key: 'execute', value: function () { var r = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : null, o = compose( [].concat( _toConsumableArray(this.middlewares), _toConsumableArray(this.defaultMiddlewares), _toConsumableArray(e.globalMiddlewares), _toConsumableArray(e.coreMiddlewares) ) ) return o(r) } } ]), e ) })() Onion.globalMiddlewares = [] Onion.defaultGlobalMiddlewaresLength = 0 Onion.coreMiddlewares = [] Onion.defaultCoreMiddlewaresLength = 0 var MapCache = (function () { function e(t) { _classCallCheck(this, e), (this.cache = new Map()), (this.timer = {}), this.extendOptions(t) } return ( _createClass(e, [ { key: 'extendOptions', value: function (r) { this.maxCache = r.maxCache || 0 } }, { key: 'get', value: function (r) { return this.cache.get(JSON.stringify(r)) } }, { key: 'set', value: function (r, o) { var n = this, a = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : 6e4 if (this.maxCache > 0 && this.cache.size >= this.maxCache) { var l = _toConsumableArray(this.cache.keys())[0] this.cache.delete(l), this.timer[l] && clearTimeout(this.timer[l]) } var s = JSON.stringify(r) this.cache.set(s, o), a > 0 && (this.timer[s] = setTimeout(function () { n.cache.delete(s), delete n.timer[s] }, a)) } }, { key: 'delete', value: function (r) { var o = JSON.stringify(r) return delete this.timer[o], this.cache.delete(o) } }, { key: 'clear', value: function () { return (this.timer = {}), this.cache.clear() } } ]), e ) })(), RequestError = (function (e) { _inherits(r, e) var t = _createSuper(r) function r(o, n) { var a, l = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : 'RequestError' return ( _classCallCheck(this, r), (a = t.call(this, o)), (a.name = 'RequestError'), (a.request = n), (a.type = l), a ) } return r })(_wrapNativeSuper(Error)), ResponseError = (function (e) { _inherits(r, e) var t = _createSuper(r) function r(o, n, a, l) { var s, c = arguments.length > 4 && arguments[4] !== void 0 ? arguments[4] : 'ResponseError' return ( _classCallCheck(this, r), (s = t.call(this, n || o.statusText)), (s.name = 'ResponseError'), (s.data = a), (s.response = o), (s.request = l), (s.type = c), s ) } return r })(_wrapNativeSuper(Error)) function readerGBK(e) { return new Promise(function (t, r) { var o = new FileReader() ;(o.onload = function () { t(o.result) }), (o.onerror = r), o.readAsText(e, 'GBK') }) } function safeJsonParse(e) { var t = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : !1, r = arguments.length > 2 && arguments[2] !== void 0 ? arguments[2] : null, o = arguments.length > 3 && arguments[3] !== void 0 ? arguments[3] : null try { return JSON.parse(e) } catch { if (t) throw new ResponseError(r, 'JSON.parse fail', e, o, 'ParseError') } return e } function timeout2Throw(e, t, r) { return new Promise(function (o, n) { setTimeout(function () { n( new RequestError( t || 'timeout of '.concat(e, 'ms exceeded'), r, 'Timeout' ) ) }, e) }) } function cancel2Throw(e) { return new Promise(function (t, r) { e.cancelToken && e.cancelToken.promise.then(function (o) { r(o) }) }) } var toString = Object.prototype.toString function getEnv() { var e return ( typeof process != 'undefined' && toString.call(process) === '[object process]' && (e = 'NODE'), typeof XMLHttpRequest != 'undefined' && (e = 'BROWSER'), e ) } function isArray(e) { return ( _typeof(e) === 'object' && Object.prototype.toString.call(e) === '[object Array]' ) } function isURLSearchParams(e) { return typeof URLSearchParams != 'undefined' && e instanceof URLSearchParams } function isDate(e) { return ( _typeof(e) === 'object' && Object.prototype.toString.call(e) === '[object Date]' ) } function isObject(e) { return e !== null && _typeof(e) === 'object' } function forEach2ObjArr(e, t) { if (!!e) if ((_typeof(e) !== 'object' && (e = [e]), isArray(e))) for (var r = 0; r < e.length; r++) t.call(null, e[r], r, e) else for (var o in e) Object.prototype.hasOwnProperty.call(e, o) && t.call(null, e[o], o, e) } function getParamObject(e) { return isURLSearchParams(e) ? lib.parse(e.toString(), { strictNullHandling: !0 }) : typeof e == 'string' ? [e] : e } function reqStringify(e) { return lib.stringify(e, { arrayFormat: 'repeat', strictNullHandling: !0 }) } function mergeRequestOptions(e, t) { return _objectSpread2( _objectSpread2(_objectSpread2({}, e), t), {}, { headers: _objectSpread2(_objectSpread2({}, e.headers), t.headers), params: _objectSpread2( _objectSpread2({}, getParamObject(e.params)), getParamObject(t.params) ), method: (t.method || e.method || 'get').toLowerCase() } ) } var addfix = function (t) { var r = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, o = r.prefix, n = r.suffix return ( o && (t = ''.concat(o).concat(t)), n && (t = ''.concat(t).concat(n)), { url: t, options: r } ) }, warnedCoreType = !1 function __defaultValidateCache(e, t) { var r = t.method, o = r === void 0 ? 'get' : r return o.toLowerCase() === 'get' } function fetchMiddleware(e, t) { if (!e) return t() var r = e.req r = r === void 0 ? {} : r var o = r.options, n = o === void 0 ? {} : o, a = r.url, l = a === void 0 ? '' : a, s = e.cache, c = e.responseInterceptors, d = n.timeout, u = d === void 0 ? 0 : d, m = n.timeoutMessage, f = n.__umiRequestCoreType__, _ = f === void 0 ? 'normal' : f, b = n.useCache, v = b === void 0 ? !1 : b, k = n.method, g = k === void 0 ? 'get' : k, x = n.params, y = n.ttl, w = n.validateCache, S = w === void 0 ? __defaultValidateCache : w if (_ !== 'normal') return process && process.env, t() var T = fetch if (!T) throw new Error('Global fetch not exist!') var A = getEnv() === 'BROWSER', $ = S(l, n) && v && A if ($) { var F = s.get({ url: l, params: x, method: g }) if (F) return (F = F.clone()), (F.useCache = !0), (e.res = F), t() } var Y return ( u > 0 ? (Y = Promise.race([ cancel2Throw(n), T(l, n), timeout2Throw(u, m, e.req) ])) : (Y = Promise.race([cancel2Throw(n), T(l, n)])), c.forEach(function (ae) { Y = Y.then(function (re) { var ie = typeof re.clone == 'function' ? re.clone() : re return ae(ie, n) }) }), Y.then(function (ae) { if ($ && ae.status === 200) { var re = ae.clone() ;(re.useCache = !0), s.set({ url: l, params: x, method: g }, re, y) } return (e.res = ae), t() }) ) } function parseResponseMiddleware(e, t) { var r return t() .then(function () { if (!!e) { var o = e.res, n = o === void 0 ? {} : o, a = e.req, l = a === void 0 ? {} : a, s = l || {}, c = s.options c = c === void 0 ? {} : c var d = c.responseType, u = d === void 0 ? 'json' : d, m = c.charset, f = m === void 0 ? 'utf8' : m c.getResponse var _ = c.throwErrIfParseFail, b = _ === void 0 ? !1 : _, v = c.parseResponse, k = v === void 0 ? !0 : v if (!!k && !(!n || !n.clone)) { if ( ((r = getEnv() === 'BROWSER' ? n.clone() : n), (r.useCache = n.useCache || !1), f === 'gbk') ) try { return n .blob() .then(readerGBK) .then(function (g) { return safeJsonParse(g, !1, r, l) }) } catch (g) { throw new ResponseError(r, g.message, null, l, 'ParseError') } else if (u === 'json') return n.text().then(function (g) { return safeJsonParse(g, b, r, l) }) try { return n[u]() } catch { throw new ResponseError( r, 'responseType not support', null, l, 'ParseError' ) } } } }) .then(function (o) { if (!!e) { e.res var n = e.req, a = n === void 0 ? {} : n, l = a || {}, s = l.options s = s === void 0 ? {} : s var c = s.getResponse, d = c === void 0 ? !1 : c if (!!r) { if (r.status >= 200 && r.status < 300) { if (d) { e.res = { data: o, response: r } return } e.res = o return } throw new ResponseError(r, 'http error', o, a, 'HttpError') } } }) .catch(function (o) { if (o instanceof RequestError || o instanceof ResponseError) throw o var n = e.req, a = e.res throw ( ((o.request = o.request || n), (o.response = o.response || a), (o.type = o.type || o.name), (o.data = o.data || void 0), o) ) }) } function simplePostMiddleware(e, t) { if (!e) return t() var r = e.req r = r === void 0 ? {} : r var o = r.options, n = o === void 0 ? {} : o, a = n.method, l = a === void 0 ? 'get' : a if (['post', 'put', 'patch', 'delete'].indexOf(l.toLowerCase()) === -1) return t() var s = n.requestType, c = s === void 0 ? 'json' : s, d = n.data if (d) { var u = Object.prototype.toString.call(d) u === '[object Object]' || u === '[object Array]' ? c === 'json' ? ((n.headers = _objectSpread2( { Accept: 'application/json', 'Content-Type': 'application/json;charset=UTF-8' }, n.headers )), (n.body = JSON.stringify(d))) : c === 'form' && ((n.headers = _objectSpread2( { Accept: 'application/json', 'Content-Type': 'application/x-www-form-urlencoded;charset=UTF-8' }, n.headers )), (n.body = reqStringify(d))) : ((n.headers = _objectSpread2( { Accept: 'application/json' }, n.headers )), (n.body = d)) } return (e.req.options = n), t() } function paramsSerialize(e, t) { var r, o if (e) if (t) r = t(e) else if (isURLSearchParams(e)) r = e.toString() else if (isArray(e)) (o = []), forEach2ObjArr(e, function (a) { a === null || typeof a == 'undefined' ? o.push(a) : o.push(isObject(a) ? JSON.stringify(a) : a) }), (r = reqStringify(o)) else { ;(o = {}), forEach2ObjArr(e, function (a, l) { var s = a a === null || typeof a == 'undefined' ? (o[l] = a) : isDate(a) ? (s = a.toISOString()) : isArray(a) ? (s = a) : isObject(a) && (s = JSON.stringify(a)), (o[l] = s) }) var n = reqStringify(o) r = n } return r } function simpleGetMiddleware(e, t) { if (!e) return t() var r = e.req r = r === void 0 ? {} : r var o = r.options, n = o === void 0 ? {} : o, a = n.paramsSerializer, l = n.params, s = e.req s = s === void 0 ? {} : s var c = s.url, d = c === void 0 ? '' : c ;(n.method = n.method ? n.method.toUpperCase() : 'GET'), (n.credentials = n.credentials || 'same-origin') var u = paramsSerialize(l, a) if (((e.req.originUrl = d), u)) { var m = d.indexOf('?') !== -1 ? '&' : '?' e.req.url = ''.concat(d).concat(m).concat(u) } return (e.req.options = n), t() } var globalMiddlewares = [ simplePostMiddleware, simpleGetMiddleware, parseResponseMiddleware ], coreMiddlewares = [fetchMiddleware] Onion.globalMiddlewares = globalMiddlewares Onion.defaultGlobalMiddlewaresLength = globalMiddlewares.length Onion.coreMiddlewares = coreMiddlewares Onion.defaultCoreMiddlewaresLength = coreMiddlewares.length var Core = (function () { function e(t) { _classCallCheck(this, e), (this.onion = new Onion([])), (this.fetchIndex = 0), (this.mapCache = new MapCache(t)), (this.initOptions = t), (this.instanceRequestInterceptors = []), (this.instanceResponseInterceptors = []) } return ( _createClass( e, [ { key: 'use', value: function (r) { var o = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : { global: !1, core: !1 } return this.onion.use(r, o), this } }, { key: 'extendOptions', value: function (r) { ;(this.initOptions = mergeRequestOptions(this.initOptions, r)), this.mapCache.extendOptions(r) } }, { key: 'dealRequestInterceptors', value: function (r) { var o = function (l, s) { return l.then(function () { var c = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {} return ( (r.req.url = c.url || r.req.url), (r.req.options = c.options || r.req.options), s(r.req.url, r.req.options) ) }) }, n = [].concat( _toConsumableArray(e.requestInterceptors), _toConsumableArray(this.instanceRequestInterceptors) ) return n.reduce(o, Promise.resolve()).then(function () { var a = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {} return ( (r.req.url = a.url || r.req.url), (r.req.options = a.options || r.req.options), Promise.resolve() ) }) } }, { key: 'request', value: function (r, o) { var n = this, a = this.onion, l = { req: { url: r, options: _objectSpread2(_objectSpread2({}, o), {}, { url: r }) }, res: null, cache: this.mapCache, responseInterceptors: [].concat( _toConsumableArray(e.responseInterceptors), _toConsumableArray(this.instanceResponseInterceptors) ) } if (typeof r != 'string') throw new Error('url MUST be a string') return new Promise(function (s, c) { n.dealRequestInterceptors(l) .then(function () { return a.execute(l) }) .then(function () { s(l.res) }) .catch(function (d) { var u = l.req.options.errorHandler if (u) try { var m = u(d) s(m) } catch (f) { c(f) } else c(d) }) }) } } ], [ { key: 'requestUse', value: function (r) { var o = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : { global: !0 } if (typeof r != 'function') throw new TypeError('Interceptor must be function!') o.global ? e.requestInterceptors.push(r) : this.instanceRequestInterceptors.push(r) } }, { key: 'responseUse', value: function (r) { var o = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : { global: !0 } if (typeof r != 'function') throw new TypeError('Interceptor must be function!') o.global ? e.responseInterceptors.push(r) : this.instanceResponseInterceptors.push(r) } } ] ), e ) })() Core.requestInterceptors = [addfix] Core.responseInterceptors = [] function Cancel(e) { this.message = e } Cancel.prototype.toString = function () { return this.message ? 'Cancel: '.concat(this.message) : 'Cancel' } Cancel.prototype.__CANCEL__ = !0 function CancelToken(e) { if (typeof e != 'function') throw new TypeError('executor must be a function.') var t this.promise = new Promise(function (n) { t = n }) var r = this e(function (n) { r.reason || ((r.reason = new Cancel(n)), t(r.reason)) }) } CancelToken.prototype.throwIfRequested = function () { if (this.reason) throw this.reason } CancelToken.source = function () { var t, r = new CancelToken(function (n) { t = n }) return { token: r, cancel: t } } function isCancel(e) { return !!(e && e.__CANCEL__) } var request$1 = function () { var t = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {}, r = new Core(t), o = function (l) { var s = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, c = mergeRequestOptions(r.initOptions, s) return r.request(l, c) } ;(o.use = r.use.bind(r)), (o.fetchIndex = r.fetchIndex), (o.interceptors = { request: { use: Core.requestUse.bind(r) }, response: { use: Core.responseUse.bind(r) } }) var n = ['get', 'post', 'delete', 'put', 'patch', 'head', 'options', 'rpc'] return ( n.forEach(function (a) { o[a] = function (l, s) { return o(l, _objectSpread2(_objectSpread2({}, s), {}, { method: a })) } }), (o.Cancel = Cancel), (o.CancelToken = CancelToken), (o.isCancel = isCancel), (o.extendOptions = r.extendOptions.bind(r)), (o.middlewares = { instance: r.onion.middlewares, defaultInstance: r.onion.defaultMiddlewares, global: Onion.globalMiddlewares, core: Onion.coreMiddlewares }), o ) }, extend = function (t) { return request$1(t) } request$1({ parseResponse: !1 }) var request$1$1 = request$1({}), lodash_isempty = { exports: {} } ;(function (e, t) { var r = 9007199254740991, o = '[object Arguments]', n = '[object Function]', a = '[object GeneratorFunction]', l = '[object Map]', s = '[object Object]', c = '[object Promise]', d = '[object Set]', u = '[object WeakMap]', m = '[object DataView]', f = /[\\^$.*+?()[\]{}|]/g, _ = /^\[object .+?Constructor\]$/, b = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal, v = typeof self == 'object' && self && self.Object === Object && self, k = b || v || Function('return this')(), g = t && !t.nodeType && t, x = g && !0 && e && !e.nodeType && e, y = x && x.exports === g function w(Fe, lr) { return Fe == null ? void 0 : Fe[lr] } function S(Fe) { var lr = !1 if (Fe != null && typeof Fe.toString != 'function') try { lr = !!(Fe + '') } catch {} return lr } function T(Fe, lr) { return function (ur) { return Fe(lr(ur)) } } var A = Function.prototype, $ = Object.prototype, F = k['__core-js_shared__'], Y = (function () { var Fe = /[^.]+$/.exec((F && F.keys && F.keys.IE_PROTO) || '') return Fe ? 'Symbol(src)_1.' + Fe : '' })(), ae = A.toString, re = $.hasOwnProperty, ie = $.toString, oe = RegExp( '^' + ae .call(re) .replace(f, '\\$&') .replace( /hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?' ) + '$' ), j = y ? k.Buffer : void 0, V = $.propertyIsEnumerable, z = j ? j.isBuffer : void 0, M = T(Object.keys, Object), L = tr(k, 'DataView'), pe = tr(k, 'Map'), ue = tr(k, 'Promise'), Ie = tr(k, 'Set'), Pt = tr(k, 'WeakMap'), rr = !V.call({ valueOf: 1 }, 'valueOf'), _e = Ne(L), Oe = Ne(pe), xe = Ne(ue), $e = Ne(Ie), jt = Ne(Pt) function or(Fe) { return ie.call(Fe) } function er(Fe) { if (!At(Fe) || de(Fe)) return !1 var lr = ir(Fe) || S(Fe) ? oe : _ return lr.test(Ne(Fe)) } function tr(Fe, lr) { var ur = w(Fe, lr) return er(ur) ? ur : void 0 } var D = or ;((L && D(new L(new ArrayBuffer(1))) != m) || (pe && D(new pe()) != l) || (ue && D(ue.resolve()) != c) || (Ie && D(new Ie()) != d) || (Pt && D(new Pt()) != u)) && (D = function (Fe) { var lr = ie.call(Fe), ur = lr == s ? Fe.constructor : void 0, _r = ur ? Ne(ur) : void 0 if (_r) switch (_r) { case _e: return m case Oe: return l case xe: return c case $e: return d case jt: return u } return lr }) function de(Fe) { return !!Y && Y in Fe } function Ce(Fe) { var lr = Fe && Fe.constructor, ur = (typeof lr == 'function' && lr.prototype) || $ return Fe === ur } function Ne(Fe) { if (Fe != null) { try { return ae.call(Fe) } catch {} try { return Fe + '' } catch {} } return '' } function Ve(Fe) { return ( Ue(Fe) && re.call(Fe, 'callee') && (!V.call(Fe, 'callee') || ie.call(Fe) == o) ) } var Et = Array.isArray function Lt(Fe) { return Fe != null && he(Fe.length) && !ir(Fe) } function Ue(Fe) { return nr(Fe) && Lt(Fe) } var kt = z || cr function qe(Fe) { if ( Lt(Fe) && (Et(Fe) || typeof Fe == 'string' || typeof Fe.splice == 'function' || kt(Fe) || Ve(Fe)) ) return !Fe.length var lr = D(Fe) if (lr == l || lr == d) return !Fe.size if (rr || Ce(Fe)) return !M(Fe).length for (var ur in Fe) if (re.call(Fe, ur)) return !1 return !0 } function ir(Fe) { var lr = At(Fe) ? ie.call(Fe) : '' return lr == n || lr == a } function he(Fe) { return typeof Fe == 'number' && Fe > -1 && Fe % 1 == 0 && Fe <= r } function At(Fe) { var lr = typeof Fe return !!Fe && (lr == 'object' || lr == 'function') } function nr(Fe) { return !!Fe && typeof Fe == 'object' } function cr() { return !1 } e.exports = qe })(lodash_isempty, lodash_isempty.exports) var objectTag = '[object Object]' function isHostObject(e) { var t = !1 if (e != null && typeof e.toString != 'function') try { t = !!(e + '') } catch {} return t } function overArg(e, t) { return function (r) { return e(t(r)) } } var funcProto = Function.prototype, objectProto = Object.prototype, funcToString = funcProto.toString, hasOwnProperty = objectProto.hasOwnProperty, objectCtorString = funcToString.call(Object), objectToString = objectProto.toString, getPrototype = overArg(Object.getPrototypeOf, Object) function isObjectLike(e) { return !!e && typeof e == 'object' } function isPlainObject$1(e) { if ( !isObjectLike(e) || objectToString.call(e) != objectTag || isHostObject(e) ) return !1 var t = getPrototype(e) if (t === null) return !0 var r = hasOwnProperty.call(t, 'constructor') && t.constructor return ( typeof r == 'function' && r instanceof r && funcToString.call(r) == objectCtorString ) } var lodash_isplainobject = isPlainObject$1, lodash_transform = { exports: {} } ;(function (e, t) { var r = 200, o = 'Expected a function', n = '__lodash_hash_undefined__', a = 1, l = 2, s = 1 / 0, c = 9007199254740991, d = '[object Arguments]', u = '[object Array]', m = '[object Boolean]', f = '[object Date]', _ = '[object Error]', b = '[object Function]', v = '[object GeneratorFunction]', k = '[object Map]', g = '[object Number]', x = '[object Object]', y = '[object Promise]', w = '[object RegExp]', S = '[object Set]', T = '[object String]', A = '[object Symbol]', $ = '[object WeakMap]', F = '[object ArrayBuffer]', Y = '[object DataView]', ae = '[object Float32Array]', re = '[object Float64Array]', ie = '[object Int8Array]', oe = '[object Int16Array]', j = '[object Int32Array]', V = '[object Uint8Array]', z = '[object Uint8ClampedArray]', M = '[object Uint16Array]', L = '[object Uint32Array]', pe = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, ue = /^\w*$/, Ie = /^\./, Pt = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g, rr = /[\\^$.*+?()[\]{}|]/g, _e = /\\(\\)?/g, Oe = /^\[object .+?Constructor\]$/, xe = /^(?:0|[1-9]\d*)$/, $e = {} ;($e[ae] = $e[re] = $e[ie] = $e[oe] = $e[j] = $e[V] = $e[z] = $e[M] = $e[L] = !0), ($e[d] = $e[u] = $e[F] = $e[m] = $e[Y] = $e[f] = $e[_] = $e[b] = $e[k] = $e[g] = $e[x] = $e[w] = $e[S] = $e[T] = $e[$] = !1) var jt = typeof commonjsGlobal == 'object' && commonjsGlobal && commonjsGlobal.Object === Object && commonjsGlobal, or = typeof self == 'object' && self && self.Object === Object && self, er = jt || or || Function('return this')(), tr = t && !t.nodeType && t, D = tr && !0 && e && !e.nodeType && e, de = D && D.exports === tr, Ce = de && jt.process, Ne = (function () { try { return Ce && Ce.binding('util') } catch {} })(), Ve = Ne && Ne.isTypedArray function Et(O, le) { for ( var ze = -1, Dt = O ? O.length : 0; ++ze < Dt && le(O[ze], ze, O) !== !1; ); return O } function Lt(O, le) { for (var ze = -1, Dt = O ? O.length : 0; ++ze < Dt; ) if (le(O[ze], ze, O)) return !0 return !1 } function Ue(O) { return function (le) { return le == null ? void 0 : le[O] } } function kt(O, le) { for (var ze = -1, Dt = Array(O); ++ze < O; ) Dt[ze] = le(ze) return Dt } function qe(O) { return function (le) { return O(le) } } function ir(O, le) { return O == null ? void 0 : O[le] } function he(O) { var le = !1 if (O != null && typeof O.toString != 'function') try { le = !!(O + '') } catch {} return le } function At(O) { var le = -1, ze = Array(O.size) return ( O.forEach(function (Dt, dr) { ze[++le] = [dr, Dt] }), ze ) } function nr(O, le) { return function (ze) { return O(le(ze)) } } function cr(O) { var le = -1, ze = Array(O.size) return ( O.forEach(function (Dt) { ze[++le] = Dt }), ze ) } var Fe = Array.prototype, lr = Function.prototype, ur = Object.prototype, _r = er['__core-js_shared__'], Sr = (function () { var O = /[^.]+$/.exec((_r && _r.keys && _r.keys.IE_PROTO) || '') return O ? 'Symbol(src)_1.' + O : '' })(), Lr = lr.toString, br = ur.hasOwnProperty, Tr = ur.toString, yr = RegExp( '^' + Lr.call(br) .replace(rr, '\\$&') .replace( /hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?' ) + '$' ), kr = er.Symbol, Dr = er.Uint8Array, Ao = nr(Object.getPrototypeOf, Object), $o = Object.create, Po = ur.propertyIsEnumerable, Bo = Fe.splice, zo = nr(Object.keys, Object), to = Or(er, 'DataView'), Hr = Or(er, 'Map'), ro = Or(er, 'Promise'), oo = Or(er, 'Set'), io = Or(er, 'WeakMap'), jr = Or(Object, 'create'), Mo = Vr(to), Io = Vr(Hr), No = Vr(ro), Vo = Vr(oo), Fo = Vr(io), qr = kr ? kr.prototype : void 0, no = qr ? qr.valueOf : void 0, po = qr ? qr.toString : void 0 function Nr(O) { var le = -1, ze = O ? O.length : 0 for (this.clear(); ++le < ze; ) { var Dt = O[le] this.set(Dt[0], Dt[1]) } } function Oo() { this.__data__ = jr ? jr(null) : {} } function Ro(O) { return this.has(O) && delete this.__data__[O] } function Lo(O) { var le = this.__data__ if (jr) { var ze = le[O] return ze === n ? void 0 : ze } return br.call(le, O) ? le[O] : void 0 } function Do(O) { var le = this.__data__ return jr ? le[O] !== void 0 : br.call(le, O) } function Ho(O, le) { var ze = this.__data__ return (ze[O] = jr && le === void 0 ? n : le), this } ;(Nr.prototype.clear = Oo), (Nr.prototype.delete = Ro), (Nr.prototype.get = Lo), (Nr.prototype.has = Do), (Nr.prototype.set = Ho) function Ar(O) { var le = -1, ze = O ? O.length : 0 for (this.clear(); ++le < ze; ) { var Dt = O[le] this.set(Dt[0], Dt[1]) } } function jo() { this.__data__ = [] } function qo(O) { var le = this.__data__, ze = Ur(le, O) if (ze < 0) return !1 var Dt = le.length - 1 return ze == Dt ? le.pop() : Bo.call(le, ze, 1), !0 } function Go(O) { var le = this.__data__, ze = Ur(le, O) return ze < 0 ? void 0 : le[ze][1] } function Uo(O) { return Ur(this.__data__, O) > -1 } function Wo(O, le) { var ze = this.__data__, Dt = Ur(ze, O) return Dt < 0 ? ze.push([O, le]) : (ze[Dt][1] = le), this } ;(Ar.prototype.clear = jo), (Ar.prototype.delete = qo), (Ar.prototype.get = Go), (Ar.prototype.has = Uo), (Ar.prototype.set = Wo) function $r(O) { var le = -1, ze = O ? O.length : 0 for (this.clear(); ++le < ze; ) { var Dt = O[le] this.set(Dt[0], Dt[1]) } } function Ko() { this.__data__ = { hash: new Nr(), map: new (Hr || Ar)(), string: new Nr() } } function Yo(O) { return Wr(this, O).delete(O) } function Jo(O) { return Wr(this, O).get(O) } function Qo(O) { return Wr(this, O).has(O) } function Xo(O, le) { return Wr(this, O).set(O, le), this } ;($r.prototype.clear = Ko), ($r.prototype.delete = Yo), ($r.prototype.get = Jo), ($r.prototype.has = Qo), ($r.prototype.set = Xo) function Gr(O) { var le = -1, ze = O ? O.length : 0 for (this.__data__ = new $r(); ++le < ze; ) this.add(O[le]) } function Zo(O) { return this.__data__.set(O, n), this } function ei(O) { return this.__data__.has(O) } ;(Gr.prototype.add = Gr.prototype.push = Zo), (Gr.prototype.has = ei) function Pr(O) { this.__data__ = new Ar(O) } function ti() { this.__data__ = new Ar() } function ri(O) { return this.__data__.delete(O) } function oi(O) { return this.__data__.get(O) } function ii(O) { return this.__data__.has(O) } function ni(O, le) { var ze = this.__data__ if (ze instanceof Ar) { var Dt = ze.__data__ if (!Hr || Dt.length < r - 1) return Dt.push([O, le]), this ze = this.__data__ = new $r(Dt) } return ze.set(O, le), this } ;(Pr.prototype.clear = ti), (Pr.prototype.delete = ri), (Pr.prototype.get = oi), (Pr.prototype.has = ii), (Pr.prototype.set = ni) function ai(O, le) { var ze = Br(O) || yo(O) ? kt(O.length, String) : [], Dt = ze.length, dr = !!Dt for (var sr in O) (le || br.call(O, sr)) && !(dr && (sr == 'length' || _o(sr, Dt))) && ze.push(sr) return ze } function Ur(O, le) { for (var ze = O.length; ze--; ) if (bo(O[ze][0], le)) return ze return -1 } function li(O) { return Rr(O) ? $o(O) : {} } var si = wi() function ci(O, le) { return O && si(O, le, Qr) } function fo(O, le) { le = Kr(le, O) ? [le] : ho(le) for (var ze = 0, Dt = le.length; O != null && ze < Dt; ) O = O[Yr(le[ze++])] return ze && ze == Dt ? O : void 0 } function di(O) { return Tr.call(O) } function ui(O, le) { return O != null && le in Object(O) } function ao(O, le, ze, Dt, dr) { return O === le ? !0 : O == null || le == null || (!Rr(O) && !Jr(le)) ? O !== O && le !== le : pi(O, le, ao, ze, Dt, dr) } function pi(O, le, ze, Dt, dr, sr) { var fr = Br(O), hr = Br(le), mr = u, gr = u fr || ((mr = Mr(O)), (mr = mr == d ? x : mr)), hr || ((gr = Mr(le)), (gr = gr == d ? x : gr)) var xr = mr == x && !he(O), wr = gr == x && !he(le), vr = mr == gr if (vr && !xr) return ( sr || (sr = new Pr()), fr || wo(O) ? mo(O, le, ze, Dt, dr, sr) : ki(O, le, mr, ze, Dt, dr, sr) ) if (!(dr & l)) { var Er = xr && br.call(O, '__wrapped__'), Cr = wr && br.call(le, '__wrapped__') if (Er || Cr) { var Ir = Er ? O.value() : O, zr = Cr ? le.value() : le return sr || (sr = new Pr()), ze(Ir, zr, Dt, dr, sr) } } return vr ? (sr || (sr = new Pr()), Ei(O, le, ze, Dt, dr, sr)) : !1 } function fi(O, le, ze, Dt) { var dr = ze.length, sr = dr, fr = !Dt if (O == null) return !sr for (O = Object(O); dr--; ) { var hr = ze[dr] if (fr && hr[2] ? hr[1] !== O[hr[0]] : !(hr[0] in O)) return !1 } for (; ++dr < sr; ) { hr = ze[dr] var mr = hr[0], gr = O[mr], xr = hr[1] if (fr && hr[2]) { if (gr === void 0 && !(mr in O)) return !1 } else { var wr = new Pr() if (Dt) var vr = Dt(gr, xr, mr, O, le, wr) if (!(vr === void 0 ? ao(xr, gr, Dt, a | l, wr) : vr)) return !1 } } return !0 } function hi(O) { if (!Rr(O) || Ai(O)) return !1 var le = so(O) || he(O) ? yr : Oe return le.test(Vr(O)) } function mi(O) { return Jr(O) && co(O.length) && !!$e[Tr.call(O)] } function _i(O) { return typeof O == 'function' ? O : O == null ? Vi : typeof O == 'object' ? Br(O) ? bi(O[0], O[1]) : vi(O) : Fi(O) } function gi(O) { if (!$i(O)) return zo(O) var le = [] for (var ze in Object(O)) br.call(O, ze) && ze != 'constructor' && le.push(ze) return le } function vi(O) { var le = Ci(O) return le.length == 1 && le[0][2] ? vo(le[0][0], le[0][1]) : function (ze) { return ze === O || fi(ze, O, le) } } function bi(O, le) { return Kr(O) && go(le) ? vo(Yr(O), le) : function (ze) { var Dt = Mi(ze, O) return Dt === void 0 && Dt === le ? Ii(ze, O) : ao(le, Dt, void 0, a | l) } } function yi(O) { return function (le) { return fo(le, O) } } function xi(O) { if (typeof O == 'string') return O if (uo(O)) return po ? po.call(O) : '' var le = O + '' return le == '0' && 1 / O == -s ? '-0' : le } function ho(O) { return Br(O) ? O : Pi(O) } function wi(O) { return function (le, ze, Dt) { for (var dr = -1, sr = Object(le), fr = Dt(le), hr = fr.length; hr--; ) { var mr = fr[O ? hr : ++dr] if (ze(sr[mr], mr, sr) === !1) break } return le } } function mo(O, le, ze, Dt, dr, sr) { var fr = dr & l, hr = O.length, mr = le.length if (hr != mr && !(fr && mr > hr)) return !1 var gr = sr.get(O) if (gr && sr.get(le)) return gr == le var xr = -1, wr = !0, vr = dr & a ? new Gr() : void 0 for (sr.set(O, le), sr.set(le, O); ++xr < hr; ) { var Er = O[xr], Cr = le[xr] if (Dt) var Ir = fr ? Dt(Cr, Er, xr, le, O, sr) : Dt(Er, Cr, xr, O, le, sr) if (Ir !== void 0) { if (Ir) continue wr = !1 break } if (vr) { if ( !Lt(le, function (zr, Fr) { if (!vr.has(Fr) && (Er === zr || ze(Er, zr, Dt, dr, sr))) return vr.add(Fr) }) ) { wr = !1 break } } else if (!(Er === Cr || ze(Er, Cr, Dt, dr, sr))) { wr = !1 break } } return sr.delete(O), sr.delete(le), wr } function ki(O, le, ze, Dt, dr, sr, fr) { switch (ze) { case Y: if (O.byteLength != le.byteLength || O.byteOffset != le.byteOffset) return !1 ;(O = O.buffer), (le = le.buffer) case F: return !(O.byteLength != le.byteLength || !Dt(new Dr(O), new Dr(le))) case m: case f: case g: return bo(+O, +le) case _: return O.name == le.name && O.message == le.message case w: case T: return O == le + '' case k: var hr = At case S: var mr = sr & l if ((hr || (hr = cr), O.size != le.size && !mr)) return !1 var gr = fr.get(O) if (gr) return gr == le ;(sr |= a), fr.set(O, le) var xr = mo(hr(O), hr(le), Dt, dr, sr, fr) return fr.delete(O), xr case A: if (no) return no.call(O) == no.call(le) } return !1 } function Ei(O, le, ze, Dt, dr, sr) { var fr = dr & l, hr = Qr(O), mr = hr.length, gr = Qr(le), xr = gr.length if (mr != xr && !fr) return !1 for (var wr = mr; wr--; ) { var vr = hr[wr] if (!(fr ? vr in le : br.call(le, vr))) return !1 } var Er = sr.get(O) if (Er && sr.get(le)) return Er == le var Cr = !0 sr.set(O, le), sr.set(le, O) for (var Ir = fr; ++wr < mr; ) { vr = hr[wr] var zr = O[vr], Fr = le[vr] if (Dt) var ko = fr ? Dt(Fr, zr, vr, le, O, sr) : Dt(zr, Fr, vr, O, le, sr) if (!(ko === void 0 ? zr === Fr || ze(zr, Fr, Dt, dr, sr) : ko)) { Cr = !1 break } Ir || (Ir = vr == 'constructor') } if (Cr && !Ir) { var Xr = O.constructor, Zr = le.constructor Xr != Zr && 'constructor' in O && 'constructor' in le && !( typeof Xr == 'function' && Xr instanceof Xr && typeof Zr == 'function' && Zr instanceof Zr ) && (Cr = !1) } return sr.delete(O), sr.delete(le), Cr } function Wr(O, le) { var ze = O.__data__ return Ti(le) ? ze[typeof le == 'string' ? 'string' : 'hash'] : ze.map } function Ci(O) { for (var le = Qr(O), ze = le.length; ze--; ) { var Dt = le[ze], dr = O[Dt] le[ze] = [Dt, dr, go(dr)] } return le } function Or(O, le) { var ze = ir(O, le) return hi(ze) ? ze : void 0 } var Mr = di ;((to && Mr(new to(new ArrayBuffer(1))) != Y) || (Hr && Mr(new Hr()) != k) || (ro && Mr(ro.resolve()) != y) || (oo && Mr(new oo()) != S) || (io && Mr(new io()) != $)) && (Mr = function (O) { var le = Tr.call(O), ze = le == x ? O.constructor : void 0, Dt = ze ? Vr(ze) : void 0 if (Dt) switch (Dt) { case Mo: return Y case Io: return k case No: return y case Vo: return S case Fo: return $ } return le }) function Si(O, le, ze) { le = Kr(le, O) ? [le] : ho(le) for (var Dt, dr = -1, fr = le.length; ++dr < fr; ) { var sr = Yr(le[dr]) if (!(Dt = O != null && ze(O, sr))) break O = O[sr] } if (Dt) return Dt var fr = O ? O.length : 0 return !!fr && co(fr) && _o(sr, fr) && (Br(O) || yo(O)) } function _o(O, le) { return ( (le = le == null ? c : le), !!le && (typeof O == 'number' || xe.test(O)) && O > -1 && O % 1 == 0 && O < le ) } function Kr(O, le) { if (Br(O)) return !1 var ze = typeof O return ze == 'number' || ze == 'symbol' || ze == 'boolean' || O == null || uo(O) ? !0 : ue.test(O) || !pe.test(O) || (le != null && O in Object(le)) } function Ti(O) { var le = typeof O return le == 'string' || le == 'number' || le == 'symbol' || le == 'boolean' ? O !== '__proto__' : O === null } function Ai(O) { return !!Sr && Sr in O } function $i(O) { var le = O && O.constructor, ze = (typeof le == 'function' && le.prototype) || ur return O === ze } function go(O) { return O === O && !Rr(O) } function vo(O, le) { return function (ze) { return ze == null ? !1 : ze[O] === le && (le !== void 0 || O in Object(ze)) } } var Pi = lo(function (O) { O = zi(O) var le = [] return ( Ie.test(O) && le.push(''), O.replace(Pt, function (ze, Dt, dr, sr) { le.push(dr ? sr.replace(_e, '$1') : Dt || ze) }), le ) }) function Yr(O) { if (typeof O == 'string' || uo(O)) return O var le = O + '' return le == '0' && 1 / O == -s ? '-0' : le } function Vr(O) { if (O != null) { try { return Lr.call(O) } catch {} try { return O + '' } catch {} } return '' } function lo(O, le) { if (typeof O != 'function' || (le && typeof le != 'function')) throw new TypeError(o) var ze = function () { var Dt = arguments, dr = le ? le.apply(this, Dt) : Dt[0], sr = ze.cache if (sr.has(dr)) return sr.get(dr) var fr = O.apply(this, Dt) return (ze.cache = sr.set(dr, fr)), fr } return (ze.cache = new (lo.Cache || $r)()), ze } lo.Cache = $r function bo(O, le) { return O === le || (O !== O && le !== le) } function yo(O) { return ( Bi(O) && br.call(O, 'callee') && (!Po.call(O, 'callee') || Tr.call(O) == d) ) } var Br = Array.isArray function xo(O) { return O != null && co(O.length) && !so(O) } function Bi(O) { return Jr(O) && xo(O) } function so(O) { var le = Rr(O) ? Tr.call(O) : '' return le == b || le == v } function co(O) { return typeof O == 'number' && O > -1 && O % 1 == 0 && O <= c } function Rr(O) { var le = typeof O return !!O && (le == 'object' || le == 'function') } function Jr(O) { return !!O && typeof O == 'object' } function uo(O) { return typeof O == 'symbol' || (Jr(O) && Tr.call(O) == A) } var wo = Ve ? qe(Ve) : mi function zi(O) { return O == null ? '' : xi(O) } function Mi(O, le, ze) { var Dt = O == null ? void 0 : fo(O, le) return Dt === void 0 ? ze : Dt } function Ii(O, le) { return O != null && Si(O, le, ui) } function Qr(O) { return xo(O) ? ai(O) : gi(O) } function Ni(O, le, ze) { var Dt = Br(O) || wo(O) if (((le = _i(le)), ze == null)) if (Dt || Rr(O)) { var dr = O.constructor Dt ? (ze = Br(O) ? new dr() : []) : (ze = so(dr) ? li(Ao(O)) : {}) } else ze = {} return ( (Dt ? Et : ci)(O, function (sr, fr, hr) { return le(ze, sr, fr, hr) }), ze ) } function Vi(O) { return O } function Fi(O) { return Kr(O) ? Ue(Yr(O)) : yi(O) } e.exports = Ni })(lodash_transform, lodash_transform.exports) const isEmpty = lodash_isempty.exports, isPlainObject = lodash_isplainobject, transform = lodash_transform.exports var src = function e( t, { cleanKeys: r = [], cleanValues: o = [], emptyArrays: n = !0, emptyObjects: a = !0, emptyStrings: l = !0, NaNValues: s = !1, nullValues: c = !0, undefinedValues: d = !0 } = {} ) { return transform(t, (u, m, f) => { if ( !r.includes(f) && ((Array.isArray(m) || isPlainObject(m)) && (m = e(m, { NaNValues: s, cleanKeys: r, cleanValues: o, emptyArrays: n, emptyObjects: a, emptyStrings: l, nullValues: c, undefinedValues: d })), !o.includes(m) && !(a && isPlainObject(m) && isEmpty(m)) && !(n && Array.isArray(m) && !m.length) && !(l && m === '') && !(s && Number.isNaN(m)) && !(c && m === null) && !(d && m === void 0)) ) { if (Array.isArray(u)) return u.push(m) u[f] = m } }) }, numeral = { exports: {} } /*! @preserve * numeral.js * version : 2.0.6 * author : Adam Draper * license : MIT * http://adamwdraper.github.com/Numeral-js/ */ ;(function (e) { ;(function (t, r) { e.exports ? (e.exports = r()) : (t.numeral = r()) })(commonjsGlobal, function () { var t, r, o = '2.0.6', n = {}, a = {}, l = { currentLocale: 'en', zeroFormat: null, nullFormat: null, defaultFormat: '0,0', scalePercentBy100: !0 }, s = { currentLocale: l.currentLocale, zeroFormat: l.zeroFormat, nullFormat: l.nullFormat, defaultFormat: l.defaultFormat, scalePercentBy100: l.scalePercentBy100 } function c(d, u) { ;(this._input = d), (this._value = u) } return ( (t = function (d) { var u, m, f, _ if (t.isNumeral(d)) u = d.value() else if (d === 0 || typeof d == 'undefined') u = 0 else if (d === null || r.isNaN(d)) u = null else if (typeof d == 'string') if (s.zeroFormat && d === s.zeroFormat) u = 0 else if ( (s.nullFormat && d === s.nullFormat) || !d.replace(/[^0-9]+/g, '').length ) u = null else { for (m in n) if ( ((_ = typeof n[m].regexps.unformat == 'function' ? n[m].regexps.unformat() : n[m].regexps.unformat), _ && d.match(_)) ) { f = n[m].unformat break } ;(f = f || t._.stringToNumber), (u = f(d)) } else u = Number(d) || null return new c(d, u) }), (t.version = o), (t.isNumeral = function (d) { return d instanceof c }), (t._ = r = { numberToFormat: function (d, u, m) { var f = a[t.options.currentLocale], _ = !1, b = !1, v = 0, k = '', g = 1e12, x = 1e9, y = 1e6, w = 1e3, S = '', T = !1, A, $, F, Y, ae, re, ie if ( ((d = d || 0), ($ = Math.abs(d)), t._.includes(u, '(') ? ((_ = !0), (u = u.replace(/[\(|\)]/g, ''))) : (t._.includes(u, '+') || t._.includes(u, '-')) && ((ae = t._.includes(u, '+') ? u.indexOf('+') : d < 0 ? u.indexOf('-') : -1), (u = u.replace(/[\+|\-]/g, ''))), t._.includes(u, 'a') && ((A = u.match(/a(k|m|b|t)?/)), (A = A ? A[1] : !1), t._.includes(u, ' a') && (k = ' '), (u = u.replace(new RegExp(k + 'a[kmbt]?'), '')), ($ >= g && !A) || A === 't' ? ((k += f.abbreviations.trillion), (d = d / g)) : ($ < g && $ >= x && !A) || A === 'b' ? ((k += f.abbreviations.billion), (d = d / x)) : ($ < x && $ >= y && !A) || A === 'm' ? ((k += f.abbreviations.million), (d = d / y)) : (($ < y && $ >= w && !A) || A === 'k') && ((k += f.abbreviations.thousand), (d = d / w))), t._.includes(u, '[.]') && ((b = !0), (u = u.replace('[.]', '.'))), (F = d.toString().split('.')[0]), (Y = u.split('.')[1]), (re = u.indexOf(',')), (v = (u.split('.')[0].split(',')[0].match(/0/g) || []).length), Y ? (t._.includes(Y, '[') ? ((Y = Y.replace(']', '')), (Y = Y.split('[')), (S = t._.toFixed( d, Y[0].length + Y[1].length, m, Y[1].length ))) : (S = t._.toFixed(d, Y.length, m)), (F = S.split('.')[0]), t._.includes(S, '.') ? (S = f.delimiters.decimal + S.split('.')[1]) : (S = ''), b && Number(S.slice(1)) === 0 && (S = '')) : (F = t._.toFixed(d, 0, m)), k && !A && Number(F) >= 1e3 && k !== f.abbreviations.trillion) ) switch (((F = String(Number(F) / 1e3)), k)) { case f.abbreviations.thousand: k = f.abbreviations.million break case f.abbreviations.million: k = f.abbreviations.billion break case f.abbreviations.billion: k = f.abbreviations.trillion break } if ( (t._.includes(F, '-') && ((F = F.slice(1)), (T = !0)), F.length < v) ) for (var oe = v - F.length; oe > 0; oe--) F = '0' + F return ( re > -1 && (F = F.toString().replace( /(\d)(?=(\d{3})+(?!\d))/g, '$1' + f.delimiters.thousands )), u.indexOf('.') === 0 && (F = ''), (ie = F + S + (k || '')), _ ? (ie = (_ && T ? '(' : '') + ie + (_ && T ? ')' : '')) : ae >= 0 ? (ie = ae === 0 ? (T ? '-' : '+') + ie : ie + (T ? '-' : '+')) : T && (ie = '-' + ie), ie ) }, stringToNumber: function (d) { var u = a[s.currentLocale], m = d, f = { thousand: 3, million: 6, billion: 9, trillion: 12 }, _, b, v if (s.zeroFormat && d === s.zeroFormat) b = 0 else if ( (s.nullFormat && d === s.nullFormat) || !d.replace(/[^0-9]+/g, '').length ) b = null else { ;(b = 1), u.delimiters.decimal !== '.' && (d = d.replace(/\./g, '').replace(u.delimiters.decimal, '.')) for (_ in f) if ( ((v = new RegExp( '[^a-zA-Z]' + u.abbreviations[_] + '(?:\\)|(\\' + u.currency.symbol + ')?(?:\\))?)?$' )), m.match(v)) ) { b *= Math.pow(10, f[_]) break } ;(b *= (d.split('-').length + Math.min(d.split('(').length - 1, d.split(')').length - 1)) % 2 ? 1 : -1), (d = d.replace(/[^0-9\.]+/g, '')), (b *= Number(d)) } return b }, isNaN: function (d) { return typeof d == 'number' && isNaN(d) }, includes: function (d, u) { return d.indexOf(u) !== -1 }, insert: function (d, u, m) { return d.slice(0, m) + u + d.slice(m) }, reduce: function (d, u) { if (this === null) throw new TypeError( 'Array.prototype.reduce called on null or undefined' ) if (typeof u != 'function') throw new TypeError(u + ' is not a function') var m = Object(d), f = m.length >>> 0, _ = 0, b if (arguments.length === 3) b = arguments[2] else { for (; _ < f && !(_ in m); ) _++ if (_ >= f) throw new TypeError( 'Reduce of empty array with no initial value' ) b = m[_++] } for (; _ < f; _++) _ in m && (b = u(b, m[_], _, m)) return b }, multiplier: function (d) { var u = d.toString().split('.') return u.length < 2 ? 1 : Math.pow(10, u[1].length) }, correctionFactor: function () { var d = Array.prototype.slice.call(arguments) return d.reduce(function (u, m) { var f = r.multiplier(m) return u > f ? u : f }, 1) }, toFixed: function (d, u, m, f) { var _ = d.toString().split('.'), b = u - (f || 0), v, k, g, x return ( _.length === 2 ? (v = Math.min(Math.max(_[1].length, b), u)) : (v = b), (g = Math.pow(10, v)), (x = (m(d + 'e+' + v) / g).toFixed(v)), f > u - v && ((k = new RegExp('\\.?0{1,' + (f - (u - v)) + '}$')), (x = x.replace(k, ''))), x ) } }), (t.options = s), (t.formats = n), (t.locales = a), (t.locale = function (d) { return d && (s.currentLocale = d.toLowerCase()), s.currentLocale }), (t.localeData = function (d) { if (!d) return a[s.currentLocale] if (((d = d.toLowerCase()), !a[d])) throw new Error('Unknown locale : ' + d) return a[d] }), (t.reset = function () { for (var d in l) s[d] = l[d] }), (t.zeroFormat = function (d) { s.zeroFormat = typeof d == 'string' ? d : null }), (t.nullFormat = function (d) { s.nullFormat = typeof d == 'string' ? d : null }), (t.defaultFormat = function (d) { s.defaultFormat = typeof d == 'string' ? d : '0.0' }), (t.register = function (d, u, m) { if (((u = u.toLowerCase()), this[d + 's'][u])) throw new TypeError(u + ' ' + d + ' already registered.') return (this[d + 's'][u] = m), m }), (t.validate = function (d, u) { var m, f, _, b, v, k, g, x if ( (typeof d != 'string' && ((d += ''), console.warn && console.warn( 'Numeral.js: Value is not string. It has been co-erced to: ', d )), (d = d.trim()), d.match(/^\d+$/)) ) return !0 if (d === '') return !1 try { g = t.localeData(u) } catch { g = t.localeData(t.locale()) } return ( (_ = g.currency.symbol), (v = g.abbreviations), (m = g.delimiters.decimal), g.delimiters.thousands === '.' ? (f = '\\.') : (f = g.delimiters.thousands), (x = d.match(/^[^\d]+/)), (x !== null && ((d = d.substr(1)), x[0] !== _)) || ((x = d.match(/[^\d]+$/)), x !== null && ((d = d.slice(0, -1)), x[0] !== v.thousand && x[0] !== v.million && x[0] !== v.billion && x[0] !== v.trillion)) ? !1 : ((k = new RegExp(f + '{2}')), d.match(/[^\d.,]/g) ? !1 : ((b = d.split(m)), b.length > 2 ? !1 : b.length < 2 ? !!b[0].match(/^\d+.*\d$/) && !b[0].match(k) : b[0].length === 1 ? !!b[0].match(/^\d+$/) && !b[0].match(k) && !!b[1].match(/^\d+$/) : !!b[0].match(/^\d+.*\d$/) && !b[0].match(k) && !!b[1].match(/^\d+$/))) ) }), (t.fn = c.prototype = { clone: function () { return t(this) }, format: function (d, u) { var m = this._value, f = d || s.defaultFormat, _, b, v if (((u = u || Math.round), m === 0 && s.zeroFormat !== null)) b = s.zeroFormat else if (m === null && s.nullFormat !== null) b = s.nullFormat else { for (_ in n) if (f.match(n[_].regexps.format)) { v = n[_].format break } ;(v = v || t._.numberToFormat), (b = v(m, f, u)) } return b }, value: function () { return this._value }, input: function () { return this._input }, set: function (d) { return (this._value = Number(d)), this }, add: function (d) { var u = r.correctionFactor.call(null, this._value, d) function m(f, _, b, v) { return f + Math.round(u * _) } return (this._value = r.reduce([this._value, d], m, 0) / u), this }, subtract: function (d) { var u = r.correctionFactor.call(null, this._value, d) function m(f, _, b, v) { return f - Math.round(u * _) } return ( (this._value = r.reduce([d], m, Math.round(this._value * u)) / u), this ) }, multiply: function (d) { function u(m, f, _, b) { var v = r.correctionFactor(m, f) return (Math.round(m * v) * Math.round(f * v)) / Math.round(v * v) } return (this._value = r.reduce([this._value, d], u, 1)), this }, divide: function (d) { function u(m, f, _, b) { var v = r.correctionFactor(m, f) return Math.round(m * v) / Math.round(f * v) } return (this._value = r.reduce([this._value, d], u)), this }, difference: function (d) { return Math.abs(t(this._value).subtract(d).value()) } }), t.register('locale', 'en', { delimiters: { thousands: ',', decimal: '.' }, abbreviations: { thousand: 'k', million: 'm', billion: 'b', trillion: 't' }, ordinal: function (d) { var u = d % 10 return ~~((d % 100) / 10) === 1 ? 'th' : u === 1 ? 'st' : u === 2 ? 'nd' : u === 3 ? 'rd' : 'th' }, currency: { symbol: '$' } }), (function () { t.register('format', 'bps', { regexps: { format: /(BPS)/, unformat: /(BPS)/ }, format: function (d, u, m) { var f = t._.includes(u, ' BPS') ? ' ' : '', _ return ( (d = d * 1e4), (u = u.replace(/\s?BPS/, '')), (_ = t._.numberToFormat(d, u, m)), t._.includes(_, ')') ? ((_ = _.split('')), _.splice(-1, 0, f + 'BPS'), (_ = _.join(''))) : (_ = _ + f + 'BPS'), _ ) }, unformat: function (d) { return +(t._.stringToNumber(d) * 1e-4).toFixed(15) } }) })(), (function () { var d = { base: 1e3, suffixes: ['B', 'KB', 'MB', 'GB', 'TB', 'PB', 'EB', 'ZB', 'YB'] }, u = { base: 1024, suffixes: [ 'B', 'KiB', 'MiB', 'GiB', 'TiB', 'PiB', 'EiB', 'ZiB', 'YiB' ] }, m = d.suffixes.concat( u.suffixes.filter(function (_) { return d.suffixes.indexOf(_) < 0 }) ), f = m.join('|') ;(f = '(' + f.replace('B', 'B(?!PS)') + ')'), t.register('format', 'bytes', { regexps: { format: /([0\s]i?b)/, unformat: new RegExp(f) }, format: function (_, b, v) { var k, g = t._.includes(b, 'ib') ? u : d, x = t._.includes(b, ' b') || t._.includes(b, ' ib') ? ' ' : '', y, w, S for ( b = b.replace(/\s?i?b/, ''), y = 0; y <= g.suffixes.length; y++ ) if ( ((w = Math.pow(g.base, y)), (S = Math.pow(g.base, y + 1)), _ === null || _ === 0 || (_ >= w && _ < S)) ) { ;(x += g.suffixes[y]), w > 0 && (_ = _ / w) break } return (k = t._.numberToFormat(_, b, v)), k + x }, unformat: function (_) { var b = t._.stringToNumber(_), v, k if (b) { for (v = d.suffixes.length - 1; v >= 0; v--) { if (t._.includes(_, d.suffixes[v])) { k = Math.pow(d.base, v) break } if (t._.includes(_, u.suffixes[v])) { k = Math.pow(u.base, v) break } } b *= k || 1 } return b } }) })(), (function () { t.register('format', 'currency', { regexps: { format: /(\$)/ }, format: function (d, u, m) { var f = t.locales[t.options.currentLocale], _ = { before: u.match(/^([\+|\-|\(|\s|\$]*)/)[0], after: u.match(/([\+|\-|\)|\s|\$]*)$/)[0] }, b, v, k for ( u = u.replace(/\s?\$\s?/, ''), b = t._.numberToFormat(d, u, m), d >= 0 ? ((_.before = _.before.replace(/[\-\(]/, '')), (_.after = _.after.replace(/[\-\)]/, ''))) : d < 0 && !t._.includes(_.before, '-') && !t._.includes(_.before, '(') && (_.before = '-' + _.before), k = 0; k < _.before.length; k++ ) switch (((v = _.before[k]), v)) { case '$': b = t._.insert(b, f.currency.symbol, k) break case ' ': b = t._.insert(b, ' ', k + f.currency.symbol.length - 1) break } for (k = _.after.length - 1; k >= 0; k--) switch (((v = _.after[k]), v)) { case '$': b = k === _.after.length - 1 ? b + f.currency.symbol : t._.insert( b, f.currency.symbol, -(_.after.length - (1 + k)) ) break case ' ': b = k === _.after.length - 1 ? b + ' ' : t._.insert( b, ' ', -( _.after.length - (1 + k) + f.currency.symbol.length - 1 ) ) break } return b } }) })(), (function () { t.register('format', 'exponential', { regexps: { format: /(e\+|e-)/, unformat: /(e\+|e-)/ }, format: function (d, u, m) { var f, _ = typeof d == 'number' && !t._.isNaN(d) ? d.toExponential() : '0e+0', b = _.split('e') return ( (u = u.replace(/e[\+|\-]{1}0/, '')), (f = t._.numberToFormat(Number(b[0]), u, m)), f + 'e' + b[1] ) }, unformat: function (d) { var u = t._.includes(d, 'e+') ? d.split('e+') : d.split('e-'), m = Number(u[0]), f = Number(u[1]) f = t._.includes(d, 'e-') ? (f *= -1) : f function _(b, v, k, g) { var x = t._.correctionFactor(b, v), y = (b * x * (v * x)) / (x * x) return y } return t._.reduce([m, Math.pow(10, f)], _, 1) } }) })(), (function () { t.register('format', 'ordinal', { regexps: { format: /(o)/ }, format: function (d, u, m) { var f = t.locales[t.options.currentLocale], _, b = t._.includes(u, ' o') ? ' ' : '' return ( (u = u.replace(/\s?o/, '')), (b += f.ordinal(d)), (_ = t._.numberToFormat(d, u, m)), _ + b ) } }) })(), (function () { t.register('format', 'percentage', { regexps: { format: /(%)/, unformat: /(%)/ }, format: function (d, u, m) { var f = t._.includes(u, ' %') ? ' ' : '', _ return ( t.options.scalePercentBy100 && (d = d * 100), (u = u.replace(/\s?\%/, '')), (_ = t._.numberToFormat(d, u, m)), t._.includes(_, ')') ? ((_ = _.split('')), _.splice(-1, 0, f + '%'), (_ = _.join(''))) : (_ = _ + f + '%'), _ ) }, unformat: function (d) { var u = t._.stringToNumber(d) return t.options.scalePercentBy100 ? u * 0.01 : u } }) })(), (function () { t.register('format', 'time', { regexps: { format: /(:)/, unformat: /(:)/ }, format: function (d, u, m) { var f = Math.floor(d / 60 / 60), _ = Math.floor((d - f * 60 * 60) / 60), b = Math.round(d - f * 60 * 60 - _ * 60) return ( f + ':' + (_ < 10 ? '0' + _ : _) + ':' + (b < 10 ? '0' + b : b) ) }, unformat: function (d) { var u = d.split(':'), m = 0 return ( u.length === 3 ? ((m = m + Number(u[0]) * 60 * 60), (m = m + Number(u[1]) * 60), (m = m + Number(u[2]))) : u.length === 2 && ((m = m + Number(u[0]) * 60), (m = m + Number(u[1]))), Number(m) ) } }) })(), t ) }) })(numeral) /*! js-cookie v3.0.1 | MIT */ function assign$1(e) { for (var t = 1; t < arguments.length; t++) { var r = arguments[t] for (var o in r) e[o] = r[o] } return e } var defaultConverter = { read: function (e) { return ( e[0] === '"' && (e = e.slice(1, -1)), e.replace(/(%[\dA-F]{2})+/gi, decodeURIComponent) ) }, write: function (e) { return encodeURIComponent(e).replace( /%(2[346BF]|3[AC-F]|40|5[BDE]|60|7[BCD])/g, decodeURIComponent ) } } function init(e, t) { function r(n, a, l) { if (typeof document != 'undefined') { ;(l = assign$1({}, t, l)), typeof l.expires == 'number' && (l.expires = new Date(Date.now() + l.expires * 864e5)), l.expires && (l.expires = l.expires.toUTCString()), (n = encodeURIComponent(n) .replace(/%(2[346B]|5E|60|7C)/g, decodeURIComponent) .replace(/[()]/g, escape)) var s = '' for (var c in l) !l[c] || ((s += '; ' + c), l[c] !== !0 && (s += '=' + l[c].split(';')[0])) return (document.cookie = n + '=' + e.write(a, n) + s) } } function o(n) { if (!(typeof document == 'undefined' || (arguments.length && !n))) { for ( var a = document.cookie ? document.cookie.split('; ') : [], l = {}, s = 0; s < a.length; s++ ) { var c = a[s].split('='), d = c.slice(1).join('=') try { var u = decodeURIComponent(c[0]) if (((l[u] = e.read(d, u)), n === u)) break } catch {} } return n ? l[n] : l } } return Object.create( { set: r, get: o, remove: function (n, a) { r(n, '', assign$1({}, a, { expires: -1 })) }, withAttributes: function (n) { return init(this.converter, assign$1({}, this.attributes, n)) }, withConverter: function (n) { return init(assign$1({}, this.converter, n), this.attributes) } }, { attributes: { value: Object.freeze(t) }, converter: { value: Object.freeze(e) } } ) } var api = init(defaultConverter, { path: '/' }) const setUserInfo = e => { api.set('userInfo', e, { expires: 7 }) }, removeAuth = () => { api.remove('token'), api.remove('userInfo') }, setAuth = e => { api.set('token', e, { expires: 7 }) }, getUserInfo$1 = () => { let e = api.get('userInfo') return (e = e ? JSON.parse(e) : {}), e || null }, getAuth = () => { let e = api.get('token') return (e = e ? JSON.parse(e) : {}), e.token || null }, getUserType = () => { let e = api.get('token') return (e = e ? JSON.parse(e) : {}), e.loginUserType || null }, getWeekCh = (e, t = 0) => t ? [ '\u661F\u671F\u5929', '\u661F\u671F\u4E00', '\u661F\u671F\u4E8C', '\u661F\u671F\u4E09', '\u661F\u671F\u56DB', '\u661F\u671F\u4E94', '\u661F\u671F\u516D' ][e] : [ '\u5468\u65E5', '\u5468\u4E00', '\u5468\u4E8C', '\u5468\u4E09', '\u5468\u56DB', '\u5468\u4E94', '\u5468\u516D' ][e] function vaildTeachingUrl() { let e = window.location.href, t = '' return ( /colexiu/.test(e) ? (t = 'https://online.colexiu.com') : /dev/.test(e) ? (t = 'https://test.colexiu.com') : (/test/.test(e), (t = 'https://dev.colexiu.com')), t ) } const getCodeBaseUrl = e => { let t = window.location.origin t = t.replace('www.', 'online.') const r = e || window.location.pathname return `${t}${r}` }, request = extend({ timeout: 2e4, timeoutMessage: '\u8BF7\u6C42\u8D85\u65F6' }) request.interceptors.request.use( (e, t) => { t.initRequest const r = getAuth() || '', o = {} return ( r && ![ '/api-auth/usernameLogin', '/api-auth/smsLogin', '/api-auth/code/sendSms' ].includes(e) && (o.Authorization = r), { url: e, options: pr(ar({}, t), { params: src(t.params), headers: ar(ar({}, t.headers), o) }) } ) }, { global: !1 } ) request.interceptors.response.use( async e => { if (e.status > 299 || e.status < 200) { const r = '\u670D\u52A1\u5668\u9519\u8BEF\uFF0C\u72B6\u6001\u7801' + e.status throw (ElMessage.error(r), new Error(r)) } const t = await e.clone().json() if (t.code !== 200 && t.errCode !== 0) { const r = t.msg || t.message || '\u5904\u7406\u5931\u8D25\uFF0C\u8BF7\u91CD\u8BD5' throw ( (t.code === 403 || t.code, t.code === 403 || t.code === 401 || ElMessage.error(r), t.code === 403 && (removeAuth(), (window.location.href = location.origin + location.pathname), ElMessage.error( '\u767B\u5F55\u5DF2\u8FC7\u671F\uFF0C\u8BF7\u91CD\u65B0\u767B\u5F55' )), new Error(r)) ) } return e }, { global: !1 } ) function mitt$1(e) { return { all: (e = e || new Map()), on: function (t, r) { var o = e.get(t) o ? o.push(r) : e.set(t, [r]) }, off: function (t, r) { var o = e.get(t) o && (r ? o.splice(o.indexOf(r) >>> 0, 1) : e.set(t, [])) }, emit: function (t, r) { var o = e.get(t) o && o.slice().map(function (n) { n(r) }), (o = e.get('*')) && o.slice().map(function (n) { n(t, r) }) } } } var mitt = mitt$1() const state = reactive({ user: { status: 'init', data: {} }, loginPopupStatus: !1, loginPopupTimer: null }), getUserInfo = async () => { const e = getAuth(), t = getUserType() if (!!e) try { const r = t === 'TEACHER' ? '/api-website/teacher/queryUserInfo' : '/api-website/student/queryUserInfo', o = await request.get(r) ;(state.user.data = o.data || {}), setUserInfo(JSON.stringify(state.user.data)), mitt.emit('mittFn'), (state.user.status = 'login') } catch { state.user.status = 'init' } } /*! * vue-router v4.0.16 * (c) 2022 Eduardo San Martin Morote * @license MIT */ const hasSymbol = typeof Symbol == 'function' && typeof Symbol.toStringTag == 'symbol', PolySymbol = e => (hasSymbol ? Symbol(e) : '_vr_' + e), matchedRouteKey = PolySymbol('rvlm'), viewDepthKey = PolySymbol('rvd'), routerKey = PolySymbol('r'), routeLocationKey = PolySymbol('rl'), routerViewLocationKey = PolySymbol('rvl'), isBrowser = typeof window != 'undefined' function isESModule(e) { return e.__esModule || (hasSymbol && e[Symbol.toStringTag] === 'Module') } const assign = Object.assign function applyToParams(e, t) { const r = {} for (const o in t) { const n = t[o] r[o] = Array.isArray(n) ? n.map(e) : e(n) } return r } const noop = () => {}, TRAILING_SLASH_RE = /\/$/, removeTrailingSlash = e => e.replace(TRAILING_SLASH_RE, '') function parseURL(e, t, r = '/') { let o, n = {}, a = '', l = '' const s = t.indexOf('?'), c = t.indexOf('#', s > -1 ? s : 0) return ( s > -1 && ((o = t.slice(0, s)), (a = t.slice(s + 1, c > -1 ? c : t.length)), (n = e(a))), c > -1 && ((o = o || t.slice(0, c)), (l = t.slice(c, t.length))), (o = resolveRelativePath(o != null ? o : t, r)), { fullPath: o + (a && '?') + a + l, path: o, query: n, hash: l } ) } function stringifyURL(e, t) { const r = t.query ? e(t.query) : '' return t.path + (r && '?') + r + (t.hash || '') } function stripBase(e, t) { return !t || !e.toLowerCase().startsWith(t.toLowerCase()) ? e : e.slice(t.length) || '/' } function isSameRouteLocation(e, t, r) { const o = t.matched.length - 1, n = r.matched.length - 1 return ( o > -1 && o === n && isSameRouteRecord(t.matched[o], r.matched[n]) && isSameRouteLocationParams(t.params, r.params) && e(t.query) === e(r.query) && t.hash === r.hash ) } function isSameRouteRecord(e, t) { return (e.aliasOf || e) === (t.aliasOf || t) } function isSameRouteLocationParams(e, t) { if (Object.keys(e).length !== Object.keys(t).length) return !1 for (const r in e) if (!isSameRouteLocationParamsValue(e[r], t[r])) return !1 return !0 } function isSameRouteLocationParamsValue(e, t) { return Array.isArray(e) ? isEquivalentArray(e, t) : Array.isArray(t) ? isEquivalentArray(t, e) : e === t } function isEquivalentArray(e, t) { return Array.isArray(t) ? e.length === t.length && e.every((r, o) => r === t[o]) : e.length === 1 && e[0] === t } function resolveRelativePath(e, t) { if (e.startsWith('/')) return e if (!e) return t const r = t.split('/'), o = e.split('/') let n = r.length - 1, a, l for (a = 0; a < o.length; a++) if (((l = o[a]), !(n === 1 || l === '.'))) if (l === '..') n-- else break return ( r.slice(0, n).join('/') + '/' + o.slice(a - (a === o.length ? 1 : 0)).join('/') ) } var NavigationType ;(function (e) { ;(e.pop = 'pop'), (e.push = 'push') })(NavigationType || (NavigationType = {})) var NavigationDirection ;(function (e) { ;(e.back = 'back'), (e.forward = 'forward'), (e.unknown = '') })(NavigationDirection || (NavigationDirection = {})) function normalizeBase(e) { if (!e) if (isBrowser) { const t = document.querySelector('base') ;(e = (t && t.getAttribute('href')) || '/'), (e = e.replace(/^\w+:\/\/[^\/]+/, '')) } else e = '/' return e[0] !== '/' && e[0] !== '#' && (e = '/' + e), removeTrailingSlash(e) } const BEFORE_HASH_RE = /^[^#]+#/ function createHref(e, t) { return e.replace(BEFORE_HASH_RE, '#') + t } function getElementPosition(e, t) { const r = document.documentElement.getBoundingClientRect(), o = e.getBoundingClientRect() return { behavior: t.behavior, left: o.left - r.left - (t.left || 0), top: o.top - r.top - (t.top || 0) } } const computeScrollPosition = () => ({ left: window.pageXOffset, top: window.pageYOffset }) function scrollToPosition(e) { let t if ('el' in e) { const r = e.el, o = typeof r == 'string' && r.startsWith('#'), n = typeof r == 'string' ? o ? document.getElementById(r.slice(1)) : document.querySelector(r) : r if (!n) return t = getElementPosition(n, e) } else t = e 'scrollBehavior' in document.documentElement.style ? window.scrollTo(t) : window.scrollTo( t.left != null ? t.left : window.pageXOffset, t.top != null ? t.top : window.pageYOffset ) } function getScrollKey(e, t) { return (history.state ? history.state.position - t : -1) + e } const scrollPositions = new Map() function saveScrollPosition(e, t) { scrollPositions.set(e, t) } function getSavedScrollPosition(e) { const t = scrollPositions.get(e) return scrollPositions.delete(e), t } let createBaseLocation = () => location.protocol + '//' + location.host function createCurrentLocation(e, t) { const { pathname: r, search: o, hash: n } = t, a = e.indexOf('#') if (a > -1) { let s = n.includes(e.slice(a)) ? e.slice(a).length : 1, c = n.slice(s) return c[0] !== '/' && (c = '/' + c), stripBase(c, '') } return stripBase(r, e) + o + n } function useHistoryListeners(e, t, r, o) { let n = [], a = [], l = null const s = ({ state: f }) => { const _ = createCurrentLocation(e, location), b = r.value, v = t.value let k = 0 if (f) { if (((r.value = _), (t.value = f), l && l === b)) { l = null return } k = v ? f.position - v.position : 0 } else o(_) n.forEach(g => { g(r.value, b, { delta: k, type: NavigationType.pop, direction: k ? k > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown }) }) } function c() { l = r.value } function d(f) { n.push(f) const _ = () => { const b = n.indexOf(f) b > -1 && n.splice(b, 1) } return a.push(_), _ } function u() { const { history: f } = window !f.state || f.replaceState( assign({}, f.state, { scroll: computeScrollPosition() }), '' ) } function m() { for (const f of a) f() ;(a = []), window.removeEventListener('popstate', s), window.removeEventListener('beforeunload', u) } return ( window.addEventListener('popstate', s), window.addEventListener('beforeunload', u), { pauseListeners: c, listen: d, destroy: m } ) } function buildState(e, t, r, o = !1, n = !1) { return { back: e, current: t, forward: r, replaced: o, position: window.history.length, scroll: n ? computeScrollPosition() : null } } function useHistoryStateNavigation(e) { const { history: t, location: r } = window, o = { value: createCurrentLocation(e, r) }, n = { value: t.state } n.value || a( o.value, { back: null, current: o.value, forward: null, position: t.length - 1, replaced: !0, scroll: null }, !0 ) function a(c, d, u) { const m = e.indexOf('#'), f = m > -1 ? (r.host && document.querySelector('base') ? e : e.slice(m)) + c : createBaseLocation() + e + c try { t[u ? 'replaceState' : 'pushState'](d, '', f), (n.value = d) } catch (_) { console.error(_), r[u ? 'replace' : 'assign'](f) } } function l(c, d) { const u = assign( {}, t.state, buildState(n.value.back, c, n.value.forward, !0), d, { position: n.value.position } ) a(c, u, !0), (o.value = c) } function s(c, d) { const u = assign({}, n.value, t.state, { forward: c, scroll: computeScrollPosition() }) a(u.current, u, !0) const m = assign( {}, buildState(o.value, c, null), { position: u.position + 1 }, d ) a(c, m, !1), (o.value = c) } return { location: o, state: n, push: s, replace: l } } function createWebHistory(e) { e = normalizeBase(e) const t = useHistoryStateNavigation(e), r = useHistoryListeners(e, t.state, t.location, t.replace) function o(a, l = !0) { l || r.pauseListeners(), history.go(a) } const n = assign( { location: '', base: e, go: o, createHref: createHref.bind(null, e) }, t, r ) return ( Object.defineProperty(n, 'location', { enumerable: !0, get: () => t.location.value }), Object.defineProperty(n, 'state', { enumerable: !0, get: () => t.state.value }), n ) } function createWebHashHistory(e) { return ( (e = location.host ? e || location.pathname + location.search : ''), e.includes('#') || (e += '#'), createWebHistory(e) ) } function isRouteLocation(e) { return typeof e == 'string' || (e && typeof e == 'object') } function isRouteName(e) { return typeof e == 'string' || typeof e == 'symbol' } const START_LOCATION_NORMALIZED = { path: '/', name: void 0, params: {}, query: {}, hash: '', fullPath: '/', matched: [], meta: {}, redirectedFrom: void 0 }, NavigationFailureSymbol = PolySymbol('nf') var NavigationFailureType ;(function (e) { ;(e[(e.aborted = 4)] = 'aborted'), (e[(e.cancelled = 8)] = 'cancelled'), (e[(e.duplicated = 16)] = 'duplicated') })(NavigationFailureType || (NavigationFailureType = {})) function createRouterError(e, t) { return assign(new Error(), { type: e, [NavigationFailureSymbol]: !0 }, t) } function isNavigationFailure(e, t) { return ( e instanceof Error && NavigationFailureSymbol in e && (t == null || !!(e.type & t)) ) } const BASE_PARAM_PATTERN = '[^/]+?', BASE_PATH_PARSER_OPTIONS = { sensitive: !1, strict: !1, start: !0, end: !0 }, REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g function tokensToParser(e, t) { const r = assign({}, BASE_PATH_PARSER_OPTIONS, t), o = [] let n = r.start ? '^' : '' const a = [] for (const d of e) { const u = d.length ? [] : [90] r.strict && !d.length && (n += '/') for (let m = 0; m < d.length; m++) { const f = d[m] let _ = 40 + (r.sensitive ? 0.25 : 0) if (f.type === 0) m || (n += '/'), (n += f.value.replace(REGEX_CHARS_RE, '\\$&')), (_ += 40) else if (f.type === 1) { const { value: b, repeatable: v, optional: k, regexp: g } = f a.push({ name: b, repeatable: v, optional: k }) const x = g || BASE_PARAM_PATTERN if (x !== BASE_PARAM_PATTERN) { _ += 10 try { new RegExp(`(${x})`) } catch (w) { throw new Error( `Invalid custom RegExp for param "${b}" (${x}): ` + w.message ) } } let y = v ? `((?:${x})(?:/(?:${x}))*)` : `(${x})` m || (y = k && d.length < 2 ? `(?:/${y})` : '/' + y), k && (y += '?'), (n += y), (_ += 20), k && (_ += -8), v && (_ += -20), x === '.*' && (_ += -50) } u.push(_) } o.push(u) } if (r.strict && r.end) { const d = o.length - 1 o[d][o[d].length - 1] += 0.7000000000000001 } r.strict || (n += '/?'), r.end ? (n += '$') : r.strict && (n += '(?:/|$)') const l = new RegExp(n, r.sensitive ? '' : 'i') function s(d) { const u = d.match(l), m = {} if (!u) return null for (let f = 1; f < u.length; f++) { const _ = u[f] || '', b = a[f - 1] m[b.name] = _ && b.repeatable ? _.split('/') : _ } return m } function c(d) { let u = '', m = !1 for (const f of e) { ;(!m || !u.endsWith('/')) && (u += '/'), (m = !1) for (const _ of f) if (_.type === 0) u += _.value else if (_.type === 1) { const { value: b, repeatable: v, optional: k } = _, g = b in d ? d[b] : '' if (Array.isArray(g) && !v) throw new Error( `Provided param "${b}" is an array but it is not repeatable (* or + modifiers)` ) const x = Array.isArray(g) ? g.join('/') : g if (!x) if (k) f.length < 2 && e.length > 1 && (u.endsWith('/') ? (u = u.slice(0, -1)) : (m = !0)) else throw new Error(`Missing required param "${b}"`) u += x } } return u } return { re: l, score: o, keys: a, parse: s, stringify: c } } function compareScoreArray(e, t) { let r = 0 for (; r < e.length && r < t.length; ) { const o = t[r] - e[r] if (o) return o r++ } return e.length < t.length ? e.length === 1 && e[0] === 40 + 40 ? -1 : 1 : e.length > t.length ? t.length === 1 && t[0] === 40 + 40 ? 1 : -1 : 0 } function comparePathParserScore(e, t) { let r = 0 const o = e.score, n = t.score for (; r < o.length && r < n.length; ) { const a = compareScoreArray(o[r], n[r]) if (a) return a r++ } if (Math.abs(n.length - o.length) === 1) { if (isLastScoreNegative(o)) return 1 if (isLastScoreNegative(n)) return -1 } return n.length - o.length } function isLastScoreNegative(e) { const t = e[e.length - 1] return e.length > 0 && t[t.length - 1] < 0 } const ROOT_TOKEN = { type: 0, value: '' }, VALID_PARAM_RE = /[a-zA-Z0-9_]/ function tokenizePath(e) { if (!e) return [[]] if (e === '/') return [[ROOT_TOKEN]] if (!e.startsWith('/')) throw new Error(`Invalid path "${e}"`) function t(_) { throw new Error(`ERR (${r})/"${d}": ${_}`) } let r = 0, o = r const n = [] let a function l() { a && n.push(a), (a = []) } let s = 0, c, d = '', u = '' function m() { !d || (r === 0 ? a.push({ type: 0, value: d }) : r === 1 || r === 2 || r === 3 ? (a.length > 1 && (c === '*' || c === '+') && t( `A repeatable param (${d}) must be alone in its segment. eg: '/:ids+.` ), a.push({ type: 1, value: d, regexp: u, repeatable: c === '*' || c === '+', optional: c === '*' || c === '?' })) : t('Invalid state to consume buffer'), (d = '')) } function f() { d += c } for (; s < e.length; ) { if (((c = e[s++]), c === '\\' && r !== 2)) { ;(o = r), (r = 4) continue } switch (r) { case 0: c === '/' ? (d && m(), l()) : c === ':' ? (m(), (r = 1)) : f() break case 4: f(), (r = o) break case 1: c === '(' ? (r = 2) : VALID_PARAM_RE.test(c) ? f() : (m(), (r = 0), c !== '*' && c !== '?' && c !== '+' && s--) break case 2: c === ')' ? u[u.length - 1] == '\\' ? (u = u.slice(0, -1) + c) : (r = 3) : (u += c) break case 3: m(), (r = 0), c !== '*' && c !== '?' && c !== '+' && s--, (u = '') break default: t('Unknown state') break } } return r === 2 && t(`Unfinished custom RegExp for param "${d}"`), m(), l(), n } function createRouteRecordMatcher(e, t, r) { const o = tokensToParser(tokenizePath(e.path), r), n = assign(o, { record: e, parent: t, children: [], alias: [] }) return t && !n.record.aliasOf == !t.record.aliasOf && t.children.push(n), n } function createRouterMatcher(e, t) { const r = [], o = new Map() t = mergeOptions({ strict: !1, end: !0, sensitive: !1 }, t) function n(u) { return o.get(u) } function a(u, m, f) { const _ = !f, b = normalizeRouteRecord(u) b.aliasOf = f && f.record const v = mergeOptions(t, u), k = [b] if ('alias' in u) { const y = typeof u.alias == 'string' ? [u.alias] : u.alias for (const w of y) k.push( assign({}, b, { components: f ? f.record.components : b.components, path: w, aliasOf: f ? f.record : b }) ) } let g, x for (const y of k) { const { path: w } = y if (m && w[0] !== '/') { const S = m.record.path, T = S[S.length - 1] === '/' ? '' : '/' y.path = m.record.path + (w && T + w) } if ( ((g = createRouteRecordMatcher(y, m, v)), f ? f.alias.push(g) : ((x = x || g), x !== g && x.alias.push(g), _ && u.name && !isAliasRecord(g) && l(u.name)), 'children' in b) ) { const S = b.children for (let T = 0; T < S.length; T++) a(S[T], g, f && f.children[T]) } ;(f = f || g), c(g) } return x ? () => { l(x) } : noop } function l(u) { if (isRouteName(u)) { const m = o.get(u) m && (o.delete(u), r.splice(r.indexOf(m), 1), m.children.forEach(l), m.alias.forEach(l)) } else { const m = r.indexOf(u) m > -1 && (r.splice(m, 1), u.record.name && o.delete(u.record.name), u.children.forEach(l), u.alias.forEach(l)) } } function s() { return r } function c(u) { let m = 0 for ( ; m < r.length && comparePathParserScore(u, r[m]) >= 0 && (u.record.path !== r[m].record.path || !isRecordChildOf(u, r[m])); ) m++ r.splice(m, 0, u), u.record.name && !isAliasRecord(u) && o.set(u.record.name, u) } function d(u, m) { let f, _ = {}, b, v if ('name' in u && u.name) { if (((f = o.get(u.name)), !f)) throw createRouterError(1, { location: u }) ;(v = f.record.name), (_ = assign( paramsFromLocation( m.params, f.keys.filter(x => !x.optional).map(x => x.name) ), u.params )), (b = f.stringify(_)) } else if ('path' in u) (b = u.path), (f = r.find(x => x.re.test(b))), f && ((_ = f.parse(b)), (v = f.record.name)) else { if (((f = m.name ? o.get(m.name) : r.find(x => x.re.test(m.path))), !f)) throw createRouterError(1, { location: u, currentLocation: m }) ;(v = f.record.name), (_ = assign({}, m.params, u.params)), (b = f.stringify(_)) } const k = [] let g = f for (; g; ) k.unshift(g.record), (g = g.parent) return { name: v, path: b, params: _, matched: k, meta: mergeMetaFields(k) } } return ( e.forEach(u => a(u)), { addRoute: a, resolve: d, removeRoute: l, getRoutes: s, getRecordMatcher: n } ) } function paramsFromLocation(e, t) { const r = {} for (const o of t) o in e && (r[o] = e[o]) return r } function normalizeRouteRecord(e) { return { path: e.path, redirect: e.redirect, name: e.name, meta: e.meta || {}, aliasOf: void 0, beforeEnter: e.beforeEnter, props: normalizeRecordProps(e), children: e.children || [], instances: {}, leaveGuards: new Set(), updateGuards: new Set(), enterCallbacks: {}, components: 'components' in e ? e.components || {} : { default: e.component } } } function normalizeRecordProps(e) { const t = {}, r = e.props || !1 if ('component' in e) t.default = r else for (const o in e.components) t[o] = typeof r == 'boolean' ? r : r[o] return t } function isAliasRecord(e) { for (; e; ) { if (e.record.aliasOf) return !0 e = e.parent } return !1 } function mergeMetaFields(e) { return e.reduce((t, r) => assign(t, r.meta), {}) } function mergeOptions(e, t) { const r = {} for (const o in e) r[o] = o in t ? t[o] : e[o] return r } function isRecordChildOf(e, t) { return t.children.some(r => r === e || isRecordChildOf(e, r)) } const HASH_RE = /#/g, AMPERSAND_RE = /&/g, SLASH_RE = /\//g, EQUAL_RE = /=/g, IM_RE = /\?/g, PLUS_RE = /\+/g, ENC_BRACKET_OPEN_RE = /%5B/g, ENC_BRACKET_CLOSE_RE = /%5D/g, ENC_CARET_RE = /%5E/g, ENC_BACKTICK_RE = /%60/g, ENC_CURLY_OPEN_RE = /%7B/g, ENC_PIPE_RE = /%7C/g, ENC_CURLY_CLOSE_RE = /%7D/g, ENC_SPACE_RE = /%20/g function commonEncode(e) { return encodeURI('' + e) .replace(ENC_PIPE_RE, '|') .replace(ENC_BRACKET_OPEN_RE, '[') .replace(ENC_BRACKET_CLOSE_RE, ']') } function encodeHash(e) { return commonEncode(e) .replace(ENC_CURLY_OPEN_RE, '{') .replace(ENC_CURLY_CLOSE_RE, '}') .replace(ENC_CARET_RE, '^') } function encodeQueryValue(e) { return commonEncode(e) .replace(PLUS_RE, '%2B') .replace(ENC_SPACE_RE, '+') .replace(HASH_RE, '%23') .replace(AMPERSAND_RE, '%26') .replace(ENC_BACKTICK_RE, '`') .replace(ENC_CURLY_OPEN_RE, '{') .replace(ENC_CURLY_CLOSE_RE, '}') .replace(ENC_CARET_RE, '^') } function encodeQueryKey(e) { return encodeQueryValue(e).replace(EQUAL_RE, '%3D') } function encodePath(e) { return commonEncode(e).replace(HASH_RE, '%23').replace(IM_RE, '%3F') } function encodeParam(e) { return e == null ? '' : encodePath(e).replace(SLASH_RE, '%2F') } function decode(e) { try { return decodeURIComponent('' + e) } catch {} return '' + e } function parseQuery(e) { const t = {} if (e === '' || e === '?') return t const o = (e[0] === '?' ? e.slice(1) : e).split('&') for (let n = 0; n < o.length; ++n) { const a = o[n].replace(PLUS_RE, ' '), l = a.indexOf('='), s = decode(l < 0 ? a : a.slice(0, l)), c = l < 0 ? null : decode(a.slice(l + 1)) if (s in t) { let d = t[s] Array.isArray(d) || (d = t[s] = [d]), d.push(c) } else t[s] = c } return t } function stringifyQuery(e) { let t = '' for (let r in e) { const o = e[r] if (((r = encodeQueryKey(r)), o == null)) { o !== void 0 && (t += (t.length ? '&' : '') + r) continue } ;(Array.isArray(o) ? o.map(a => a && encodeQueryValue(a)) : [o && encodeQueryValue(o)] ).forEach(a => { a !== void 0 && ((t += (t.length ? '&' : '') + r), a != null && (t += '=' + a)) }) } return t } function normalizeQuery(e) { const t = {} for (const r in e) { const o = e[r] o !== void 0 && (t[r] = Array.isArray(o) ? o.map(n => (n == null ? null : '' + n)) : o == null ? o : '' + o) } return t } function useCallbacks() { let e = [] function t(o) { return ( e.push(o), () => { const n = e.indexOf(o) n > -1 && e.splice(n, 1) } ) } function r() { e = [] } return { add: t, list: () => e, reset: r } } function guardToPromiseFn(e, t, r, o, n) { const a = o && (o.enterCallbacks[n] = o.enterCallbacks[n] || []) return () => new Promise((l, s) => { const c = m => { m === !1 ? s(createRouterError(4, { from: r, to: t })) : m instanceof Error ? s(m) : isRouteLocation(m) ? s(createRouterError(2, { from: t, to: m })) : (a && o.enterCallbacks[n] === a && typeof m == 'function' && a.push(m), l()) }, d = e.call(o && o.instances[n], t, r, c) let u = Promise.resolve(d) e.length < 3 && (u = u.then(c)), u.catch(m => s(m)) }) } function extractComponentsGuards(e, t, r, o) { const n = [] for (const a of e) for (const l in a.components) { let s = a.components[l] if (!(t !== 'beforeRouteEnter' && !a.instances[l])) if (isRouteComponent(s)) { const d = (s.__vccOpts || s)[t] d && n.push(guardToPromiseFn(d, r, o, a, l)) } else { let c = s() n.push(() => c.then(d => { if (!d) return Promise.reject( new Error(`Couldn't resolve component "${l}" at "${a.path}"`) ) const u = isESModule(d) ? d.default : d a.components[l] = u const f = (u.__vccOpts || u)[t] return f && guardToPromiseFn(f, r, o, a, l)() }) ) } } return n } function isRouteComponent(e) { return ( typeof e == 'object' || 'displayName' in e || 'props' in e || '__vccOpts' in e ) } function useLink(e) { const t = inject(routerKey), r = inject(routeLocationKey), o = computed(() => t.resolve(unref(e.to))), n = computed(() => { const { matched: c } = o.value, { length: d } = c, u = c[d - 1], m = r.matched if (!u || !m.length) return -1 const f = m.findIndex(isSameRouteRecord.bind(null, u)) if (f > -1) return f const _ = getOriginalPath(c[d - 2]) return d > 1 && getOriginalPath(u) === _ && m[m.length - 1].path !== _ ? m.findIndex(isSameRouteRecord.bind(null, c[d - 2])) : f }), a = computed( () => n.value > -1 && includesParams(r.params, o.value.params) ), l = computed( () => n.value > -1 && n.value === r.matched.length - 1 && isSameRouteLocationParams(r.params, o.value.params) ) function s(c = {}) { return guardEvent(c) ? t[unref(e.replace) ? 'replace' : 'push'](unref(e.to)).catch(noop) : Promise.resolve() } return { route: o, href: computed(() => o.value.href), isActive: a, isExactActive: l, navigate: s } } const RouterLinkImpl = defineComponent({ name: 'RouterLink', compatConfig: { MODE: 3 }, props: { to: { type: [String, Object], required: !0 }, replace: Boolean, activeClass: String, exactActiveClass: String, custom: Boolean, ariaCurrentValue: { type: String, default: 'page' } }, useLink, setup(e, { slots: t }) { const r = reactive(useLink(e)), { options: o } = inject(routerKey), n = computed(() => ({ [getLinkClass( e.activeClass, o.linkActiveClass, 'router-link-active' )]: r.isActive, [getLinkClass( e.exactActiveClass, o.linkExactActiveClass, 'router-link-exact-active' )]: r.isExactActive })) return () => { const a = t.default && t.default(r) return e.custom ? a : h( 'a', { 'aria-current': r.isExactActive ? e.ariaCurrentValue : null, href: r.href, onClick: r.navigate, class: n.value }, a ) } } }), RouterLink = RouterLinkImpl function guardEvent(e) { if ( !(e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) && !e.defaultPrevented && !(e.button !== void 0 && e.button !== 0) ) { if (e.currentTarget && e.currentTarget.getAttribute) { const t = e.currentTarget.getAttribute('target') if (/\b_blank\b/i.test(t)) return } return e.preventDefault && e.preventDefault(), !0 } } function includesParams(e, t) { for (const r in t) { const o = t[r], n = e[r] if (typeof o == 'string') { if (o !== n) return !1 } else if ( !Array.isArray(n) || n.length !== o.length || o.some((a, l) => a !== n[l]) ) return !1 } return !0 } function getOriginalPath(e) { return e ? (e.aliasOf ? e.aliasOf.path : e.path) : '' } const getLinkClass = (e, t, r) => (e != null ? e : t != null ? t : r), RouterViewImpl = defineComponent({ name: 'RouterView', inheritAttrs: !1, props: { name: { type: String, default: 'default' }, route: Object }, compatConfig: { MODE: 3 }, setup(e, { attrs: t, slots: r }) { const o = inject(routerViewLocationKey), n = computed(() => e.route || o.value), a = inject(viewDepthKey, 0), l = computed(() => n.value.matched[a]) provide(viewDepthKey, a + 1), provide(matchedRouteKey, l), provide(routerViewLocationKey, n) const s = ref() return ( watch( () => [s.value, l.value, e.name], ([c, d, u], [m, f, _]) => { d && ((d.instances[u] = c), f && f !== d && c && c === m && (d.leaveGuards.size || (d.leaveGuards = f.leaveGuards), d.updateGuards.size || (d.updateGuards = f.updateGuards))), c && d && (!f || !isSameRouteRecord(d, f) || !m) && (d.enterCallbacks[u] || []).forEach(b => b(c)) }, { flush: 'post' } ), () => { const c = n.value, d = l.value, u = d && d.components[e.name], m = e.name if (!u) return normalizeSlot(r.default, { Component: u, route: c }) const f = d.props[e.name], _ = f ? f === !0 ? c.params : typeof f == 'function' ? f(c) : f : null, v = h( u, assign({}, _, t, { onVnodeUnmounted: k => { k.component.isUnmounted && (d.instances[m] = null) }, ref: s }) ) return normalizeSlot(r.default, { Component: v, route: c }) || v } ) } }) function normalizeSlot(e, t) { if (!e) return null const r = e(t) return r.length === 1 ? r[0] : r } const RouterView = RouterViewImpl function createRouter(e) { const t = createRouterMatcher(e.routes, e), r = e.parseQuery || parseQuery, o = e.stringifyQuery || stringifyQuery, n = e.history, a = useCallbacks(), l = useCallbacks(), s = useCallbacks(), c = shallowRef(START_LOCATION_NORMALIZED) let d = START_LOCATION_NORMALIZED isBrowser && e.scrollBehavior && 'scrollRestoration' in history && (history.scrollRestoration = 'manual') const u = applyToParams.bind(null, _e => '' + _e), m = applyToParams.bind(null, encodeParam), f = applyToParams.bind(null, decode) function _(_e, Oe) { let xe, $e return ( isRouteName(_e) ? ((xe = t.getRecordMatcher(_e)), ($e = Oe)) : ($e = _e), t.addRoute($e, xe) ) } function b(_e) { const Oe = t.getRecordMatcher(_e) Oe && t.removeRoute(Oe) } function v() { return t.getRoutes().map(_e => _e.record) } function k(_e) { return !!t.getRecordMatcher(_e) } function g(_e, Oe) { if (((Oe = assign({}, Oe || c.value)), typeof _e == 'string')) { const tr = parseURL(r, _e, Oe.path), D = t.resolve({ path: tr.path }, Oe), de = n.createHref(tr.fullPath) return assign(tr, D, { params: f(D.params), hash: decode(tr.hash), redirectedFrom: void 0, href: de }) } let xe if ('path' in _e) xe = assign({}, _e, { path: parseURL(r, _e.path, Oe.path).path }) else { const tr = assign({}, _e.params) for (const D in tr) tr[D] == null && delete tr[D] ;(xe = assign({}, _e, { params: m(_e.params) })), (Oe.params = m(Oe.params)) } const $e = t.resolve(xe, Oe), jt = _e.hash || '' $e.params = u(f($e.params)) const or = stringifyURL( o, assign({}, _e, { hash: encodeHash(jt), path: $e.path }) ), er = n.createHref(or) return assign( { fullPath: or, hash: jt, query: o === stringifyQuery ? normalizeQuery(_e.query) : _e.query || {} }, $e, { redirectedFrom: void 0, href: er } ) } function x(_e) { return typeof _e == 'string' ? parseURL(r, _e, c.value.path) : assign({}, _e) } function y(_e, Oe) { if (d !== _e) return createRouterError(8, { from: Oe, to: _e }) } function w(_e) { return A(_e) } function S(_e) { return w(assign(x(_e), { replace: !0 })) } function T(_e) { const Oe = _e.matched[_e.matched.length - 1] if (Oe && Oe.redirect) { const { redirect: xe } = Oe let $e = typeof xe == 'function' ? xe(_e) : xe return ( typeof $e == 'string' && (($e = $e.includes('?') || $e.includes('#') ? ($e = x($e)) : { path: $e }), ($e.params = {})), assign({ query: _e.query, hash: _e.hash, params: _e.params }, $e) ) } } function A(_e, Oe) { const xe = (d = g(_e)), $e = c.value, jt = _e.state, or = _e.force, er = _e.replace === !0, tr = T(xe) if (tr) return A(assign(x(tr), { state: jt, force: or, replace: er }), Oe || xe) const D = xe D.redirectedFrom = Oe let de return ( !or && isSameRouteLocation(o, $e, xe) && ((de = createRouterError(16, { to: D, from: $e })), pe($e, $e, !0, !1)), (de ? Promise.resolve(de) : F(D, $e)) .catch(Ce => isNavigationFailure(Ce) ? isNavigationFailure(Ce, 2) ? Ce : L(Ce) : z(Ce, D, $e) ) .then(Ce => { if (Ce) { if (isNavigationFailure(Ce, 2)) return A( assign(x(Ce.to), { state: jt, force: or, replace: er }), Oe || D ) } else Ce = ae(D, $e, !0, er, jt) return Y(D, $e, Ce), Ce }) ) } function $(_e, Oe) { const xe = y(_e, Oe) return xe ? Promise.reject(xe) : Promise.resolve() } function F(_e, Oe) { let xe const [$e, jt, or] = extractChangingRecords(_e, Oe) xe = extractComponentsGuards($e.reverse(), 'beforeRouteLeave', _e, Oe) for (const tr of $e) tr.leaveGuards.forEach(D => { xe.push(guardToPromiseFn(D, _e, Oe)) }) const er = $.bind(null, _e, Oe) return ( xe.push(er), runGuardQueue(xe) .then(() => { xe = [] for (const tr of a.list()) xe.push(guardToPromiseFn(tr, _e, Oe)) return xe.push(er), runGuardQueue(xe) }) .then(() => { xe = extractComponentsGuards(jt, 'beforeRouteUpdate', _e, Oe) for (const tr of jt) tr.updateGuards.forEach(D => { xe.push(guardToPromiseFn(D, _e, Oe)) }) return xe.push(er), runGuardQueue(xe) }) .then(() => { xe = [] for (const tr of _e.matched) if (tr.beforeEnter && !Oe.matched.includes(tr)) if (Array.isArray(tr.beforeEnter)) for (const D of tr.beforeEnter) xe.push(guardToPromiseFn(D, _e, Oe)) else xe.push(guardToPromiseFn(tr.beforeEnter, _e, Oe)) return xe.push(er), runGuardQueue(xe) }) .then( () => ( _e.matched.forEach(tr => (tr.enterCallbacks = {})), (xe = extractComponentsGuards(or, 'beforeRouteEnter', _e, Oe)), xe.push(er), runGuardQueue(xe) ) ) .then(() => { xe = [] for (const tr of l.list()) xe.push(guardToPromiseFn(tr, _e, Oe)) return xe.push(er), runGuardQueue(xe) }) .catch(tr => (isNavigationFailure(tr, 8) ? tr : Promise.reject(tr))) ) } function Y(_e, Oe, xe) { for (const $e of s.list()) $e(_e, Oe, xe) } function ae(_e, Oe, xe, $e, jt) { const or = y(_e, Oe) if (or) return or const er = Oe === START_LOCATION_NORMALIZED, tr = isBrowser ? history.state : {} xe && ($e || er ? n.replace(_e.fullPath, assign({ scroll: er && tr && tr.scroll }, jt)) : n.push(_e.fullPath, jt)), (c.value = _e), pe(_e, Oe, xe, er), L() } let re function ie() { re || (re = n.listen((_e, Oe, xe) => { const $e = g(_e), jt = T($e) if (jt) { A(assign(jt, { replace: !0 }), $e).catch(noop) return } d = $e const or = c.value isBrowser && saveScrollPosition( getScrollKey(or.fullPath, xe.delta), computeScrollPosition() ), F($e, or) .catch(er => isNavigationFailure(er, 12) ? er : isNavigationFailure(er, 2) ? (A(er.to, $e) .then(tr => { isNavigationFailure(tr, 20) && !xe.delta && xe.type === NavigationType.pop && n.go(-1, !1) }) .catch(noop), Promise.reject()) : (xe.delta && n.go(-xe.delta, !1), z(er, $e, or)) ) .then(er => { ;(er = er || ae($e, or, !1)), er && (xe.delta ? n.go(-xe.delta, !1) : xe.type === NavigationType.pop && isNavigationFailure(er, 20) && n.go(-1, !1)), Y($e, or, er) }) .catch(noop) })) } let oe = useCallbacks(), j = useCallbacks(), V function z(_e, Oe, xe) { L(_e) const $e = j.list() return ( $e.length ? $e.forEach(jt => jt(_e, Oe, xe)) : console.error(_e), Promise.reject(_e) ) } function M() { return V && c.value !== START_LOCATION_NORMALIZED ? Promise.resolve() : new Promise((_e, Oe) => { oe.add([_e, Oe]) }) } function L(_e) { return ( V || ((V = !_e), ie(), oe.list().forEach(([Oe, xe]) => (_e ? xe(_e) : Oe())), oe.reset()), _e ) } function pe(_e, Oe, xe, $e) { const { scrollBehavior: jt } = e if (!isBrowser || !jt) return Promise.resolve() const or = (!xe && getSavedScrollPosition(getScrollKey(_e.fullPath, 0))) || (($e || !xe) && history.state && history.state.scroll) || null return nextTick() .then(() => jt(_e, Oe, or)) .then(er => er && scrollToPosition(er)) .catch(er => z(er, _e, Oe)) } const ue = _e => n.go(_e) let Ie const Pt = new Set() return { currentRoute: c, addRoute: _, removeRoute: b, hasRoute: k, getRoutes: v, resolve: g, options: e, push: w, replace: S, go: ue, back: () => ue(-1), forward: () => ue(1), beforeEach: a.add, beforeResolve: l.add, afterEach: s.add, onError: j.add, isReady: M, install(_e) { const Oe = this _e.component('RouterLink', RouterLink), _e.component('RouterView', RouterView), (_e.config.globalProperties.$router = Oe), Object.defineProperty(_e.config.globalProperties, '$route', { enumerable: !0, get: () => unref(c) }), isBrowser && !Ie && c.value === START_LOCATION_NORMALIZED && ((Ie = !0), w(n.location).catch(jt => {})) const xe = {} for (const jt in START_LOCATION_NORMALIZED) xe[jt] = computed(() => c.value[jt]) _e.provide(routerKey, Oe), _e.provide(routeLocationKey, reactive(xe)), _e.provide(routerViewLocationKey, c) const $e = _e.unmount Pt.add(_e), (_e.unmount = function () { Pt.delete(_e), Pt.size < 1 && ((d = START_LOCATION_NORMALIZED), re && re(), (re = null), (c.value = START_LOCATION_NORMALIZED), (Ie = !1), (V = !1)), $e() }) } } } function runGuardQueue(e) { return e.reduce((t, r) => t.then(() => r()), Promise.resolve()) } function extractChangingRecords(e, t) { const r = [], o = [], n = [], a = Math.max(t.matched.length, e.matched.length) for (let l = 0; l < a; l++) { const s = t.matched[l] s && (e.matched.find(d => isSameRouteRecord(d, s)) ? o.push(s) : r.push(s)) const c = e.matched[l] c && (t.matched.find(d => isSameRouteRecord(d, c)) || n.push(c)) } return [r, o, n] } function useRouter() { return inject(routerKey) } function useRoute() { return inject(routeLocationKey) } const userInfoWrap = '_userInfoWrap_1kiez_1', title = '_title_1kiez_8', userHeader = '_userHeader_1kiez_14', dropdownWrap = '_dropdownWrap_1kiez_21', dropdownWrapUser = '_dropdownWrapUser_1kiez_26', dropdownInfo = '_dropdownInfo_1kiez_60', dropdownItemTitle = '_dropdownItemTitle_1kiez_67', dropdownItemsubTitle = '_dropdownItemsubTitle_1kiez_74' var classes$1 = { userInfoWrap, title, userHeader, dropdownWrap, dropdownWrapUser, dropdownInfo, dropdownItemTitle, dropdownItemsubTitle }, iconTeacher = './assets/icon_teacher.2d942bf5.png', userBanner = './assets/userBanner.5848ec90.png', changeIcon = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAYAAAAf8/9hAAAAAXNSR0IArs4c6QAAAERlWElmTU0AKgAAAAgAAYdpAAQAAAABAAAAGgAAAAAAA6ABAAMAAAABAAEAAKACAAQAAAABAAAAEKADAAQAAAABAAAAEAAAAAA0VXHyAAABwklEQVQ4Ea1TTy8DQRR/b7qIqEaIixBJxZ+kabmJ9EQkLqIuxNlHEO4+gPgIPgARepSIuDg4SLQnl24jOPkTWRXRpc/vTbustjcmuzNv3u/Pm5mdJfpj43p9+irb6T2/ryOfIaEhizMVMGZjXW1bZ2OZl7Dml0HqfHeGKrwjJINhUhAz8TUZWc1PLp/85GqRikX4mNAFYNORWfDMBiZGSbpsrfwtZrqBy2dTAy0ArtWAYA285/LG97KZDvt7osPAck0NkFSuahS3BiyyqBNmuuyZ7F2Klkti2KxE2IyEX4cpAU5RubBZ0N7RjpjisFXr0cfz+70n4opOGppwK3IDFqt9oapBjYndRXR9kH40iJHA4VWA+wihY1vBGggxvrOkkLxtYd5kh8r1BvH2iuu+xcX33QtgSZjp3ahuAV4HsEuhdtwnydkaYQemi1JrNO17xX3wkhYSzupoD7E7Jls/hxNWVmMUmLh7KLnY3bxmlKsaja3BaWK5ZIRXdZOarG9IRvD22TxugXJVo3NroMHl1NKpY2QaJq7OmzZgjqEZ5QZ4w7VN5Y46+M1bw3FncPftz4SlFwxxVtpj2/nxuddA/C/jF7Tlp+KpHhg2AAAAAElFTkSuQmCC', backIcon = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAqFJREFUWEftlz1MFFEQx/9zh6AxJsbEWKChkEQxrEKissuJkUqJioruHuJHpYUWJiYmVmpBY2llQ2MsTFwgQozGSonifZiocO8UEhsk16AhR2Hka++N4ZCDQ273XRCu4bX7n5nfm3kzbx+hwIsKHB9rAFkZqIzax0niPhgVIPi9y0MhYZgBb11uRQYgHZzpOZgnwOgD0aS3Y/lBGMHb3joFAC1sCwA7fX7fgf6D577k41SLdpwmKW8x452Y3HoH9fWOqn0mA1rIdkCICsPKK6W7ers3FfunfgJckg5KeFFctMH6uP/kbxWIeYCwzQB6hGHVqxjOaSred5YV+VJD2TYcmfatOzFY0zTq5WuFANJhB1MOjn6ts4bdIFYSYKYeCZKphligOZ4LwhVgT8jeUuRHldsOJKOUGI9dNEkfobFft3qX0rgCaJH2LjCf8qqjwvdxMLeI2mDXYq07QNh+A+CIQgAFCTmAvC6MYNtC8SoCzBwJYkDeE3qwdQ5idQEyUemB0M2bs2Pj79KWmAPafy1BVuITwjB3FApgmCGPxY3mgUIAxImmGmL6xYTSGdgbsV8zI6/RnKsdGOglZ7pR1F1I5tEFT68y6LLbfxMxNgKodu1Dpu4k+Hyi1hrPaw4oNDeqP3WWOZOLL6MFlkRtYpivwbJSeU/CZQMQtQrdvLuil1GODKSI6EZMNx96bWLZt+G+PrtUjiNzqhmY8BEuxXSrwyv44jYcA2NUGGb57MhUXMxUGWl/S8AhMMaY6EzcMHsUrefPd2W0vY0kXwHhEQNPSGLKy4nD/qGBwNnv5d9elqwf/XUYcGJxvWXEy27JNqz6/GxzamL6FYAadQf0QxjmNnX9v8rsl5Ft+7Xt1ATI3aTyLiCKq9Y6F+Ta06zgGfgDpjFLMDq1eQ4AAAAASUVORK5CYII=', peopleIcon = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAACAAAAAgCAYAAABzenr0AAAAAXNSR0IArs4c6QAAAwNJREFUWEfFl01IFGEYx//PjBiVgRc7GCKEIGy7fkTa7pYUQXkyStzZguwSHTplVHSKoksQJeGhU4eIIH2lQiwoKKiMXT+C0Fkniz4gO/RlpJXKujNPbKyguev7ziQ41+f/8dt39n1nhrDMFy1zP9wB8FnN3+uLaCCDiWvAtBbgcYAsInSlCviq5Td+uflRygAVA6KcU9wBUGXOAsJnYj48FIp2q0IoAVT3tVemWH8M5kJZMIMdAh0yQ8Y1mTY9lwJUDD5Y7UyODxNQqhKY0SRt1oJWuOmFzCMFCMQ6ToPonCwoy/yhGTJ2ynwKAOItCOtlQVnmzEm7NLFt/+hi3kUB/P03S8jWP3go/2th4uZEMHrDM0BFb3uQWYt7BQDolBmKXPAM4OsXVboN6R8pVwFDO5oINbV5Bqh6cafQnp75BkD3sgrM1JAIR+56Bkgb/XHRQ8BWDwBTNDFdNFR/8Pf/AfSJveTgtmsAostmMHJM5pNuw3RAoFd0gbFbFjZn/t5mbLLCxneZRwmg/FnXmvy85D0w18kCAXy0CfVW0LAUtPKjeDbEJ0S+VkJnCNwCYFW2g4cAkdLRYtUan1TK0xqlFZgbVv1UFNkrsJs58zgm+kHEL5NJp2ukbt9r1eJZnWsAtwUyvRJA4LkI8Aw1EngjGMXQaOW8YGYGMAbwKECPZrS87pHNjWOycukt8MVEWZ6OVnbQoBI2RzMJQtsUkuffBA9MeDoHfH1ih27jFgjSl5CcBYRXcLQ9ZrhpJJcm6y2o6hdVto0YgPlL7XIZMvKvyNOCZk3Tu2z2BQC+hMjXf2IYQJm3viwugmUXoNryG8l/pwsA/HFxhIArS1aeCWKik4lg5KIUIBDvHAS4YqkBAHwxR1EMw7DnZs9bgcqYWOcQ0q9QStvTNaSO7Wat8SQngL+3cxcxP3AdrG44boaM1kUARDMxrqvnuVMS+NJQKHoiJ8CGWEe9RnTfXayymsEUNcORzpwA6YE/LqIEcvMRokDAKcdxeoa37BuQ7gKFtCWV/AFiHgAwoMbGYQAAAABJRU5ErkJggg==', loganInfo = defineComponent({ name: 'loganInfo', props: { title: { type: String, default: '' } }, setup(e, t) { const r = reactive({ title: e.title, user: {}, userType: '', showChange: !1 }) mitt.on('mittFn', () => { console.log('mittFn'), a() }) const o = useRoute(), n = useRouter() onMounted(() => { nextTick(() => { a() }) }) const a = () => { ;(r.user = getUserInfo$1()), (r.userType = getUserType()), r.user.userType && (r.user.userType.indexOf('TEACHER') != -1 && r.user.userType.indexOf('STUDENT') != -1 ? (r.showChange = !0) : (r.showChange = !1)) }, l = u => { n.push({ path: u }) }, s = () => { const u = getAuth() let m = '', f = '', _ = o.fullPath r.userType == 'TEACHER' ? ((m = 'STUDENT'), (f = '\u5B66\u751F'), _.indexOf('userInfo') != -1 && (_ = '/studentInfo')) : ((m = 'TEACHER'), (f = '\u8001\u5E08'), _.indexOf('studentInfo') != -1 && (_ = '/userInfo')), ElMessageBox.confirm( `\u662F\u5426\u786E\u5B9A\u5207\u6362\u5230${f}\uFF1F`, '\u63D0\u793A', { type: 'warning' } ).then(() => { setAuth(JSON.stringify({ token: u, loginUserType: m })), n.push({ path: _, query: ar({}, o.query) }), setTimeout(() => { window.location.reload() }, 500) }) }, c = async () => { try { const u = await request.get('/api-auth/exit', {}) n.push({ path: '/' }), window.location.reload() } catch (u) { console.log(u) } }, d = u => { u == 'strudent' ? l('/studentInfo') : u == 'teacher' ? l('/userInfo') : u == 'change' ? s() : u == 'back' && c() } return pr(ar({}, toRefs(r)), { gotoPage: l, changeRoute: s, logout: c, changeState: d }) }, render() { return createVNode(Fragment, null, [ createVNode( ElDropdown, { onCommand: e => this.changeState(e) }, { default: () => [ createVNode('div', { class: classes$1.userInfoWrap }, [ createVNode('p', { class: classes$1.title }, [ this.user.username ]), createVNode( 'img', { src: this.user.heardUrl ? this.user.heardUrl : iconTeacher, class: classes$1.userHeader, alt: '' }, null ) ]) ], dropdown: () => createVNode(Fragment, null, [ createVNode('div', { class: classes$1.dropdownWrap }, [ createVNode('div', { class: classes$1.dropdownWrapUser }, [ createVNode('div', { class: classes$1.userInfoWrap }, [ createVNode( 'img', { src: this.user.heardUrl ? this.user.heardUrl : iconTeacher, class: classes$1.userHeader, alt: '' }, null ), createVNode('p', { class: classes$1.title }, [ this.user.username ]) ]), createVNode('img', { src: userBanner, alt: '' }, null) ]), this.userType == 'TEACHER' ? createVNode('div', { class: classes$1.dropdownInfo }, [ createVNode('div', { class: classes$1.dropdownItem }, [ createVNode( 'p', { class: classes$1.dropdownItemTitle }, [this.user.fansNum || 0] ), createVNode( 'p', { class: classes$1.dropdownItemsubTitle }, [createTextVNode('\u7C89\u4E1D')] ) ]), createVNode('div', { class: classes$1.dropdownItem }, [ createVNode( 'p', { class: classes$1.dropdownItemTitle }, [this.user.musicSheetNum || 0] ), createVNode( 'p', { class: classes$1.dropdownItemsubTitle }, [createTextVNode('\u4E50\u8C31')] ) ]) ]) : null, createVNode(ElDropdownMenu, null, { default: () => [ this.userType == 'TEACHER' ? createVNode( ElDropdownItem, { command: 'teacher' }, { default: () => [ createVNode( 'img', { class: classes$1.dropdownImg, src: peopleIcon, alt: '' }, null ), ' ', createTextVNode('\u4E2A\u4EBA\u4E2D\u5FC3') ] } ) : createVNode( ElDropdownItem, { command: 'strudent' }, { default: () => [ createVNode( 'img', { class: classes$1.dropdownImg, src: peopleIcon, alt: '' }, null ), ' ', createTextVNode('\u4E2A\u4EBA\u4E2D\u5FC3') ] } ), this.showChange ? createVNode( ElDropdownItem, { command: 'change' }, { default: () => [ createVNode( 'img', { class: classes$1.dropdownImg, src: changeIcon, alt: '' }, null ), ' ', createTextVNode('\u89D2\u8272\u5207\u6362') ] } ) : null, createVNode( ElDropdownItem, { command: 'back', class: 'backItem' }, { default: () => [ createVNode('div', { class: 'backWrap' }, [ createVNode( 'img', { class: classes$1.dropdownImg, src: backIcon, alt: '' }, null ), ' ', createTextVNode('\u9000\u51FA\u767B\u5F55') ]) ] } ) ] }) ]) ]) } ) ]) } }), ColHeader = defineComponent({ name: 'col-header', components: { loganInfo }, data() { return { navigator: [ { name: '\u9996\u9875', href: '/home', current: !1 }, { name: '\u8C31\u5E93', href: '/musicLibrary', current: !1 }, { name: '\u89C6\u9891\u8BFE', href: '/videoDetailList', current: !1 }, { name: '\u4E0B\u8F7D', href: '/downLoad', current: !1 } ], navPath: ['', '/musicLibrary', '', '', '/downLoad'], isTop: !1, isdark: !1, token: '', userType: '', isLogin: !1, userInfo: {} } }, mounted() { ;(this.token = getAuth()), (this.userType = getUserType()), this.userType && this.token && (this.isLogin = !0), window.addEventListener('scroll', e => { ;(document.documentElement.scrollTop | document.body.scrollTop) > 70 ? (this.isTop = !0) : (this.isTop = !1) }) }, methods: { gotoMain() { this.$router.push({ path: '/' }) } }, watch: { $route(e) { console.log(e), (this.isdark = !!e.meta.isdark), this.navigator.forEach(t => { t.current = !1 }), this.navigator.forEach(t => { t.href === e.meta.highlightPath && (t.current = !0) }) } }, render() { return createVNode(Fragment, null, [ createVNode( 'div', { class: [ 'headerSection backdrop-blur-sm', this.isTop ? '' : 'top', this.isdark ? 'isdark' : '' ] }, [ createVNode('div', { class: 'flex items-center h-full' }, [ createVNode( 'div', { class: 'logoWrap', onClick: () => this.gotoMain() }, [ createVNode( 'img', { class: 'w-full', src: logo, alt: '' }, null ) ] ), createVNode('div', { class: 'flex' }, [ this.navigator.map(e => createVNode('div', null, [ createVNode( RouterLink, { to: e.href, class: [ e.current ? 'activeItem' : 'normalItem', 'itemCenter' ] }, { default: () => [e.name] } ) ]) ) ]) ]), createVNode('div', { class: 'rightWrap' }, [ this.isLogin ? createVNode(Fragment, null, [ createVNode('div', null, [ createVNode(loganInfo, null, null) ]) ]) : createVNode( ElButton, { type: 'primary', round: !0, onClick: () => { state.loginPopupStatus = !0 } }, { default: () => [ createTextVNode('\u767B\u5F55/\u6CE8\u518C') ] } ) ]) ] ), this.isTop ? createVNode('div', { class: 'wall' }, null) : '' ]) } }) const zhCn = { name: 'zh-cn', el: { colorpicker: { confirm: '\u786E\u5B9A', clear: '\u6E05\u7A7A' }, datepicker: { now: '\u6B64\u523B', today: '\u4ECA\u5929', cancel: '\u53D6\u6D88', clear: '\u6E05\u7A7A', confirm: '\u786E\u5B9A', selectDate: '\u9009\u62E9\u65E5\u671F', selectTime: '\u9009\u62E9\u65F6\u95F4', startDate: '\u5F00\u59CB\u65E5\u671F', startTime: '\u5F00\u59CB\u65F6\u95F4', endDate: '\u7ED3\u675F\u65E5\u671F', endTime: '\u7ED3\u675F\u65F6\u95F4', prevYear: '\u524D\u4E00\u5E74', nextYear: '\u540E\u4E00\u5E74', prevMonth: '\u4E0A\u4E2A\u6708', nextMonth: '\u4E0B\u4E2A\u6708', year: '\u5E74', month1: '1 \u6708', month2: '2 \u6708', month3: '3 \u6708', month4: '4 \u6708', month5: '5 \u6708', month6: '6 \u6708', month7: '7 \u6708', month8: '8 \u6708', month9: '9 \u6708', month10: '10 \u6708', month11: '11 \u6708', month12: '12 \u6708', weeks: { sun: '\u65E5', mon: '\u4E00', tue: '\u4E8C', wed: '\u4E09', thu: '\u56DB', fri: '\u4E94', sat: '\u516D' }, months: { jan: '\u4E00\u6708', feb: '\u4E8C\u6708', mar: '\u4E09\u6708', apr: '\u56DB\u6708', may: '\u4E94\u6708', jun: '\u516D\u6708', jul: '\u4E03\u6708', aug: '\u516B\u6708', sep: '\u4E5D\u6708', oct: '\u5341\u6708', nov: '\u5341\u4E00\u6708', dec: '\u5341\u4E8C\u6708' } }, select: { loading: '\u52A0\u8F7D\u4E2D', noMatch: '\u65E0\u5339\u914D\u6570\u636E', noData: '\u65E0\u6570\u636E', placeholder: '\u8BF7\u9009\u62E9' }, cascader: { noMatch: '\u65E0\u5339\u914D\u6570\u636E', loading: '\u52A0\u8F7D\u4E2D', placeholder: '\u8BF7\u9009\u62E9', noData: '\u6682\u65E0\u6570\u636E' }, pagination: { goto: '\u524D\u5F80', pagesize: '\u6761/\u9875', total: '\u5171 {total} \u6761', pageClassifier: '\u9875', deprecationWarning: '\u4F60\u4F7F\u7528\u4E86\u4E00\u4E9B\u5DF2\u88AB\u5E9F\u5F03\u7684\u7528\u6CD5\uFF0C\u8BF7\u53C2\u8003 el-pagination \u7684\u5B98\u65B9\u6587\u6863' }, messagebox: { title: '\u63D0\u793A', confirm: '\u786E\u5B9A', cancel: '\u53D6\u6D88', error: '\u8F93\u5165\u7684\u6570\u636E\u4E0D\u5408\u6CD5!' }, upload: { deleteTip: '\u6309 delete \u952E\u53EF\u5220\u9664', delete: '\u5220\u9664', preview: '\u67E5\u770B\u56FE\u7247', continue: '\u7EE7\u7EED\u4E0A\u4F20' }, table: { emptyText: '\u6682\u65E0\u6570\u636E', confirmFilter: '\u7B5B\u9009', resetFilter: '\u91CD\u7F6E', clearFilter: '\u5168\u90E8', sumText: '\u5408\u8BA1' }, tree: { emptyText: '\u6682\u65E0\u6570\u636E' }, transfer: { noMatch: '\u65E0\u5339\u914D\u6570\u636E', noData: '\u65E0\u6570\u636E', titles: ['\u5217\u8868 1', '\u5217\u8868 2'], filterPlaceholder: '\u8BF7\u8F93\u5165\u641C\u7D22\u5185\u5BB9', noCheckedFormat: '\u5171 {total} \u9879', hasCheckedFormat: '\u5DF2\u9009 {checked}/{total} \u9879' }, image: { error: '\u52A0\u8F7D\u5931\u8D25' }, pageHeader: { title: '\u8FD4\u56DE' }, popconfirm: { confirmButtonText: '\u786E\u5B9A', cancelButtonText: '\u53D6\u6D88' } } } var cert_bg = './assets/cert_bg.381bc950.png', __glob_10_0 = Object.freeze( Object.defineProperty( { __proto__: null, default: cert_bg }, Symbol.toStringTag, { value: 'Module' } ) ), iconClose$1 = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEgAAABICAMAAABiM0N1AAAAAXNSR0IArs4c6QAAAS9QTFRFAAAAgICAqqqqv7+/qqqq1dXVsbGxxMTEtra2sbGxvLy8tbW1uLi4s7OzuLi4tbW1urq6tra2t7e3tLS0uLi4uLi4tra2t7e3uLi4tra2uLi4uLi4tra2t7e3uLi4tra2t7e3tbW1tra2t7e3tra2tbW1t7e3tra2tra2tra2t7e3tra2tra2tra2tra2tbW1t7e3t7e3t7e3tra2tra2tra2tra2tbW1tra2tra2tra2tra2tbW1tra2tra2t7e3tra2tra2tra2tra2tra2tra2t7e3uLi4ubm5urq6u7u7vLy8vr6+wMDAwcHBwsLCw8PDxMTExcXFyMjIycnJzs7O1dXV2tra8fHx8vLy8/Pz9PT09fX19/f3+Pj4+fn5+vr6+/v7/f39/v7+////HUnnAgAAAEV0Uk5TAAIDBAYGDQ0OFxcYJCUvMDA/QEFBU1RVXV5eZGVmbG1ub3R1iY6Oj5CurrKzubq7y8zQ0dLT4OHk5e3u7+/w9/j5+/z+std/qQAAAqdJREFUWMOt2Ola2kAUBuChSIuKiNCqFMqaFlnEgqyJRRGOtkVZ7G5FXOb+r6GRhgcJJzOT5fuZzPNqJjNMziHEOK7NqJQt1+R2W66Vs1Jk00UsZC2WV0AXJR9bM6eshIungOa0GF4RZrzpBjDSSHmFGHdCAU6UhJvvBCsgkEqQNzmZLgilm2FOla8Ewin5GI/VAhNpGT7em2MwlZNt3Il0wGQ6UfT/Me2o0g4yP8dgISehpffVAktpbejWz0ewmNLienoPlrP33NnqWoe6r+fOiwrYSHW+g+NgK8mZ81KxBymz36cU2Exae/UNu1DTM4V28btfkWtnowt0bHgK7WO3vo3pn4H+4uU1ffyFjS4+OavoeXFLKZ3opMuxevGxj23ep1Mqhjk9SpekqUPpd2x8XIXy6FNfL0maM/6CDS+o5zK+iIYTnaQ5d1fo8CMX8Ru8Up3EdgACJAIiEs+BKJFAQOI6IJEs8CW+AzlSZiz9kSbxHSiTGvAlvgN1IoOYxHZAJm0QkjgOtHlQ///80NsBD5KFHK4kk7qYw5Nq5JDv3E34Upnk+M7ViC9lGVukP1+HQ64kkaiAIyBFSEDE4Ut+4vok4vAkRS1TCuid30vrWZP+nmHD80YH/wWyLzRpiI2PqdA69u14fo/sr6n00MNKnWnRdID9iR/39Ga09Et3Qx9+Gh6Q5C06SZ8HyGScj3qMI9vTtPsR0dC+I9N2odSs0HPqQ4sk7UGJedFYteNUnpWTITufxwvVVsY6lFksIUpWHV0JYb2o8TlUZgUdKvy2HSpF3zlUHO84VK6HHGogbDBbGh9EWxp7vO7PllARWA050/ZJuoU6SK9SzMKrmfaKt8Z29w1aY52DsMdcm20VadYdFeLrVhp/Ln9k1j6sH+akaIDVPvwHInBuRJ1esLQAAAAASUVORK5CYII=', __glob_10_1 = Object.freeze( Object.defineProperty( { __proto__: null, default: iconClose$1 }, Symbol.toStringTag, { value: 'Module' } ) ), icon_pc_login = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAHgAAAB0CAYAAABOpvapAAAAAXNSR0IArs4c6QAABsRJREFUeNrt3WtsU3UYx/GBCoqoDMToG18Y37i1ZTg2EK8gAgKCF1DxgtwvIiIKhojKskTikKiRZISESGKCYf8z1LABKmIRtl62rkR0jDvIRcYYo4ONMbb27/Ns/y5s9nQd9HaePr/kG30l4Xw87elZ4SQlRWgpNpFptms5ZodWarbnVZrseV6zXUjuxms9lnmVrcdWy8FjnRStDSjJTzU7xTaGiHJwzPHYRxTX4hATzQ5Rxwc8RsGxR4PI4dqFjw90zPOFHbnlZZnP3Lg6k8P6cs3vufH5ntwGJKWcC/W7/qvlzl82IA9Uw4UlTyhvh21X14CbC+2B+nb57MWPQsFhV6e7vr87iRfW4THFYxscWsu5FhhXBiV3DVi4ggCvZorITiHrHX9XR2BcKdQn9F8APnDrnL185kbtTNY5i/MqAwHjnNCdofwCQe5QefjwR+0s9ujd8dIDxtmgO0L4j+u9PNTwoY8acI2eQzBgXBHUm4HpAuN2QbczMF1gnBXqxcB0gXE7oNsiDZxSLnqYnNo4uN02O5HC3zP+3mMJjPsVujVSwOmugl7w4dyduLcYNTceg1gC436GekYCGH6APY1/UKBNizUwbosfOZzAJru2nL+toS2PB2BcAdSDgekC434a6NAYmDCw3F59UqYFRmZgCsC4X6pPyDS7xsBUgXHbzv0jB7RHZmBKwLjCqnbIDEwNGLe56hggMzBZYNyPZ49KCwPTBW75kFx1vA7+0Y2BiQKrre0KMgMbDxiXy8C0gXGrGZg2MO5rBqYNjFvFwLSBcTkMTBsYt4KBaQPjshmYNjAui4FpA+M+ZmDawLilDEwbGLeEgWkD+9adrtjPwHSBpc/nk58fczMwVWA/8mdHyxiYKrAfOfuIi4GpAuO8gJx1uJSBqQL7kT85XMLAVIH9yMsOORmYKjCuGZCXHnIwMFVgP/KHB+0MTBW4FdkrFx+wMTBVYFwTIC86UMzAVIFbkL1euXB/EQNTBcZdBeQFFUUMTBUY1+htlvMrdjMwVWA/8rx9uxiYKjDuCiDP3vcHA1MFxjUA8szynQxMFRh3ublJTi+3GhvYkbeYgTtBnvr370YFbkx1iBQG7mT1gDxz384T6nEDhshkF5stxWJ4rP+uSiPtIjSU/7ZZusC4WmgIA9MFxnmgDAamvRoonYFp7zw0kIFprxoawMC0dw4yU8F98NDWngDZFBDYJi4kIjDuLJRK4ux1anP0b3uK8kQFxlVCDxka16FNAMSLQR4P8G0iA8u65qt1k/Zut8FTT24su1ZscohC+HcRjeCRdfkA2PnDS+B/gIQGbnmtbrwsx+7ZSvEp4PuTrNabEx645bX6Sr0c495CCthSKsa3vZYnOjDuDCCPJoJscWhftHuzZuDWnb5SJ0e5C42Na9fWAGh3BtbZqYY6ObKs0IDfBBHV8EDoWQEvtxm4/U40XJIjygqMAItP/i6zOLWPHnCJu3Q/TzFwgPfkxvqGyeW/fWpyihmBUg+V9OoeePiIAmfUiEiUCl8MgLtUZvPuDckhfWBmYN0dgO7Tv9EgjuqdXSk2kRk3d0QYOOgqoHsDHTe4oCkI8vI5lYGNs3Lonv//FCcvR//bkfkrGdhY+wvq3+4MdmpTgpzBWxjYePsT6nfNe3B6kI8txxnYmNsD9cXjhk/rBkjdK+kUq+jNwMZcGZSsfmR3RO8sTi3ZlMHAxl0p1Ae/sB73V9IMfN1zDHMX5OpfSYuVDGzwHaz31A5x/hDfV9IMfGNz156TgwMhO8QxBiYyV22VzHRu6gjsjYsraQYOz0o8Z2VGB+S4uJJm4DBedXkq5aD2yJXwk58jAbOLw9DOti/HMbAxZrsAyI78Ln4TQ8xjYAOt6MIZmd4VZJu4hHfGGNhA21Xzr3y4C8iW4o0mBjbYrOdPy4EhIWtN5r2FyQxswO04fwqQtc6Av+T3YANve/VJmRYAGW5n1sJVdHa6a+0tDGzw1fuaCia5t/bHL8thadb1fZKysrrz52Ba2wjdxDc6aG+D7PinDxiY3L6LGjIDx2zro4LMwDHdOqgbA9Pe2ogiM3BcLJeB6e8bBqa/rxiY/lYxMP3lMDD9rWBg+stmYPpbzsD0t4yB6W8pA9PfkusBvh9KhwZBGapMaLBqiOoRaKjqUegx1eOqJ6AnVU9Bw1TDVU9DI1TPQCNVo1SjoWdVY6CxqnGq56DxqgnQ86oXVC9CL6kmQpNUL6tegV5VTYZeU72uegN6UzUFeks1VTUNmq6aAc1UzVLNhuao5kLzVG+r5kPvqBZA76oWqt6DFqnehz5QLVYtUfUP1fY/nuU4wwsh3B0AAAAASUVORK5CYII=', __glob_10_2 = Object.freeze( Object.defineProperty( { __proto__: null, default: icon_pc_login }, Symbol.toStringTag, { value: 'Module' } ) ), icon_qrcode_login = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAG4AAABuCAYAAADGWyb7AAAAAXNSR0IArs4c6QAABpZJREFUeNrtnXtQFHUcwOnls5c6lk2NjWVjAXfA+AhfafZQy3xkPjMf5LMsrXTyj5wcZ3KsZmqmJienLKfMuF1E8wGCIZK2t8fjBOEkhEQBEQFBRPM44H59f/ZjpmwX2fO42698PzOfuT9gj5393DL729/ubUgIUOdxrxyZsYtZ7JJptaqx0SEGCbdLM1p5z/l6y1lUudzU28IuLbu6ooyxTfmXatkIE8ejcDrhQOaqr2HD03dSOGzhOLn159kwE8ajcNcJxzl2sZoNTY+ncNjCcbIhXrSJ4lG4NobjOOuqWLQjvgx+OTEQwoYuNBwuNfX2CEfcWC2tqrzBn+Fg/eoCtS3ALJ/Dcc573Hnw0j0kAITb5Q+NhhuYKd3j4yfXlz0uOyRAwDpMuqFwglSwG4XDF46TAnalcPjCcZLBLhQOXzjOfrAzhcMXjrOvPeJRuPYPx9kzLGvXAotq+9yIVlVaEcBwTqsir9QyTJVC/RnO6pDGGN8W8qfBCMfSasvdUaps9JNuD1Q42DA/+/hpNxzOYre978Ne7w5KOM6B6lIWaSwehTNDOE5SdQmLtMsUDls4TmLVaRbRtngUzkzhOHsr2xSPwpktHGd3ZTHEo3DownF2njvJ35zCYQvH2aEfj8KZORxHrijSikfhzB6OE3u2kMJhDMfZfvYEhcMYjvNjeQGFwxjun3gn3PCH4/0ZbsCRX+6Cnxdrqspbopw7HtbSmpPU3Z/hwu22pbrrobt+UgGKcIKP/RkuwFd53RTTOjfCBgqHMxxnPYXDGY6zjsLhDMf5gMLhDMdZQ+FwhmN5l2u+hA29x+ThSi0OeUkghHXfhCKc1+tlnxQfpZs+/HHTRzDibSx2Ujhs4VrifXQyi8JhC9cSb/2fmRQOWzhOM8RbV5RB4bCFa4m3tiidwmELJ/5terdXFG6zHP6ph/a0zp5ucJZ9p6Z2+TOLYpusZehhqa/u5eSKNE5vOTMIl7v3M304QRM4J1DzcWhAEK4l3iwKhy8cpxGcTuHwhWuJN5XC4QvH8YBTKBy+cJwGcCKFQ4jH2+xdXnDkii/hYLiwGX7nr6CqyrW6Y1BFnqC/rG0R6nBXd7vmJrbs+G8+hJO/M8FgGsflee2FG+ItPp5G4TByBeItdB2icBj5q6mRxbhSKRzWePPzDlI4jFyGeHPzUhgcOaZYFGmUpnY5QXeDKpICr4faXVVKpnDXcKnJw+bkpvi0J4SmS32CPUTrsOE49Y0eNjv3VwqHkYsQb+axAxQOI3WNDWyGgXgUzkRcgHjTcpIpHEZqPW42NSeJwiHd85qX5Kdtg0PxNXpac37QvFuVB+XfrG5UuF7mEc06knSb7jKKvF5v/UKVuKgOF05wDgwzuheEOWIjfBlewM0so7Xer39CQudWxpK7btppnRukAnyCwuGkHBxA4XByBnyMwuGkFHyUwuGkBOxH4RBS09hQPzE70fm4I76X4XAwTRSZLkVqGZoq3Wk4nF26ADMYTk2V2GkU7hrKrlxicZWnoozvcfJGo8OL64RjNAA3ThH4EIXDSSH4IIXDSQH4AIXDST7Yh8LhxAXex5/HAxuuQkt+Yjhc3X6/lgMzM+/QPGntkjrpvV9rWu22eRSu7eSCvXWnYVr5olG9cVyHvXcgCOSAvSgcTo6CPSkcTrLAHhQOJxngvRQOJyp4N4VDSJPX6xifnRADJ5nXwlhuq5b88aL8EN5vHpEGUDg/4KyrYqMzd+sOwCHcwQ73zUJYgLuE0uGlO4XDSSrYjcLhJAXsSuFwkgx2oXA42Q92pnA42Qd2aiWcx6rYZhk1TJH6U7j2Z/cgx440o/eA0wDcBKTVnmmIUmUKh5ED1aUs8v/xKBwGkqpLWOR/H3BP4bCQWHUaHnAvUziM7K08BfEoHEouNjbEjXXt76l/DYs8HsLWaBmu2GIoXHD5HryV7gHHybfgLRQOJ5uvjUfh8LCJwuHlCwqH9WizybM5IkMaApe0r6JwyNh65g+a1sHKlrJ8CoeVb8qOUzisfF3qonBY+aokj8KhHSeczqVweI82Cwqtdnld2O+xgykcPlb/e1qnLzgQHAQOFg4BnxRGC4eCw4TDwRHCkcKnwFHC0eDTwjHCZ8Bnhc+BzwvHCseB44UvgC8KJwhfAicKJ4GThVOEL4NTha+A04TThTPAmcJZ4Gzhq8I54GvCueA84XzhAjBG+Dq4ULhIuBhcIlwKLhO+IXwTXC58C3xbuEK4EnxH+C74nnCVcLWw99/nAhQABWtoMAAAAABJRU5ErkJggg==', __glob_10_3 = Object.freeze( Object.defineProperty( { __proto__: null, default: icon_qrcode_login }, Symbol.toStringTag, { value: 'Module' } ) ), icon_scan = 'data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEYAAABGCAMAAABG8BK2AAAAAXNSR0IArs4c6QAAAaFQTFRFAAAAAP8AAP//AICAAKqqAL+AAL+/M8yZKtWqJNu2HMaqM8yzIruqM8yqMM+vLcOlK8aqJMKqMc6qKr+qKcytMc6xL8aqKsOqKsyqKc6tKMenMMenLsmqLcutK8aqMMisKsqsLsWoLMisL8asL8aqL8uqLsenLcWqLcmqKsiqLcqqLMenLsqrLcutK8mpLceoLMmrLsipLsiqLMepLsirLcaqLMisLsarLsmrLsmsLceqLcirLciqLcmrLMeqK8ioLsirLcmsLMirLMirLciqLsmrLseqLcapLcirLMmqLcepLMiqLsirLceqLMirLMeqLsmqLseqLcirLceqLcerLcerLcirLMepLsiqLcerLciqLceqLciqLMeqLsmqLseqLserLsipLcirLceqLceqLceqLciqLceqLceqLMeqLcepLceqLcaqLcepLceqLceqLciqLceqLserLceqLceqLciqLcerLceqLMaqLceqLceqLcerLceqLMepLMiqLceqLceqLceqLMeqLcaqLceqLciqLcerLMeqLciqLceqLceqSre5RwAAAIp0Uk5TAAEBAgMEBAUGBwkKDw8QERIVFRgZGhseHh8gICEiJCUrLC4xNjY3OTk8P0BDREdJTFNUVlhaXF5eX2BhZmdpampxc3R4ent9fYSJioyTlZaWnJ2foKOmp6ipqq6xsrKzs7i5uru8vcjM0NDT1NbW19jZ2tvf3+Pk5ujp6err6+3u9vf4+fn7/f3+KDkJOAAAAb5JREFUWMPtmNdTwkAQxlFR7NgrYO+KAoK9917ALtgb9t57zf3V7gZ1zJl78OIT5nu5b+bb/U0ml5ndiUbzh8ruHJ2mNNWbRBWl90/RRdOjHdlfeYKHyOk0RkKJv5StIp4EX244lc9JvQTTwqgiJwaMtV5W3ijBtLLKiFcLcS0rPY+VYBJvmZwaiJdEtzVPyT1goF5xxuCsm9am2LwI6RWayQC+Kw6YxO4LcG9oank/lTrsfgMjPlYVL6ZabFcxKkbF+DnmBU87L8aB3a9g1uEUsngxBYjZR3NNhB7+STlGyEMFmqhSk5KJW1KTpvFbheQUK1JOMFKMe0Sh9oyAmSGKNQOYQ+WYA8C4lGNcgIlbEZRBhGXfBqNPUSS9H369QdG+0zbSFclPqbwla6lwtsPL3gjlpSQ/QvsCmDO8tDJejA2779U5pWJUjIr5t5jnnz8AfqEm7H4Cc4xmOzOCUrhMTzhdFJG5g91HkDkZo/mujYI037CmuBPSfOYmUC6hFDHrhDzMh1lxnwTTzVwphsRcN8GIGyQYO4syrvtc/Hfl4tUw6aY5JwvZdXyrMZmtlCyFgfRF5VroIqv5Y8F/BzBk2GZgoePwAAAAAElFTkSuQmCC', __glob_10_4 = Object.freeze( Object.defineProperty( { __proto__: null, default: icon_scan }, Symbol.toStringTag, { value: 'Module' } ) ), register_bg = './assets/register_bg.26861da8.png', __glob_10_5 = Object.freeze( Object.defineProperty( { __proto__: null, default: register_bg }, Symbol.toStringTag, { value: 'Module' } ) ), teacher1 = './assets/teacher_1.fa7c93ef.png', __glob_10_6 = Object.freeze( Object.defineProperty( { __proto__: null, default: teacher1 }, Symbol.toStringTag, { value: 'Module' } ) ), teacher2 = './assets/teacher_2.49bf3854.png', __glob_10_7 = Object.freeze( Object.defineProperty( { __proto__: null, default: teacher2 }, Symbol.toStringTag, { value: 'Module' } ) ) const loginSection = '_loginSection_zs3y3_1', iconClose = '_iconClose_zs3y3_1', loginTabs = '_loginTabs_zs3y3_5', scanTxt = '_scanTxt_zs3y3_18', toolTips = '_toolTips_zs3y3_21', toolTips_arrow = '_toolTips_arrow_zs3y3_37' var styles$4 = { loginSection, iconClose, loginTabs, scanTxt, toolTips, toolTips_arrow } const loginImgCode = '_loginImgCode_1avda_1', loginClose = '_loginClose_1avda_4' var styles$3 = { loginImgCode, loginClose }, ImgCode = defineComponent({ name: 'img-code', props: { phone: { type: String, default: '' }, onSendCode: { type: Function, default: () => {} }, onClose: { type: Function, default: () => {} } }, data() { return { loading: !1, code: '', identifyingCode: location.origin + '/api-website/code/getImageCode?phone=' + this.phone } }, methods: { updateIdentifyingCode() { this.identifyingCode = `${this.identifyingCode}&token=${Math.random()}` }, async checkVerifyLoginImage() { try { if (this.code.length < 4) return ;(this.loading = !0), await request.post('/api-website/code/verifyImageCode', { requestType: 'form', data: { phone: this.phone, code: this.code } }), await request.post('/api-website/code/sendSmsCode', { requestType: 'form', data: { mobile: this.phone, type: 'LOGIN' } }), (this.loading = !1), ElMessage.success('\u9A8C\u8BC1\u7801\u5DF2\u53D1\u9001'), this.onClose(), this.onSendCode() } catch { ;(this.loading = !1), this.updateIdentifyingCode() } } }, watch: { code(e) { e.length >= 4 && this.checkVerifyLoginImage() } }, render() { return createVNode(Fragment, null, [ createVNode('div', { class: 'absolute inset-y-0 inset-x-0' }, null), createVNode( 'div', { class: [ styles$3.loginImgCode, 'absolute w-[90%] left-[5%] top-0 bg-white pt-5 pb-8 px-6 rounded-md' ], loading: this.loading }, [ createVNode( 'div', { onClick: () => { this.onClose() } }, [ createVNode( ElIcon, { class: styles$3.loginClose }, { default: () => [createVNode(close_default, null, null)] } ) ] ), createVNode( 'div', { class: 'text-center text-[16px] text-[#333]' }, [createTextVNode('\u8F93\u5165\u56FE\u5F62\u9A8C\u8BC1\u7801')] ), createVNode( ElRow, { gutter: 8, class: 'mt-3' }, { default: () => [ createVNode( ElCol, { span: 16 }, { default: () => [ createVNode( ElInput, { placeholder: '\u8BF7\u8F93\u5165\u9A8C\u8BC1\u7801', modelValue: this.code, 'onUpdate:modelValue': e => (this.code = e) }, null ) ] } ), createVNode( ElCol, { span: 8 }, { default: () => [ createVNode( 'div', { onClick: this.updateIdentifyingCode }, [ createVNode( ElImage, { class: 'w-full h-full', src: this.identifyingCode, fit: 'cover' }, null ) ] ) ] } ) ] } ) ] ) ]) } }) const formLogin = '_formLogin_1sznz_1', codeStyles = '_codeStyles_1sznz_4', btnStyles = '_btnStyles_1sznz_8' var styles$2 = { formLogin, codeStyles, btnStyles } function checkPhone(e) { return /^1[3456789]\d{9}$/.test(e) } function checkIDCard(e) { let t = !0 return ( /(^\d{15}$)|(^\d{18}$)|(^\d{17}(\d|X|x)$)/.test(e || '') === !1 && (t = !1), t ) } var Form = defineComponent({ name: 'loginForm', props: { type: { type: String, default: 'teacher-login' }, onClose: { type: Function, default: () => {} }, onChange: { type: Function, default: e => {} } }, data() { return { loading: !1, codeDsiable: !1, codeStatus: !1, codeTimer: 120, codeInverval: null, form: { username: '', code: '' }, formRules: { username: [ { required: !0, message: '\u8BF7\u8F93\u5165\u624B\u673A\u53F7', trigger: 'blur' }, { pattern: /^1[3456789]\d{9}$/, message: '\u8BF7\u8F93\u5165\u6B63\u786E\u7684\u624B\u673A\u53F7', trigger: 'blur' } ], code: [ { required: !0, message: '\u8BF7\u8F93\u5165\u9A8C\u8BC1\u7801', trigger: 'blur' } ] } } }, unmounted() { console.log('form unmounted'), clearInterval(this.codeInverval) }, methods: { onSubmit() { this.$refs.loginForm.validate(async e => { if (e) { if (this.type === 'teacher-login') { const t = { isSurportRegister: !1, loginUserType: 'TEACHER' } await this.onLogin(t) } else if (this.type === 'student-login') { const t = { isSurportRegister: !1, loginUserType: 'STUDENT' } await this.onLogin(t) } else if (this.type === 'teacher-register') { const t = { isSurportRegister: !0, loginUserType: 'TEACHER' } await this.onLogin(t) } else if (this.type === 'student-register') { const t = { isSurportRegister: !0, loginUserType: 'STUDENT' } await this.onLogin(t) } } }) }, async onLogin(e) { this.loading = !0 try { const t = this.form, r = await request.post('/api-auth/smsLogin', { requestType: 'form', data: ar( { clientId: 'website', clientSecret: 'website', phone: t.username, smsCode: t.code }, e ) }), { authentication: o } = r.data, n = o.token_type + ' ' + o.access_token setAuth(JSON.stringify({ token: n, loginUserType: e.loginUserType })), this.type === 'teacher-login' || this.type === 'student-login' ? (window.location.reload(), this.onClose()) : (this.type === 'teacher-register' || this.type === 'student-register') && this.onChange('register-success') } catch (t) { console.log(t) } this.loading = !1 }, onResetFields() { this.$refs.loginForm.resetFields() } }, render() { return createVNode( ElForm, { ref: 'loginForm', model: this.form, rules: this.formRules, class: [styles$2.formLogin, 'relative'] }, { default: () => [ createVNode( ElFormItem, { prop: 'username' }, { default: () => [ createVNode( ElInput, { modelValue: this.form.username, 'onUpdate:modelValue': e => (this.form.username = e), placeholder: '\u8BF7\u8F93\u5165\u60A8\u7684\u624B\u673A\u53F7\u7801', maxlength: 11, autocomplete: 'off' }, null ) ] } ), createVNode( ElFormItem, { prop: 'code' }, { default: () => [ createVNode( ElInput, { modelValue: this.form.code, 'onUpdate:modelValue': e => (this.form.code = e), maxlength: 6, minlength: 6, placeholder: '\u8BF7\u8F93\u5165\u9A8C\u8BC1\u7801' }, { suffix: () => createVNode( 'div', { class: 'before:border-l before:border-l-[#E5E5E5] before:h-[18px] before:mr-3' }, [ createVNode( ElLink, { disabled: this.codeDsiable, class: styles$2.codeStyles, type: 'primary', underline: !1, onClick: () => { if (!checkPhone(this.form.username)) return ElMessage.error( '\u8BF7\u8F93\u5165\u6B63\u786E\u7684\u624B\u673A\u53F7\u7801' ) this.codeStatus = !0 } }, { default: () => [ this.codeDsiable ? this.codeTimer + 's' : '\u83B7\u53D6\u9A8C\u8BC1\u7801' ] } ) ] ) } ) ] } ), createVNode(ElFormItem, null, { default: () => [ createVNode( ElButton, { type: 'primary', class: styles$2.btnStyles, onClick: this.onSubmit, disabled: this.loading, loading: this.loading }, { default: () => [ this.type === 'teacher-login' || this.type === 'student-login' ? '\u767B \u5F55' : '\u6CE8 \u518C' ] } ) ] }), this.codeStatus && createVNode( ImgCode, { phone: this.form.username, onClose: () => { this.codeStatus = !1 }, onSendCode: async () => { ;(this.codeDsiable = !0), (this.codeInverval = setInterval(() => { this.codeTimer--, this.codeTimer === 0 && ((this.codeDsiable = !1), clearInterval(this.codeInverval), (this.codeTimer = 120)) }, 1e3)) } }, null ) ] } ) } }) /*! * qrcode.vue v3.3.3 * A Vue.js component to generate QRCode. * © 2017-2021 @scopewu(https://github.com/scopewu) * MIT License. */ /*! ***************************************************************************** Copyright (c) Microsoft Corporation. Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted. THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. ***************************************************************************** */ var __assign = function () { return ( (__assign = Object.assign || function (t) { for (var r, o = 1, n = arguments.length; o < n; o++) { r = arguments[o] for (var a in r) Object.prototype.hasOwnProperty.call(r, a) && (t[a] = r[a]) } return t }), __assign.apply(this, arguments) ) }, mode$1 = { MODE_NUMBER: 1 << 0, MODE_ALPHA_NUM: 1 << 1, MODE_8BIT_BYTE: 1 << 2, MODE_KANJI: 1 << 3 }, mode = mode$1 function QR8bitByte(e) { ;(this.mode = mode.MODE_8BIT_BYTE), (this.data = e) } QR8bitByte.prototype = { getLength: function (e) { return this.data.length }, write: function (e) { for (var t = 0; t < this.data.length; t++) e.put(this.data.charCodeAt(t), 8) } } var _8BitByte = QR8bitByte, ErrorCorrectLevel = { L: 1, M: 0, Q: 3, H: 2 }, ECL = ErrorCorrectLevel function QRRSBlock(e, t) { ;(this.totalCount = e), (this.dataCount = t) } QRRSBlock.RS_BLOCK_TABLE = [ [1, 26, 19], [1, 26, 16], [1, 26, 13], [1, 26, 9], [1, 44, 34], [1, 44, 28], [1, 44, 22], [1, 44, 16], [1, 70, 55], [1, 70, 44], [2, 35, 17], [2, 35, 13], [1, 100, 80], [2, 50, 32], [2, 50, 24], [4, 25, 9], [1, 134, 108], [2, 67, 43], [2, 33, 15, 2, 34, 16], [2, 33, 11, 2, 34, 12], [2, 86, 68], [4, 43, 27], [4, 43, 19], [4, 43, 15], [2, 98, 78], [4, 49, 31], [2, 32, 14, 4, 33, 15], [4, 39, 13, 1, 40, 14], [2, 121, 97], [2, 60, 38, 2, 61, 39], [4, 40, 18, 2, 41, 19], [4, 40, 14, 2, 41, 15], [2, 146, 116], [3, 58, 36, 2, 59, 37], [4, 36, 16, 4, 37, 17], [4, 36, 12, 4, 37, 13], [2, 86, 68, 2, 87, 69], [4, 69, 43, 1, 70, 44], [6, 43, 19, 2, 44, 20], [6, 43, 15, 2, 44, 16], [4, 101, 81], [1, 80, 50, 4, 81, 51], [4, 50, 22, 4, 51, 23], [3, 36, 12, 8, 37, 13], [2, 116, 92, 2, 117, 93], [6, 58, 36, 2, 59, 37], [4, 46, 20, 6, 47, 21], [7, 42, 14, 4, 43, 15], [4, 133, 107], [8, 59, 37, 1, 60, 38], [8, 44, 20, 4, 45, 21], [12, 33, 11, 4, 34, 12], [3, 145, 115, 1, 146, 116], [4, 64, 40, 5, 65, 41], [11, 36, 16, 5, 37, 17], [11, 36, 12, 5, 37, 13], [5, 109, 87, 1, 110, 88], [5, 65, 41, 5, 66, 42], [5, 54, 24, 7, 55, 25], [11, 36, 12], [5, 122, 98, 1, 123, 99], [7, 73, 45, 3, 74, 46], [15, 43, 19, 2, 44, 20], [3, 45, 15, 13, 46, 16], [1, 135, 107, 5, 136, 108], [10, 74, 46, 1, 75, 47], [1, 50, 22, 15, 51, 23], [2, 42, 14, 17, 43, 15], [5, 150, 120, 1, 151, 121], [9, 69, 43, 4, 70, 44], [17, 50, 22, 1, 51, 23], [2, 42, 14, 19, 43, 15], [3, 141, 113, 4, 142, 114], [3, 70, 44, 11, 71, 45], [17, 47, 21, 4, 48, 22], [9, 39, 13, 16, 40, 14], [3, 135, 107, 5, 136, 108], [3, 67, 41, 13, 68, 42], [15, 54, 24, 5, 55, 25], [15, 43, 15, 10, 44, 16], [4, 144, 116, 4, 145, 117], [17, 68, 42], [17, 50, 22, 6, 51, 23], [19, 46, 16, 6, 47, 17], [2, 139, 111, 7, 140, 112], [17, 74, 46], [7, 54, 24, 16, 55, 25], [34, 37, 13], [4, 151, 121, 5, 152, 122], [4, 75, 47, 14, 76, 48], [11, 54, 24, 14, 55, 25], [16, 45, 15, 14, 46, 16], [6, 147, 117, 4, 148, 118], [6, 73, 45, 14, 74, 46], [11, 54, 24, 16, 55, 25], [30, 46, 16, 2, 47, 17], [8, 132, 106, 4, 133, 107], [8, 75, 47, 13, 76, 48], [7, 54, 24, 22, 55, 25], [22, 45, 15, 13, 46, 16], [10, 142, 114, 2, 143, 115], [19, 74, 46, 4, 75, 47], [28, 50, 22, 6, 51, 23], [33, 46, 16, 4, 47, 17], [8, 152, 122, 4, 153, 123], [22, 73, 45, 3, 74, 46], [8, 53, 23, 26, 54, 24], [12, 45, 15, 28, 46, 16], [3, 147, 117, 10, 148, 118], [3, 73, 45, 23, 74, 46], [4, 54, 24, 31, 55, 25], [11, 45, 15, 31, 46, 16], [7, 146, 116, 7, 147, 117], [21, 73, 45, 7, 74, 46], [1, 53, 23, 37, 54, 24], [19, 45, 15, 26, 46, 16], [5, 145, 115, 10, 146, 116], [19, 75, 47, 10, 76, 48], [15, 54, 24, 25, 55, 25], [23, 45, 15, 25, 46, 16], [13, 145, 115, 3, 146, 116], [2, 74, 46, 29, 75, 47], [42, 54, 24, 1, 55, 25], [23, 45, 15, 28, 46, 16], [17, 145, 115], [10, 74, 46, 23, 75, 47], [10, 54, 24, 35, 55, 25], [19, 45, 15, 35, 46, 16], [17, 145, 115, 1, 146, 116], [14, 74, 46, 21, 75, 47], [29, 54, 24, 19, 55, 25], [11, 45, 15, 46, 46, 16], [13, 145, 115, 6, 146, 116], [14, 74, 46, 23, 75, 47], [44, 54, 24, 7, 55, 25], [59, 46, 16, 1, 47, 17], [12, 151, 121, 7, 152, 122], [12, 75, 47, 26, 76, 48], [39, 54, 24, 14, 55, 25], [22, 45, 15, 41, 46, 16], [6, 151, 121, 14, 152, 122], [6, 75, 47, 34, 76, 48], [46, 54, 24, 10, 55, 25], [2, 45, 15, 64, 46, 16], [17, 152, 122, 4, 153, 123], [29, 74, 46, 14, 75, 47], [49, 54, 24, 10, 55, 25], [24, 45, 15, 46, 46, 16], [4, 152, 122, 18, 153, 123], [13, 74, 46, 32, 75, 47], [48, 54, 24, 14, 55, 25], [42, 45, 15, 32, 46, 16], [20, 147, 117, 4, 148, 118], [40, 75, 47, 7, 76, 48], [43, 54, 24, 22, 55, 25], [10, 45, 15, 67, 46, 16], [19, 148, 118, 6, 149, 119], [18, 75, 47, 31, 76, 48], [34, 54, 24, 34, 55, 25], [20, 45, 15, 61, 46, 16] ] QRRSBlock.getRSBlocks = function (e, t) { var r = QRRSBlock.getRsBlockTable(e, t) if (r == null) throw new Error( 'bad rs block @ typeNumber:' + e + '/errorCorrectLevel:' + t ) for (var o = r.length / 3, n = new Array(), a = 0; a < o; a++) for ( var l = r[a * 3 + 0], s = r[a * 3 + 1], c = r[a * 3 + 2], d = 0; d < l; d++ ) n.push(new QRRSBlock(s, c)) return n } QRRSBlock.getRsBlockTable = function (e, t) { switch (t) { case ECL.L: return QRRSBlock.RS_BLOCK_TABLE[(e - 1) * 4 + 0] case ECL.M: return QRRSBlock.RS_BLOCK_TABLE[(e - 1) * 4 + 1] case ECL.Q: return QRRSBlock.RS_BLOCK_TABLE[(e - 1) * 4 + 2] case ECL.H: return QRRSBlock.RS_BLOCK_TABLE[(e - 1) * 4 + 3] default: return } } var RSBlock$1 = QRRSBlock function QRBitBuffer() { ;(this.buffer = new Array()), (this.length = 0) } QRBitBuffer.prototype = { get: function (e) { var t = Math.floor(e / 8) return ((this.buffer[t] >>> (7 - (e % 8))) & 1) == 1 }, put: function (e, t) { for (var r = 0; r < t; r++) this.putBit(((e >>> (t - r - 1)) & 1) == 1) }, getLengthInBits: function () { return this.length }, putBit: function (e) { var t = Math.floor(this.length / 8) this.buffer.length <= t && this.buffer.push(0), e && (this.buffer[t] |= 128 >>> this.length % 8), this.length++ } } var BitBuffer$1 = QRBitBuffer, QRMath = { glog: function (e) { if (e < 1) throw new Error('glog(' + e + ')') return QRMath.LOG_TABLE[e] }, gexp: function (e) { for (; e < 0; ) e += 255 for (; e >= 256; ) e -= 255 return QRMath.EXP_TABLE[e] }, EXP_TABLE: new Array(256), LOG_TABLE: new Array(256) } for (var i = 0; i < 8; i++) QRMath.EXP_TABLE[i] = 1 << i for (var i = 8; i < 256; i++) QRMath.EXP_TABLE[i] = QRMath.EXP_TABLE[i - 4] ^ QRMath.EXP_TABLE[i - 5] ^ QRMath.EXP_TABLE[i - 6] ^ QRMath.EXP_TABLE[i - 8] for (var i = 0; i < 255; i++) QRMath.LOG_TABLE[QRMath.EXP_TABLE[i]] = i var math$2 = QRMath, math$1 = math$2 function QRPolynomial(e, t) { if (e.length == null) throw new Error(e.length + '/' + t) for (var r = 0; r < e.length && e[r] == 0; ) r++ this.num = new Array(e.length - r + t) for (var o = 0; o < e.length - r; o++) this.num[o] = e[o + r] } QRPolynomial.prototype = { get: function (e) { return this.num[e] }, getLength: function () { return this.num.length }, multiply: function (e) { for ( var t = new Array(this.getLength() + e.getLength() - 1), r = 0; r < this.getLength(); r++ ) for (var o = 0; o < e.getLength(); o++) t[r + o] ^= math$1.gexp( math$1.glog(this.get(r)) + math$1.glog(e.get(o)) ) return new QRPolynomial(t, 0) }, mod: function (e) { if (this.getLength() - e.getLength() < 0) return this for ( var t = math$1.glog(this.get(0)) - math$1.glog(e.get(0)), r = new Array(this.getLength()), o = 0; o < this.getLength(); o++ ) r[o] = this.get(o) for (var o = 0; o < e.getLength(); o++) r[o] ^= math$1.gexp(math$1.glog(e.get(o)) + t) return new QRPolynomial(r, 0).mod(e) } } var Polynomial$2 = QRPolynomial, Mode = mode$1, Polynomial$1 = Polynomial$2, math = math$2, QRMaskPattern = { PATTERN000: 0, PATTERN001: 1, PATTERN010: 2, PATTERN011: 3, PATTERN100: 4, PATTERN101: 5, PATTERN110: 6, PATTERN111: 7 }, QRUtil = { PATTERN_POSITION_TABLE: [ [], [6, 18], [6, 22], [6, 26], [6, 30], [6, 34], [6, 22, 38], [6, 24, 42], [6, 26, 46], [6, 28, 50], [6, 30, 54], [6, 32, 58], [6, 34, 62], [6, 26, 46, 66], [6, 26, 48, 70], [6, 26, 50, 74], [6, 30, 54, 78], [6, 30, 56, 82], [6, 30, 58, 86], [6, 34, 62, 90], [6, 28, 50, 72, 94], [6, 26, 50, 74, 98], [6, 30, 54, 78, 102], [6, 28, 54, 80, 106], [6, 32, 58, 84, 110], [6, 30, 58, 86, 114], [6, 34, 62, 90, 118], [6, 26, 50, 74, 98, 122], [6, 30, 54, 78, 102, 126], [6, 26, 52, 78, 104, 130], [6, 30, 56, 82, 108, 134], [6, 34, 60, 86, 112, 138], [6, 30, 58, 86, 114, 142], [6, 34, 62, 90, 118, 146], [6, 30, 54, 78, 102, 126, 150], [6, 24, 50, 76, 102, 128, 154], [6, 28, 54, 80, 106, 132, 158], [6, 32, 58, 84, 110, 136, 162], [6, 26, 54, 82, 110, 138, 166], [6, 30, 58, 86, 114, 142, 170] ], G15: (1 << 10) | (1 << 8) | (1 << 5) | (1 << 4) | (1 << 2) | (1 << 1) | (1 << 0), G18: (1 << 12) | (1 << 11) | (1 << 10) | (1 << 9) | (1 << 8) | (1 << 5) | (1 << 2) | (1 << 0), G15_MASK: (1 << 14) | (1 << 12) | (1 << 10) | (1 << 4) | (1 << 1), getBCHTypeInfo: function (e) { for ( var t = e << 10; QRUtil.getBCHDigit(t) - QRUtil.getBCHDigit(QRUtil.G15) >= 0; ) t ^= QRUtil.G15 << (QRUtil.getBCHDigit(t) - QRUtil.getBCHDigit(QRUtil.G15)) return ((e << 10) | t) ^ QRUtil.G15_MASK }, getBCHTypeNumber: function (e) { for ( var t = e << 12; QRUtil.getBCHDigit(t) - QRUtil.getBCHDigit(QRUtil.G18) >= 0; ) t ^= QRUtil.G18 << (QRUtil.getBCHDigit(t) - QRUtil.getBCHDigit(QRUtil.G18)) return (e << 12) | t }, getBCHDigit: function (e) { for (var t = 0; e != 0; ) t++, (e >>>= 1) return t }, getPatternPosition: function (e) { return QRUtil.PATTERN_POSITION_TABLE[e - 1] }, getMask: function (e, t, r) { switch (e) { case QRMaskPattern.PATTERN000: return (t + r) % 2 == 0 case QRMaskPattern.PATTERN001: return t % 2 == 0 case QRMaskPattern.PATTERN010: return r % 3 == 0 case QRMaskPattern.PATTERN011: return (t + r) % 3 == 0 case QRMaskPattern.PATTERN100: return (Math.floor(t / 2) + Math.floor(r / 3)) % 2 == 0 case QRMaskPattern.PATTERN101: return ((t * r) % 2) + ((t * r) % 3) == 0 case QRMaskPattern.PATTERN110: return (((t * r) % 2) + ((t * r) % 3)) % 2 == 0 case QRMaskPattern.PATTERN111: return (((t * r) % 3) + ((t + r) % 2)) % 2 == 0 default: throw new Error('bad maskPattern:' + e) } }, getErrorCorrectPolynomial: function (e) { for (var t = new Polynomial$1([1], 0), r = 0; r < e; r++) t = t.multiply(new Polynomial$1([1, math.gexp(r)], 0)) return t }, getLengthInBits: function (e, t) { if (1 <= t && t < 10) switch (e) { case Mode.MODE_NUMBER: return 10 case Mode.MODE_ALPHA_NUM: return 9 case Mode.MODE_8BIT_BYTE: return 8 case Mode.MODE_KANJI: return 8 default: throw new Error('mode:' + e) } else if (t < 27) switch (e) { case Mode.MODE_NUMBER: return 12 case Mode.MODE_ALPHA_NUM: return 11 case Mode.MODE_8BIT_BYTE: return 16 case Mode.MODE_KANJI: return 10 default: throw new Error('mode:' + e) } else if (t < 41) switch (e) { case Mode.MODE_NUMBER: return 14 case Mode.MODE_ALPHA_NUM: return 13 case Mode.MODE_8BIT_BYTE: return 16 case Mode.MODE_KANJI: return 12 default: throw new Error('mode:' + e) } else throw new Error('type:' + t) }, getLostPoint: function (e) { for (var t = e.getModuleCount(), r = 0, o = 0; o < t; o++) for (var n = 0; n < t; n++) { for (var a = 0, l = e.isDark(o, n), s = -1; s <= 1; s++) if (!(o + s < 0 || t <= o + s)) for (var c = -1; c <= 1; c++) n + c < 0 || t <= n + c || (s == 0 && c == 0) || (l == e.isDark(o + s, n + c) && a++) a > 5 && (r += 3 + a - 5) } for (var o = 0; o < t - 1; o++) for (var n = 0; n < t - 1; n++) { var d = 0 e.isDark(o, n) && d++, e.isDark(o + 1, n) && d++, e.isDark(o, n + 1) && d++, e.isDark(o + 1, n + 1) && d++, (d == 0 || d == 4) && (r += 3) } for (var o = 0; o < t; o++) for (var n = 0; n < t - 6; n++) e.isDark(o, n) && !e.isDark(o, n + 1) && e.isDark(o, n + 2) && e.isDark(o, n + 3) && e.isDark(o, n + 4) && !e.isDark(o, n + 5) && e.isDark(o, n + 6) && (r += 40) for (var n = 0; n < t; n++) for (var o = 0; o < t - 6; o++) e.isDark(o, n) && !e.isDark(o + 1, n) && e.isDark(o + 2, n) && e.isDark(o + 3, n) && e.isDark(o + 4, n) && !e.isDark(o + 5, n) && e.isDark(o + 6, n) && (r += 40) for (var u = 0, n = 0; n < t; n++) for (var o = 0; o < t; o++) e.isDark(o, n) && u++ var m = Math.abs((100 * u) / t / t - 50) / 5 return (r += m * 10), r } }, util$1 = QRUtil, BitByte = _8BitByte, RSBlock = RSBlock$1, BitBuffer = BitBuffer$1, util = util$1, Polynomial = Polynomial$2 function QRCode$1(e, t) { ;(this.typeNumber = e), (this.errorCorrectLevel = t), (this.modules = null), (this.moduleCount = 0), (this.dataCache = null), (this.dataList = []) } var proto = QRCode$1.prototype proto.addData = function (e) { var t = new BitByte(e) this.dataList.push(t), (this.dataCache = null) } proto.isDark = function (e, t) { if (e < 0 || this.moduleCount <= e || t < 0 || this.moduleCount <= t) throw new Error(e + ',' + t) return this.modules[e][t] } proto.getModuleCount = function () { return this.moduleCount } proto.make = function () { if (this.typeNumber < 1) { var e = 1 for (e = 1; e < 40; e++) { for ( var t = RSBlock.getRSBlocks(e, this.errorCorrectLevel), r = new BitBuffer(), o = 0, n = 0; n < t.length; n++ ) o += t[n].dataCount for (var n = 0; n < this.dataList.length; n++) { var a = this.dataList[n] r.put(a.mode, 4), r.put(a.getLength(), util.getLengthInBits(a.mode, e)), a.write(r) } if (r.getLengthInBits() <= o * 8) break } this.typeNumber = e } this.makeImpl(!1, this.getBestMaskPattern()) } proto.makeImpl = function (e, t) { ;(this.moduleCount = this.typeNumber * 4 + 17), (this.modules = new Array(this.moduleCount)) for (var r = 0; r < this.moduleCount; r++) { this.modules[r] = new Array(this.moduleCount) for (var o = 0; o < this.moduleCount; o++) this.modules[r][o] = null } this.setupPositionProbePattern(0, 0), this.setupPositionProbePattern(this.moduleCount - 7, 0), this.setupPositionProbePattern(0, this.moduleCount - 7), this.setupPositionAdjustPattern(), this.setupTimingPattern(), this.setupTypeInfo(e, t), this.typeNumber >= 7 && this.setupTypeNumber(e), this.dataCache == null && (this.dataCache = QRCode$1.createData( this.typeNumber, this.errorCorrectLevel, this.dataList )), this.mapData(this.dataCache, t) } proto.setupPositionProbePattern = function (e, t) { for (var r = -1; r <= 7; r++) if (!(e + r <= -1 || this.moduleCount <= e + r)) for (var o = -1; o <= 7; o++) t + o <= -1 || this.moduleCount <= t + o || ((0 <= r && r <= 6 && (o == 0 || o == 6)) || (0 <= o && o <= 6 && (r == 0 || r == 6)) || (2 <= r && r <= 4 && 2 <= o && o <= 4) ? (this.modules[e + r][t + o] = !0) : (this.modules[e + r][t + o] = !1)) } proto.getBestMaskPattern = function () { for (var e = 0, t = 0, r = 0; r < 8; r++) { this.makeImpl(!0, r) var o = util.getLostPoint(this) ;(r == 0 || e > o) && ((e = o), (t = r)) } return t } proto.createMovieClip = function (e, t, r) { var o = e.createEmptyMovieClip(t, r), n = 1 this.make() for (var a = 0; a < this.modules.length; a++) for (var l = a * n, s = 0; s < this.modules[a].length; s++) { var c = s * n, d = this.modules[a][s] d && (o.beginFill(0, 100), o.moveTo(c, l), o.lineTo(c + n, l), o.lineTo(c + n, l + n), o.lineTo(c, l + n), o.endFill()) } return o } proto.setupTimingPattern = function () { for (var e = 8; e < this.moduleCount - 8; e++) this.modules[e][6] == null && (this.modules[e][6] = e % 2 == 0) for (var t = 8; t < this.moduleCount - 8; t++) this.modules[6][t] == null && (this.modules[6][t] = t % 2 == 0) } proto.setupPositionAdjustPattern = function () { for ( var e = util.getPatternPosition(this.typeNumber), t = 0; t < e.length; t++ ) for (var r = 0; r < e.length; r++) { var o = e[t], n = e[r] if (this.modules[o][n] == null) for (var a = -2; a <= 2; a++) for (var l = -2; l <= 2; l++) a == -2 || a == 2 || l == -2 || l == 2 || (a == 0 && l == 0) ? (this.modules[o + a][n + l] = !0) : (this.modules[o + a][n + l] = !1) } } proto.setupTypeNumber = function (e) { for (var t = util.getBCHTypeNumber(this.typeNumber), r = 0; r < 18; r++) { var o = !e && ((t >> r) & 1) == 1 this.modules[Math.floor(r / 3)][(r % 3) + this.moduleCount - 8 - 3] = o } for (var r = 0; r < 18; r++) { var o = !e && ((t >> r) & 1) == 1 this.modules[(r % 3) + this.moduleCount - 8 - 3][Math.floor(r / 3)] = o } } proto.setupTypeInfo = function (e, t) { for ( var r = (this.errorCorrectLevel << 3) | t, o = util.getBCHTypeInfo(r), n = 0; n < 15; n++ ) { var a = !e && ((o >> n) & 1) == 1 n < 6 ? (this.modules[n][8] = a) : n < 8 ? (this.modules[n + 1][8] = a) : (this.modules[this.moduleCount - 15 + n][8] = a) } for (var n = 0; n < 15; n++) { var a = !e && ((o >> n) & 1) == 1 n < 8 ? (this.modules[8][this.moduleCount - n - 1] = a) : n < 9 ? (this.modules[8][15 - n - 1 + 1] = a) : (this.modules[8][15 - n - 1] = a) } this.modules[this.moduleCount - 8][8] = !e } proto.mapData = function (e, t) { for ( var r = -1, o = this.moduleCount - 1, n = 7, a = 0, l = this.moduleCount - 1; l > 0; l -= 2 ) for (l == 6 && l--; ; ) { for (var s = 0; s < 2; s++) if (this.modules[o][l - s] == null) { var c = !1 a < e.length && (c = ((e[a] >>> n) & 1) == 1) var d = util.getMask(t, o, l - s) d && (c = !c), (this.modules[o][l - s] = c), n--, n == -1 && (a++, (n = 7)) } if (((o += r), o < 0 || this.moduleCount <= o)) { ;(o -= r), (r = -r) break } } } QRCode$1.PAD0 = 236 QRCode$1.PAD1 = 17 QRCode$1.createData = function (e, t, r) { for ( var o = RSBlock.getRSBlocks(e, t), n = new BitBuffer(), a = 0; a < r.length; a++ ) { var l = r[a] n.put(l.mode, 4), n.put(l.getLength(), util.getLengthInBits(l.mode, e)), l.write(n) } for (var s = 0, a = 0; a < o.length; a++) s += o[a].dataCount if (n.getLengthInBits() > s * 8) throw new Error( 'code length overflow. (' + n.getLengthInBits() + '>' + s * 8 + ')' ) for ( n.getLengthInBits() + 4 <= s * 8 && n.put(0, 4); n.getLengthInBits() % 8 != 0; ) n.putBit(!1) for ( ; !( n.getLengthInBits() >= s * 8 || (n.put(QRCode$1.PAD0, 8), n.getLengthInBits() >= s * 8) ); ) n.put(QRCode$1.PAD1, 8) return QRCode$1.createBytes(n, o) } QRCode$1.createBytes = function (e, t) { for ( var r = 0, o = 0, n = 0, a = new Array(t.length), l = new Array(t.length), s = 0; s < t.length; s++ ) { var c = t[s].dataCount, d = t[s].totalCount - c ;(o = Math.max(o, c)), (n = Math.max(n, d)), (a[s] = new Array(c)) for (var u = 0; u < a[s].length; u++) a[s][u] = 255 & e.buffer[u + r] r += c var m = util.getErrorCorrectPolynomial(d), f = new Polynomial(a[s], m.getLength() - 1), _ = f.mod(m) l[s] = new Array(m.getLength() - 1) for (var u = 0; u < l[s].length; u++) { var b = u + _.getLength() - l[s].length l[s][u] = b >= 0 ? _.get(b) : 0 } } for (var v = 0, u = 0; u < t.length; u++) v += t[u].totalCount for (var k = new Array(v), g = 0, u = 0; u < o; u++) for (var s = 0; s < t.length; s++) u < a[s].length && (k[g++] = a[s][u]) for (var u = 0; u < n; u++) for (var s = 0; s < t.length; s++) u < l[s].length && (k[g++] = l[s][u]) return k } var QRCode_1 = QRCode$1, defaultErrorCorrectLevel = 'H', SUPPORTS_PATH2D = (function () { try { new Path2D().addPath(new Path2D()) } catch { return !1 } return !0 })() function QRCode(e, t) { var r = ErrorCorrectLevel[t], o = new QRCode_1(-1, r) return o.addData(toUTF8String(e)), o.make(), o } function validErrorCorrectLevel(e) { return e in ErrorCorrectLevel } function toUTF8String(e) { for (var t = '', r = 0; r < e.length; r++) { var o = e.charCodeAt(r) o < 128 ? (t += String.fromCharCode(o)) : o < 2048 ? ((t += String.fromCharCode(192 | (o >> 6))), (t += String.fromCharCode(128 | (o & 63)))) : o < 55296 || o >= 57344 ? ((t += String.fromCharCode(224 | (o >> 12))), (t += String.fromCharCode(128 | ((o >> 6) & 63))), (t += String.fromCharCode(128 | (o & 63)))) : (r++, (o = 65536 + (((o & 1023) << 10) | (e.charCodeAt(r) & 1023))), (t += String.fromCharCode(240 | (o >> 18))), (t += String.fromCharCode(128 | ((o >> 12) & 63))), (t += String.fromCharCode(128 | ((o >> 6) & 63))), (t += String.fromCharCode(128 | (o & 63)))) } return t } function generatePath(e, t) { t === void 0 && (t = 0) var r = [] return ( e.forEach(function (o, n) { var a = null o.forEach(function (l, s) { if (!l && a !== null) { r.push( 'M' + (a + t) + ' ' + (n + t) + 'h' + (s - a) + 'v1H' + (a + t) + 'z' ), (a = null) return } if (s === o.length - 1) { if (!l) return a === null ? r.push('M' + (s + t) + ',' + (n + t) + ' h1v1H' + (s + t) + 'z') : r.push( 'M' + (a + t) + ',' + (n + t) + ' h' + (s + 1 - a) + 'v1H' + (a + t) + 'z' ) return } l && a === null && (a = s) }) }), r.join('') ) } var QRCodeProps = { value: { type: String, required: !0, default: '' }, size: { type: Number, default: 100 }, level: { type: String, default: defaultErrorCorrectLevel, validator: function (e) { return validErrorCorrectLevel(e) } }, background: { type: String, default: '#fff' }, foreground: { type: String, default: '#000' }, margin: { type: Number, required: !1, default: 0 } }, QRCodeVueProps = __assign(__assign({}, QRCodeProps), { renderAs: { type: String, required: !1, default: 'canvas', validator: function (e) { return ['canvas', 'svg'].indexOf(e) > -1 } } }), QRCodeSvg = defineComponent({ name: 'QRCodeSvg', props: QRCodeProps, setup: function (e) { var t = ref(0), r = ref(''), o = function () { var n = e.value, a = e.level, l = e.margin, s = QRCode(n, a).modules ;(t.value = s.length + l * 2), (r.value = generatePath(s, l)) } return ( o(), onUpdated(o), function () { return h( 'svg', { width: e.size, height: e.size, 'shape-rendering': 'crispEdges', xmlns: 'http://www.w3.org/2000/svg', viewBox: '0 0 ' + t.value + ' ' + t.value }, [ h('path', { fill: e.background, d: 'M0,0 h' + t.value + 'v' + t.value + 'H0z' }), h('path', { fill: e.foreground, d: r.value }) ] ) } ) } }), QRCodeCanvas = defineComponent({ name: 'QRCodeCanvas', props: QRCodeProps, setup: function (e) { var t = ref(null), r = function () { var o = e.value, n = e.level, a = e.size, l = e.margin, s = e.background, c = e.foreground, d = QRCode(o, n).modules, u = d.length + l * 2, m = t.value if (!!m) { var f = m.getContext('2d') if (!!f) { var _ = window.devicePixelRatio || 1, b = (a / u) * _ ;(m.height = m.width = a * _), f.scale(b, b), (f.fillStyle = s), f.fillRect(0, 0, u, u), (f.fillStyle = c), SUPPORTS_PATH2D ? f.fill(new Path2D(generatePath(d, l))) : d.forEach(function (v, k) { v.forEach(function (g, x) { g && f.fillRect(x + l, k + l, 1, 1) }) }) } } } return ( onMounted(r), onUpdated(r), function () { return h('canvas', { ref: t, style: { width: e.size + 'px', height: e.size + 'px' } }) } ) } }), QrcodeVue = defineComponent({ name: 'Qrcode', render: function () { var e = this.$props, t = e.renderAs, r = e.value, o = e.size, n = e.margin, a = e.level, l = e.background, s = e.foreground, c = o >>> 0, d = n >>> 0, u = validErrorCorrectLevel(a) ? a : defaultErrorCorrectLevel return h(t === 'svg' ? QRCodeSvg : QRCodeCanvas, { value: r, size: c, margin: d, level: u, background: l, foreground: s }) }, props: QRCodeVueProps }) const txt = '_txt_1ivm3_1' var styles$1 = { txt }, logoIco = './assets/logo.d4268eb2.png' const getAssetsHomeFile$1 = e => { const t = `../../images/${e}` return { '../../images/cert_bg.png': __glob_10_0, '../../images/icon_close.png': __glob_10_1, '../../images/icon_pc_login.png': __glob_10_2, '../../images/icon_qrcode_login.png': __glob_10_3, '../../images/icon_scan.png': __glob_10_4, '../../images/register_bg.png': __glob_10_5, '../../images/teacher_1.png': __glob_10_6, '../../images/teacher_2.png': __glob_10_7 }[t].default } var QrLogin = defineComponent({ name: 'qrCode', props: { loginType: { type: String }, onChange: { type: Function, default: e => {} }, onClose: { type: Function, default: () => {} } }, data() { return { qrCode: '', isScan: !1, scanCode: '', codeTimerOut: !1, codeStatus: 'no_scan' } }, async mounted() { try { const e = sessionStorage.getItem('scanCode') e ? ((this.scanCode = e), sessionStorage.removeItem('scanCode')) : await this.getCode(), console.log(this.loginType), (this.qrCode = `${getCodeBaseUrl( `/${this.loginType}` )}/#/scanLogin?code=${this.scanCode}`), console.log(this.qrCode), (state.loginPopupTimer = setInterval(async () => { await this.getList() }, 5e3)) } catch {} }, methods: { async getCode() { try { const e = await request.get('/api-auth/getQRLoginCode', { params: { clientId: 'website', clientSecret: 'website' } }) ;(this.scanCode = e.data.code), (this.codeStatus = e.data.codeStatus), sessionStorage.setItem('scanCode', e.data.code) } catch {} }, async getList() { try { console.log(this.scanCode) const e = await request.get('/api-auth/pollingQRLoginCode', { params: { code: this.scanCode } }) console.log(e, 'getlist') const t = e.data if (!t) { ;(this.codeTimerOut = !0), this.removeTimer() return } if (((this.codeStatus = t.codeStatus), t.codeStatus === 'succeed')) { this.removeTimer() const { authentication: r, userType: o } = t, n = r.token_type + ' ' + r.access_token setAuth(JSON.stringify({ token: n, loginUserType: o })), this.onClose(), window.location.reload() } else t.codeStatus === 'filed' ? this.removeTimer() : t.codeStatus === 'scanned' && (this.isScan = !0) } catch { console.log('error'), (this.codeTimerOut = !0), this.removeTimer() } }, removeTimer() { ;(this.codeStatus = 'no_scan'), (this.isScan = !1), clearInterval(state.loginPopupTimer) } }, render() { return createVNode('div', { class: 'text-center pt-4' }, [ createVNode( 'div', { class: 'absolute top-2 right-2 z-10', onClick: () => { this.removeTimer(), this.onChange('login') } }, [ createVNode( 'img', { src: getAssetsHomeFile$1('icon_pc_login.png'), class: 'w-14 h-14 cursor-pointer' }, null ) ] ), this.isScan ? createVNode(Fragment, null, [ createVNode( ElIcon, { class: 'mx-auto w-[138px] h-[138px] align-middle', size: 70, color: 'var(--el-color-primary)' }, { default: () => [createVNode(circle_check_default, null, null)] } ), createVNode('p', { class: 'text-lg text-[#666] mt-6' }, [ createTextVNode('\u626B\u63CF\u6210\u529F') ]), createVNode( 'p', { class: 'font-semibold text-[#1A1A1A] text-[20px] pt-4' }, [ createTextVNode( '\u8BF7\u5728\u624B\u673A\u4E0A\u6839\u636E\u63D0\u793A\u786E\u8BA4\u767B\u5F55' ) ] ), createVNode( ElLink, { type: 'primary', underline: !1, class: 'm-auto mt-3', onClick: async () => { await this.getCode(), (this.isScan = !1) } }, { default: () => [ createTextVNode( '\u8FD4\u56DE\u626B\u63CF\u4E8C\u7EF4\u7801' ) ] } ) ]) : createVNode(Fragment, null, [ createVNode( 'div', { class: 'mx-auto w-[178px] h-[178px] align-middle flex items-center justify-center relative overflow-hidden rounded', style: { boxShadow: '0px 0px 8px 0px rgba(0, 0, 0, 0.18)' } }, [ createVNode( QrcodeVue, { value: this.qrCode, size: 168 }, null ), createVNode( 'div', { class: 'absolute w-[178px] h-[178px] top-0 left-0 flex items-center justify-center' }, [ createVNode( 'img', { src: logoIco, class: 'w-9 h-9' }, null ) ] ), this.codeTimerOut && createVNode( 'div', { class: 'absolute inset-0 bg-black bg-opacity-75 flex items-center justify-center flex-col' }, [ createVNode('p', { class: 'text-white text-sm pb-2' }, [ createTextVNode( '\u4E8C\u7EF4\u7801\u5DF2\u5931\u6548' ) ]), createVNode( ElButton, { type: 'primary', size: 'small', onClick: async () => { ;(this.codeTimerOut = !1), await this.getCode(), (state.loginPopupTimer = setInterval( async () => { await this.getList() }, 5e3 )) } }, { default: () => [ createTextVNode('\u70B9\u51FB\u5237\u65B0') ] } ) ] ) ] ), createVNode( 'div', { class: 'flex items-center justify-center pt-8 font-normal' }, [ createVNode( 'img', { class: 'w-9 h-9 align-middle mr-4', src: getAssetsHomeFile$1('icon_scan.png') }, null ), createVNode('div', { class: ['text-left leading-[22px]'] }, [ createVNode('p', null, [ createTextVNode('\u6253\u5F00'), createVNode('span', { class: styles$1.txt }, [ createTextVNode( '\u9177\u4E50\u79C0\u5B66\u751F\u7AEFAPP' ) ]) ]), createVNode('p', null, [ createTextVNode('\u626B\u4E00\u626B\u767B\u5F55') ]) ]) ] ) ]) ]) } }), TeacherAuth = defineComponent({ name: 'teacher-auth', props: { onClose: { type: Function, default: () => {} } }, methods: { onDetail(e = 'teacher') { this.onClose(), e === 'teacher' ? this.$router.push('/teacherAuth') : e === 'music' && this.$router.push('/musicAuth') } }, render() { return createVNode(Fragment, null, [ createVNode( 'div', { class: 'text-[#1a1a1a] font-semibold text-xl text-center after:w-4 after:h-[3px] after:rounded-sm after:bg-[#2DC7AA] after:block after:m-auto after:mt-2' }, [createTextVNode('\u9177\u4E50\u79C0\u8BA4\u8BC1')] ), createVNode('div', { class: 'text-center text-gray-500 pt-4 pb-5' }, [ createTextVNode( '\u5B8C\u6210\u9177\u4E50\u79C0\u8BA4\u8BC1\u80FD\u5F00\u542F\u66F4\u591A\u529F\u80FD\uFF01' ) ]), createVNode( ElRow, { gutter: 10 }, { default: () => [ createVNode( ElCol, { span: 12, class: 'cursor-pointer' }, { default: () => [ createVNode( 'div', { class: 'border-neutral-200 border-solid border rounded flex items-center p-4', onClick: () => { this.onDetail('teacher') } }, [ createVNode( 'img', { src: teacher1, class: 'w-16 h-[84px]' }, null ), createVNode('div', { class: 'pl-3' }, [ createVNode( 'p', { class: 'text-slate-700 text-[16px] font-semibold' }, [createTextVNode('\u8FBE\u4EBA\u8BA4\u8BC1')] ), createVNode( 'p', { class: 'text-gray-400 text-[14px] leading-5 pt-1' }, [ createTextVNode('\u5F00\u542F\u7EBF\u4E0A'), createVNode('br', null, null), createTextVNode('\u6559\u5B66\u4E4B\u65C5') ] ) ]) ] ) ] } ), createVNode( ElCol, { span: 12, class: 'cursor-pointer' }, { default: () => [ createVNode( 'div', { class: 'border-neutral-200 border-solid border rounded flex items-center py-4 pl-4 pr-0', onClick: () => { this.onDetail('music') } }, [ createVNode( 'img', { src: teacher2, class: 'w-16 h-[84px]' }, null ), createVNode('div', { class: 'pl-3' }, [ createVNode( 'p', { class: 'text-slate-700 text-[16px] font-semibold' }, [createTextVNode('\u97F3\u4E50\u4EBA\u8BA4\u8BC1')] ), createVNode( 'p', { class: 'text-gray-400 text-[14px] leading-5 pt-1' }, [ createTextVNode('\u4E0A\u4F20\u66F2\u8C31'), createVNode('br', null, null), createTextVNode('\u83B7\u53D6\u6536\u76CA') ] ) ]) ] ) ] } ) ] } ), createVNode( ElButton, { type: 'primary', class: 'w-full mt-4', style: { height: '40px' }, onClick: () => { this.onClose() } }, { default: () => [createTextVNode('\u4E0B\u6B21\u518D\u8BF4')] } ) ]) } }), sutdentDownLoad = './assets/student_download.7cedcba0.png', teacherDownLoad = './assets/teacher_download.267d7472.png' const getAssetsHomeFile = e => { const t = `./images/${e}` return { './images/cert_bg.png': __glob_10_0, './images/icon_close.png': __glob_10_1, './images/icon_pc_login.png': __glob_10_2, './images/icon_qrcode_login.png': __glob_10_3, './images/icon_scan.png': __glob_10_4, './images/register_bg.png': __glob_10_5, './images/teacher_1.png': __glob_10_6, './images/teacher_2.png': __glob_10_7 }[t].default } var Login = defineComponent({ name: 'Login', props: { onClose: { type: Function, default: () => {} } }, data() { return { qrCodeDownLoad: 'http://dev.colexiu.com/student/#/download', type: 'login', registerType: 'teacher', loginType: 'teacher' } }, methods: { onReset(e) { e === 'login' ? (this.$refs.teacherLogin && this.$refs.teacherLogin.onResetFields(), this.$refs.studentLogin && this.$refs.studentLogin.onResetFields()) : e === 'register' && (this.$refs.teacherRegister && this.$refs.teacherRegister.onResetFields(), this.$refs.studentRegister && this.$refs.studentRegister.onResetFields()) } }, watch: { type(e) { e != 'qr-login' && clearInterval(state.loginPopupTimer) } }, render() { return createVNode('div', { class: [styles$4.loginSection, 'relative'] }, [ createVNode( 'i', { class: [ styles$4.iconClose, 'w-9 h-9 rounded-full flex absolute -top-1 -right-[18px]' ], onClick: () => { this.onClose() } }, null ), this.type == 'teacher-auth' ? createVNode( 'img', { src: getAssetsHomeFile('cert_bg.png'), class: [styles$4.loginBg, '-mt-[10px]'] }, null ) : createVNode( 'img', { src: getAssetsHomeFile('register_bg.png'), class: [styles$4.loginBg, '-mt-[10px]'] }, null ), createVNode( 'div', { class: [ styles$4.loginTabs, 'px-9 pt-5 pb-12 bg-white relative', this.type === 'qr-login' ? 'pb-4' : '', this.type === 'teacher-auth' ? 'px-6 pb-8' : '' ] }, [ this.type === 'login' && createVNode(Fragment, null, [ createVNode('div', { class: 'absolute top-2 right-2 z-10' }, [ createVNode('div', { class: styles$4.toolTips }, [ createVNode('span', null, [ createTextVNode( '\u626B\u7801\u767B\u5F55\u66F4\u65B9\u4FBF' ) ]), createVNode('span', { class: styles$4.toolTips_arrow }, null) ]), createVNode( 'img', { src: getAssetsHomeFile('icon_qrcode_login.png'), class: 'w-14 h-14 cursor-pointer', onClick: () => { this.type = 'qr-login' } }, null ) ]), createVNode( ElTabs, { modelValue: this.loginType, 'onUpdate:modelValue': e => (this.loginType = e) }, { default: () => [ createVNode( ElTabPane, { label: '\u8001\u5E08\u767B\u5F55', name: 'teacher' }, { default: () => [ this.loginType === 'teacher' && createVNode( Form, { type: 'teacher-login', key: 'teacherLogin', ref: 'teacherLogin', onClose: () => { this.onClose() } }, null ) ] } ), createVNode( ElTabPane, { label: '\u5B66\u5458\u767B\u5F55', name: 'student' }, { default: () => [ this.loginType === 'student' && createVNode( Form, { type: 'student-login', key: 'studentLogin', ref: 'studentLogin', onClose: () => { this.onClose() } }, null ) ] } ) ] } ), createVNode('div', { class: [styles$4.scanTxt] }, [ createTextVNode('\u6CA1\u6709\u8D26\u53F7\uFF0C'), createVNode( 'span', { class: 'cursor-pointer', onClick: () => { this.onReset('login'), (this.type = 'register') } }, [createTextVNode('\u9A6C\u4E0A\u6CE8\u518C')] ) ]) ]), this.type === 'qr-login' && createVNode(Fragment, null, [ createVNode( QrLogin, { loginType: this.loginType, onChange: e => { this.type = e }, onClose: () => { this.onClose() } }, null ), createVNode( 'div', { class: [styles$4.scanTxt, 'pt-14 text-center'] }, [ createTextVNode('\u6CA1\u6709\u8D26\u53F7\uFF0C'), createVNode( 'span', { class: 'cursor-pointer', onClick: () => { this.type = 'register' } }, [createTextVNode('\u9A6C\u4E0A\u6CE8\u518C')] ) ] ) ]), this.type === 'register' && createVNode(Fragment, null, [ createVNode( ElTabs, { modelValue: this.registerType, 'onUpdate:modelValue': e => (this.registerType = e) }, { default: () => [ createVNode( ElTabPane, { label: '\u8001\u5E08\u6CE8\u518C', name: 'teacher' }, { default: () => [ this.registerType === 'teacher' && createVNode( Form, { type: 'teacher-register', key: 'teacher-register', ref: 'teacherRegister', onClose: () => { this.onClose() }, onChange: e => { this.type = e } }, null ) ] } ), createVNode( ElTabPane, { label: '\u5B66\u5458\u6CE8\u518C', name: 'student' }, { default: () => [ this.registerType === 'student' && createVNode( Form, { type: 'student-register', key: 'student-register', ref: 'studentRegister', onClose: () => { this.onClose() }, onChange: e => { this.type = e } }, null ) ] } ) ] } ), createVNode('div', { class: [styles$4.scanTxt] }, [ createTextVNode('\u5DF2\u6709\u8D26\u53F7\uFF0C'), createVNode( 'span', { class: 'cursor-pointer', onClick: () => { this.onReset('register'), (this.type = 'login') } }, [createTextVNode('\u9A6C\u4E0A\u767B\u5F55')] ) ]) ]), this.type === 'register-success' && createVNode('div', { class: 'text-center pt-4' }, [ this.registerType === 'teacher' ? createVNode( 'img', { src: teacherDownLoad, class: 'mx-auto shadow-lg w-[178px] h-[178px] align-middle' }, null ) : createVNode( 'img', { src: sutdentDownLoad, class: 'mx-auto shadow-lg w-[178px] h-[178px] align-middle' }, null ), createVNode('h3', { class: 'text-lg text=[#1a1a1a] pt-4 pb-2' }, [ createTextVNode('\u6CE8\u518C\u6210\u529F') ]), createVNode('div', { class: [styles$4.scanTxt, 'leading-6'] }, [ createVNode('p', null, [ createTextVNode( '\u606D\u559C\u60A8\u5DF2\u6210\u529F\u6CE8\u518C\u9177\u4E50\u79C0' ), this.registerType === 'teacher' ? '\u8001\u5E08' : '\u5B66\u751F', createTextVNode('\u8D26\u53F7\uFF01') ]), createVNode('p', null, [ createVNode('span', null, [ createTextVNode('\u4E0B\u8F7D\u9177\u4E50\u79C0'), this.registerType === 'teacher' ? '\u8001\u5E08' : '\u5B66\u751F', createTextVNode('\u7AEFAPP') ]), createTextVNode('\u53D1\u73B0\u66F4\u5927\u7684\u4E16\u754C') ]) ]), createVNode( ElButton, { type: 'primary', class: 'w-full mt-4', style: { height: '40px' }, onClick: () => { this.registerType == 'teacher' ? (this.type = 'teacher-auth') : this.onClose() } }, { default: () => [createTextVNode('\u77E5\u9053\u4E86')] } ) ]), this.type === 'teacher-auth' && createVNode( TeacherAuth, { onClose: () => { ;(this.type = 'login'), (this.loginType = 'teacher'), this.onClose() } }, null ) ] ) ]) } }) const loginContainer = '_loginContainer_19itr_1' var styles = { loginContainer } const silderWrap = '_silderWrap_1nf2j_1', silderList = '_silderList_1nf2j_7', silderItem = '_silderItem_1nf2j_12', line = '_line_1nf2j_25', wall = '_wall_1nf2j_61', goTop = '_goTop_1nf2j_67', submitBtn = '_submitBtn_1nf2j_95', submsg = '_submsg_1nf2j_109', Mopopver = '_Mopopver_1nf2j_112', codeItem = '_codeItem_1nf2j_112', hoverTitle = '_hoverTitle_1nf2j_119', hoverMsg = '_hoverMsg_1nf2j_125' var classes = { silderWrap, silderList, silderItem, line, wall, goTop, submitBtn, submsg, Mopopver, codeItem, hoverTitle, hoverMsg } function scrollAnimation(e, t) { let r = t - e, o = e setTimeout(() => { ;(o += Math.ceil(r / 10)), window.scrollTo(o, e), r > 10 || r < -10 ? scrollAnimation(o, t) : window.scrollTo(o, t) }, 1) } var silder1 = './assets/silder1.35e921bc.svg', silder3 = './assets/silder3.2cf8c416.svg', silder5 = './assets/silder5.32b5d7c1.svg', weixin = './assets/weixinCode.b45b0e07.jpg', silder = defineComponent({ name: 'silder', setup() { const e = reactive({ showgo: !1 }), t = () => { const r = document.documentElement.scrollTop || document.body.scrollTop scrollAnimation(r, 0) } return ( onMounted(() => { window.onscroll = function () { document.documentElement.scrollTop > 300 ? (e.showgo = !0) : (e.showgo = !1) } }), () => createVNode(Fragment, null, [ createVNode('div', { class: classes.silderWrap }, [ createVNode('div', { class: classes.silderList }, [ createVNode( ElPopover, { placement: 'left', trigger: 'hover', 'popper-class': 'Mopopver' }, { default: () => [ createVNode('div', null, [ createVNode('div', { class: classes.codeItem }, [ createVNode( 'img', { src: studentCode, width: '111', height: '111' }, null ), createVNode( 'p', { style: { 'text-align': 'center' } }, [createTextVNode('\u9177\u4E50\u79C0')] ) ]), createVNode('div', { class: classes.codeItem }, [ createVNode( 'img', { src: teacherCode, width: '111', height: '111' }, null ), createVNode( 'p', { style: { 'text-align': 'center' } }, [createTextVNode('\u9177\u4E50\u79C0\u5B66\u9662')] ) ]) ]) ], reference: () => createVNode('div', { class: classes.silderItem }, [ createVNode('img', { src: silder3 }, null), createVNode('p', null, [ createTextVNode('APP\u4E0B\u8F7D') ]), createVNode('div', { class: classes.line }, null) ]) } ), createVNode( ElPopover, { placement: 'left', trigger: 'hover', 'popper-class': 'Mopopver' }, { default: () => [ createVNode('div', null, [ createVNode('div', { class: classes.codeItem }, [ createVNode( 'img', { src: weixin, width: '111', height: '111' }, null ), createVNode('p', null, [ createTextVNode('\u5FAE\u4FE1\u8BA2\u9605\u53F7') ]) ]) ]) ], reference: () => createVNode('div', { class: classes.silderItem }, [ createVNode('img', { src: silder1 }, null), createVNode('p', null, [ createTextVNode('\u5173\u6CE8\u5FAE\u4FE1') ]), createVNode('div', { class: classes.wall }, null) ]) } ) ]), e.showgo ? createVNode('div', { class: classes.goTop, onClick: t }, [ createVNode('img', { src: silder5 }, null), createTextVNode('\u56DE\u5230\u9876\u90E8') ]) : '' ]) ]) ) } }), App = defineComponent({ components: { silder }, name: 'App', async created() { var e try { ;(e = state.user.data) != null && e.userId && (await getUserInfo()) } catch {} }, render() { return createVNode(Fragment, null, [ createVNode(ColHeader, null, null), createVNode('div', { style: { minHeight: 'calc(100vh - 263.5px)' } }, [ createVNode( ElConfigProvider, { locale: zhCn, message: { max: 1 } }, { default: () => [createVNode(RouterView, null, null)] } ) ]), createVNode(silder, null, null), createVNode(ColFooter, null, null), createVNode('div', { class: styles.loginContainer }, [ createVNode( ElDialog, { modelValue: state.loginPopupStatus, 'onUpdate:modelValue': e => (state.loginPopupStatus = e), closeOnClickModal: !1, closeOnPressEscape: !1 }, { default: () => [ state.loginPopupStatus && createVNode( Login, { onClose: () => { clearTimeout(state.loginPopupTimer), (state.loginPopupStatus = !1) } }, null ) ] } ) ]) ]) } }) const scriptRel = 'modulepreload', seen = {}, base = './', __vitePreload = function (t, r) { return !r || r.length === 0 ? t() : Promise.all( r.map(o => { if (((o = `${base}${o}`), o in seen)) return seen[o] = !0 const n = o.endsWith('.css'), a = n ? '[rel="stylesheet"]' : '' if (document.querySelector(`link[href="${o}"]${a}`)) return const l = document.createElement('link') if ( ((l.rel = n ? 'stylesheet' : scriptRel), n || ((l.as = 'script'), (l.crossOrigin = '')), (l.href = o), document.head.appendChild(l), n) ) return new Promise((s, c) => { l.addEventListener('load', s), l.addEventListener('error', () => c(new Error(`Unable to preload CSS for ${o}`)) ) }) }) ).then(() => t()) } var routes = [ { path: '/', component: () => __vitePreload( () => import('./index.59a32e46.js'), [ 'assets/index.59a32e46.js', 'assets/index.be405b3c.css', 'assets/scrollbar.min.61ca5c8d.js', 'assets/scrollbar.min.6447ec8b.css', 'assets/pan.47bc7f75.js', 'assets/start.1edc8c81.js', 'assets/index.6d3b110d.js', 'assets/index.b8e60fca.css', 'assets/icon.6e6f91da.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/music.f2b8674a.js', 'assets/arrow.15dbd454.js', 'assets/index.aecb2b6c.js', 'assets/index.139602a3.css', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/hot.5fc25a45.js', 'assets/index.a754d401.js', 'assets/index.e0f3a12d.css' ] ), meta: { title: '\u9996\u9875', highlightPath: '/home', isdark: !1 } }, { path: '/home', name: 'home', component: () => __vitePreload( () => import('./index.59a32e46.js'), [ 'assets/index.59a32e46.js', 'assets/index.be405b3c.css', 'assets/scrollbar.min.61ca5c8d.js', 'assets/scrollbar.min.6447ec8b.css', 'assets/pan.47bc7f75.js', 'assets/start.1edc8c81.js', 'assets/index.6d3b110d.js', 'assets/index.b8e60fca.css', 'assets/icon.6e6f91da.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/music.f2b8674a.js', 'assets/arrow.15dbd454.js', 'assets/index.aecb2b6c.js', 'assets/index.139602a3.css', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/hot.5fc25a45.js', 'assets/index.a754d401.js', 'assets/index.e0f3a12d.css' ] ), meta: { title: '\u9996\u9875', highlightPath: '/home', isdark: !1 } }, { path: '/downLoad', name: 'downLoad', component: () => __vitePreload( () => import('./index.3e2fc969.js'), ['assets/index.3e2fc969.js', 'assets/index.1cd08b2b.css'] ), meta: { title: '\u4E0B\u8F7D', highlightPath: '/downLoad', isdark: !0 } }, { path: '/musicLibrary', name: 'musicLibrary', component: () => __vitePreload( () => import('./index.5e4e0104.js'), [ 'assets/index.5e4e0104.js', 'assets/arrow.15dbd454.js', 'assets/index.module.45442ec5.js', 'assets/index.module.758c99b1.css', 'assets/scrollbar.min.61ca5c8d.js', 'assets/scrollbar.min.6447ec8b.css', 'assets/pan.47bc7f75.js', 'assets/start.1edc8c81.js', 'assets/index.6d3b110d.js', 'assets/index.b8e60fca.css', 'assets/icon.6e6f91da.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/music.f2b8674a.js', 'assets/index.aecb2b6c.js', 'assets/index.139602a3.css', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/hot.5fc25a45.js', 'assets/index.6a29d334.js', 'assets/index.778fb3e5.css', 'assets/index2.ba9e0a49.js', 'assets/index.a754d401.js', 'assets/index.e0f3a12d.css' ] ), meta: { title: '\u8C31\u5E93', highlightPath: '/musicLibrary', index: 2, isdark: !1 } }, { path: '/muiscDetial', name: 'muiscDetial', component: () => __vitePreload( () => import('./index.530807a7.js'), [ 'assets/index.530807a7.js', 'assets/index.519a8c97.css', 'assets/index.f58a8780.js', 'assets/index.d9f312dc.css', 'assets/start.1edc8c81.js', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/music.f2b8674a.js', 'assets/arrow.15dbd454.js', 'assets/index2.ba9e0a49.js' ] ), meta: { title: '\u66F2\u8C31\u8BE6\u60C5', highlightPath: '/musicLibrary', index: 2, isdark: !0 } }, { path: '/searchdetail', name: 'searchdetail', component: () => __vitePreload( () => import('./searchdetail.06dd66ab.js'), [ 'assets/searchdetail.06dd66ab.js', 'assets/index.module.45442ec5.js', 'assets/index.module.758c99b1.css', 'assets/index.aecb2b6c.js', 'assets/index.139602a3.css', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/hot.5fc25a45.js', 'assets/arrow.15dbd454.js', 'assets/index.6a29d334.js', 'assets/index.778fb3e5.css', 'assets/index2.ba9e0a49.js', 'assets/scrollbar.min.61ca5c8d.js', 'assets/scrollbar.min.6447ec8b.css', 'assets/pan.47bc7f75.js', 'assets/start.1edc8c81.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index.b42087f4.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/icon.6e6f91da.js', 'assets/music.f2b8674a.js' ] ), meta: { title: '\u641C\u7D22', index: 3, highlightPath: '/musicLibrary', isdark: !0 } }, { path: '/albumDetail', name: 'albumDetail', component: () => __vitePreload( () => import('./index.56c0f1af.js'), [ 'assets/index.56c0f1af.js', 'assets/index.2d0fb12b.css', 'assets/pan.47bc7f75.js', 'assets/start.1edc8c81.js', 'assets/arrow.15dbd454.js', 'assets/hot.5fc25a45.js', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/icon.6e6f91da.js', 'assets/music.f2b8674a.js', 'assets/index.b42087f4.js' ] ), meta: { title: '\u4E13\u8F91\u8BE6\u60C5', index: 3, highlightPath: '/musicLibrary', isdark: !0 } }, { path: '/videoDetailList', name: 'videoDetailList', component: () => __vitePreload( () => import('./index.eb4d465b.js'), [ 'assets/index.eb4d465b.js', 'assets/index.module.bfa5c48b.js', 'assets/index.module.2401b5fd.css', 'assets/index.aecb2b6c.js', 'assets/index.139602a3.css', 'assets/index.ce9e278a.js', 'assets/index.e270c06c.css', 'assets/index2.6b7eb987.js', 'assets/hot.5fc25a45.js', 'assets/arrow.15dbd454.js', 'assets/index.6a29d334.js', 'assets/index.778fb3e5.css', 'assets/index2.ba9e0a49.js', 'assets/index.6d3b110d.js', 'assets/index.b8e60fca.css', 'assets/icon.6e6f91da.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index.b42087f4.js' ] ), meta: { title: '\u89C6\u9891\u8BFE', index: 3, highlightPath: '/videoDetailList', isdark: !0 } }, { path: '/videoDetail', name: 'videoDetail', component: () => __vitePreload( () => import('./videoDetail.45b7315a.js'), [ 'assets/videoDetail.45b7315a.js', 'assets/videoDetail.a04158db.css', 'assets/index.6d3b110d.js', 'assets/index.b8e60fca.css', 'assets/icon.6e6f91da.js', 'assets/index.module.bfa5c48b.js', 'assets/index.module.2401b5fd.css', 'assets/index.f58a8780.js', 'assets/index.d9f312dc.css', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js' ] ), meta: { title: '\u89C6\u9891\u8BFE\u8BE6\u60C5', index: 3, highlightPath: '/videoDetailList', isdark: !0 } }, { path: '/teacherAuth', name: 'teacherAuth', component: () => __vitePreload( () => import('./index.d7081f8f.js'), [ 'assets/index.d7081f8f.js', 'assets/index.5559ea3c.css', 'assets/teacher_main.59b5b960.js', 'assets/index.9505fca5.js', 'assets/index.73d23370.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.71359404.js', 'assets/index2.695c0652.js', 'assets/isSameOrBefore.aa5d7801.js', 'assets/index.4ca3083a.js', 'assets/index.7ff86ba7.css', 'assets/icon_upload.a3b9dc82.js' ] ), meta: { title: '\u8FBE\u4EBA\u8BA4\u8BC1', isdark: !0 } }, { path: '/musicAuth', name: 'musicAuth', component: () => __vitePreload( () => import('./index.60e99b3f.js'), [ 'assets/index.60e99b3f.js', 'assets/index.244807ad.css', 'assets/teacher_main.59b5b960.js' ] ), meta: { title: '\u97F3\u4E50\u4EBA\u8BA4\u8BC1', isdark: !0 } }, { path: '/userInfo', name: 'userInfo', meta: { title: '\u7528\u6237\u4FE1\u606F', index: 5, isdark: !0 }, component: () => __vitePreload( () => import('./index.90e11d03.js'), ['assets/index.90e11d03.js', 'assets/index.56a96cb4.css'] ), redirect: '/userInfo/practiceSetting', children: [ { path: '/userInfo/practiceSetting', name: 'userInfoPracticeSetting', component: () => __vitePreload( () => import('./index.6fbd232b.js'), [ 'assets/index.6fbd232b.js', 'assets/index.4e28b24d.css', 'assets/index.b42087f4.js', 'assets/toolsValidate.add49407.js', 'assets/isSameOrBefore.aa5d7801.js', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.71359404.js' ] ), meta: { title: '\u966A\u7EC3\u8BFE', index: 2, isdark: !0 } }, { path: '/userInfo/liveClass', name: 'userInfoLiveClass', component: () => __vitePreload( () => import('./index.a19350d3.js'), [ 'assets/index.a19350d3.js', 'assets/index.f8e90b65.css', 'assets/index.b42087f4.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index.37658c21.js', 'assets/index2.07a0e1bf.js' ] ), meta: { title: '\u76F4\u64AD\u8BFE', index: 3, isdark: !0 } }, { path: '/userInfo/liveOperation', name: 'userInfoLiveOperation', component: () => __vitePreload( () => import('./index.f44ecd6e.js'), [ 'assets/index.f44ecd6e.js', 'assets/index.f122ee02.css', 'assets/index.9505fca5.js', 'assets/index.73d23370.css', 'assets/icon_course_list.adaa1c3f.js', 'assets/icon_course_list.081f006c.css', 'assets/icon_upload.a3b9dc82.js', 'assets/toolsValidate.add49407.js', 'assets/index2.695c0652.js', 'assets/isSameOrBefore.aa5d7801.js', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.71359404.js' ] ), meta: { title: '\u76F4\u64AD\u8BFE', index: 4, hidden: !0, activeMenu: 'userInfoLiveClass', isdark: !0 } }, { path: '/userInfo/videoClass', name: 'userInfoVideoClass', component: () => __vitePreload( () => import('./index.28cd52fa.js'), [ 'assets/index.28cd52fa.js', 'assets/index.f8e90b65.css', 'assets/index.b42087f4.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index.37658c21.js', 'assets/index2.07a0e1bf.js' ] ), meta: { title: '\u89C6\u9891\u8BFE', index: 4, isdark: !0 } }, { path: '/userInfo/videoOperation', name: 'userInfoVideoOperation', component: () => __vitePreload( () => import('./index.888d6e13.js'), [ 'assets/index.888d6e13.js', 'assets/index.dcb51fd9.css', 'assets/index.9505fca5.js', 'assets/index.73d23370.css', 'assets/index.4ca3083a.js', 'assets/index.7ff86ba7.css', 'assets/icon_upload.a3b9dc82.js', 'assets/icon_course_list.adaa1c3f.js', 'assets/icon_course_list.081f006c.css', 'assets/index.f58a8780.js', 'assets/index.d9f312dc.css', 'assets/toolsValidate.add49407.js', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.71359404.js' ] ), meta: { title: '\u89C6\u9891\u8BFE', index: 4, hidden: !0, activeMenu: 'userInfoVideoClass', isdark: !0 } }, { path: '/userInfo/musicClass', name: 'userInfoMusicClass', component: () => __vitePreload( () => import('./index.70c17b61.js'), [ 'assets/index.70c17b61.js', 'assets/index.b1b0523d.css', 'assets/index.b42087f4.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/icon.6e6f91da.js', 'assets/music.f2b8674a.js', 'assets/arrow.15dbd454.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.07a0e1bf.js' ] ), meta: { title: '\u6211\u7684\u66F2\u8C31', index: 5, isdark: !0 } }, { path: '/userInfo/musicOperation', name: 'userInfoMusicOperation', component: () => __vitePreload( () => import('./index.fcb21cd8.js'), [ 'assets/index.fcb21cd8.js', 'assets/index.6e53a27d.css', 'assets/index.4ca3083a.js', 'assets/index.7ff86ba7.css', 'assets/icon_upload.a3b9dc82.js', 'assets/toolsValidate.add49407.js', 'assets/index2.71359404.js', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js' ] ), meta: { title: '\u89C6\u9891\u8BFE', index: 4, hidden: !0, activeMenu: 'userInfoMusicClass', isdark: !0 } }, { path: '/userInfo/myFans', name: 'userInfoMyFans', component: () => __vitePreload( () => import('./index.941cbb9b.js'), [ 'assets/index.941cbb9b.js', 'assets/index.b42087f4.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.07a0e1bf.js' ] ), meta: { title: '\u6211\u7684\u7C89\u4E1D', index: 4, hidden: !0, isdark: !0 } } ] }, { path: '/studentInfo', name: 'studentInfo', component: () => __vitePreload( () => import('./index.52b9b846.js'), ['assets/index.52b9b846.js', 'assets/index.56a96cb4.css'] ), meta: { title: '\u7528\u6237\u4FE1\u606F', index: 5, isdark: !0 }, redirect: '/studentInfo/myScore', children: [ { path: '/studentInfo/myScore', name: 'studentInfoMyScore', component: () => __vitePreload( () => import('./index.59d74867.js'), [ 'assets/index.59d74867.js', 'assets/index.1fd31612.css', 'assets/index.b42087f4.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.07a0e1bf.js', 'assets/index.ae518b48.js', 'assets/index.3e8f7b98.css', 'assets/icon.6e6f91da.js', 'assets/music.f2b8674a.js', 'assets/arrow.15dbd454.js' ] ), meta: { title: '\u6211\u7684\u66F2\u8C31', index: 5, isdark: !0 } }, { path: '/studentInfo/myFollow', name: 'studentInfoMyFollow', component: () => __vitePreload( () => import('./index.bd4776ad.js'), [ 'assets/index.bd4776ad.js', 'assets/index.b42087f4.js', 'assets/index.cf4d47ea.js', 'assets/index.d57374b4.css', 'assets/index2.ba9e0a49.js', 'assets/index2.6b7eb987.js', 'assets/index2.07a0e1bf.js' ] ), meta: { title: '\u6211\u5173\u6CE8\u7684\u8001\u5E08', index: 5, hidden: !0, isdark: !0 } } ] }, { path: '/404', name: '404', component: () => __vitePreload( () => import('./index.72a7d951.js'), ['assets/index.72a7d951.js', 'assets/index.9328bdc8.css'] ), meta: { title: '404', isdark: !0 } }, { path: '/:pathMatch(.*)*', component: () => __vitePreload( () => import('./index.72a7d951.js'), ['assets/index.72a7d951.js', 'assets/index.9328bdc8.css'] ), meta: { title: '404 Not Fund', isdark: !0 } } ] const router = createRouter({ history: createWebHashHistory(), routes, scrollBehavior() { return new Promise((e, t) => { e({ left: 0, top: 0 }) }) } }) router.beforeEach(async (e, t, r) => { const o = e.meta.title document.title = o || '\u9177\u4E50\u79C0' try { await getUserInfo() } catch {} r() }) var index$1 = (() => `*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji"}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-size:100%;font-weight:inherit;line-height:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input:-ms-input-placeholder,textarea:-ms-input-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::-webkit-backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }.container{width:100%}@media (min-width: 640px){.container{max-width:640px}}@media (min-width: 768px){.container{max-width:768px}}@media (min-width: 1024px){.container{max-width:1024px}}@media (min-width: 1200px){.container{max-width:1200px}}@media (min-width: 1536px){.container{max-width:1536px}}.visible{visibility:visible}.absolute{position:absolute}.\\!absolute{position:absolute!important}.relative{position:relative}.inset-0{top:0px;right:0px;bottom:0px;left:0px}.inset-y-0{top:0px;bottom:0px}.inset-x-0{left:0px;right:0px}.-top-1{top:-.25rem}.-right-\\[18px\\]{right:-18px}.top-2{top:.5rem}.right-2{right:.5rem}.right-11{right:2.75rem}.top-4{top:1rem}.top-0{top:0px}.left-0{left:0px}.left-\\[5\\%\\]{left:5%}.right-3{right:.75rem}.bottom-2{bottom:.5rem}.right-0{right:0px}.right-4{right:1rem}.z-10{z-index:10}.m-auto{margin:auto}.-m-1{margin:-.25rem}.mx-auto{margin-left:auto;margin-right:auto}.mx-2{margin-left:.5rem;margin-right:.5rem}.mx-2\\.5{margin-left:.625rem;margin-right:.625rem}.\\!my-4{margin-top:1rem!important;margin-bottom:1rem!important}.mx-\\[14px\\]{margin-left:14px;margin-right:14px}.mx-\\[10px\\]{margin-left:10px;margin-right:10px}.mx-4{margin-left:1rem;margin-right:1rem}.mb-2{margin-bottom:.5rem}.mt-4{margin-top:1rem}.mr-2{margin-right:.5rem}.mb-3{margin-bottom:.75rem}.mr-3{margin-right:.75rem}.-mt-\\[10px\\]{margin-top:-10px}.mt-\\[100px\\]{margin-top:100px}.mb-14{margin-bottom:3.5rem}.mr-4{margin-right:1rem}.mt-36{margin-top:9rem}.mb-\\[60px\\]{margin-bottom:60px}.mb-16{margin-bottom:4rem}.mr-1{margin-right:.25rem}.mr-5{margin-right:1.25rem}.mb-4{margin-bottom:1rem}.mt-3{margin-top:.75rem}.mt-6{margin-top:1.5rem}.mb-1\\.5{margin-bottom:.375rem}.mb-1{margin-bottom:.25rem}.mr-3\\.5{margin-right:.875rem}.\\!mb-0{margin-bottom:0!important}.mt-\\[10px\\]{margin-top:10px}.ml-3{margin-left:.75rem}.mt-7{margin-top:1.75rem}.mb-24{margin-bottom:6rem}.mb-10{margin-bottom:2.5rem}.\\!mr-2{margin-right:.5rem!important}.block{display:block}.inline-block{display:inline-block}.flex{display:flex}.\\!flex{display:flex!important}.table{display:table}.hidden{display:none}.\\!h-\\[38px\\]{height:38px!important}.h-\\[30px\\]{height:30px}.h-7{height:1.75rem}.h-full{height:100%}.h-\\[70px\\]{height:70px}.h-\\[375px\\]{height:375px}.h-9{height:2.25rem}.h-14{height:3.5rem}.h-\\[178px\\]{height:178px}.h-\\[73px\\]{height:73px}.h-\\[22px\\]{height:22px}.h-\\[54px\\]{height:54px}.\\!h-4{height:1rem!important}.h-\\[94px\\]{height:94px}.h-\\[42px\\]{height:42px}.h-\\[138px\\]{height:138px}.h-\\[84px\\]{height:84px}.h-\\[168px\\]{height:168px}.h-\\[18px\\]{height:18px}.h-\\[68px\\]{height:68px}.h-\\[302px\\]{height:302px}.h-\\[175px\\]{height:175px}.h-\\[26px\\]{height:26px}.\\!h-auto{height:auto!important}.h-72{height:18rem}.\\!h-\\[70px\\]{height:70px!important}.h-\\[87px\\]{height:87px}.min-h-full{min-height:100%}.min-h-\\[280px\\]{min-height:280px}.w-1\\/4{width:25%}.w-28{width:7rem}.\\!w-40{width:10rem!important}.w-\\[30px\\]{width:30px}.w-full{width:100%}.w-8{width:2rem}.w-64{width:16rem}.w-\\[425px\\]{width:425px}.w-9{width:2.25rem}.w-14{width:3.5rem}.w-\\[178px\\]{width:178px}.w-\\[1200px\\]{width:1200px}.w-56{width:14rem}.w-\\[960px\\]{width:960px}.w-\\[388px\\]{width:388px}.w-\\[97px\\]{width:97px}.w-40{width:10rem}.w-\\[54px\\]{width:54px}.w-32{width:8rem}.w-\\[168px\\]{width:168px}.w-1\\/5{width:20%}.w-2\\/3{width:66.666667%}.w-1\\/2{width:50%}.w-1\\/3{width:33.333333%}.w-\\[262px\\]{width:262px}.w-24{width:6rem}.\\!w-36{width:9rem!important}.w-\\[296px\\]{width:296px}.w-\\[138px\\]{width:138px}.w-\\[90\\%\\]{width:90%}.w-16{width:4rem}.w-\\[18px\\]{width:18px}.w-7{width:1.75rem}.w-\\[68px\\]{width:68px}.w-\\[22px\\]{width:22px}.\\!w-full{width:100%!important}.w-\\[152px\\]{width:152px}.w-\\[100px\\]{width:100px}.w-\\[94px\\]{width:94px}.basis-1\\/2{flex-basis:50%}.basis-1\\/3{flex-basis:33.333333%}.cursor-pointer{cursor:pointer}.flex-row{flex-direction:row}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.justify-between{justify-content:space-between}.overflow-auto{overflow:auto}.overflow-hidden{overflow:hidden}.text-ellipsis{text-overflow:ellipsis}.whitespace-nowrap{white-space:nowrap}.rounded-sm{border-radius:.125rem}.rounded-full{border-radius:9999px}.rounded-\\[6px\\]{border-radius:6px}.rounded{border-radius:.25rem}.rounded-md{border-radius:.375rem}.rounded-xl{border-radius:.75rem}.rounded-lg{border-radius:.5rem}.border{border-width:1px}.border-2{border-width:2px}.border-b{border-bottom-width:1px}.border-r{border-right-width:1px}.border-t{border-top-width:1px}.border-solid{border-style:solid}.border-dashed{border-style:dashed}.\\!border-\\[\\#2DC7AA\\]{--tw-border-opacity: 1 !important;border-color:rgb(45 199 170 / var(--tw-border-opacity))!important}.border-neutral-200{--tw-border-opacity: 1;border-color:rgb(229 229 229 / var(--tw-border-opacity))}.border-\\[\\#f5f5f5\\]{--tw-border-opacity: 1;border-color:rgb(245 245 245 / var(--tw-border-opacity))}.border-\\[\\#EDEDED\\]{--tw-border-opacity: 1;border-color:rgb(237 237 237 / var(--tw-border-opacity))}.border-gray-300{--tw-border-opacity: 1;border-color:rgb(209 213 219 / var(--tw-border-opacity))}.border-b-\\[\\#E5E5E5\\]{--tw-border-opacity: 1;border-bottom-color:rgb(229 229 229 / var(--tw-border-opacity))}.border-b-\\[\\#F2F2F2\\]{--tw-border-opacity: 1;border-bottom-color:rgb(242 242 242 / var(--tw-border-opacity))}.border-t-\\[\\#E5E5E5\\]{--tw-border-opacity: 1;border-top-color:rgb(229 229 229 / var(--tw-border-opacity))}.border-t-\\[\\#EBEBEB\\]{--tw-border-opacity: 1;border-top-color:rgb(235 235 235 / var(--tw-border-opacity))}.bg-white{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}.bg-slate-600{--tw-bg-opacity: 1;background-color:rgb(71 85 105 / var(--tw-bg-opacity))}.bg-\\[\\#FAFAFA\\]{--tw-bg-opacity: 1;background-color:rgb(250 250 250 / var(--tw-bg-opacity))}.\\!bg-white{--tw-bg-opacity: 1 !important;background-color:rgb(255 255 255 / var(--tw-bg-opacity))!important}.bg-black{--tw-bg-opacity: 1;background-color:rgb(0 0 0 / var(--tw-bg-opacity))}.bg-black\\/40{background-color:rgba(0,0,0,.4)}.bg-opacity-75{--tw-bg-opacity: .75}.p-8{padding:2rem}.p-4{padding:1rem}.p-\\[14px\\]{padding:14px}.\\!px-12{padding-left:3rem!important;padding-right:3rem!important}.py-32{padding-top:8rem;padding-bottom:8rem}.px-9{padding-left:2.25rem;padding-right:2.25rem}.px-6{padding-left:1.5rem;padding-right:1.5rem}.px-\\[138px\\]{padding-left:138px;padding-right:138px}.px-10{padding-left:2.5rem;padding-right:2.5rem}.py-5{padding-top:1.25rem;padding-bottom:1.25rem}.py-3{padding-top:.75rem;padding-bottom:.75rem}.px-3{padding-left:.75rem;padding-right:.75rem}.py-4{padding-top:1rem;padding-bottom:1rem}.px-\\[14px\\]{padding-left:14px;padding-right:14px}.px-4{padding-left:1rem;padding-right:1rem}.px-\\[38px\\]{padding-left:38px;padding-right:38px}.py-3\\.5{padding-top:.875rem;padding-bottom:.875rem}.px-\\[190px\\]{padding-left:190px;padding-right:190px}.px-52{padding-left:13rem;padding-right:13rem}.py-2{padding-top:.5rem;padding-bottom:.5rem}.px-44{padding-left:11rem;padding-right:11rem}.px-\\[200px\\]{padding-left:200px;padding-right:200px}.py-1{padding-top:.25rem;padding-bottom:.25rem}.py-6{padding-top:1.5rem;padding-bottom:1.5rem}.px-\\[18px\\]{padding-left:18px;padding-right:18px}.px-\\[235px\\]{padding-left:235px;padding-right:235px}.px-8{padding-left:2rem;padding-right:2rem}.px-1{padding-left:.25rem;padding-right:.25rem}.py-\\[14px\\]{padding-top:14px;padding-bottom:14px}.px-\\[10px\\]{padding-left:10px;padding-right:10px}.px-\\[140px\\]{padding-left:140px;padding-right:140px}.px-72{padding-left:18rem;padding-right:18rem}.pt-2{padding-top:.5rem}.pt-1{padding-top:.25rem}.pt-4{padding-top:1rem}.pb-6{padding-bottom:1.5rem}.pt-9{padding-top:2.25rem}.pt-5{padding-top:1.25rem}.pb-12{padding-bottom:3rem}.pb-4{padding-bottom:1rem}.pb-8{padding-bottom:2rem}.pt-14{padding-top:3.5rem}.pb-2{padding-bottom:.5rem}.pt-24{padding-top:6rem}.pb-28{padding-bottom:7rem}.pb-5{padding-bottom:1.25rem}.pb-20{padding-bottom:5rem}.pb-11{padding-bottom:2.75rem}.pr-3{padding-right:.75rem}.pl-10{padding-left:2.5rem}.pb-3{padding-bottom:.75rem}.pl-3{padding-left:.75rem}.pr-5{padding-right:1.25rem}.pl-5{padding-left:1.25rem}.pr-1{padding-right:.25rem}.pr-16{padding-right:4rem}.pr-2{padding-right:.5rem}.pl-2\\.5{padding-left:.625rem}.pl-2{padding-left:.5rem}.pt-8{padding-top:2rem}.pt-2\\.5{padding-top:.625rem}.pt-12{padding-top:3rem}.pt-6{padding-top:1.5rem}.pb-7{padding-bottom:1.75rem}.pb-1\\.5{padding-bottom:.375rem}.pb-1{padding-bottom:.25rem}.pl-4{padding-left:1rem}.pr-4{padding-right:1rem}.pr-0{padding-right:0}.pt-\\[30px\\]{padding-top:30px}.pl-1{padding-left:.25rem}.pb-\\[2px\\]{padding-bottom:2px}.pt-3{padding-top:.75rem}.pb-10{padding-bottom:2.5rem}.pt-7{padding-top:1.75rem}.pl-\\[100px\\]{padding-left:100px}.pt-\\[10px\\]{padding-top:10px}.pb-24{padding-bottom:6rem}.text-left{text-align:left}.\\!text-center{text-align:center!important}.text-center{text-align:center}.text-justify{text-align:justify}.align-middle{vertical-align:middle}.text-base{font-size:1rem;line-height:1.5rem}.text-xl{font-size:1.25rem;line-height:1.75rem}.text-lg{font-size:1.125rem;line-height:1.75rem}.text-\\[28px\\]{font-size:28px}.text-2xl{font-size:1.5rem;line-height:2rem}.text-\\[14px\\]{font-size:14px}.text-sm{font-size:.875rem;line-height:1.25rem}.text-\\[16px\\]{font-size:16px}.text-\\[20px\\]{font-size:20px}.text-\\[15px\\]{font-size:15px}.text-\\[13px\\]{font-size:13px}.font-semibold{font-weight:600}.font-semibold{font-weight:500}.font-normal{font-weight:400}.leading-6{line-height:1.5rem}.leading-none{line-height:1}.leading-tight{line-height:1.25}.leading-\\[22px\\]{line-height:22px}.leading-5{line-height:1.25rem}.leading-relaxed{line-height:1.625}.text-\\[\\#999999\\],.text-\\[\\#999\\]{--tw-text-opacity: 1;color:rgb(153 153 153 / var(--tw-text-opacity))}.text-\\[\\#333\\]{--tw-text-opacity: 1;color:rgb(51 51 51 / var(--tw-text-opacity))}.text-\\[\\#666\\]{--tw-text-opacity: 1;color:rgb(102 102 102 / var(--tw-text-opacity))}.text-\\[\\#1A1A1A\\]{--tw-text-opacity: 1;color:rgb(26 26 26 / var(--tw-text-opacity))}.text-white{--tw-text-opacity: 1;color:rgb(255 255 255 / var(--tw-text-opacity))}.text-\\[\\#1a1a1a\\]{--tw-text-opacity: 1;color:rgb(26 26 26 / var(--tw-text-opacity))}.text-gray-500{--tw-text-opacity: 1;color:rgb(107 114 128 / var(--tw-text-opacity))}.text-slate-700{--tw-text-opacity: 1;color:rgb(51 65 85 / var(--tw-text-opacity))}.text-gray-400{--tw-text-opacity: 1;color:rgb(156 163 175 / var(--tw-text-opacity))}.text-black{--tw-text-opacity: 1;color:rgb(0 0 0 / var(--tw-text-opacity))}.text-\\[\\#2DC7AA\\]{--tw-text-opacity: 1;color:rgb(45 199 170 / var(--tw-text-opacity))}.text-\\[\\#FF4E19\\]{--tw-text-opacity: 1;color:rgb(255 78 25 / var(--tw-text-opacity))}.text-\\[\\#333333\\]{--tw-text-opacity: 1;color:rgb(51 51 51 / var(--tw-text-opacity))}.text-\\[\\#7A7A7A\\]{--tw-text-opacity: 1;color:rgb(122 122 122 / var(--tw-text-opacity))}.underline{-webkit-text-decoration-line:underline;text-decoration-line:underline}.shadow-lg{--tw-shadow: 0 10px 15px -3px rgb(0 0 0 / .1), 0 4px 6px -4px rgb(0 0 0 / .1);--tw-shadow-colored: 0 10px 15px -3px var(--tw-shadow-color), 0 4px 6px -4px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.blur{--tw-blur: blur(8px);filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.filter{filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)}.backdrop-blur-sm{--tw-backdrop-blur: blur(4px);-webkit-backdrop-filter:var(--tw-backdrop-blur) var(--tw-backdrop-brightness) var(--tw-backdrop-contrast) var(--tw-backdrop-grayscale) var(--tw-backdrop-hue-rotate) var(--tw-backdrop-invert) var(--tw-backdrop-opacity) var(--tw-backdrop-saturate) var(--tw-backdrop-sepia);backdrop-filter:var(--tw-backdrop-blur) var(--tw-backdrop-brightness) var(--tw-backdrop-contrast) var(--tw-backdrop-grayscale) var(--tw-backdrop-hue-rotate) var(--tw-backdrop-invert) var(--tw-backdrop-opacity) var(--tw-backdrop-saturate) var(--tw-backdrop-sepia)}.transition-all{transition-property:all;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}:root{--el-color-primary: #2DC7AA !important;--el-color-primary-light-3: #2DC7AF !important;--el-color-primary-light-5: #2FD8AC !important;--el-color-primary-light-7: #2FD8AC !important;--el-color-primary-light-8: #bbffef !important;--el-color-primary-light-9: #ecf9f6 !important;--el-color-primary-dark-2: #24ad93 !important;--searchbgColor:"#f6f7f8" !important}html{font-size:16px!important}body{background:#F6F7F8}.user-shadow{box-shadow:0 2px 7px rgba(0,0,0,.04)}::-webkit-scrollbar{width:8px;height:8px;background-color:#fff}::-webkit-scrollbar-track{-webkit-box-shadow:inset 0 0 8px rgba(0,0,0,0);background-color:#fff}::-webkit-scrollbar-thumb{-webkit-box-shadow:inset 0 0 8px rgba(0,0,0,0);background-color:#d5d5d5}.before\\:mr-3:before{content:var(--tw-content);margin-right:.75rem}.before\\:h-\\[18px\\]:before{content:var(--tw-content);height:18px}.before\\:border-l:before{content:var(--tw-content);border-left-width:1px}.before\\:border-l-\\[\\#E5E5E5\\]:before{content:var(--tw-content);--tw-border-opacity: 1;border-left-color:rgb(229 229 229 / var(--tw-border-opacity))}.after\\:m-auto:after{content:var(--tw-content);margin:auto}.after\\:mt-2:after{content:var(--tw-content);margin-top:.5rem}.after\\:block:after{content:var(--tw-content);display:block}.after\\:h-\\[3px\\]:after{content:var(--tw-content);height:3px}.after\\:w-4:after{content:var(--tw-content);width:1rem}.after\\:rounded-sm:after{content:var(--tw-content);border-radius:.125rem}.after\\:bg-\\[\\#2DC7AA\\]:after{content:var(--tw-content);--tw-bg-opacity: 1;background-color:rgb(45 199 170 / var(--tw-bg-opacity))}.last\\:mb-0:last-child{margin-bottom:0}.hover\\:\\!text-\\[\\#2DC7AA\\]:hover{--tw-text-opacity: 1 !important;color:rgb(45 199 170 / var(--tw-text-opacity))!important}.hover\\:shadow-md:hover{--tw-shadow: 0 4px 6px -1px rgb(0 0 0 / .1), 0 2px 4px -2px rgb(0 0 0 / .1);--tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.hover\\:drop-shadow-lg:hover{--tw-drop-shadow: drop-shadow(0 10px 8px rgb(0 0 0 / .04)) drop-shadow(0 4px 3px rgb(0 0 0 / .1));filter:var(--tw-blur) var(--tw-brightness) var(--tw-contrast) var(--tw-grayscale) var(--tw-hue-rotate) var(--tw-invert) var(--tw-saturate) var(--tw-sepia) var(--tw-drop-shadow)} `)(), normalize = (() => `/*! normalize.css v8.0.1 | MIT License | github.com/necolas/normalize.css */html{line-height:1.15;-webkit-text-size-adjust:100%}body{margin:0}main{display:block}h1{font-size:2em;margin:.67em 0}hr{box-sizing:content-box;height:0;overflow:visible}pre{font-family:monospace,monospace;font-size:1em}a{background-color:transparent}abbr[title]{border-bottom:none;text-decoration:underline;-webkit-text-decoration:underline dotted;text-decoration:underline dotted}b,strong{font-weight:bolder}code,kbd,samp{font-family:monospace,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}img{border-style:none}button,input,optgroup,select,textarea{font-family:inherit;font-size:100%;line-height:1.15;margin:0}button,input{overflow:visible}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button}button::-moz-focus-inner,[type=button]::-moz-focus-inner,[type=reset]::-moz-focus-inner,[type=submit]::-moz-focus-inner{border-style:none;padding:0}button:-moz-focusring,[type=button]:-moz-focusring,[type=reset]:-moz-focusring,[type=submit]:-moz-focusring{outline:1px dotted ButtonText}fieldset{padding:.35em .75em .625em}legend{box-sizing:border-box;color:inherit;display:table;max-width:100%;padding:0;white-space:normal}progress{vertical-align:baseline}textarea{overflow:auto}[type=checkbox],[type=radio]{box-sizing:border-box;padding:0}[type=number]::-webkit-inner-spin-button,[type=number]::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}details{display:block}summary{display:list-item}template{display:none}[hidden]{display:none} `)(), index = (() => `@charset "UTF-8";:root{--el-color-primary-rgb:64,158,255;--el-color-success-rgb:103,194,58;--el-color-warning-rgb:230,162,60;--el-color-danger-rgb:245,108,108;--el-color-error-rgb:245,108,108;--el-color-info-rgb:144,147,153;--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-family:"Helvetica Neue",Helvetica,"PingFang SC","Hiragino Sans GB","Microsoft YaHei","\\5fae\\8f6f\\96c5\\9ed1",Arial,sans-serif;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-transition-duration:.3s;--el-transition-duration-fast:.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(.645, .045, .355, 1);--el-transition-function-fast-bezier:cubic-bezier(.23, 1, .32, 1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-box-shadow:box-shadow var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-component-size-large:40px;--el-component-size:32px;--el-component-size-small:24px;color-scheme:light;--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary:#409eff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-primary-dark-2:#337ecc;--el-color-success:#67c23a;--el-color-success-light-3:#95d475;--el-color-success-light-5:#b3e19d;--el-color-success-light-7:#d1edc4;--el-color-success-light-8:#e1f3d8;--el-color-success-light-9:#f0f9eb;--el-color-success-dark-2:#529b2e;--el-color-warning:#e6a23c;--el-color-warning-light-3:#eebe77;--el-color-warning-light-5:#f3d19e;--el-color-warning-light-7:#f8e3c5;--el-color-warning-light-8:#faecd8;--el-color-warning-light-9:#fdf6ec;--el-color-warning-dark-2:#b88230;--el-color-danger:#f56c6c;--el-color-danger-light-3:#f89898;--el-color-danger-light-5:#fab6b6;--el-color-danger-light-7:#fcd3d3;--el-color-danger-light-8:#fde2e2;--el-color-danger-light-9:#fef0f0;--el-color-danger-dark-2:#c45656;--el-color-error:#f56c6c;--el-color-error-light-3:#f89898;--el-color-error-light-5:#fab6b6;--el-color-error-light-7:#fcd3d3;--el-color-error-light-8:#fde2e2;--el-color-error-light-9:#fef0f0;--el-color-error-dark-2:#c45656;--el-color-info:#909399;--el-color-info-light-3:#b1b3b8;--el-color-info-light-5:#c8c9cc;--el-color-info-light-7:#dedfe0;--el-color-info-light-8:#e9e9eb;--el-color-info-light-9:#f4f4f5;--el-color-info-dark-2:#73767a;--el-bg-color:#ffffff;--el-bg-color-page:#f2f3f5;--el-bg-color-overlay:#ffffff;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#a8abb2;--el-text-color-disabled:#c0c4cc;--el-border-color:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-color-dark:#d4d7de;--el-border-color-darker:#cdd0d6;--el-fill-color:#f0f2f5;--el-fill-color-light:#f5f7fa;--el-fill-color-lighter:#fafafa;--el-fill-color-extra-light:#fafcff;--el-fill-color-dark:#ebedf0;--el-fill-color-darker:#e6e8eb;--el-fill-color-blank:#ffffff;--el-box-shadow:0px 12px 32px 4px rgba(0, 0, 0, .04),0px 8px 20px rgba(0, 0, 0, .08);--el-box-shadow-light:0px 0px 12px rgba(0, 0, 0, .12);--el-box-shadow-lighter:0px 0px 6px rgba(0, 0, 0, .12);--el-box-shadow-dark:0px 16px 48px 16px rgba(0, 0, 0, .08),0px 12px 32px rgba(0, 0, 0, .12),0px 8px 16px -8px rgba(0, 0, 0, .16);--el-disabled-bg-color:var(--el-fill-color-light);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-overlay-color:rgba(0, 0, 0, .8);--el-overlay-color-light:rgba(0, 0, 0, .7);--el-overlay-color-lighter:rgba(0, 0, 0, .5);--el-mask-color:rgba(255, 255, 255, .9);--el-mask-color-extra-light:rgba(255, 255, 255, .3);--el-border-width:1px;--el-border-style:solid;--el-border-color-hover:var(--el-text-color-disabled);--el-border:var(--el-border-width) var(--el-border-style) var(--el-border-color);--el-svg-monochrome-grey:var(--el-border-color)}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-to{opacity:0;transform:translateY(-30px)}.el-list-leave-active{position:absolute!important}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotate(0)}to{transform:rotate(360deg)}}.el-icon{--color:inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}.el-affix--fixed{position:fixed}.el-alert{--el-alert-padding:8px 16px;--el-alert-border-radius-base:var(--el-border-radius-base);--el-alert-title-font-size:13px;--el-alert-description-font-size:12px;--el-alert-close-font-size:12px;--el-alert-close-customed-font-size:13px;--el-alert-icon-size:16px;--el-alert-icon-large-size:28px;width:100%;padding:var(--el-alert-padding);margin:0;box-sizing:border-box;border-radius:var(--el-alert-border-radius-base);position:relative;background-color:var(--el-color-white);overflow:hidden;opacity:1;display:flex;align-items:center;transition:opacity var(--el-transition-duration-fast)}.el-alert.is-light .el-alert__close-btn{color:var(--el-text-color-placeholder)}.el-alert.is-dark .el-alert__close-btn,.el-alert.is-dark .el-alert__description{color:var(--el-color-white)}.el-alert.is-center{justify-content:center}.el-alert--success{--el-alert-bg-color:var(--el-color-success-light-9)}.el-alert--success.is-light{background-color:var(--el-alert-bg-color);color:var(--el-color-success)}.el-alert--success.is-light .el-alert__description{color:var(--el-color-success)}.el-alert--success.is-dark{background-color:var(--el-color-success);color:var(--el-color-white)}.el-alert--info{--el-alert-bg-color:var(--el-color-info-light-9)}.el-alert--info.is-light{background-color:var(--el-alert-bg-color);color:var(--el-color-info)}.el-alert--info.is-light .el-alert__description{color:var(--el-color-info)}.el-alert--info.is-dark{background-color:var(--el-color-info);color:var(--el-color-white)}.el-alert--warning{--el-alert-bg-color:var(--el-color-warning-light-9)}.el-alert--warning.is-light{background-color:var(--el-alert-bg-color);color:var(--el-color-warning)}.el-alert--warning.is-light .el-alert__description{color:var(--el-color-warning)}.el-alert--warning.is-dark{background-color:var(--el-color-warning);color:var(--el-color-white)}.el-alert--error{--el-alert-bg-color:var(--el-color-error-light-9)}.el-alert--error.is-light{background-color:var(--el-alert-bg-color);color:var(--el-color-error)}.el-alert--error.is-light .el-alert__description{color:var(--el-color-error)}.el-alert--error.is-dark{background-color:var(--el-color-error);color:var(--el-color-white)}.el-alert__content{display:table-cell;padding:0 8px}.el-alert .el-alert__icon{font-size:var(--el-alert-icon-size);width:var(--el-alert-icon-size)}.el-alert .el-alert__icon.is-big{font-size:var(--el-alert-icon-large-size);width:var(--el-alert-icon-large-size)}.el-alert__title{font-size:var(--el-alert-title-font-size);line-height:18px;vertical-align:text-top}.el-alert__title.is-bold{font-weight:700}.el-alert .el-alert__description{font-size:var(--el-alert-description-font-size);margin:5px 0 0}.el-alert .el-alert__close-btn{font-size:var(--el-alert-close-font-size);opacity:1;position:absolute;top:12px;right:15px;cursor:pointer}.el-alert .el-alert__close-btn.is-customed{font-style:normal;font-size:var(--el-alert-close-customed-font-size);top:9px}.el-alert-fade-enter-from,.el-alert-fade-leave-active{opacity:0}.el-aside{overflow:auto;box-sizing:border-box;flex-shrink:0;width:var(--el-aside-width,300px)}.el-autocomplete{position:relative;display:inline-block}.el-autocomplete__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-box-shadow-light)}.el-autocomplete__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-autocomplete__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-autocomplete__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-autocomplete__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-autocomplete__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-autocomplete-suggestion{border-radius:var(--el-border-radius-base);box-sizing:border-box}.el-autocomplete-suggestion__wrap{max-height:280px;padding:10px 0;box-sizing:border-box}.el-autocomplete-suggestion__list{margin:0;padding:0}.el-autocomplete-suggestion li{padding:0 20px;margin:0;line-height:34px;cursor:pointer;color:var(--el-text-color-regular);font-size:var(--el-font-size-base);list-style:none;text-align:left;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.el-autocomplete-suggestion li:hover,.el-autocomplete-suggestion li.highlighted{background-color:var(--el-fill-color-light)}.el-autocomplete-suggestion li.divider{margin-top:6px;border-top:1px solid var(--el-color-black)}.el-autocomplete-suggestion li.divider:last-child{margin-bottom:-6px}.el-autocomplete-suggestion.is-loading li{text-align:center;height:100px;line-height:100px;font-size:20px;color:var(--el-text-color-secondary)}.el-autocomplete-suggestion.is-loading li:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-autocomplete-suggestion.is-loading li:hover{background-color:var(--el-bg-color-overlay)}.el-autocomplete-suggestion.is-loading .el-icon-loading{vertical-align:middle}.el-avatar{--el-avatar-text-color:var(--el-color-white);--el-avatar-bg-color:var(--el-text-color-disabled);--el-avatar-text-size:14px;--el-avatar-icon-size:18px;--el-avatar-border-radius:var(--el-border-radius-base);--el-avatar-size-large:56px;--el-avatar-size-small:24px;--el-avatar-size:40px;display:inline-flex;justify-content:center;align-items:center;box-sizing:border-box;text-align:center;overflow:hidden;color:var(--el-avatar-text-color);background:var(--el-avatar-bg-color);width:var(--el-avatar-size);height:var(--el-avatar-size);font-size:var(--el-avatar-text-size)}.el-avatar>img{display:block;height:100%}.el-avatar--circle{border-radius:50%}.el-avatar--square{border-radius:var(--el-avatar-border-radius)}.el-avatar--icon{font-size:var(--el-avatar-icon-size)}.el-avatar--small{--el-avatar-size:24px}.el-avatar--large{--el-avatar-size:56px}.el-backtop{--el-backtop-bg-color:var(--el-bg-color-overlay);--el-backtop-text-color:var(--el-color-primary);--el-backtop-hover-bg-color:var(--el-border-color-extra-light);position:fixed;background-color:var(--el-backtop-bg-color);width:40px;height:40px;border-radius:50%;color:var(--el-backtop-text-color);display:flex;align-items:center;justify-content:center;font-size:20px;box-shadow:var(--el-box-shadow-lighter);cursor:pointer;z-index:5}.el-backtop:hover{background-color:var(--el-backtop-hover-bg-color)}.el-backtop__icon{font-size:20px}.el-badge{--el-badge-bg-color:var(--el-color-danger);--el-badge-radius:10px;--el-badge-font-size:12px;--el-badge-padding:6px;--el-badge-size:18px;position:relative;vertical-align:middle;display:inline-block}.el-badge__content{background-color:var(--el-badge-bg-color);border-radius:var(--el-badge-radius);color:var(--el-color-white);display:inline-flex;justify-content:center;align-items:center;font-size:var(--el-badge-font-size);height:var(--el-badge-size);padding:0 var(--el-badge-padding);white-space:nowrap;border:1px solid var(--el-bg-color)}.el-badge__content.is-fixed{position:absolute;top:0;right:calc(1px + var(--el-badge-size)/ 2);transform:translateY(-50%) translate(100%)}.el-badge__content.is-fixed.is-dot{right:5px}.el-badge__content.is-dot{height:8px;width:8px;padding:0;right:0;border-radius:50%}.el-badge__content--primary{background-color:var(--el-color-primary)}.el-badge__content--success{background-color:var(--el-color-success)}.el-badge__content--warning{background-color:var(--el-color-warning)}.el-badge__content--info{background-color:var(--el-color-info)}.el-badge__content--danger{background-color:var(--el-color-danger)}.el-breadcrumb{font-size:14px;line-height:1}.el-breadcrumb:after,.el-breadcrumb:before{display:table;content:""}.el-breadcrumb:after{clear:both}.el-breadcrumb__separator{margin:0 9px;font-weight:700;color:var(--el-text-color-placeholder)}.el-breadcrumb__separator.el-icon{margin:0 6px;font-weight:400}.el-breadcrumb__separator.el-icon svg{vertical-align:middle}.el-breadcrumb__item{float:left;display:flex;align-items:center}.el-breadcrumb__inner{color:var(--el-text-color-regular)}.el-breadcrumb__inner a,.el-breadcrumb__inner.is-link{font-weight:700;text-decoration:none;transition:var(--el-transition-color);color:var(--el-text-color-primary)}.el-breadcrumb__inner a:hover,.el-breadcrumb__inner.is-link:hover{color:var(--el-color-primary);cursor:pointer}.el-breadcrumb__item:last-child .el-breadcrumb__inner,.el-breadcrumb__item:last-child .el-breadcrumb__inner a,.el-breadcrumb__item:last-child .el-breadcrumb__inner a:hover,.el-breadcrumb__item:last-child .el-breadcrumb__inner:hover{font-weight:400;color:var(--el-text-color-regular);cursor:text}.el-breadcrumb__item:last-child .el-breadcrumb__separator{display:none}.el-button-group{display:inline-block;vertical-align:middle}.el-button-group:after,.el-button-group:before{display:table;content:""}.el-button-group:after{clear:both}.el-button-group>.el-button{float:left;position:relative}.el-button-group>.el-button+.el-button{margin-left:0}.el-button-group>.el-button:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.el-button-group>.el-button:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.el-button-group>.el-button:first-child:last-child{border-top-right-radius:var(--el-border-radius-base);border-bottom-right-radius:var(--el-border-radius-base);border-top-left-radius:var(--el-border-radius-base);border-bottom-left-radius:var(--el-border-radius-base)}.el-button-group>.el-button:first-child:last-child.is-round{border-radius:var(--el-border-radius-round)}.el-button-group>.el-button:first-child:last-child.is-circle{border-radius:50%}.el-button-group>.el-button:not(:first-child):not(:last-child){border-radius:0}.el-button-group>.el-button:not(:last-child){margin-right:-1px}.el-button-group>.el-button:active,.el-button-group>.el-button:focus,.el-button-group>.el-button:hover{z-index:1}.el-button-group>.el-button.is-active{z-index:1}.el-button-group>.el-dropdown>.el-button{border-top-left-radius:0;border-bottom-left-radius:0;border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color);--el-button-bg-color:var(--el-fill-color-blank);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-fill-color-blank);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255, 255, 255, .5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color);display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;color:var(--el-button-text-color);text-align:center;box-sizing:border-box;outline:0;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;user-select:none;vertical-align:middle;-webkit-appearance:none;background-color:var(--el-button-bg-color);border:var(--el-border);border-color:var(--el-button-border-color);padding:8px 15px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button:focus,.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color);background-color:var(--el-button-hover-bg-color);outline:0}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button:focus-visible{border-color:transparent;outline:2px solid var(--el-button-border-color);outline-offset:1px}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-fill-color-blank);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button.is-disabled,.el-button.is-disabled:focus,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{z-index:1;pointer-events:none;content:"";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:var(--el-mask-color-extra-light)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px}.el-button.is-text{color:var(--el-button-text-color);border:0 solid transparent;background-color:transparent}.el-button.is-text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important}.el-button.is-text:not(.is-disabled):focus,.el-button.is-text:not(.is-disabled):hover{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled):focus-visible{border-color:transparent;outline:2px solid var(--el-button-border-color);outline-offset:1px}.el-button.is-text:not(.is-disabled):active{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg{background-color:var(--el-fill-color-light)}.el-button.is-text:not(.is-disabled).is-has-bg:hover{background-color:var(--el-fill-color)}.el-button.is-text:not(.is-disabled).is-has-bg:active{background-color:var(--el-fill-color-dark)}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button.is-link{border-color:transparent;color:var(--el-button-text-color);background:0 0;padding-left:0;padding-right:0;outline:0;outline-offset:0}.el-button.is-link:hover{color:var(--el-button-hover-link-text-color)}.el-button.is-link.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button.is-link:not(.is-disabled):focus,.el-button.is-link:not(.is-disabled):hover{border-color:transparent;background-color:transparent}.el-button.is-link:not(.is-disabled):active{border-color:transparent;background-color:transparent}.el-button--text{border-color:transparent;background:0 0;color:var(--el-color-primary);padding-left:0;padding-right:0}.el-button--text.is-disabled{color:var(--el-button-disabled-text-color);background-color:transparent!important;border-color:transparent!important}.el-button--text:not(.is-disabled):focus,.el-button--text:not(.is-disabled):hover{color:var(--el-color-primary-light-3);border-color:transparent;background-color:transparent}.el-button--text:not(.is-disabled):active{color:var(--el-color-primary-dark-2);border-color:transparent;background-color:transparent}.el-button__link--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-primary);--el-button-border-color:var(--el-color-primary);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-primary-light-5);--el-button-hover-bg-color:var(--el-color-primary-light-3);--el-button-hover-border-color:var(--el-color-primary-light-3);--el-button-active-bg-color:var(--el-color-primary-dark-2);--el-button-active-border-color:var(--el-color-primary-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-primary-light-5);--el-button-disabled-border-color:var(--el-color-primary-light-5)}.el-button--primary.is-link,.el-button--primary.is-plain,.el-button--primary.is-text{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:var(--el-color-primary-light-9);--el-button-border-color:var(--el-color-primary-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white)}.el-button--primary.is-link.is-disabled,.el-button--primary.is-link.is-disabled:active,.el-button--primary.is-link.is-disabled:focus,.el-button--primary.is-link.is-disabled:hover,.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover,.el-button--primary.is-text.is-disabled,.el-button--primary.is-text.is-disabled:active,.el-button--primary.is-text.is-disabled:focus,.el-button--primary.is-text.is-disabled:hover{color:var(--el-color-primary-light-5);background-color:var(--el-color-primary-light-9);border-color:var(--el-color-primary-light-8)}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-success);--el-button-border-color:var(--el-color-success);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-success-light-5);--el-button-hover-bg-color:var(--el-color-success-light-3);--el-button-hover-border-color:var(--el-color-success-light-3);--el-button-active-bg-color:var(--el-color-success-dark-2);--el-button-active-border-color:var(--el-color-success-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-success-light-5);--el-button-disabled-border-color:var(--el-color-success-light-5)}.el-button--success.is-link,.el-button--success.is-plain,.el-button--success.is-text{--el-button-text-color:var(--el-color-success);--el-button-bg-color:var(--el-color-success-light-9);--el-button-border-color:var(--el-color-success-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white)}.el-button--success.is-link.is-disabled,.el-button--success.is-link.is-disabled:active,.el-button--success.is-link.is-disabled:focus,.el-button--success.is-link.is-disabled:hover,.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover,.el-button--success.is-text.is-disabled,.el-button--success.is-text.is-disabled:active,.el-button--success.is-text.is-disabled:focus,.el-button--success.is-text.is-disabled:hover{color:var(--el-color-success-light-5);background-color:var(--el-color-success-light-9);border-color:var(--el-color-success-light-8)}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-warning);--el-button-border-color:var(--el-color-warning);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-warning-light-5);--el-button-hover-bg-color:var(--el-color-warning-light-3);--el-button-hover-border-color:var(--el-color-warning-light-3);--el-button-active-bg-color:var(--el-color-warning-dark-2);--el-button-active-border-color:var(--el-color-warning-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-warning-light-5);--el-button-disabled-border-color:var(--el-color-warning-light-5)}.el-button--warning.is-link,.el-button--warning.is-plain,.el-button--warning.is-text{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:var(--el-color-warning-light-9);--el-button-border-color:var(--el-color-warning-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white)}.el-button--warning.is-link.is-disabled,.el-button--warning.is-link.is-disabled:active,.el-button--warning.is-link.is-disabled:focus,.el-button--warning.is-link.is-disabled:hover,.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover,.el-button--warning.is-text.is-disabled,.el-button--warning.is-text.is-disabled:active,.el-button--warning.is-text.is-disabled:focus,.el-button--warning.is-text.is-disabled:hover{color:var(--el-color-warning-light-5);background-color:var(--el-color-warning-light-9);border-color:var(--el-color-warning-light-8)}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-danger);--el-button-border-color:var(--el-color-danger);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-danger-light-5);--el-button-hover-bg-color:var(--el-color-danger-light-3);--el-button-hover-border-color:var(--el-color-danger-light-3);--el-button-active-bg-color:var(--el-color-danger-dark-2);--el-button-active-border-color:var(--el-color-danger-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-danger-light-5);--el-button-disabled-border-color:var(--el-color-danger-light-5)}.el-button--danger.is-link,.el-button--danger.is-plain,.el-button--danger.is-text{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:var(--el-color-danger-light-9);--el-button-border-color:var(--el-color-danger-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white)}.el-button--danger.is-link.is-disabled,.el-button--danger.is-link.is-disabled:active,.el-button--danger.is-link.is-disabled:focus,.el-button--danger.is-link.is-disabled:hover,.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover,.el-button--danger.is-text.is-disabled,.el-button--danger.is-text.is-disabled:active,.el-button--danger.is-text.is-disabled:focus,.el-button--danger.is-text.is-disabled:hover{color:var(--el-color-danger-light-5);background-color:var(--el-color-danger-light-9);border-color:var(--el-color-danger-light-8)}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-bg-color:var(--el-color-info);--el-button-border-color:var(--el-color-info);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-link-text-color:var(--el-color-info-light-5);--el-button-hover-bg-color:var(--el-color-info-light-3);--el-button-hover-border-color:var(--el-color-info-light-3);--el-button-active-bg-color:var(--el-color-info-dark-2);--el-button-active-border-color:var(--el-color-info-dark-2);--el-button-disabled-text-color:var(--el-color-white);--el-button-disabled-bg-color:var(--el-color-info-light-5);--el-button-disabled-border-color:var(--el-color-info-light-5)}.el-button--info.is-link,.el-button--info.is-plain,.el-button--info.is-text{--el-button-text-color:var(--el-color-info);--el-button-bg-color:var(--el-color-info-light-9);--el-button-border-color:var(--el-color-info-light-5);--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white)}.el-button--info.is-link.is-disabled,.el-button--info.is-link.is-disabled:active,.el-button--info.is-link.is-disabled:focus,.el-button--info.is-link.is-disabled:hover,.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover,.el-button--info.is-text.is-disabled,.el-button--info.is-text.is-disabled:active,.el-button--info.is-text.is-disabled:focus,.el-button--info.is-text.is-disabled:hover{color:var(--el-color-info-light-5);background-color:var(--el-color-info-light-9);border-color:var(--el-color-info-light-8)}.el-button--large{--el-button-size:40px;height:var(--el-button-size);padding:12px 19px;font-size:var(--el-font-size-base);border-radius:var(--el-border-radius-base)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size:24px;height:var(--el-button-size);padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}.el-calendar{--el-calendar-border:var(--el-table-border, 1px solid var(--el-border-color-lighter));--el-calendar-header-border-bottom:var(--el-calendar-border);--el-calendar-selected-bg-color:var(--el-color-primary-light-9);--el-calendar-cell-width:85px;background-color:var(--el-fill-color-blank)}.el-calendar__header{display:flex;justify-content:space-between;padding:12px 20px;border-bottom:var(--el-calendar-header-border-bottom)}.el-calendar__title{color:var(--el-text-color);align-self:center}.el-calendar__body{padding:12px 20px 35px}.el-calendar-table{table-layout:fixed;width:100%}.el-calendar-table thead th{padding:12px 0;color:var(--el-text-color-regular);font-weight:400}.el-calendar-table:not(.is-range) td.next,.el-calendar-table:not(.is-range) td.prev{color:var(--el-text-color-placeholder)}.el-calendar-table td{border-bottom:var(--el-calendar-border);border-right:var(--el-calendar-border);vertical-align:top;transition:background-color var(--el-transition-duration-fast) ease}.el-calendar-table td.is-selected{background-color:var(--el-calendar-selected-bg-color)}.el-calendar-table td.is-today{color:var(--el-color-primary)}.el-calendar-table tr:first-child td{border-top:var(--el-calendar-border)}.el-calendar-table tr td:first-child{border-left:var(--el-calendar-border)}.el-calendar-table tr.el-calendar-table__row--hide-border td{border-top:none}.el-calendar-table .el-calendar-day{box-sizing:border-box;padding:8px;height:var(--el-calendar-cell-width)}.el-calendar-table .el-calendar-day:hover{cursor:pointer;background-color:var(--el-calendar-selected-bg-color)}.el-card{--el-card-border-color:var(--el-border-color-light);--el-card-border-radius:4px;--el-card-padding:20px;--el-card-bg-color:var(--el-fill-color-blank);border-radius:var(--el-card-border-radius);border:1px solid var(--el-card-border-color);background-color:var(--el-card-bg-color);overflow:hidden;color:var(--el-text-color-primary);transition:var(--el-transition-duration)}.el-card.is-always-shadow{box-shadow:var(--el-box-shadow-light)}.el-card.is-hover-shadow:focus,.el-card.is-hover-shadow:hover{box-shadow:var(--el-box-shadow-light)}.el-card__header{padding:calc(var(--el-card-padding) - 2px) var(--el-card-padding);border-bottom:1px solid var(--el-card-border-color);box-sizing:border-box}.el-card__body{padding:var(--el-card-padding)}.el-carousel__item{position:absolute;top:0;left:0;width:100%;height:100%;display:inline-block;overflow:hidden;z-index:calc(var(--el-index-normal) - 1)}.el-carousel__item.is-active{z-index:calc(var(--el-index-normal) - 1)}.el-carousel__item.is-animating{transition:transform .4s ease-in-out}.el-carousel__item--card{width:50%;transition:transform .4s ease-in-out}.el-carousel__item--card.is-in-stage{cursor:pointer;z-index:var(--el-index-normal)}.el-carousel__item--card.is-in-stage.is-hover .el-carousel__mask,.el-carousel__item--card.is-in-stage:hover .el-carousel__mask{opacity:.12}.el-carousel__item--card.is-active{z-index:calc(var(--el-index-normal) + 1)}.el-carousel__mask{position:absolute;width:100%;height:100%;top:0;left:0;background-color:var(--el-color-white);opacity:.24;transition:var(--el-transition-duration-fast)}.el-carousel{--el-carousel-arrow-font-size:12px;--el-carousel-arrow-size:36px;--el-carousel-arrow-background:rgba(31, 45, 61, .11);--el-carousel-arrow-hover-background:rgba(31, 45, 61, .23);--el-carousel-indicator-width:30px;--el-carousel-indicator-height:2px;--el-carousel-indicator-padding-horizontal:4px;--el-carousel-indicator-padding-vertical:12px;--el-carousel-indicator-out-color:var(--el-border-color-hover);position:relative}.el-carousel--horizontal{overflow-x:hidden}.el-carousel--vertical{overflow-y:hidden}.el-carousel__container{position:relative;height:300px}.el-carousel__arrow{border:none;outline:0;padding:0;margin:0;height:var(--el-carousel-arrow-size);width:var(--el-carousel-arrow-size);cursor:pointer;transition:var(--el-transition-duration);border-radius:50%;background-color:var(--el-carousel-arrow-background);color:#fff;position:absolute;top:50%;z-index:10;transform:translateY(-50%);text-align:center;font-size:var(--el-carousel-arrow-font-size);display:inline-flex;justify-content:center;align-items:center}.el-carousel__arrow--left{left:16px}.el-carousel__arrow--right{right:16px}.el-carousel__arrow:hover{background-color:var(--el-carousel-arrow-hover-background)}.el-carousel__arrow i{cursor:pointer}.el-carousel__indicators{position:absolute;list-style:none;margin:0;padding:0;z-index:calc(var(--el-index-normal) + 1)}.el-carousel__indicators--horizontal{bottom:0;left:50%;transform:translate(-50%)}.el-carousel__indicators--vertical{right:0;top:50%;transform:translateY(-50%)}.el-carousel__indicators--outside{bottom:calc(var(--el-carousel-indicator-height) + var(--el-carousel-indicator-padding-vertical) * 2);text-align:center;position:static;transform:none}.el-carousel__indicators--outside .el-carousel__indicator:hover button{opacity:.64}.el-carousel__indicators--outside button{background-color:var(--el-carousel-indicator-out-color);opacity:.24}.el-carousel__indicators--labels{left:0;right:0;transform:none;text-align:center}.el-carousel__indicators--labels .el-carousel__button{height:auto;width:auto;padding:2px 18px;font-size:12px}.el-carousel__indicators--labels .el-carousel__indicator{padding:6px 4px}.el-carousel__indicator{background-color:transparent;cursor:pointer}.el-carousel__indicator:hover button{opacity:.72}.el-carousel__indicator--horizontal{display:inline-block;padding:var(--el-carousel-indicator-padding-vertical) var(--el-carousel-indicator-padding-horizontal)}.el-carousel__indicator--vertical{padding:var(--el-carousel-indicator-padding-horizontal) var(--el-carousel-indicator-padding-vertical)}.el-carousel__indicator--vertical .el-carousel__button{width:var(--el-carousel-indicator-height);height:calc(var(--el-carousel-indicator-width)/ 2)}.el-carousel__indicator.is-active button{opacity:1}.el-carousel__button{display:block;opacity:.48;width:var(--el-carousel-indicator-width);height:var(--el-carousel-indicator-height);background-color:#fff;border:none;outline:0;padding:0;margin:0;cursor:pointer;transition:var(--el-transition-duration)}.carousel-arrow-left-enter-from,.carousel-arrow-left-leave-active{transform:translateY(-50%) translate(-10px);opacity:0}.carousel-arrow-right-enter-from,.carousel-arrow-right-leave-active{transform:translateY(-50%) translate(10px);opacity:0}.el-cascader-panel{--el-cascader-menu-text-color:var(--el-text-color-regular);--el-cascader-menu-selected-text-color:var(--el-color-primary);--el-cascader-menu-fill:var(--el-bg-color-overlay);--el-cascader-menu-font-size:var(--el-font-size-base);--el-cascader-menu-radius:var(--el-border-radius-base);--el-cascader-menu-border:solid 1px var(--el-border-color-light);--el-cascader-menu-shadow:var(--el-box-shadow-light);--el-cascader-node-background-hover:var(--el-fill-color-light);--el-cascader-node-color-disabled:var(--el-text-color-placeholder);--el-cascader-color-empty:var(--el-text-color-placeholder);--el-cascader-tag-background:var(--el-fill-color);display:flex;border-radius:var(--el-cascader-menu-radius);font-size:var(--el-cascader-menu-font-size)}.el-cascader-panel.is-bordered{border:var(--el-cascader-menu-border);border-radius:var(--el-cascader-menu-radius)}.el-cascader-menu{min-width:180px;box-sizing:border-box;color:var(--el-cascader-menu-text-color);border-right:var(--el-cascader-menu-border)}.el-cascader-menu:last-child{border-right:none}.el-cascader-menu:last-child .el-cascader-node{padding-right:20px}.el-cascader-menu__wrap.el-scrollbar__wrap{height:204px}.el-cascader-menu__list{position:relative;min-height:100%;margin:0;padding:6px 0;list-style:none;box-sizing:border-box}.el-cascader-menu__hover-zone{position:absolute;top:0;left:0;width:100%;height:100%;pointer-events:none}.el-cascader-menu__empty-text{position:absolute;top:50%;left:50%;transform:translate(-50%,-50%);display:flex;align-items:center;color:var(--el-cascader-color-empty)}.el-cascader-menu__empty-text .is-loading{margin-right:2px}.el-cascader-node{position:relative;display:flex;align-items:center;padding:0 30px 0 20px;height:34px;line-height:34px;outline:0}.el-cascader-node.is-selectable.in-active-path{color:var(--el-cascader-menu-text-color)}.el-cascader-node.in-active-path,.el-cascader-node.is-active,.el-cascader-node.is-selectable.in-checked-path{color:var(--el-cascader-menu-selected-text-color);font-weight:700}.el-cascader-node:not(.is-disabled){cursor:pointer}.el-cascader-node:not(.is-disabled):focus,.el-cascader-node:not(.is-disabled):hover{background:var(--el-cascader-node-background-hover)}.el-cascader-node.is-disabled{color:var(--el-cascader-node-color-disabled);cursor:not-allowed}.el-cascader-node__prefix{position:absolute;left:10px}.el-cascader-node__postfix{position:absolute;right:10px}.el-cascader-node__label{flex:1;text-align:left;padding:0 8px;white-space:nowrap;overflow:hidden;text-overflow:ellipsis}.el-cascader-node>.el-radio{margin-right:0}.el-cascader-node>.el-radio .el-radio__label{padding-left:0}.el-cascader{--el-cascader-menu-text-color:var(--el-text-color-regular);--el-cascader-menu-selected-text-color:var(--el-color-primary);--el-cascader-menu-fill:var(--el-bg-color-overlay);--el-cascader-menu-font-size:var(--el-font-size-base);--el-cascader-menu-radius:var(--el-border-radius-base);--el-cascader-menu-border:solid 1px var(--el-border-color-light);--el-cascader-menu-shadow:var(--el-box-shadow-light);--el-cascader-node-background-hover:var(--el-fill-color-light);--el-cascader-node-color-disabled:var(--el-text-color-placeholder);--el-cascader-color-empty:var(--el-text-color-placeholder);--el-cascader-tag-background:var(--el-fill-color);display:inline-block;position:relative;font-size:var(--el-font-size-base);line-height:32px;outline:0}.el-cascader:not(.is-disabled):hover .el-input__wrapper{cursor:pointer;box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-cascader .el-input{cursor:pointer}.el-cascader .el-input .el-input__inner{text-overflow:ellipsis;cursor:pointer}.el-cascader .el-input .el-input__inner::selection{outline:0}.el-cascader .el-input .el-input__suffix-inner .el-icon{height:calc(100% - 2px)}.el-cascader .el-input .el-input__suffix-inner .el-icon svg{vertical-align:middle}.el-cascader .el-input .icon-arrow-down{transition:transform var(--el-transition-duration);font-size:14px}.el-cascader .el-input .icon-arrow-down.is-reverse{transform:rotate(180deg)}.el-cascader .el-input .icon-circle-close:hover{color:var(--el-input-clear-hover-color,var(--el-text-color-secondary))}.el-cascader .el-input.is-focus .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color,var(--el-color-primary)) inset}.el-cascader--large{font-size:14px;line-height:40px}.el-cascader--small{font-size:12px;line-height:24px}.el-cascader.is-disabled .el-cascader__label{z-index:calc(var(--el-index-normal) + 1);color:var(--el-disabled-text-color)}.el-cascader__dropdown{--el-cascader-menu-text-color:var(--el-text-color-regular);--el-cascader-menu-selected-text-color:var(--el-color-primary);--el-cascader-menu-fill:var(--el-bg-color-overlay);--el-cascader-menu-font-size:var(--el-font-size-base);--el-cascader-menu-radius:var(--el-border-radius-base);--el-cascader-menu-border:solid 1px var(--el-border-color-light);--el-cascader-menu-shadow:var(--el-box-shadow-light);--el-cascader-node-background-hover:var(--el-fill-color-light);--el-cascader-node-color-disabled:var(--el-text-color-placeholder);--el-cascader-color-empty:var(--el-text-color-placeholder);--el-cascader-tag-background:var(--el-fill-color);font-size:var(--el-cascader-menu-font-size);border-radius:var(--el-cascader-menu-radius)}.el-cascader__dropdown.el-popper{background:var(--el-cascader-menu-fill);border:var(--el-cascader-menu-border);box-shadow:var(--el-cascader-menu-shadow)}.el-cascader__dropdown.el-popper .el-popper__arrow:before{border:var(--el-cascader-menu-border)}.el-cascader__dropdown.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-cascader__dropdown.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-cascader__dropdown.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-cascader__dropdown.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-cascader__dropdown.el-popper{box-shadow:var(--el-cascader-menu-shadow)}.el-cascader__tags{position:absolute;left:0;right:30px;top:50%;transform:translateY(-50%);display:flex;flex-wrap:wrap;line-height:normal;text-align:left;box-sizing:border-box}.el-cascader__tags .el-tag{display:inline-flex;align-items:center;max-width:100%;margin:2px 0 2px 6px;text-overflow:ellipsis;background:var(--el-cascader-tag-background)}.el-cascader__tags .el-tag:not(.is-hit){border-color:transparent}.el-cascader__tags .el-tag>span{flex:1;overflow:hidden;text-overflow:ellipsis}.el-cascader__tags .el-tag .el-icon-close{flex:none;background-color:var(--el-text-color-placeholder);color:var(--el-color-white)}.el-cascader__tags .el-tag .el-icon-close:hover{background-color:var(--el-text-color-secondary)}.el-cascader__collapse-tags{white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap}.el-cascader__collapse-tag{line-height:inherit;height:inherit;display:flex}.el-cascader__suggestion-panel{border-radius:var(--el-cascader-menu-radius)}.el-cascader__suggestion-list{max-height:204px;margin:0;padding:6px 0;font-size:var(--el-font-size-base);color:var(--el-cascader-menu-text-color);text-align:center}.el-cascader__suggestion-item{display:flex;justify-content:space-between;align-items:center;height:34px;padding:0 15px;text-align:left;outline:0;cursor:pointer}.el-cascader__suggestion-item:focus,.el-cascader__suggestion-item:hover{background:var(--el-cascader-node-background-hover)}.el-cascader__suggestion-item.is-checked{color:var(--el-cascader-menu-selected-text-color);font-weight:700}.el-cascader__suggestion-item>span{margin-right:10px}.el-cascader__empty-text{margin:10px 0;color:var(--el-cascader-color-empty)}.el-cascader__search-input{flex:1;height:24px;min-width:60px;margin:2px 0 2px 11px;padding:0;color:var(--el-cascader-menu-text-color);border:none;outline:0;box-sizing:border-box;background:0 0}.el-cascader__search-input::placeholder{color:transparent}.el-check-tag{background-color:var(--el-color-info-light-9);border-radius:var(--el-border-radius-base);color:var(--el-color-info);cursor:pointer;display:inline-block;font-size:var(--el-font-size-base);line-height:var(--el-font-size-base);padding:7px 15px;transition:var(--el-transition-all);font-weight:700}.el-check-tag:hover{background-color:var(--el-color-info-light-7)}.el-check-tag.is-checked{background-color:var(--el-color-primary-light-8);color:var(--el-color-primary)}.el-check-tag.is-checked:hover{background-color:var(--el-color-primary-light-7)}.el-checkbox-button{--el-checkbox-button-checked-bg-color:var(--el-color-primary);--el-checkbox-button-checked-text-color:var(--el-color-white);--el-checkbox-button-checked-border-color:var(--el-color-primary);position:relative;display:inline-block}.el-checkbox-button__inner{display:inline-block;line-height:1;font-weight:var(--el-checkbox-font-weight);white-space:nowrap;vertical-align:middle;cursor:pointer;background:var(--el-button-bg-color,var(--el-fill-color-blank));border:var(--el-border);border-left:0;color:var(--el-button-text-color,var(--el-text-color-regular));-webkit-appearance:none;text-align:center;box-sizing:border-box;outline:0;margin:0;position:relative;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;padding:8px 15px;font-size:var(--el-font-size-base);border-radius:0}.el-checkbox-button__inner.is-round{padding:8px 15px}.el-checkbox-button__inner:hover{color:var(--el-color-primary)}.el-checkbox-button__inner [class*=el-icon-]{line-height:.9}.el-checkbox-button__inner [class*=el-icon-]+span{margin-left:5px}.el-checkbox-button__original{opacity:0;outline:0;position:absolute;margin:0;z-index:-1}.el-checkbox-button.is-checked .el-checkbox-button__inner{color:var(--el-checkbox-button-checked-text-color);background-color:var(--el-checkbox-button-checked-bg-color);border-color:var(--el-checkbox-button-checked-border-color);box-shadow:-1px 0 0 0 var(--el-color-primary-light-7)}.el-checkbox-button.is-checked:first-child .el-checkbox-button__inner{border-left-color:var(--el-checkbox-button-checked-border-color)}.el-checkbox-button.is-disabled .el-checkbox-button__inner{color:var(--el-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color,var(--el-fill-color-blank));border-color:var(--el-button-disabled-border-color,var(--el-border-color-light));box-shadow:none}.el-checkbox-button.is-disabled:first-child .el-checkbox-button__inner{border-left-color:var(--el-button-disabled-border-color,var(--el-border-color-light))}.el-checkbox-button:first-child .el-checkbox-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-checkbox-button.is-focus .el-checkbox-button__inner{border-color:var(--el-checkbox-button-checked-border-color)}.el-checkbox-button:last-child .el-checkbox-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-checkbox-button--large .el-checkbox-button__inner{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:0}.el-checkbox-button--large .el-checkbox-button__inner.is-round{padding:12px 19px}.el-checkbox-button--small .el-checkbox-button__inner{padding:5px 11px;font-size:12px;border-radius:0}.el-checkbox-button--small .el-checkbox-button__inner.is-round{padding:5px 11px}.el-checkbox-group{font-size:0;line-height:0}.el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-fill-color-blank);--el-checkbox-input-border:var(--el-border);--el-checkbox-disabled-border-color:var(--el-border-color);--el-checkbox-disabled-input-fill:var(--el-fill-color-light);--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-color-white);--el-checkbox-input-border-color-hover:var(--el-color-primary);color:var(--el-checkbox-text-color);font-weight:var(--el-checkbox-font-weight);font-size:var(--el-font-size-base);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;-webkit-user-select:none;user-select:none;margin-right:30px;height:32px}.el-checkbox.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter);cursor:not-allowed}.el-checkbox.is-bordered.el-checkbox--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{padding:0 11px 0 7px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner:after{height:6px;width:2px}.el-checkbox input:focus-visible+.el-checkbox__inner{outline:2px solid var(--el-checkbox-input-border-color-hover);outline-offset:1px;border-radius:var(--el-checkbox-border-radius)}.el-checkbox__input{white-space:nowrap;cursor:pointer;outline:0;display:inline-flex;position:relative}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner:after{cursor:not-allowed;border-color:var(--el-checkbox-disabled-icon-color)}.el-checkbox__input.is-disabled .el-checkbox__inner+.el-checkbox__label{cursor:not-allowed}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner:after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner:before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner:after{transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus:not(.is-checked) .el-checkbox__original:not(:focus-visible){border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner:before{content:"";position:absolute;display:block;background-color:var(--el-checkbox-checked-icon-color);height:2px;transform:scale(.5);left:0;right:0;top:5px}.el-checkbox__input.is-indeterminate .el-checkbox__inner:after{display:none}.el-checkbox__inner{display:inline-block;position:relative;border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;width:var(--el-checkbox-input-width);height:var(--el-checkbox-input-height);background-color:var(--el-checkbox-bg-color);z-index:var(--el-index-normal);transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46),outline .25s cubic-bezier(.71,-.46,.29,1.46)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner:after{box-sizing:content-box;content:"";border:1px solid var(--el-checkbox-checked-icon-color);border-left:0;border-top:0;height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);width:3px;transition:transform .15s ease-in 50ms;transform-origin:center}.el-checkbox__original{opacity:0;outline:0;position:absolute;margin:0;width:0;height:0;z-index:-1}.el-checkbox__label{display:inline-block;padding-left:8px;line-height:1;font-size:var(--el-checkbox-font-size)}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{width:14px;height:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{width:12px;height:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner:before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner:after{width:2px;height:6px}.el-checkbox:last-of-type{margin-right:0}[class*=el-col-]{float:left;box-sizing:border-box}[class*=el-col-].is-guttered{display:block;min-height:1px}.el-col-0,.el-col-0.is-guttered{display:none}.el-col-0{max-width:0%;flex:0 0 0%}.el-col-offset-0{margin-left:0}.el-col-pull-0{position:relative;right:0}.el-col-push-0{position:relative;left:0}.el-col-1{max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-offset-1{margin-left:4.1666666667%}.el-col-pull-1{position:relative;right:4.1666666667%}.el-col-push-1{position:relative;left:4.1666666667%}.el-col-2{max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-offset-2{margin-left:8.3333333333%}.el-col-pull-2{position:relative;right:8.3333333333%}.el-col-push-2{position:relative;left:8.3333333333%}.el-col-3{max-width:12.5%;flex:0 0 12.5%}.el-col-offset-3{margin-left:12.5%}.el-col-pull-3{position:relative;right:12.5%}.el-col-push-3{position:relative;left:12.5%}.el-col-4{max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-offset-4{margin-left:16.6666666667%}.el-col-pull-4{position:relative;right:16.6666666667%}.el-col-push-4{position:relative;left:16.6666666667%}.el-col-5{max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-offset-5{margin-left:20.8333333333%}.el-col-pull-5{position:relative;right:20.8333333333%}.el-col-push-5{position:relative;left:20.8333333333%}.el-col-6{max-width:25%;flex:0 0 25%}.el-col-offset-6{margin-left:25%}.el-col-pull-6{position:relative;right:25%}.el-col-push-6{position:relative;left:25%}.el-col-7{max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-offset-7{margin-left:29.1666666667%}.el-col-pull-7{position:relative;right:29.1666666667%}.el-col-push-7{position:relative;left:29.1666666667%}.el-col-8{max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-offset-8{margin-left:33.3333333333%}.el-col-pull-8{position:relative;right:33.3333333333%}.el-col-push-8{position:relative;left:33.3333333333%}.el-col-9{max-width:37.5%;flex:0 0 37.5%}.el-col-offset-9{margin-left:37.5%}.el-col-pull-9{position:relative;right:37.5%}.el-col-push-9{position:relative;left:37.5%}.el-col-10{max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-offset-10{margin-left:41.6666666667%}.el-col-pull-10{position:relative;right:41.6666666667%}.el-col-push-10{position:relative;left:41.6666666667%}.el-col-11{max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-offset-11{margin-left:45.8333333333%}.el-col-pull-11{position:relative;right:45.8333333333%}.el-col-push-11{position:relative;left:45.8333333333%}.el-col-12{max-width:50%;flex:0 0 50%}.el-col-offset-12{margin-left:50%}.el-col-pull-12{position:relative;right:50%}.el-col-push-12{position:relative;left:50%}.el-col-13{max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-offset-13{margin-left:54.1666666667%}.el-col-pull-13{position:relative;right:54.1666666667%}.el-col-push-13{position:relative;left:54.1666666667%}.el-col-14{max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-offset-14{margin-left:58.3333333333%}.el-col-pull-14{position:relative;right:58.3333333333%}.el-col-push-14{position:relative;left:58.3333333333%}.el-col-15{max-width:62.5%;flex:0 0 62.5%}.el-col-offset-15{margin-left:62.5%}.el-col-pull-15{position:relative;right:62.5%}.el-col-push-15{position:relative;left:62.5%}.el-col-16{max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-offset-16{margin-left:66.6666666667%}.el-col-pull-16{position:relative;right:66.6666666667%}.el-col-push-16{position:relative;left:66.6666666667%}.el-col-17{max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-offset-17{margin-left:70.8333333333%}.el-col-pull-17{position:relative;right:70.8333333333%}.el-col-push-17{position:relative;left:70.8333333333%}.el-col-18{max-width:75%;flex:0 0 75%}.el-col-offset-18{margin-left:75%}.el-col-pull-18{position:relative;right:75%}.el-col-push-18{position:relative;left:75%}.el-col-19{max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-offset-19{margin-left:79.1666666667%}.el-col-pull-19{position:relative;right:79.1666666667%}.el-col-push-19{position:relative;left:79.1666666667%}.el-col-20{max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-offset-20{margin-left:83.3333333333%}.el-col-pull-20{position:relative;right:83.3333333333%}.el-col-push-20{position:relative;left:83.3333333333%}.el-col-21{max-width:87.5%;flex:0 0 87.5%}.el-col-offset-21{margin-left:87.5%}.el-col-pull-21{position:relative;right:87.5%}.el-col-push-21{position:relative;left:87.5%}.el-col-22{max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-offset-22{margin-left:91.6666666667%}.el-col-pull-22{position:relative;right:91.6666666667%}.el-col-push-22{position:relative;left:91.6666666667%}.el-col-23{max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-offset-23{margin-left:95.8333333333%}.el-col-pull-23{position:relative;right:95.8333333333%}.el-col-push-23{position:relative;left:95.8333333333%}.el-col-24{max-width:100%;flex:0 0 100%}.el-col-offset-24{margin-left:100%}.el-col-pull-24{position:relative;right:100%}.el-col-push-24{position:relative;left:100%}@media only screen and (max-width:768px){.el-col-xs-0,.el-col-xs-0.is-guttered{display:none}.el-col-xs-0{max-width:0%;flex:0 0 0%}.el-col-xs-offset-0{margin-left:0}.el-col-xs-pull-0{position:relative;right:0}.el-col-xs-push-0{position:relative;left:0}.el-col-xs-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-xs-offset-1{margin-left:4.1666666667%}.el-col-xs-pull-1{position:relative;right:4.1666666667%}.el-col-xs-push-1{position:relative;left:4.1666666667%}.el-col-xs-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-xs-offset-2{margin-left:8.3333333333%}.el-col-xs-pull-2{position:relative;right:8.3333333333%}.el-col-xs-push-2{position:relative;left:8.3333333333%}.el-col-xs-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-xs-offset-3{margin-left:12.5%}.el-col-xs-pull-3{position:relative;right:12.5%}.el-col-xs-push-3{position:relative;left:12.5%}.el-col-xs-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-xs-offset-4{margin-left:16.6666666667%}.el-col-xs-pull-4{position:relative;right:16.6666666667%}.el-col-xs-push-4{position:relative;left:16.6666666667%}.el-col-xs-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-xs-offset-5{margin-left:20.8333333333%}.el-col-xs-pull-5{position:relative;right:20.8333333333%}.el-col-xs-push-5{position:relative;left:20.8333333333%}.el-col-xs-6{display:block;max-width:25%;flex:0 0 25%}.el-col-xs-offset-6{margin-left:25%}.el-col-xs-pull-6{position:relative;right:25%}.el-col-xs-push-6{position:relative;left:25%}.el-col-xs-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-xs-offset-7{margin-left:29.1666666667%}.el-col-xs-pull-7{position:relative;right:29.1666666667%}.el-col-xs-push-7{position:relative;left:29.1666666667%}.el-col-xs-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-xs-offset-8{margin-left:33.3333333333%}.el-col-xs-pull-8{position:relative;right:33.3333333333%}.el-col-xs-push-8{position:relative;left:33.3333333333%}.el-col-xs-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-xs-offset-9{margin-left:37.5%}.el-col-xs-pull-9{position:relative;right:37.5%}.el-col-xs-push-9{position:relative;left:37.5%}.el-col-xs-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-xs-offset-10{margin-left:41.6666666667%}.el-col-xs-pull-10{position:relative;right:41.6666666667%}.el-col-xs-push-10{position:relative;left:41.6666666667%}.el-col-xs-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-xs-offset-11{margin-left:45.8333333333%}.el-col-xs-pull-11{position:relative;right:45.8333333333%}.el-col-xs-push-11{position:relative;left:45.8333333333%}.el-col-xs-12{display:block;max-width:50%;flex:0 0 50%}.el-col-xs-offset-12{margin-left:50%}.el-col-xs-pull-12{position:relative;right:50%}.el-col-xs-push-12{position:relative;left:50%}.el-col-xs-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-xs-offset-13{margin-left:54.1666666667%}.el-col-xs-pull-13{position:relative;right:54.1666666667%}.el-col-xs-push-13{position:relative;left:54.1666666667%}.el-col-xs-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-xs-offset-14{margin-left:58.3333333333%}.el-col-xs-pull-14{position:relative;right:58.3333333333%}.el-col-xs-push-14{position:relative;left:58.3333333333%}.el-col-xs-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-xs-offset-15{margin-left:62.5%}.el-col-xs-pull-15{position:relative;right:62.5%}.el-col-xs-push-15{position:relative;left:62.5%}.el-col-xs-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-xs-offset-16{margin-left:66.6666666667%}.el-col-xs-pull-16{position:relative;right:66.6666666667%}.el-col-xs-push-16{position:relative;left:66.6666666667%}.el-col-xs-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-xs-offset-17{margin-left:70.8333333333%}.el-col-xs-pull-17{position:relative;right:70.8333333333%}.el-col-xs-push-17{position:relative;left:70.8333333333%}.el-col-xs-18{display:block;max-width:75%;flex:0 0 75%}.el-col-xs-offset-18{margin-left:75%}.el-col-xs-pull-18{position:relative;right:75%}.el-col-xs-push-18{position:relative;left:75%}.el-col-xs-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-xs-offset-19{margin-left:79.1666666667%}.el-col-xs-pull-19{position:relative;right:79.1666666667%}.el-col-xs-push-19{position:relative;left:79.1666666667%}.el-col-xs-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-xs-offset-20{margin-left:83.3333333333%}.el-col-xs-pull-20{position:relative;right:83.3333333333%}.el-col-xs-push-20{position:relative;left:83.3333333333%}.el-col-xs-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-xs-offset-21{margin-left:87.5%}.el-col-xs-pull-21{position:relative;right:87.5%}.el-col-xs-push-21{position:relative;left:87.5%}.el-col-xs-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-xs-offset-22{margin-left:91.6666666667%}.el-col-xs-pull-22{position:relative;right:91.6666666667%}.el-col-xs-push-22{position:relative;left:91.6666666667%}.el-col-xs-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-xs-offset-23{margin-left:95.8333333333%}.el-col-xs-pull-23{position:relative;right:95.8333333333%}.el-col-xs-push-23{position:relative;left:95.8333333333%}.el-col-xs-24{display:block;max-width:100%;flex:0 0 100%}.el-col-xs-offset-24{margin-left:100%}.el-col-xs-pull-24{position:relative;right:100%}.el-col-xs-push-24{position:relative;left:100%}}@media only screen and (min-width:768px){.el-col-sm-0,.el-col-sm-0.is-guttered{display:none}.el-col-sm-0{max-width:0%;flex:0 0 0%}.el-col-sm-offset-0{margin-left:0}.el-col-sm-pull-0{position:relative;right:0}.el-col-sm-push-0{position:relative;left:0}.el-col-sm-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-sm-offset-1{margin-left:4.1666666667%}.el-col-sm-pull-1{position:relative;right:4.1666666667%}.el-col-sm-push-1{position:relative;left:4.1666666667%}.el-col-sm-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-sm-offset-2{margin-left:8.3333333333%}.el-col-sm-pull-2{position:relative;right:8.3333333333%}.el-col-sm-push-2{position:relative;left:8.3333333333%}.el-col-sm-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-sm-offset-3{margin-left:12.5%}.el-col-sm-pull-3{position:relative;right:12.5%}.el-col-sm-push-3{position:relative;left:12.5%}.el-col-sm-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-sm-offset-4{margin-left:16.6666666667%}.el-col-sm-pull-4{position:relative;right:16.6666666667%}.el-col-sm-push-4{position:relative;left:16.6666666667%}.el-col-sm-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-sm-offset-5{margin-left:20.8333333333%}.el-col-sm-pull-5{position:relative;right:20.8333333333%}.el-col-sm-push-5{position:relative;left:20.8333333333%}.el-col-sm-6{display:block;max-width:25%;flex:0 0 25%}.el-col-sm-offset-6{margin-left:25%}.el-col-sm-pull-6{position:relative;right:25%}.el-col-sm-push-6{position:relative;left:25%}.el-col-sm-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-sm-offset-7{margin-left:29.1666666667%}.el-col-sm-pull-7{position:relative;right:29.1666666667%}.el-col-sm-push-7{position:relative;left:29.1666666667%}.el-col-sm-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-sm-offset-8{margin-left:33.3333333333%}.el-col-sm-pull-8{position:relative;right:33.3333333333%}.el-col-sm-push-8{position:relative;left:33.3333333333%}.el-col-sm-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-sm-offset-9{margin-left:37.5%}.el-col-sm-pull-9{position:relative;right:37.5%}.el-col-sm-push-9{position:relative;left:37.5%}.el-col-sm-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-sm-offset-10{margin-left:41.6666666667%}.el-col-sm-pull-10{position:relative;right:41.6666666667%}.el-col-sm-push-10{position:relative;left:41.6666666667%}.el-col-sm-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-sm-offset-11{margin-left:45.8333333333%}.el-col-sm-pull-11{position:relative;right:45.8333333333%}.el-col-sm-push-11{position:relative;left:45.8333333333%}.el-col-sm-12{display:block;max-width:50%;flex:0 0 50%}.el-col-sm-offset-12{margin-left:50%}.el-col-sm-pull-12{position:relative;right:50%}.el-col-sm-push-12{position:relative;left:50%}.el-col-sm-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-sm-offset-13{margin-left:54.1666666667%}.el-col-sm-pull-13{position:relative;right:54.1666666667%}.el-col-sm-push-13{position:relative;left:54.1666666667%}.el-col-sm-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-sm-offset-14{margin-left:58.3333333333%}.el-col-sm-pull-14{position:relative;right:58.3333333333%}.el-col-sm-push-14{position:relative;left:58.3333333333%}.el-col-sm-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-sm-offset-15{margin-left:62.5%}.el-col-sm-pull-15{position:relative;right:62.5%}.el-col-sm-push-15{position:relative;left:62.5%}.el-col-sm-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-sm-offset-16{margin-left:66.6666666667%}.el-col-sm-pull-16{position:relative;right:66.6666666667%}.el-col-sm-push-16{position:relative;left:66.6666666667%}.el-col-sm-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-sm-offset-17{margin-left:70.8333333333%}.el-col-sm-pull-17{position:relative;right:70.8333333333%}.el-col-sm-push-17{position:relative;left:70.8333333333%}.el-col-sm-18{display:block;max-width:75%;flex:0 0 75%}.el-col-sm-offset-18{margin-left:75%}.el-col-sm-pull-18{position:relative;right:75%}.el-col-sm-push-18{position:relative;left:75%}.el-col-sm-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-sm-offset-19{margin-left:79.1666666667%}.el-col-sm-pull-19{position:relative;right:79.1666666667%}.el-col-sm-push-19{position:relative;left:79.1666666667%}.el-col-sm-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-sm-offset-20{margin-left:83.3333333333%}.el-col-sm-pull-20{position:relative;right:83.3333333333%}.el-col-sm-push-20{position:relative;left:83.3333333333%}.el-col-sm-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-sm-offset-21{margin-left:87.5%}.el-col-sm-pull-21{position:relative;right:87.5%}.el-col-sm-push-21{position:relative;left:87.5%}.el-col-sm-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-sm-offset-22{margin-left:91.6666666667%}.el-col-sm-pull-22{position:relative;right:91.6666666667%}.el-col-sm-push-22{position:relative;left:91.6666666667%}.el-col-sm-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-sm-offset-23{margin-left:95.8333333333%}.el-col-sm-pull-23{position:relative;right:95.8333333333%}.el-col-sm-push-23{position:relative;left:95.8333333333%}.el-col-sm-24{display:block;max-width:100%;flex:0 0 100%}.el-col-sm-offset-24{margin-left:100%}.el-col-sm-pull-24{position:relative;right:100%}.el-col-sm-push-24{position:relative;left:100%}}@media only screen and (min-width:992px){.el-col-md-0,.el-col-md-0.is-guttered{display:none}.el-col-md-0{max-width:0%;flex:0 0 0%}.el-col-md-offset-0{margin-left:0}.el-col-md-pull-0{position:relative;right:0}.el-col-md-push-0{position:relative;left:0}.el-col-md-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-md-offset-1{margin-left:4.1666666667%}.el-col-md-pull-1{position:relative;right:4.1666666667%}.el-col-md-push-1{position:relative;left:4.1666666667%}.el-col-md-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-md-offset-2{margin-left:8.3333333333%}.el-col-md-pull-2{position:relative;right:8.3333333333%}.el-col-md-push-2{position:relative;left:8.3333333333%}.el-col-md-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-md-offset-3{margin-left:12.5%}.el-col-md-pull-3{position:relative;right:12.5%}.el-col-md-push-3{position:relative;left:12.5%}.el-col-md-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-md-offset-4{margin-left:16.6666666667%}.el-col-md-pull-4{position:relative;right:16.6666666667%}.el-col-md-push-4{position:relative;left:16.6666666667%}.el-col-md-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-md-offset-5{margin-left:20.8333333333%}.el-col-md-pull-5{position:relative;right:20.8333333333%}.el-col-md-push-5{position:relative;left:20.8333333333%}.el-col-md-6{display:block;max-width:25%;flex:0 0 25%}.el-col-md-offset-6{margin-left:25%}.el-col-md-pull-6{position:relative;right:25%}.el-col-md-push-6{position:relative;left:25%}.el-col-md-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-md-offset-7{margin-left:29.1666666667%}.el-col-md-pull-7{position:relative;right:29.1666666667%}.el-col-md-push-7{position:relative;left:29.1666666667%}.el-col-md-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-md-offset-8{margin-left:33.3333333333%}.el-col-md-pull-8{position:relative;right:33.3333333333%}.el-col-md-push-8{position:relative;left:33.3333333333%}.el-col-md-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-md-offset-9{margin-left:37.5%}.el-col-md-pull-9{position:relative;right:37.5%}.el-col-md-push-9{position:relative;left:37.5%}.el-col-md-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-md-offset-10{margin-left:41.6666666667%}.el-col-md-pull-10{position:relative;right:41.6666666667%}.el-col-md-push-10{position:relative;left:41.6666666667%}.el-col-md-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-md-offset-11{margin-left:45.8333333333%}.el-col-md-pull-11{position:relative;right:45.8333333333%}.el-col-md-push-11{position:relative;left:45.8333333333%}.el-col-md-12{display:block;max-width:50%;flex:0 0 50%}.el-col-md-offset-12{margin-left:50%}.el-col-md-pull-12{position:relative;right:50%}.el-col-md-push-12{position:relative;left:50%}.el-col-md-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-md-offset-13{margin-left:54.1666666667%}.el-col-md-pull-13{position:relative;right:54.1666666667%}.el-col-md-push-13{position:relative;left:54.1666666667%}.el-col-md-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-md-offset-14{margin-left:58.3333333333%}.el-col-md-pull-14{position:relative;right:58.3333333333%}.el-col-md-push-14{position:relative;left:58.3333333333%}.el-col-md-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-md-offset-15{margin-left:62.5%}.el-col-md-pull-15{position:relative;right:62.5%}.el-col-md-push-15{position:relative;left:62.5%}.el-col-md-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-md-offset-16{margin-left:66.6666666667%}.el-col-md-pull-16{position:relative;right:66.6666666667%}.el-col-md-push-16{position:relative;left:66.6666666667%}.el-col-md-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-md-offset-17{margin-left:70.8333333333%}.el-col-md-pull-17{position:relative;right:70.8333333333%}.el-col-md-push-17{position:relative;left:70.8333333333%}.el-col-md-18{display:block;max-width:75%;flex:0 0 75%}.el-col-md-offset-18{margin-left:75%}.el-col-md-pull-18{position:relative;right:75%}.el-col-md-push-18{position:relative;left:75%}.el-col-md-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-md-offset-19{margin-left:79.1666666667%}.el-col-md-pull-19{position:relative;right:79.1666666667%}.el-col-md-push-19{position:relative;left:79.1666666667%}.el-col-md-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-md-offset-20{margin-left:83.3333333333%}.el-col-md-pull-20{position:relative;right:83.3333333333%}.el-col-md-push-20{position:relative;left:83.3333333333%}.el-col-md-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-md-offset-21{margin-left:87.5%}.el-col-md-pull-21{position:relative;right:87.5%}.el-col-md-push-21{position:relative;left:87.5%}.el-col-md-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-md-offset-22{margin-left:91.6666666667%}.el-col-md-pull-22{position:relative;right:91.6666666667%}.el-col-md-push-22{position:relative;left:91.6666666667%}.el-col-md-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-md-offset-23{margin-left:95.8333333333%}.el-col-md-pull-23{position:relative;right:95.8333333333%}.el-col-md-push-23{position:relative;left:95.8333333333%}.el-col-md-24{display:block;max-width:100%;flex:0 0 100%}.el-col-md-offset-24{margin-left:100%}.el-col-md-pull-24{position:relative;right:100%}.el-col-md-push-24{position:relative;left:100%}}@media only screen and (min-width:1200px){.el-col-lg-0,.el-col-lg-0.is-guttered{display:none}.el-col-lg-0{max-width:0%;flex:0 0 0%}.el-col-lg-offset-0{margin-left:0}.el-col-lg-pull-0{position:relative;right:0}.el-col-lg-push-0{position:relative;left:0}.el-col-lg-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-lg-offset-1{margin-left:4.1666666667%}.el-col-lg-pull-1{position:relative;right:4.1666666667%}.el-col-lg-push-1{position:relative;left:4.1666666667%}.el-col-lg-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-lg-offset-2{margin-left:8.3333333333%}.el-col-lg-pull-2{position:relative;right:8.3333333333%}.el-col-lg-push-2{position:relative;left:8.3333333333%}.el-col-lg-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-lg-offset-3{margin-left:12.5%}.el-col-lg-pull-3{position:relative;right:12.5%}.el-col-lg-push-3{position:relative;left:12.5%}.el-col-lg-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-lg-offset-4{margin-left:16.6666666667%}.el-col-lg-pull-4{position:relative;right:16.6666666667%}.el-col-lg-push-4{position:relative;left:16.6666666667%}.el-col-lg-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-lg-offset-5{margin-left:20.8333333333%}.el-col-lg-pull-5{position:relative;right:20.8333333333%}.el-col-lg-push-5{position:relative;left:20.8333333333%}.el-col-lg-6{display:block;max-width:25%;flex:0 0 25%}.el-col-lg-offset-6{margin-left:25%}.el-col-lg-pull-6{position:relative;right:25%}.el-col-lg-push-6{position:relative;left:25%}.el-col-lg-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-lg-offset-7{margin-left:29.1666666667%}.el-col-lg-pull-7{position:relative;right:29.1666666667%}.el-col-lg-push-7{position:relative;left:29.1666666667%}.el-col-lg-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-lg-offset-8{margin-left:33.3333333333%}.el-col-lg-pull-8{position:relative;right:33.3333333333%}.el-col-lg-push-8{position:relative;left:33.3333333333%}.el-col-lg-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-lg-offset-9{margin-left:37.5%}.el-col-lg-pull-9{position:relative;right:37.5%}.el-col-lg-push-9{position:relative;left:37.5%}.el-col-lg-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-lg-offset-10{margin-left:41.6666666667%}.el-col-lg-pull-10{position:relative;right:41.6666666667%}.el-col-lg-push-10{position:relative;left:41.6666666667%}.el-col-lg-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-lg-offset-11{margin-left:45.8333333333%}.el-col-lg-pull-11{position:relative;right:45.8333333333%}.el-col-lg-push-11{position:relative;left:45.8333333333%}.el-col-lg-12{display:block;max-width:50%;flex:0 0 50%}.el-col-lg-offset-12{margin-left:50%}.el-col-lg-pull-12{position:relative;right:50%}.el-col-lg-push-12{position:relative;left:50%}.el-col-lg-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-lg-offset-13{margin-left:54.1666666667%}.el-col-lg-pull-13{position:relative;right:54.1666666667%}.el-col-lg-push-13{position:relative;left:54.1666666667%}.el-col-lg-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-lg-offset-14{margin-left:58.3333333333%}.el-col-lg-pull-14{position:relative;right:58.3333333333%}.el-col-lg-push-14{position:relative;left:58.3333333333%}.el-col-lg-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-lg-offset-15{margin-left:62.5%}.el-col-lg-pull-15{position:relative;right:62.5%}.el-col-lg-push-15{position:relative;left:62.5%}.el-col-lg-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-lg-offset-16{margin-left:66.6666666667%}.el-col-lg-pull-16{position:relative;right:66.6666666667%}.el-col-lg-push-16{position:relative;left:66.6666666667%}.el-col-lg-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-lg-offset-17{margin-left:70.8333333333%}.el-col-lg-pull-17{position:relative;right:70.8333333333%}.el-col-lg-push-17{position:relative;left:70.8333333333%}.el-col-lg-18{display:block;max-width:75%;flex:0 0 75%}.el-col-lg-offset-18{margin-left:75%}.el-col-lg-pull-18{position:relative;right:75%}.el-col-lg-push-18{position:relative;left:75%}.el-col-lg-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-lg-offset-19{margin-left:79.1666666667%}.el-col-lg-pull-19{position:relative;right:79.1666666667%}.el-col-lg-push-19{position:relative;left:79.1666666667%}.el-col-lg-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-lg-offset-20{margin-left:83.3333333333%}.el-col-lg-pull-20{position:relative;right:83.3333333333%}.el-col-lg-push-20{position:relative;left:83.3333333333%}.el-col-lg-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-lg-offset-21{margin-left:87.5%}.el-col-lg-pull-21{position:relative;right:87.5%}.el-col-lg-push-21{position:relative;left:87.5%}.el-col-lg-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-lg-offset-22{margin-left:91.6666666667%}.el-col-lg-pull-22{position:relative;right:91.6666666667%}.el-col-lg-push-22{position:relative;left:91.6666666667%}.el-col-lg-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-lg-offset-23{margin-left:95.8333333333%}.el-col-lg-pull-23{position:relative;right:95.8333333333%}.el-col-lg-push-23{position:relative;left:95.8333333333%}.el-col-lg-24{display:block;max-width:100%;flex:0 0 100%}.el-col-lg-offset-24{margin-left:100%}.el-col-lg-pull-24{position:relative;right:100%}.el-col-lg-push-24{position:relative;left:100%}}@media only screen and (min-width:1920px){.el-col-xl-0,.el-col-xl-0.is-guttered{display:none}.el-col-xl-0{max-width:0%;flex:0 0 0%}.el-col-xl-offset-0{margin-left:0}.el-col-xl-pull-0{position:relative;right:0}.el-col-xl-push-0{position:relative;left:0}.el-col-xl-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-xl-offset-1{margin-left:4.1666666667%}.el-col-xl-pull-1{position:relative;right:4.1666666667%}.el-col-xl-push-1{position:relative;left:4.1666666667%}.el-col-xl-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-xl-offset-2{margin-left:8.3333333333%}.el-col-xl-pull-2{position:relative;right:8.3333333333%}.el-col-xl-push-2{position:relative;left:8.3333333333%}.el-col-xl-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-xl-offset-3{margin-left:12.5%}.el-col-xl-pull-3{position:relative;right:12.5%}.el-col-xl-push-3{position:relative;left:12.5%}.el-col-xl-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-xl-offset-4{margin-left:16.6666666667%}.el-col-xl-pull-4{position:relative;right:16.6666666667%}.el-col-xl-push-4{position:relative;left:16.6666666667%}.el-col-xl-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-xl-offset-5{margin-left:20.8333333333%}.el-col-xl-pull-5{position:relative;right:20.8333333333%}.el-col-xl-push-5{position:relative;left:20.8333333333%}.el-col-xl-6{display:block;max-width:25%;flex:0 0 25%}.el-col-xl-offset-6{margin-left:25%}.el-col-xl-pull-6{position:relative;right:25%}.el-col-xl-push-6{position:relative;left:25%}.el-col-xl-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-xl-offset-7{margin-left:29.1666666667%}.el-col-xl-pull-7{position:relative;right:29.1666666667%}.el-col-xl-push-7{position:relative;left:29.1666666667%}.el-col-xl-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-xl-offset-8{margin-left:33.3333333333%}.el-col-xl-pull-8{position:relative;right:33.3333333333%}.el-col-xl-push-8{position:relative;left:33.3333333333%}.el-col-xl-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-xl-offset-9{margin-left:37.5%}.el-col-xl-pull-9{position:relative;right:37.5%}.el-col-xl-push-9{position:relative;left:37.5%}.el-col-xl-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-xl-offset-10{margin-left:41.6666666667%}.el-col-xl-pull-10{position:relative;right:41.6666666667%}.el-col-xl-push-10{position:relative;left:41.6666666667%}.el-col-xl-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-xl-offset-11{margin-left:45.8333333333%}.el-col-xl-pull-11{position:relative;right:45.8333333333%}.el-col-xl-push-11{position:relative;left:45.8333333333%}.el-col-xl-12{display:block;max-width:50%;flex:0 0 50%}.el-col-xl-offset-12{margin-left:50%}.el-col-xl-pull-12{position:relative;right:50%}.el-col-xl-push-12{position:relative;left:50%}.el-col-xl-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-xl-offset-13{margin-left:54.1666666667%}.el-col-xl-pull-13{position:relative;right:54.1666666667%}.el-col-xl-push-13{position:relative;left:54.1666666667%}.el-col-xl-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-xl-offset-14{margin-left:58.3333333333%}.el-col-xl-pull-14{position:relative;right:58.3333333333%}.el-col-xl-push-14{position:relative;left:58.3333333333%}.el-col-xl-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-xl-offset-15{margin-left:62.5%}.el-col-xl-pull-15{position:relative;right:62.5%}.el-col-xl-push-15{position:relative;left:62.5%}.el-col-xl-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-xl-offset-16{margin-left:66.6666666667%}.el-col-xl-pull-16{position:relative;right:66.6666666667%}.el-col-xl-push-16{position:relative;left:66.6666666667%}.el-col-xl-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-xl-offset-17{margin-left:70.8333333333%}.el-col-xl-pull-17{position:relative;right:70.8333333333%}.el-col-xl-push-17{position:relative;left:70.8333333333%}.el-col-xl-18{display:block;max-width:75%;flex:0 0 75%}.el-col-xl-offset-18{margin-left:75%}.el-col-xl-pull-18{position:relative;right:75%}.el-col-xl-push-18{position:relative;left:75%}.el-col-xl-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-xl-offset-19{margin-left:79.1666666667%}.el-col-xl-pull-19{position:relative;right:79.1666666667%}.el-col-xl-push-19{position:relative;left:79.1666666667%}.el-col-xl-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-xl-offset-20{margin-left:83.3333333333%}.el-col-xl-pull-20{position:relative;right:83.3333333333%}.el-col-xl-push-20{position:relative;left:83.3333333333%}.el-col-xl-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-xl-offset-21{margin-left:87.5%}.el-col-xl-pull-21{position:relative;right:87.5%}.el-col-xl-push-21{position:relative;left:87.5%}.el-col-xl-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-xl-offset-22{margin-left:91.6666666667%}.el-col-xl-pull-22{position:relative;right:91.6666666667%}.el-col-xl-push-22{position:relative;left:91.6666666667%}.el-col-xl-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-xl-offset-23{margin-left:95.8333333333%}.el-col-xl-pull-23{position:relative;right:95.8333333333%}.el-col-xl-push-23{position:relative;left:95.8333333333%}.el-col-xl-24{display:block;max-width:100%;flex:0 0 100%}.el-col-xl-offset-24{margin-left:100%}.el-col-xl-pull-24{position:relative;right:100%}.el-col-xl-push-24{position:relative;left:100%}}.el-collapse{--el-collapse-border-color:var(--el-border-color-lighter);--el-collapse-header-height:48px;--el-collapse-header-bg-color:var(--el-fill-color-blank);--el-collapse-header-text-color:var(--el-text-color-primary);--el-collapse-header-font-size:13px;--el-collapse-content-bg-color:var(--el-fill-color-blank);--el-collapse-content-font-size:13px;--el-collapse-content-text-color:var(--el-text-color-primary);border-top:1px solid var(--el-collapse-border-color);border-bottom:1px solid var(--el-collapse-border-color)}.el-collapse-item.is-disabled .el-collapse-item__header{color:var(--el-text-color-disabled);cursor:not-allowed}.el-collapse-item__header{display:flex;align-items:center;height:var(--el-collapse-header-height);line-height:var(--el-collapse-header-height);background-color:var(--el-collapse-header-bg-color);color:var(--el-collapse-header-text-color);cursor:pointer;border-bottom:1px solid var(--el-collapse-border-color);font-size:var(--el-collapse-header-font-size);font-weight:500;transition:border-bottom-color var(--el-transition-duration);outline:0}.el-collapse-item__arrow{margin:0 8px 0 auto;transition:transform var(--el-transition-duration);font-weight:300}.el-collapse-item__arrow.is-active{transform:rotate(90deg)}.el-collapse-item__header.focusing:focus:not(:hover){color:var(--el-color-primary)}.el-collapse-item__header.is-active{border-bottom-color:transparent}.el-collapse-item__wrap{will-change:height;background-color:var(--el-collapse-content-bg-color);overflow:hidden;box-sizing:border-box;border-bottom:1px solid var(--el-collapse-border-color)}.el-collapse-item__content{padding-bottom:25px;font-size:var(--el-collapse-content-font-size);color:var(--el-collapse-content-text-color);line-height:1.7692307692}.el-collapse-item:last-child{margin-bottom:-1px}.el-color-predefine{display:flex;font-size:12px;margin-top:8px;width:280px}.el-color-predefine__colors{display:flex;flex:1;flex-wrap:wrap}.el-color-predefine__color-selector{margin:0 0 8px 8px;width:20px;height:20px;border-radius:4px;cursor:pointer}.el-color-predefine__color-selector:nth-child(10n+1){margin-left:0}.el-color-predefine__color-selector.selected{box-shadow:0 0 3px 2px var(--el-color-primary)}.el-color-predefine__color-selector>div{display:flex;height:100%;border-radius:3px}.el-color-predefine__color-selector.is-alpha{background-image:url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAwAAAAMCAIAAADZF8uwAAAAGUlEQVQYV2M4gwH+YwCGIasIUwhT25BVBADtzYNYrHvv4gAAAABJRU5ErkJggg==)}.el-color-hue-slider{position:relative;box-sizing:border-box;width:280px;height:12px;background-color:red;padding:0 2px;float:right}.el-color-hue-slider__bar{position:relative;background:linear-gradient(to right,red 0,#ff0 17%,#0f0 33%,#0ff 50%,#00f 67%,#f0f 83%,red 100%);height:100%}.el-color-hue-slider__thumb{position:absolute;cursor:pointer;box-sizing:border-box;left:0;top:0;width:4px;height:100%;border-radius:1px;background:#fff;border:1px solid var(--el-border-color-lighter);box-shadow:0 0 2px rgba(0,0,0,.6);z-index:1}.el-color-hue-slider.is-vertical{width:12px;height:180px;padding:2px 0}.el-color-hue-slider.is-vertical .el-color-hue-slider__bar{background:linear-gradient(to bottom,red 0,#ff0 17%,#0f0 33%,#0ff 50%,#00f 67%,#f0f 83%,red 100%)}.el-color-hue-slider.is-vertical .el-color-hue-slider__thumb{left:0;top:0;width:100%;height:4px}.el-color-svpanel{position:relative;width:280px;height:180px}.el-color-svpanel__black,.el-color-svpanel__white{position:absolute;top:0;left:0;right:0;bottom:0}.el-color-svpanel__white{background:linear-gradient(to right,#fff,rgba(255,255,255,0))}.el-color-svpanel__black{background:linear-gradient(to top,#000,rgba(0,0,0,0))}.el-color-svpanel__cursor{position:absolute}.el-color-svpanel__cursor>div{cursor:head;width:4px;height:4px;box-shadow:0 0 0 1.5px #fff,inset 0 0 1px 1px rgba(0,0,0,.3),0 0 1px 2px rgba(0,0,0,.4);border-radius:50%;transform:translate(-2px,-2px)}.el-color-alpha-slider{position:relative;box-sizing:border-box;width:280px;height:12px;background-image:linear-gradient(45deg,var(--el-color-picker-alpha-bg-a) 25%,var(--el-color-picker-alpha-bg-b) 25%),linear-gradient(135deg,var(--el-color-picker-alpha-bg-a) 25%,var(--el-color-picker-alpha-bg-b) 25%),linear-gradient(45deg,var(--el-color-picker-alpha-bg-b) 75%,var(--el-color-picker-alpha-bg-a) 75%),linear-gradient(135deg,var(--el-color-picker-alpha-bg-b) 75%,var(--el-color-picker-alpha-bg-a) 75%);background-size:12px 12px;background-position:0 0,6px 0,6px -6px,0 6px}.el-color-alpha-slider__bar{position:relative;background:linear-gradient(to right,rgba(255,255,255,0) 0,var(--el-bg-color) 100%);height:100%}.el-color-alpha-slider__thumb{position:absolute;cursor:pointer;box-sizing:border-box;left:0;top:0;width:4px;height:100%;border-radius:1px;background:#fff;border:1px solid var(--el-border-color-lighter);box-shadow:0 0 2px rgba(0,0,0,.6);z-index:1}.el-color-alpha-slider.is-vertical{width:20px;height:180px}.el-color-alpha-slider.is-vertical .el-color-alpha-slider__bar{background:linear-gradient(to bottom,rgba(255,255,255,0) 0,#fff 100%)}.el-color-alpha-slider.is-vertical .el-color-alpha-slider__thumb{left:0;top:0;width:100%;height:4px}.el-color-dropdown{width:300px}.el-color-dropdown__main-wrapper{margin-bottom:6px}.el-color-dropdown__main-wrapper:after{content:"";display:table;clear:both}.el-color-dropdown__btns{margin-top:12px;text-align:right}.el-color-dropdown__value{float:left;line-height:26px;font-size:12px;color:#000;width:160px}.el-color-picker{display:inline-block;position:relative;line-height:normal}.el-color-picker.is-disabled .el-color-picker__trigger{cursor:not-allowed}.el-color-picker--large{height:40px}.el-color-picker--large .el-color-picker__trigger{height:40px;width:40px}.el-color-picker--large .el-color-picker__mask{height:38px;width:38px}.el-color-picker--small{height:24px}.el-color-picker--small .el-color-picker__trigger{height:24px;width:24px}.el-color-picker--small .el-color-picker__mask{height:22px;width:22px}.el-color-picker--small .el-color-picker__empty,.el-color-picker--small .el-color-picker__icon{transform:scale(.8)}.el-color-picker__mask{height:38px;width:38px;border-radius:4px;position:absolute;top:1px;left:1px;z-index:1;cursor:not-allowed;background-color:rgba(255,255,255,.7)}.el-color-picker__trigger{display:inline-flex;justify-content:center;align-items:center;box-sizing:border-box;height:32px;width:32px;padding:4px;border:1px solid var(--el-border-color);border-radius:4px;font-size:0;position:relative;cursor:pointer}.el-color-picker__color{position:relative;display:block;box-sizing:border-box;border:1px solid var(--el-text-color-secondary);border-radius:var(--el-border-radius-small);width:100%;height:100%;text-align:center}.el-color-picker__color.is-alpha{background-image:linear-gradient(45deg,var(--el-color-picker-alpha-bg-a) 25%,var(--el-color-picker-alpha-bg-b) 25%),linear-gradient(135deg,var(--el-color-picker-alpha-bg-a) 25%,var(--el-color-picker-alpha-bg-b) 25%),linear-gradient(45deg,var(--el-color-picker-alpha-bg-b) 75%,var(--el-color-picker-alpha-bg-a) 75%),linear-gradient(135deg,var(--el-color-picker-alpha-bg-b) 75%,var(--el-color-picker-alpha-bg-a) 75%);background-size:12px 12px;background-position:0 0,6px 0,6px -6px,0 6px}.el-color-picker__color-inner{display:inline-flex;justify-content:center;align-items:center;width:100%;height:100%}.el-color-picker .el-color-picker__empty{font-size:12px;color:var(--el-text-color-secondary)}.el-color-picker .el-color-picker__icon{display:inline-flex;justify-content:center;align-items:center;color:#fff;font-size:12px}.el-color-picker__panel{position:absolute;z-index:10;padding:6px;box-sizing:content-box;background-color:#fff;border-radius:var(--el-border-radius-base);box-shadow:var(--el-box-shadow-light)}.el-color-picker__panel.el-popper{border:1px solid var(--el-border-color-lighter)}.el-color-picker,.el-color-picker__panel{--el-color-picker-alpha-bg-a:#ccc;--el-color-picker-alpha-bg-b:transparent}.dark .el-color-picker,.dark .el-color-picker__panel{--el-color-picker-alpha-bg-a:#333333}.el-container{display:flex;flex-direction:row;flex:1;flex-basis:auto;box-sizing:border-box;min-width:0}.el-container.is-vertical{flex-direction:column}.el-date-table{font-size:12px;-webkit-user-select:none;user-select:none}.el-date-table.is-week-mode .el-date-table__row:hover .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table.is-week-mode .el-date-table__row:hover td.available:hover{color:var(--el-datepicker-text-color)}.el-date-table.is-week-mode .el-date-table__row:hover td:first-child .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table.is-week-mode .el-date-table__row:hover td:last-child .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table.is-week-mode .el-date-table__row.current .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td{width:32px;height:30px;padding:4px 0;box-sizing:border-box;text-align:center;cursor:pointer;position:relative}.el-date-table td .el-date-table-cell{height:30px;padding:3px 0;box-sizing:border-box}.el-date-table td .el-date-table-cell .el-date-table-cell__text{width:24px;height:24px;display:block;margin:0 auto;line-height:24px;position:absolute;left:50%;transform:translate(-50%);border-radius:50%}.el-date-table td.next-month,.el-date-table td.prev-month{color:var(--el-datepicker-off-text-color)}.el-date-table td.today{position:relative}.el-date-table td.today .el-date-table-cell__text{color:var(--el-color-primary);font-weight:700}.el-date-table td.today.end-date .el-date-table-cell__text,.el-date-table td.today.start-date .el-date-table-cell__text{color:#fff}.el-date-table td.available:hover{color:var(--el-datepicker-hover-text-color)}.el-date-table td.in-range .el-date-table-cell{background-color:var(--el-datepicker-inrange-bg-color)}.el-date-table td.in-range .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.current:not(.disabled) .el-date-table-cell__text{color:#fff;background-color:var(--el-datepicker-active-color)}.el-date-table td.current:not(.disabled):focus-visible .el-date-table-cell__text{outline:2px solid var(--el-datepicker-active-color);outline-offset:1px}.el-date-table td.end-date .el-date-table-cell,.el-date-table td.start-date .el-date-table-cell{color:#fff}.el-date-table td.end-date .el-date-table-cell__text,.el-date-table td.start-date .el-date-table-cell__text{background-color:var(--el-datepicker-active-color)}.el-date-table td.start-date .el-date-table-cell{margin-left:5px;border-top-left-radius:15px;border-bottom-left-radius:15px}.el-date-table td.end-date .el-date-table-cell{margin-right:5px;border-top-right-radius:15px;border-bottom-right-radius:15px}.el-date-table td.disabled .el-date-table-cell{background-color:var(--el-fill-color-light);opacity:1;cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-date-table td.selected .el-date-table-cell{margin-left:5px;margin-right:5px;background-color:var(--el-datepicker-inrange-bg-color);border-radius:15px}.el-date-table td.selected .el-date-table-cell:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-date-table td.selected .el-date-table-cell__text{background-color:var(--el-datepicker-active-color);color:#fff;border-radius:15px}.el-date-table td.week{font-size:80%;color:var(--el-datepicker-header-text-color)}.el-date-table td:focus{outline:0}.el-date-table th{padding:5px;color:var(--el-datepicker-header-text-color);font-weight:400;border-bottom:solid 1px var(--el-border-color-lighter)}.el-month-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-month-table td{text-align:center;padding:8px 0;cursor:pointer}.el-month-table td div{height:48px;padding:6px 0;box-sizing:border-box}.el-month-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-month-table td.today.end-date .cell,.el-month-table td.today.start-date .cell{color:#fff}.el-month-table td.disabled .cell{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-month-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-month-table td .cell{width:60px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);margin:0 auto;border-radius:18px}.el-month-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-month-table td.in-range div{background-color:var(--el-datepicker-inrange-bg-color)}.el-month-table td.in-range div:hover{background-color:var(--el-datepicker-inrange-hover-bg-color)}.el-month-table td.end-date div,.el-month-table td.start-date div{color:#fff}.el-month-table td.end-date .cell,.el-month-table td.start-date .cell{color:#fff;background-color:var(--el-datepicker-active-color)}.el-month-table td.start-date div{border-top-left-radius:24px;border-bottom-left-radius:24px}.el-month-table td.end-date div{border-top-right-radius:24px;border-bottom-right-radius:24px}.el-month-table td.current:not(.disabled) .cell{color:var(--el-datepicker-active-color)}.el-month-table td:focus-visible{outline:0}.el-month-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color)}.el-year-table{font-size:12px;margin:-1px;border-collapse:collapse}.el-year-table .el-icon{color:var(--el-datepicker-icon-color)}.el-year-table td{text-align:center;padding:20px 3px;cursor:pointer}.el-year-table td.today .cell{color:var(--el-color-primary);font-weight:700}.el-year-table td.disabled .cell{background-color:var(--el-fill-color-light);cursor:not-allowed;color:var(--el-text-color-placeholder)}.el-year-table td.disabled .cell:hover{color:var(--el-text-color-placeholder)}.el-year-table td .cell{width:48px;height:36px;display:block;line-height:36px;color:var(--el-datepicker-text-color);border-radius:18px;margin:0 auto}.el-year-table td .cell:hover{color:var(--el-datepicker-hover-text-color)}.el-year-table td.current:not(.disabled) .cell{color:var(--el-datepicker-active-color)}.el-year-table td:focus-visible{outline:0}.el-year-table td:focus-visible .cell{outline:2px solid var(--el-datepicker-active-color)}.el-time-spinner.has-seconds .el-time-spinner__wrapper{width:33.3%}.el-time-spinner__wrapper{max-height:192px;overflow:auto;display:inline-block;width:50%;vertical-align:top;position:relative}.el-time-spinner__wrapper.el-scrollbar__wrap:not(.el-scrollbar__wrap--hidden-default){padding-bottom:15px}.el-time-spinner__wrapper.is-arrow{box-sizing:border-box;text-align:center;overflow:hidden}.el-time-spinner__wrapper.is-arrow .el-time-spinner__list{transform:translateY(-32px)}.el-time-spinner__wrapper.is-arrow .el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:default}.el-time-spinner__arrow{font-size:12px;color:var(--el-text-color-secondary);position:absolute;left:0;width:100%;z-index:var(--el-index-normal);text-align:center;height:30px;line-height:30px;cursor:pointer}.el-time-spinner__arrow:hover{color:var(--el-color-primary)}.el-time-spinner__arrow.arrow-up{top:10px}.el-time-spinner__arrow.arrow-down{bottom:10px}.el-time-spinner__input.el-input{width:70%}.el-time-spinner__input.el-input .el-input__inner{padding:0;text-align:center}.el-time-spinner__list{padding:0;margin:0;list-style:none;text-align:center}.el-time-spinner__list:after,.el-time-spinner__list:before{content:"";display:block;width:100%;height:80px}.el-time-spinner__item{height:32px;line-height:32px;font-size:12px;color:var(--el-text-color-regular)}.el-time-spinner__item:hover:not(.is-disabled):not(.is-active){background:var(--el-fill-color-light);cursor:pointer}.el-time-spinner__item.is-active:not(.is-disabled){color:var(--el-text-color-primary);font-weight:700}.el-time-spinner__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-picker__popper{--el-datepicker-border-color:var(--el-disabled-border-color)}.el-picker__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-datepicker-border-color);box-shadow:var(--el-box-shadow-light)}.el-picker__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-datepicker-border-color)}.el-picker__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-picker__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-date-editor{--el-date-editor-width:220px;--el-date-editor-monthrange-width:300px;--el-date-editor-daterange-width:350px;--el-date-editor-datetimerange-width:400px;--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);position:relative;display:inline-block;text-align:left}.el-date-editor.el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-date-editor.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-date-editor.el-input,.el-date-editor.el-input__wrapper{width:var(--el-date-editor-width);height:var(--el-input-height,var(--el-component-size))}.el-date-editor--monthrange{--el-date-editor-width:var(--el-date-editor-monthrange-width)}.el-date-editor--daterange,.el-date-editor--timerange{--el-date-editor-width:var(--el-date-editor-daterange-width)}.el-date-editor--datetimerange{--el-date-editor-width:var(--el-date-editor-datetimerange-width)}.el-date-editor--dates .el-input__wrapper{text-overflow:ellipsis;white-space:nowrap}.el-date-editor .close-icon,.el-date-editor .clear-icon{cursor:pointer}.el-date-editor .clear-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__icon{height:inherit;font-size:14px;color:var(--el-text-color-placeholder);float:left}.el-date-editor .el-range__icon svg{vertical-align:middle}.el-date-editor .el-range-input{-webkit-appearance:none;appearance:none;border:none;outline:0;display:inline-block;height:100%;margin:0;padding:0;width:39%;text-align:center;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);background-color:transparent}.el-date-editor .el-range-input::placeholder{color:var(--el-text-color-placeholder)}.el-date-editor .el-range-separator{flex:1;display:inline-flex;justify-content:center;align-items:center;height:100%;padding:0 5px;margin:0;font-size:14px;word-break:keep-all;color:var(--el-text-color-primary)}.el-date-editor .el-range__close-icon{font-size:14px;color:var(--el-text-color-placeholder);height:inherit;width:unset;cursor:pointer}.el-date-editor .el-range__close-icon:hover{color:var(--el-text-color-secondary)}.el-date-editor .el-range__close-icon svg{vertical-align:middle}.el-date-editor .el-range__close-icon--hidden{opacity:0;visibility:hidden}.el-range-editor.el-input__wrapper{display:inline-flex;align-items:center;padding:0 10px}.el-range-editor .el-range-input{line-height:1}.el-range-editor.is-active,.el-range-editor.is-active:hover{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-range-editor--large{line-height:var(--el-component-size-large)}.el-range-editor--large.el-input__wrapper{height:var(--el-component-size-large)}.el-range-editor--large .el-range-separator{line-height:40px;font-size:14px}.el-range-editor--large .el-range-input{font-size:14px}.el-range-editor--small{line-height:var(--el-component-size-small)}.el-range-editor--small.el-input__wrapper{height:var(--el-component-size-small)}.el-range-editor--small .el-range-separator{line-height:24px;font-size:12px}.el-range-editor--small .el-range-input{font-size:12px}.el-range-editor.is-disabled{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled:focus,.el-range-editor.is-disabled:hover{border-color:var(--el-disabled-border-color)}.el-range-editor.is-disabled input{background-color:var(--el-disabled-bg-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-range-editor.is-disabled input::placeholder{color:var(--el-text-color-placeholder)}.el-range-editor.is-disabled .el-range-separator{color:var(--el-disabled-text-color)}.el-picker-panel{color:var(--el-text-color-regular);background:var(--el-bg-color-overlay);border-radius:var(--el-border-radius-base);line-height:30px}.el-picker-panel .el-time-panel{margin:5px 0;border:solid 1px var(--el-datepicker-border-color);background-color:var(--el-bg-color-overlay);box-shadow:var(--el-box-shadow-light)}.el-picker-panel__body-wrapper:after,.el-picker-panel__body:after{content:"";display:table;clear:both}.el-picker-panel__content{position:relative;margin:15px}.el-picker-panel__footer{border-top:1px solid var(--el-datepicker-inner-border-color);padding:4px 12px;text-align:right;background-color:var(--el-bg-color-overlay);position:relative;font-size:0}.el-picker-panel__shortcut{display:block;width:100%;border:0;background-color:transparent;line-height:28px;font-size:14px;color:var(--el-datepicker-text-color);padding-left:12px;text-align:left;outline:0;cursor:pointer}.el-picker-panel__shortcut:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__shortcut.active{background-color:#e6f1fe;color:var(--el-datepicker-active-color)}.el-picker-panel__btn{border:1px solid var(--el-fill-color-darker);color:var(--el-text-color-primary);line-height:24px;border-radius:2px;padding:0 20px;cursor:pointer;background-color:transparent;outline:0;font-size:12px}.el-picker-panel__btn[disabled]{color:var(--el-text-color-disabled);cursor:not-allowed}.el-picker-panel__icon-btn{font-size:12px;color:var(--el-datepicker-icon-color);border:0;background:0 0;cursor:pointer;outline:0;margin-top:8px}.el-picker-panel__icon-btn:hover{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn:focus-visible{color:var(--el-datepicker-hover-text-color)}.el-picker-panel__icon-btn.is-disabled{color:var(--el-text-color-disabled)}.el-picker-panel__icon-btn.is-disabled:hover{cursor:not-allowed}.el-picker-panel__icon-btn .el-icon{cursor:pointer;font-size:inherit}.el-picker-panel__link-btn{vertical-align:middle}.el-picker-panel [slot=sidebar],.el-picker-panel__sidebar{position:absolute;top:0;bottom:0;width:110px;border-right:1px solid var(--el-datepicker-inner-border-color);box-sizing:border-box;padding-top:6px;background-color:var(--el-bg-color-overlay);overflow:auto}.el-picker-panel [slot=sidebar]+.el-picker-panel__body,.el-picker-panel__sidebar+.el-picker-panel__body{margin-left:110px}.el-date-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:322px}.el-date-picker.has-sidebar.has-time{width:434px}.el-date-picker.has-sidebar{width:438px}.el-date-picker.has-time .el-picker-panel__body-wrapper{position:relative}.el-date-picker .el-picker-panel__content{width:292px}.el-date-picker table{table-layout:fixed;width:100%}.el-date-picker__editor-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-picker__header{margin:12px;text-align:center}.el-date-picker__header--bordered{margin-bottom:0;padding-bottom:12px;border-bottom:solid 1px var(--el-border-color-lighter)}.el-date-picker__header--bordered+.el-picker-panel__content{margin-top:0}.el-date-picker__header-label{font-size:16px;font-weight:500;padding:0 5px;line-height:22px;text-align:center;cursor:pointer;color:var(--el-text-color-regular)}.el-date-picker__header-label:hover{color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label:focus-visible{outline:0;color:var(--el-datepicker-hover-text-color)}.el-date-picker__header-label.active{color:var(--el-datepicker-active-color)}.el-date-picker__prev-btn{float:left}.el-date-picker__next-btn{float:right}.el-date-picker__time-wrap{padding:10px;text-align:center}.el-date-picker__time-label{float:left;cursor:pointer;line-height:30px;margin-left:10px}.el-date-picker .el-time-panel{position:absolute}.el-date-range-picker{--el-datepicker-text-color:var(--el-text-color-regular);--el-datepicker-off-text-color:var(--el-text-color-placeholder);--el-datepicker-header-text-color:var(--el-text-color-regular);--el-datepicker-icon-color:var(--el-text-color-primary);--el-datepicker-border-color:var(--el-disabled-border-color);--el-datepicker-inner-border-color:var(--el-border-color-light);--el-datepicker-inrange-bg-color:var(--el-border-color-extra-light);--el-datepicker-inrange-hover-bg-color:var(--el-border-color-extra-light);--el-datepicker-active-color:var(--el-color-primary);--el-datepicker-hover-text-color:var(--el-color-primary);width:646px}.el-date-range-picker.has-sidebar{width:756px}.el-date-range-picker table{table-layout:fixed;width:100%}.el-date-range-picker .el-picker-panel__body{min-width:513px}.el-date-range-picker .el-picker-panel__content{margin:0}.el-date-range-picker__header{position:relative;text-align:center;height:28px}.el-date-range-picker__header [class*=arrow-left]{float:left}.el-date-range-picker__header [class*=arrow-right]{float:right}.el-date-range-picker__header div{font-size:16px;font-weight:500;margin-right:50px}.el-date-range-picker__content{float:left;width:50%;box-sizing:border-box;margin:0;padding:16px}.el-date-range-picker__content.is-left{border-right:1px solid var(--el-datepicker-inner-border-color)}.el-date-range-picker__content .el-date-range-picker__header div{margin-left:50px;margin-right:50px}.el-date-range-picker__editors-wrap{box-sizing:border-box;display:table-cell}.el-date-range-picker__editors-wrap.is-right{text-align:right}.el-date-range-picker__time-header{position:relative;border-bottom:1px solid var(--el-datepicker-inner-border-color);font-size:12px;padding:8px 5px 5px;display:table;width:100%;box-sizing:border-box}.el-date-range-picker__time-header>.el-icon-arrow-right{font-size:20px;vertical-align:middle;display:table-cell;color:var(--el-datepicker-icon-color)}.el-date-range-picker__time-picker-wrap{position:relative;display:table-cell;padding:0 5px}.el-date-range-picker__time-picker-wrap .el-picker-panel{position:absolute;top:13px;right:0;z-index:1;background:#fff}.el-date-range-picker__time-picker-wrap .el-time-panel{position:absolute}.el-time-range-picker{width:354px;overflow:visible}.el-time-range-picker__content{position:relative;text-align:center;padding:10px;z-index:1}.el-time-range-picker__cell{box-sizing:border-box;margin:0;padding:4px 7px 7px;width:50%;display:inline-block}.el-time-range-picker__header{margin-bottom:5px;text-align:center;font-size:14px}.el-time-range-picker__body{border-radius:2px;border:1px solid var(--el-datepicker-border-color)}.el-time-panel{border-radius:2px;position:relative;width:180px;left:0;z-index:var(--el-index-top);-webkit-user-select:none;user-select:none;box-sizing:content-box}.el-time-panel__content{font-size:0;position:relative;overflow:hidden}.el-time-panel__content:after,.el-time-panel__content:before{content:"";top:50%;position:absolute;margin-top:-16px;height:32px;z-index:-1;left:0;right:0;box-sizing:border-box;padding-top:6px;text-align:left}.el-time-panel__content:after{left:50%;margin-left:12%;margin-right:12%}.el-time-panel__content:before{padding-left:50%;margin-right:12%;margin-left:12%;border-top:1px solid var(--el-border-color-light);border-bottom:1px solid var(--el-border-color-light)}.el-time-panel__content.has-seconds:after{left:66.6666666667%}.el-time-panel__content.has-seconds:before{padding-left:33.3333333333%}.el-time-panel__footer{border-top:1px solid var(--el-timepicker-inner-border-color,var(--el-border-color-light));padding:4px;height:36px;line-height:25px;text-align:right;box-sizing:border-box}.el-time-panel__btn{border:none;line-height:28px;padding:0 5px;margin:0 5px;cursor:pointer;background-color:transparent;outline:0;font-size:12px;color:var(--el-text-color-primary)}.el-time-panel__btn.confirm{font-weight:800;color:var(--el-timepicker-active-color,var(--el-color-primary))}.el-descriptions{--el-descriptions-table-border:1px solid var(--el-border-color-lighter);--el-descriptions-item-bordered-label-background:var(--el-fill-color-light);box-sizing:border-box;font-size:var(--el-font-size-base);color:var(--el-text-color-primary)}.el-descriptions__header{display:flex;justify-content:space-between;align-items:center;margin-bottom:16px}.el-descriptions__title{color:var(--el-text-color-primary);font-size:16px;font-weight:700}.el-descriptions__body{background-color:var(--el-fill-color-blank)}.el-descriptions__body .el-descriptions__table{border-collapse:collapse;width:100%}.el-descriptions__body .el-descriptions__table .el-descriptions__cell{box-sizing:border-box;text-align:left;font-weight:400;line-height:23px;font-size:14px}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-left{text-align:left}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-center{text-align:center}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-right{text-align:right}.el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{border:var(--el-descriptions-table-border);padding:8px 11px}.el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:12px}.el-descriptions--large{font-size:14px}.el-descriptions--large .el-descriptions__header{margin-bottom:20px}.el-descriptions--large .el-descriptions__header .el-descriptions__title{font-size:16px}.el-descriptions--large .el-descriptions__body .el-descriptions__table .el-descriptions__cell{font-size:14px}.el-descriptions--large .el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{padding:12px 15px}.el-descriptions--large .el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:16px}.el-descriptions--small{font-size:12px}.el-descriptions--small .el-descriptions__header{margin-bottom:12px}.el-descriptions--small .el-descriptions__header .el-descriptions__title{font-size:14px}.el-descriptions--small .el-descriptions__body .el-descriptions__table .el-descriptions__cell{font-size:12px}.el-descriptions--small .el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{padding:4px 7px}.el-descriptions--small .el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:8px}.el-descriptions__label.el-descriptions__cell.is-bordered-label{font-weight:700;color:var(--el-text-color-regular);background:var(--el-descriptions-item-bordered-label-background)}.el-descriptions__label:not(.is-bordered-label){color:var(--el-text-color-primary);margin-right:16px}.el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:6px}.el-descriptions__content.el-descriptions__cell.is-bordered-content{color:var(--el-text-color-primary)}.el-descriptions__content:not(.is-bordered-label){color:var(--el-text-color-regular)}.el-descriptions--large .el-descriptions__label:not(.is-bordered-label){margin-right:16px}.el-descriptions--large .el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:8px}.el-descriptions--small .el-descriptions__label:not(.is-bordered-label){margin-right:12px}.el-descriptions--small .el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:4px}:root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:.5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{to{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-dialog{--el-dialog-width:50%;--el-dialog-margin-top:15vh;--el-dialog-bg-color:var(--el-bg-color);--el-dialog-box-shadow:var(--el-box-shadow);--el-dialog-title-font-size:var(--el-font-size-large);--el-dialog-content-font-size:14px;--el-dialog-font-line-height:var(--el-font-line-height-primary);--el-dialog-padding-primary:20px;--el-dialog-border-radius:var(--el-border-radius-small);position:relative;margin:var(--el-dialog-margin-top,15vh) auto 50px;background:var(--el-dialog-bg-color);border-radius:var(--el-dialog-border-radius);box-shadow:var(--el-dialog-box-shadow);box-sizing:border-box;width:var(--el-dialog-width,50%)}.el-dialog:focus{outline:0!important}.el-dialog.is-fullscreen{--el-dialog-width:100%;--el-dialog-margin-top:0;margin-bottom:0;height:100%;overflow:auto}.el-dialog__wrapper{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto;margin:0}.el-dialog.is-draggable .el-dialog__header{cursor:move;-webkit-user-select:none;user-select:none}.el-dialog__header{padding:var(--el-dialog-padding-primary);padding-bottom:10px;margin-right:16px;word-break:break-all}.el-dialog__headerbtn{position:absolute;top:6px;right:0;padding:0;width:54px;height:54px;background:0 0;border:none;outline:0;cursor:pointer;font-size:var(--el-message-close-size,16px)}.el-dialog__headerbtn .el-dialog__close{color:var(--el-color-info);font-size:inherit}.el-dialog__headerbtn:focus .el-dialog__close,.el-dialog__headerbtn:hover .el-dialog__close{color:var(--el-color-primary)}.el-dialog__title{line-height:var(--el-dialog-font-line-height);font-size:var(--el-dialog-title-font-size);color:var(--el-text-color-primary)}.el-dialog__body{padding:calc(var(--el-dialog-padding-primary) + 10px) var(--el-dialog-padding-primary);color:var(--el-text-color-regular);font-size:var(--el-dialog-content-font-size);word-break:break-all}.el-dialog__footer{padding:var(--el-dialog-padding-primary);padding-top:10px;text-align:right;box-sizing:border-box}.el-dialog--center{text-align:center}.el-dialog--center .el-dialog__body{text-align:initial;padding:25px calc(var(--el-dialog-padding-primary) + 5px) 30px}.el-dialog--center .el-dialog__footer{text-align:inherit}.el-overlay-dialog{position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.dialog-fade-enter-active{animation:modal-fade-in var(--el-transition-duration)}.dialog-fade-enter-active .el-overlay-dialog{animation:dialog-fade-in var(--el-transition-duration)}.dialog-fade-leave-active{animation:modal-fade-out var(--el-transition-duration)}.dialog-fade-leave-active .el-overlay-dialog{animation:dialog-fade-out var(--el-transition-duration)}@keyframes dialog-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes dialog-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}@keyframes modal-fade-in{0%{opacity:0}to{opacity:1}}@keyframes modal-fade-out{0%{opacity:1}to{opacity:0}}.el-divider{position:relative}.el-divider--horizontal{display:block;height:1px;width:100%;margin:24px 0;border-top:1px var(--el-border-color) var(--el-border-style)}.el-divider--vertical{display:inline-block;width:1px;height:1em;margin:0 8px;vertical-align:middle;position:relative;border-left:1px var(--el-border-color) var(--el-border-style)}.el-divider__text{position:absolute;background-color:var(--el-bg-color);padding:0 20px;font-weight:500;color:var(--el-text-color-primary);font-size:14px}.el-divider__text.is-left{left:20px;transform:translateY(-50%)}.el-divider__text.is-center{left:50%;transform:translate(-50%) translateY(-50%)}.el-divider__text.is-right{right:20px;transform:translateY(-50%)}.el-drawer{--el-drawer-bg-color:var(--el-dialog-bg-color, var(--el-bg-color));--el-drawer-padding-primary:var(--el-dialog-padding-primary, 20px);position:absolute;box-sizing:border-box;background-color:var(--el-drawer-bg-color);display:flex;flex-direction:column;box-shadow:var(--el-box-shadow-dark);overflow:hidden;transition:all var(--el-transition-duration)}.el-drawer .rtl,.el-drawer .ltr,.el-drawer .ttb,.el-drawer .btt{transform:translate(0)}.el-drawer__sr-focus:focus{outline:0!important}.el-drawer__header{align-items:center;color:#72767b;display:flex;margin-bottom:32px;padding:var(--el-drawer-padding-primary);padding-bottom:0}.el-drawer__header>:first-child{flex:1}.el-drawer__title{margin:0;flex:1;line-height:inherit;font-size:1rem}.el-drawer__footer{padding:var(--el-drawer-padding-primary);padding-top:10px;text-align:right}.el-drawer__close-btn{border:none;cursor:pointer;font-size:var(--el-font-size-extra-large);color:inherit;background-color:transparent;outline:0}.el-drawer__close-btn:focus i,.el-drawer__close-btn:hover i{color:var(--el-color-primary)}.el-drawer__close-btn .el-icon{font-size:inherit;vertical-align:text-bottom}.el-drawer__body{flex:1;padding:var(--el-drawer-padding-primary);overflow:auto}.el-drawer__body>*{box-sizing:border-box}.el-drawer.ltr,.el-drawer.rtl{height:100%;top:0;bottom:0}.el-drawer.btt,.el-drawer.ttb{width:100%;left:0;right:0}.el-drawer.ltr{left:0}.el-drawer.rtl{right:0}.el-drawer.ttb{top:0}.el-drawer.btt{bottom:0}.el-drawer-fade-enter-active,.el-drawer-fade-leave-active{transition:all var(--el-transition-duration)}.el-drawer-fade-enter-active,.el-drawer-fade-enter-from,.el-drawer-fade-enter-to,.el-drawer-fade-leave-active,.el-drawer-fade-leave-from,.el-drawer-fade-leave-to{overflow:hidden!important}.el-drawer-fade-enter-from,.el-drawer-fade-leave-to{opacity:0}.el-drawer-fade-enter-to,.el-drawer-fade-leave-from{opacity:1}.el-drawer-fade-enter-from .rtl,.el-drawer-fade-leave-to .rtl{transform:translate(100%)}.el-drawer-fade-enter-from .ltr,.el-drawer-fade-leave-to .ltr{transform:translate(-100%)}.el-drawer-fade-enter-from .ttb,.el-drawer-fade-leave-to .ttb{transform:translateY(-100%)}.el-drawer-fade-enter-from .btt,.el-drawer-fade-leave-to .btt{transform:translateY(100%)}.el-dropdown{--el-dropdown-menu-box-shadow:var(--el-box-shadow-light);--el-dropdown-menuItem-hover-fill:var(--el-color-primary-light-9);--el-dropdown-menuItem-hover-color:var(--el-color-primary);--el-dropdown-menu-index:10;display:inline-flex;position:relative;color:var(--el-text-color-regular);font-size:var(--el-font-size-base);line-height:1;vertical-align:top}.el-dropdown.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-dropdown__popper{--el-dropdown-menu-box-shadow:var(--el-box-shadow-light);--el-dropdown-menuItem-hover-fill:var(--el-color-primary-light-9);--el-dropdown-menuItem-hover-color:var(--el-color-primary);--el-dropdown-menu-index:10}.el-dropdown__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-dropdown-menu-box-shadow)}.el-dropdown__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-dropdown__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-dropdown__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-dropdown__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-dropdown__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-dropdown__popper .el-dropdown-menu{border:none}.el-dropdown__popper .el-dropdown__popper-selfdefine{outline:0}.el-dropdown__popper .el-scrollbar__bar{z-index:calc(var(--el-dropdown-menu-index) + 1)}.el-dropdown__popper .el-dropdown__list{list-style:none;padding:0;margin:0;box-sizing:border-box}.el-dropdown .el-dropdown__caret-button{padding-left:0;padding-right:0;display:inline-flex;justify-content:center;align-items:center;width:32px;border-left:none}.el-dropdown .el-dropdown__caret-button>span{display:inline-flex}.el-dropdown .el-dropdown__caret-button:before{content:"";position:absolute;display:block;width:1px;top:-1px;bottom:-1px;left:0;background:var(--el-overlay-color-lighter)}.el-dropdown .el-dropdown__caret-button.el-button:before{background:var(--el-border-color);opacity:.5}.el-dropdown .el-dropdown__caret-button .el-dropdown__icon{font-size:inherit;padding-left:0}.el-dropdown .el-dropdown-selfdefine{outline:0}.el-dropdown--large .el-dropdown__caret-button{width:40px}.el-dropdown--small .el-dropdown__caret-button{width:24px}.el-dropdown-menu{position:relative;top:0;left:0;z-index:var(--el-dropdown-menu-index);padding:5px 0;margin:0;background-color:var(--el-bg-color-overlay);border:none;border-radius:var(--el-border-radius-base);box-shadow:none;list-style:none}.el-dropdown-menu__item{display:flex;align-items:center;white-space:nowrap;list-style:none;line-height:22px;padding:5px 16px;margin:0;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);cursor:pointer;outline:0}.el-dropdown-menu__item:not(.is-disabled):focus{background-color:var(--el-dropdown-menuItem-hover-fill);color:var(--el-dropdown-menuItem-hover-color)}.el-dropdown-menu__item i{margin-right:5px}.el-dropdown-menu__item--divided{margin:6px 0;border-top:1px solid var(--el-border-color-lighter)}.el-dropdown-menu__item.is-disabled{cursor:not-allowed;color:var(--el-text-color-disabled)}.el-dropdown-menu--large{padding:7px 0}.el-dropdown-menu--large .el-dropdown-menu__item{padding:7px 20px;line-height:22px;font-size:14px}.el-dropdown-menu--large .el-dropdown-menu__item--divided{margin:8px 0}.el-dropdown-menu--small{padding:3px 0}.el-dropdown-menu--small .el-dropdown-menu__item{padding:2px 12px;line-height:20px;font-size:12px}.el-dropdown-menu--small .el-dropdown-menu__item--divided{margin:4px 0}.el-empty{--el-empty-padding:40px 0;--el-empty-image-width:160px;--el-empty-description-margin-top:20px;--el-empty-bottom-margin-top:20px;--el-empty-fill-color-0:var(--el-color-white);--el-empty-fill-color-1:#fcfcfd;--el-empty-fill-color-2:#f8f9fb;--el-empty-fill-color-3:#f7f8fc;--el-empty-fill-color-4:#eeeff3;--el-empty-fill-color-5:#edeef2;--el-empty-fill-color-6:#e9ebef;--el-empty-fill-color-7:#e5e7e9;--el-empty-fill-color-8:#e0e3e9;--el-empty-fill-color-9:#d5d7de;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center;box-sizing:border-box;padding:var(--el-empty-padding)}.el-empty__image{width:var(--el-empty-image-width)}.el-empty__image img{-webkit-user-select:none;user-select:none;width:100%;height:100%;vertical-align:top;object-fit:contain}.el-empty__image svg{color:var(--el-svg-monochrome-grey);fill:currentColor;width:100%;height:100%;vertical-align:top}.el-empty__description{margin-top:var(--el-empty-description-margin-top)}.el-empty__description p{margin:0;font-size:var(--el-font-size-base);color:var(--el-text-color-secondary)}.el-empty__bottom{margin-top:var(--el-empty-bottom-margin-top)}.el-footer{--el-footer-padding:0 20px;--el-footer-height:60px;padding:var(--el-footer-padding);box-sizing:border-box;flex-shrink:0;height:var(--el-footer-height)}.el-form{--el-form-label-font-size:var(--el-font-size-base)}.el-form--label-left .el-form-item__label{justify-content:flex-start}.el-form--label-top .el-form-item{display:block}.el-form--label-top .el-form-item .el-form-item__label{display:block;height:auto;text-align:left;margin-bottom:8px;line-height:22px}.el-form--inline .el-form-item{display:inline-flex;vertical-align:middle;margin-right:32px}.el-form--inline.el-form--label-top{display:flex;flex-wrap:wrap}.el-form--inline.el-form--label-top .el-form-item{display:block}.el-form--large.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:12px;line-height:22px}.el-form--default.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:8px;line-height:22px}.el-form--small.el-form--label-top .el-form-item .el-form-item__label{margin-bottom:4px;line-height:20px}.el-form-item{display:flex;--font-size:14px;margin-bottom:18px}.el-form-item .el-form-item{margin-bottom:0}.el-form-item .el-input__validateIcon{display:none}.el-form-item--large{--font-size:14px;--el-form-label-font-size:var(--font-size);margin-bottom:22px}.el-form-item--large .el-form-item__label{height:40px;line-height:40px}.el-form-item--large .el-form-item__content{line-height:40px}.el-form-item--large .el-form-item__error{padding-top:4px}.el-form-item--default{--font-size:14px;--el-form-label-font-size:var(--font-size);margin-bottom:18px}.el-form-item--default .el-form-item__label{height:32px;line-height:32px}.el-form-item--default .el-form-item__content{line-height:32px}.el-form-item--default .el-form-item__error{padding-top:2px}.el-form-item--small{--font-size:12px;--el-form-label-font-size:var(--font-size);margin-bottom:18px}.el-form-item--small .el-form-item__label{height:24px;line-height:24px}.el-form-item--small .el-form-item__content{line-height:24px}.el-form-item--small .el-form-item__error{padding-top:2px}.el-form-item__label-wrap{display:flex}.el-form-item__label{display:inline-flex;justify-content:flex-end;align-items:flex-start;flex:0 0 auto;font-size:var(--el-form-label-font-size);color:var(--el-text-color-regular);height:32px;line-height:32px;padding:0 12px 0 0;box-sizing:border-box}.el-form-item__content{display:flex;flex-wrap:wrap;align-items:center;flex:1;line-height:32px;position:relative;font-size:var(--font-size);min-width:0}.el-form-item__content .el-input-group{vertical-align:top}.el-form-item__error{color:var(--el-color-danger);font-size:12px;line-height:1;padding-top:2px;position:absolute;top:100%;left:0}.el-form-item__error--inline{position:relative;top:auto;left:auto;display:inline-block;margin-left:10px}.el-form-item.is-required:not(.is-no-asterisk)>.el-form-item__label-wrap>.el-form-item__label:before,.el-form-item.is-required:not(.is-no-asterisk)>.el-form-item__label:before{content:"*";color:var(--el-color-danger);margin-right:4px}.el-form-item.is-error .el-select-v2__wrapper,.el-form-item.is-error .el-select-v2__wrapper:focus,.el-form-item.is-error .el-textarea__inner,.el-form-item.is-error .el-textarea__inner:focus{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-form-item.is-error .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-form-item.is-error .el-input-group__append .el-input__wrapper,.el-form-item.is-error .el-input-group__prepend .el-input__wrapper{box-shadow:0 0 0 1px transparent inset}.el-form-item.is-error .el-input__validateIcon{color:var(--el-color-danger)}.el-form-item--feedback .el-input__validateIcon{display:inline-flex}.el-header{--el-header-padding:0 20px;--el-header-height:60px;padding:var(--el-header-padding);box-sizing:border-box;flex-shrink:0;height:var(--el-header-height)}.el-image-viewer__wrapper{position:fixed;top:0;right:0;bottom:0;left:0}.el-image-viewer__btn{position:absolute;z-index:1;display:flex;align-items:center;justify-content:center;border-radius:50%;opacity:.8;cursor:pointer;box-sizing:border-box;-webkit-user-select:none;user-select:none}.el-image-viewer__btn .el-icon{font-size:inherit;cursor:pointer}.el-image-viewer__close{top:40px;right:40px;width:40px;height:40px;font-size:40px}.el-image-viewer__canvas{width:100%;height:100%;display:flex;justify-content:center;align-items:center;-webkit-user-select:none;user-select:none}.el-image-viewer__actions{left:50%;bottom:30px;transform:translate(-50%);width:282px;height:44px;padding:0 23px;background-color:var(--el-text-color-regular);border-color:#fff;border-radius:22px}.el-image-viewer__actions__inner{width:100%;height:100%;text-align:justify;cursor:default;font-size:23px;color:#fff;display:flex;align-items:center;justify-content:space-around}.el-image-viewer__prev{top:50%;transform:translateY(-50%);left:40px;width:44px;height:44px;font-size:24px;color:#fff;background-color:var(--el-text-color-regular);border-color:#fff}.el-image-viewer__next{top:50%;transform:translateY(-50%);right:40px;text-indent:2px;width:44px;height:44px;font-size:24px;color:#fff;background-color:var(--el-text-color-regular);border-color:#fff}.el-image-viewer__close{width:44px;height:44px;font-size:24px;color:#fff;background-color:var(--el-text-color-regular);border-color:#fff}.el-image-viewer__mask{position:absolute;width:100%;height:100%;top:0;left:0;opacity:.5;background:#000}.viewer-fade-enter-active{animation:viewer-fade-in var(--el-transition-duration)}.viewer-fade-leave-active{animation:viewer-fade-out var(--el-transition-duration)}@keyframes viewer-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes viewer-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}.el-image__error,.el-image__inner,.el-image__placeholder{width:100%;height:100%}.el-image__error,.el-image__placeholder{position:absolute;top:0;left:0}.el-image{position:relative;display:inline-block;overflow:hidden}.el-image__inner{vertical-align:top}.el-image__placeholder{background:var(--el-fill-color-light)}.el-image__error{display:flex;justify-content:center;align-items:center;font-size:14px;background:var(--el-fill-color-light);color:var(--el-text-color-placeholder);vertical-align:middle}.el-image__preview{cursor:pointer}.el-input-number{position:relative;display:inline-block;width:150px;line-height:30px}.el-input-number .el-input__wrapper{padding-left:42px;padding-right:42px}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;text-align:center}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{margin:0;-webkit-appearance:none}.el-input-number__decrease,.el-input-number__increase{display:flex;justify-content:center;align-items:center;height:auto;position:absolute;z-index:1;top:1px;bottom:1px;width:32px;background:var(--el-fill-color-light);color:var(--el-text-color-regular);cursor:pointer;font-size:13px;-webkit-user-select:none;user-select:none}.el-input-number__decrease:hover,.el-input-number__increase:hover{color:var(--el-color-primary)}.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input_wrapper,.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input_wrapper{box-shadow:0 0 0 1px var(--el-input-focus-border-color,var(--el-color-primary)) inset}.el-input-number__decrease.is-disabled,.el-input-number__increase.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{right:1px;border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;border-left:var(--el-border)}.el-input-number__decrease{left:1px;border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border)}.el-input-number.is-disabled .el-input-number__decrease,.el-input-number.is-disabled .el-input-number__increase{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__decrease:hover,.el-input-number.is-disabled .el-input-number__increase:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{width:180px;line-height:38px}.el-input-number--large .el-input-number__decrease,.el-input-number--large .el-input-number__increase{width:40px;font-size:14px}.el-input-number--large .el-input__wrapper{padding-left:47px;padding-right:47px}.el-input-number--small{width:120px;line-height:22px}.el-input-number--small .el-input-number__decrease,.el-input-number--small .el-input-number__increase{width:24px;font-size:12px}.el-input-number--small .el-input__wrapper{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__decrease [class*=el-icon],.el-input-number--small .el-input-number__increase [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__wrapper{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__wrapper{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__decrease,.el-input-number.is-controls-right .el-input-number__increase{--el-input-number-controls-height:15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon],.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{bottom:auto;left:auto;border-radius:0 var(--el-border-radius-base) 0 0;border-bottom:var(--el-border)}.el-input-number.is-controls-right .el-input-number__decrease{right:1px;top:auto;left:auto;border-right:none;border-left:var(--el-border);border-radius:0 0 var(--el-border-radius-base) 0}.el-input-number.is-controls-right[class*=large] [class*=decrease],.el-input-number.is-controls-right[class*=large] [class*=increase]{--el-input-number-controls-height:19px}.el-input-number.is-controls-right[class*=small] [class*=decrease],.el-input-number.is-controls-right[class*=small] [class*=increase]{--el-input-number-controls-height:11px}.el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);position:relative;display:inline-block;width:100%;vertical-align:bottom;font-size:var(--el-font-size-base)}.el-textarea__inner{position:relative;display:block;resize:vertical;padding:5px 11px;line-height:1.5;box-sizing:border-box;width:100%;font-size:inherit;font-family:inherit;color:var(--el-input-text-color,var(--el-text-color-regular));background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;-webkit-appearance:none;box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));transition:var(--el-transition-box-shadow);border:none}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-textarea__inner:focus{outline:0;box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-textarea .el-input__count{color:var(--el-color-info);background:var(--el-fill-color-blank);position:absolute;font-size:12px;line-height:14px;bottom:5px;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{border-color:var(--el-color-danger)}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border);--el-input-hover-border:var(--el-border-color-hover);--el-input-focus-border:var(--el-color-primary);--el-input-transparent-border:0 0 0 1px transparent inset;--el-input-border-color:var(--el-border-color);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-fill-color-blank);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border-color:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border-color:var(--el-color-primary);--el-input-height:var(--el-component-size);position:relative;font-size:var(--el-font-size-base);display:inline-flex;width:100%;line-height:var(--el-input-height);box-sizing:border-box}.el-input::-webkit-scrollbar{z-index:11;width:6px}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{border-radius:5px;width:6px;background:var(--el-text-color-disabled)}.el-input::-webkit-scrollbar-corner{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track{background:var(--el-fill-color-blank)}.el-input::-webkit-scrollbar-track-piece{background:var(--el-fill-color-blank);width:6px}.el-input .el-input__clear,.el-input .el-input__password{color:var(--el-input-icon-color);font-size:14px;cursor:pointer}.el-input .el-input__clear:hover,.el-input .el-input__password:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{height:100%;display:inline-flex;align-items:center;color:var(--el-color-info);font-size:12px}.el-input .el-input__count .el-input__count-inner{background:var(--el-fill-color-blank);line-height:initial;display:inline-block;padding-left:8px}.el-input__wrapper{display:inline-flex;flex-grow:1;align-items:center;justify-content:center;padding:1px 11px;background-color:var(--el-input-bg-color,var(--el-fill-color-blank));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));transition:var(--el-transition-box-shadow);box-shadow:0 0 0 1px var(--el-input-border-color,var(--el-border-color)) inset}.el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-input-hover-border-color) inset}.el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-input-focus-border-color) inset}.el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 32px) - 2px);width:100%;flex-grow:1;-webkit-appearance:none;color:var(--el-input-text-color,var(--el-text-color-regular));font-size:inherit;height:var(--el-input-inner-height);line-height:var(--el-input-inner-height);padding:0;outline:0;border:none;background:0 0;box-sizing:border-box}.el-input__inner:focus{outline:0}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner[type=password]::-ms-reveal{display:none}.el-input__prefix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__prefix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__prefix-inner>:last-child{margin-right:8px}.el-input__prefix-inner>:first-child,.el-input__prefix-inner>:first-child.el-input__icon{margin-left:0}.el-input__suffix{display:inline-flex;white-space:nowrap;flex-shrink:0;flex-wrap:nowrap;height:100%;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__suffix-inner{pointer-events:all;display:inline-flex;align-items:center;justify-content:center}.el-input__suffix-inner>:first-child{margin-left:8px}.el-input .el-input__icon{height:inherit;line-height:inherit;display:flex;justify-content:center;align-items:center;transition:all var(--el-transition-duration);margin-left:8px}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__wrapper{box-shadow:0 0 0 1px var(--el-input-focus-color,) inset}.el-input.is-disabled{cursor:not-allowed}.el-input.is-disabled .el-input__wrapper{background-color:var(--el-disabled-bg-color);box-shadow:0 0 0 1px var(--el-disabled-border-color) inset}.el-input.is-disabled .el-input__inner{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__wrapper{box-shadow:0 0 0 1px var(--el-color-danger) inset}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--large{--el-input-height:var(--el-component-size-large);font-size:14px}.el-input--large .el-input__wrapper{padding:1px 15px}.el-input--large .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 40px) - 2px)}.el-input--small{--el-input-height:var(--el-component-size-small);font-size:12px}.el-input--small .el-input__wrapper{padding:1px 7px}.el-input--small .el-input__inner{--el-input-inner-height:calc(var(--el-input-height, 24px) - 2px)}.el-input-group{display:inline-flex;width:100%;align-items:stretch}.el-input-group__append,.el-input-group__prepend{background-color:var(--el-fill-color-light);color:var(--el-color-info);position:relative;display:inline-flex;align-items:center;justify-content:center;min-height:100%;border-radius:var(--el-input-border-radius);padding:0 20px;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:0}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:0 -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-input__wrapper,.el-input-group__append div.el-select:hover .el-input__wrapper,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-input__wrapper,.el-input-group__prepend div.el-select:hover .el-input__wrapper{border-color:transparent;background-color:transparent;color:inherit}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-right:0;border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group__append{border-left:0;border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--prepend>.el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-input-group__prepend .el-select .el-input .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select .el-input .el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0;box-shadow:1px 0 0 0 var(--el-input-border-color) inset,0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__wrapper{box-shadow:1px 0 0 0 var(--el-input-focus-border-color) inset,1px 0 0 0 var(--el-input-focus-border-color),0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important;z-index:2}.el-input-group--prepend .el-input-group__prepend .el-select .el-input.is-focus .el-input__wrapper:focus{outline:0;z-index:2;box-shadow:1px 0 0 0 var(--el-input-focus-border-color) inset,1px 0 0 0 var(--el-input-focus-border-color),0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important}.el-input-group--prepend .el-input-group__prepend .el-select:hover .el-input__inner{box-shadow:none!important}.el-input-group--prepend .el-input-group__prepend .el-select:hover .el-input__wrapper{z-index:1;box-shadow:1px 0 0 0 var(--el-input-hover-border-color) inset,1px 0 0 0 var(--el-input-hover-border-color),0 1px 0 0 var(--el-input-hover-border-color) inset,0 -1px 0 0 var(--el-input-hover-border-color) inset!important}.el-input-group--append>.el-input__wrapper{border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group--append .el-input-group__append .el-select .el-input .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select .el-input .el-input__wrapper{border-top-left-radius:0;border-bottom-left-radius:0;box-shadow:0 1px 0 0 var(--el-input-border-color) inset,0 -1px 0 0 var(--el-input-border-color) inset,-1px 0 0 0 var(--el-input-border-color) inset}.el-input-group--append .el-input-group__append .el-select .el-input.is-focus .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select .el-input.is-focus .el-input__wrapper{z-index:2;box-shadow:-1px 0 0 0 var(--el-input-focus-border-color),-1px 0 0 0 var(--el-input-focus-border-color) inset,0 1px 0 0 var(--el-input-focus-border-color) inset,0 -1px 0 0 var(--el-input-focus-border-color) inset!important}.el-input-group--append .el-input-group__append .el-select:hover .el-input__inner{box-shadow:none!important}.el-input-group--append .el-input-group__append .el-select:hover .el-input__wrapper{z-index:1;box-shadow:-1px 0 0 0 var(--el-input-hover-border-color),-1px 0 0 0 var(--el-input-hover-border-color) inset,0 1px 0 0 var(--el-input-hover-border-color) inset,0 -1px 0 0 var(--el-input-hover-border-color) inset!important}.el-link{--el-link-font-size:var(--el-font-size-base);--el-link-font-weight:var(--el-font-weight-primary);--el-link-text-color:var(--el-text-color-regular);--el-link-hover-text-color:var(--el-color-primary);--el-link-disabled-text-color:var(--el-text-color-placeholder);display:inline-flex;flex-direction:row;align-items:center;justify-content:center;vertical-align:middle;position:relative;text-decoration:none;outline:0;cursor:pointer;padding:0;font-size:var(--el-link-font-size);font-weight:var(--el-link-font-weight);color:var(--el-link-text-color)}.el-link:hover{color:var(--el-link-hover-text-color)}.el-link.is-underline:hover:after{content:"";position:absolute;left:0;right:0;height:0;bottom:0;border-bottom:1px solid var(--el-link-hover-text-color)}.el-link.is-disabled{color:var(--el-link-disabled-text-color);cursor:not-allowed}.el-link [class*=el-icon-]+span{margin-left:5px}.el-link.el-link--default:after{border-color:var(--el-link-hover-text-color)}.el-link__inner{display:inline-flex;justify-content:center;align-items:center}.el-link.el-link--primary{--el-link-text-color:var(--el-color-primary);--el-link-hover-text-color:var(--el-color-primary-light-3);--el-link-disabled-text-color:var(--el-color-primary-light-5)}.el-link.el-link--primary:after{border-color:var(--el-link-text-color)}.el-link.el-link--primary.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--success{--el-link-text-color:var(--el-color-success);--el-link-hover-text-color:var(--el-color-success-light-3);--el-link-disabled-text-color:var(--el-color-success-light-5)}.el-link.el-link--success:after{border-color:var(--el-link-text-color)}.el-link.el-link--success.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--warning{--el-link-text-color:var(--el-color-warning);--el-link-hover-text-color:var(--el-color-warning-light-3);--el-link-disabled-text-color:var(--el-color-warning-light-5)}.el-link.el-link--warning:after{border-color:var(--el-link-text-color)}.el-link.el-link--warning.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--danger{--el-link-text-color:var(--el-color-danger);--el-link-hover-text-color:var(--el-color-danger-light-3);--el-link-disabled-text-color:var(--el-color-danger-light-5)}.el-link.el-link--danger:after{border-color:var(--el-link-text-color)}.el-link.el-link--danger.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--error{--el-link-text-color:var(--el-color-error);--el-link-hover-text-color:var(--el-color-error-light-3);--el-link-disabled-text-color:var(--el-color-error-light-5)}.el-link.el-link--error:after{border-color:var(--el-link-text-color)}.el-link.el-link--error.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--info{--el-link-text-color:var(--el-color-info);--el-link-hover-text-color:var(--el-color-info-light-3);--el-link-disabled-text-color:var(--el-color-info-light-5)}.el-link.el-link--info:after{border-color:var(--el-link-text-color)}.el-link.el-link--info.is-underline:hover:after{border-color:var(--el-link-text-color)}:root{--el-loading-spinner-size:42px;--el-loading-fullscreen-spinner-size:50px}.el-loading-parent--relative{position:relative!important}.el-loading-parent--hidden{overflow:hidden!important}.el-loading-mask{position:absolute;z-index:2000;background-color:var(--el-mask-color);margin:0;top:0;right:0;bottom:0;left:0;transition:opacity var(--el-transition-duration)}.el-loading-mask.is-fullscreen{position:fixed}.el-loading-mask.is-fullscreen .el-loading-spinner{margin-top:calc((0px - var(--el-loading-fullscreen-spinner-size))/ 2)}.el-loading-mask.is-fullscreen .el-loading-spinner .circular{height:var(--el-loading-fullscreen-spinner-size);width:var(--el-loading-fullscreen-spinner-size)}.el-loading-spinner{top:50%;margin-top:calc((0px - var(--el-loading-spinner-size))/ 2);width:100%;text-align:center;position:absolute}.el-loading-spinner .el-loading-text{color:var(--el-color-primary);margin:3px 0;font-size:14px}.el-loading-spinner .circular{display:inline;height:var(--el-loading-spinner-size);width:var(--el-loading-spinner-size);animation:loading-rotate 2s linear infinite}.el-loading-spinner .path{animation:loading-dash 1.5s ease-in-out infinite;stroke-dasharray:90,150;stroke-dashoffset:0;stroke-width:2;stroke:var(--el-color-primary);stroke-linecap:round}.el-loading-spinner i{color:var(--el-color-primary)}.el-loading-fade-enter-from,.el-loading-fade-leave-to{opacity:0}@keyframes loading-rotate{to{transform:rotate(360deg)}}@keyframes loading-dash{0%{stroke-dasharray:1,200;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-40px}to{stroke-dasharray:90,150;stroke-dashoffset:-120px}}.el-main{--el-main-padding:20px;display:block;flex:1;flex-basis:auto;overflow:auto;box-sizing:border-box;padding:var(--el-main-padding)}:root{--el-menu-active-color:var(--el-color-primary);--el-menu-text-color:var(--el-text-color-primary);--el-menu-hover-text-color:var(--el-color-primary);--el-menu-bg-color:var(--el-fill-color-blank);--el-menu-hover-bg-color:var(--el-color-primary-light-9);--el-menu-item-height:56px;--el-menu-sub-item-height:calc(var(--el-menu-item-height) - 6px);--el-menu-horizontal-sub-item-height:36px;--el-menu-item-font-size:var(--el-font-size-base);--el-menu-item-hover-fill:var(--el-color-primary-light-9);--el-menu-border-color:var(--el-border-color);--el-menu-base-level-padding:20px;--el-menu-level-padding:20px;--el-menu-icon-width:24px;--el-menu-icon-transform-closed:none;--el-menu-icon-transform-open:rotateZ(180deg)}.el-menu{border-right:solid 1px var(--el-menu-border-color);list-style:none;position:relative;margin:0;padding-left:0;background-color:var(--el-menu-bg-color);box-sizing:border-box}.el-menu--vertical:not(.el-menu--collapse):not(.el-menu--popup-container) .el-menu-item,.el-menu--vertical:not(.el-menu--collapse):not(.el-menu--popup-container) .el-menu-item-group__title,.el-menu--vertical:not(.el-menu--collapse):not(.el-menu--popup-container) .el-sub-menu__title{padding-left:calc(var(--el-menu-base-level-padding) + var(--el-menu-level) * var(--el-menu-level-padding))}.el-menu--horizontal{display:flex;flex-wrap:nowrap;border-bottom:solid 1px var(--el-menu-border-color);border-right:none}.el-menu--horizontal>.el-menu-item{display:inline-flex;justify-content:center;align-items:center;height:100%;margin:0;border-bottom:2px solid transparent;color:var(--el-menu-text-color)}.el-menu--horizontal>.el-menu-item a,.el-menu--horizontal>.el-menu-item a:hover{color:inherit}.el-menu--horizontal>.el-menu-item:not(.is-disabled):focus,.el-menu--horizontal>.el-menu-item:not(.is-disabled):hover{background-color:#fff}.el-menu--horizontal>.el-sub-menu:focus,.el-menu--horizontal>.el-sub-menu:hover{outline:0}.el-menu--horizontal>.el-sub-menu:hover .el-sub-menu__title{color:var(--el-menu-hover-text-color)}.el-menu--horizontal>.el-sub-menu.is-active .el-sub-menu__title{border-bottom:2px solid var(--el-menu-active-color);color:var(--el-menu-active-color)}.el-menu--horizontal>.el-sub-menu .el-sub-menu__title{height:100%;border-bottom:2px solid transparent;color:var(--el-menu-text-color)}.el-menu--horizontal>.el-sub-menu .el-sub-menu__title:hover{background-color:var(--el-bg-color-overlay)}.el-menu--horizontal>.el-sub-menu .el-sub-menu__icon-arrow{position:static;vertical-align:middle;margin-left:8px;margin-top:-3px}.el-menu--horizontal .el-menu .el-menu-item,.el-menu--horizontal .el-menu .el-sub-menu__title{background-color:var(--el-menu-bg-color);display:flex;align-items:center;height:var(--el-menu-horizontal-sub-item-height);padding:0 10px;color:var(--el-menu-text-color)}.el-menu--horizontal .el-menu .el-sub-menu__title{padding-right:40px}.el-menu--horizontal .el-menu .el-menu-item.is-active,.el-menu--horizontal .el-menu .el-sub-menu.is-active>.el-sub-menu__title{color:var(--el-menu-active-color)}.el-menu--horizontal .el-menu-item:not(.is-disabled):focus,.el-menu--horizontal .el-menu-item:not(.is-disabled):hover{outline:0;color:var(--el-menu-hover-text-color);background-color:var(--el-menu-hover-bg-color)}.el-menu--horizontal>.el-menu-item.is-active{border-bottom:2px solid var(--el-menu-active-color);color:var(--el-menu-active-color)!important}.el-menu--collapse{width:calc(var(--el-menu-icon-width) + var(--el-menu-base-level-padding) * 2)}.el-menu--collapse>.el-menu-item [class^=el-icon],.el-menu--collapse>.el-sub-menu>.el-sub-menu__title [class^=el-icon]{margin:0;vertical-align:middle;width:var(--el-menu-icon-width);text-align:center}.el-menu--collapse>.el-menu-item .el-sub-menu__icon-arrow,.el-menu--collapse>.el-sub-menu>.el-sub-menu__title .el-sub-menu__icon-arrow{display:none}.el-menu--collapse>.el-menu-item>span,.el-menu--collapse>.el-sub-menu>.el-sub-menu__title>span{height:0;width:0;overflow:hidden;visibility:hidden;display:inline-block}.el-menu--collapse>.el-menu-item.is-active i{color:inherit}.el-menu--collapse .el-menu .el-sub-menu{min-width:200px}.el-menu--collapse .el-sub-menu{position:relative}.el-menu--collapse .el-sub-menu .el-menu{position:absolute;margin-left:5px;top:0;left:100%;z-index:10;border:1px solid var(--el-border-color-light);border-radius:var(--el-border-radius-small);box-shadow:var(--el-box-shadow-light)}.el-menu--collapse .el-sub-menu.is-opened>.el-sub-menu__title .el-sub-menu__icon-arrow{transform:var(--el-menu-icon-transform-closed)}.el-menu--collapse .el-sub-menu.is-active .el-sub-menu__title{color:var(--el-menu-active-color)}.el-menu--popup{z-index:100;min-width:200px;border:none;padding:5px 0;border-radius:var(--el-border-radius-small);box-shadow:var(--el-box-shadow-light)}.el-menu .el-icon{flex-shrink:0}.el-menu-item{display:flex;align-items:center;height:var(--el-menu-item-height);line-height:var(--el-menu-item-height);font-size:var(--el-menu-item-font-size);color:var(--el-menu-text-color);padding:0 var(--el-menu-base-level-padding);list-style:none;cursor:pointer;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration),color var(--el-transition-duration);box-sizing:border-box;white-space:nowrap}.el-menu-item *{vertical-align:bottom}.el-menu-item i{color:inherit}.el-menu-item:focus,.el-menu-item:hover{outline:0}.el-menu-item:hover{background-color:var(--el-menu-hover-bg-color)}.el-menu-item.is-disabled{opacity:.25;cursor:not-allowed;background:0 0!important}.el-menu-item [class^=el-icon]{margin-right:5px;width:var(--el-menu-icon-width);text-align:center;font-size:18px;vertical-align:middle}.el-menu-item.is-active{color:var(--el-menu-active-color)}.el-menu-item.is-active i{color:inherit}.el-menu-item .el-menu-tooltip__trigger{position:absolute;left:0;top:0;height:100%;width:100%;display:inline-flex;align-items:center;box-sizing:border-box;padding:0 var(--el-menu-base-level-padding)}.el-sub-menu{list-style:none;margin:0;padding-left:0}.el-sub-menu__title{display:flex;align-items:center;height:var(--el-menu-item-height);line-height:var(--el-menu-item-height);font-size:var(--el-menu-item-font-size);color:var(--el-menu-text-color);padding:0 var(--el-menu-base-level-padding);list-style:none;cursor:pointer;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration),color var(--el-transition-duration);box-sizing:border-box;white-space:nowrap}.el-sub-menu__title *{vertical-align:bottom}.el-sub-menu__title i{color:inherit}.el-sub-menu__title:focus,.el-sub-menu__title:hover{outline:0}.el-sub-menu__title.is-disabled{opacity:.25;cursor:not-allowed;background:0 0!important}.el-sub-menu__title:hover{background-color:var(--el-menu-hover-bg-color)}.el-sub-menu .el-menu{border:none}.el-sub-menu .el-menu-item{height:var(--el-menu-sub-item-height);line-height:var(--el-menu-sub-item-height);min-width:200px}.el-sub-menu__hide-arrow .el-sub-menu__icon-arrow{display:none!important}.el-sub-menu.is-active .el-sub-menu__title{border-bottom-color:var(--el-menu-active-color)}.el-sub-menu.is-opened>.el-sub-menu__title .el-sub-menu__icon-arrow{transform:var(--el-menu-icon-transform-open)}.el-sub-menu.is-disabled .el-menu-item,.el-sub-menu.is-disabled .el-sub-menu__title{opacity:.25;cursor:not-allowed;background:0 0!important}.el-sub-menu .el-icon{vertical-align:middle;margin-right:5px;width:var(--el-menu-icon-width);text-align:center;font-size:18px}.el-sub-menu .el-icon.el-sub-menu__icon-more{margin-right:0!important}.el-sub-menu .el-sub-menu__icon-arrow{position:absolute;top:50%;right:var(--el-menu-base-level-padding);margin-top:-7px;transform:var(--el-menu-icon-transform-closed);transition:transform var(--el-transition-duration);font-size:12px;margin-right:0;width:inherit}.el-menu-item-group>ul{padding:0}.el-menu-item-group__title{padding:7px 0 7px var(--el-menu-base-level-padding);line-height:normal;font-size:12px;color:var(--el-text-color-secondary)}.horizontal-collapse-transition .el-sub-menu__title .el-sub-menu__icon-arrow{transition:var(--el-transition-duration-fast);opacity:0}.el-message-box{--el-messagebox-title-color:var(--el-text-color-primary);--el-messagebox-width:420px;--el-messagebox-border-radius:4px;--el-messagebox-font-size:var(--el-font-size-large);--el-messagebox-content-font-size:var(--el-font-size-base);--el-messagebox-content-color:var(--el-text-color-regular);--el-messagebox-error-font-size:12px;--el-messagebox-padding-primary:15px;display:inline-block;width:var(--el-messagebox-width);padding-bottom:10px;vertical-align:middle;background-color:var(--el-bg-color);border-radius:var(--el-messagebox-border-radius);border:1px solid var(--el-border-color-lighter);font-size:var(--el-messagebox-font-size);box-shadow:var(--el-box-shadow-light);text-align:left;overflow:hidden;-webkit-backface-visibility:hidden;backface-visibility:hidden}.el-message-box:focus{outline:0!important}.el-overlay.is-message-box .el-overlay-message-box{text-align:center;position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.el-overlay.is-message-box .el-overlay-message-box:after{content:"";display:inline-block;height:100%;width:0;vertical-align:middle}.el-message-box.is-draggable .el-message-box__header{cursor:move;-webkit-user-select:none;user-select:none}.el-message-box__header{position:relative;padding:var(--el-messagebox-padding-primary);padding-bottom:10px}.el-message-box__title{padding-left:0;margin-bottom:0;font-size:var(--el-messagebox-font-size);line-height:1;color:var(--el-messagebox-title-color)}.el-message-box__headerbtn{position:absolute;top:var(--el-messagebox-padding-primary);right:var(--el-messagebox-padding-primary);padding:0;border:none;outline:0;background:0 0;font-size:var(--el-message-close-size,16px);cursor:pointer}.el-message-box__headerbtn .el-message-box__close{color:var(--el-color-info);font-size:inherit}.el-message-box__headerbtn:focus .el-message-box__close,.el-message-box__headerbtn:hover .el-message-box__close{color:var(--el-color-primary)}.el-message-box__content{padding:10px var(--el-messagebox-padding-primary);color:var(--el-messagebox-content-color);font-size:var(--el-messagebox-content-font-size)}.el-message-box__container{position:relative}.el-message-box__input{padding-top:15px}.el-message-box__input div.invalid>input{border-color:var(--el-color-error)}.el-message-box__input div.invalid>input:focus{border-color:var(--el-color-error)}.el-message-box__status{position:absolute;top:50%;transform:translateY(-50%);font-size:24px!important}.el-message-box__status:before{padding-left:1px}.el-message-box__status.el-icon{position:absolute}.el-message-box__status+.el-message-box__message{padding-left:36px;padding-right:12px;word-break:break-word}.el-message-box__status.el-message-box-icon--success{--el-messagebox-color:var(--el-color-success);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--info{--el-messagebox-color:var(--el-color-info);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--warning{--el-messagebox-color:var(--el-color-warning);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--error{--el-messagebox-color:var(--el-color-error);color:var(--el-messagebox-color)}.el-message-box__message{margin:0}.el-message-box__message p{margin:0;line-height:24px}.el-message-box__errormsg{color:var(--el-color-error);font-size:var(--el-messagebox-error-font-size);min-height:18px;margin-top:2px}.el-message-box__btns{padding:5px 15px 0;display:flex;flex-wrap:wrap;justify-content:flex-end;align-items:center}.el-message-box__btns button:nth-child(2){margin-left:10px}.el-message-box__btns-reverse{flex-direction:row-reverse}.el-message-box--center .el-message-box__title{position:relative;display:flex;align-items:center;justify-content:center}.el-message-box--center .el-message-box__status{position:relative;top:auto;padding-right:5px;text-align:center;transform:translateY(-1px)}.el-message-box--center .el-message-box__message{margin-left:0}.el-message-box--center .el-message-box__btns{justify-content:center}.el-message-box--center .el-message-box__content{padding-left:calc(var(--el-messagebox-padding-primary) + 12px);padding-right:calc(var(--el-messagebox-padding-primary) + 12px);text-align:center}.fade-in-linear-enter-active .el-overlay-message-box{animation:msgbox-fade-in var(--el-transition-duration)}.fade-in-linear-leave-active .el-overlay-message-box{animation:msgbox-fade-in var(--el-transition-duration) reverse}@keyframes msgbox-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}to{transform:translateZ(0);opacity:1}}@keyframes msgbox-fade-out{0%{transform:translateZ(0);opacity:1}to{transform:translate3d(0,-20px,0);opacity:0}}.el-message{--el-message-min-width:380px;--el-message-bg-color:var(--el-color-info-light-9);--el-message-border-color:var(--el-border-color-lighter);--el-message-padding:15px 15px 15px 20px;--el-message-close-size:16px;--el-message-close-icon-color:var(--el-text-color-placeholder);--el-message-close-hover-color:var(--el-text-color-secondary);min-width:var(--el-message-min-width);box-sizing:border-box;border-radius:var(--el-border-radius-base);border-width:var(--el-border-width);border-style:var(--el-border-style);border-color:var(--el-message-border-color);position:fixed;left:50%;top:20px;transform:translate(-50%);transition:opacity .3s,transform .4s,top .4s;background-color:var(--el-message-bg-color);transition:opacity var(--el-transition-duration),transform .4s,top .4s;padding:var(--el-message-padding);display:flex;align-items:center}.el-message.is-center{justify-content:center}.el-message.is-closable .el-message__content{padding-right:16px}.el-message p{margin:0}.el-message--success{--el-message-bg-color:var(--el-color-success-light-9);--el-message-border-color:var(--el-color-success-light-8);--el-message-text-color:var(--el-color-success)}.el-message--success .el-message__content,.el-message .el-message-icon--success{color:var(--el-message-text-color)}.el-message--info{--el-message-bg-color:var(--el-color-info-light-9);--el-message-border-color:var(--el-color-info-light-8);--el-message-text-color:var(--el-color-info)}.el-message--info .el-message__content,.el-message .el-message-icon--info{color:var(--el-message-text-color)}.el-message--warning{--el-message-bg-color:var(--el-color-warning-light-9);--el-message-border-color:var(--el-color-warning-light-8);--el-message-text-color:var(--el-color-warning)}.el-message--warning .el-message__content,.el-message .el-message-icon--warning{color:var(--el-message-text-color)}.el-message--error{--el-message-bg-color:var(--el-color-error-light-9);--el-message-border-color:var(--el-color-error-light-8);--el-message-text-color:var(--el-color-error)}.el-message--error .el-message__content,.el-message .el-message-icon--error{color:var(--el-message-text-color)}.el-message__icon{margin-right:10px}.el-message .el-message__badge{position:absolute;top:-8px;right:-8px}.el-message__content{padding:0;font-size:14px;line-height:1}.el-message__content:focus{outline-width:0}.el-message .el-message__closeBtn{position:absolute;top:50%;right:15px;transform:translateY(-50%);cursor:pointer;color:var(--el-message-close-icon-color);font-size:var(--el-message-close-size)}.el-message .el-message__closeBtn:focus{outline-width:0}.el-message .el-message__closeBtn:hover{color:var(--el-message-close-hover-color)}.el-message-fade-enter-from,.el-message-fade-leave-to{opacity:0;transform:translate(-50%,-100%)}.el-notification{--el-notification-width:330px;--el-notification-padding:14px 26px 14px 13px;--el-notification-radius:8px;--el-notification-shadow:var(--el-box-shadow-light);--el-notification-border-color:var(--el-border-color-lighter);--el-notification-icon-size:24px;--el-notification-close-font-size:var(--el-message-close-size, 16px);--el-notification-group-margin-left:13px;--el-notification-group-margin-right:8px;--el-notification-content-font-size:var(--el-font-size-base);--el-notification-content-color:var(--el-text-color-regular);--el-notification-title-font-size:16px;--el-notification-title-color:var(--el-text-color-primary);--el-notification-close-color:var(--el-text-color-secondary);--el-notification-close-hover-color:var(--el-text-color-regular);display:flex;width:var(--el-notification-width);padding:var(--el-notification-padding);border-radius:var(--el-notification-radius);box-sizing:border-box;border:1px solid var(--el-notification-border-color);position:fixed;background-color:var(--el-bg-color-overlay);box-shadow:var(--el-notification-shadow);transition:opacity var(--el-transition-duration),transform var(--el-transition-duration),left var(--el-transition-duration),right var(--el-transition-duration),top .4s,bottom var(--el-transition-duration);overflow-wrap:anywhere;overflow:hidden;z-index:9999}.el-notification.right{right:16px}.el-notification.left{left:16px}.el-notification__group{margin-left:var(--el-notification-group-margin-left);margin-right:var(--el-notification-group-margin-right)}.el-notification__title{font-weight:700;font-size:var(--el-notification-title-font-size);line-height:var(--el-notification-icon-size);color:var(--el-notification-title-color);margin:0}.el-notification__content{font-size:var(--el-notification-content-font-size);line-height:24px;margin:6px 0 0;color:var(--el-notification-content-color);text-align:justify}.el-notification__content p{margin:0}.el-notification .el-notification__icon{height:var(--el-notification-icon-size);width:var(--el-notification-icon-size);font-size:var(--el-notification-icon-size)}.el-notification .el-notification__closeBtn{position:absolute;top:18px;right:15px;cursor:pointer;color:var(--el-notification-close-color);font-size:var(--el-notification-close-font-size)}.el-notification .el-notification__closeBtn:hover{color:var(--el-notification-close-hover-color)}.el-notification .el-notification--success{--el-notification-icon-color:var(--el-color-success);color:var(--el-notification-icon-color)}.el-notification .el-notification--info{--el-notification-icon-color:var(--el-color-info);color:var(--el-notification-icon-color)}.el-notification .el-notification--warning{--el-notification-icon-color:var(--el-color-warning);color:var(--el-notification-icon-color)}.el-notification .el-notification--error{--el-notification-icon-color:var(--el-color-error);color:var(--el-notification-icon-color)}.el-notification-fade-enter-from.right{right:0;transform:translate(100%)}.el-notification-fade-enter-from.left{left:0;transform:translate(-100%)}.el-notification-fade-leave-to{opacity:0}.el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:var(--el-overlay-color-lighter);overflow:auto}.el-overlay .el-overlay-root{height:0}.el-page-header{display:flex;line-height:24px}.el-page-header__left{display:flex;cursor:pointer;margin-right:40px;position:relative}.el-page-header__left:after{content:"";position:absolute;width:1px;height:16px;right:-20px;top:50%;transform:translateY(-50%);background-color:var(--el-border-color)}.el-page-header__icon{font-size:18px;margin-right:6px;display:flex;align-items:center}.el-page-header__icon .el-icon{font-size:inherit}.el-page-header__title{font-size:14px;font-weight:500}.el-page-header__content{font-size:18px;color:var(--el-text-color-primary)}.el-pagination{--el-pagination-font-size:14px;--el-pagination-bg-color:var(--el-fill-color-blank);--el-pagination-text-color:var(--el-text-color-primary);--el-pagination-border-radius:3px;--el-pagination-button-color:var(--el-text-color-primary);--el-pagination-button-width:32px;--el-pagination-button-height:32px;--el-pagination-button-disabled-color:var(--el-text-color-placeholder);--el-pagination-button-disabled-bg-color:var(--el-fill-color-blank);--el-pagination-button-bg-color:var(--el-fill-color);--el-pagination-hover-color:var(--el-color-primary);--el-pagination-height-extra-small:24px;--el-pagination-line-height-extra-small:var(--el-pagination-height-extra-small);white-space:nowrap;padding:2px 5px;color:var(--el-pagination-text-color);font-weight:400;display:flex;align-items:center}.el-pagination:after,.el-pagination:before{display:table;content:""}.el-pagination:after{clear:both}.el-pagination button,.el-pagination span:not([class*=suffix]){display:flex;justify-content:center;align-items:center;font-size:var(--el-pagination-font-size);min-width:var(--el-pagination-button-width);height:var(--el-pagination-button-height);line-height:var(--el-pagination-button-height);box-sizing:border-box}.el-pagination .el-input__inner{text-align:center;-moz-appearance:textfield;line-height:normal}.el-pagination .el-select .el-input{width:128px}.el-pagination button{border:none;padding:0 6px;background:0 0}.el-pagination button:focus{outline:0}.el-pagination button:hover{color:var(--el-pagination-hover-color)}.el-pagination button:disabled{color:var(--el-pagination-button-disabled-color);background-color:var(--el-pagination-button-disabled-bg-color);cursor:not-allowed}.el-pagination .btn-next,.el-pagination .btn-prev{background:center center no-repeat;background-size:16px;background-color:var(--el-pagination-bg-color);cursor:pointer;margin:0;color:var(--el-pagination-button-color)}.el-pagination .btn-next .el-icon,.el-pagination .btn-prev .el-icon{display:block;font-size:12px;font-weight:700;width:inherit}.el-pagination .el-pager li.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-pagination--small .btn-next,.el-pagination--small .btn-prev,.el-pagination--small .el-pager li,.el-pagination--small .el-pager li.btn-quicknext,.el-pagination--small .el-pager li.btn-quickprev,.el-pagination--small .el-pager li:last-child{border-color:transparent;font-size:var(--el-font-size-extra-small);line-height:var(--el-pagination-line-height-extra-small);height:var(--el-pagination-height-extra-small);min-width:24px}.el-pagination--small .arrow.is-disabled{visibility:hidden}.el-pagination--small .more:before,.el-pagination--small li.more:before{line-height:var(--el-pagination-line-height-extra-small)}.el-pagination--small button,.el-pagination--small span:not([class*=suffix]){height:var(--el-pagination-height-extra-small);line-height:var(--el-pagination-line-height-extra-small);font-size:var(--el-font-size-extra-small)}.el-pagination--small .el-pagination__editor{height:var(--el-pagination-line-height-extra-small)}.el-pagination--small .el-pagination__editor.el-input .el-input__inner{height:var(--el-pagination-height-extra-small)}.el-pagination--small .el-input--small,.el-pagination--small .el-input__inner{height:var(--el-pagination-height-extra-small)!important;line-height:var(--el-pagination-line-height-extra-small)}.el-pagination--small .el-input__suffix,.el-pagination--small .el-input__suffix .el-input__suffix-inner,.el-pagination--small .el-input__suffix .el-input__suffix-inner i.el-select__caret{line-height:var(--el-pagination-line-height-extra-small)}.el-pagination--small .el-select .el-input{width:100px}.el-pagination__sizes{margin:0 16px 0 0;font-weight:400;color:var(--el-text-color-regular)}.el-pagination__sizes+button.btn-prev[type=button]{margin-left:0}.el-pagination__sizes+.el-pager .number:first-child{margin-left:0}.el-pagination__sizes+.el-pager .number:last-child{margin-right:0}.el-pagination__total{margin-right:16px;font-weight:400;color:var(--el-text-color-regular)}.el-pagination__total+button.btn-prev[type=button]{margin-left:0}.el-pagination__total+.el-pager .number:first-child{margin-left:0}.el-pagination__total+.el-pager .number:last-child{margin-right:0}.el-pagination__total[disabled=true]{color:var(--el-text-color-placeholder)}.el-pagination__jump{margin-left:16px;font-weight:400;color:var(--el-text-color-regular)}.el-pagination__jump .el-input__inner{padding:0 3px}.el-pagination__jump[disabled=true]{color:var(--el-text-color-placeholder)}.el-pagination__rightwrapper{flex:1;display:flex;align-items:center;justify-content:flex-end}.el-pagination__editor{line-height:18px;margin:0 8px;height:var(--el-pagination-button-height);min-width:56px;text-align:center;box-sizing:border-box;border-radius:var(--el-pagination-border-radius)}.el-pagination__editor.el-input{width:50px}.el-pagination__editor.el-input .el-input__inner{height:var(--el-pagination-button-height)}.el-pagination__editor .el-input__inner::-webkit-inner-spin-button,.el-pagination__editor .el-input__inner::-webkit-outer-spin-button{-webkit-appearance:none;margin:0}.el-pagination.is-background .btn-next,.el-pagination.is-background .btn-prev,.el-pagination.is-background .el-pager li{margin:0 4px;background-color:var(--el-pagination-button-bg-color);color:var(--el-text-color-regular);min-width:32px;border-radius:2px}.el-pagination.is-background .btn-next.is-disabled,.el-pagination.is-background .btn-prev.is-disabled,.el-pagination.is-background .el-pager li.is-disabled{color:var(--el-text-color-placeholder);background-color:var(--el-disabled-bg-color)}.el-pagination.is-background .btn-next.is-first,.el-pagination.is-background .btn-prev.is-first,.el-pagination.is-background .el-pager li.is-first{margin-left:0}.el-pagination.is-background .btn-next.is-last,.el-pagination.is-background .btn-prev.is-last,.el-pagination.is-background .el-pager li.is-last{margin-right:0}.el-pagination.is-background .btn-next,.el-pagination.is-background .btn-prev{padding:0}.el-pagination.is-background .btn-next:disabled,.el-pagination.is-background .btn-prev:disabled{color:var(--el-text-color-placeholder);background-color:var(--el-disabled-bg-color)}.el-pagination.is-background .btn-next:hover:not([disabled]),.el-pagination.is-background .btn-prev:hover:not([disabled]){color:var(--el-pagination-hover-color)}.el-pagination.is-background .el-pager li:not(.is-disabled):hover{color:var(--el-pagination-hover-color)}.el-pagination.is-background .el-pager li:not(.is-disabled).is-active{background-color:var(--el-color-primary);color:var(--el-color-white);font-weight:700}.el-pagination.is-background.el-pagination--small .btn-next,.el-pagination.is-background.el-pagination--small .btn-prev,.el-pagination.is-background.el-pagination--small .el-pager li{min-width:24px}.el-pagination.is-background .el-pagination__sizes.is-last{margin-left:16px}.el-pager{-webkit-user-select:none;user-select:none;list-style:none;font-size:0;padding:0;margin:0;display:flex;align-items:center}.el-pager li{padding:0 4px;background:var(--el-pagination-bg-color);display:flex;justify-content:center;align-items:center;font-size:var(--el-pagination-font-size);min-width:var(--el-pagination-button-width);height:var(--el-pagination-button-height);line-height:var(--el-pagination-button-height);box-sizing:border-box;cursor:pointer;text-align:center;margin:0 1px}.el-pager li.btn-quickprev:hover,.el-pager li.btn-quicknext:hover{cursor:pointer}.el-pager li.btn-quicknext,.el-pager li.btn-quickprev{line-height:32px;color:var(--el-pagination-button-color)}.el-pager li.btn-quicknext.is-disabled,.el-pager li.btn-quickprev.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-pager li.btn-quicknext svg,.el-pager li.btn-quickprev svg{pointer-events:none}.el-pager li.is-active+li{border-left:0}.el-pager li:focus-visible{outline:1px solid var(--el-pagination-hover-color)}.el-pager li:hover{color:var(--el-pagination-hover-color)}.el-pager li.is-active{color:var(--el-pagination-hover-color);cursor:default}.el-pager+button.btn-next[type=button]{margin-right:0}.el-popconfirm__main{display:flex;align-items:center}.el-popconfirm__icon{margin-right:5px}.el-popconfirm__action{text-align:right;margin-top:8px}.el-popover{--el-popover-bg-color:var(--el-color-white);--el-popover-font-size:var(--el-font-size-base);--el-popover-border-color:var(--el-border-color-lighter);--el-popover-padding:12px;--el-popover-padding-large:18px 20px;--el-popover-title-font-size:16px;--el-popover-title-text-color:var(--el-text-color-primary);--el-popover-border-radius:4px}.el-popover.el-popper{background:var(--el-popover-bg-color);min-width:150px;border-radius:var(--el-popover-border-radius);border:1px solid var(--el-popover-border-color);padding:var(--el-popover-padding);z-index:var(--el-index-popper);color:var(--el-text-color-regular);line-height:1.4;text-align:justify;font-size:var(--el-popover-font-size);box-shadow:var(--el-box-shadow-light);word-break:break-all}.el-popover.el-popper--plain{padding:var(--el-popover-padding-large)}.el-popover__title{color:var(--el-popover-title-text-color);font-size:var(--el-popover-title-font-size);line-height:1;margin-bottom:12px}.el-popover__reference:focus:hover,.el-popover__reference:focus:not(.focusing){outline-width:0}.el-popover.el-popper:focus,.el-popover.el-popper:focus:active{outline-width:0}.el-progress{position:relative;line-height:1;display:flex;align-items:center}.el-progress__text{font-size:14px;color:var(--el-text-color-regular);margin-left:5px;min-width:50px;line-height:1}.el-progress__text i{vertical-align:middle;display:block}.el-progress--circle,.el-progress--dashboard{display:inline-block}.el-progress--circle .el-progress__text,.el-progress--dashboard .el-progress__text{position:absolute;top:50%;left:0;width:100%;text-align:center;margin:0;transform:translateY(-50%)}.el-progress--circle .el-progress__text i,.el-progress--dashboard .el-progress__text i{vertical-align:middle;display:inline-block}.el-progress--without-text .el-progress__text{display:none}.el-progress--without-text .el-progress-bar{padding-right:0;margin-right:0;display:block}.el-progress--text-inside .el-progress-bar{padding-right:0;margin-right:0}.el-progress.is-success .el-progress-bar__inner{background-color:var(--el-color-success)}.el-progress.is-success .el-progress__text{color:var(--el-color-success)}.el-progress.is-warning .el-progress-bar__inner{background-color:var(--el-color-warning)}.el-progress.is-warning .el-progress__text{color:var(--el-color-warning)}.el-progress.is-exception .el-progress-bar__inner{background-color:var(--el-color-danger)}.el-progress.is-exception .el-progress__text{color:var(--el-color-danger)}.el-progress-bar{flex-grow:1;box-sizing:border-box}.el-progress-bar__outer{height:6px;border-radius:100px;background-color:var(--el-border-color-lighter);overflow:hidden;position:relative;vertical-align:middle}.el-progress-bar__inner{position:absolute;left:0;top:0;height:100%;background-color:var(--el-color-primary);text-align:right;border-radius:100px;line-height:1;white-space:nowrap;transition:width .6s ease}.el-progress-bar__inner:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-progress-bar__inner--indeterminate{transform:translateZ(0);animation:indeterminate 3s infinite}.el-progress-bar__innerText{display:inline-block;vertical-align:middle;color:#fff;font-size:12px;margin:0 5px}@keyframes progress{0%{background-position:0 0}to{background-position:32px 0}}@keyframes indeterminate{0%{left:-100%}to{left:100%}}.el-radio-button{--el-radio-button-checked-bg-color:var(--el-color-primary);--el-radio-button-checked-text-color:var(--el-color-white);--el-radio-button-checked-border-color:var(--el-color-primary);--el-radio-button-disabled-checked-fill:var(--el-border-color-extra-light);position:relative;display:inline-block;outline:0}.el-radio-button__inner{display:inline-block;line-height:1;white-space:nowrap;vertical-align:middle;background:var(--el-button-bg-color,var(--el-fill-color-blank));border:var(--el-border);font-weight:var(--el-button-font-weight,var(--el-font-weight-primary));border-left:0;color:var(--el-button-text-color,var(--el-text-color-regular));-webkit-appearance:none;text-align:center;box-sizing:border-box;outline:0;margin:0;position:relative;cursor:pointer;transition:var(--el-transition-all);-webkit-user-select:none;user-select:none;padding:8px 15px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button__inner.is-round{padding:8px 15px}.el-radio-button__inner:hover{color:var(--el-color-primary)}.el-radio-button__inner [class*=el-icon-]{line-height:.9}.el-radio-button__inner [class*=el-icon-]+span{margin-left:5px}.el-radio-button:first-child .el-radio-button__inner{border-left:var(--el-border);border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);box-shadow:none!important}.el-radio-button__original-radio{opacity:0;outline:0;position:absolute;z-index:-1}.el-radio-button__original-radio:checked+.el-radio-button__inner{color:var(--el-radio-button-checked-text-color,var(--el-color-white));background-color:var(--el-radio-button-checked-bg-color,var(--el-color-primary));border-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));box-shadow:-1px 0 0 0 var(--el-radio-button-checked-border-color,var(--el-color-primary))}.el-radio-button__original-radio:focus-visible+.el-radio-button__inner{border-left:var(--el-border);border-left-color:var(--el-radio-button-checked-border-color,var(--el-color-primary));outline:2px solid var(--el-radio-button-checked-border-color);outline-offset:1px;z-index:2;border-radius:var(--el-border-radius-base);box-shadow:none}.el-radio-button__original-radio:disabled+.el-radio-button__inner{color:var(--el-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color,var(--el-fill-color-blank));border-color:var(--el-button-disabled-border-color,var(--el-border-color-light));box-shadow:none}.el-radio-button__original-radio:disabled:checked+.el-radio-button__inner{background-color:var(--el-radio-button-disabled-checked-fill)}.el-radio-button:last-child .el-radio-button__inner{border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0}.el-radio-button:first-child:last-child .el-radio-button__inner{border-radius:var(--el-border-radius-base)}.el-radio-button--large .el-radio-button__inner{padding:12px 19px;font-size:var(--el-font-size-base);border-radius:0}.el-radio-button--large .el-radio-button__inner.is-round{padding:12px 19px}.el-radio-button--small .el-radio-button__inner{padding:5px 11px;font-size:12px;border-radius:0}.el-radio-button--small .el-radio-button__inner.is-round{padding:5px 11px}.el-radio-group{display:inline-flex;align-items:center;flex-wrap:wrap;font-size:0}.el-radio{--el-radio-font-size:var(--el-font-size-base);--el-radio-text-color:var(--el-text-color-regular);--el-radio-font-weight:var(--el-font-weight-primary);--el-radio-input-height:14px;--el-radio-input-width:14px;--el-radio-input-border-radius:var(--el-border-radius-circle);--el-radio-input-bg-color:var(--el-fill-color-blank);--el-radio-input-border:var(--el-border);--el-radio-input-border-color:var(--el-border-color);--el-radio-input-border-color-hover:var(--el-color-primary);color:var(--el-radio-text-color);font-weight:var(--el-radio-font-weight);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;outline:0;font-size:var(--el-font-size-base);-webkit-user-select:none;user-select:none;margin-right:32px;height:32px}.el-radio.el-radio--large{height:40px}.el-radio.el-radio--small{height:24px}.el-radio.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border);box-sizing:border-box}.el-radio.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-radio.is-bordered.is-disabled{cursor:not-allowed;border-color:var(--el-border-color-lighter)}.el-radio.is-bordered.el-radio--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--large .el-radio__label{font-size:var(--el-font-size-base)}.el-radio.is-bordered.el-radio--large .el-radio__inner{height:14px;width:14px}.el-radio.is-bordered.el-radio--small{padding:0 11px 0 7px;border-radius:var(--el-border-radius-base)}.el-radio.is-bordered.el-radio--small .el-radio__label{font-size:12px}.el-radio.is-bordered.el-radio--small .el-radio__inner{height:12px;width:12px}.el-radio:last-child{margin-right:0}.el-radio__input{white-space:nowrap;cursor:pointer;outline:0;display:inline-flex;position:relative;vertical-align:middle}.el-radio__input.is-disabled .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);cursor:not-allowed}.el-radio__input.is-disabled .el-radio__inner:after{cursor:not-allowed;background-color:var(--el-disabled-bg-color)}.el-radio__input.is-disabled .el-radio__inner+.el-radio__label{cursor:not-allowed}.el-radio__input.is-disabled.is-checked .el-radio__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color)}.el-radio__input.is-disabled.is-checked .el-radio__inner:after{background-color:var(--el-text-color-placeholder)}.el-radio__input.is-disabled+span.el-radio__label{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-radio__input.is-checked .el-radio__inner{border-color:var(--el-color-primary);background:var(--el-color-primary)}.el-radio__input.is-checked .el-radio__inner:after{transform:translate(-50%,-50%) scale(1)}.el-radio__input.is-checked+.el-radio__label{color:var(--el-color-primary)}.el-radio__input.is-focus .el-radio__inner{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner{border:var(--el-radio-input-border);border-radius:var(--el-radio-input-border-radius);width:var(--el-radio-input-width);height:var(--el-radio-input-height);background-color:var(--el-radio-input-bg-color);position:relative;cursor:pointer;display:inline-block;box-sizing:border-box}.el-radio__inner:hover{border-color:var(--el-radio-input-border-color-hover)}.el-radio__inner:after{width:4px;height:4px;border-radius:var(--el-radio-input-border-radius);background-color:var(--el-color-white);content:"";position:absolute;left:50%;top:50%;transform:translate(-50%,-50%) scale(0);transition:transform .15s ease-in}.el-radio__original{opacity:0;outline:0;position:absolute;z-index:-1;top:0;left:0;right:0;bottom:0;margin:0}.el-radio__original:focus-visible+.el-radio__inner{outline:2px solid var(--el-radio-input-border-color-hover);outline-offset:1px;border-radius:var(--el-radio-input-border-radius)}.el-radio:focus:not(:focus-visible):not(.is-focus):not(:active):not(.is-disabled) .el-radio__inner{box-shadow:0 0 2px 2px var(--el-radio-input-border-color-hover)}.el-radio__label{font-size:var(--el-radio-font-size);padding-left:8px}.el-radio.el-radio--large .el-radio__label{font-size:14px}.el-radio.el-radio--large .el-radio__inner{width:14px;height:14px}.el-radio.el-radio--small .el-radio__label{font-size:12px}.el-radio.el-radio--small .el-radio__inner{width:12px;height:12px}.el-rate{--el-rate-height:20px;--el-rate-font-size:var(--el-font-size-base);--el-rate-icon-size:18px;--el-rate-icon-margin:6px;--el-rate-void-color:var(--el-border-color-darker);--el-rate-fill-color:#f7ba2a;--el-rate-disabled-void-color:var(--el-fill-color);--el-rate-text-color:var(--el-text-color-primary);display:inline-flex;align-items:center;height:32px}.el-rate:active,.el-rate:focus{outline-width:0}.el-rate__item{cursor:pointer;display:inline-block;position:relative;font-size:0;vertical-align:middle;color:var(--el-rate-void-color)}.el-rate .el-rate__icon{position:relative;display:inline-block;font-size:var(--el-rate-icon-size);margin-right:var(--el-rate-icon-margin);transition:var(--el-transition-duration)}.el-rate .el-rate__icon.hover{transform:scale(1.15)}.el-rate .el-rate__icon .path2{position:absolute;left:0;top:0}.el-rate .el-rate__icon.is-active{color:var(--el-rate-fill-color)}.el-rate__decimal{position:absolute;top:0;left:0;display:inline-block;overflow:hidden;color:var(--el-rate-fill-color)}.el-rate__text{font-size:var(--el-rate-font-size);vertical-align:middle;color:var(--el-rate-text-color)}.el-rate--large{height:40px}.el-rate--small{height:24px}.el-rate.is-disabled .el-rate__item{cursor:auto;color:var(--el-rate-disabled-void-color)}.el-result{--el-result-padding:40px 30px;--el-result-icon-font-size:64px;--el-result-title-font-size:20px;--el-result-title-margin-top:20px;--el-result-subtitle-margin-top:10px;--el-result-extra-margin-top:30px;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center;box-sizing:border-box;padding:var(--el-result-padding)}.el-result__icon svg{width:var(--el-result-icon-font-size);height:var(--el-result-icon-font-size)}.el-result__title{margin-top:var(--el-result-title-margin-top)}.el-result__title p{margin:0;font-size:var(--el-result-title-font-size);color:var(--el-text-color-primary);line-height:1.3}.el-result__subtitle{margin-top:var(--el-result-subtitle-margin-top)}.el-result__subtitle p{margin:0;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);line-height:1.3}.el-result__extra{margin-top:var(--el-result-extra-margin-top)}.el-result .icon-primary{--el-result-color:var(--el-color-primary);color:var(--el-result-color)}.el-result .icon-success{--el-result-color:var(--el-color-success);color:var(--el-result-color)}.el-result .icon-warning{--el-result-color:var(--el-color-warning);color:var(--el-result-color)}.el-result .icon-danger{--el-result-color:var(--el-color-danger);color:var(--el-result-color)}.el-result .icon-error{--el-result-color:var(--el-color-error);color:var(--el-result-color)}.el-result .icon-info{--el-result-color:var(--el-color-info);color:var(--el-result-color)}.el-row{display:flex;flex-wrap:wrap;position:relative;box-sizing:border-box}.el-row.is-justify-center{justify-content:center}.el-row.is-justify-end{justify-content:flex-end}.el-row.is-justify-space-between{justify-content:space-between}.el-row.is-justify-space-around{justify-content:space-around}.el-row.is-justify-space-evenly{justify-content:space-evenly}.el-row.is-align-middle{align-items:center}.el-row.is-align-bottom{align-items:flex-end}.el-scrollbar{--el-scrollbar-opacity:.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary);overflow:hidden;position:relative;height:100%}.el-scrollbar__wrap{overflow:auto;height:100%}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{position:relative;display:block;width:0;height:0;cursor:pointer;border-radius:inherit;background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));transition:var(--el-transition-duration) background-color;opacity:var(--el-scrollbar-opacity,.3)}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{position:absolute;right:2px;bottom:2px;z-index:1;border-radius:4px}.el-scrollbar__bar.is-vertical{width:6px;top:2px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity .34s ease-out}.el-scrollbar-fade-leave-active{transition:opacity .12s ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}.el-select-dropdown{z-index:calc(var(--el-index-top) + 1);border-radius:var(--el-border-radius-base);box-sizing:border-box}.el-select-dropdown .el-scrollbar.is-empty .el-select-dropdown__list{padding:0}.el-select-dropdown__option-item:hover:not(.hover){background-color:transparent}.el-select-dropdown__empty{padding:10px 0;margin:0;text-align:center;color:var(--el-text-color-secondary);font-size:var(--el-select-font-size)}.el-select-dropdown__wrap{max-height:274px}.el-select-dropdown__list{list-style:none;margin:6px 0!important;padding:0!important;box-sizing:border-box}.el-select-dropdown__option-item{font-size:var(--el-select-font-size);padding:0 32px 0 20px;position:relative;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;color:var(--el-text-color-regular);height:34px;line-height:34px;box-sizing:border-box;cursor:pointer}.el-select-dropdown__option-item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-select-dropdown__option-item.is-disabled:hover{background-color:var(--el-bg-color)}.el-select-dropdown__option-item.is-selected{background-color:var(--el-fill-color-light);font-weight:700}.el-select-dropdown__option-item.is-selected:not(.is-multiple){color:var(--el-color-primary)}.el-select-dropdown__option-item.hover{background-color:var(--el-fill-color-light)!important}.el-select-dropdown__option-item:hover{background-color:var(--el-fill-color-light)}.el-select-dropdown.is-multiple .el-select-dropdown__option-item.is-selected{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay)}.el-select-dropdown.is-multiple .el-select-dropdown__option-item.is-selected .el-icon{position:absolute;right:20px;top:0;height:inherit;font-size:12px}.el-select-dropdown.is-multiple .el-select-dropdown__option-item.is-selected .el-icon svg{height:inherit;vertical-align:middle}.el-select-group{margin:0;padding:0}.el-select-group__wrap{position:relative;list-style:none;margin:0;padding:0}.el-select-group__wrap:not(:last-of-type){padding-bottom:24px}.el-select-group__wrap:not(:last-of-type):after{content:"";position:absolute;display:block;left:20px;right:20px;bottom:12px;height:1px;background:var(--el-border-color-light)}.el-select-group__split-dash{position:absolute;left:20px;right:20px;height:1px;background:var(--el-border-color-light)}.el-select-group__title{padding-left:20px;font-size:12px;color:var(--el-color-info);line-height:30px}.el-select-group .el-select-dropdown__item{padding-left:20px}.el-select-v2{--el-select-border-color-hover:var(--el-border-color-hover);--el-select-disabled-border:var(--el-disabled-border-color);--el-select-font-size:var(--el-font-size-base);--el-select-close-hover-color:var(--el-text-color-secondary);--el-select-input-color:var(--el-text-color-placeholder);--el-select-multiple-input-color:var(--el-text-color-regular);--el-select-input-focus-border-color:var(--el-color-primary);--el-select-input-font-size:14px;display:inline-block;position:relative;vertical-align:middle;font-size:14px}.el-select-v2__wrapper{display:flex;align-items:center;flex-wrap:wrap;box-sizing:border-box;cursor:pointer;padding:1px 30px 1px 0;border:1px solid var(--el-border-color);border-radius:var(--el-border-radius-base);transition:border-color var(--el-transition-duration-fast) var(--el-ease-in-out-bezier-function)}.el-select-v2__wrapper:hover{border-color:var(--el-text-color-placeholder)}.el-select-v2__wrapper.is-filterable{cursor:text}.el-select-v2__wrapper.is-focused{border-color:var(--el-color-primary)}.el-select-v2__wrapper.is-hovering:not(.is-focused){border-color:var(--el-text-color-placeholder)}.el-select-v2__wrapper.is-disabled{cursor:not-allowed;background-color:var(--el-fill-color-light);color:var(--el-text-color-placeholder);border-color:var(--el-select-disabled-border)}.el-select-v2__wrapper.is-disabled:hover{border-color:var(--el-select-disabled-border)}.el-select-v2__wrapper.is-disabled.is-focus{border-color:var(--el-input-focus-border-color)}.el-select-v2__wrapper.is-disabled .is-transparent{opacity:1;-webkit-user-select:none;user-select:none}.el-select-v2__wrapper.is-disabled .el-select-v2__caret,.el-select-v2__wrapper.is-disabled .el-select-v2__combobox-input{cursor:not-allowed}.el-select-v2__wrapper .el-select-v2__input-wrapper{box-sizing:border-box;position:relative;margin-inline-start:12px;max-width:100%;overflow:hidden}.el-select-v2__wrapper,.el-select-v2__wrapper .el-select-v2__input-wrapper{line-height:32px}.el-select-v2__wrapper .el-select-v2__input-wrapper input{line-height:24px;height:24px;min-width:4px;width:100%;background-color:transparent;-webkit-appearance:none;appearance:none;background:0 0;border:none;margin:2px 0;outline:0;padding:0}.el-select-v2 .el-select-v2__tags-text{text-overflow:ellipsis;display:inline-flex;justify-content:center;align-items:center;overflow:hidden}.el-select-v2__empty{padding:10px 0;margin:0;text-align:center;color:var(--el-text-color-secondary);font-size:14px}.el-select-v2__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-box-shadow-light)}.el-select-v2__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-select-v2__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-select-v2__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-select-v2__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-select-v2__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-select-v2--large .el-select-v2__wrapper .el-select-v2__combobox-input{height:32px}.el-select-v2--large .el-select-v2__caret,.el-select-v2--large .el-select-v2__suffix{height:40px}.el-select-v2--large .el-select-v2__placeholder{font-size:14px;line-height:40px}.el-select-v2--small .el-select-v2__wrapper .el-select-v2__combobox-input{height:16px}.el-select-v2--small .el-select-v2__caret,.el-select-v2--small .el-select-v2__suffix{height:24px}.el-select-v2--small .el-select-v2__placeholder{font-size:12px;line-height:24px}.el-select-v2 .el-select-v2__selection>span{display:inline-block}.el-select-v2:hover .el-select-v2__combobox-input{border-color:var(--el-select-border-color-hover)}.el-select-v2 .el-select__selection-text{text-overflow:ellipsis;display:inline-block;overflow-x:hidden;vertical-align:bottom}.el-select-v2 .el-select-v2__combobox-input{padding-right:35px;display:block}.el-select-v2 .el-select-v2__combobox-input:focus{border-color:var(--el-select-input-focus-border-color)}.el-select-v2__input{border:none;outline:0;padding:0;margin-left:15px;color:var(--el-select-multiple-input-color);font-size:var(--el-select-font-size);-webkit-appearance:none;appearance:none;height:28px}.el-select-v2__input.is-small{height:14px}.el-select-v2__close{cursor:pointer;position:absolute;top:8px;z-index:var(--el-index-top);right:25px;color:var(--el-select-input-color);line-height:18px;font-size:var(--el-select-input-font-size)}.el-select-v2__close:hover{color:var(--el-select-close-hover-color)}.el-select-v2__suffix{display:inline-flex;position:absolute;right:12px;height:32px;top:50%;transform:translateY(-50%);color:var(--el-input-icon-color,var(--el-text-color-placeholder))}.el-select-v2__suffix .el-input__icon{height:inherit}.el-select-v2__caret{color:var(--el-select-input-color);font-size:var(--el-select-input-font-size);transition:transform var(--el-transition-duration);transform:rotate(180deg);cursor:pointer}.el-select-v2__caret.is-reverse{transform:rotate(0)}.el-select-v2__caret.is-show-close{font-size:var(--el-select-font-size);text-align:center;transform:rotate(180deg);border-radius:var(--el-border-radius-circle);color:var(--el-select-input-color);transition:var(--el-transition-color)}.el-select-v2__caret.is-show-close:hover{color:var(--el-select-close-hover-color)}.el-select-v2__caret.el-icon{height:inherit}.el-select-v2__caret.el-icon svg{vertical-align:middle}.el-select-v2__selection{white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap}.el-select-v2__wrapper{background-color:var(--el-fill-color-blank);border:1px solid var(--el-border-color);border-radius:var(--el-border-radius-base);position:relative;transition:all var(--el-transition-duration) var(--el-ease-in-out-bezier-function)}.el-select-v2__input-calculator{left:0;position:absolute;top:0;visibility:hidden;white-space:pre;z-index:999}.el-select-v2__selected-item{line-height:inherit;height:inherit;-webkit-user-select:none;user-select:none;display:flex}.el-select-v2__placeholder{position:absolute;top:50%;transform:translateY(-50%);margin-inline-start:12px;width:calc(100% - 52px);overflow:hidden;text-overflow:ellipsis;white-space:nowrap;color:var(--el-input-text-color,var(--el-text-color-regular))}.el-select-v2__placeholder.is-transparent{color:var(--el-text-color-placeholder)}.el-select-v2 .el-select-v2__selection .el-tag{box-sizing:border-box;border-color:transparent;margin:2px 0 2px 6px;background-color:var(--el-fill-color)}.el-select-v2 .el-select-v2__selection .el-tag .el-icon-close{background-color:var(--el-text-color-placeholder);right:-7px;color:var(--el-color-white)}.el-select-v2 .el-select-v2__selection .el-tag .el-icon-close:hover{background-color:var(--el-text-color-secondary)}.el-select-v2 .el-select-v2__selection .el-tag .el-icon-close:before{display:block;transform:translateY(.5px)}.el-select-v2.el-select-v2--small .el-select-v2__selection .el-tag{margin:1px 0 1px 6px;height:18px}.el-select-dropdown{z-index:calc(var(--el-index-top) + 1);border-radius:var(--el-border-radius-base);box-sizing:border-box}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay)}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected.hover{background-color:var(--el-fill-color-light)}.el-select-dropdown.is-multiple .el-select-dropdown__item.selected:after{content:"";position:absolute;top:50%;right:20px;border-top:none;border-right:none;background-repeat:no-repeat;background-position:center;background-color:var(--el-color-primary);-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;transform:translateY(-50%);width:12px;height:12px}.el-select-dropdown .el-select-dropdown__option-item.is-selected:after{content:"";position:absolute;top:50%;right:20px;border-top:none;border-right:none;background-repeat:no-repeat;background-position:center;background-color:var(--el-color-primary);-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;mask-size:100% 100%;-webkit-mask:url("data:image/svg+xml;utf8,%3Csvg class='icon' width='200' height='200' viewBox='0 0 1024 1024' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath fill='currentColor' d='M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z'%3E%3C/path%3E%3C/svg%3E") no-repeat;-webkit-mask-size:100% 100%;transform:translateY(-50%);width:12px;height:12px}.el-select-dropdown .el-scrollbar.is-empty .el-select-dropdown__list{padding:0}.el-select-dropdown__empty{padding:10px 0;margin:0;text-align:center;color:var(--el-text-color-secondary);font-size:var(--el-select-font-size)}.el-select-dropdown__wrap{max-height:274px}.el-select-dropdown__list{list-style:none;padding:6px 0;margin:0;box-sizing:border-box}.el-select{--el-select-border-color-hover:var(--el-border-color-hover);--el-select-disabled-border:var(--el-disabled-border-color);--el-select-font-size:var(--el-font-size-base);--el-select-close-hover-color:var(--el-text-color-secondary);--el-select-input-color:var(--el-text-color-placeholder);--el-select-multiple-input-color:var(--el-text-color-regular);--el-select-input-focus-border-color:var(--el-color-primary);--el-select-input-font-size:14px;display:inline-block;position:relative;line-height:32px}.el-select__popper.el-popper{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light);box-shadow:var(--el-box-shadow-light)}.el-select__popper.el-popper .el-popper__arrow:before{border:1px solid var(--el-border-color-light)}.el-select__popper.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent;border-left-color:transparent}.el-select__popper.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent;border-right-color:transparent}.el-select__popper.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent;border-bottom-color:transparent}.el-select__popper.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent;border-top-color:transparent}.el-select .el-select-tags-wrapper.has-prefix{margin-left:6px}.el-select--large{line-height:40px}.el-select--large .el-select-tags-wrapper.has-prefix{margin-left:8px}.el-select--small{line-height:24px}.el-select--small .el-select-tags-wrapper.has-prefix{margin-left:4px}.el-select .el-select__tags>span{display:inline-block}.el-select:hover:not(.el-select--disabled) .el-input__wrapper{box-shadow:0 0 0 1px var(--el-select-border-color-hover) inset}.el-select .el-select__tags-text{text-overflow:ellipsis;display:inline-flex;justify-content:center;align-items:center;overflow:hidden}.el-select .el-input__wrapper{cursor:pointer}.el-select .el-input__wrapper.is-focus{box-shadow:0 0 0 1px var(--el-select-input-focus-border-color) inset!important}.el-select .el-input__inner{cursor:pointer}.el-select .el-input{display:flex}.el-select .el-input .el-select__caret{color:var(--el-select-input-color);font-size:var(--el-select-input-font-size);transition:transform var(--el-transition-duration);transform:rotate(180deg);cursor:pointer}.el-select .el-input .el-select__caret.is-reverse{transform:rotate(0)}.el-select .el-input .el-select__caret.is-show-close{font-size:var(--el-select-font-size);text-align:center;transform:rotate(180deg);border-radius:var(--el-border-radius-circle);color:var(--el-select-input-color);transition:var(--el-transition-color)}.el-select .el-input .el-select__caret.is-show-close:hover{color:var(--el-select-close-hover-color)}.el-select .el-input .el-select__caret.el-icon{position:relative;height:inherit;z-index:2}.el-select .el-input.is-disabled .el-input__wrapper{cursor:not-allowed}.el-select .el-input.is-disabled .el-input__wrapper:hover{box-shadow:0 0 0 1px var(--el-select-disabled-border) inset}.el-select .el-input.is-disabled .el-input__inner,.el-select .el-input.is-disabled .el-select__caret{cursor:not-allowed}.el-select .el-input.is-focus .el-input__wrapper{box-shadow:0 0 0 1px var(--el-select-input-focus-border-color) inset!important}.el-select__input{border:none;outline:0;padding:0;margin-left:15px;color:var(--el-select-multiple-input-color);font-size:var(--el-select-font-size);-webkit-appearance:none;appearance:none;height:28px;background-color:transparent}.el-select__close{cursor:pointer;position:absolute;top:8px;z-index:var(--el-index-top);right:25px;color:var(--el-select-input-color);line-height:18px;font-size:var(--el-select-input-font-size)}.el-select__close:hover{color:var(--el-select-close-hover-color)}.el-select__tags{position:absolute;line-height:normal;top:50%;transform:translateY(-50%);white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap}.el-select__collapse-tags{white-space:normal;z-index:var(--el-index-normal);display:flex;align-items:center;flex-wrap:wrap}.el-select__collapse-tag{line-height:inherit;height:inherit;display:flex}.el-select .el-select__tags .el-tag{box-sizing:border-box;border-color:transparent;margin:2px 6px 2px 0}.el-select .el-select__tags .el-tag:last-child{margin-right:0}.el-select .el-select__tags .el-tag .el-icon-close{background-color:var(--el-text-color-placeholder);right:-7px;top:0;color:#fff}.el-select .el-select__tags .el-tag .el-icon-close:hover{background-color:var(--el-text-color-secondary)}.el-select .el-select__tags .el-tag .el-icon-close:before{display:block;transform:translateY(.5px)}.el-select .el-select__tags .el-tag--info{background-color:var(--el-fill-color)}.el-skeleton{--el-skeleton-circle-size:var(--el-avatar-size)}.el-skeleton__item{background:var(--el-skeleton-color);display:inline-block;height:16px;border-radius:var(--el-border-radius-base);width:100%}.el-skeleton__circle{border-radius:50%;width:var(--el-skeleton-circle-size);height:var(--el-skeleton-circle-size);line-height:var(--el-skeleton-circle-size)}.el-skeleton__button{height:40px;width:64px;border-radius:4px}.el-skeleton__p{width:100%}.el-skeleton__p.is-last{width:61%}.el-skeleton__p.is-first{width:33%}.el-skeleton__text{width:100%;height:var(--el-font-size-small)}.el-skeleton__caption{height:var(--el-font-size-extra-small)}.el-skeleton__h1{height:var(--el-font-size-extra-large)}.el-skeleton__h3{height:var(--el-font-size-large)}.el-skeleton__h5{height:var(--el-font-size-medium)}.el-skeleton__image{width:unset;display:flex;align-items:center;justify-content:center;border-radius:0}.el-skeleton__image svg{color:var(--el-svg-monochrome-grey);fill:currentColor;width:22%;height:22%}.el-skeleton{--el-skeleton-color:var(--el-fill-color);--el-skeleton-to-color:var(--el-fill-color-darker)}@keyframes el-skeleton-loading{0%{background-position:100% 50%}to{background-position:0 50%}}.el-skeleton{width:100%}.el-skeleton__first-line,.el-skeleton__paragraph{height:16px;margin-top:16px;background:var(--el-skeleton-color)}.el-skeleton.is-animated .el-skeleton__item{background:linear-gradient(90deg,var(--el-skeleton-color) 25%,var(--el-skeleton-to-color) 37%,var(--el-skeleton-color) 63%);background-size:400% 100%;animation:el-skeleton-loading 1.4s ease infinite}.el-slider{--el-slider-main-bg-color:var(--el-color-primary);--el-slider-runway-bg-color:var(--el-border-color-light);--el-slider-stop-bg-color:var(--el-color-white);--el-slider-disabled-color:var(--el-text-color-placeholder);--el-slider-border-radius:3px;--el-slider-height:6px;--el-slider-button-size:20px;--el-slider-button-wrapper-size:36px;--el-slider-button-wrapper-offset:-15px;width:100%;height:32px;display:flex;align-items:center}.el-slider__runway{flex:1;height:var(--el-slider-height);background-color:var(--el-slider-runway-bg-color);border-radius:var(--el-slider-border-radius);position:relative;cursor:pointer}.el-slider__runway.show-input{margin-right:30px;width:auto}.el-slider__runway.is-disabled{cursor:default}.el-slider__runway.is-disabled .el-slider__bar{background-color:var(--el-slider-disabled-color)}.el-slider__runway.is-disabled .el-slider__button{border-color:var(--el-slider-disabled-color)}.el-slider__runway.is-disabled .el-slider__button-wrapper.hover,.el-slider__runway.is-disabled .el-slider__button-wrapper:hover,.el-slider__runway.is-disabled .el-slider__button-wrapper.dragging{cursor:not-allowed}.el-slider__runway.is-disabled .el-slider__button.dragging,.el-slider__runway.is-disabled .el-slider__button.hover,.el-slider__runway.is-disabled .el-slider__button:hover{transform:scale(1)}.el-slider__runway.is-disabled .el-slider__button.hover,.el-slider__runway.is-disabled .el-slider__button:hover,.el-slider__runway.is-disabled .el-slider__button.dragging{cursor:not-allowed}.el-slider__input{flex-shrink:0;width:130px}.el-slider__bar{height:var(--el-slider-height);background-color:var(--el-slider-main-bg-color);border-top-left-radius:var(--el-slider-border-radius);border-bottom-left-radius:var(--el-slider-border-radius);position:absolute}.el-slider__button-wrapper{height:var(--el-slider-button-wrapper-size);width:var(--el-slider-button-wrapper-size);position:absolute;z-index:1;top:var(--el-slider-button-wrapper-offset);transform:translate(-50%);background-color:transparent;text-align:center;-webkit-user-select:none;user-select:none;line-height:normal;outline:0}.el-slider__button-wrapper:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-slider__button-wrapper.hover,.el-slider__button-wrapper:hover{cursor:grab}.el-slider__button-wrapper.dragging{cursor:grabbing}.el-slider__button{display:inline-block;width:var(--el-slider-button-size);height:var(--el-slider-button-size);vertical-align:middle;border:solid 2px var(--el-slider-main-bg-color);background-color:var(--el-color-white);border-radius:50%;box-sizing:border-box;transition:var(--el-transition-duration-fast);-webkit-user-select:none;user-select:none}.el-slider__button.dragging,.el-slider__button.hover,.el-slider__button:hover{transform:scale(1.2)}.el-slider__button.hover,.el-slider__button:hover{cursor:grab}.el-slider__button.dragging{cursor:grabbing}.el-slider__stop{position:absolute;height:var(--el-slider-height);width:var(--el-slider-height);border-radius:var(--el-border-radius-circle);background-color:var(--el-slider-stop-bg-color);transform:translate(-50%)}.el-slider__marks{top:0;left:12px;width:18px;height:100%}.el-slider__marks-text{position:absolute;transform:translate(-50%);font-size:14px;color:var(--el-color-info);margin-top:15px}.el-slider.is-vertical{position:relative;height:100%;flex:0}.el-slider.is-vertical .el-slider__runway{width:var(--el-slider-height);height:100%;margin:0 16px}.el-slider.is-vertical .el-slider__bar{width:var(--el-slider-height);height:auto;border-radius:0 0 3px 3px}.el-slider.is-vertical .el-slider__button-wrapper{top:auto;left:var(--el-slider-button-wrapper-offset);transform:translateY(50%)}.el-slider.is-vertical .el-slider__stop{transform:translateY(50%)}.el-slider.is-vertical .el-slider__marks-text{margin-top:0;left:15px;transform:translateY(50%)}.el-slider--large{height:40px}.el-slider--small{height:24px}.el-space{display:inline-flex;vertical-align:top}.el-space__item{display:flex;flex-wrap:wrap}.el-space__item>*{flex:1}.el-space--vertical{flex-direction:column}.el-time-spinner{width:100%;white-space:nowrap}.el-spinner{display:inline-block;vertical-align:middle}.el-spinner-inner{animation:rotate 2s linear infinite;width:50px;height:50px}.el-spinner-inner .path{stroke:var(--el-border-color-lighter);stroke-linecap:round;animation:dash 1.5s ease-in-out infinite}@keyframes rotate{to{transform:rotate(360deg)}}@keyframes dash{0%{stroke-dasharray:1,150;stroke-dashoffset:0}50%{stroke-dasharray:90,150;stroke-dashoffset:-35}to{stroke-dasharray:90,150;stroke-dashoffset:-124}}.el-step{position:relative;flex-shrink:1}.el-step:last-of-type .el-step__line{display:none}.el-step:last-of-type.is-flex{flex-basis:auto!important;flex-shrink:0;flex-grow:0}.el-step:last-of-type .el-step__description,.el-step:last-of-type .el-step__main{padding-right:0}.el-step__head{position:relative;width:100%}.el-step__head.is-process{color:var(--el-text-color-primary);border-color:var(--el-text-color-primary)}.el-step__head.is-wait{color:var(--el-text-color-placeholder);border-color:var(--el-text-color-placeholder)}.el-step__head.is-success{color:var(--el-color-success);border-color:var(--el-color-success)}.el-step__head.is-error{color:var(--el-color-danger);border-color:var(--el-color-danger)}.el-step__head.is-finish{color:var(--el-color-primary);border-color:var(--el-color-primary)}.el-step__icon{position:relative;z-index:1;display:inline-flex;justify-content:center;align-items:center;width:24px;height:24px;font-size:14px;box-sizing:border-box;background:var(--el-bg-color);transition:.15s ease-out}.el-step__icon.is-text{border-radius:50%;border:2px solid;border-color:inherit}.el-step__icon.is-icon{width:40px}.el-step__icon-inner{display:inline-block;-webkit-user-select:none;user-select:none;text-align:center;font-weight:700;line-height:1;color:inherit}.el-step__icon-inner[class*=el-icon]:not(.is-status){font-size:25px;font-weight:400}.el-step__icon-inner.is-status{transform:translateY(1px)}.el-step__line{position:absolute;border-color:inherit;background-color:var(--el-text-color-placeholder)}.el-step__line-inner{display:block;border-width:1px;border-style:solid;border-color:inherit;transition:.15s ease-out;box-sizing:border-box;width:0;height:0}.el-step__main{white-space:normal;text-align:left}.el-step__title{font-size:16px;line-height:38px}.el-step__title.is-process{font-weight:700;color:var(--el-text-color-primary)}.el-step__title.is-wait{color:var(--el-text-color-placeholder)}.el-step__title.is-success{color:var(--el-color-success)}.el-step__title.is-error{color:var(--el-color-danger)}.el-step__title.is-finish{color:var(--el-color-primary)}.el-step__description{padding-right:10%;margin-top:-5px;font-size:12px;line-height:20px;font-weight:400}.el-step__description.is-process{color:var(--el-text-color-primary)}.el-step__description.is-wait{color:var(--el-text-color-placeholder)}.el-step__description.is-success{color:var(--el-color-success)}.el-step__description.is-error{color:var(--el-color-danger)}.el-step__description.is-finish{color:var(--el-color-primary)}.el-step.is-horizontal{display:inline-block}.el-step.is-horizontal .el-step__line{height:2px;top:11px;left:0;right:0}.el-step.is-vertical{display:flex}.el-step.is-vertical .el-step__head{flex-grow:0;width:24px}.el-step.is-vertical .el-step__main{padding-left:10px;flex-grow:1}.el-step.is-vertical .el-step__title{line-height:24px;padding-bottom:8px}.el-step.is-vertical .el-step__line{width:2px;top:0;bottom:0;left:11px}.el-step.is-vertical .el-step__icon.is-icon{width:24px}.el-step.is-center .el-step__head,.el-step.is-center .el-step__main{text-align:center}.el-step.is-center .el-step__description{padding-left:20%;padding-right:20%}.el-step.is-center .el-step__line{left:50%;right:-50%}.el-step.is-simple{display:flex;align-items:center}.el-step.is-simple .el-step__head{width:auto;font-size:0;padding-right:10px}.el-step.is-simple .el-step__icon{background:0 0;width:16px;height:16px;font-size:12px}.el-step.is-simple .el-step__icon-inner[class*=el-icon]:not(.is-status){font-size:18px}.el-step.is-simple .el-step__icon-inner.is-status{transform:scale(.8) translateY(1px)}.el-step.is-simple .el-step__main{position:relative;display:flex;align-items:stretch;flex-grow:1}.el-step.is-simple .el-step__title{font-size:16px;line-height:20px}.el-step.is-simple:not(:last-of-type) .el-step__title{max-width:50%;word-break:break-all}.el-step.is-simple .el-step__arrow{flex-grow:1;display:flex;align-items:center;justify-content:center}.el-step.is-simple .el-step__arrow:after,.el-step.is-simple .el-step__arrow:before{content:"";display:inline-block;position:absolute;height:15px;width:1px;background:var(--el-text-color-placeholder)}.el-step.is-simple .el-step__arrow:before{transform:rotate(-45deg) translateY(-4px);transform-origin:0 0}.el-step.is-simple .el-step__arrow:after{transform:rotate(45deg) translateY(4px);transform-origin:100% 100%}.el-step.is-simple:last-of-type .el-step__arrow{display:none}.el-steps{display:flex}.el-steps--simple{padding:13px 8%;border-radius:4px;background:var(--el-fill-color-light)}.el-steps--horizontal{white-space:nowrap}.el-steps--vertical{height:100%;flex-flow:column}.el-switch{--el-switch-on-color:var(--el-color-primary);--el-switch-off-color:var(--el-border-color);display:inline-flex;align-items:center;position:relative;font-size:14px;line-height:20px;height:32px;vertical-align:middle}.el-switch.is-disabled .el-switch__core,.el-switch.is-disabled .el-switch__label{cursor:not-allowed}.el-switch__label{transition:var(--el-transition-duration-fast);height:20px;display:inline-block;font-size:14px;font-weight:500;cursor:pointer;vertical-align:middle;color:var(--el-text-color-primary)}.el-switch__label.is-active{color:var(--el-color-primary)}.el-switch__label--left{margin-right:10px}.el-switch__label--right{margin-left:10px}.el-switch__label *{line-height:1;font-size:14px;display:inline-block}.el-switch__label .el-icon{height:inherit}.el-switch__label .el-icon svg{vertical-align:middle}.el-switch__input{position:absolute;width:0;height:0;opacity:0;margin:0}.el-switch__input:focus-visible~.el-switch__core{outline:2px solid var(--el-switch-on-color);outline-offset:1px}.el-switch__core{margin:0;display:inline-block;position:relative;width:40px;height:20px;border:1px solid var(--el-switch-off-color);outline:0;border-radius:10px;box-sizing:border-box;background:var(--el-switch-off-color);cursor:pointer;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration);vertical-align:middle}.el-switch__core .el-switch__inner{position:absolute;top:1px;left:1px;transition:all var(--el-transition-duration);width:16px;height:16px;display:flex;justify-content:center;align-items:center;left:50%;white-space:nowrap}.el-switch__core .el-switch__inner .is-icon,.el-switch__core .el-switch__inner .is-text{color:var(--el-color-white);transition:opacity var(--el-transition-duration);position:absolute;-webkit-user-select:none;user-select:none}.el-switch__core .el-switch__action{position:absolute;top:1px;left:1px;border-radius:var(--el-border-radius-circle);transition:all var(--el-transition-duration);width:16px;height:16px;background-color:var(--el-color-white);display:flex;justify-content:center;align-items:center;color:var(--el-switch-off-color)}.el-switch__core .el-switch__action .is-icon,.el-switch__core .el-switch__action .is-text{transition:opacity var(--el-transition-duration);position:absolute;-webkit-user-select:none;user-select:none}.el-switch__core .is-text{font-size:12px}.el-switch__core .is-show{opacity:1}.el-switch__core .is-hide{opacity:0}.el-switch.is-checked .el-switch__core{border-color:var(--el-switch-on-color);background-color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__action{left:100%;margin-left:-17px;color:var(--el-switch-on-color)}.el-switch.is-checked .el-switch__core .el-switch__inner{left:50%;white-space:nowrap;margin-left:-17px}.el-switch.is-disabled{opacity:.6}.el-switch--wide .el-switch__label.el-switch__label--left span{left:10px}.el-switch--wide .el-switch__label.el-switch__label--right span{right:10px}.el-switch .label-fade-enter-from,.el-switch .label-fade-leave-active{opacity:0}.el-switch--large{font-size:14px;line-height:24px;height:40px}.el-switch--large .el-switch__label{height:24px;font-size:14px}.el-switch--large .el-switch__label *{font-size:14px}.el-switch--large .el-switch__core{width:50px;height:24px;border-radius:12px}.el-switch--large .el-switch__core .el-switch__inner,.el-switch--large .el-switch__core .el-switch__action{width:20px;height:20px}.el-switch--large.is-checked .el-switch__core .el-switch__action,.el-switch--large.is-checked .el-switch__core .el-switch__inner{margin-left:-21px}.el-switch--small{font-size:12px;line-height:16px;height:24px}.el-switch--small .el-switch__label{height:16px;font-size:12px}.el-switch--small .el-switch__label *{font-size:12px}.el-switch--small .el-switch__core{width:30px;height:16px;border-radius:8px}.el-switch--small .el-switch__core .el-switch__inner,.el-switch--small .el-switch__core .el-switch__action{width:12px;height:12px}.el-switch--small.is-checked .el-switch__core .el-switch__action,.el-switch--small.is-checked .el-switch__core .el-switch__inner{margin-left:-13px}.el-table-column--selection .cell{padding-left:14px;padding-right:14px}.el-table-filter{border:solid 1px var(--el-border-color-lighter);border-radius:2px;background-color:#fff;box-shadow:var(--el-box-shadow-light);box-sizing:border-box}.el-table-filter__list{padding:5px 0;margin:0;list-style:none;min-width:100px}.el-table-filter__list-item{line-height:36px;padding:0 10px;cursor:pointer;font-size:var(--el-font-size-base)}.el-table-filter__list-item:hover{background-color:var(--el-color-primary-light-9);color:var(--el-color-primary)}.el-table-filter__list-item.is-active{background-color:var(--el-color-primary);color:#fff}.el-table-filter__content{min-width:100px}.el-table-filter__bottom{border-top:1px solid var(--el-border-color-lighter);padding:8px}.el-table-filter__bottom button{background:0 0;border:none;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-small);padding:0 3px}.el-table-filter__bottom button:hover{color:var(--el-color-primary)}.el-table-filter__bottom button:focus{outline:0}.el-table-filter__bottom button.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-table-filter__wrap{max-height:280px}.el-table-filter__checkbox-group{padding:10px}.el-table-filter__checkbox-group label.el-checkbox{display:flex;align-items:center;margin-right:5px;margin-bottom:12px;margin-left:5px;height:unset}.el-table-filter__checkbox-group .el-checkbox:last-child{margin-bottom:0}.el-table{--el-table-border-color:var(--el-border-color-lighter);--el-table-border:1px solid var(--el-table-border-color);--el-table-text-color:var(--el-text-color-regular);--el-table-header-text-color:var(--el-text-color-secondary);--el-table-row-hover-bg-color:var(--el-fill-color-light);--el-table-current-row-bg-color:var(--el-color-primary-light-9);--el-table-header-bg-color:var(--el-bg-color);--el-table-fixed-box-shadow:var(--el-box-shadow-light);--el-table-bg-color:var(--el-fill-color-blank);--el-table-tr-bg-color:var(--el-fill-color-blank);--el-table-expanded-cell-bg-color:var(--el-fill-color-blank);--el-table-fixed-left-column:inset 10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-fixed-right-column:inset -10px 0 10px -10px rgba(0, 0, 0, .15);position:relative;overflow:hidden;box-sizing:border-box;height:-moz-fit-content;height:fit-content;width:100%;max-width:100%;background-color:var(--el-table-bg-color);font-size:14px;color:var(--el-table-text-color)}.el-table__inner-wrapper{position:relative}.el-table__inner-wrapper:before{left:0;bottom:0;width:100%;height:1px;z-index:3}.el-table.has-footer .el-table__inner-wrapper:before{bottom:1px}.el-table__empty-block{position:sticky;left:0;min-height:60px;text-align:center;width:100%;display:flex;justify-content:center;align-items:center}.el-table__empty-text{line-height:60px;width:50%;color:var(--el-text-color-secondary)}.el-table__expand-column .cell{padding:0;text-align:center;-webkit-user-select:none;user-select:none}.el-table__expand-icon{position:relative;cursor:pointer;color:var(--el-text-color-regular);font-size:12px;transition:transform var(--el-transition-duration-fast) ease-in-out;height:20px}.el-table__expand-icon--expanded{transform:rotate(90deg)}.el-table__expand-icon>.el-icon{font-size:12px}.el-table__expanded-cell{background-color:var(--el-table-expanded-cell-bg-color)}.el-table__expanded-cell[class*=cell]{padding:20px 50px}.el-table__expanded-cell:hover{background-color:transparent!important}.el-table__placeholder{display:inline-block;width:20px}.el-table__append-wrapper{overflow:hidden}.el-table--fit{border-right:0;border-bottom:0}.el-table--fit .el-table__cell.gutter{border-right-width:1px}.el-table thead{color:var(--el-table-header-text-color);font-weight:500}.el-table thead.is-group th.el-table__cell{background:var(--el-fill-color-light)}.el-table .el-table__cell{padding:8px 0;min-width:0;box-sizing:border-box;text-overflow:ellipsis;vertical-align:middle;position:relative;text-align:left;z-index:1}.el-table .el-table__cell.is-center{text-align:center}.el-table .el-table__cell.is-right{text-align:right}.el-table .el-table__cell.gutter{width:15px;border-right-width:0;border-bottom-width:0;padding:0}.el-table .el-table__cell.is-hidden>*{visibility:hidden}.el-table .cell{box-sizing:border-box;overflow:hidden;text-overflow:ellipsis;white-space:normal;word-break:break-all;line-height:23px;padding:0 12px}.el-table .cell.el-tooltip{white-space:nowrap;min-width:50px}.el-table--large{font-size:var(--el-font-size-base)}.el-table--large .el-table__cell{padding:12px 0}.el-table--large .cell{padding:0 16px}.el-table--small{font-size:12px}.el-table--small .el-table__cell{padding:4px 0}.el-table--small .cell{padding:0 8px}.el-table tr{background-color:var(--el-table-tr-bg-color)}.el-table tr input[type=checkbox]{margin:0}.el-table td.el-table__cell,.el-table th.el-table__cell.is-leaf{border-bottom:var(--el-table-border)}.el-table th.el-table__cell.is-sortable{cursor:pointer}.el-table th.el-table__cell{-webkit-user-select:none;user-select:none;background-color:var(--el-table-header-bg-color)}.el-table th.el-table__cell>.cell{display:inline-block;box-sizing:border-box;position:relative;vertical-align:middle;width:100%}.el-table th.el-table__cell>.cell.highlight{color:var(--el-color-primary)}.el-table th.el-table__cell.required>div:before{display:inline-block;content:"";width:8px;height:8px;border-radius:50%;background:#ff4d51;margin-right:5px;vertical-align:middle}.el-table td.el-table__cell div{box-sizing:border-box}.el-table td.el-table__cell.gutter{width:0}.el-table--border .el-table__footer-wrapper tr:first-child td:first-child,.el-table--border .el-table__footer-wrapper tr:first-child th:first-child,.el-table--border .el-table__inner-wrapper tr:first-child td:first-child,.el-table--border .el-table__inner-wrapper tr:first-child th:first-child,.el-table--group .el-table__footer-wrapper tr:first-child td:first-child,.el-table--group .el-table__footer-wrapper tr:first-child th:first-child,.el-table--group .el-table__inner-wrapper tr:first-child td:first-child,.el-table--group .el-table__inner-wrapper tr:first-child th:first-child{border-left:var(--el-table-border)}.el-table--border .el-table__footer-wrapper,.el-table--group .el-table__footer-wrapper{border-top:var(--el-table-border)}.el-table--border .el-table__inner-wrapper:after,.el-table--border:after,.el-table--border:before,.el-table__inner-wrapper:before{content:"";position:absolute;background-color:var(--el-table-border-color);z-index:3}.el-table--border .el-table__inner-wrapper:after{left:0;top:0;width:100%;height:1px;z-index:3}.el-table--border:before{top:-1px;left:0;width:1px;height:100%;z-index:3}.el-table--border:after{top:-1px;right:0;width:1px;height:100%;z-index:3}.el-table--border .el-table__inner-wrapper{border-right:none;border-bottom:none}.el-table--border .el-table__footer-wrapper{position:relative;margin-top:-2px}.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table--border th.el-table__cell.gutter:last-of-type{border-bottom:var(--el-table-border);border-bottom-width:1px}.el-table--border th.el-table__cell{border-bottom:var(--el-table-border)}.el-table--hidden{visibility:hidden}.el-table__body-wrapper,.el-table__footer-wrapper,.el-table__header-wrapper{width:100%}.el-table__body-wrapper tr td.el-table-fixed-column--left,.el-table__body-wrapper tr td.el-table-fixed-column--right,.el-table__body-wrapper tr th.el-table-fixed-column--left,.el-table__body-wrapper tr th.el-table-fixed-column--right,.el-table__footer-wrapper tr td.el-table-fixed-column--left,.el-table__footer-wrapper tr td.el-table-fixed-column--right,.el-table__footer-wrapper tr th.el-table-fixed-column--left,.el-table__footer-wrapper tr th.el-table-fixed-column--right,.el-table__header-wrapper tr td.el-table-fixed-column--left,.el-table__header-wrapper tr td.el-table-fixed-column--right,.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{position:sticky!important;z-index:2;background:var(--el-bg-color)}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before{content:"";position:absolute;top:0;width:10px;bottom:-1px;overflow-x:hidden;overflow-y:hidden;box-shadow:none;touch-action:none;pointer-events:none}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column:before{left:-10px}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column:before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column:before{right:-10px;box-shadow:none}.el-table__body-wrapper tr td.el-table__fixed-right-patch,.el-table__body-wrapper tr th.el-table__fixed-right-patch,.el-table__footer-wrapper tr td.el-table__fixed-right-patch,.el-table__footer-wrapper tr th.el-table__fixed-right-patch,.el-table__header-wrapper tr td.el-table__fixed-right-patch,.el-table__header-wrapper tr th.el-table__fixed-right-patch{position:sticky!important;z-index:2;background:#fff;right:0}.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body,.el-table__footer,.el-table__header{table-layout:fixed;border-collapse:separate}.el-table__footer-wrapper,.el-table__header-wrapper{overflow:hidden}.el-table__footer-wrapper tbody td.el-table__cell,.el-table__header-wrapper tbody td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__body-wrapper .el-table-column--selection .el-checkbox,.el-table__header-wrapper .el-table-column--selection .el-checkbox{height:unset}.el-table.is-scrolling-left .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-left.el-table--border .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:var(--el-table-border)}.el-table.is-scrolling-left th.el-table-fixed-column--left{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-right th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-middle .el-table-fixed-column--right.is-first-column:before{box-shadow:var(--el-table-fixed-right-column)}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column:before{box-shadow:var(--el-table-fixed-left-column)}.el-table.is-scrolling-none .el-table-fixed-column--left.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--left.is-last-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-first-column:before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-last-column:before{box-shadow:none}.el-table.is-scrolling-none th.el-table-fixed-column--left,.el-table.is-scrolling-none th.el-table-fixed-column--right{background-color:var(--el-table-header-bg-color)}.el-table__body-wrapper{overflow:hidden;position:relative}.el-table__body-wrapper .el-scrollbar__bar{z-index:2}.el-table .caret-wrapper{display:inline-flex;flex-direction:column;align-items:center;height:14px;width:24px;vertical-align:middle;cursor:pointer;overflow:initial;position:relative}.el-table .sort-caret{width:0;height:0;border:solid 5px transparent;position:absolute;left:7px}.el-table .sort-caret.ascending{border-bottom-color:var(--el-text-color-placeholder);top:-5px}.el-table .sort-caret.descending{border-top-color:var(--el-text-color-placeholder);bottom:-3px}.el-table .ascending .sort-caret.ascending{border-bottom-color:var(--el-color-primary)}.el-table .descending .sort-caret.descending{border-top-color:var(--el-color-primary)}.el-table .hidden-columns{visibility:hidden;position:absolute;z-index:-1}.el-table--striped .el-table__body tr.el-table__row--striped td.el-table__cell{background:var(--el-fill-color-lighter)}.el-table--striped .el-table__body tr.el-table__row--striped.current-row td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__body tr.hover-row.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped>td.el-table__cell,.el-table__body tr.hover-row>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr.current-row>td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__column-resize-proxy{position:absolute;left:200px;top:0;bottom:0;width:0;border-left:var(--el-table-border);z-index:10}.el-table__column-filter-trigger{display:inline-block;cursor:pointer}.el-table__column-filter-trigger i{color:var(--el-color-info);font-size:14px;vertical-align:middle}.el-table__border-left-patch{top:0;left:0;width:1px;height:100%;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table__border-bottom-patch{left:0;height:1px;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table__border-right-patch{top:0;height:100%;width:1px;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table--enable-row-transition .el-table__body td.el-table__cell{transition:background-color .25s ease}.el-table--enable-row-hover .el-table__body tr:hover>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table [class*=el-table__row--level] .el-table__expand-icon{display:inline-block;width:12px;line-height:12px;height:12px;text-align:center;margin-right:8px}.el-table-v2{--el-table-border-color:var(--el-border-color-lighter);--el-table-border:1px solid var(--el-table-border-color);--el-table-text-color:var(--el-text-color-regular);--el-table-header-text-color:var(--el-text-color-secondary);--el-table-row-hover-bg-color:var(--el-fill-color-light);--el-table-current-row-bg-color:var(--el-color-primary-light-9);--el-table-header-bg-color:var(--el-bg-color);--el-table-fixed-box-shadow:var(--el-box-shadow-light);--el-table-bg-color:var(--el-fill-color-blank);--el-table-tr-bg-color:var(--el-fill-color-blank);--el-table-expanded-cell-bg-color:var(--el-fill-color-blank);--el-table-fixed-left-column:inset 10px 0 10px -10px rgba(0, 0, 0, .15);--el-table-fixed-right-column:inset -10px 0 10px -10px rgba(0, 0, 0, .15);font-size:14px}.el-table-v2 *{box-sizing:border-box}.el-table-v2__root{position:relative}.el-table-v2__root:hover .el-table-v2__main .el-virtual-scrollbar{opacity:1}.el-table-v2__main{display:flex;flex-direction:column-reverse;position:absolute;overflow:hidden;top:0;background-color:var(--el-bg-color);left:0}.el-table-v2__main .el-vl__horizontal,.el-table-v2__main .el-vl__vertical{z-index:2}.el-table-v2__left{display:flex;flex-direction:column-reverse;position:absolute;overflow:hidden;top:0;background-color:var(--el-bg-color);left:0;box-shadow:2px 0 4px rgba(0,0,0,.06)}.el-table-v2__left .el-virtual-scrollbar{opacity:0}.el-table-v2__left .el-vl__horizontal,.el-table-v2__left .el-vl__vertical{z-index:-1}.el-table-v2__right{display:flex;flex-direction:column-reverse;position:absolute;overflow:hidden;top:0;background-color:var(--el-bg-color);right:0;box-shadow:-2px 0 4px rgba(0,0,0,.06)}.el-table-v2__right .el-virtual-scrollbar{opacity:0}.el-table-v2__right .el-vl__horizontal,.el-table-v2__right .el-vl__vertical{z-index:-1}.el-table-v2__header-row,.el-table-v2__row{padding-inline-end:var(--el-table-scrollbar-size)}.el-table-v2__header-wrapper{overflow:hidden}.el-table-v2__header{position:relative;overflow:hidden}.el-table-v2__footer{position:absolute;left:0;right:0;bottom:0;overflow:hidden}.el-table-v2__empty{position:absolute;left:0}.el-table-v2__overlay{position:absolute;left:0;right:0;top:0;bottom:0;z-index:9999}.el-table-v2__header-row{display:flex;border-bottom:var(--el-table-border)}.el-table-v2__header-cell{display:flex;align-items:center;padding:0 8px;height:100%;-webkit-user-select:none;user-select:none;overflow:hidden;background-color:var(--el-table-header-bg-color);color:var(--el-table-header-text-color);font-weight:700}.el-table-v2__header-cell.is-align-center{justify-content:center;text-align:center}.el-table-v2__header-cell.is-align-right{justify-content:flex-end;text-align:right}.el-table-v2__header-cell.is-sortable{cursor:pointer}.el-table-v2__header-cell:hover .el-icon{display:block}.el-table-v2__sort-icon{transition:opacity,display var(--el-transition-duration);opacity:.6;display:none}.el-table-v2__sort-icon.is-sorting{display:block;opacity:1}.el-table-v2__row{border-bottom:var(--el-table-border);display:flex;align-items:center;transition:background-color var(--el-transition-duration)}.el-table-v2__row.is-hovered,.el-table-v2__row:hover{background-color:var(--el-table-row-hover-bg-color)}.el-table-v2__row-cell{height:100%;overflow:hidden;display:flex;align-items:center;padding:0 8px}.el-table-v2__row-cell.is-align-center{justify-content:center;text-align:center}.el-table-v2__row-cell.is-align-right{justify-content:flex-end;text-align:right}.el-table-v2__expand-icon{margin:0 4px;cursor:pointer;-webkit-user-select:none;user-select:none}.el-table-v2__expand-icon svg{transition:transform var(--el-transition-duration)}.el-table-v2__expand-icon.is-expanded svg{transform:rotate(90deg)}.el-table-v2:not(.is-dynamic) .el-table-v2__cell-text{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-table-v2.is-dynamic .el-table-v2__row{overflow:hidden;align-items:stretch}.el-tabs{--el-tabs-header-height:40px}.el-tabs__header{padding:0;position:relative;margin:0 0 15px}.el-tabs__active-bar{position:absolute;bottom:0;left:0;height:2px;background-color:var(--el-color-primary);z-index:1;transition:width var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),transform var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);list-style:none}.el-tabs__new-tab{display:flex;align-items:center;justify-content:center;float:right;border:1px solid var(--el-border-color);height:20px;width:20px;line-height:20px;margin:10px 0 10px 10px;border-radius:3px;text-align:center;font-size:12px;color:var(--el-text-color-primary);cursor:pointer;transition:all .15s}.el-tabs__new-tab .is-icon-plus{height:inherit;width:inherit;transform:scale(.8)}.el-tabs__new-tab .is-icon-plus svg{vertical-align:middle}.el-tabs__new-tab:hover{color:var(--el-color-primary)}.el-tabs__nav-wrap{overflow:hidden;margin-bottom:-1px;position:relative}.el-tabs__nav-wrap:after{content:"";position:absolute;left:0;bottom:0;width:100%;height:2px;background-color:var(--el-border-color-light);z-index:var(--el-index-normal)}.el-tabs__nav-wrap.is-scrollable{padding:0 20px;box-sizing:border-box}.el-tabs__nav-scroll{overflow:hidden}.el-tabs__nav-next,.el-tabs__nav-prev{position:absolute;cursor:pointer;line-height:44px;font-size:12px;color:var(--el-text-color-secondary)}.el-tabs__nav-next{right:0}.el-tabs__nav-prev{left:0}.el-tabs__nav{white-space:nowrap;position:relative;transition:transform var(--el-transition-duration);float:left;z-index:calc(var(--el-index-normal) + 1)}.el-tabs__nav.is-stretch{min-width:100%;display:flex}.el-tabs__nav.is-stretch>*{flex:1;text-align:center}.el-tabs__item{padding:0 20px;height:var(--el-tabs-header-height);box-sizing:border-box;line-height:var(--el-tabs-header-height);display:inline-block;list-style:none;font-size:var(--el-font-size-base);font-weight:500;color:var(--el-text-color-primary);position:relative}.el-tabs__item:focus,.el-tabs__item:focus:active{outline:0}.el-tabs__item:focus-visible{box-shadow:0 0 2px 2px var(--el-color-primary) inset;border-radius:3px}.el-tabs__item .is-icon-close{border-radius:50%;text-align:center;transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);margin-left:5px}.el-tabs__item .is-icon-close:before{transform:scale(.9);display:inline-block}.el-tabs__item .is-icon-close:hover{background-color:var(--el-text-color-placeholder);color:#fff}.el-tabs__item .is-icon-close svg{margin-top:1px}.el-tabs__item.is-active{color:var(--el-color-primary)}.el-tabs__item:hover{color:var(--el-color-primary);cursor:pointer}.el-tabs__item.is-disabled{color:var(--el-disabled-text-color);cursor:default}.el-tabs__content{overflow:hidden;position:relative}.el-tabs--card>.el-tabs__header{border-bottom:1px solid var(--el-border-color-light);height:var(--el-tabs-header-height)}.el-tabs--card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--card>.el-tabs__header .el-tabs__nav{border:1px solid var(--el-border-color-light);border-bottom:none;border-radius:4px 4px 0 0;box-sizing:border-box}.el-tabs--card>.el-tabs__header .el-tabs__active-bar{display:none}.el-tabs--card>.el-tabs__header .el-tabs__item .is-icon-close{position:relative;font-size:12px;width:0;height:14px;vertical-align:middle;line-height:15px;overflow:hidden;top:-1px;right:-2px;transform-origin:100% 50%}.el-tabs--card>.el-tabs__header .el-tabs__item{border-bottom:1px solid transparent;border-left:1px solid var(--el-border-color-light);transition:color var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier),padding var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier)}.el-tabs--card>.el-tabs__header .el-tabs__item:first-child{border-left:none}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover{padding-left:13px;padding-right:13px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-closable:hover .is-icon-close{width:14px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active{border-bottom-color:var(--el-bg-color)}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable{padding-left:20px;padding-right:20px}.el-tabs--card>.el-tabs__header .el-tabs__item.is-active.is-closable .is-icon-close{width:14px}.el-tabs--border-card{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color)}.el-tabs--border-card>.el-tabs__content{padding:15px}.el-tabs--border-card>.el-tabs__header{background-color:var(--el-fill-color-light);border-bottom:1px solid var(--el-border-color-light);margin:0}.el-tabs--border-card>.el-tabs__header .el-tabs__nav-wrap:after{content:none}.el-tabs--border-card>.el-tabs__header .el-tabs__item{transition:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);border:1px solid transparent;margin-top:-1px;color:var(--el-text-color-secondary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:first-child{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item+.el-tabs__item{margin-left:-1px}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-active{color:var(--el-color-primary);background-color:var(--el-bg-color-overlay);border-right-color:var(--el-border-color);border-left-color:var(--el-border-color)}.el-tabs--border-card>.el-tabs__header .el-tabs__item:not(.is-disabled):hover{color:var(--el-color-primary)}.el-tabs--border-card>.el-tabs__header .el-tabs__item.is-disabled{color:var(--el-disabled-text-color)}.el-tabs--border-card>.el-tabs__header .is-scrollable .el-tabs__item:first-child{margin-left:0}.el-tabs--bottom .el-tabs__item.is-bottom:nth-child(2),.el-tabs--bottom .el-tabs__item.is-top:nth-child(2),.el-tabs--top .el-tabs__item.is-bottom:nth-child(2),.el-tabs--top .el-tabs__item.is-top:nth-child(2){padding-left:0}.el-tabs--bottom .el-tabs__item.is-bottom:last-child,.el-tabs--bottom .el-tabs__item.is-top:last-child,.el-tabs--top .el-tabs__item.is-bottom:last-child,.el-tabs--top .el-tabs__item.is-top:last-child{padding-right:0}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:nth-child(2),.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:nth-child(2){padding-left:20px}.el-tabs--bottom .el-tabs--left>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom .el-tabs--right>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--bottom.el-tabs--card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top .el-tabs--left>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top .el-tabs--right>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--border-card>.el-tabs__header .el-tabs__item:last-child,.el-tabs--top.el-tabs--card>.el-tabs__header .el-tabs__item:last-child{padding-right:20px}.el-tabs--bottom .el-tabs__header.is-bottom{margin-bottom:0;margin-top:10px}.el-tabs--bottom.el-tabs--border-card .el-tabs__header.is-bottom{border-bottom:0;border-top:1px solid var(--el-border-color)}.el-tabs--bottom.el-tabs--border-card .el-tabs__nav-wrap.is-bottom{margin-top:-1px;margin-bottom:0}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom:not(.is-active){border:1px solid transparent}.el-tabs--bottom.el-tabs--border-card .el-tabs__item.is-bottom{margin:0 -1px -1px}.el-tabs--left,.el-tabs--right{overflow:hidden}.el-tabs--left .el-tabs__header.is-left,.el-tabs--left .el-tabs__header.is-right,.el-tabs--left .el-tabs__nav-scroll,.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__header.is-left,.el-tabs--right .el-tabs__header.is-right,.el-tabs--right .el-tabs__nav-scroll,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{height:100%}.el-tabs--left .el-tabs__active-bar.is-left,.el-tabs--left .el-tabs__active-bar.is-right,.el-tabs--right .el-tabs__active-bar.is-left,.el-tabs--right .el-tabs__active-bar.is-right{top:0;bottom:auto;width:2px;height:auto}.el-tabs--left .el-tabs__nav-wrap.is-left,.el-tabs--left .el-tabs__nav-wrap.is-right,.el-tabs--right .el-tabs__nav-wrap.is-left,.el-tabs--right .el-tabs__nav-wrap.is-right{margin-bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{height:30px;line-height:30px;width:100%;text-align:center;cursor:pointer}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next i,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev i{transform:rotate(90deg)}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-prev,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-prev{left:auto;top:0}.el-tabs--left .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--left .el-tabs__nav-wrap.is-right>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-left>.el-tabs__nav-next,.el-tabs--right .el-tabs__nav-wrap.is-right>.el-tabs__nav-next{right:auto;bottom:0}.el-tabs--left .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--left .el-tabs__nav-wrap.is-right.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-left.is-scrollable,.el-tabs--right .el-tabs__nav-wrap.is-right.is-scrollable{padding:30px 0}.el-tabs--left .el-tabs__nav-wrap.is-left:after,.el-tabs--left .el-tabs__nav-wrap.is-right:after,.el-tabs--right .el-tabs__nav-wrap.is-left:after,.el-tabs--right .el-tabs__nav-wrap.is-right:after{height:100%;width:2px;bottom:auto;top:0}.el-tabs--left .el-tabs__nav.is-left,.el-tabs--left .el-tabs__nav.is-right,.el-tabs--right .el-tabs__nav.is-left,.el-tabs--right .el-tabs__nav.is-right{float:none}.el-tabs--left .el-tabs__item.is-left,.el-tabs--left .el-tabs__item.is-right,.el-tabs--right .el-tabs__item.is-left,.el-tabs--right .el-tabs__item.is-right{display:block}.el-tabs--left .el-tabs__header.is-left{float:left;margin-bottom:0;margin-right:10px}.el-tabs--left .el-tabs__nav-wrap.is-left{margin-right:-1px}.el-tabs--left .el-tabs__nav-wrap.is-left:after{left:auto;right:0}.el-tabs--left .el-tabs__active-bar.is-left{right:0;left:auto}.el-tabs--left .el-tabs__item.is-left{text-align:right}.el-tabs--left.el-tabs--card .el-tabs__active-bar.is-left{display:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left{border-left:none;border-right:1px solid var(--el-border-color-light);border-bottom:none;border-top:1px solid var(--el-border-color-light);text-align:left}.el-tabs--left.el-tabs--card .el-tabs__item.is-left:first-child{border-right:1px solid var(--el-border-color-light);border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active{border:1px solid var(--el-border-color-light);border-right-color:#fff;border-left:none;border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:first-child{border-top:none}.el-tabs--left.el-tabs--card .el-tabs__item.is-left.is-active:last-child{border-bottom:none}.el-tabs--left.el-tabs--card .el-tabs__nav{border-radius:4px 0 0 4px;border-bottom:1px solid var(--el-border-color-light);border-right:none}.el-tabs--left.el-tabs--card .el-tabs__new-tab{float:none}.el-tabs--left.el-tabs--border-card .el-tabs__header.is-left{border-right:1px solid var(--el-border-color)}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left{border:1px solid transparent;margin:-1px 0 -1px -1px}.el-tabs--left.el-tabs--border-card .el-tabs__item.is-left.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.el-tabs--right .el-tabs__header.is-right{float:right;margin-bottom:0;margin-left:10px}.el-tabs--right .el-tabs__nav-wrap.is-right{margin-left:-1px}.el-tabs--right .el-tabs__nav-wrap.is-right:after{left:0;right:auto}.el-tabs--right .el-tabs__active-bar.is-right{left:0}.el-tabs--right.el-tabs--card .el-tabs__active-bar.is-right{display:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right{border-bottom:none;border-top:1px solid var(--el-border-color-light)}.el-tabs--right.el-tabs--card .el-tabs__item.is-right:first-child{border-left:1px solid var(--el-border-color-light);border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active{border:1px solid var(--el-border-color-light);border-left-color:#fff;border-right:none;border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:first-child{border-top:none}.el-tabs--right.el-tabs--card .el-tabs__item.is-right.is-active:last-child{border-bottom:none}.el-tabs--right.el-tabs--card .el-tabs__nav{border-radius:0 4px 4px 0;border-bottom:1px solid var(--el-border-color-light);border-left:none}.el-tabs--right.el-tabs--border-card .el-tabs__header.is-right{border-left:1px solid var(--el-border-color)}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right{border:1px solid transparent;margin:-1px -1px -1px 0}.el-tabs--right.el-tabs--border-card .el-tabs__item.is-right.is-active{border-color:transparent;border-top-color:#d1dbe5;border-bottom-color:#d1dbe5}.slideInLeft-transition,.slideInRight-transition{display:inline-block}.slideInRight-enter{animation:slideInRight-enter var(--el-transition-duration)}.slideInRight-leave{position:absolute;left:0;right:0;animation:slideInRight-leave var(--el-transition-duration)}.slideInLeft-enter{animation:slideInLeft-enter var(--el-transition-duration)}.slideInLeft-leave{position:absolute;left:0;right:0;animation:slideInLeft-leave var(--el-transition-duration)}@keyframes slideInRight-enter{0%{opacity:0;transform-origin:0 0;transform:translate(100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInRight-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(100%);opacity:0}}@keyframes slideInLeft-enter{0%{opacity:0;transform-origin:0 0;transform:translate(-100%)}to{opacity:1;transform-origin:0 0;transform:translate(0)}}@keyframes slideInLeft-leave{0%{transform-origin:0 0;transform:translate(0);opacity:1}to{transform-origin:0 0;transform:translate(-100%);opacity:0}}.el-tag{--el-tag-font-size:12px;--el-tag-border-radius:4px;--el-tag-border-radius-rounded:9999px;--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary);--el-tag-text-color:var(--el-color-primary);background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color);display:inline-flex;justify-content:center;align-items:center;height:24px;padding:0 9px;font-size:var(--el-tag-font-size);line-height:1;border-width:1px;border-style:solid;border-radius:var(--el-tag-border-radius);box-sizing:border-box;white-space:nowrap;--el-icon-size:14px}.el-tag.el-tag--primary{--el-tag-bg-color:var(--el-color-primary-light-9);--el-tag-border-color:var(--el-color-primary-light-8);--el-tag-hover-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-bg-color:var(--el-color-success-light-9);--el-tag-border-color:var(--el-color-success-light-8);--el-tag-hover-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-bg-color:var(--el-color-warning-light-9);--el-tag-border-color:var(--el-color-warning-light-8);--el-tag-hover-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-bg-color:var(--el-color-danger-light-9);--el-tag-border-color:var(--el-color-danger-light-8);--el-tag-hover-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-bg-color:var(--el-color-error-light-9);--el-tag-border-color:var(--el-color-error-light-8);--el-tag-hover-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-bg-color:var(--el-color-info-light-9);--el-tag-border-color:var(--el-color-info-light-8);--el-tag-hover-color:var(--el-color-info)}.el-tag.el-tag--primary{--el-tag-text-color:var(--el-color-primary)}.el-tag.el-tag--success{--el-tag-text-color:var(--el-color-success)}.el-tag.el-tag--warning{--el-tag-text-color:var(--el-color-warning)}.el-tag.el-tag--danger{--el-tag-text-color:var(--el-color-danger)}.el-tag.el-tag--error{--el-tag-text-color:var(--el-color-error)}.el-tag.el-tag--info{--el-tag-text-color:var(--el-color-info)}.el-tag.is-hit{border-color:var(--el-color-primary)}.el-tag.is-round{border-radius:var(--el-tag-border-radius-rounded)}.el-tag .el-tag__close{color:var(--el-tag-text-color)}.el-tag .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag .el-icon{border-radius:50%;cursor:pointer;font-size:calc(var(--el-icon-size) - 2px);height:var(--el-icon-size);width:var(--el-icon-size)}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3);--el-tag-text-color:var(--el-color-white)}.el-tag--dark.el-tag--primary{--el-tag-bg-color:var(--el-color-primary);--el-tag-border-color:var(--el-color-primary);--el-tag-hover-color:var(--el-color-primary-light-3)}.el-tag--dark.el-tag--success{--el-tag-bg-color:var(--el-color-success);--el-tag-border-color:var(--el-color-success);--el-tag-hover-color:var(--el-color-success-light-3)}.el-tag--dark.el-tag--warning{--el-tag-bg-color:var(--el-color-warning);--el-tag-border-color:var(--el-color-warning);--el-tag-hover-color:var(--el-color-warning-light-3)}.el-tag--dark.el-tag--danger{--el-tag-bg-color:var(--el-color-danger);--el-tag-border-color:var(--el-color-danger);--el-tag-hover-color:var(--el-color-danger-light-3)}.el-tag--dark.el-tag--error{--el-tag-bg-color:var(--el-color-error);--el-tag-border-color:var(--el-color-error);--el-tag-hover-color:var(--el-color-error-light-3)}.el-tag--dark.el-tag--info{--el-tag-bg-color:var(--el-color-info);--el-tag-border-color:var(--el-color-info);--el-tag-hover-color:var(--el-color-info-light-3)}.el-tag--dark.el-tag--primary,.el-tag--dark.el-tag--success,.el-tag--dark.el-tag--warning,.el-tag--dark.el-tag--danger,.el-tag--dark.el-tag--error,.el-tag--dark.el-tag--info{--el-tag-text-color:var(--el-color-white)}.el-tag--plain{--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary);--el-tag-bg-color:var(--el-fill-color-blank)}.el-tag--plain.el-tag--primary{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-primary-light-5);--el-tag-hover-color:var(--el-color-primary)}.el-tag--plain.el-tag--success{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-success-light-5);--el-tag-hover-color:var(--el-color-success)}.el-tag--plain.el-tag--warning{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-warning-light-5);--el-tag-hover-color:var(--el-color-warning)}.el-tag--plain.el-tag--danger{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-danger-light-5);--el-tag-hover-color:var(--el-color-danger)}.el-tag--plain.el-tag--error{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-error-light-5);--el-tag-hover-color:var(--el-color-error)}.el-tag--plain.el-tag--info{--el-tag-bg-color:var(--el-fill-color-blank);--el-tag-border-color:var(--el-color-info-light-5);--el-tag-hover-color:var(--el-color-info)}.el-tag.is-closable{padding-right:5px}.el-tag--large{padding:0 11px;height:32px;--el-icon-size:16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--small{padding:0 7px;height:20px;--el-icon-size:12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}.el-tag.el-tag--primary.is-hit{border-color:var(--el-color-primary)}.el-tag.el-tag--success.is-hit{border-color:var(--el-color-success)}.el-tag.el-tag--warning.is-hit{border-color:var(--el-color-warning)}.el-tag.el-tag--danger.is-hit{border-color:var(--el-color-danger)}.el-tag.el-tag--error.is-hit{border-color:var(--el-color-error)}.el-tag.el-tag--info.is-hit{border-color:var(--el-color-info)}.time-select{margin:5px 0;min-width:0}.time-select .el-picker-panel__content{max-height:200px;margin:0}.time-select-item{padding:8px 10px;font-size:14px;line-height:20px}.time-select-item.disabled{color:var(--el-datepicker-border-color);cursor:not-allowed}.time-select-item:hover{background-color:var(--el-fill-color-light);font-weight:700;cursor:pointer}.time-select .time-select-item.selected:not(.disabled){color:var(--el-color-primary);font-weight:700}.el-timeline-item{position:relative;padding-bottom:20px}.el-timeline-item__wrapper{position:relative;padding-left:28px;top:-3px}.el-timeline-item__tail{position:absolute;left:4px;height:100%;border-left:2px solid var(--el-timeline-node-color)}.el-timeline-item .el-timeline-item__icon{color:var(--el-color-white);font-size:var(--el-font-size-small)}.el-timeline-item__node{position:absolute;background-color:var(--el-timeline-node-color);border-color:var(--el-timeline-node-color);border-radius:50%;box-sizing:border-box;display:flex;justify-content:center;align-items:center}.el-timeline-item__node--normal{left:-1px;width:var(--el-timeline-node-size-normal);height:var(--el-timeline-node-size-normal)}.el-timeline-item__node--large{left:-2px;width:var(--el-timeline-node-size-large);height:var(--el-timeline-node-size-large)}.el-timeline-item__node.is-hollow{background:var(--el-color-white);border-style:solid;border-width:2px}.el-timeline-item__node--primary{background-color:var(--el-color-primary);border-color:var(--el-color-primary)}.el-timeline-item__node--success{background-color:var(--el-color-success);border-color:var(--el-color-success)}.el-timeline-item__node--warning{background-color:var(--el-color-warning);border-color:var(--el-color-warning)}.el-timeline-item__node--danger{background-color:var(--el-color-danger);border-color:var(--el-color-danger)}.el-timeline-item__node--info{background-color:var(--el-color-info);border-color:var(--el-color-info)}.el-timeline-item__dot{position:absolute;display:flex;justify-content:center;align-items:center}.el-timeline-item__content{color:var(--el-text-color-primary)}.el-timeline-item__timestamp{color:var(--el-text-color-secondary);line-height:1;font-size:var(--el-font-size-small)}.el-timeline-item__timestamp.is-top{margin-bottom:8px;padding-top:4px}.el-timeline-item__timestamp.is-bottom{margin-top:8px}.el-timeline{--el-timeline-node-size-normal:12px;--el-timeline-node-size-large:14px;--el-timeline-node-color:var(--el-border-color-light);margin:0;font-size:var(--el-font-size-base);list-style:none}.el-timeline .el-timeline-item:last-child .el-timeline-item__tail{display:none}.el-timeline .el-timeline-item__center{display:flex;align-items:center}.el-timeline .el-timeline-item__center .el-timeline-item__wrapper{width:100%}.el-timeline .el-timeline-item__center .el-timeline-item__tail{top:0}.el-timeline .el-timeline-item__center:first-child .el-timeline-item__tail{height:calc(50% + 10px);top:calc(50% - 10px)}.el-timeline .el-timeline-item__center:last-child .el-timeline-item__tail{display:block;height:calc(50% - 10px)}.el-tooltip-v2__content{--el-tooltip-v2-padding:5px 10px;--el-tooltip-v2-border-radius:4px;--el-tooltip-v2-border-color:var(--el-border-color);border-radius:var(--el-tooltip-v2-border-radius);color:var(--el-color-black);background-color:var(--el-color-white);padding:var(--el-tooltip-v2-padding);border:1px solid var(--el-border-color)}.el-tooltip-v2__arrow{position:absolute;color:var(--el-color-white);width:var(--el-tooltip-v2-arrow-width);height:var(--el-tooltip-v2-arrow-height);pointer-events:none;left:var(--el-tooltip-v2-arrow-x);top:var(--el-tooltip-v2-arrow-y)}.el-tooltip-v2__arrow:before{content:"";width:0;height:0;border:var(--el-tooltip-v2-arrow-border-width) solid transparent;position:absolute}.el-tooltip-v2__arrow:after{content:"";width:0;height:0;border:var(--el-tooltip-v2-arrow-border-width) solid transparent;position:absolute}.el-tooltip-v2__content[data-side^=top] .el-tooltip-v2__arrow{bottom:0}.el-tooltip-v2__content[data-side^=top] .el-tooltip-v2__arrow:before{border-top-color:var(--el-color-white);border-top-width:var(--el-tooltip-v2-arrow-border-width);border-bottom:0;top:calc(100% - 1px)}.el-tooltip-v2__content[data-side^=top] .el-tooltip-v2__arrow:after{border-top-color:var(--el-border-color);border-top-width:var(--el-tooltip-v2-arrow-border-width);border-bottom:0;top:100%;z-index:-1}.el-tooltip-v2__content[data-side^=bottom] .el-tooltip-v2__arrow{top:0}.el-tooltip-v2__content[data-side^=bottom] .el-tooltip-v2__arrow:before{border-bottom-color:var(--el-color-white);border-bottom-width:var(--el-tooltip-v2-arrow-border-width);border-top:0;bottom:calc(100% - 1px)}.el-tooltip-v2__content[data-side^=bottom] .el-tooltip-v2__arrow:after{border-bottom-color:var(--el-border-color);border-bottom-width:var(--el-tooltip-v2-arrow-border-width);border-top:0;bottom:100%;z-index:-1}.el-tooltip-v2__content[data-side^=left] .el-tooltip-v2__arrow{right:0}.el-tooltip-v2__content[data-side^=left] .el-tooltip-v2__arrow:before{border-left-color:var(--el-color-white);border-left-width:var(--el-tooltip-v2-arrow-border-width);border-right:0;left:calc(100% - 1px)}.el-tooltip-v2__content[data-side^=left] .el-tooltip-v2__arrow:after{border-left-color:var(--el-border-color);border-left-width:var(--el-tooltip-v2-arrow-border-width);border-right:0;left:100%;z-index:-1}.el-tooltip-v2__content[data-side^=right] .el-tooltip-v2__arrow{left:0}.el-tooltip-v2__content[data-side^=right] .el-tooltip-v2__arrow:before{border-right-color:var(--el-color-white);border-right-width:var(--el-tooltip-v2-arrow-border-width);border-left:0;right:calc(100% - 1px)}.el-tooltip-v2__content[data-side^=right] .el-tooltip-v2__arrow:after{border-right-color:var(--el-border-color);border-right-width:var(--el-tooltip-v2-arrow-border-width);border-left:0;right:100%;z-index:-1}.el-tooltip-v2__content.is-dark{--el-tooltip-v2-border-color:transparent;background-color:var(--el-color-black);color:var(--el-color-white);border-color:transparent}.el-tooltip-v2__content.is-dark .el-tooltip-v2__arrow{background-color:var(--el-color-black);border-color:transparent}.el-transfer{--el-transfer-border-color:var(--el-border-color-lighter);--el-transfer-border-radius:var(--el-border-radius-base);--el-transfer-panel-width:200px;--el-transfer-panel-header-height:40px;--el-transfer-panel-header-bg-color:var(--el-fill-color-light);--el-transfer-panel-footer-height:40px;--el-transfer-panel-body-height:278px;--el-transfer-item-height:30px;--el-transfer-filter-height:32px;font-size:var(--el-font-size-base)}.el-transfer__buttons{display:inline-block;vertical-align:middle;padding:0 30px}.el-transfer__button{vertical-align:top}.el-transfer__button:nth-child(2){margin:0 0 0 10px}.el-transfer__button i,.el-transfer__button span{font-size:14px}.el-transfer__button .el-icon+span{margin-left:0}.el-transfer-panel{overflow:hidden;background:var(--el-bg-color-overlay);display:inline-block;text-align:left;vertical-align:middle;width:var(--el-transfer-panel-width);max-height:100%;box-sizing:border-box;position:relative}.el-transfer-panel__body{height:var(--el-transfer-panel-body-height);border-left:1px solid var(--el-transfer-border-color);border-right:1px solid var(--el-transfer-border-color);border-bottom:1px solid var(--el-transfer-border-color);border-bottom-left-radius:var(--el-transfer-border-radius);border-bottom-right-radius:var(--el-transfer-border-radius);overflow:hidden}.el-transfer-panel__body.is-with-footer{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.el-transfer-panel__list{margin:0;padding:6px 0;list-style:none;height:var(--el-transfer-panel-body-height);overflow:auto;box-sizing:border-box}.el-transfer-panel__list.is-filterable{height:calc(100% - var(--el-transfer-filter-height) - 30px);padding-top:0}.el-transfer-panel__item{height:var(--el-transfer-item-height);line-height:var(--el-transfer-item-height);padding-left:15px;display:block!important}.el-transfer-panel__item+.el-transfer-panel__item{margin-left:0}.el-transfer-panel__item.el-checkbox{color:var(--el-text-color-regular)}.el-transfer-panel__item:hover{color:var(--el-color-primary)}.el-transfer-panel__item.el-checkbox .el-checkbox__label{width:100%;overflow:hidden;text-overflow:ellipsis;white-space:nowrap;display:block;box-sizing:border-box;padding-left:22px;line-height:var(--el-transfer-item-height)}.el-transfer-panel__item .el-checkbox__input{position:absolute;top:8px}.el-transfer-panel__filter{text-align:center;margin:15px;box-sizing:border-box;width:auto}.el-transfer-panel__filter .el-input__inner{height:var(--el-transfer-filter-height);width:100%;font-size:12px;display:inline-block;box-sizing:border-box;border-radius:calc(var(--el-transfer-filter-height)/ 2)}.el-transfer-panel__filter .el-icon-circle-close{cursor:pointer}.el-transfer-panel .el-transfer-panel__header{display:flex;align-items:center;height:var(--el-transfer-panel-header-height);background:var(--el-transfer-panel-header-bg-color);margin:0;padding-left:15px;border:1px solid var(--el-transfer-border-color);border-top-left-radius:var(--el-transfer-border-radius);border-top-right-radius:var(--el-transfer-border-radius);box-sizing:border-box;color:var(--el-color-black)}.el-transfer-panel .el-transfer-panel__header .el-checkbox{position:relative;display:flex;width:100%;align-items:center}.el-transfer-panel .el-transfer-panel__header .el-checkbox .el-checkbox__label{font-size:16px;color:var(--el-text-color-primary);font-weight:400}.el-transfer-panel .el-transfer-panel__header .el-checkbox .el-checkbox__label span{position:absolute;right:15px;top:50%;transform:translate3d(0,-50%,0);color:var(--el-text-color-secondary);font-size:12px;font-weight:400}.el-transfer-panel .el-transfer-panel__footer{height:var(--el-transfer-panel-footer-height);background:var(--el-bg-color-overlay);margin:0;padding:0;border:1px solid var(--el-transfer-border-color);border-bottom-left-radius:var(--el-transfer-border-radius);border-bottom-right-radius:var(--el-transfer-border-radius)}.el-transfer-panel .el-transfer-panel__footer:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-transfer-panel .el-transfer-panel__footer .el-checkbox{padding-left:20px;color:var(--el-text-color-regular)}.el-transfer-panel .el-transfer-panel__empty{margin:0;height:var(--el-transfer-item-height);line-height:var(--el-transfer-item-height);padding:6px 15px 0;color:var(--el-text-color-secondary);text-align:center}.el-transfer-panel .el-checkbox__label{padding-left:8px}.el-transfer-panel .el-checkbox__inner{height:14px;width:14px;border-radius:3px}.el-transfer-panel .el-checkbox__inner:after{height:6px;width:3px;left:4px}.el-tree{--el-tree-node-hover-bg-color:var(--el-fill-color-light);--el-tree-text-color:var(--el-text-color-regular);--el-tree-expand-icon-color:var(--el-text-color-placeholder);position:relative;cursor:default;background:var(--el-fill-color-blank);color:var(--el-tree-text-color)}.el-tree__empty-block{position:relative;min-height:60px;text-align:center;width:100%;height:100%}.el-tree__empty-text{position:absolute;left:50%;top:50%;transform:translate(-50%,-50%);color:var(--el-text-color-secondary);font-size:var(--el-font-size-base)}.el-tree__drop-indicator{position:absolute;left:0;right:0;height:1px;background-color:var(--el-color-primary)}.el-tree-node{white-space:nowrap;outline:0}.el-tree-node:focus>.el-tree-node__content{background-color:var(--el-tree-node-hover-bg-color)}.el-tree-node.is-drop-inner>.el-tree-node__content .el-tree-node__label{background-color:var(--el-color-primary);color:#fff}.el-tree-node__content{display:flex;align-items:center;height:26px;cursor:pointer}.el-tree-node__content>.el-tree-node__expand-icon{padding:6px;box-sizing:content-box}.el-tree-node__content>label.el-checkbox{margin-right:8px}.el-tree-node__content:hover{background-color:var(--el-tree-node-hover-bg-color)}.el-tree.is-dragging .el-tree-node__content{cursor:move}.el-tree.is-dragging .el-tree-node__content *{pointer-events:none}.el-tree.is-dragging.is-drop-not-allow .el-tree-node__content{cursor:not-allowed}.el-tree-node__expand-icon{cursor:pointer;color:var(--el-tree-expand-icon-color);font-size:12px;transform:rotate(0);transition:transform var(--el-transition-duration) ease-in-out}.el-tree-node__expand-icon.expanded{transform:rotate(90deg)}.el-tree-node__expand-icon.is-leaf{color:transparent;cursor:default}.el-tree-node__expand-icon.is-hidden{visibility:hidden}.el-tree-node__label{font-size:var(--el-font-size-base)}.el-tree-node__loading-icon{margin-right:8px;font-size:var(--el-font-size-base);color:var(--el-tree-expand-icon-color)}.el-tree-node>.el-tree-node__children{overflow:hidden;background-color:transparent}.el-tree-node.is-expanded>.el-tree-node__children{display:block}.el-tree--highlight-current .el-tree-node.is-current>.el-tree-node__content{background-color:var(--el-color-primary-light-9)}.el-tree-select{--el-tree-node-hover-bg-color:var(--el-fill-color-light);--el-tree-text-color:var(--el-text-color-regular);--el-tree-expand-icon-color:var(--el-text-color-placeholder)}.el-tree-select__popper .el-tree-node__expand-icon{margin-left:8px}.el-tree-select__popper .el-tree-node.is-checked>.el-tree-node__content .el-select-dropdown__item.selected:after{content:none}.el-tree-select__popper .el-select-dropdown__item{flex:1;background:0 0!important;padding-left:0;height:20px;line-height:20px}.el-upload{--el-upload-dragger-padding-horizontal:40px;--el-upload-dragger-padding-vertical:10px;display:inline-flex;justify-content:center;align-items:center;cursor:pointer;outline:0}.el-upload__input{display:none}.el-upload__tip{font-size:12px;color:var(--el-text-color-regular);margin-top:7px}.el-upload iframe{position:absolute;z-index:-1;top:0;left:0;opacity:0}.el-upload--picture-card{--el-upload-picture-card-size:148px;background-color:var(--el-fill-color-lighter);border:1px dashed var(--el-border-color-darker);border-radius:6px;box-sizing:border-box;width:var(--el-upload-picture-card-size);height:var(--el-upload-picture-card-size);cursor:pointer;vertical-align:top;display:inline-flex;justify-content:center;align-items:center}.el-upload--picture-card i{font-size:28px;color:var(--el-text-color-secondary)}.el-upload--picture-card:hover{border-color:var(--el-color-primary);color:var(--el-color-primary)}.el-upload.is-drag{display:block}.el-upload:focus{border-color:var(--el-color-primary);color:var(--el-color-primary)}.el-upload:focus .el-upload-dragger{border-color:var(--el-color-primary)}.el-upload-dragger{padding:var(--el-upload-dragger-padding-horizontal) var(--el-upload-dragger-padding-vertical);background-color:var(--el-fill-color-blank);border:1px dashed var(--el-border-color);border-radius:6px;box-sizing:border-box;text-align:center;cursor:pointer;position:relative;overflow:hidden}.el-upload-dragger .el-icon--upload{font-size:67px;color:var(--el-text-color-placeholder);margin-bottom:16px;line-height:50px}.el-upload-dragger+.el-upload__tip{text-align:center}.el-upload-dragger~.el-upload__files{border-top:var(--el-border);margin-top:7px;padding-top:5px}.el-upload-dragger .el-upload__text{color:var(--el-text-color-regular);font-size:14px;text-align:center}.el-upload-dragger .el-upload__text em{color:var(--el-color-primary);font-style:normal}.el-upload-dragger:hover{border-color:var(--el-color-primary)}.el-upload-dragger.is-dragover{padding:calc(var(--el-upload-dragger-padding-horizontal) - 1px) calc(var(--el-upload-dragger-padding-vertical) - 1px);background-color:var(--el-color-primary-light-9);border:2px dashed var(--el-color-primary)}.el-upload-list{margin:10px 0 0;padding:0;list-style:none;position:relative}.el-upload-list__item{transition:all .5s cubic-bezier(.55,0,.1,1);font-size:14px;color:var(--el-text-color-regular);margin-bottom:5px;position:relative;box-sizing:border-box;border-radius:4px;width:100%}.el-upload-list__item .el-progress{position:absolute;top:20px;width:100%}.el-upload-list__item .el-progress__text{position:absolute;right:0;top:-13px}.el-upload-list__item .el-progress-bar{margin-right:0;padding-right:0}.el-upload-list__item .el-icon--upload-success{color:var(--el-color-success)}.el-upload-list__item .el-icon--close{display:none;position:absolute;right:5px;top:50%;cursor:pointer;opacity:.75;color:var(--el-text-color-regular);transition:opacity var(--el-transition-duration);transform:translateY(-50%)}.el-upload-list__item .el-icon--close:hover{opacity:1;color:var(--el-color-primary)}.el-upload-list__item .el-icon--close-tip{display:none;position:absolute;top:1px;right:5px;font-size:12px;cursor:pointer;opacity:1;color:var(--el-color-primary);font-style:normal}.el-upload-list__item:hover{background-color:var(--el-fill-color-light)}.el-upload-list__item:hover .el-icon--close{display:inline-flex}.el-upload-list__item:hover .el-progress__text{display:none}.el-upload-list__item .el-upload-list__item-info{display:inline-flex;justify-content:center;flex-direction:column;width:calc(100% - 30px);margin-left:4px}.el-upload-list__item.is-success .el-upload-list__item-status-label{display:inline-flex}.el-upload-list__item.is-success .el-upload-list__item-name:focus,.el-upload-list__item.is-success .el-upload-list__item-name:hover{color:var(--el-color-primary);cursor:pointer}.el-upload-list__item.is-success:focus:not(:hover) .el-icon--close-tip{display:inline-block}.el-upload-list__item.is-success:active,.el-upload-list__item.is-success:not(.focusing):focus{outline-width:0}.el-upload-list__item.is-success:active .el-icon--close-tip,.el-upload-list__item.is-success:not(.focusing):focus .el-icon--close-tip{display:none}.el-upload-list__item.is-success:focus .el-upload-list__item-status-label,.el-upload-list__item.is-success:hover .el-upload-list__item-status-label{display:none;opacity:0}.el-upload-list.is-disabled .el-upload-list__item-status-label,.el-upload-list.is-disabled .el-upload-list__item:hover{display:block}.el-upload-list__item-name{color:var(--el-text-color-regular);display:inline-flex;text-align:center;align-items:center;padding:0 4px;transition:color var(--el-transition-duration);font-size:var(--el-font-size-base)}.el-upload-list__item-name .el-icon{margin-right:6px;color:var(--el-text-color-secondary)}.el-upload-list__item-file-name{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.el-upload-list__item-status-label{position:absolute;right:5px;top:0;line-height:inherit;display:none;height:100%;justify-content:center;align-items:center;transition:opacity var(--el-transition-duration)}.el-upload-list__item-delete{position:absolute;right:10px;top:0;font-size:12px;color:var(--el-text-color-regular);display:none}.el-upload-list__item-delete:hover{color:var(--el-color-primary)}.el-upload-list--picture-card{--el-upload-list-picture-card-size:148px;display:inline-flex;flex-wrap:wrap;margin:0}.el-upload-list--picture-card .el-upload-list__item{overflow:hidden;background-color:var(--el-fill-color-blank);border:1px solid var(--el-border-color);border-radius:6px;box-sizing:border-box;width:var(--el-upload-list-picture-card-size);height:var(--el-upload-list-picture-card-size);margin:0 8px 8px 0;padding:0;display:inline-flex}.el-upload-list--picture-card .el-upload-list__item .el-icon--check,.el-upload-list--picture-card .el-upload-list__item .el-icon--circle-check{color:#fff}.el-upload-list--picture-card .el-upload-list__item .el-icon--close{display:none}.el-upload-list--picture-card .el-upload-list__item:hover .el-upload-list__item-status-label{opacity:0;display:block}.el-upload-list--picture-card .el-upload-list__item:hover .el-progress__text{display:block}.el-upload-list--picture-card .el-upload-list__item .el-upload-list__item-name{display:none}.el-upload-list--picture-card .el-upload-list__item-thumbnail{width:100%;height:100%;object-fit:contain}.el-upload-list--picture-card .el-upload-list__item-status-label{right:-15px;top:-6px;width:40px;height:24px;background:var(--el-color-success);text-align:center;transform:rotate(45deg)}.el-upload-list--picture-card .el-upload-list__item-status-label i{font-size:12px;margin-top:11px;transform:rotate(-45deg)}.el-upload-list--picture-card .el-upload-list__item-actions{position:absolute;width:100%;height:100%;left:0;top:0;cursor:default;display:inline-flex;justify-content:center;align-items:center;color:#fff;opacity:0;font-size:20px;background-color:var(--el-overlay-color-lighter);transition:opacity var(--el-transition-duration)}.el-upload-list--picture-card .el-upload-list__item-actions span{display:none;cursor:pointer}.el-upload-list--picture-card .el-upload-list__item-actions span+span{margin-left:1rem}.el-upload-list--picture-card .el-upload-list__item-actions .el-upload-list__item-delete{position:static;font-size:inherit;color:inherit}.el-upload-list--picture-card .el-upload-list__item-actions:hover{opacity:1}.el-upload-list--picture-card .el-upload-list__item-actions:hover span{display:inline-flex}.el-upload-list--picture-card .el-progress{top:50%;left:50%;transform:translate(-50%,-50%);bottom:auto;width:126px}.el-upload-list--picture-card .el-progress .el-progress__text{top:50%}.el-upload-list--picture .el-upload-list__item{overflow:hidden;z-index:0;background-color:var(--el-fill-color-blank);border:1px solid var(--el-border-color);border-radius:6px;box-sizing:border-box;margin-top:10px;padding:10px}.el-upload-list--picture .el-upload-list__item .el-icon--check,.el-upload-list--picture .el-upload-list__item .el-icon--circle-check{color:#fff}.el-upload-list--picture .el-upload-list__item:hover .el-upload-list__item-status-label{opacity:0;display:block}.el-upload-list--picture .el-upload-list__item:hover .el-progress__text{display:block}.el-upload-list--picture .el-upload-list__item.is-success .el-upload-list__item-name i{display:none}.el-upload-list--picture .el-upload-list__item .el-icon--close{top:5px;transform:translateY(0)}.el-upload-list--picture .el-upload-list__item-thumbnail{display:inline-flex;justify-content:center;align-items:center;width:70px;height:70px;object-fit:contain;position:relative;z-index:1;background-color:var(--el-color-white)}.el-upload-list--picture .el-upload-list__item-status-label{position:absolute;right:-17px;top:-7px;width:46px;height:26px;background:var(--el-color-success);text-align:center;transform:rotate(45deg)}.el-upload-list--picture .el-upload-list__item-status-label i{font-size:12px;margin-top:12px;transform:rotate(-45deg)}.el-upload-list--picture .el-progress{position:relative;top:-7px}.el-upload-cover{position:absolute;left:0;top:0;width:100%;height:100%;overflow:hidden;z-index:10;cursor:default}.el-upload-cover:after{display:inline-block;content:"";height:100%;vertical-align:middle}.el-upload-cover img{display:block;width:100%;height:100%}.el-upload-cover__label{right:-15px;top:-6px;width:40px;height:24px;background:var(--el-color-success);text-align:center;transform:rotate(45deg)}.el-upload-cover__label i{font-size:12px;margin-top:11px;transform:rotate(-45deg);color:#fff}.el-upload-cover__progress{display:inline-block;vertical-align:middle;position:static;width:243px}.el-upload-cover__progress+.el-upload__inner{opacity:0}.el-upload-cover__content{position:absolute;top:0;left:0;width:100%;height:100%}.el-upload-cover__interact{position:absolute;bottom:0;left:0;width:100%;height:100%;background-color:var(--el-overlay-color-light);text-align:center}.el-upload-cover__interact .btn{display:inline-block;color:#fff;font-size:14px;cursor:pointer;vertical-align:middle;transition:var(--el-transition-md-fade);margin-top:60px}.el-upload-cover__interact .btn i{margin-top:0}.el-upload-cover__interact .btn span{opacity:0;transition:opacity .15s linear}.el-upload-cover__interact .btn:not(:first-child){margin-left:35px}.el-upload-cover__interact .btn:hover{transform:translateY(-13px)}.el-upload-cover__interact .btn:hover span{opacity:1}.el-upload-cover__interact .btn i{color:#fff;display:block;font-size:24px;line-height:inherit;margin:0 auto 5px}.el-upload-cover__title{position:absolute;bottom:0;left:0;background-color:#fff;height:36px;width:100%;overflow:hidden;text-overflow:ellipsis;white-space:nowrap;font-weight:400;text-align:left;padding:0 10px;margin:0;line-height:36px;font-size:14px;color:var(--el-text-color-primary)}.el-upload-cover+.el-upload__inner{opacity:0;position:relative;z-index:1}.el-vl__wrapper{position:relative}.el-vl__wrapper:hover .el-virtual-scrollbar,.el-vl__wrapper.always-on .el-virtual-scrollbar{opacity:1}.el-vl__window{scrollbar-width:none}.el-vl__window::-webkit-scrollbar{display:none}.el-virtual-scrollbar{opacity:0;transition:opacity .34s ease-out}.el-virtual-scrollbar.always-on{opacity:1}.el-vg__wrapper{position:relative}.el-popper{--el-popper-border-radius:var(--el-popover-border-radius, 4px);position:absolute;border-radius:var(--el-popper-border-radius);padding:5px 11px;z-index:2000;font-size:12px;line-height:20px;min-width:10px;word-wrap:break-word;visibility:visible}.el-popper.is-dark{color:var(--el-bg-color);background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow:before{border:1px solid var(--el-text-color-primary);background:var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-bg-color-overlay);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow:before{border:1px solid var(--el-border-color-light);background:var(--el-bg-color-overlay);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{position:absolute;width:10px;height:10px;z-index:-1}.el-popper__arrow:before{position:absolute;width:10px;height:10px;z-index:-1;content:" ";transform:rotate(45deg);background:var(--el-text-color-primary);box-sizing:border-box}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow:before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow:before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow:before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow:before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow:before{border-top-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow:before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow:before{border-left-color:transparent!important;border-bottom-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow:before{border-right-color:transparent!important;border-top-color:transparent!important}.el-select-dropdown__item{font-size:var(--el-font-size-base);padding:0 32px 0 20px;position:relative;white-space:nowrap;overflow:hidden;text-overflow:ellipsis;color:var(--el-text-color-regular);height:34px;line-height:34px;box-sizing:border-box;cursor:pointer}.el-select-dropdown__item.is-disabled{color:var(--el-text-color-placeholder);cursor:not-allowed}.el-select-dropdown__item.hover,.el-select-dropdown__item:hover{background-color:var(--el-fill-color-light)}.el-select-dropdown__item.selected{color:var(--el-color-primary);font-weight:700} `)() ;(function () { if (typeof window == 'undefined') return var e, t = 'ontouchstart' in window document.createTouch || (document.createTouch = function (u, m, f, _, b, v, k) { return new r( m, f, { pageX: _, pageY: b, screenX: v, screenY: k, clientX: _ - window.pageXOffset, clientY: b - window.pageYOffset }, 0, 0 ) }), document.createTouchList || (document.createTouchList = function () { for (var u = o(), m = 0; m < arguments.length; m++) u[m] = arguments[m] return (u.length = arguments.length), u }), Element.prototype.matches || (Element.prototype.matches = Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector), Element.prototype.closest || (Element.prototype.closest = function (u) { var m = this do { if (m.matches(u)) return m m = m.parentElement || m.parentNode } while (m !== null && m.nodeType === 1) return null }) var r = function (m, f, _, b, v) { ;(b = b || 0), (v = v || 0), (this.identifier = f), (this.target = m), (this.clientX = _.clientX + b), (this.clientY = _.clientY + v), (this.screenX = _.screenX + b), (this.screenY = _.screenY + v), (this.pageX = _.pageX + b), (this.pageY = _.pageY + v) } function o() { var u = [] return ( (u.item = function (m) { return this[m] || null }), (u.identifiedTouch = function (m) { return this[m + 1] || null }), u ) } var n = !1 function a(u) { return function (m) { m.type === 'mousedown' && (n = !0), m.type === 'mouseup' && (n = !1), !(m.type === 'mousemove' && !n) && ((m.type === 'mousedown' || !e || (e && !e.dispatchEvent)) && (e = m.target), e.closest('[data-no-touch-simulate]') == null && l(u, m), m.type === 'mouseup' && (e = null)) } } function l(u, m) { var f = document.createEvent('Event') f.initEvent(u, !0, !0), (f.altKey = m.altKey), (f.ctrlKey = m.ctrlKey), (f.metaKey = m.metaKey), (f.shiftKey = m.shiftKey), (f.touches = c(m)), (f.targetTouches = c(m)), (f.changedTouches = s(m)), e.dispatchEvent(f) } function s(u) { var m = o() return m.push(new r(e, 1, u, 0, 0)), m } function c(u) { return u.type === 'mouseup' ? o() : s(u) } function d() { window.addEventListener('mousedown', a('touchstart'), !0), window.addEventListener('mousemove', a('touchmove'), !0), window.addEventListener('mouseup', a('touchend'), !0) } ;(d.multiTouchOffset = 75), t || new d() })() var lottie = { exports: {} } ;(function (module, exports) { typeof navigator != 'undefined' && (function (e, t) { module.exports = t() })(commonjsGlobal, function () { var svgNS = 'http://www.w3.org/2000/svg', locationHref = '', _useWebWorker = !1, initialDefaultFrame = -999999, setWebWorker = function (t) { _useWebWorker = !!t }, getWebWorker = function () { return _useWebWorker }, setLocationHref = function (t) { locationHref = t }, getLocationHref = function () { return locationHref } function createTag(e) { return document.createElement(e) } function extendPrototype(e, t) { var r, o = e.length, n for (r = 0; r < o; r += 1) { n = e[r].prototype for (var a in n) Object.prototype.hasOwnProperty.call(n, a) && (t.prototype[a] = n[a]) } } function getDescriptor(e, t) { return Object.getOwnPropertyDescriptor(e, t) } function createProxyFunction(e) { function t() {} return (t.prototype = e), t } var audioControllerFactory = (function () { function e(t) { ;(this.audios = []), (this.audioFactory = t), (this._volume = 1), (this._isMuted = !1) } return ( (e.prototype = { addAudio: function (r) { this.audios.push(r) }, pause: function () { var r, o = this.audios.length for (r = 0; r < o; r += 1) this.audios[r].pause() }, resume: function () { var r, o = this.audios.length for (r = 0; r < o; r += 1) this.audios[r].resume() }, setRate: function (r) { var o, n = this.audios.length for (o = 0; o < n; o += 1) this.audios[o].setRate(r) }, createAudio: function (r) { return this.audioFactory ? this.audioFactory(r) : window.Howl ? new window.Howl({ src: [r] }) : { isPlaying: !1, play: function () { this.isPlaying = !0 }, seek: function () { this.isPlaying = !1 }, playing: function () {}, rate: function () {}, setVolume: function () {} } }, setAudioFactory: function (r) { this.audioFactory = r }, setVolume: function (r) { ;(this._volume = r), this._updateVolume() }, mute: function () { ;(this._isMuted = !0), this._updateVolume() }, unmute: function () { ;(this._isMuted = !1), this._updateVolume() }, getVolume: function () { return this._volume }, _updateVolume: function () { var r, o = this.audios.length for (r = 0; r < o; r += 1) this.audios[r].volume(this._volume * (this._isMuted ? 0 : 1)) } }), function () { return new e() } ) })(), createTypedArray = (function () { function e(r, o) { var n = 0, a = [], l switch (r) { case 'int16': case 'uint8c': l = 1 break default: l = 1.1 break } for (n = 0; n < o; n += 1) a.push(l) return a } function t(r, o) { return r === 'float32' ? new Float32Array(o) : r === 'int16' ? new Int16Array(o) : r === 'uint8c' ? new Uint8ClampedArray(o) : e(r, o) } return typeof Uint8ClampedArray == 'function' && typeof Float32Array == 'function' ? t : e })() function createSizedArray(e) { return Array.apply(null, { length: e }) } function _typeof$6(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$6 = function (r) { return typeof r }) : (_typeof$6 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$6(e) ) } var subframeEnabled = !0, expressionsPlugin = null, idPrefix$1 = '', isSafari = /^((?!chrome|android).)*safari/i.test(navigator.userAgent), bmPow = Math.pow, bmSqrt = Math.sqrt, bmFloor = Math.floor, bmMax = Math.max, bmMin = Math.min, BMMath = {} ;(function () { var e = [ 'abs', 'acos', 'acosh', 'asin', 'asinh', 'atan', 'atanh', 'atan2', 'ceil', 'cbrt', 'expm1', 'clz32', 'cos', 'cosh', 'exp', 'floor', 'fround', 'hypot', 'imul', 'log', 'log1p', 'log2', 'log10', 'max', 'min', 'pow', 'random', 'round', 'sign', 'sin', 'sinh', 'sqrt', 'tan', 'tanh', 'trunc', 'E', 'LN10', 'LN2', 'LOG10E', 'LOG2E', 'PI', 'SQRT1_2', 'SQRT2' ], t, r = e.length for (t = 0; t < r; t += 1) BMMath[e[t]] = Math[e[t]] })(), (BMMath.random = Math.random), (BMMath.abs = function (e) { var t = _typeof$6(e) if (t === 'object' && e.length) { var r = createSizedArray(e.length), o, n = e.length for (o = 0; o < n; o += 1) r[o] = Math.abs(e[o]) return r } return Math.abs(e) }) var defaultCurveSegments = 150, degToRads = Math.PI / 180, roundCorner = 0.5519 function styleDiv(e) { ;(e.style.position = 'absolute'), (e.style.top = 0), (e.style.left = 0), (e.style.display = 'block'), (e.style.transformOrigin = '0 0'), (e.style.webkitTransformOrigin = '0 0'), (e.style.backfaceVisibility = 'visible'), (e.style.webkitBackfaceVisibility = 'visible'), (e.style.transformStyle = 'preserve-3d'), (e.style.webkitTransformStyle = 'preserve-3d'), (e.style.mozTransformStyle = 'preserve-3d') } function BMEnterFrameEvent(e, t, r, o) { ;(this.type = e), (this.currentTime = t), (this.totalTime = r), (this.direction = o < 0 ? -1 : 1) } function BMCompleteEvent(e, t) { ;(this.type = e), (this.direction = t < 0 ? -1 : 1) } function BMCompleteLoopEvent(e, t, r, o) { ;(this.type = e), (this.currentLoop = r), (this.totalLoops = t), (this.direction = o < 0 ? -1 : 1) } function BMSegmentStartEvent(e, t, r) { ;(this.type = e), (this.firstFrame = t), (this.totalFrames = r) } function BMDestroyEvent(e, t) { ;(this.type = e), (this.target = t) } function BMRenderFrameErrorEvent(e, t) { ;(this.type = 'renderFrameError'), (this.nativeError = e), (this.currentTime = t) } function BMConfigErrorEvent(e) { ;(this.type = 'configError'), (this.nativeError = e) } var createElementID = (function () { var e = 0 return function () { return (e += 1), idPrefix$1 + '__lottie_element_' + e } })() function HSVtoRGB(e, t, r) { var o, n, a, l, s, c, d, u switch ( ((l = Math.floor(e * 6)), (s = e * 6 - l), (c = r * (1 - t)), (d = r * (1 - s * t)), (u = r * (1 - (1 - s) * t)), l % 6) ) { case 0: ;(o = r), (n = u), (a = c) break case 1: ;(o = d), (n = r), (a = c) break case 2: ;(o = c), (n = r), (a = u) break case 3: ;(o = c), (n = d), (a = r) break case 4: ;(o = u), (n = c), (a = r) break case 5: ;(o = r), (n = c), (a = d) break } return [o, n, a] } function RGBtoHSV(e, t, r) { var o = Math.max(e, t, r), n = Math.min(e, t, r), a = o - n, l, s = o === 0 ? 0 : a / o, c = o / 255 switch (o) { case n: l = 0 break case e: ;(l = t - r + a * (t < r ? 6 : 0)), (l /= 6 * a) break case t: ;(l = r - e + a * 2), (l /= 6 * a) break case r: ;(l = e - t + a * 4), (l /= 6 * a) break } return [l, s, c] } function addSaturationToRGB(e, t) { var r = RGBtoHSV(e[0] * 255, e[1] * 255, e[2] * 255) return ( (r[1] += t), r[1] > 1 ? (r[1] = 1) : r[1] <= 0 && (r[1] = 0), HSVtoRGB(r[0], r[1], r[2]) ) } function addBrightnessToRGB(e, t) { var r = RGBtoHSV(e[0] * 255, e[1] * 255, e[2] * 255) return ( (r[2] += t), r[2] > 1 ? (r[2] = 1) : r[2] < 0 && (r[2] = 0), HSVtoRGB(r[0], r[1], r[2]) ) } function addHueToRGB(e, t) { var r = RGBtoHSV(e[0] * 255, e[1] * 255, e[2] * 255) return ( (r[0] += t / 360), r[0] > 1 ? (r[0] -= 1) : r[0] < 0 && (r[0] += 1), HSVtoRGB(r[0], r[1], r[2]) ) } var rgbToHex = (function () { var e = [], t, r for (t = 0; t < 256; t += 1) (r = t.toString(16)), (e[t] = r.length === 1 ? '0' + r : r) return function (o, n, a) { return ( o < 0 && (o = 0), n < 0 && (n = 0), a < 0 && (a = 0), '#' + e[o] + e[n] + e[a] ) } })(), setSubframeEnabled = function (t) { subframeEnabled = !!t }, getSubframeEnabled = function () { return subframeEnabled }, setExpressionsPlugin = function (t) { expressionsPlugin = t }, getExpressionsPlugin = function () { return expressionsPlugin }, setDefaultCurveSegments = function (t) { defaultCurveSegments = t }, getDefaultCurveSegments = function () { return defaultCurveSegments }, setIdPrefix = function (t) { idPrefix$1 = t } function createNS(e) { return document.createElementNS(svgNS, e) } function _typeof$5(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$5 = function (r) { return typeof r }) : (_typeof$5 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$5(e) ) } var dataManager = (function () { var e = 1, t = [], r, o, n = { onmessage: function () {}, postMessage: function (_) { r({ data: _ }) } }, a = { postMessage: function (_) { n.onmessage({ data: _ }) } } function l(f) { if (window.Worker && window.Blob && getWebWorker()) { var _ = new Blob( ['var _workerSelf = self; self.onmessage = ', f.toString()], { type: 'text/javascript' } ), b = URL.createObjectURL(_) return new Worker(b) } return (r = f), n } function s() { o || ((o = l(function (_) { function b() { function k(j, V) { var z, M, L = j.length, pe, ue, Ie, Pt for (M = 0; M < L; M += 1) if (((z = j[M]), 'ks' in z && !z.completed)) { if ( ((z.completed = !0), z.tt && (j[M - 1].td = z.tt), z.hasMask) ) { var rr = z.masksProperties for (ue = rr.length, pe = 0; pe < ue; pe += 1) if (rr[pe].pt.k.i) S(rr[pe].pt.k) else for ( Pt = rr[pe].pt.k.length, Ie = 0; Ie < Pt; Ie += 1 ) rr[pe].pt.k[Ie].s && S(rr[pe].pt.k[Ie].s[0]), rr[pe].pt.k[Ie].e && S(rr[pe].pt.k[Ie].e[0]) } z.ty === 0 ? ((z.layers = y(z.refId, V)), k(z.layers, V)) : z.ty === 4 ? w(z.shapes) : z.ty === 5 && ie(z) } } function g(j, V) { if (j) { var z = 0, M = j.length for (z = 0; z < M; z += 1) j[z].t === 1 && ((j[z].data.layers = y(j[z].data.refId, V)), k(j[z].data.layers, V)) } } function x(j, V) { for (var z = 0, M = V.length; z < M; ) { if (V[z].id === j) return V[z] z += 1 } return null } function y(j, V) { var z = x(j, V) return z ? z.layers.__used ? JSON.parse(JSON.stringify(z.layers)) : ((z.layers.__used = !0), z.layers) : null } function w(j) { var V, z = j.length, M, L for (V = z - 1; V >= 0; V -= 1) if (j[V].ty === 'sh') if (j[V].ks.k.i) S(j[V].ks.k) else for (L = j[V].ks.k.length, M = 0; M < L; M += 1) j[V].ks.k[M].s && S(j[V].ks.k[M].s[0]), j[V].ks.k[M].e && S(j[V].ks.k[M].e[0]) else j[V].ty === 'gr' && w(j[V].it) } function S(j) { var V, z = j.i.length for (V = 0; V < z; V += 1) (j.i[V][0] += j.v[V][0]), (j.i[V][1] += j.v[V][1]), (j.o[V][0] += j.v[V][0]), (j.o[V][1] += j.v[V][1]) } function T(j, V) { var z = V ? V.split('.') : [100, 100, 100] return j[0] > z[0] ? !0 : z[0] > j[0] ? !1 : j[1] > z[1] ? !0 : z[1] > j[1] ? !1 : j[2] > z[2] ? !0 : z[2] > j[2] ? !1 : null } var A = (function () { var j = [4, 4, 14] function V(M) { var L = M.t.d M.t.d = { k: [{ s: L, t: 0 }] } } function z(M) { var L, pe = M.length for (L = 0; L < pe; L += 1) M[L].ty === 5 && V(M[L]) } return function (M) { if (T(j, M.v) && (z(M.layers), M.assets)) { var L, pe = M.assets.length for (L = 0; L < pe; L += 1) M.assets[L].layers && z(M.assets[L].layers) } } })(), $ = (function () { var j = [4, 7, 99] return function (V) { if (V.chars && !T(j, V.v)) { var z, M = V.chars.length for (z = 0; z < M; z += 1) { var L = V.chars[z] L.data && L.data.shapes && (w(L.data.shapes), (L.data.ip = 0), (L.data.op = 99999), (L.data.st = 0), (L.data.sr = 1), (L.data.ks = { p: { k: [0, 0], a: 0 }, s: { k: [100, 100], a: 0 }, a: { k: [0, 0], a: 0 }, r: { k: 0, a: 0 }, o: { k: 100, a: 0 } }), V.chars[z].t || (L.data.shapes.push({ ty: 'no' }), L.data.shapes[0].it.push({ p: { k: [0, 0], a: 0 }, s: { k: [100, 100], a: 0 }, a: { k: [0, 0], a: 0 }, r: { k: 0, a: 0 }, o: { k: 100, a: 0 }, sk: { k: 0, a: 0 }, sa: { k: 0, a: 0 }, ty: 'tr' }))) } } } })(), F = (function () { var j = [5, 7, 15] function V(M) { var L = M.t.p typeof L.a == 'number' && (L.a = { a: 0, k: L.a }), typeof L.p == 'number' && (L.p = { a: 0, k: L.p }), typeof L.r == 'number' && (L.r = { a: 0, k: L.r }) } function z(M) { var L, pe = M.length for (L = 0; L < pe; L += 1) M[L].ty === 5 && V(M[L]) } return function (M) { if (T(j, M.v) && (z(M.layers), M.assets)) { var L, pe = M.assets.length for (L = 0; L < pe; L += 1) M.assets[L].layers && z(M.assets[L].layers) } } })(), Y = (function () { var j = [4, 1, 9] function V(M) { var L, pe = M.length, ue, Ie for (L = 0; L < pe; L += 1) if (M[L].ty === 'gr') V(M[L].it) else if (M[L].ty === 'fl' || M[L].ty === 'st') if (M[L].c.k && M[L].c.k[0].i) for ( Ie = M[L].c.k.length, ue = 0; ue < Ie; ue += 1 ) M[L].c.k[ue].s && ((M[L].c.k[ue].s[0] /= 255), (M[L].c.k[ue].s[1] /= 255), (M[L].c.k[ue].s[2] /= 255), (M[L].c.k[ue].s[3] /= 255)), M[L].c.k[ue].e && ((M[L].c.k[ue].e[0] /= 255), (M[L].c.k[ue].e[1] /= 255), (M[L].c.k[ue].e[2] /= 255), (M[L].c.k[ue].e[3] /= 255)) else (M[L].c.k[0] /= 255), (M[L].c.k[1] /= 255), (M[L].c.k[2] /= 255), (M[L].c.k[3] /= 255) } function z(M) { var L, pe = M.length for (L = 0; L < pe; L += 1) M[L].ty === 4 && V(M[L].shapes) } return function (M) { if (T(j, M.v) && (z(M.layers), M.assets)) { var L, pe = M.assets.length for (L = 0; L < pe; L += 1) M.assets[L].layers && z(M.assets[L].layers) } } })(), ae = (function () { var j = [4, 4, 18] function V(M) { var L, pe = M.length, ue, Ie for (L = pe - 1; L >= 0; L -= 1) if (M[L].ty === 'sh') if (M[L].ks.k.i) M[L].ks.k.c = M[L].closed else for ( Ie = M[L].ks.k.length, ue = 0; ue < Ie; ue += 1 ) M[L].ks.k[ue].s && (M[L].ks.k[ue].s[0].c = M[L].closed), M[L].ks.k[ue].e && (M[L].ks.k[ue].e[0].c = M[L].closed) else M[L].ty === 'gr' && V(M[L].it) } function z(M) { var L, pe, ue = M.length, Ie, Pt, rr, _e for (pe = 0; pe < ue; pe += 1) { if (((L = M[pe]), L.hasMask)) { var Oe = L.masksProperties for (Pt = Oe.length, Ie = 0; Ie < Pt; Ie += 1) if (Oe[Ie].pt.k.i) Oe[Ie].pt.k.c = Oe[Ie].cl else for ( _e = Oe[Ie].pt.k.length, rr = 0; rr < _e; rr += 1 ) Oe[Ie].pt.k[rr].s && (Oe[Ie].pt.k[rr].s[0].c = Oe[Ie].cl), Oe[Ie].pt.k[rr].e && (Oe[Ie].pt.k[rr].e[0].c = Oe[Ie].cl) } L.ty === 4 && V(L.shapes) } } return function (M) { if (T(j, M.v) && (z(M.layers), M.assets)) { var L, pe = M.assets.length for (L = 0; L < pe; L += 1) M.assets[L].layers && z(M.assets[L].layers) } } })() function re(j) { j.__complete || (Y(j), A(j), $(j), F(j), ae(j), k(j.layers, j.assets), g(j.chars, j.assets), (j.__complete = !0)) } function ie(j) { j.t.a.length === 0 && 'm' in j.t.p } var oe = {} return ( (oe.completeData = re), (oe.checkColors = Y), (oe.checkChars = $), (oe.checkPathProperties = F), (oe.checkShapes = ae), (oe.completeLayers = k), oe ) } if ( (a.dataManager || (a.dataManager = b()), a.assetLoader || (a.assetLoader = (function () { function k(x) { var y = x.getResponseHeader('content-type') return (y && x.responseType === 'json' && y.indexOf('json') !== -1) || (x.response && _typeof$5(x.response) === 'object') ? x.response : x.response && typeof x.response == 'string' ? JSON.parse(x.response) : x.responseText ? JSON.parse(x.responseText) : null } function g(x, y, w, S) { var T, A = new XMLHttpRequest() try { A.responseType = 'json' } catch {} A.onreadystatechange = function () { if (A.readyState === 4) if (A.status === 200) (T = k(A)), w(T) else try { ;(T = k(A)), w(T) } catch ($) { S && S($) } } try { A.open('GET', x, !0) } catch { A.open('GET', y + '/' + x, !0) } A.send() } return { load: g } })()), _.data.type === 'loadAnimation') ) a.assetLoader.load( _.data.path, _.data.fullPath, function (k) { a.dataManager.completeData(k), a.postMessage({ id: _.data.id, payload: k, status: 'success' }) }, function () { a.postMessage({ id: _.data.id, status: 'error' }) } ) else if (_.data.type === 'complete') { var v = _.data.animation a.dataManager.completeData(v), a.postMessage({ id: _.data.id, payload: v, status: 'success' }) } else _.data.type === 'loadData' && a.assetLoader.load( _.data.path, _.data.fullPath, function (k) { a.postMessage({ id: _.data.id, payload: k, status: 'success' }) }, function () { a.postMessage({ id: _.data.id, status: 'error' }) } ) })), (o.onmessage = function (f) { var _ = f.data, b = _.id, v = t[b] ;(t[b] = null), _.status === 'success' ? v.onComplete(_.payload) : v.onError && v.onError() })) } function c(f, _) { e += 1 var b = 'processId_' + e return (t[b] = { onComplete: f, onError: _ }), b } function d(f, _, b) { s() var v = c(_, b) o.postMessage({ type: 'loadAnimation', path: f, fullPath: window.location.origin + window.location.pathname, id: v }) } function u(f, _, b) { s() var v = c(_, b) o.postMessage({ type: 'loadData', path: f, fullPath: window.location.origin + window.location.pathname, id: v }) } function m(f, _, b) { s() var v = c(_, b) o.postMessage({ type: 'complete', animation: f, id: v }) } return { loadAnimation: d, loadData: u, completeAnimation: m } })(), ImagePreloader = (function () { var e = (function () { var g = createTag('canvas') ;(g.width = 1), (g.height = 1) var x = g.getContext('2d') return (x.fillStyle = 'rgba(0,0,0,0)'), x.fillRect(0, 0, 1, 1), g })() function t() { ;(this.loadedAssets += 1), this.loadedAssets === this.totalImages && this.loadedFootagesCount === this.totalFootages && this.imagesLoadedCb && this.imagesLoadedCb(null) } function r() { ;(this.loadedFootagesCount += 1), this.loadedAssets === this.totalImages && this.loadedFootagesCount === this.totalFootages && this.imagesLoadedCb && this.imagesLoadedCb(null) } function o(g, x, y) { var w = '' if (g.e) w = g.p else if (x) { var S = g.p S.indexOf('images/') !== -1 && (S = S.split('/')[1]), (w = x + S) } else (w = y), (w += g.u ? g.u : ''), (w += g.p) return w } function n(g) { var x = 0, y = setInterval( function () { var w = g.getBBox() ;(w.width || x > 500) && (this._imageLoaded(), clearInterval(y)), (x += 1) }.bind(this), 50 ) } function a(g) { var x = o(g, this.assetsPath, this.path), y = createNS('image') isSafari ? this.testImageLoaded(y) : y.addEventListener('load', this._imageLoaded, !1), y.addEventListener( 'error', function () { ;(w.img = e), this._imageLoaded() }.bind(this), !1 ), y.setAttributeNS('http://www.w3.org/1999/xlink', 'href', x), this._elementHelper.append ? this._elementHelper.append(y) : this._elementHelper.appendChild(y) var w = { img: y, assetData: g } return w } function l(g) { var x = o(g, this.assetsPath, this.path), y = createTag('img') ;(y.crossOrigin = 'anonymous'), y.addEventListener('load', this._imageLoaded, !1), y.addEventListener( 'error', function () { ;(w.img = e), this._imageLoaded() }.bind(this), !1 ), (y.src = x) var w = { img: y, assetData: g } return w } function s(g) { var x = { assetData: g }, y = o(g, this.assetsPath, this.path) return ( dataManager.loadData( y, function (w) { ;(x.img = w), this._footageLoaded() }.bind(this), function () { ;(x.img = {}), this._footageLoaded() }.bind(this) ), x ) } function c(g, x) { this.imagesLoadedCb = x var y, w = g.length for (y = 0; y < w; y += 1) g[y].layers || (!g[y].t || g[y].t === 'seq' ? ((this.totalImages += 1), this.images.push(this._createImageData(g[y]))) : g[y].t === 3 && ((this.totalFootages += 1), this.images.push(this.createFootageData(g[y])))) } function d(g) { this.path = g || '' } function u(g) { this.assetsPath = g || '' } function m(g) { for (var x = 0, y = this.images.length; x < y; ) { if (this.images[x].assetData === g) return this.images[x].img x += 1 } return null } function f() { ;(this.imagesLoadedCb = null), (this.images.length = 0) } function _() { return this.totalImages === this.loadedAssets } function b() { return this.totalFootages === this.loadedFootagesCount } function v(g, x) { g === 'svg' ? ((this._elementHelper = x), (this._createImageData = this.createImageData.bind(this))) : (this._createImageData = this.createImgData.bind(this)) } function k() { ;(this._imageLoaded = t.bind(this)), (this._footageLoaded = r.bind(this)), (this.testImageLoaded = n.bind(this)), (this.createFootageData = s.bind(this)), (this.assetsPath = ''), (this.path = ''), (this.totalImages = 0), (this.totalFootages = 0), (this.loadedAssets = 0), (this.loadedFootagesCount = 0), (this.imagesLoadedCb = null), (this.images = []) } return ( (k.prototype = { loadAssets: c, setAssetsPath: u, setPath: d, loadedImages: _, loadedFootages: b, destroy: f, getAsset: m, createImgData: l, createImageData: a, imageLoaded: t, footageLoaded: r, setCacheType: v }), k ) })() function BaseEvent() {} BaseEvent.prototype = { triggerEvent: function (t, r) { if (this._cbs[t]) for (var o = this._cbs[t], n = 0; n < o.length; n += 1) o[n](r) }, addEventListener: function (t, r) { return ( this._cbs[t] || (this._cbs[t] = []), this._cbs[t].push(r), function () { this.removeEventListener(t, r) }.bind(this) ) }, removeEventListener: function (t, r) { if (!r) this._cbs[t] = null else if (this._cbs[t]) { for (var o = 0, n = this._cbs[t].length; o < n; ) this._cbs[t][o] === r && (this._cbs[t].splice(o, 1), (o -= 1), (n -= 1)), (o += 1) this._cbs[t].length || (this._cbs[t] = null) } } } var markerParser = (function () { function e(t) { for ( var r = t.split(`\r `), o = {}, n, a = 0, l = 0; l < r.length; l += 1 ) (n = r[l].split(':')), n.length === 2 && ((o[n[0]] = n[1].trim()), (a += 1)) if (a === 0) throw new Error() return o } return function (t) { for (var r = [], o = 0; o < t.length; o += 1) { var n = t[o], a = { time: n.tm, duration: n.dr } try { a.payload = JSON.parse(t[o].cm) } catch { try { a.payload = e(t[o].cm) } catch { a.payload = { name: t[o].cm } } } r.push(a) } return r } })(), ProjectInterface = (function () { function e(t) { this.compositions.push(t) } return function () { function t(r) { for (var o = 0, n = this.compositions.length; o < n; ) { if ( this.compositions[o].data && this.compositions[o].data.nm === r ) return ( this.compositions[o].prepareFrame && this.compositions[o].data.xt && this.compositions[o].prepareFrame(this.currentFrame), this.compositions[o].compInterface ) o += 1 } return null } return ( (t.compositions = []), (t.currentFrame = 0), (t.registerComposition = e), t ) } })(), renderers = {}, registerRenderer = function (t, r) { renderers[t] = r } function getRenderer(e) { return renderers[e] } function _typeof$4(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$4 = function (r) { return typeof r }) : (_typeof$4 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$4(e) ) } var AnimationItem = function () { ;(this._cbs = []), (this.name = ''), (this.path = ''), (this.isLoaded = !1), (this.currentFrame = 0), (this.currentRawFrame = 0), (this.firstFrame = 0), (this.totalFrames = 0), (this.frameRate = 0), (this.frameMult = 0), (this.playSpeed = 1), (this.playDirection = 1), (this.playCount = 0), (this.animationData = {}), (this.assets = []), (this.isPaused = !0), (this.autoplay = !1), (this.loop = !0), (this.renderer = null), (this.animationID = createElementID()), (this.assetsPath = ''), (this.timeCompleted = 0), (this.segmentPos = 0), (this.isSubframeEnabled = getSubframeEnabled()), (this.segments = []), (this._idle = !0), (this._completedLoop = !1), (this.projectInterface = ProjectInterface()), (this.imagePreloader = new ImagePreloader()), (this.audioController = audioControllerFactory()), (this.markers = []), (this.configAnimation = this.configAnimation.bind(this)), (this.onSetupError = this.onSetupError.bind(this)), (this.onSegmentComplete = this.onSegmentComplete.bind(this)), (this.drawnFrameEvent = new BMEnterFrameEvent('drawnFrame', 0, 0, 0)) } extendPrototype([BaseEvent], AnimationItem), (AnimationItem.prototype.setParams = function (e) { ;(e.wrapper || e.container) && (this.wrapper = e.wrapper || e.container) var t = 'svg' e.animType ? (t = e.animType) : e.renderer && (t = e.renderer) var r = getRenderer(t) ;(this.renderer = new r(this, e.rendererSettings)), this.imagePreloader.setCacheType(t, this.renderer.globalData.defs), this.renderer.setProjectInterface(this.projectInterface), (this.animType = t), e.loop === '' || e.loop === null || e.loop === void 0 || e.loop === !0 ? (this.loop = !0) : e.loop === !1 ? (this.loop = !1) : (this.loop = parseInt(e.loop, 10)), (this.autoplay = 'autoplay' in e ? e.autoplay : !0), (this.name = e.name ? e.name : ''), (this.autoloadSegments = Object.prototype.hasOwnProperty.call( e, 'autoloadSegments' ) ? e.autoloadSegments : !0), (this.assetsPath = e.assetsPath), (this.initialSegment = e.initialSegment), e.audioFactory && this.audioController.setAudioFactory(e.audioFactory), e.animationData ? this.setupAnimation(e.animationData) : e.path && (e.path.lastIndexOf('\\') !== -1 ? (this.path = e.path.substr(0, e.path.lastIndexOf('\\') + 1)) : (this.path = e.path.substr(0, e.path.lastIndexOf('/') + 1)), (this.fileName = e.path.substr(e.path.lastIndexOf('/') + 1)), (this.fileName = this.fileName.substr( 0, this.fileName.lastIndexOf('.json') )), dataManager.loadAnimation( e.path, this.configAnimation, this.onSetupError )) }), (AnimationItem.prototype.onSetupError = function () { this.trigger('data_failed') }), (AnimationItem.prototype.setupAnimation = function (e) { dataManager.completeAnimation(e, this.configAnimation) }), (AnimationItem.prototype.setData = function (e, t) { t && _typeof$4(t) !== 'object' && (t = JSON.parse(t)) var r = { wrapper: e, animationData: t }, o = e.attributes ;(r.path = o.getNamedItem('data-animation-path') ? o.getNamedItem('data-animation-path').value : o.getNamedItem('data-bm-path') ? o.getNamedItem('data-bm-path').value : o.getNamedItem('bm-path') ? o.getNamedItem('bm-path').value : ''), (r.animType = o.getNamedItem('data-anim-type') ? o.getNamedItem('data-anim-type').value : o.getNamedItem('data-bm-type') ? o.getNamedItem('data-bm-type').value : o.getNamedItem('bm-type') ? o.getNamedItem('bm-type').value : o.getNamedItem('data-bm-renderer') ? o.getNamedItem('data-bm-renderer').value : o.getNamedItem('bm-renderer') ? o.getNamedItem('bm-renderer').value : 'canvas') var n = o.getNamedItem('data-anim-loop') ? o.getNamedItem('data-anim-loop').value : o.getNamedItem('data-bm-loop') ? o.getNamedItem('data-bm-loop').value : o.getNamedItem('bm-loop') ? o.getNamedItem('bm-loop').value : '' n === 'false' ? (r.loop = !1) : n === 'true' ? (r.loop = !0) : n !== '' && (r.loop = parseInt(n, 10)) var a = o.getNamedItem('data-anim-autoplay') ? o.getNamedItem('data-anim-autoplay').value : o.getNamedItem('data-bm-autoplay') ? o.getNamedItem('data-bm-autoplay').value : o.getNamedItem('bm-autoplay') ? o.getNamedItem('bm-autoplay').value : !0 ;(r.autoplay = a !== 'false'), (r.name = o.getNamedItem('data-name') ? o.getNamedItem('data-name').value : o.getNamedItem('data-bm-name') ? o.getNamedItem('data-bm-name').value : o.getNamedItem('bm-name') ? o.getNamedItem('bm-name').value : '') var l = o.getNamedItem('data-anim-prerender') ? o.getNamedItem('data-anim-prerender').value : o.getNamedItem('data-bm-prerender') ? o.getNamedItem('data-bm-prerender').value : o.getNamedItem('bm-prerender') ? o.getNamedItem('bm-prerender').value : '' l === 'false' && (r.prerender = !1), this.setParams(r) }), (AnimationItem.prototype.includeLayers = function (e) { e.op > this.animationData.op && ((this.animationData.op = e.op), (this.totalFrames = Math.floor(e.op - this.animationData.ip))) var t = this.animationData.layers, r, o = t.length, n = e.layers, a, l = n.length for (a = 0; a < l; a += 1) for (r = 0; r < o; ) { if (t[r].id === n[a].id) { t[r] = n[a] break } r += 1 } if ( ((e.chars || e.fonts) && (this.renderer.globalData.fontManager.addChars(e.chars), this.renderer.globalData.fontManager.addFonts( e.fonts, this.renderer.globalData.defs )), e.assets) ) for (o = e.assets.length, r = 0; r < o; r += 1) this.animationData.assets.push(e.assets[r]) ;(this.animationData.__complete = !1), dataManager.completeAnimation( this.animationData, this.onSegmentComplete ) }), (AnimationItem.prototype.onSegmentComplete = function (e) { this.animationData = e var t = getExpressionsPlugin() t && t.initExpressions(this), this.loadNextSegment() }), (AnimationItem.prototype.loadNextSegment = function () { var e = this.animationData.segments if (!e || e.length === 0 || !this.autoloadSegments) { this.trigger('data_ready'), (this.timeCompleted = this.totalFrames) return } var t = e.shift() this.timeCompleted = t.time * this.frameRate var r = this.path + this.fileName + '_' + this.segmentPos + '.json' ;(this.segmentPos += 1), dataManager.loadData( r, this.includeLayers.bind(this), function () { this.trigger('data_failed') }.bind(this) ) }), (AnimationItem.prototype.loadSegments = function () { var e = this.animationData.segments e || (this.timeCompleted = this.totalFrames), this.loadNextSegment() }), (AnimationItem.prototype.imagesLoaded = function () { this.trigger('loaded_images'), this.checkLoaded() }), (AnimationItem.prototype.preloadImages = function () { this.imagePreloader.setAssetsPath(this.assetsPath), this.imagePreloader.setPath(this.path), this.imagePreloader.loadAssets( this.animationData.assets, this.imagesLoaded.bind(this) ) }), (AnimationItem.prototype.configAnimation = function (e) { if (!!this.renderer) try { ;(this.animationData = e), this.initialSegment ? ((this.totalFrames = Math.floor( this.initialSegment[1] - this.initialSegment[0] )), (this.firstFrame = Math.round(this.initialSegment[0]))) : ((this.totalFrames = Math.floor( this.animationData.op - this.animationData.ip )), (this.firstFrame = Math.round(this.animationData.ip))), this.renderer.configAnimation(e), e.assets || (e.assets = []), (this.assets = this.animationData.assets), (this.frameRate = this.animationData.fr), (this.frameMult = this.animationData.fr / 1e3), this.renderer.searchExtraCompositions(e.assets), (this.markers = markerParser(e.markers || [])), this.trigger('config_ready'), this.preloadImages(), this.loadSegments(), this.updaFrameModifier(), this.waitForFontsLoaded(), this.isPaused && this.audioController.pause() } catch (t) { this.triggerConfigError(t) } }), (AnimationItem.prototype.waitForFontsLoaded = function () { !this.renderer || (this.renderer.globalData.fontManager.isLoaded ? this.checkLoaded() : setTimeout(this.waitForFontsLoaded.bind(this), 20)) }), (AnimationItem.prototype.checkLoaded = function () { if ( !this.isLoaded && this.renderer.globalData.fontManager.isLoaded && (this.imagePreloader.loadedImages() || this.renderer.rendererType !== 'canvas') && this.imagePreloader.loadedFootages() ) { this.isLoaded = !0 var e = getExpressionsPlugin() e && e.initExpressions(this), this.renderer.initItems(), setTimeout( function () { this.trigger('DOMLoaded') }.bind(this), 0 ), this.gotoFrame(), this.autoplay && this.play() } }), (AnimationItem.prototype.resize = function () { this.renderer.updateContainerSize() }), (AnimationItem.prototype.setSubframe = function (e) { this.isSubframeEnabled = !!e }), (AnimationItem.prototype.gotoFrame = function () { ;(this.currentFrame = this.isSubframeEnabled ? this.currentRawFrame : ~~this.currentRawFrame), this.timeCompleted !== this.totalFrames && this.currentFrame > this.timeCompleted && (this.currentFrame = this.timeCompleted), this.trigger('enterFrame'), this.renderFrame(), this.trigger('drawnFrame') }), (AnimationItem.prototype.renderFrame = function () { if (!(this.isLoaded === !1 || !this.renderer)) try { this.renderer.renderFrame(this.currentFrame + this.firstFrame) } catch (e) { this.triggerRenderFrameError(e) } }), (AnimationItem.prototype.play = function (e) { ;(e && this.name !== e) || (this.isPaused === !0 && ((this.isPaused = !1), this.trigger('_pause'), this.audioController.resume(), this._idle && ((this._idle = !1), this.trigger('_active')))) }), (AnimationItem.prototype.pause = function (e) { ;(e && this.name !== e) || (this.isPaused === !1 && ((this.isPaused = !0), this.trigger('_play'), (this._idle = !0), this.trigger('_idle'), this.audioController.pause())) }), (AnimationItem.prototype.togglePause = function (e) { ;(e && this.name !== e) || (this.isPaused === !0 ? this.play() : this.pause()) }), (AnimationItem.prototype.stop = function (e) { ;(e && this.name !== e) || (this.pause(), (this.playCount = 0), (this._completedLoop = !1), this.setCurrentRawFrameValue(0)) }), (AnimationItem.prototype.getMarkerData = function (e) { for (var t, r = 0; r < this.markers.length; r += 1) if (((t = this.markers[r]), t.payload && t.payload.name === e)) return t return null }), (AnimationItem.prototype.goToAndStop = function (e, t, r) { if (!(r && this.name !== r)) { var o = Number(e) if (isNaN(o)) { var n = this.getMarkerData(e) n && this.goToAndStop(n.time, !0) } else t ? this.setCurrentRawFrameValue(e) : this.setCurrentRawFrameValue(e * this.frameModifier) this.pause() } }), (AnimationItem.prototype.goToAndPlay = function (e, t, r) { if (!(r && this.name !== r)) { var o = Number(e) if (isNaN(o)) { var n = this.getMarkerData(e) n && (n.duration ? this.playSegments([n.time, n.time + n.duration], !0) : this.goToAndStop(n.time, !0)) } else this.goToAndStop(o, t, r) this.play() } }), (AnimationItem.prototype.advanceTime = function (e) { if (!(this.isPaused === !0 || this.isLoaded === !1)) { var t = this.currentRawFrame + e * this.frameModifier, r = !1 t >= this.totalFrames - 1 && this.frameModifier > 0 ? !this.loop || this.playCount === this.loop ? this.checkSegments( t > this.totalFrames ? t % this.totalFrames : 0 ) || ((r = !0), (t = this.totalFrames - 1)) : t >= this.totalFrames ? ((this.playCount += 1), this.checkSegments(t % this.totalFrames) || (this.setCurrentRawFrameValue(t % this.totalFrames), (this._completedLoop = !0), this.trigger('loopComplete'))) : this.setCurrentRawFrameValue(t) : t < 0 ? this.checkSegments(t % this.totalFrames) || (this.loop && !(this.playCount-- <= 0 && this.loop !== !0) ? (this.setCurrentRawFrameValue( this.totalFrames + (t % this.totalFrames) ), this._completedLoop ? this.trigger('loopComplete') : (this._completedLoop = !0)) : ((r = !0), (t = 0))) : this.setCurrentRawFrameValue(t), r && (this.setCurrentRawFrameValue(t), this.pause(), this.trigger('complete')) } }), (AnimationItem.prototype.adjustSegment = function (e, t) { ;(this.playCount = 0), e[1] < e[0] ? (this.frameModifier > 0 && (this.playSpeed < 0 ? this.setSpeed(-this.playSpeed) : this.setDirection(-1)), (this.totalFrames = e[0] - e[1]), (this.timeCompleted = this.totalFrames), (this.firstFrame = e[1]), this.setCurrentRawFrameValue(this.totalFrames - 0.001 - t)) : e[1] > e[0] && (this.frameModifier < 0 && (this.playSpeed < 0 ? this.setSpeed(-this.playSpeed) : this.setDirection(1)), (this.totalFrames = e[1] - e[0]), (this.timeCompleted = this.totalFrames), (this.firstFrame = e[0]), this.setCurrentRawFrameValue(0.001 + t)), this.trigger('segmentStart') }), (AnimationItem.prototype.setSegment = function (e, t) { var r = -1 this.isPaused && (this.currentRawFrame + this.firstFrame < e ? (r = e) : this.currentRawFrame + this.firstFrame > t && (r = t - e)), (this.firstFrame = e), (this.totalFrames = t - e), (this.timeCompleted = this.totalFrames), r !== -1 && this.goToAndStop(r, !0) }), (AnimationItem.prototype.playSegments = function (e, t) { if ((t && (this.segments.length = 0), _typeof$4(e[0]) === 'object')) { var r, o = e.length for (r = 0; r < o; r += 1) this.segments.push(e[r]) } else this.segments.push(e) this.segments.length && t && this.adjustSegment(this.segments.shift(), 0), this.isPaused && this.play() }), (AnimationItem.prototype.resetSegments = function (e) { ;(this.segments.length = 0), this.segments.push([this.animationData.ip, this.animationData.op]), e && this.checkSegments(0) }), (AnimationItem.prototype.checkSegments = function (e) { return this.segments.length ? (this.adjustSegment(this.segments.shift(), e), !0) : !1 }), (AnimationItem.prototype.destroy = function (e) { ;(e && this.name !== e) || !this.renderer || (this.renderer.destroy(), this.imagePreloader.destroy(), this.trigger('destroy'), (this._cbs = null), (this.onEnterFrame = null), (this.onLoopComplete = null), (this.onComplete = null), (this.onSegmentStart = null), (this.onDestroy = null), (this.renderer = null), (this.renderer = null), (this.imagePreloader = null), (this.projectInterface = null)) }), (AnimationItem.prototype.setCurrentRawFrameValue = function (e) { ;(this.currentRawFrame = e), this.gotoFrame() }), (AnimationItem.prototype.setSpeed = function (e) { ;(this.playSpeed = e), this.updaFrameModifier() }), (AnimationItem.prototype.setDirection = function (e) { ;(this.playDirection = e < 0 ? -1 : 1), this.updaFrameModifier() }), (AnimationItem.prototype.setVolume = function (e, t) { ;(t && this.name !== t) || this.audioController.setVolume(e) }), (AnimationItem.prototype.getVolume = function () { return this.audioController.getVolume() }), (AnimationItem.prototype.mute = function (e) { ;(e && this.name !== e) || this.audioController.mute() }), (AnimationItem.prototype.unmute = function (e) { ;(e && this.name !== e) || this.audioController.unmute() }), (AnimationItem.prototype.updaFrameModifier = function () { ;(this.frameModifier = this.frameMult * this.playSpeed * this.playDirection), this.audioController.setRate(this.playSpeed * this.playDirection) }), (AnimationItem.prototype.getPath = function () { return this.path }), (AnimationItem.prototype.getAssetsPath = function (e) { var t = '' if (e.e) t = e.p else if (this.assetsPath) { var r = e.p r.indexOf('images/') !== -1 && (r = r.split('/')[1]), (t = this.assetsPath + r) } else (t = this.path), (t += e.u ? e.u : ''), (t += e.p) return t }), (AnimationItem.prototype.getAssetData = function (e) { for (var t = 0, r = this.assets.length; t < r; ) { if (e === this.assets[t].id) return this.assets[t] t += 1 } return null }), (AnimationItem.prototype.hide = function () { this.renderer.hide() }), (AnimationItem.prototype.show = function () { this.renderer.show() }), (AnimationItem.prototype.getDuration = function (e) { return e ? this.totalFrames : this.totalFrames / this.frameRate }), (AnimationItem.prototype.updateDocumentData = function (e, t, r) { try { var o = this.renderer.getElementByPath(e) o.updateDocumentData(t, r) } catch {} }), (AnimationItem.prototype.trigger = function (e) { if (this._cbs && this._cbs[e]) switch (e) { case 'enterFrame': this.triggerEvent( e, new BMEnterFrameEvent( e, this.currentFrame, this.totalFrames, this.frameModifier ) ) break case 'drawnFrame': ;(this.drawnFrameEvent.currentTime = this.currentFrame), (this.drawnFrameEvent.totalTime = this.totalFrames), (this.drawnFrameEvent.direction = this.frameModifier), this.triggerEvent(e, this.drawnFrameEvent) break case 'loopComplete': this.triggerEvent( e, new BMCompleteLoopEvent( e, this.loop, this.playCount, this.frameMult ) ) break case 'complete': this.triggerEvent(e, new BMCompleteEvent(e, this.frameMult)) break case 'segmentStart': this.triggerEvent( e, new BMSegmentStartEvent(e, this.firstFrame, this.totalFrames) ) break case 'destroy': this.triggerEvent(e, new BMDestroyEvent(e, this)) break default: this.triggerEvent(e) } e === 'enterFrame' && this.onEnterFrame && this.onEnterFrame.call( this, new BMEnterFrameEvent( e, this.currentFrame, this.totalFrames, this.frameMult ) ), e === 'loopComplete' && this.onLoopComplete && this.onLoopComplete.call( this, new BMCompleteLoopEvent( e, this.loop, this.playCount, this.frameMult ) ), e === 'complete' && this.onComplete && this.onComplete.call( this, new BMCompleteEvent(e, this.frameMult) ), e === 'segmentStart' && this.onSegmentStart && this.onSegmentStart.call( this, new BMSegmentStartEvent(e, this.firstFrame, this.totalFrames) ), e === 'destroy' && this.onDestroy && this.onDestroy.call(this, new BMDestroyEvent(e, this)) }), (AnimationItem.prototype.triggerRenderFrameError = function (e) { var t = new BMRenderFrameErrorEvent(e, this.currentFrame) this.triggerEvent('error', t), this.onError && this.onError.call(this, t) }), (AnimationItem.prototype.triggerConfigError = function (e) { var t = new BMConfigErrorEvent(e, this.currentFrame) this.triggerEvent('error', t), this.onError && this.onError.call(this, t) }) var animationManager = (function () { var e = {}, t = [], r = 0, o = 0, n = 0, a = !0, l = !1 function s(V) { for (var z = 0, M = V.target; z < o; ) t[z].animation === M && (t.splice(z, 1), (z -= 1), (o -= 1), M.isPaused || m()), (z += 1) } function c(V, z) { if (!V) return null for (var M = 0; M < o; ) { if (t[M].elem === V && t[M].elem !== null) return t[M].animation M += 1 } var L = new AnimationItem() return f(L, V), L.setData(V, z), L } function d() { var V, z = t.length, M = [] for (V = 0; V < z; V += 1) M.push(t[V].animation) return M } function u() { ;(n += 1), Y() } function m() { n -= 1 } function f(V, z) { V.addEventListener('destroy', s), V.addEventListener('_active', u), V.addEventListener('_idle', m), t.push({ elem: z, animation: V }), (o += 1) } function _(V) { var z = new AnimationItem() return f(z, null), z.setParams(V), z } function b(V, z) { var M for (M = 0; M < o; M += 1) t[M].animation.setSpeed(V, z) } function v(V, z) { var M for (M = 0; M < o; M += 1) t[M].animation.setDirection(V, z) } function k(V) { var z for (z = 0; z < o; z += 1) t[z].animation.play(V) } function g(V) { var z = V - r, M for (M = 0; M < o; M += 1) t[M].animation.advanceTime(z) ;(r = V), n && !l ? window.requestAnimationFrame(g) : (a = !0) } function x(V) { ;(r = V), window.requestAnimationFrame(g) } function y(V) { var z for (z = 0; z < o; z += 1) t[z].animation.pause(V) } function w(V, z, M) { var L for (L = 0; L < o; L += 1) t[L].animation.goToAndStop(V, z, M) } function S(V) { var z for (z = 0; z < o; z += 1) t[z].animation.stop(V) } function T(V) { var z for (z = 0; z < o; z += 1) t[z].animation.togglePause(V) } function A(V) { var z for (z = o - 1; z >= 0; z -= 1) t[z].animation.destroy(V) } function $(V, z, M) { var L = [].concat( [].slice.call(document.getElementsByClassName('lottie')), [].slice.call(document.getElementsByClassName('bodymovin')) ), pe, ue = L.length for (pe = 0; pe < ue; pe += 1) M && L[pe].setAttribute('data-bm-type', M), c(L[pe], V) if (z && ue === 0) { M || (M = 'svg') var Ie = document.getElementsByTagName('body')[0] Ie.innerText = '' var Pt = createTag('div') ;(Pt.style.width = '100%'), (Pt.style.height = '100%'), Pt.setAttribute('data-bm-type', M), Ie.appendChild(Pt), c(Pt, V) } } function F() { var V for (V = 0; V < o; V += 1) t[V].animation.resize() } function Y() { !l && n && a && (window.requestAnimationFrame(x), (a = !1)) } function ae() { l = !0 } function re() { ;(l = !1), Y() } function ie(V, z) { var M for (M = 0; M < o; M += 1) t[M].animation.setVolume(V, z) } function oe(V) { var z for (z = 0; z < o; z += 1) t[z].animation.mute(V) } function j(V) { var z for (z = 0; z < o; z += 1) t[z].animation.unmute(V) } return ( (e.registerAnimation = c), (e.loadAnimation = _), (e.setSpeed = b), (e.setDirection = v), (e.play = k), (e.pause = y), (e.stop = S), (e.togglePause = T), (e.searchAnimations = $), (e.resize = F), (e.goToAndStop = w), (e.destroy = A), (e.freeze = ae), (e.unfreeze = re), (e.setVolume = ie), (e.mute = oe), (e.unmute = j), (e.getRegisteredAnimations = d), e ) })(), BezierFactory = (function () { var e = {} e.getBezierEasing = r var t = {} function r(x, y, w, S, T) { var A = T || ('bez_' + x + '_' + y + '_' + w + '_' + S).replace(/\./g, 'p') if (t[A]) return t[A] var $ = new g([x, y, w, S]) return (t[A] = $), $ } var o = 4, n = 0.001, a = 1e-7, l = 10, s = 11, c = 1 / (s - 1), d = typeof Float32Array == 'function' function u(x, y) { return 1 - 3 * y + 3 * x } function m(x, y) { return 3 * y - 6 * x } function f(x) { return 3 * x } function _(x, y, w) { return ((u(y, w) * x + m(y, w)) * x + f(y)) * x } function b(x, y, w) { return 3 * u(y, w) * x * x + 2 * m(y, w) * x + f(y) } function v(x, y, w, S, T) { var A, $, F = 0 do ($ = y + (w - y) / 2), (A = _($, S, T) - x), A > 0 ? (w = $) : (y = $) while (Math.abs(A) > a && ++F < l) return $ } function k(x, y, w, S) { for (var T = 0; T < o; ++T) { var A = b(y, w, S) if (A === 0) return y var $ = _(y, w, S) - x y -= $ / A } return y } function g(x) { ;(this._p = x), (this._mSampleValues = d ? new Float32Array(s) : new Array(s)), (this._precomputed = !1), (this.get = this.get.bind(this)) } return ( (g.prototype = { get: function (y) { var w = this._p[0], S = this._p[1], T = this._p[2], A = this._p[3] return ( this._precomputed || this._precompute(), w === S && T === A ? y : y === 0 ? 0 : y === 1 ? 1 : _(this._getTForX(y), S, A) ) }, _precompute: function () { var y = this._p[0], w = this._p[1], S = this._p[2], T = this._p[3] ;(this._precomputed = !0), (y !== w || S !== T) && this._calcSampleValues() }, _calcSampleValues: function () { for (var y = this._p[0], w = this._p[2], S = 0; S < s; ++S) this._mSampleValues[S] = _(S * c, y, w) }, _getTForX: function (y) { for ( var w = this._p[0], S = this._p[2], T = this._mSampleValues, A = 0, $ = 1, F = s - 1; $ !== F && T[$] <= y; ++$ ) A += c --$ var Y = (y - T[$]) / (T[$ + 1] - T[$]), ae = A + Y * c, re = b(ae, w, S) return re >= n ? k(y, ae, w, S) : re === 0 ? ae : v(y, A, A + c, w, S) } }), e ) })(), pooling = (function () { function e(t) { return t.concat(createSizedArray(t.length)) } return { double: e } })(), poolFactory = (function () { return function (e, t, r) { var o = 0, n = e, a = createSizedArray(n), l = { newElement: s, release: c } function s() { var d return o ? ((o -= 1), (d = a[o])) : (d = t()), d } function c(d) { o === n && ((a = pooling.double(a)), (n *= 2)), r && r(d), (a[o] = d), (o += 1) } return l } })(), bezierLengthPool = (function () { function e() { return { addedLength: 0, percents: createTypedArray('float32', getDefaultCurveSegments()), lengths: createTypedArray('float32', getDefaultCurveSegments()) } } return poolFactory(8, e) })(), segmentsLengthPool = (function () { function e() { return { lengths: [], totalLength: 0 } } function t(r) { var o, n = r.lengths.length for (o = 0; o < n; o += 1) bezierLengthPool.release(r.lengths[o]) r.lengths.length = 0 } return poolFactory(8, e, t) })() function bezFunction() { var e = Math function t(f, _, b, v, k, g) { var x = f * v + _ * k + b * g - k * v - g * f - b * _ return x > -0.001 && x < 0.001 } function r(f, _, b, v, k, g, x, y, w) { if (b === 0 && g === 0 && w === 0) return t(f, _, v, k, x, y) var S = e.sqrt(e.pow(v - f, 2) + e.pow(k - _, 2) + e.pow(g - b, 2)), T = e.sqrt(e.pow(x - f, 2) + e.pow(y - _, 2) + e.pow(w - b, 2)), A = e.sqrt(e.pow(x - v, 2) + e.pow(y - k, 2) + e.pow(w - g, 2)), $ return ( S > T ? S > A ? ($ = S - T - A) : ($ = A - T - S) : A > T ? ($ = A - T - S) : ($ = T - S - A), $ > -1e-4 && $ < 1e-4 ) } var o = (function () { return function (f, _, b, v) { var k = getDefaultCurveSegments(), g, x, y, w, S, T = 0, A, $ = [], F = [], Y = bezierLengthPool.newElement() for (y = b.length, g = 0; g < k; g += 1) { for (S = g / (k - 1), A = 0, x = 0; x < y; x += 1) (w = bmPow(1 - S, 3) * f[x] + 3 * bmPow(1 - S, 2) * S * b[x] + 3 * (1 - S) * bmPow(S, 2) * v[x] + bmPow(S, 3) * _[x]), ($[x] = w), F[x] !== null && (A += bmPow($[x] - F[x], 2)), (F[x] = $[x]) A && ((A = bmSqrt(A)), (T += A)), (Y.percents[g] = S), (Y.lengths[g] = T) } return (Y.addedLength = T), Y } })() function n(f) { var _ = segmentsLengthPool.newElement(), b = f.c, v = f.v, k = f.o, g = f.i, x, y = f._length, w = _.lengths, S = 0 for (x = 0; x < y - 1; x += 1) (w[x] = o(v[x], v[x + 1], k[x], g[x + 1])), (S += w[x].addedLength) return ( b && y && ((w[x] = o(v[x], v[0], k[x], g[0])), (S += w[x].addedLength)), (_.totalLength = S), _ ) } function a(f) { ;(this.segmentLength = 0), (this.points = new Array(f)) } function l(f, _) { ;(this.partialLength = f), (this.point = _) } var s = (function () { var f = {} return function (_, b, v, k) { var g = ( _[0] + '_' + _[1] + '_' + b[0] + '_' + b[1] + '_' + v[0] + '_' + v[1] + '_' + k[0] + '_' + k[1] ).replace(/\./g, 'p') if (!f[g]) { var x = getDefaultCurveSegments(), y, w, S, T, A, $ = 0, F, Y, ae = null _.length === 2 && (_[0] !== b[0] || _[1] !== b[1]) && t(_[0], _[1], b[0], b[1], _[0] + v[0], _[1] + v[1]) && t(_[0], _[1], b[0], b[1], b[0] + k[0], b[1] + k[1]) && (x = 2) var re = new a(x) for (S = v.length, y = 0; y < x; y += 1) { for ( Y = createSizedArray(S), A = y / (x - 1), F = 0, w = 0; w < S; w += 1 ) (T = bmPow(1 - A, 3) * _[w] + 3 * bmPow(1 - A, 2) * A * (_[w] + v[w]) + 3 * (1 - A) * bmPow(A, 2) * (b[w] + k[w]) + bmPow(A, 3) * b[w]), (Y[w] = T), ae !== null && (F += bmPow(Y[w] - ae[w], 2)) ;(F = bmSqrt(F)), ($ += F), (re.points[y] = new l(F, Y)), (ae = Y) } ;(re.segmentLength = $), (f[g] = re) } return f[g] } })() function c(f, _) { var b = _.percents, v = _.lengths, k = b.length, g = bmFloor((k - 1) * f), x = f * _.addedLength, y = 0 if (g === k - 1 || g === 0 || x === v[g]) return b[g] for (var w = v[g] > x ? -1 : 1, S = !0; S; ) if ( (v[g] <= x && v[g + 1] > x ? ((y = (x - v[g]) / (v[g + 1] - v[g])), (S = !1)) : (g += w), g < 0 || g >= k - 1) ) { if (g === k - 1) return b[g] S = !1 } return b[g] + (b[g + 1] - b[g]) * y } function d(f, _, b, v, k, g) { var x = c(k, g), y = 1 - x, w = e.round( (y * y * y * f[0] + (x * y * y + y * x * y + y * y * x) * b[0] + (x * x * y + y * x * x + x * y * x) * v[0] + x * x * x * _[0]) * 1e3 ) / 1e3, S = e.round( (y * y * y * f[1] + (x * y * y + y * x * y + y * y * x) * b[1] + (x * x * y + y * x * x + x * y * x) * v[1] + x * x * x * _[1]) * 1e3 ) / 1e3 return [w, S] } var u = createTypedArray('float32', 8) function m(f, _, b, v, k, g, x) { k < 0 ? (k = 0) : k > 1 && (k = 1) var y = c(k, x) g = g > 1 ? 1 : g var w = c(g, x), S, T = f.length, A = 1 - y, $ = 1 - w, F = A * A * A, Y = y * A * A * 3, ae = y * y * A * 3, re = y * y * y, ie = A * A * $, oe = y * A * $ + A * y * $ + A * A * w, j = y * y * $ + A * y * w + y * A * w, V = y * y * w, z = A * $ * $, M = y * $ * $ + A * w * $ + A * $ * w, L = y * w * $ + A * w * w + y * $ * w, pe = y * w * w, ue = $ * $ * $, Ie = w * $ * $ + $ * w * $ + $ * $ * w, Pt = w * w * $ + $ * w * w + w * $ * w, rr = w * w * w for (S = 0; S < T; S += 1) (u[S * 4] = e.round((F * f[S] + Y * b[S] + ae * v[S] + re * _[S]) * 1e3) / 1e3), (u[S * 4 + 1] = e.round((ie * f[S] + oe * b[S] + j * v[S] + V * _[S]) * 1e3) / 1e3), (u[S * 4 + 2] = e.round((z * f[S] + M * b[S] + L * v[S] + pe * _[S]) * 1e3) / 1e3), (u[S * 4 + 3] = e.round((ue * f[S] + Ie * b[S] + Pt * v[S] + rr * _[S]) * 1e3) / 1e3) return u } return { getSegmentsLength: n, getNewSegment: m, getPointInSegment: d, buildBezierData: s, pointOnLine2D: t, pointOnLine3D: r } } var bez = bezFunction(), PropertyFactory = (function () { var e = initialDefaultFrame, t = Math.abs function r(k, g) { var x = this.offsetTime, y this.propType === 'multidimensional' && (y = createTypedArray('float32', this.pv.length)) for ( var w = g.lastIndex, S = w, T = this.keyframes.length - 1, A = !0, $, F, Y; A; ) { if ( (($ = this.keyframes[S]), (F = this.keyframes[S + 1]), S === T - 1 && k >= F.t - x) ) { $.h && ($ = F), (w = 0) break } if (F.t - x > k) { w = S break } S < T - 1 ? (S += 1) : ((w = 0), (A = !1)) } Y = this.keyframesMetadata[S] || {} var ae, re, ie, oe, j, V, z = F.t - x, M = $.t - x, L if ($.to) { Y.bezierData || (Y.bezierData = bez.buildBezierData( $.s, F.s || $.e, $.to, $.ti )) var pe = Y.bezierData if (k >= z || k < M) { var ue = k >= z ? pe.points.length - 1 : 0 for (re = pe.points[ue].point.length, ae = 0; ae < re; ae += 1) y[ae] = pe.points[ue].point[ae] } else { Y.__fnct ? (V = Y.__fnct) : ((V = BezierFactory.getBezierEasing( $.o.x, $.o.y, $.i.x, $.i.y, $.n ).get), (Y.__fnct = V)), (ie = V((k - M) / (z - M))) var Ie = pe.segmentLength * ie, Pt, rr = g.lastFrame < k && g._lastKeyframeIndex === S ? g._lastAddedLength : 0 for ( j = g.lastFrame < k && g._lastKeyframeIndex === S ? g._lastPoint : 0, A = !0, oe = pe.points.length; A; ) { if ( ((rr += pe.points[j].partialLength), Ie === 0 || ie === 0 || j === pe.points.length - 1) ) { for ( re = pe.points[j].point.length, ae = 0; ae < re; ae += 1 ) y[ae] = pe.points[j].point[ae] break } else if ( Ie >= rr && Ie < rr + pe.points[j + 1].partialLength ) { for ( Pt = (Ie - rr) / pe.points[j + 1].partialLength, re = pe.points[j].point.length, ae = 0; ae < re; ae += 1 ) y[ae] = pe.points[j].point[ae] + (pe.points[j + 1].point[ae] - pe.points[j].point[ae]) * Pt break } j < oe - 1 ? (j += 1) : (A = !1) } ;(g._lastPoint = j), (g._lastAddedLength = rr - pe.points[j].partialLength), (g._lastKeyframeIndex = S) } } else { var _e, Oe, xe, $e, jt if (((T = $.s.length), (L = F.s || $.e), this.sh && $.h !== 1)) if (k >= z) (y[0] = L[0]), (y[1] = L[1]), (y[2] = L[2]) else if (k <= M) (y[0] = $.s[0]), (y[1] = $.s[1]), (y[2] = $.s[2]) else { var or = a($.s), er = a(L), tr = (k - M) / (z - M) n(y, o(or, er, tr)) } else for (S = 0; S < T; S += 1) $.h !== 1 && (k >= z ? (ie = 1) : k < M ? (ie = 0) : ($.o.x.constructor === Array ? (Y.__fnct || (Y.__fnct = []), Y.__fnct[S] ? (V = Y.__fnct[S]) : ((_e = $.o.x[S] === void 0 ? $.o.x[0] : $.o.x[S]), (Oe = $.o.y[S] === void 0 ? $.o.y[0] : $.o.y[S]), (xe = $.i.x[S] === void 0 ? $.i.x[0] : $.i.x[S]), ($e = $.i.y[S] === void 0 ? $.i.y[0] : $.i.y[S]), (V = BezierFactory.getBezierEasing( _e, Oe, xe, $e ).get), (Y.__fnct[S] = V))) : Y.__fnct ? (V = Y.__fnct) : ((_e = $.o.x), (Oe = $.o.y), (xe = $.i.x), ($e = $.i.y), (V = BezierFactory.getBezierEasing( _e, Oe, xe, $e ).get), ($.keyframeMetadata = V)), (ie = V((k - M) / (z - M))))), (L = F.s || $.e), (jt = $.h === 1 ? $.s[S] : $.s[S] + (L[S] - $.s[S]) * ie), this.propType === 'multidimensional' ? (y[S] = jt) : (y = jt) } return (g.lastIndex = w), y } function o(k, g, x) { var y = [], w = k[0], S = k[1], T = k[2], A = k[3], $ = g[0], F = g[1], Y = g[2], ae = g[3], re, ie, oe, j, V return ( (ie = w * $ + S * F + T * Y + A * ae), ie < 0 && ((ie = -ie), ($ = -$), (F = -F), (Y = -Y), (ae = -ae)), 1 - ie > 1e-6 ? ((re = Math.acos(ie)), (oe = Math.sin(re)), (j = Math.sin((1 - x) * re) / oe), (V = Math.sin(x * re) / oe)) : ((j = 1 - x), (V = x)), (y[0] = j * w + V * $), (y[1] = j * S + V * F), (y[2] = j * T + V * Y), (y[3] = j * A + V * ae), y ) } function n(k, g) { var x = g[0], y = g[1], w = g[2], S = g[3], T = Math.atan2(2 * y * S - 2 * x * w, 1 - 2 * y * y - 2 * w * w), A = Math.asin(2 * x * y + 2 * w * S), $ = Math.atan2(2 * x * S - 2 * y * w, 1 - 2 * x * x - 2 * w * w) ;(k[0] = T / degToRads), (k[1] = A / degToRads), (k[2] = $ / degToRads) } function a(k) { var g = k[0] * degToRads, x = k[1] * degToRads, y = k[2] * degToRads, w = Math.cos(g / 2), S = Math.cos(x / 2), T = Math.cos(y / 2), A = Math.sin(g / 2), $ = Math.sin(x / 2), F = Math.sin(y / 2), Y = w * S * T - A * $ * F, ae = A * $ * T + w * S * F, re = A * S * T + w * $ * F, ie = w * $ * T - A * S * F return [ae, re, ie, Y] } function l() { var k = this.comp.renderedFrame - this.offsetTime, g = this.keyframes[0].t - this.offsetTime, x = this.keyframes[this.keyframes.length - 1].t - this.offsetTime if ( !( k === this._caching.lastFrame || (this._caching.lastFrame !== e && ((this._caching.lastFrame >= x && k >= x) || (this._caching.lastFrame < g && k < g))) ) ) { this._caching.lastFrame >= k && ((this._caching._lastKeyframeIndex = -1), (this._caching.lastIndex = 0)) var y = this.interpolateValue(k, this._caching) this.pv = y } return (this._caching.lastFrame = k), this.pv } function s(k) { var g if (this.propType === 'unidimensional') (g = k * this.mult), t(this.v - g) > 1e-5 && ((this.v = g), (this._mdf = !0)) else for (var x = 0, y = this.v.length; x < y; ) (g = k[x] * this.mult), t(this.v[x] - g) > 1e-5 && ((this.v[x] = g), (this._mdf = !0)), (x += 1) } function c() { if ( !( this.elem.globalData.frameId === this.frameId || !this.effectsSequence.length ) ) { if (this.lock) { this.setVValue(this.pv) return } ;(this.lock = !0), (this._mdf = this._isFirstFrame) var k, g = this.effectsSequence.length, x = this.kf ? this.pv : this.data.k for (k = 0; k < g; k += 1) x = this.effectsSequence[k](x) this.setVValue(x), (this._isFirstFrame = !1), (this.lock = !1), (this.frameId = this.elem.globalData.frameId) } } function d(k) { this.effectsSequence.push(k), this.container.addDynamicProperty(this) } function u(k, g, x, y) { ;(this.propType = 'unidimensional'), (this.mult = x || 1), (this.data = g), (this.v = x ? g.k * x : g.k), (this.pv = g.k), (this._mdf = !1), (this.elem = k), (this.container = y), (this.comp = k.comp), (this.k = !1), (this.kf = !1), (this.vel = 0), (this.effectsSequence = []), (this._isFirstFrame = !0), (this.getValue = c), (this.setVValue = s), (this.addEffect = d) } function m(k, g, x, y) { ;(this.propType = 'multidimensional'), (this.mult = x || 1), (this.data = g), (this._mdf = !1), (this.elem = k), (this.container = y), (this.comp = k.comp), (this.k = !1), (this.kf = !1), (this.frameId = -1) var w, S = g.k.length for ( this.v = createTypedArray('float32', S), this.pv = createTypedArray('float32', S), this.vel = createTypedArray('float32', S), w = 0; w < S; w += 1 ) (this.v[w] = g.k[w] * this.mult), (this.pv[w] = g.k[w]) ;(this._isFirstFrame = !0), (this.effectsSequence = []), (this.getValue = c), (this.setVValue = s), (this.addEffect = d) } function f(k, g, x, y) { ;(this.propType = 'unidimensional'), (this.keyframes = g.k), (this.keyframesMetadata = []), (this.offsetTime = k.data.st), (this.frameId = -1), (this._caching = { lastFrame: e, lastIndex: 0, value: 0, _lastKeyframeIndex: -1 }), (this.k = !0), (this.kf = !0), (this.data = g), (this.mult = x || 1), (this.elem = k), (this.container = y), (this.comp = k.comp), (this.v = e), (this.pv = e), (this._isFirstFrame = !0), (this.getValue = c), (this.setVValue = s), (this.interpolateValue = r), (this.effectsSequence = [l.bind(this)]), (this.addEffect = d) } function _(k, g, x, y) { this.propType = 'multidimensional' var w, S = g.k.length, T, A, $, F for (w = 0; w < S - 1; w += 1) g.k[w].to && g.k[w].s && g.k[w + 1] && g.k[w + 1].s && ((T = g.k[w].s), (A = g.k[w + 1].s), ($ = g.k[w].to), (F = g.k[w].ti), ((T.length === 2 && !(T[0] === A[0] && T[1] === A[1]) && bez.pointOnLine2D( T[0], T[1], A[0], A[1], T[0] + $[0], T[1] + $[1] ) && bez.pointOnLine2D( T[0], T[1], A[0], A[1], A[0] + F[0], A[1] + F[1] )) || (T.length === 3 && !(T[0] === A[0] && T[1] === A[1] && T[2] === A[2]) && bez.pointOnLine3D( T[0], T[1], T[2], A[0], A[1], A[2], T[0] + $[0], T[1] + $[1], T[2] + $[2] ) && bez.pointOnLine3D( T[0], T[1], T[2], A[0], A[1], A[2], A[0] + F[0], A[1] + F[1], A[2] + F[2] ))) && ((g.k[w].to = null), (g.k[w].ti = null)), T[0] === A[0] && T[1] === A[1] && $[0] === 0 && $[1] === 0 && F[0] === 0 && F[1] === 0 && (T.length === 2 || (T[2] === A[2] && $[2] === 0 && F[2] === 0)) && ((g.k[w].to = null), (g.k[w].ti = null))) ;(this.effectsSequence = [l.bind(this)]), (this.data = g), (this.keyframes = g.k), (this.keyframesMetadata = []), (this.offsetTime = k.data.st), (this.k = !0), (this.kf = !0), (this._isFirstFrame = !0), (this.mult = x || 1), (this.elem = k), (this.container = y), (this.comp = k.comp), (this.getValue = c), (this.setVValue = s), (this.interpolateValue = r), (this.frameId = -1) var Y = g.k[0].s.length for ( this.v = createTypedArray('float32', Y), this.pv = createTypedArray('float32', Y), w = 0; w < Y; w += 1 ) (this.v[w] = e), (this.pv[w] = e) ;(this._caching = { lastFrame: e, lastIndex: 0, value: createTypedArray('float32', Y) }), (this.addEffect = d) } function b(k, g, x, y, w) { var S if (!g.k.length) S = new u(k, g, y, w) else if (typeof g.k[0] == 'number') S = new m(k, g, y, w) else switch (x) { case 0: S = new f(k, g, y, w) break case 1: S = new _(k, g, y, w) break } return S.effectsSequence.length && w.addDynamicProperty(S), S } var v = { getProp: b } return v })() function DynamicPropertyContainer() {} DynamicPropertyContainer.prototype = { addDynamicProperty: function (t) { this.dynamicProperties.indexOf(t) === -1 && (this.dynamicProperties.push(t), this.container.addDynamicProperty(this), (this._isAnimated = !0)) }, iterateDynamicProperties: function () { this._mdf = !1 var t, r = this.dynamicProperties.length for (t = 0; t < r; t += 1) this.dynamicProperties[t].getValue(), this.dynamicProperties[t]._mdf && (this._mdf = !0) }, initDynamicPropertyContainer: function (t) { ;(this.container = t), (this.dynamicProperties = []), (this._mdf = !1), (this._isAnimated = !1) } } var pointPool = (function () { function e() { return createTypedArray('float32', 2) } return poolFactory(8, e) })() function ShapePath() { ;(this.c = !1), (this._length = 0), (this._maxLength = 8), (this.v = createSizedArray(this._maxLength)), (this.o = createSizedArray(this._maxLength)), (this.i = createSizedArray(this._maxLength)) } ;(ShapePath.prototype.setPathData = function (e, t) { ;(this.c = e), this.setLength(t) for (var r = 0; r < t; ) (this.v[r] = pointPool.newElement()), (this.o[r] = pointPool.newElement()), (this.i[r] = pointPool.newElement()), (r += 1) }), (ShapePath.prototype.setLength = function (e) { for (; this._maxLength < e; ) this.doubleArrayLength() this._length = e }), (ShapePath.prototype.doubleArrayLength = function () { ;(this.v = this.v.concat(createSizedArray(this._maxLength))), (this.i = this.i.concat(createSizedArray(this._maxLength))), (this.o = this.o.concat(createSizedArray(this._maxLength))), (this._maxLength *= 2) }), (ShapePath.prototype.setXYAt = function (e, t, r, o, n) { var a switch ( ((this._length = Math.max(this._length, o + 1)), this._length >= this._maxLength && this.doubleArrayLength(), r) ) { case 'v': a = this.v break case 'i': a = this.i break case 'o': a = this.o break default: a = [] break } ;(!a[o] || (a[o] && !n)) && (a[o] = pointPool.newElement()), (a[o][0] = e), (a[o][1] = t) }), (ShapePath.prototype.setTripleAt = function (e, t, r, o, n, a, l, s) { this.setXYAt(e, t, 'v', l, s), this.setXYAt(r, o, 'o', l, s), this.setXYAt(n, a, 'i', l, s) }), (ShapePath.prototype.reverse = function () { var e = new ShapePath() e.setPathData(this.c, this._length) var t = this.v, r = this.o, o = this.i, n = 0 this.c && (e.setTripleAt( t[0][0], t[0][1], o[0][0], o[0][1], r[0][0], r[0][1], 0, !1 ), (n = 1)) var a = this._length - 1, l = this._length, s for (s = n; s < l; s += 1) e.setTripleAt( t[a][0], t[a][1], o[a][0], o[a][1], r[a][0], r[a][1], s, !1 ), (a -= 1) return e }) var shapePool = (function () { function e() { return new ShapePath() } function t(n) { var a = n._length, l for (l = 0; l < a; l += 1) pointPool.release(n.v[l]), pointPool.release(n.i[l]), pointPool.release(n.o[l]), (n.v[l] = null), (n.i[l] = null), (n.o[l] = null) ;(n._length = 0), (n.c = !1) } function r(n) { var a = o.newElement(), l, s = n._length === void 0 ? n.v.length : n._length for (a.setLength(s), a.c = n.c, l = 0; l < s; l += 1) a.setTripleAt( n.v[l][0], n.v[l][1], n.o[l][0], n.o[l][1], n.i[l][0], n.i[l][1], l ) return a } var o = poolFactory(4, e, t) return (o.clone = r), o })() function ShapeCollection() { ;(this._length = 0), (this._maxLength = 4), (this.shapes = createSizedArray(this._maxLength)) } ;(ShapeCollection.prototype.addShape = function (e) { this._length === this._maxLength && ((this.shapes = this.shapes.concat( createSizedArray(this._maxLength) )), (this._maxLength *= 2)), (this.shapes[this._length] = e), (this._length += 1) }), (ShapeCollection.prototype.releaseShapes = function () { var e for (e = 0; e < this._length; e += 1) shapePool.release(this.shapes[e]) this._length = 0 }) var shapeCollectionPool = (function () { var e = { newShapeCollection: n, release: a }, t = 0, r = 4, o = createSizedArray(r) function n() { var l return t ? ((t -= 1), (l = o[t])) : (l = new ShapeCollection()), l } function a(l) { var s, c = l._length for (s = 0; s < c; s += 1) shapePool.release(l.shapes[s]) ;(l._length = 0), t === r && ((o = pooling.double(o)), (r *= 2)), (o[t] = l), (t += 1) } return e })(), ShapePropertyFactory = (function () { var e = -999999 function t(g, x, y) { var w = y.lastIndex, S, T, A, $, F, Y, ae, re, ie, oe = this.keyframes if (g < oe[0].t - this.offsetTime) (S = oe[0].s[0]), (A = !0), (w = 0) else if (g >= oe[oe.length - 1].t - this.offsetTime) (S = oe[oe.length - 1].s ? oe[oe.length - 1].s[0] : oe[oe.length - 2].e[0]), (A = !0) else { for ( var j = w, V = oe.length - 1, z = !0, M, L, pe; z && ((M = oe[j]), (L = oe[j + 1]), !(L.t - this.offsetTime > g)); ) j < V - 1 ? (j += 1) : (z = !1) if ( ((pe = this.keyframesMetadata[j] || {}), (A = M.h === 1), (w = j), !A) ) { if (g >= L.t - this.offsetTime) re = 1 else if (g < M.t - this.offsetTime) re = 0 else { var ue pe.__fnct ? (ue = pe.__fnct) : ((ue = BezierFactory.getBezierEasing( M.o.x, M.o.y, M.i.x, M.i.y ).get), (pe.__fnct = ue)), (re = ue( (g - (M.t - this.offsetTime)) / (L.t - this.offsetTime - (M.t - this.offsetTime)) )) } T = L.s ? L.s[0] : M.e[0] } S = M.s[0] } for ( Y = x._length, ae = S.i[0].length, y.lastIndex = w, $ = 0; $ < Y; $ += 1 ) for (F = 0; F < ae; F += 1) (ie = A ? S.i[$][F] : S.i[$][F] + (T.i[$][F] - S.i[$][F]) * re), (x.i[$][F] = ie), (ie = A ? S.o[$][F] : S.o[$][F] + (T.o[$][F] - S.o[$][F]) * re), (x.o[$][F] = ie), (ie = A ? S.v[$][F] : S.v[$][F] + (T.v[$][F] - S.v[$][F]) * re), (x.v[$][F] = ie) } function r() { var g = this.comp.renderedFrame - this.offsetTime, x = this.keyframes[0].t - this.offsetTime, y = this.keyframes[this.keyframes.length - 1].t - this.offsetTime, w = this._caching.lastFrame return ( (w !== e && ((w < x && g < x) || (w > y && g > y))) || ((this._caching.lastIndex = w < g ? this._caching.lastIndex : 0), this.interpolateShape(g, this.pv, this._caching)), (this._caching.lastFrame = g), this.pv ) } function o() { this.paths = this.localShapeCollection } function n(g, x) { if (g._length !== x._length || g.c !== x.c) return !1 var y, w = g._length for (y = 0; y < w; y += 1) if ( g.v[y][0] !== x.v[y][0] || g.v[y][1] !== x.v[y][1] || g.o[y][0] !== x.o[y][0] || g.o[y][1] !== x.o[y][1] || g.i[y][0] !== x.i[y][0] || g.i[y][1] !== x.i[y][1] ) return !1 return !0 } function a(g) { n(this.v, g) || ((this.v = shapePool.clone(g)), this.localShapeCollection.releaseShapes(), this.localShapeCollection.addShape(this.v), (this._mdf = !0), (this.paths = this.localShapeCollection)) } function l() { if (this.elem.globalData.frameId !== this.frameId) { if (!this.effectsSequence.length) { this._mdf = !1 return } if (this.lock) { this.setVValue(this.pv) return } ;(this.lock = !0), (this._mdf = !1) var g this.kf ? (g = this.pv) : this.data.ks ? (g = this.data.ks.k) : (g = this.data.pt.k) var x, y = this.effectsSequence.length for (x = 0; x < y; x += 1) g = this.effectsSequence[x](g) this.setVValue(g), (this.lock = !1), (this.frameId = this.elem.globalData.frameId) } } function s(g, x, y) { ;(this.propType = 'shape'), (this.comp = g.comp), (this.container = g), (this.elem = g), (this.data = x), (this.k = !1), (this.kf = !1), (this._mdf = !1) var w = y === 3 ? x.pt.k : x.ks.k ;(this.v = shapePool.clone(w)), (this.pv = shapePool.clone(this.v)), (this.localShapeCollection = shapeCollectionPool.newShapeCollection()), (this.paths = this.localShapeCollection), this.paths.addShape(this.v), (this.reset = o), (this.effectsSequence = []) } function c(g) { this.effectsSequence.push(g), this.container.addDynamicProperty(this) } ;(s.prototype.interpolateShape = t), (s.prototype.getValue = l), (s.prototype.setVValue = a), (s.prototype.addEffect = c) function d(g, x, y) { ;(this.propType = 'shape'), (this.comp = g.comp), (this.elem = g), (this.container = g), (this.offsetTime = g.data.st), (this.keyframes = y === 3 ? x.pt.k : x.ks.k), (this.keyframesMetadata = []), (this.k = !0), (this.kf = !0) var w = this.keyframes[0].s[0].i.length ;(this.v = shapePool.newElement()), this.v.setPathData(this.keyframes[0].s[0].c, w), (this.pv = shapePool.clone(this.v)), (this.localShapeCollection = shapeCollectionPool.newShapeCollection()), (this.paths = this.localShapeCollection), this.paths.addShape(this.v), (this.lastFrame = e), (this.reset = o), (this._caching = { lastFrame: e, lastIndex: 0 }), (this.effectsSequence = [r.bind(this)]) } ;(d.prototype.getValue = l), (d.prototype.interpolateShape = t), (d.prototype.setVValue = a), (d.prototype.addEffect = c) var u = (function () { var g = roundCorner function x(y, w) { ;(this.v = shapePool.newElement()), this.v.setPathData(!0, 4), (this.localShapeCollection = shapeCollectionPool.newShapeCollection()), (this.paths = this.localShapeCollection), this.localShapeCollection.addShape(this.v), (this.d = w.d), (this.elem = y), (this.comp = y.comp), (this.frameId = -1), this.initDynamicPropertyContainer(y), (this.p = PropertyFactory.getProp(y, w.p, 1, 0, this)), (this.s = PropertyFactory.getProp(y, w.s, 1, 0, this)), this.dynamicProperties.length ? (this.k = !0) : ((this.k = !1), this.convertEllToPath()) } return ( (x.prototype = { reset: o, getValue: function () { this.elem.globalData.frameId !== this.frameId && ((this.frameId = this.elem.globalData.frameId), this.iterateDynamicProperties(), this._mdf && this.convertEllToPath()) }, convertEllToPath: function () { var w = this.p.v[0], S = this.p.v[1], T = this.s.v[0] / 2, A = this.s.v[1] / 2, $ = this.d !== 3, F = this.v ;(F.v[0][0] = w), (F.v[0][1] = S - A), (F.v[1][0] = $ ? w + T : w - T), (F.v[1][1] = S), (F.v[2][0] = w), (F.v[2][1] = S + A), (F.v[3][0] = $ ? w - T : w + T), (F.v[3][1] = S), (F.i[0][0] = $ ? w - T * g : w + T * g), (F.i[0][1] = S - A), (F.i[1][0] = $ ? w + T : w - T), (F.i[1][1] = S - A * g), (F.i[2][0] = $ ? w + T * g : w - T * g), (F.i[2][1] = S + A), (F.i[3][0] = $ ? w - T : w + T), (F.i[3][1] = S + A * g), (F.o[0][0] = $ ? w + T * g : w - T * g), (F.o[0][1] = S - A), (F.o[1][0] = $ ? w + T : w - T), (F.o[1][1] = S + A * g), (F.o[2][0] = $ ? w - T * g : w + T * g), (F.o[2][1] = S + A), (F.o[3][0] = $ ? w - T : w + T), (F.o[3][1] = S - A * g) } }), extendPrototype([DynamicPropertyContainer], x), x ) })(), m = (function () { function g(x, y) { ;(this.v = shapePool.newElement()), this.v.setPathData(!0, 0), (this.elem = x), (this.comp = x.comp), (this.data = y), (this.frameId = -1), (this.d = y.d), this.initDynamicPropertyContainer(x), y.sy === 1 ? ((this.ir = PropertyFactory.getProp(x, y.ir, 0, 0, this)), (this.is = PropertyFactory.getProp( x, y.is, 0, 0.01, this )), (this.convertToPath = this.convertStarToPath)) : (this.convertToPath = this.convertPolygonToPath), (this.pt = PropertyFactory.getProp(x, y.pt, 0, 0, this)), (this.p = PropertyFactory.getProp(x, y.p, 1, 0, this)), (this.r = PropertyFactory.getProp( x, y.r, 0, degToRads, this )), (this.or = PropertyFactory.getProp(x, y.or, 0, 0, this)), (this.os = PropertyFactory.getProp(x, y.os, 0, 0.01, this)), (this.localShapeCollection = shapeCollectionPool.newShapeCollection()), this.localShapeCollection.addShape(this.v), (this.paths = this.localShapeCollection), this.dynamicProperties.length ? (this.k = !0) : ((this.k = !1), this.convertToPath()) } return ( (g.prototype = { reset: o, getValue: function () { this.elem.globalData.frameId !== this.frameId && ((this.frameId = this.elem.globalData.frameId), this.iterateDynamicProperties(), this._mdf && this.convertToPath()) }, convertStarToPath: function () { var y = Math.floor(this.pt.v) * 2, w = (Math.PI * 2) / y, S = !0, T = this.or.v, A = this.ir.v, $ = this.os.v, F = this.is.v, Y = (2 * Math.PI * T) / (y * 2), ae = (2 * Math.PI * A) / (y * 2), re, ie, oe, j, V = -Math.PI / 2 V += this.r.v var z = this.data.d === 3 ? -1 : 1 for (this.v._length = 0, re = 0; re < y; re += 1) { ;(ie = S ? T : A), (oe = S ? $ : F), (j = S ? Y : ae) var M = ie * Math.cos(V), L = ie * Math.sin(V), pe = M === 0 && L === 0 ? 0 : L / Math.sqrt(M * M + L * L), ue = M === 0 && L === 0 ? 0 : -M / Math.sqrt(M * M + L * L) ;(M += +this.p.v[0]), (L += +this.p.v[1]), this.v.setTripleAt( M, L, M - pe * j * oe * z, L - ue * j * oe * z, M + pe * j * oe * z, L + ue * j * oe * z, re, !0 ), (S = !S), (V += w * z) } }, convertPolygonToPath: function () { var y = Math.floor(this.pt.v), w = (Math.PI * 2) / y, S = this.or.v, T = this.os.v, A = (2 * Math.PI * S) / (y * 4), $, F = -Math.PI * 0.5, Y = this.data.d === 3 ? -1 : 1 for ( F += this.r.v, this.v._length = 0, $ = 0; $ < y; $ += 1 ) { var ae = S * Math.cos(F), re = S * Math.sin(F), ie = ae === 0 && re === 0 ? 0 : re / Math.sqrt(ae * ae + re * re), oe = ae === 0 && re === 0 ? 0 : -ae / Math.sqrt(ae * ae + re * re) ;(ae += +this.p.v[0]), (re += +this.p.v[1]), this.v.setTripleAt( ae, re, ae - ie * A * T * Y, re - oe * A * T * Y, ae + ie * A * T * Y, re + oe * A * T * Y, $, !0 ), (F += w * Y) } ;(this.paths.length = 0), (this.paths[0] = this.v) } }), extendPrototype([DynamicPropertyContainer], g), g ) })(), f = (function () { function g(x, y) { ;(this.v = shapePool.newElement()), (this.v.c = !0), (this.localShapeCollection = shapeCollectionPool.newShapeCollection()), this.localShapeCollection.addShape(this.v), (this.paths = this.localShapeCollection), (this.elem = x), (this.comp = x.comp), (this.frameId = -1), (this.d = y.d), this.initDynamicPropertyContainer(x), (this.p = PropertyFactory.getProp(x, y.p, 1, 0, this)), (this.s = PropertyFactory.getProp(x, y.s, 1, 0, this)), (this.r = PropertyFactory.getProp(x, y.r, 0, 0, this)), this.dynamicProperties.length ? (this.k = !0) : ((this.k = !1), this.convertRectToPath()) } return ( (g.prototype = { convertRectToPath: function () { var y = this.p.v[0], w = this.p.v[1], S = this.s.v[0] / 2, T = this.s.v[1] / 2, A = bmMin(S, T, this.r.v), $ = A * (1 - roundCorner) ;(this.v._length = 0), this.d === 2 || this.d === 1 ? (this.v.setTripleAt( y + S, w - T + A, y + S, w - T + A, y + S, w - T + $, 0, !0 ), this.v.setTripleAt( y + S, w + T - A, y + S, w + T - $, y + S, w + T - A, 1, !0 ), A !== 0 ? (this.v.setTripleAt( y + S - A, w + T, y + S - A, w + T, y + S - $, w + T, 2, !0 ), this.v.setTripleAt( y - S + A, w + T, y - S + $, w + T, y - S + A, w + T, 3, !0 ), this.v.setTripleAt( y - S, w + T - A, y - S, w + T - A, y - S, w + T - $, 4, !0 ), this.v.setTripleAt( y - S, w - T + A, y - S, w - T + $, y - S, w - T + A, 5, !0 ), this.v.setTripleAt( y - S + A, w - T, y - S + A, w - T, y - S + $, w - T, 6, !0 ), this.v.setTripleAt( y + S - A, w - T, y + S - $, w - T, y + S - A, w - T, 7, !0 )) : (this.v.setTripleAt( y - S, w + T, y - S + $, w + T, y - S, w + T, 2 ), this.v.setTripleAt( y - S, w - T, y - S, w - T + $, y - S, w - T, 3 ))) : (this.v.setTripleAt( y + S, w - T + A, y + S, w - T + $, y + S, w - T + A, 0, !0 ), A !== 0 ? (this.v.setTripleAt( y + S - A, w - T, y + S - A, w - T, y + S - $, w - T, 1, !0 ), this.v.setTripleAt( y - S + A, w - T, y - S + $, w - T, y - S + A, w - T, 2, !0 ), this.v.setTripleAt( y - S, w - T + A, y - S, w - T + A, y - S, w - T + $, 3, !0 ), this.v.setTripleAt( y - S, w + T - A, y - S, w + T - $, y - S, w + T - A, 4, !0 ), this.v.setTripleAt( y - S + A, w + T, y - S + A, w + T, y - S + $, w + T, 5, !0 ), this.v.setTripleAt( y + S - A, w + T, y + S - $, w + T, y + S - A, w + T, 6, !0 ), this.v.setTripleAt( y + S, w + T - A, y + S, w + T - A, y + S, w + T - $, 7, !0 )) : (this.v.setTripleAt( y - S, w - T, y - S + $, w - T, y - S, w - T, 1, !0 ), this.v.setTripleAt( y - S, w + T, y - S, w + T - $, y - S, w + T, 2, !0 ), this.v.setTripleAt( y + S, w + T, y + S - $, w + T, y + S, w + T, 3, !0 ))) }, getValue: function () { this.elem.globalData.frameId !== this.frameId && ((this.frameId = this.elem.globalData.frameId), this.iterateDynamicProperties(), this._mdf && this.convertRectToPath()) }, reset: o }), extendPrototype([DynamicPropertyContainer], g), g ) })() function _(g, x, y) { var w if (y === 3 || y === 4) { var S = y === 3 ? x.pt : x.ks, T = S.k T.length ? (w = new d(g, x, y)) : (w = new s(g, x, y)) } else y === 5 ? (w = new f(g, x)) : y === 6 ? (w = new u(g, x)) : y === 7 && (w = new m(g, x)) return w.k && g.addDynamicProperty(w), w } function b() { return s } function v() { return d } var k = {} return ( (k.getShapeProp = _), (k.getConstructorFunction = b), (k.getKeyframedConstructorFunction = v), k ) })() /*! Transformation Matrix v2.0 (c) Epistemex 2014-2015 www.epistemex.com By Ken Fyrstenberg Contributions by leeoniya. License: MIT, header required. */ var Matrix = (function () { var e = Math.cos, t = Math.sin, r = Math.tan, o = Math.round function n() { return ( (this.props[0] = 1), (this.props[1] = 0), (this.props[2] = 0), (this.props[3] = 0), (this.props[4] = 0), (this.props[5] = 1), (this.props[6] = 0), (this.props[7] = 0), (this.props[8] = 0), (this.props[9] = 0), (this.props[10] = 1), (this.props[11] = 0), (this.props[12] = 0), (this.props[13] = 0), (this.props[14] = 0), (this.props[15] = 1), this ) } function a(z) { if (z === 0) return this var M = e(z), L = t(z) return this._t(M, -L, 0, 0, L, M, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1) } function l(z) { if (z === 0) return this var M = e(z), L = t(z) return this._t(1, 0, 0, 0, 0, M, -L, 0, 0, L, M, 0, 0, 0, 0, 1) } function s(z) { if (z === 0) return this var M = e(z), L = t(z) return this._t(M, 0, L, 0, 0, 1, 0, 0, -L, 0, M, 0, 0, 0, 0, 1) } function c(z) { if (z === 0) return this var M = e(z), L = t(z) return this._t(M, -L, 0, 0, L, M, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1) } function d(z, M) { return this._t(1, M, z, 1, 0, 0) } function u(z, M) { return this.shear(r(z), r(M)) } function m(z, M) { var L = e(M), pe = t(M) return this._t(L, pe, 0, 0, -pe, L, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1) ._t(1, 0, 0, 0, r(z), 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1) ._t(L, -pe, 0, 0, pe, L, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1) } function f(z, M, L) { return ( !L && L !== 0 && (L = 1), z === 1 && M === 1 && L === 1 ? this : this._t(z, 0, 0, 0, 0, M, 0, 0, 0, 0, L, 0, 0, 0, 0, 1) ) } function _( z, M, L, pe, ue, Ie, Pt, rr, _e, Oe, xe, $e, jt, or, er, tr ) { return ( (this.props[0] = z), (this.props[1] = M), (this.props[2] = L), (this.props[3] = pe), (this.props[4] = ue), (this.props[5] = Ie), (this.props[6] = Pt), (this.props[7] = rr), (this.props[8] = _e), (this.props[9] = Oe), (this.props[10] = xe), (this.props[11] = $e), (this.props[12] = jt), (this.props[13] = or), (this.props[14] = er), (this.props[15] = tr), this ) } function b(z, M, L) { return ( (L = L || 0), z !== 0 || M !== 0 || L !== 0 ? this._t(1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, z, M, L, 1) : this ) } function v( z, M, L, pe, ue, Ie, Pt, rr, _e, Oe, xe, $e, jt, or, er, tr ) { var D = this.props if ( z === 1 && M === 0 && L === 0 && pe === 0 && ue === 0 && Ie === 1 && Pt === 0 && rr === 0 && _e === 0 && Oe === 0 && xe === 1 && $e === 0 ) return ( (D[12] = D[12] * z + D[15] * jt), (D[13] = D[13] * Ie + D[15] * or), (D[14] = D[14] * xe + D[15] * er), (D[15] *= tr), (this._identityCalculated = !1), this ) var de = D[0], Ce = D[1], Ne = D[2], Ve = D[3], Et = D[4], Lt = D[5], Ue = D[6], kt = D[7], qe = D[8], ir = D[9], he = D[10], At = D[11], nr = D[12], cr = D[13], Fe = D[14], lr = D[15] return ( (D[0] = de * z + Ce * ue + Ne * _e + Ve * jt), (D[1] = de * M + Ce * Ie + Ne * Oe + Ve * or), (D[2] = de * L + Ce * Pt + Ne * xe + Ve * er), (D[3] = de * pe + Ce * rr + Ne * $e + Ve * tr), (D[4] = Et * z + Lt * ue + Ue * _e + kt * jt), (D[5] = Et * M + Lt * Ie + Ue * Oe + kt * or), (D[6] = Et * L + Lt * Pt + Ue * xe + kt * er), (D[7] = Et * pe + Lt * rr + Ue * $e + kt * tr), (D[8] = qe * z + ir * ue + he * _e + At * jt), (D[9] = qe * M + ir * Ie + he * Oe + At * or), (D[10] = qe * L + ir * Pt + he * xe + At * er), (D[11] = qe * pe + ir * rr + he * $e + At * tr), (D[12] = nr * z + cr * ue + Fe * _e + lr * jt), (D[13] = nr * M + cr * Ie + Fe * Oe + lr * or), (D[14] = nr * L + cr * Pt + Fe * xe + lr * er), (D[15] = nr * pe + cr * rr + Fe * $e + lr * tr), (this._identityCalculated = !1), this ) } function k() { return ( this._identityCalculated || ((this._identity = !( this.props[0] !== 1 || this.props[1] !== 0 || this.props[2] !== 0 || this.props[3] !== 0 || this.props[4] !== 0 || this.props[5] !== 1 || this.props[6] !== 0 || this.props[7] !== 0 || this.props[8] !== 0 || this.props[9] !== 0 || this.props[10] !== 1 || this.props[11] !== 0 || this.props[12] !== 0 || this.props[13] !== 0 || this.props[14] !== 0 || this.props[15] !== 1 )), (this._identityCalculated = !0)), this._identity ) } function g(z) { for (var M = 0; M < 16; ) { if (z.props[M] !== this.props[M]) return !1 M += 1 } return !0 } function x(z) { var M for (M = 0; M < 16; M += 1) z.props[M] = this.props[M] return z } function y(z) { var M for (M = 0; M < 16; M += 1) this.props[M] = z[M] } function w(z, M, L) { return { x: z * this.props[0] + M * this.props[4] + L * this.props[8] + this.props[12], y: z * this.props[1] + M * this.props[5] + L * this.props[9] + this.props[13], z: z * this.props[2] + M * this.props[6] + L * this.props[10] + this.props[14] } } function S(z, M, L) { return ( z * this.props[0] + M * this.props[4] + L * this.props[8] + this.props[12] ) } function T(z, M, L) { return ( z * this.props[1] + M * this.props[5] + L * this.props[9] + this.props[13] ) } function A(z, M, L) { return ( z * this.props[2] + M * this.props[6] + L * this.props[10] + this.props[14] ) } function $() { var z = this.props[0] * this.props[5] - this.props[1] * this.props[4], M = this.props[5] / z, L = -this.props[1] / z, pe = -this.props[4] / z, ue = this.props[0] / z, Ie = (this.props[4] * this.props[13] - this.props[5] * this.props[12]) / z, Pt = -( this.props[0] * this.props[13] - this.props[1] * this.props[12] ) / z, rr = new Matrix() return ( (rr.props[0] = M), (rr.props[1] = L), (rr.props[4] = pe), (rr.props[5] = ue), (rr.props[12] = Ie), (rr.props[13] = Pt), rr ) } function F(z) { var M = this.getInverseMatrix() return M.applyToPointArray(z[0], z[1], z[2] || 0) } function Y(z) { var M, L = z.length, pe = [] for (M = 0; M < L; M += 1) pe[M] = F(z[M]) return pe } function ae(z, M, L) { var pe = createTypedArray('float32', 6) if (this.isIdentity()) (pe[0] = z[0]), (pe[1] = z[1]), (pe[2] = M[0]), (pe[3] = M[1]), (pe[4] = L[0]), (pe[5] = L[1]) else { var ue = this.props[0], Ie = this.props[1], Pt = this.props[4], rr = this.props[5], _e = this.props[12], Oe = this.props[13] ;(pe[0] = z[0] * ue + z[1] * Pt + _e), (pe[1] = z[0] * Ie + z[1] * rr + Oe), (pe[2] = M[0] * ue + M[1] * Pt + _e), (pe[3] = M[0] * Ie + M[1] * rr + Oe), (pe[4] = L[0] * ue + L[1] * Pt + _e), (pe[5] = L[0] * Ie + L[1] * rr + Oe) } return pe } function re(z, M, L) { var pe return ( this.isIdentity() ? (pe = [z, M, L]) : (pe = [ z * this.props[0] + M * this.props[4] + L * this.props[8] + this.props[12], z * this.props[1] + M * this.props[5] + L * this.props[9] + this.props[13], z * this.props[2] + M * this.props[6] + L * this.props[10] + this.props[14] ]), pe ) } function ie(z, M) { if (this.isIdentity()) return z + ',' + M var L = this.props return ( Math.round((z * L[0] + M * L[4] + L[12]) * 100) / 100 + ',' + Math.round((z * L[1] + M * L[5] + L[13]) * 100) / 100 ) } function oe() { for (var z = 0, M = this.props, L = 'matrix3d(', pe = 1e4; z < 16; ) (L += o(M[z] * pe) / pe), (L += z === 15 ? ')' : ','), (z += 1) return L } function j(z) { var M = 1e4 return (z < 1e-6 && z > 0) || (z > -1e-6 && z < 0) ? o(z * M) / M : z } function V() { var z = this.props, M = j(z[0]), L = j(z[1]), pe = j(z[4]), ue = j(z[5]), Ie = j(z[12]), Pt = j(z[13]) return ( 'matrix(' + M + ',' + L + ',' + pe + ',' + ue + ',' + Ie + ',' + Pt + ')' ) } return function () { ;(this.reset = n), (this.rotate = a), (this.rotateX = l), (this.rotateY = s), (this.rotateZ = c), (this.skew = u), (this.skewFromAxis = m), (this.shear = d), (this.scale = f), (this.setTransform = _), (this.translate = b), (this.transform = v), (this.applyToPoint = w), (this.applyToX = S), (this.applyToY = T), (this.applyToZ = A), (this.applyToPointArray = re), (this.applyToTriplePoints = ae), (this.applyToPointStringified = ie), (this.toCSS = oe), (this.to2dCSS = V), (this.clone = x), (this.cloneFromProps = y), (this.equals = g), (this.inversePoints = Y), (this.inversePoint = F), (this.getInverseMatrix = $), (this._t = this.transform), (this.isIdentity = k), (this._identity = !0), (this._identityCalculated = !1), (this.props = createTypedArray('float32', 16)), this.reset() } })() function _typeof$3(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$3 = function (r) { return typeof r }) : (_typeof$3 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$3(e) ) } var lottie = {} function setLocation(e) { setLocationHref(e) } function searchAnimations() { animationManager.searchAnimations() } function setSubframeRendering(e) { setSubframeEnabled(e) } function setPrefix(e) { setIdPrefix(e) } function loadAnimation(e) { return animationManager.loadAnimation(e) } function setQuality(e) { if (typeof e == 'string') switch (e) { case 'high': setDefaultCurveSegments(200) break default: case 'medium': setDefaultCurveSegments(50) break case 'low': setDefaultCurveSegments(10) break } else !isNaN(e) && e > 1 && setDefaultCurveSegments(e) } function inBrowser() { return typeof navigator != 'undefined' } function installPlugin(e, t) { e === 'expressions' && setExpressionsPlugin(t) } function getFactory(e) { switch (e) { case 'propertyFactory': return PropertyFactory case 'shapePropertyFactory': return ShapePropertyFactory case 'matrix': return Matrix default: return null } } ;(lottie.play = animationManager.play), (lottie.pause = animationManager.pause), (lottie.setLocationHref = setLocation), (lottie.togglePause = animationManager.togglePause), (lottie.setSpeed = animationManager.setSpeed), (lottie.setDirection = animationManager.setDirection), (lottie.stop = animationManager.stop), (lottie.searchAnimations = searchAnimations), (lottie.registerAnimation = animationManager.registerAnimation), (lottie.loadAnimation = loadAnimation), (lottie.setSubframeRendering = setSubframeRendering), (lottie.resize = animationManager.resize), (lottie.goToAndStop = animationManager.goToAndStop), (lottie.destroy = animationManager.destroy), (lottie.setQuality = setQuality), (lottie.inBrowser = inBrowser), (lottie.installPlugin = installPlugin), (lottie.freeze = animationManager.freeze), (lottie.unfreeze = animationManager.unfreeze), (lottie.setVolume = animationManager.setVolume), (lottie.mute = animationManager.mute), (lottie.unmute = animationManager.unmute), (lottie.getRegisteredAnimations = animationManager.getRegisteredAnimations), (lottie.useWebWorker = setWebWorker), (lottie.setIDPrefix = setPrefix), (lottie.__getFactory = getFactory), (lottie.version = '5.9.6') function checkReady() { document.readyState === 'complete' && (clearInterval(readyStateCheckInterval), searchAnimations()) } function getQueryVariable(e) { for (var t = queryString.split('&'), r = 0; r < t.length; r += 1) { var o = t[r].split('=') if (decodeURIComponent(o[0]) == e) return decodeURIComponent(o[1]) } return null } var queryString = '' { var scripts = document.getElementsByTagName('script'), index = scripts.length - 1, myScript = scripts[index] || { src: '' } ;(queryString = myScript.src ? myScript.src.replace(/^[^\?]+\??/, '') : ''), getQueryVariable('renderer') } var readyStateCheckInterval = setInterval(checkReady, 100) try { _typeof$3(exports) !== 'object' && (window.bodymovin = lottie) } catch (e) {} var ShapeModifiers = (function () { var e = {}, t = {} ;(e.registerModifier = r), (e.getModifier = o) function r(n, a) { t[n] || (t[n] = a) } function o(n, a, l) { return new t[n](a, l) } return e })() function ShapeModifier() {} ;(ShapeModifier.prototype.initModifierProperties = function () {}), (ShapeModifier.prototype.addShapeToModifier = function () {}), (ShapeModifier.prototype.addShape = function (e) { if (!this.closed) { e.sh.container.addDynamicProperty(e.sh) var t = { shape: e.sh, data: e, localShapeCollection: shapeCollectionPool.newShapeCollection() } this.shapes.push(t), this.addShapeToModifier(t), this._isAnimated && e.setAsAnimated() } }), (ShapeModifier.prototype.init = function (e, t) { ;(this.shapes = []), (this.elem = e), this.initDynamicPropertyContainer(e), this.initModifierProperties(e, t), (this.frameId = initialDefaultFrame), (this.closed = !1), (this.k = !1), this.dynamicProperties.length ? (this.k = !0) : this.getValue(!0) }), (ShapeModifier.prototype.processKeys = function () { this.elem.globalData.frameId !== this.frameId && ((this.frameId = this.elem.globalData.frameId), this.iterateDynamicProperties()) }), extendPrototype([DynamicPropertyContainer], ShapeModifier) function TrimModifier() {} extendPrototype([ShapeModifier], TrimModifier), (TrimModifier.prototype.initModifierProperties = function (e, t) { ;(this.s = PropertyFactory.getProp(e, t.s, 0, 0.01, this)), (this.e = PropertyFactory.getProp(e, t.e, 0, 0.01, this)), (this.o = PropertyFactory.getProp(e, t.o, 0, 0, this)), (this.sValue = 0), (this.eValue = 0), (this.getValue = this.processKeys), (this.m = t.m), (this._isAnimated = !!this.s.effectsSequence.length || !!this.e.effectsSequence.length || !!this.o.effectsSequence.length) }), (TrimModifier.prototype.addShapeToModifier = function (e) { e.pathsData = [] }), (TrimModifier.prototype.calculateShapeEdges = function (e, t, r, o, n) { var a = [] t <= 1 ? a.push({ s: e, e: t }) : e >= 1 ? a.push({ s: e - 1, e: t - 1 }) : (a.push({ s: e, e: 1 }), a.push({ s: 0, e: t - 1 })) var l = [], s, c = a.length, d for (s = 0; s < c; s += 1) if (((d = a[s]), !(d.e * n < o || d.s * n > o + r))) { var u, m d.s * n <= o ? (u = 0) : (u = (d.s * n - o) / r), d.e * n >= o + r ? (m = 1) : (m = (d.e * n - o) / r), l.push([u, m]) } return l.length || l.push([0, 0]), l }), (TrimModifier.prototype.releasePathsData = function (e) { var t, r = e.length for (t = 0; t < r; t += 1) segmentsLengthPool.release(e[t]) return (e.length = 0), e }), (TrimModifier.prototype.processShapes = function (e) { var t, r if (this._mdf || e) { var o = (this.o.v % 360) / 360 if ( (o < 0 && (o += 1), this.s.v > 1 ? (t = 1 + o) : this.s.v < 0 ? (t = 0 + o) : (t = this.s.v + o), this.e.v > 1 ? (r = 1 + o) : this.e.v < 0 ? (r = 0 + o) : (r = this.e.v + o), t > r) ) { var n = t ;(t = r), (r = n) } ;(t = Math.round(t * 1e4) * 1e-4), (r = Math.round(r * 1e4) * 1e-4), (this.sValue = t), (this.eValue = r) } else (t = this.sValue), (r = this.eValue) var a, l, s = this.shapes.length, c, d, u, m, f, _ = 0 if (r === t) for (l = 0; l < s; l += 1) this.shapes[l].localShapeCollection.releaseShapes(), (this.shapes[l].shape._mdf = !0), (this.shapes[l].shape.paths = this.shapes[l].localShapeCollection), this._mdf && (this.shapes[l].pathsData.length = 0) else if ((r === 1 && t === 0) || (r === 0 && t === 1)) { if (this._mdf) for (l = 0; l < s; l += 1) (this.shapes[l].pathsData.length = 0), (this.shapes[l].shape._mdf = !0) } else { var b = [], v, k for (l = 0; l < s; l += 1) if ( ((v = this.shapes[l]), !v.shape._mdf && !this._mdf && !e && this.m !== 2) ) v.shape.paths = v.localShapeCollection else { if ( ((a = v.shape.paths), (d = a._length), (f = 0), !v.shape._mdf && v.pathsData.length) ) f = v.totalShapeLength else { for ( u = this.releasePathsData(v.pathsData), c = 0; c < d; c += 1 ) (m = bez.getSegmentsLength(a.shapes[c])), u.push(m), (f += m.totalLength) ;(v.totalShapeLength = f), (v.pathsData = u) } ;(_ += f), (v.shape._mdf = !0) } var g = t, x = r, y = 0, w for (l = s - 1; l >= 0; l -= 1) if (((v = this.shapes[l]), v.shape._mdf)) { for ( k = v.localShapeCollection, k.releaseShapes(), this.m === 2 && s > 1 ? ((w = this.calculateShapeEdges( t, r, v.totalShapeLength, y, _ )), (y += v.totalShapeLength)) : (w = [[g, x]]), d = w.length, c = 0; c < d; c += 1 ) { ;(g = w[c][0]), (x = w[c][1]), (b.length = 0), x <= 1 ? b.push({ s: v.totalShapeLength * g, e: v.totalShapeLength * x }) : g >= 1 ? b.push({ s: v.totalShapeLength * (g - 1), e: v.totalShapeLength * (x - 1) }) : (b.push({ s: v.totalShapeLength * g, e: v.totalShapeLength }), b.push({ s: 0, e: v.totalShapeLength * (x - 1) })) var S = this.addShapes(v, b[0]) if (b[0].s !== b[0].e) { if (b.length > 1) { var T = v.shape.paths.shapes[v.shape.paths._length - 1] if (T.c) { var A = S.pop() this.addPaths(S, k), (S = this.addShapes(v, b[1], A)) } else this.addPaths(S, k), (S = this.addShapes(v, b[1])) } this.addPaths(S, k) } } v.shape.paths = k } } }), (TrimModifier.prototype.addPaths = function (e, t) { var r, o = e.length for (r = 0; r < o; r += 1) t.addShape(e[r]) }), (TrimModifier.prototype.addSegment = function (e, t, r, o, n, a, l) { n.setXYAt(t[0], t[1], 'o', a), n.setXYAt(r[0], r[1], 'i', a + 1), l && n.setXYAt(e[0], e[1], 'v', a), n.setXYAt(o[0], o[1], 'v', a + 1) }), (TrimModifier.prototype.addSegmentFromArray = function (e, t, r, o) { t.setXYAt(e[1], e[5], 'o', r), t.setXYAt(e[2], e[6], 'i', r + 1), o && t.setXYAt(e[0], e[4], 'v', r), t.setXYAt(e[3], e[7], 'v', r + 1) }), (TrimModifier.prototype.addShapes = function (e, t, r) { var o = e.pathsData, n = e.shape.paths.shapes, a, l = e.shape.paths._length, s, c, d = 0, u, m, f, _, b = [], v, k = !0 for ( r ? ((m = r._length), (v = r._length)) : ((r = shapePool.newElement()), (m = 0), (v = 0)), b.push(r), a = 0; a < l; a += 1 ) { for ( f = o[a].lengths, r.c = n[a].c, c = n[a].c ? f.length : f.length + 1, s = 1; s < c; s += 1 ) if (((u = f[s - 1]), d + u.addedLength < t.s)) (d += u.addedLength), (r.c = !1) else if (d > t.e) { r.c = !1 break } else t.s <= d && t.e >= d + u.addedLength ? (this.addSegment( n[a].v[s - 1], n[a].o[s - 1], n[a].i[s], n[a].v[s], r, m, k ), (k = !1)) : ((_ = bez.getNewSegment( n[a].v[s - 1], n[a].v[s], n[a].o[s - 1], n[a].i[s], (t.s - d) / u.addedLength, (t.e - d) / u.addedLength, f[s - 1] )), this.addSegmentFromArray(_, r, m, k), (k = !1), (r.c = !1)), (d += u.addedLength), (m += 1) if (n[a].c && f.length) { if (((u = f[s - 1]), d <= t.e)) { var g = f[s - 1].addedLength t.s <= d && t.e >= d + g ? (this.addSegment( n[a].v[s - 1], n[a].o[s - 1], n[a].i[0], n[a].v[0], r, m, k ), (k = !1)) : ((_ = bez.getNewSegment( n[a].v[s - 1], n[a].v[0], n[a].o[s - 1], n[a].i[0], (t.s - d) / g, (t.e - d) / g, f[s - 1] )), this.addSegmentFromArray(_, r, m, k), (k = !1), (r.c = !1)) } else r.c = !1 ;(d += u.addedLength), (m += 1) } if ( (r._length && (r.setXYAt(r.v[v][0], r.v[v][1], 'i', v), r.setXYAt( r.v[r._length - 1][0], r.v[r._length - 1][1], 'o', r._length - 1 )), d > t.e) ) break a < l - 1 && ((r = shapePool.newElement()), (k = !0), b.push(r), (m = 0)) } return b }) function PuckerAndBloatModifier() {} extendPrototype([ShapeModifier], PuckerAndBloatModifier), (PuckerAndBloatModifier.prototype.initModifierProperties = function ( e, t ) { ;(this.getValue = this.processKeys), (this.amount = PropertyFactory.getProp(e, t.a, 0, null, this)), (this._isAnimated = !!this.amount.effectsSequence.length) }), (PuckerAndBloatModifier.prototype.processPath = function (e, t) { var r = t / 100, o = [0, 0], n = e._length, a = 0 for (a = 0; a < n; a += 1) (o[0] += e.v[a][0]), (o[1] += e.v[a][1]) ;(o[0] /= n), (o[1] /= n) var l = shapePool.newElement() l.c = e.c var s, c, d, u, m, f for (a = 0; a < n; a += 1) (s = e.v[a][0] + (o[0] - e.v[a][0]) * r), (c = e.v[a][1] + (o[1] - e.v[a][1]) * r), (d = e.o[a][0] + (o[0] - e.o[a][0]) * -r), (u = e.o[a][1] + (o[1] - e.o[a][1]) * -r), (m = e.i[a][0] + (o[0] - e.i[a][0]) * -r), (f = e.i[a][1] + (o[1] - e.i[a][1]) * -r), l.setTripleAt(s, c, d, u, m, f, a) return l }), (PuckerAndBloatModifier.prototype.processShapes = function (e) { var t, r, o = this.shapes.length, n, a, l = this.amount.v if (l !== 0) { var s, c for (r = 0; r < o; r += 1) { if ( ((s = this.shapes[r]), (c = s.localShapeCollection), !(!s.shape._mdf && !this._mdf && !e)) ) for ( c.releaseShapes(), s.shape._mdf = !0, t = s.shape.paths.shapes, a = s.shape.paths._length, n = 0; n < a; n += 1 ) c.addShape(this.processPath(t[n], l)) s.shape.paths = s.localShapeCollection } } this.dynamicProperties.length || (this._mdf = !1) }) var TransformPropertyFactory = (function () { var e = [0, 0] function t(c) { var d = this._mdf this.iterateDynamicProperties(), (this._mdf = this._mdf || d), this.a && c.translate(-this.a.v[0], -this.a.v[1], this.a.v[2]), this.s && c.scale(this.s.v[0], this.s.v[1], this.s.v[2]), this.sk && c.skewFromAxis(-this.sk.v, this.sa.v), this.r ? c.rotate(-this.r.v) : c .rotateZ(-this.rz.v) .rotateY(this.ry.v) .rotateX(this.rx.v) .rotateZ(-this.or.v[2]) .rotateY(this.or.v[1]) .rotateX(this.or.v[0]), this.data.p.s ? this.data.p.z ? c.translate(this.px.v, this.py.v, -this.pz.v) : c.translate(this.px.v, this.py.v, 0) : c.translate(this.p.v[0], this.p.v[1], -this.p.v[2]) } function r(c) { if (this.elem.globalData.frameId !== this.frameId) { if ( (this._isDirty && (this.precalculateMatrix(), (this._isDirty = !1)), this.iterateDynamicProperties(), this._mdf || c) ) { var d if ( (this.v.cloneFromProps(this.pre.props), this.appliedTransformations < 1 && this.v.translate(-this.a.v[0], -this.a.v[1], this.a.v[2]), this.appliedTransformations < 2 && this.v.scale(this.s.v[0], this.s.v[1], this.s.v[2]), this.sk && this.appliedTransformations < 3 && this.v.skewFromAxis(-this.sk.v, this.sa.v), this.r && this.appliedTransformations < 4 ? this.v.rotate(-this.r.v) : !this.r && this.appliedTransformations < 4 && this.v .rotateZ(-this.rz.v) .rotateY(this.ry.v) .rotateX(this.rx.v) .rotateZ(-this.or.v[2]) .rotateY(this.or.v[1]) .rotateX(this.or.v[0]), this.autoOriented) ) { var u, m if ( ((d = this.elem.globalData.frameRate), this.p && this.p.keyframes && this.p.getValueAtTime) ) this.p._caching.lastFrame + this.p.offsetTime <= this.p.keyframes[0].t ? ((u = this.p.getValueAtTime( (this.p.keyframes[0].t + 0.01) / d, 0 )), (m = this.p.getValueAtTime(this.p.keyframes[0].t / d, 0))) : this.p._caching.lastFrame + this.p.offsetTime >= this.p.keyframes[this.p.keyframes.length - 1].t ? ((u = this.p.getValueAtTime( this.p.keyframes[this.p.keyframes.length - 1].t / d, 0 )), (m = this.p.getValueAtTime( (this.p.keyframes[this.p.keyframes.length - 1].t - 0.05) / d, 0 ))) : ((u = this.p.pv), (m = this.p.getValueAtTime( (this.p._caching.lastFrame + this.p.offsetTime - 0.01) / d, this.p.offsetTime ))) else if ( this.px && this.px.keyframes && this.py.keyframes && this.px.getValueAtTime && this.py.getValueAtTime ) { ;(u = []), (m = []) var f = this.px, _ = this.py f._caching.lastFrame + f.offsetTime <= f.keyframes[0].t ? ((u[0] = f.getValueAtTime( (f.keyframes[0].t + 0.01) / d, 0 )), (u[1] = _.getValueAtTime( (_.keyframes[0].t + 0.01) / d, 0 )), (m[0] = f.getValueAtTime(f.keyframes[0].t / d, 0)), (m[1] = _.getValueAtTime(_.keyframes[0].t / d, 0))) : f._caching.lastFrame + f.offsetTime >= f.keyframes[f.keyframes.length - 1].t ? ((u[0] = f.getValueAtTime( f.keyframes[f.keyframes.length - 1].t / d, 0 )), (u[1] = _.getValueAtTime( _.keyframes[_.keyframes.length - 1].t / d, 0 )), (m[0] = f.getValueAtTime( (f.keyframes[f.keyframes.length - 1].t - 0.01) / d, 0 )), (m[1] = _.getValueAtTime( (_.keyframes[_.keyframes.length - 1].t - 0.01) / d, 0 ))) : ((u = [f.pv, _.pv]), (m[0] = f.getValueAtTime( (f._caching.lastFrame + f.offsetTime - 0.01) / d, f.offsetTime )), (m[1] = _.getValueAtTime( (_._caching.lastFrame + _.offsetTime - 0.01) / d, _.offsetTime ))) } else (m = e), (u = m) this.v.rotate(-Math.atan2(u[1] - m[1], u[0] - m[0])) } this.data.p && this.data.p.s ? this.data.p.z ? this.v.translate(this.px.v, this.py.v, -this.pz.v) : this.v.translate(this.px.v, this.py.v, 0) : this.v.translate(this.p.v[0], this.p.v[1], -this.p.v[2]) } this.frameId = this.elem.globalData.frameId } } function o() { if (!this.a.k) this.pre.translate(-this.a.v[0], -this.a.v[1], this.a.v[2]), (this.appliedTransformations = 1) else return if (!this.s.effectsSequence.length) this.pre.scale(this.s.v[0], this.s.v[1], this.s.v[2]), (this.appliedTransformations = 2) else return if (this.sk) if ( !this.sk.effectsSequence.length && !this.sa.effectsSequence.length ) this.pre.skewFromAxis(-this.sk.v, this.sa.v), (this.appliedTransformations = 3) else return this.r ? this.r.effectsSequence.length || (this.pre.rotate(-this.r.v), (this.appliedTransformations = 4)) : !this.rz.effectsSequence.length && !this.ry.effectsSequence.length && !this.rx.effectsSequence.length && !this.or.effectsSequence.length && (this.pre .rotateZ(-this.rz.v) .rotateY(this.ry.v) .rotateX(this.rx.v) .rotateZ(-this.or.v[2]) .rotateY(this.or.v[1]) .rotateX(this.or.v[0]), (this.appliedTransformations = 4)) } function n() {} function a(c) { this._addDynamicProperty(c), this.elem.addDynamicProperty(c), (this._isDirty = !0) } function l(c, d, u) { if ( ((this.elem = c), (this.frameId = -1), (this.propType = 'transform'), (this.data = d), (this.v = new Matrix()), (this.pre = new Matrix()), (this.appliedTransformations = 0), this.initDynamicPropertyContainer(u || c), d.p && d.p.s ? ((this.px = PropertyFactory.getProp(c, d.p.x, 0, 0, this)), (this.py = PropertyFactory.getProp(c, d.p.y, 0, 0, this)), d.p.z && (this.pz = PropertyFactory.getProp(c, d.p.z, 0, 0, this))) : (this.p = PropertyFactory.getProp( c, d.p || { k: [0, 0, 0] }, 1, 0, this )), d.rx) ) { if ( ((this.rx = PropertyFactory.getProp(c, d.rx, 0, degToRads, this)), (this.ry = PropertyFactory.getProp(c, d.ry, 0, degToRads, this)), (this.rz = PropertyFactory.getProp(c, d.rz, 0, degToRads, this)), d.or.k[0].ti) ) { var m, f = d.or.k.length for (m = 0; m < f; m += 1) (d.or.k[m].to = null), (d.or.k[m].ti = null) } ;(this.or = PropertyFactory.getProp(c, d.or, 1, degToRads, this)), (this.or.sh = !0) } else this.r = PropertyFactory.getProp( c, d.r || { k: 0 }, 0, degToRads, this ) d.sk && ((this.sk = PropertyFactory.getProp(c, d.sk, 0, degToRads, this)), (this.sa = PropertyFactory.getProp(c, d.sa, 0, degToRads, this))), (this.a = PropertyFactory.getProp( c, d.a || { k: [0, 0, 0] }, 1, 0, this )), (this.s = PropertyFactory.getProp( c, d.s || { k: [100, 100, 100] }, 1, 0.01, this )), d.o ? (this.o = PropertyFactory.getProp(c, d.o, 0, 0.01, c)) : (this.o = { _mdf: !1, v: 1 }), (this._isDirty = !0), this.dynamicProperties.length || this.getValue(!0) } ;(l.prototype = { applyToMatrix: t, getValue: r, precalculateMatrix: o, autoOrient: n }), extendPrototype([DynamicPropertyContainer], l), (l.prototype.addDynamicProperty = a), (l.prototype._addDynamicProperty = DynamicPropertyContainer.prototype.addDynamicProperty) function s(c, d, u) { return new l(c, d, u) } return { getTransformProperty: s } })() function RepeaterModifier() {} extendPrototype([ShapeModifier], RepeaterModifier), (RepeaterModifier.prototype.initModifierProperties = function (e, t) { ;(this.getValue = this.processKeys), (this.c = PropertyFactory.getProp(e, t.c, 0, null, this)), (this.o = PropertyFactory.getProp(e, t.o, 0, null, this)), (this.tr = TransformPropertyFactory.getTransformProperty( e, t.tr, this )), (this.so = PropertyFactory.getProp(e, t.tr.so, 0, 0.01, this)), (this.eo = PropertyFactory.getProp(e, t.tr.eo, 0, 0.01, this)), (this.data = t), this.dynamicProperties.length || this.getValue(!0), (this._isAnimated = !!this.dynamicProperties.length), (this.pMatrix = new Matrix()), (this.rMatrix = new Matrix()), (this.sMatrix = new Matrix()), (this.tMatrix = new Matrix()), (this.matrix = new Matrix()) }), (RepeaterModifier.prototype.applyTransforms = function ( e, t, r, o, n, a ) { var l = a ? -1 : 1, s = o.s.v[0] + (1 - o.s.v[0]) * (1 - n), c = o.s.v[1] + (1 - o.s.v[1]) * (1 - n) e.translate(o.p.v[0] * l * n, o.p.v[1] * l * n, o.p.v[2]), t.translate(-o.a.v[0], -o.a.v[1], o.a.v[2]), t.rotate(-o.r.v * l * n), t.translate(o.a.v[0], o.a.v[1], o.a.v[2]), r.translate(-o.a.v[0], -o.a.v[1], o.a.v[2]), r.scale(a ? 1 / s : s, a ? 1 / c : c), r.translate(o.a.v[0], o.a.v[1], o.a.v[2]) }), (RepeaterModifier.prototype.init = function (e, t, r, o) { for ( this.elem = e, this.arr = t, this.pos = r, this.elemsData = o, this._currentCopies = 0, this._elements = [], this._groups = [], this.frameId = -1, this.initDynamicPropertyContainer(e), this.initModifierProperties(e, t[r]); r > 0; ) (r -= 1), this._elements.unshift(t[r]) this.dynamicProperties.length ? (this.k = !0) : this.getValue(!0) }), (RepeaterModifier.prototype.resetElements = function (e) { var t, r = e.length for (t = 0; t < r; t += 1) (e[t]._processed = !1), e[t].ty === 'gr' && this.resetElements(e[t].it) }), (RepeaterModifier.prototype.cloneElements = function (e) { var t = JSON.parse(JSON.stringify(e)) return this.resetElements(t), t }), (RepeaterModifier.prototype.changeGroupRender = function (e, t) { var r, o = e.length for (r = 0; r < o; r += 1) (e[r]._render = t), e[r].ty === 'gr' && this.changeGroupRender(e[r].it, t) }), (RepeaterModifier.prototype.processShapes = function (e) { var t, r, o, n, a, l = !1 if (this._mdf || e) { var s = Math.ceil(this.c.v) if (this._groups.length < s) { for (; this._groups.length < s; ) { var c = { it: this.cloneElements(this._elements), ty: 'gr' } c.it.push({ a: { a: 0, ix: 1, k: [0, 0] }, nm: 'Transform', o: { a: 0, ix: 7, k: 100 }, p: { a: 0, ix: 2, k: [0, 0] }, r: { a: 1, ix: 6, k: [ { s: 0, e: 0, t: 0 }, { s: 0, e: 0, t: 1 } ] }, s: { a: 0, ix: 3, k: [100, 100] }, sa: { a: 0, ix: 5, k: 0 }, sk: { a: 0, ix: 4, k: 0 }, ty: 'tr' }), this.arr.splice(0, 0, c), this._groups.splice(0, 0, c), (this._currentCopies += 1) } this.elem.reloadShapes(), (l = !0) } a = 0 var d for (o = 0; o <= this._groups.length - 1; o += 1) { if ( ((d = a < s), (this._groups[o]._render = d), this.changeGroupRender(this._groups[o].it, d), !d) ) { var u = this.elemsData[o].it, m = u[u.length - 1] m.transform.op.v !== 0 ? ((m.transform.op._mdf = !0), (m.transform.op.v = 0)) : (m.transform.op._mdf = !1) } a += 1 } this._currentCopies = s var f = this.o.v, _ = f % 1, b = f > 0 ? Math.floor(f) : Math.ceil(f), v = this.pMatrix.props, k = this.rMatrix.props, g = this.sMatrix.props this.pMatrix.reset(), this.rMatrix.reset(), this.sMatrix.reset(), this.tMatrix.reset(), this.matrix.reset() var x = 0 if (f > 0) { for (; x < b; ) this.applyTransforms( this.pMatrix, this.rMatrix, this.sMatrix, this.tr, 1, !1 ), (x += 1) _ && (this.applyTransforms( this.pMatrix, this.rMatrix, this.sMatrix, this.tr, _, !1 ), (x += _)) } else if (f < 0) { for (; x > b; ) this.applyTransforms( this.pMatrix, this.rMatrix, this.sMatrix, this.tr, 1, !0 ), (x -= 1) _ && (this.applyTransforms( this.pMatrix, this.rMatrix, this.sMatrix, this.tr, -_, !0 ), (x -= _)) } ;(o = this.data.m === 1 ? 0 : this._currentCopies - 1), (n = this.data.m === 1 ? 1 : -1), (a = this._currentCopies) for (var y, w; a; ) { if ( ((t = this.elemsData[o].it), (r = t[t.length - 1].transform.mProps.v.props), (w = r.length), (t[t.length - 1].transform.mProps._mdf = !0), (t[t.length - 1].transform.op._mdf = !0), (t[t.length - 1].transform.op.v = this._currentCopies === 1 ? this.so.v : this.so.v + (this.eo.v - this.so.v) * (o / (this._currentCopies - 1))), x !== 0) ) { for ( ((o !== 0 && n === 1) || (o !== this._currentCopies - 1 && n === -1)) && this.applyTransforms( this.pMatrix, this.rMatrix, this.sMatrix, this.tr, 1, !1 ), this.matrix.transform( k[0], k[1], k[2], k[3], k[4], k[5], k[6], k[7], k[8], k[9], k[10], k[11], k[12], k[13], k[14], k[15] ), this.matrix.transform( g[0], g[1], g[2], g[3], g[4], g[5], g[6], g[7], g[8], g[9], g[10], g[11], g[12], g[13], g[14], g[15] ), this.matrix.transform( v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13], v[14], v[15] ), y = 0; y < w; y += 1 ) r[y] = this.matrix.props[y] this.matrix.reset() } else for (this.matrix.reset(), y = 0; y < w; y += 1) r[y] = this.matrix.props[y] ;(x += 1), (a -= 1), (o += n) } } else for (a = this._currentCopies, o = 0, n = 1; a; ) (t = this.elemsData[o].it), (r = t[t.length - 1].transform.mProps.v.props), (t[t.length - 1].transform.mProps._mdf = !1), (t[t.length - 1].transform.op._mdf = !1), (a -= 1), (o += n) return l }), (RepeaterModifier.prototype.addShape = function () {}) function RoundCornersModifier() {} extendPrototype([ShapeModifier], RoundCornersModifier), (RoundCornersModifier.prototype.initModifierProperties = function ( e, t ) { ;(this.getValue = this.processKeys), (this.rd = PropertyFactory.getProp(e, t.r, 0, null, this)), (this._isAnimated = !!this.rd.effectsSequence.length) }), (RoundCornersModifier.prototype.processPath = function (e, t) { var r = shapePool.newElement() r.c = e.c var o, n = e._length, a, l, s, c, d, u, m = 0, f, _, b, v, k, g for (o = 0; o < n; o += 1) (a = e.v[o]), (s = e.o[o]), (l = e.i[o]), a[0] === s[0] && a[1] === s[1] && a[0] === l[0] && a[1] === l[1] ? (o === 0 || o === n - 1) && !e.c ? (r.setTripleAt(a[0], a[1], s[0], s[1], l[0], l[1], m), (m += 1)) : (o === 0 ? (c = e.v[n - 1]) : (c = e.v[o - 1]), (d = Math.sqrt( Math.pow(a[0] - c[0], 2) + Math.pow(a[1] - c[1], 2) )), (u = d ? Math.min(d / 2, t) / d : 0), (k = a[0] + (c[0] - a[0]) * u), (f = k), (g = a[1] - (a[1] - c[1]) * u), (_ = g), (b = f - (f - a[0]) * roundCorner), (v = _ - (_ - a[1]) * roundCorner), r.setTripleAt(f, _, b, v, k, g, m), (m += 1), o === n - 1 ? (c = e.v[0]) : (c = e.v[o + 1]), (d = Math.sqrt( Math.pow(a[0] - c[0], 2) + Math.pow(a[1] - c[1], 2) )), (u = d ? Math.min(d / 2, t) / d : 0), (b = a[0] + (c[0] - a[0]) * u), (f = b), (v = a[1] + (c[1] - a[1]) * u), (_ = v), (k = f - (f - a[0]) * roundCorner), (g = _ - (_ - a[1]) * roundCorner), r.setTripleAt(f, _, b, v, k, g, m), (m += 1)) : (r.setTripleAt( e.v[o][0], e.v[o][1], e.o[o][0], e.o[o][1], e.i[o][0], e.i[o][1], m ), (m += 1)) return r }), (RoundCornersModifier.prototype.processShapes = function (e) { var t, r, o = this.shapes.length, n, a, l = this.rd.v if (l !== 0) { var s, c for (r = 0; r < o; r += 1) { if ( ((s = this.shapes[r]), (c = s.localShapeCollection), !(!s.shape._mdf && !this._mdf && !e)) ) for ( c.releaseShapes(), s.shape._mdf = !0, t = s.shape.paths.shapes, a = s.shape.paths._length, n = 0; n < a; n += 1 ) c.addShape(this.processPath(t[n], l)) s.shape.paths = s.localShapeCollection } } this.dynamicProperties.length || (this._mdf = !1) }) function getFontProperties(e) { for ( var t = e.fStyle ? e.fStyle.split(' ') : [], r = 'normal', o = 'normal', n = t.length, a, l = 0; l < n; l += 1 ) switch (((a = t[l].toLowerCase()), a)) { case 'italic': o = 'italic' break case 'bold': r = '700' break case 'black': r = '900' break case 'medium': r = '500' break case 'regular': case 'normal': r = '400' break case 'light': case 'thin': r = '200' break } return { style: o, weight: e.fWeight || r } } var FontManager = (function () { var e = 5e3, t = { w: 0, size: 0, shapes: [], data: { shapes: [] } }, r = [] r = r.concat([ 2304, 2305, 2306, 2307, 2362, 2363, 2364, 2364, 2366, 2367, 2368, 2369, 2370, 2371, 2372, 2373, 2374, 2375, 2376, 2377, 2378, 2379, 2380, 2381, 2382, 2383, 2387, 2388, 2389, 2390, 2391, 2402, 2403 ]) var o = ['d83cdffb', 'd83cdffc', 'd83cdffd', 'd83cdffe', 'd83cdfff'], n = [65039, 8205] function a(w) { var S = w.split(','), T, A = S.length, $ = [] for (T = 0; T < A; T += 1) S[T] !== 'sans-serif' && S[T] !== 'monospace' && $.push(S[T]) return $.join(',') } function l(w, S) { var T = createTag('span') T.setAttribute('aria-hidden', !0), (T.style.fontFamily = S) var A = createTag('span') ;(A.innerText = 'giItT1WQy@!-/#'), (T.style.position = 'absolute'), (T.style.left = '-10000px'), (T.style.top = '-10000px'), (T.style.fontSize = '300px'), (T.style.fontVariant = 'normal'), (T.style.fontStyle = 'normal'), (T.style.fontWeight = 'normal'), (T.style.letterSpacing = '0'), T.appendChild(A), document.body.appendChild(T) var $ = A.offsetWidth return ( (A.style.fontFamily = a(w) + ', ' + S), { node: A, w: $, parent: T } ) } function s() { var w, S = this.fonts.length, T, A, $ = S for (w = 0; w < S; w += 1) this.fonts[w].loaded ? ($ -= 1) : this.fonts[w].fOrigin === 'n' || this.fonts[w].origin === 0 ? (this.fonts[w].loaded = !0) : ((T = this.fonts[w].monoCase.node), (A = this.fonts[w].monoCase.w), T.offsetWidth !== A ? (($ -= 1), (this.fonts[w].loaded = !0)) : ((T = this.fonts[w].sansCase.node), (A = this.fonts[w].sansCase.w), T.offsetWidth !== A && (($ -= 1), (this.fonts[w].loaded = !0))), this.fonts[w].loaded && (this.fonts[w].sansCase.parent.parentNode.removeChild( this.fonts[w].sansCase.parent ), this.fonts[w].monoCase.parent.parentNode.removeChild( this.fonts[w].monoCase.parent ))) $ !== 0 && Date.now() - this.initTime < e ? setTimeout(this.checkLoadedFontsBinded, 20) : setTimeout(this.setIsLoadedBinded, 10) } function c(w, S) { var T = document.body && S ? 'svg' : 'canvas', A, $ = getFontProperties(w) if (T === 'svg') { var F = createNS('text') ;(F.style.fontSize = '100px'), F.setAttribute('font-family', w.fFamily), F.setAttribute('font-style', $.style), F.setAttribute('font-weight', $.weight), (F.textContent = '1'), w.fClass ? ((F.style.fontFamily = 'inherit'), F.setAttribute('class', w.fClass)) : (F.style.fontFamily = w.fFamily), S.appendChild(F), (A = F) } else { var Y = new OffscreenCanvas(500, 500).getContext('2d') ;(Y.font = $.style + ' ' + $.weight + ' 100px ' + w.fFamily), (A = Y) } function ae(re) { return T === 'svg' ? ((A.textContent = re), A.getComputedTextLength()) : A.measureText(re).width } return { measureText: ae } } function d(w, S) { if (!w) { this.isLoaded = !0 return } if (this.chars) { ;(this.isLoaded = !0), (this.fonts = w.list) return } if (!document.body) { ;(this.isLoaded = !0), w.list.forEach(function (V) { ;(V.helper = c(V)), (V.cache = {}) }), (this.fonts = w.list) return } var T = w.list, A, $ = T.length, F = $ for (A = 0; A < $; A += 1) { var Y = !0, ae, re if ( ((T[A].loaded = !1), (T[A].monoCase = l(T[A].fFamily, 'monospace')), (T[A].sansCase = l(T[A].fFamily, 'sans-serif')), !T[A].fPath) ) (T[A].loaded = !0), (F -= 1) else if (T[A].fOrigin === 'p' || T[A].origin === 3) { if ( ((ae = document.querySelectorAll( 'style[f-forigin="p"][f-family="' + T[A].fFamily + '"], style[f-origin="3"][f-family="' + T[A].fFamily + '"]' )), ae.length > 0 && (Y = !1), Y) ) { var ie = createTag('style') ie.setAttribute('f-forigin', T[A].fOrigin), ie.setAttribute('f-origin', T[A].origin), ie.setAttribute('f-family', T[A].fFamily), (ie.type = 'text/css'), (ie.innerText = '@font-face {font-family: ' + T[A].fFamily + "; font-style: normal; src: url('" + T[A].fPath + "');}"), S.appendChild(ie) } } else if (T[A].fOrigin === 'g' || T[A].origin === 1) { for ( ae = document.querySelectorAll( 'link[f-forigin="g"], link[f-origin="1"]' ), re = 0; re < ae.length; re += 1 ) ae[re].href.indexOf(T[A].fPath) !== -1 && (Y = !1) if (Y) { var oe = createTag('link') oe.setAttribute('f-forigin', T[A].fOrigin), oe.setAttribute('f-origin', T[A].origin), (oe.type = 'text/css'), (oe.rel = 'stylesheet'), (oe.href = T[A].fPath), document.body.appendChild(oe) } } else if (T[A].fOrigin === 't' || T[A].origin === 2) { for ( ae = document.querySelectorAll( 'script[f-forigin="t"], script[f-origin="2"]' ), re = 0; re < ae.length; re += 1 ) T[A].fPath === ae[re].src && (Y = !1) if (Y) { var j = createTag('link') j.setAttribute('f-forigin', T[A].fOrigin), j.setAttribute('f-origin', T[A].origin), j.setAttribute('rel', 'stylesheet'), j.setAttribute('href', T[A].fPath), S.appendChild(j) } } ;(T[A].helper = c(T[A], S)), (T[A].cache = {}), this.fonts.push(T[A]) } F === 0 ? (this.isLoaded = !0) : setTimeout(this.checkLoadedFonts.bind(this), 100) } function u(w) { if (!!w) { this.chars || (this.chars = []) var S, T = w.length, A, $ = this.chars.length, F for (S = 0; S < T; S += 1) { for (A = 0, F = !1; A < $; ) this.chars[A].style === w[S].style && this.chars[A].fFamily === w[S].fFamily && this.chars[A].ch === w[S].ch && (F = !0), (A += 1) F || (this.chars.push(w[S]), ($ += 1)) } } } function m(w, S, T) { for (var A = 0, $ = this.chars.length; A < $; ) { if ( this.chars[A].ch === w && this.chars[A].style === S && this.chars[A].fFamily === T ) return this.chars[A] A += 1 } return ( ((typeof w == 'string' && w.charCodeAt(0) !== 13) || !w) && console && console.warn && !this._warned && ((this._warned = !0), console.warn( 'Missing character from exported characters list: ', w, S, T )), t ) } function f(w, S, T) { var A = this.getFontByName(S), $ = w.charCodeAt(0) if (!A.cache[$ + 1]) { var F = A.helper if (w === ' ') { var Y = F.measureText('|' + w + '|'), ae = F.measureText('||') A.cache[$ + 1] = (Y - ae) / 100 } else A.cache[$ + 1] = F.measureText(w) / 100 } return A.cache[$ + 1] * T } function _(w) { for (var S = 0, T = this.fonts.length; S < T; ) { if (this.fonts[S].fName === w) return this.fonts[S] S += 1 } return this.fonts[0] } function b(w, S) { var T = w.toString(16) + S.toString(16) return o.indexOf(T) !== -1 } function v(w, S) { return S ? w === n[0] && S === n[1] : w === n[1] } function k(w) { return r.indexOf(w) !== -1 } function g() { this.isLoaded = !0 } var x = function () { ;(this.fonts = []), (this.chars = null), (this.typekitLoaded = 0), (this.isLoaded = !1), (this._warned = !1), (this.initTime = Date.now()), (this.setIsLoadedBinded = this.setIsLoaded.bind(this)), (this.checkLoadedFontsBinded = this.checkLoadedFonts.bind(this)) } ;(x.isModifier = b), (x.isZeroWidthJoiner = v), (x.isCombinedCharacter = k) var y = { addChars: u, addFonts: d, getCharData: m, getFontByName: _, measureText: f, checkLoadedFonts: s, setIsLoaded: g } return (x.prototype = y), x })() function RenderableElement() {} RenderableElement.prototype = { initRenderable: function () { ;(this.isInRange = !1), (this.hidden = !1), (this.isTransparent = !1), (this.renderableComponents = []) }, addRenderableComponent: function (t) { this.renderableComponents.indexOf(t) === -1 && this.renderableComponents.push(t) }, removeRenderableComponent: function (t) { this.renderableComponents.indexOf(t) !== -1 && this.renderableComponents.splice( this.renderableComponents.indexOf(t), 1 ) }, prepareRenderableFrame: function (t) { this.checkLayerLimits(t) }, checkTransparency: function () { this.finalTransform.mProp.o.v <= 0 ? !this.isTransparent && this.globalData.renderConfig.hideOnTransparent && ((this.isTransparent = !0), this.hide()) : this.isTransparent && ((this.isTransparent = !1), this.show()) }, checkLayerLimits: function (t) { this.data.ip - this.data.st <= t && this.data.op - this.data.st > t ? this.isInRange !== !0 && ((this.globalData._mdf = !0), (this._mdf = !0), (this.isInRange = !0), this.show()) : this.isInRange !== !1 && ((this.globalData._mdf = !0), (this.isInRange = !1), this.hide()) }, renderRenderable: function () { var t, r = this.renderableComponents.length for (t = 0; t < r; t += 1) this.renderableComponents[t].renderFrame(this._isFirstFrame) }, sourceRectAtTime: function () { return { top: 0, left: 0, width: 100, height: 100 } }, getLayerSize: function () { return this.data.ty === 5 ? { w: this.data.textData.width, h: this.data.textData.height } : { w: this.data.width, h: this.data.height } } } var MaskManagerInterface = (function () { function e(r, o) { ;(this._mask = r), (this._data = o) } Object.defineProperty(e.prototype, 'maskPath', { get: function () { return ( this._mask.prop.k && this._mask.prop.getValue(), this._mask.prop ) } }), Object.defineProperty(e.prototype, 'maskOpacity', { get: function () { return ( this._mask.op.k && this._mask.op.getValue(), this._mask.op.v * 100 ) } }) var t = function (o) { var n = createSizedArray(o.viewData.length), a, l = o.viewData.length for (a = 0; a < l; a += 1) n[a] = new e(o.viewData[a], o.masksProperties[a]) var s = function (d) { for (a = 0; a < l; ) { if (o.masksProperties[a].nm === d) return n[a] a += 1 } return null } return s } return t })(), ExpressionPropertyInterface = (function () { var e = { pv: 0, v: 0, mult: 1 }, t = { pv: [0, 0, 0], v: [0, 0, 0], mult: 1 } function r(l, s, c) { Object.defineProperty(l, 'velocity', { get: function () { return s.getVelocityAtTime(s.comp.currentFrame) } }), (l.numKeys = s.keyframes ? s.keyframes.length : 0), (l.key = function (d) { if (!l.numKeys) return 0 var u = '' 's' in s.keyframes[d - 1] ? (u = s.keyframes[d - 1].s) : 'e' in s.keyframes[d - 2] ? (u = s.keyframes[d - 2].e) : (u = s.keyframes[d - 2].s) var m = c === 'unidimensional' ? new Number(u) : Object.assign({}, u) return ( (m.time = s.keyframes[d - 1].t / s.elem.comp.globalData.frameRate), (m.value = c === 'unidimensional' ? u[0] : u), m ) }), (l.valueAtTime = s.getValueAtTime), (l.speedAtTime = s.getSpeedAtTime), (l.velocityAtTime = s.getVelocityAtTime), (l.propertyGroup = s.propertyGroup) } function o(l) { ;(!l || !('pv' in l)) && (l = e) var s = 1 / l.mult, c = l.pv * s, d = new Number(c) return ( (d.value = c), r(d, l, 'unidimensional'), function () { return ( l.k && l.getValue(), (c = l.v * s), d.value !== c && ((d = new Number(c)), (d.value = c), r(d, l, 'unidimensional')), d ) } ) } function n(l) { ;(!l || !('pv' in l)) && (l = t) var s = 1 / l.mult, c = (l.data && l.data.l) || l.pv.length, d = createTypedArray('float32', c), u = createTypedArray('float32', c) return ( (d.value = u), r(d, l, 'multidimensional'), function () { l.k && l.getValue() for (var m = 0; m < c; m += 1) (u[m] = l.v[m] * s), (d[m] = u[m]) return d } ) } function a() { return e } return function (l) { return l ? (l.propType === 'unidimensional' ? o(l) : n(l)) : a } })(), TransformExpressionInterface = (function () { return function (e) { function t(l) { switch (l) { case 'scale': case 'Scale': case 'ADBE Scale': case 6: return t.scale case 'rotation': case 'Rotation': case 'ADBE Rotation': case 'ADBE Rotate Z': case 10: return t.rotation case 'ADBE Rotate X': return t.xRotation case 'ADBE Rotate Y': return t.yRotation case 'position': case 'Position': case 'ADBE Position': case 2: return t.position case 'ADBE Position_0': return t.xPosition case 'ADBE Position_1': return t.yPosition case 'ADBE Position_2': return t.zPosition case 'anchorPoint': case 'AnchorPoint': case 'Anchor Point': case 'ADBE AnchorPoint': case 1: return t.anchorPoint case 'opacity': case 'Opacity': case 11: return t.opacity default: return null } } Object.defineProperty(t, 'rotation', { get: ExpressionPropertyInterface(e.r || e.rz) }), Object.defineProperty(t, 'zRotation', { get: ExpressionPropertyInterface(e.rz || e.r) }), Object.defineProperty(t, 'xRotation', { get: ExpressionPropertyInterface(e.rx) }), Object.defineProperty(t, 'yRotation', { get: ExpressionPropertyInterface(e.ry) }), Object.defineProperty(t, 'scale', { get: ExpressionPropertyInterface(e.s) }) var r, o, n, a return ( e.p ? (a = ExpressionPropertyInterface(e.p)) : ((r = ExpressionPropertyInterface(e.px)), (o = ExpressionPropertyInterface(e.py)), e.pz && (n = ExpressionPropertyInterface(e.pz))), Object.defineProperty(t, 'position', { get: function () { return e.p ? a() : [r(), o(), n ? n() : 0] } }), Object.defineProperty(t, 'xPosition', { get: ExpressionPropertyInterface(e.px) }), Object.defineProperty(t, 'yPosition', { get: ExpressionPropertyInterface(e.py) }), Object.defineProperty(t, 'zPosition', { get: ExpressionPropertyInterface(e.pz) }), Object.defineProperty(t, 'anchorPoint', { get: ExpressionPropertyInterface(e.a) }), Object.defineProperty(t, 'opacity', { get: ExpressionPropertyInterface(e.o) }), Object.defineProperty(t, 'skew', { get: ExpressionPropertyInterface(e.sk) }), Object.defineProperty(t, 'skewAxis', { get: ExpressionPropertyInterface(e.sa) }), Object.defineProperty(t, 'orientation', { get: ExpressionPropertyInterface(e.or) }), t ) } })(), LayerExpressionInterface = (function () { function e(d) { var u = new Matrix() if (d !== void 0) { var m = this._elem.finalTransform.mProp.getValueAtTime(d) m.clone(u) } else { var f = this._elem.finalTransform.mProp f.applyToMatrix(u) } return u } function t(d, u) { var m = this.getMatrix(u) return ( (m.props[12] = 0), (m.props[13] = 0), (m.props[14] = 0), this.applyPoint(m, d) ) } function r(d, u) { var m = this.getMatrix(u) return this.applyPoint(m, d) } function o(d, u) { var m = this.getMatrix(u) return ( (m.props[12] = 0), (m.props[13] = 0), (m.props[14] = 0), this.invertPoint(m, d) ) } function n(d, u) { var m = this.getMatrix(u) return this.invertPoint(m, d) } function a(d, u) { if (this._elem.hierarchy && this._elem.hierarchy.length) { var m, f = this._elem.hierarchy.length for (m = 0; m < f; m += 1) this._elem.hierarchy[m].finalTransform.mProp.applyToMatrix(d) } return d.applyToPointArray(u[0], u[1], u[2] || 0) } function l(d, u) { if (this._elem.hierarchy && this._elem.hierarchy.length) { var m, f = this._elem.hierarchy.length for (m = 0; m < f; m += 1) this._elem.hierarchy[m].finalTransform.mProp.applyToMatrix(d) } return d.inversePoint(u) } function s(d) { var u = new Matrix() if ( (u.reset(), this._elem.finalTransform.mProp.applyToMatrix(u), this._elem.hierarchy && this._elem.hierarchy.length) ) { var m, f = this._elem.hierarchy.length for (m = 0; m < f; m += 1) this._elem.hierarchy[m].finalTransform.mProp.applyToMatrix(u) return u.inversePoint(d) } return u.inversePoint(d) } function c() { return [1, 1, 1, 1] } return function (d) { var u function m(v) { _.mask = new MaskManagerInterface(v, d) } function f(v) { _.effect = v } function _(v) { switch (v) { case 'ADBE Root Vectors Group': case 'Contents': case 2: return _.shapeInterface case 1: case 6: case 'Transform': case 'transform': case 'ADBE Transform Group': return u case 4: case 'ADBE Effect Parade': case 'effects': case 'Effects': return _.effect case 'ADBE Text Properties': return _.textInterface default: return null } } ;(_.getMatrix = e), (_.invertPoint = l), (_.applyPoint = a), (_.toWorld = r), (_.toWorldVec = t), (_.fromWorld = n), (_.fromWorldVec = o), (_.toComp = r), (_.fromComp = s), (_.sampleImage = c), (_.sourceRectAtTime = d.sourceRectAtTime.bind(d)), (_._elem = d), (u = TransformExpressionInterface(d.finalTransform.mProp)) var b = getDescriptor(u, 'anchorPoint') return ( Object.defineProperties(_, { hasParent: { get: function () { return d.hierarchy.length } }, parent: { get: function () { return d.hierarchy[0].layerInterface } }, rotation: getDescriptor(u, 'rotation'), scale: getDescriptor(u, 'scale'), position: getDescriptor(u, 'position'), opacity: getDescriptor(u, 'opacity'), anchorPoint: b, anchor_point: b, transform: { get: function () { return u } }, active: { get: function () { return d.isInRange } } }), (_.startTime = d.data.st), (_.index = d.data.ind), (_.source = d.data.refId), (_.height = d.data.ty === 0 ? d.data.h : 100), (_.width = d.data.ty === 0 ? d.data.w : 100), (_.inPoint = d.data.ip / d.comp.globalData.frameRate), (_.outPoint = d.data.op / d.comp.globalData.frameRate), (_._name = d.data.nm), (_.registerMaskInterface = m), (_.registerEffectsInterface = f), _ ) } })(), propertyGroupFactory = (function () { return function (e, t) { return function (r) { return (r = r === void 0 ? 1 : r), r <= 0 ? e : t(r - 1) } } })(), PropertyInterface = (function () { return function (e, t) { var r = { _name: e } function o(n) { return (n = n === void 0 ? 1 : n), n <= 0 ? r : t(n - 1) } return o } })(), EffectsExpressionInterface = (function () { var e = { createEffectsInterface: t } function t(n, a) { if (n.effectsManager) { var l = [], s = n.data.ef, c, d = n.effectsManager.effectElements.length for (c = 0; c < d; c += 1) l.push(r(s[c], n.effectsManager.effectElements[c], a, n)) var u = n.data.ef || [], m = function (_) { for (c = 0, d = u.length; c < d; ) { if (_ === u[c].nm || _ === u[c].mn || _ === u[c].ix) return l[c] c += 1 } return null } return ( Object.defineProperty(m, 'numProperties', { get: function () { return u.length } }), m ) } return null } function r(n, a, l, s) { function c(_) { for (var b = n.ef, v = 0, k = b.length; v < k; ) { if (_ === b[v].nm || _ === b[v].mn || _ === b[v].ix) return b[v].ty === 5 ? u[v] : u[v]() v += 1 } throw new Error() } var d = propertyGroupFactory(c, l), u = [], m, f = n.ef.length for (m = 0; m < f; m += 1) n.ef[m].ty === 5 ? u.push( r( n.ef[m], a.effectElements[m], a.effectElements[m].propertyGroup, s ) ) : u.push(o(a.effectElements[m], n.ef[m].ty, s, d)) return ( n.mn === 'ADBE Color Control' && Object.defineProperty(c, 'color', { get: function () { return u[0]() } }), Object.defineProperties(c, { numProperties: { get: function () { return n.np } }, _name: { value: n.nm }, propertyGroup: { value: d } }), (c.enabled = n.en !== 0), (c.active = c.enabled), c ) } function o(n, a, l, s) { var c = ExpressionPropertyInterface(n.p) function d() { return a === 10 ? l.comp.compInterface(n.p.v) : c() } return ( n.p.setGroupProperty && n.p.setGroupProperty(PropertyInterface('', s)), d ) } return e })(), CompExpressionInterface = (function () { return function (e) { function t(r) { for (var o = 0, n = e.layers.length; o < n; ) { if (e.layers[o].nm === r || e.layers[o].ind === r) return e.elements[o].layerInterface o += 1 } return null } return ( Object.defineProperty(t, '_name', { value: e.data.nm }), (t.layer = t), (t.pixelAspect = 1), (t.height = e.data.h || e.globalData.compSize.h), (t.width = e.data.w || e.globalData.compSize.w), (t.pixelAspect = 1), (t.frameDuration = 1 / e.globalData.frameRate), (t.displayStartTime = 0), (t.numLayers = e.layers.length), t ) } })(), ShapePathInterface = (function () { return function (t, r, o) { var n = r.sh function a(s) { return s === 'Shape' || s === 'shape' || s === 'Path' || s === 'path' || s === 'ADBE Vector Shape' || s === 2 ? a.path : null } var l = propertyGroupFactory(a, o) return ( n.setGroupProperty(PropertyInterface('Path', l)), Object.defineProperties(a, { path: { get: function () { return n.k && n.getValue(), n } }, shape: { get: function () { return n.k && n.getValue(), n } }, _name: { value: t.nm }, ix: { value: t.ix }, propertyIndex: { value: t.ix }, mn: { value: t.mn }, propertyGroup: { value: o } }), a ) } })(), ShapeExpressionInterface = (function () { function e(b, v, k) { var g = [], x, y = b ? b.length : 0 for (x = 0; x < y; x += 1) b[x].ty === 'gr' ? g.push(r(b[x], v[x], k)) : b[x].ty === 'fl' ? g.push(o(b[x], v[x], k)) : b[x].ty === 'st' ? g.push(l(b[x], v[x], k)) : b[x].ty === 'tm' ? g.push(s(b[x], v[x], k)) : b[x].ty === 'tr' || (b[x].ty === 'el' ? g.push(d(b[x], v[x], k)) : b[x].ty === 'sr' ? g.push(u(b[x], v[x], k)) : b[x].ty === 'sh' ? g.push(ShapePathInterface(b[x], v[x], k)) : b[x].ty === 'rc' ? g.push(m(b[x], v[x], k)) : b[x].ty === 'rd' ? g.push(f(b[x], v[x], k)) : b[x].ty === 'rp' ? g.push(_(b[x], v[x], k)) : b[x].ty === 'gf' ? g.push(n(b[x], v[x], k)) : g.push(a(b[x], v[x]))) return g } function t(b, v, k) { var g, x = function (S) { for (var T = 0, A = g.length; T < A; ) { if ( g[T]._name === S || g[T].mn === S || g[T].propertyIndex === S || g[T].ix === S || g[T].ind === S ) return g[T] T += 1 } return typeof S == 'number' ? g[S - 1] : null } ;(x.propertyGroup = propertyGroupFactory(x, k)), (g = e(b.it, v.it, x.propertyGroup)), (x.numProperties = g.length) var y = c( b.it[b.it.length - 1], v.it[v.it.length - 1], x.propertyGroup ) return ( (x.transform = y), (x.propertyIndex = b.cix), (x._name = b.nm), x ) } function r(b, v, k) { var g = function (S) { switch (S) { case 'ADBE Vectors Group': case 'Contents': case 2: return g.content default: return g.transform } } g.propertyGroup = propertyGroupFactory(g, k) var x = t(b, v, g.propertyGroup), y = c( b.it[b.it.length - 1], v.it[v.it.length - 1], g.propertyGroup ) return ( (g.content = x), (g.transform = y), Object.defineProperty(g, '_name', { get: function () { return b.nm } }), (g.numProperties = b.np), (g.propertyIndex = b.ix), (g.nm = b.nm), (g.mn = b.mn), g ) } function o(b, v, k) { function g(x) { return x === 'Color' || x === 'color' ? g.color : x === 'Opacity' || x === 'opacity' ? g.opacity : null } return ( Object.defineProperties(g, { color: { get: ExpressionPropertyInterface(v.c) }, opacity: { get: ExpressionPropertyInterface(v.o) }, _name: { value: b.nm }, mn: { value: b.mn } }), v.c.setGroupProperty(PropertyInterface('Color', k)), v.o.setGroupProperty(PropertyInterface('Opacity', k)), g ) } function n(b, v, k) { function g(x) { return x === 'Start Point' || x === 'start point' ? g.startPoint : x === 'End Point' || x === 'end point' ? g.endPoint : x === 'Opacity' || x === 'opacity' ? g.opacity : null } return ( Object.defineProperties(g, { startPoint: { get: ExpressionPropertyInterface(v.s) }, endPoint: { get: ExpressionPropertyInterface(v.e) }, opacity: { get: ExpressionPropertyInterface(v.o) }, type: { get: function () { return 'a' } }, _name: { value: b.nm }, mn: { value: b.mn } }), v.s.setGroupProperty(PropertyInterface('Start Point', k)), v.e.setGroupProperty(PropertyInterface('End Point', k)), v.o.setGroupProperty(PropertyInterface('Opacity', k)), g ) } function a() { function b() { return null } return b } function l(b, v, k) { var g = propertyGroupFactory(A, k), x = propertyGroupFactory(T, g) function y($) { Object.defineProperty(T, b.d[$].nm, { get: ExpressionPropertyInterface(v.d.dataProps[$].p) }) } var w, S = b.d ? b.d.length : 0, T = {} for (w = 0; w < S; w += 1) y(w), v.d.dataProps[w].p.setGroupProperty(x) function A($) { return $ === 'Color' || $ === 'color' ? A.color : $ === 'Opacity' || $ === 'opacity' ? A.opacity : $ === 'Stroke Width' || $ === 'stroke width' ? A.strokeWidth : null } return ( Object.defineProperties(A, { color: { get: ExpressionPropertyInterface(v.c) }, opacity: { get: ExpressionPropertyInterface(v.o) }, strokeWidth: { get: ExpressionPropertyInterface(v.w) }, dash: { get: function () { return T } }, _name: { value: b.nm }, mn: { value: b.mn } }), v.c.setGroupProperty(PropertyInterface('Color', g)), v.o.setGroupProperty(PropertyInterface('Opacity', g)), v.w.setGroupProperty(PropertyInterface('Stroke Width', g)), A ) } function s(b, v, k) { function g(y) { return y === b.e.ix || y === 'End' || y === 'end' ? g.end : y === b.s.ix ? g.start : y === b.o.ix ? g.offset : null } var x = propertyGroupFactory(g, k) return ( (g.propertyIndex = b.ix), v.s.setGroupProperty(PropertyInterface('Start', x)), v.e.setGroupProperty(PropertyInterface('End', x)), v.o.setGroupProperty(PropertyInterface('Offset', x)), (g.propertyIndex = b.ix), (g.propertyGroup = k), Object.defineProperties(g, { start: { get: ExpressionPropertyInterface(v.s) }, end: { get: ExpressionPropertyInterface(v.e) }, offset: { get: ExpressionPropertyInterface(v.o) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } function c(b, v, k) { function g(y) { return b.a.ix === y || y === 'Anchor Point' ? g.anchorPoint : b.o.ix === y || y === 'Opacity' ? g.opacity : b.p.ix === y || y === 'Position' ? g.position : b.r.ix === y || y === 'Rotation' || y === 'ADBE Vector Rotation' ? g.rotation : b.s.ix === y || y === 'Scale' ? g.scale : (b.sk && b.sk.ix === y) || y === 'Skew' ? g.skew : (b.sa && b.sa.ix === y) || y === 'Skew Axis' ? g.skewAxis : null } var x = propertyGroupFactory(g, k) return ( v.transform.mProps.o.setGroupProperty( PropertyInterface('Opacity', x) ), v.transform.mProps.p.setGroupProperty( PropertyInterface('Position', x) ), v.transform.mProps.a.setGroupProperty( PropertyInterface('Anchor Point', x) ), v.transform.mProps.s.setGroupProperty( PropertyInterface('Scale', x) ), v.transform.mProps.r.setGroupProperty( PropertyInterface('Rotation', x) ), v.transform.mProps.sk && (v.transform.mProps.sk.setGroupProperty( PropertyInterface('Skew', x) ), v.transform.mProps.sa.setGroupProperty( PropertyInterface('Skew Angle', x) )), v.transform.op.setGroupProperty(PropertyInterface('Opacity', x)), Object.defineProperties(g, { opacity: { get: ExpressionPropertyInterface(v.transform.mProps.o) }, position: { get: ExpressionPropertyInterface(v.transform.mProps.p) }, anchorPoint: { get: ExpressionPropertyInterface(v.transform.mProps.a) }, scale: { get: ExpressionPropertyInterface(v.transform.mProps.s) }, rotation: { get: ExpressionPropertyInterface(v.transform.mProps.r) }, skew: { get: ExpressionPropertyInterface(v.transform.mProps.sk) }, skewAxis: { get: ExpressionPropertyInterface(v.transform.mProps.sa) }, _name: { value: b.nm } }), (g.ty = 'tr'), (g.mn = b.mn), (g.propertyGroup = k), g ) } function d(b, v, k) { function g(w) { return b.p.ix === w ? g.position : b.s.ix === w ? g.size : null } var x = propertyGroupFactory(g, k) g.propertyIndex = b.ix var y = v.sh.ty === 'tm' ? v.sh.prop : v.sh return ( y.s.setGroupProperty(PropertyInterface('Size', x)), y.p.setGroupProperty(PropertyInterface('Position', x)), Object.defineProperties(g, { size: { get: ExpressionPropertyInterface(y.s) }, position: { get: ExpressionPropertyInterface(y.p) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } function u(b, v, k) { function g(w) { return b.p.ix === w ? g.position : b.r.ix === w ? g.rotation : b.pt.ix === w ? g.points : b.or.ix === w || w === 'ADBE Vector Star Outer Radius' ? g.outerRadius : b.os.ix === w ? g.outerRoundness : b.ir && (b.ir.ix === w || w === 'ADBE Vector Star Inner Radius') ? g.innerRadius : b.is && b.is.ix === w ? g.innerRoundness : null } var x = propertyGroupFactory(g, k), y = v.sh.ty === 'tm' ? v.sh.prop : v.sh return ( (g.propertyIndex = b.ix), y.or.setGroupProperty(PropertyInterface('Outer Radius', x)), y.os.setGroupProperty(PropertyInterface('Outer Roundness', x)), y.pt.setGroupProperty(PropertyInterface('Points', x)), y.p.setGroupProperty(PropertyInterface('Position', x)), y.r.setGroupProperty(PropertyInterface('Rotation', x)), b.ir && (y.ir.setGroupProperty(PropertyInterface('Inner Radius', x)), y.is.setGroupProperty(PropertyInterface('Inner Roundness', x))), Object.defineProperties(g, { position: { get: ExpressionPropertyInterface(y.p) }, rotation: { get: ExpressionPropertyInterface(y.r) }, points: { get: ExpressionPropertyInterface(y.pt) }, outerRadius: { get: ExpressionPropertyInterface(y.or) }, outerRoundness: { get: ExpressionPropertyInterface(y.os) }, innerRadius: { get: ExpressionPropertyInterface(y.ir) }, innerRoundness: { get: ExpressionPropertyInterface(y.is) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } function m(b, v, k) { function g(w) { return b.p.ix === w ? g.position : b.r.ix === w ? g.roundness : b.s.ix === w || w === 'Size' || w === 'ADBE Vector Rect Size' ? g.size : null } var x = propertyGroupFactory(g, k), y = v.sh.ty === 'tm' ? v.sh.prop : v.sh return ( (g.propertyIndex = b.ix), y.p.setGroupProperty(PropertyInterface('Position', x)), y.s.setGroupProperty(PropertyInterface('Size', x)), y.r.setGroupProperty(PropertyInterface('Rotation', x)), Object.defineProperties(g, { position: { get: ExpressionPropertyInterface(y.p) }, roundness: { get: ExpressionPropertyInterface(y.r) }, size: { get: ExpressionPropertyInterface(y.s) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } function f(b, v, k) { function g(w) { return b.r.ix === w || w === 'Round Corners 1' ? g.radius : null } var x = propertyGroupFactory(g, k), y = v return ( (g.propertyIndex = b.ix), y.rd.setGroupProperty(PropertyInterface('Radius', x)), Object.defineProperties(g, { radius: { get: ExpressionPropertyInterface(y.rd) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } function _(b, v, k) { function g(w) { return b.c.ix === w || w === 'Copies' ? g.copies : b.o.ix === w || w === 'Offset' ? g.offset : null } var x = propertyGroupFactory(g, k), y = v return ( (g.propertyIndex = b.ix), y.c.setGroupProperty(PropertyInterface('Copies', x)), y.o.setGroupProperty(PropertyInterface('Offset', x)), Object.defineProperties(g, { copies: { get: ExpressionPropertyInterface(y.c) }, offset: { get: ExpressionPropertyInterface(y.o) }, _name: { value: b.nm } }), (g.mn = b.mn), g ) } return function (b, v, k) { var g function x(w) { if (typeof w == 'number') return (w = w === void 0 ? 1 : w), w === 0 ? k : g[w - 1] for (var S = 0, T = g.length; S < T; ) { if (g[S]._name === w) return g[S] S += 1 } return null } function y() { return k } return ( (x.propertyGroup = propertyGroupFactory(x, y)), (g = e(b, v, x.propertyGroup)), (x.numProperties = g.length), (x._name = 'Contents'), x ) } })(), TextExpressionInterface = (function () { return function (e) { var t, r function o(n) { switch (n) { case 'ADBE Text Document': return o.sourceText default: return null } } return ( Object.defineProperty(o, 'sourceText', { get: function () { e.textProperty.getValue() var a = e.textProperty.currentData.t return ( a !== t && ((e.textProperty.currentData.t = t), (r = new String(a)), (r.value = a || new String(a))), r ) } }), o ) } })(), getBlendMode = (function () { var e = { 0: 'source-over', 1: 'multiply', 2: 'screen', 3: 'overlay', 4: 'darken', 5: 'lighten', 6: 'color-dodge', 7: 'color-burn', 8: 'hard-light', 9: 'soft-light', 10: 'difference', 11: 'exclusion', 12: 'hue', 13: 'saturation', 14: 'color', 15: 'luminosity' } return function (t) { return e[t] || '' } })() function SliderEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 0, 0, r) } function AngleEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 0, 0, r) } function ColorEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 1, 0, r) } function PointEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 1, 0, r) } function LayerIndexEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 0, 0, r) } function MaskIndexEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 0, 0, r) } function CheckboxEffect(e, t, r) { this.p = PropertyFactory.getProp(t, e.v, 0, 0, r) } function NoValueEffect() { this.p = {} } function EffectsManager(e, t) { var r = e.ef || [] this.effectElements = [] var o, n = r.length, a for (o = 0; o < n; o += 1) (a = new GroupEffect(r[o], t)), this.effectElements.push(a) } function GroupEffect(e, t) { this.init(e, t) } extendPrototype([DynamicPropertyContainer], GroupEffect), (GroupEffect.prototype.getValue = GroupEffect.prototype.iterateDynamicProperties), (GroupEffect.prototype.init = function (e, t) { ;(this.data = e), (this.effectElements = []), this.initDynamicPropertyContainer(t) var r, o = this.data.ef.length, n, a = this.data.ef for (r = 0; r < o; r += 1) { switch (((n = null), a[r].ty)) { case 0: n = new SliderEffect(a[r], t, this) break case 1: n = new AngleEffect(a[r], t, this) break case 2: n = new ColorEffect(a[r], t, this) break case 3: n = new PointEffect(a[r], t, this) break case 4: case 7: n = new CheckboxEffect(a[r], t, this) break case 10: n = new LayerIndexEffect(a[r], t, this) break case 11: n = new MaskIndexEffect(a[r], t, this) break case 5: n = new EffectsManager(a[r], t) break default: n = new NoValueEffect(a[r]) break } n && this.effectElements.push(n) } }) function BaseElement() {} BaseElement.prototype = { checkMasks: function () { if (!this.data.hasMask) return !1 for (var t = 0, r = this.data.masksProperties.length; t < r; ) { if ( this.data.masksProperties[t].mode !== 'n' && this.data.masksProperties[t].cl !== !1 ) return !0 t += 1 } return !1 }, initExpressions: function () { ;(this.layerInterface = LayerExpressionInterface(this)), this.data.hasMask && this.maskManager && this.layerInterface.registerMaskInterface(this.maskManager) var t = EffectsExpressionInterface.createEffectsInterface( this, this.layerInterface ) this.layerInterface.registerEffectsInterface(t), this.data.ty === 0 || this.data.xt ? (this.compInterface = CompExpressionInterface(this)) : this.data.ty === 4 ? ((this.layerInterface.shapeInterface = ShapeExpressionInterface( this.shapesData, this.itemsData, this.layerInterface )), (this.layerInterface.content = this.layerInterface.shapeInterface)) : this.data.ty === 5 && ((this.layerInterface.textInterface = TextExpressionInterface(this)), (this.layerInterface.text = this.layerInterface.textInterface)) }, setBlendMode: function () { var t = getBlendMode(this.data.bm), r = this.baseElement || this.layerElement r.style['mix-blend-mode'] = t }, initBaseData: function (t, r, o) { ;(this.globalData = r), (this.comp = o), (this.data = t), (this.layerId = createElementID()), this.data.sr || (this.data.sr = 1), (this.effectsManager = new EffectsManager( this.data, this, this.dynamicProperties )) }, getType: function () { return this.type }, sourceRectAtTime: function () {} } function FrameElement() {} FrameElement.prototype = { initFrame: function () { ;(this._isFirstFrame = !1), (this.dynamicProperties = []), (this._mdf = !1) }, prepareProperties: function (t, r) { var o, n = this.dynamicProperties.length for (o = 0; o < n; o += 1) (r || (this._isParent && this.dynamicProperties[o].propType === 'transform')) && (this.dynamicProperties[o].getValue(), this.dynamicProperties[o]._mdf && ((this.globalData._mdf = !0), (this._mdf = !0))) }, addDynamicProperty: function (t) { this.dynamicProperties.indexOf(t) === -1 && this.dynamicProperties.push(t) } } function _typeof$2(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$2 = function (r) { return typeof r }) : (_typeof$2 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$2(e) ) } var FootageInterface = (function () { var e = function (o) { var n = '', a = o.getFootageData() function l() { return (n = ''), (a = o.getFootageData()), s } function s(c) { if (a[c]) return (n = c), (a = a[c]), _typeof$2(a) === 'object' ? s : a var d = c.indexOf(n) if (d !== -1) { var u = parseInt(c.substr(d + n.length), 10) return (a = a[u]), _typeof$2(a) === 'object' ? s : a } return '' } return l }, t = function (o) { function n(a) { return a === 'Outline' ? n.outlineInterface() : null } return (n._name = 'Outline'), (n.outlineInterface = e(o)), n } return function (r) { function o(n) { return n === 'Data' ? o.dataInterface : null } return (o._name = 'Data'), (o.dataInterface = t(r)), o } })() function FootageElement(e, t, r) { this.initFrame(), this.initRenderable(), (this.assetData = t.getAssetData(e.refId)), (this.footageData = t.imageLoader.getAsset(this.assetData)), this.initBaseData(e, t, r) } ;(FootageElement.prototype.prepareFrame = function () {}), extendPrototype( [RenderableElement, BaseElement, FrameElement], FootageElement ), (FootageElement.prototype.getBaseElement = function () { return null }), (FootageElement.prototype.renderFrame = function () {}), (FootageElement.prototype.destroy = function () {}), (FootageElement.prototype.initExpressions = function () { this.layerInterface = FootageInterface(this) }), (FootageElement.prototype.getFootageData = function () { return this.footageData }) function AudioElement(e, t, r) { this.initFrame(), this.initRenderable(), (this.assetData = t.getAssetData(e.refId)), this.initBaseData(e, t, r), (this._isPlaying = !1), (this._canPlay = !1) var o = this.globalData.getAssetsPath(this.assetData) ;(this.audio = this.globalData.audioController.createAudio(o)), (this._currentTime = 0), this.globalData.audioController.addAudio(this), (this._volumeMultiplier = 1), (this._volume = 1), (this._previousVolume = null), (this.tm = e.tm ? PropertyFactory.getProp(this, e.tm, 0, t.frameRate, this) : { _placeholder: !0 }), (this.lv = PropertyFactory.getProp( this, e.au && e.au.lv ? e.au.lv : { k: [100] }, 1, 0.01, this )) } ;(AudioElement.prototype.prepareFrame = function (e) { if ( (this.prepareRenderableFrame(e, !0), this.prepareProperties(e, !0), this.tm._placeholder) ) this._currentTime = e / this.data.sr else { var t = this.tm.v this._currentTime = t } this._volume = this.lv.v[0] var r = this._volume * this._volumeMultiplier this._previousVolume !== r && ((this._previousVolume = r), this.audio.volume(r)) }), extendPrototype( [RenderableElement, BaseElement, FrameElement], AudioElement ), (AudioElement.prototype.renderFrame = function () { this.isInRange && this._canPlay && (this._isPlaying ? (!this.audio.playing() || Math.abs( this._currentTime / this.globalData.frameRate - this.audio.seek() ) > 0.1) && this.audio.seek(this._currentTime / this.globalData.frameRate) : (this.audio.play(), this.audio.seek(this._currentTime / this.globalData.frameRate), (this._isPlaying = !0))) }), (AudioElement.prototype.show = function () {}), (AudioElement.prototype.hide = function () { this.audio.pause(), (this._isPlaying = !1) }), (AudioElement.prototype.pause = function () { this.audio.pause(), (this._isPlaying = !1), (this._canPlay = !1) }), (AudioElement.prototype.resume = function () { this._canPlay = !0 }), (AudioElement.prototype.setRate = function (e) { this.audio.rate(e) }), (AudioElement.prototype.volume = function (e) { ;(this._volumeMultiplier = e), (this._previousVolume = e * this._volume), this.audio.volume(this._previousVolume) }), (AudioElement.prototype.getBaseElement = function () { return null }), (AudioElement.prototype.destroy = function () {}), (AudioElement.prototype.sourceRectAtTime = function () {}), (AudioElement.prototype.initExpressions = function () {}) function BaseRenderer() {} ;(BaseRenderer.prototype.checkLayers = function (e) { var t, r = this.layers.length, o for (this.completeLayers = !0, t = r - 1; t >= 0; t -= 1) this.elements[t] || ((o = this.layers[t]), o.ip - o.st <= e - this.layers[t].st && o.op - o.st > e - this.layers[t].st && this.buildItem(t)), (this.completeLayers = this.elements[t] ? this.completeLayers : !1) this.checkPendingElements() }), (BaseRenderer.prototype.createItem = function (e) { switch (e.ty) { case 2: return this.createImage(e) case 0: return this.createComp(e) case 1: return this.createSolid(e) case 3: return this.createNull(e) case 4: return this.createShape(e) case 5: return this.createText(e) case 6: return this.createAudio(e) case 13: return this.createCamera(e) case 15: return this.createFootage(e) default: return this.createNull(e) } }), (BaseRenderer.prototype.createCamera = function () { throw new Error("You're using a 3d camera. Try the html renderer.") }), (BaseRenderer.prototype.createAudio = function (e) { return new AudioElement(e, this.globalData, this) }), (BaseRenderer.prototype.createFootage = function (e) { return new FootageElement(e, this.globalData, this) }), (BaseRenderer.prototype.buildAllItems = function () { var e, t = this.layers.length for (e = 0; e < t; e += 1) this.buildItem(e) this.checkPendingElements() }), (BaseRenderer.prototype.includeLayers = function (e) { this.completeLayers = !1 var t, r = e.length, o, n = this.layers.length for (t = 0; t < r; t += 1) for (o = 0; o < n; ) { if (this.layers[o].id === e[t].id) { this.layers[o] = e[t] break } o += 1 } }), (BaseRenderer.prototype.setProjectInterface = function (e) { this.globalData.projectInterface = e }), (BaseRenderer.prototype.initItems = function () { this.globalData.progressiveLoad || this.buildAllItems() }), (BaseRenderer.prototype.buildElementParenting = function (e, t, r) { for ( var o = this.elements, n = this.layers, a = 0, l = n.length; a < l; ) n[a].ind == t && (!o[a] || o[a] === !0 ? (this.buildItem(a), this.addPendingElement(e)) : (r.push(o[a]), o[a].setAsParent(), n[a].parent !== void 0 ? this.buildElementParenting(e, n[a].parent, r) : e.setHierarchy(r))), (a += 1) }), (BaseRenderer.prototype.addPendingElement = function (e) { this.pendingElements.push(e) }), (BaseRenderer.prototype.searchExtraCompositions = function (e) { var t, r = e.length for (t = 0; t < r; t += 1) if (e[t].xt) { var o = this.createComp(e[t]) o.initExpressions(), this.globalData.projectInterface.registerComposition(o) } }), (BaseRenderer.prototype.getElementByPath = function (e) { var t = e.shift(), r if (typeof t == 'number') r = this.elements[t] else { var o, n = this.elements.length for (o = 0; o < n; o += 1) if (this.elements[o].data.nm === t) { r = this.elements[o] break } } return e.length === 0 ? r : r.getElementByPath(e) }), (BaseRenderer.prototype.setupGlobalData = function (e, t) { ;(this.globalData.fontManager = new FontManager()), this.globalData.fontManager.addChars(e.chars), this.globalData.fontManager.addFonts(e.fonts, t), (this.globalData.getAssetData = this.animationItem.getAssetData.bind(this.animationItem)), (this.globalData.getAssetsPath = this.animationItem.getAssetsPath.bind(this.animationItem)), (this.globalData.imageLoader = this.animationItem.imagePreloader), (this.globalData.audioController = this.animationItem.audioController), (this.globalData.frameId = 0), (this.globalData.frameRate = e.fr), (this.globalData.nm = e.nm), (this.globalData.compSize = { w: e.w, h: e.h }) }) function TransformElement() {} TransformElement.prototype = { initTransform: function () { ;(this.finalTransform = { mProp: this.data.ks ? TransformPropertyFactory.getTransformProperty( this, this.data.ks, this ) : { o: 0 }, _matMdf: !1, _opMdf: !1, mat: new Matrix() }), this.data.ao && (this.finalTransform.mProp.autoOriented = !0), this.data.ty }, renderTransform: function () { if ( ((this.finalTransform._opMdf = this.finalTransform.mProp.o._mdf || this._isFirstFrame), (this.finalTransform._matMdf = this.finalTransform.mProp._mdf || this._isFirstFrame), this.hierarchy) ) { var t, r = this.finalTransform.mat, o = 0, n = this.hierarchy.length if (!this.finalTransform._matMdf) for (; o < n; ) { if (this.hierarchy[o].finalTransform.mProp._mdf) { this.finalTransform._matMdf = !0 break } o += 1 } if (this.finalTransform._matMdf) for ( t = this.finalTransform.mProp.v.props, r.cloneFromProps(t), o = 0; o < n; o += 1 ) (t = this.hierarchy[o].finalTransform.mProp.v.props), r.transform( t[0], t[1], t[2], t[3], t[4], t[5], t[6], t[7], t[8], t[9], t[10], t[11], t[12], t[13], t[14], t[15] ) } }, globalToLocal: function (t) { var r = [] r.push(this.finalTransform) for (var o = !0, n = this.comp; o; ) n.finalTransform ? (n.data.hasMask && r.splice(0, 0, n.finalTransform), (n = n.comp)) : (o = !1) var a, l = r.length, s for (a = 0; a < l; a += 1) (s = r[a].mat.applyToPointArray(0, 0, 0)), (t = [t[0] - s[0], t[1] - s[1], 0]) return t }, mHelper: new Matrix() } function MaskElement(e, t, r) { ;(this.data = e), (this.element = t), (this.globalData = r), (this.storedData = []), (this.masksProperties = this.data.masksProperties || []), (this.maskElement = null) var o = this.globalData.defs, n, a = this.masksProperties ? this.masksProperties.length : 0 ;(this.viewData = createSizedArray(a)), (this.solidPath = '') var l, s = this.masksProperties, c = 0, d = [], u, m, f = createElementID(), _, b, v, k, g = 'clipPath', x = 'clip-path' for (n = 0; n < a; n += 1) if ( (((s[n].mode !== 'a' && s[n].mode !== 'n') || s[n].inv || s[n].o.k !== 100 || s[n].o.x) && ((g = 'mask'), (x = 'mask')), (s[n].mode === 's' || s[n].mode === 'i') && c === 0 ? ((_ = createNS('rect')), _.setAttribute('fill', '#ffffff'), _.setAttribute('width', this.element.comp.data.w || 0), _.setAttribute('height', this.element.comp.data.h || 0), d.push(_)) : (_ = null), (l = createNS('path')), s[n].mode === 'n') ) (this.viewData[n] = { op: PropertyFactory.getProp( this.element, s[n].o, 0, 0.01, this.element ), prop: ShapePropertyFactory.getShapeProp(this.element, s[n], 3), elem: l, lastPath: '' }), o.appendChild(l) else { ;(c += 1), l.setAttribute('fill', s[n].mode === 's' ? '#000000' : '#ffffff'), l.setAttribute('clip-rule', 'nonzero') var y if ( (s[n].x.k !== 0 ? ((g = 'mask'), (x = 'mask'), (k = PropertyFactory.getProp( this.element, s[n].x, 0, null, this.element )), (y = createElementID()), (b = createNS('filter')), b.setAttribute('id', y), (v = createNS('feMorphology')), v.setAttribute('operator', 'erode'), v.setAttribute('in', 'SourceGraphic'), v.setAttribute('radius', '0'), b.appendChild(v), o.appendChild(b), l.setAttribute( 'stroke', s[n].mode === 's' ? '#000000' : '#ffffff' )) : ((v = null), (k = null)), (this.storedData[n] = { elem: l, x: k, expan: v, lastPath: '', lastOperator: '', filterId: y, lastRadius: 0 }), s[n].mode === 'i') ) { m = d.length var w = createNS('g') for (u = 0; u < m; u += 1) w.appendChild(d[u]) var S = createNS('mask') S.setAttribute('mask-type', 'alpha'), S.setAttribute('id', f + '_' + c), S.appendChild(l), o.appendChild(S), w.setAttribute( 'mask', 'url(' + getLocationHref() + '#' + f + '_' + c + ')' ), (d.length = 0), d.push(w) } else d.push(l) s[n].inv && !this.solidPath && (this.solidPath = this.createLayerSolidPath()), (this.viewData[n] = { elem: l, lastPath: '', op: PropertyFactory.getProp( this.element, s[n].o, 0, 0.01, this.element ), prop: ShapePropertyFactory.getShapeProp(this.element, s[n], 3), invRect: _ }), this.viewData[n].prop.k || this.drawPath(s[n], this.viewData[n].prop.v, this.viewData[n]) } for (this.maskElement = createNS(g), a = d.length, n = 0; n < a; n += 1) this.maskElement.appendChild(d[n]) c > 0 && (this.maskElement.setAttribute('id', f), this.element.maskedElement.setAttribute( x, 'url(' + getLocationHref() + '#' + f + ')' ), o.appendChild(this.maskElement)), this.viewData.length && this.element.addRenderableComponent(this) } ;(MaskElement.prototype.getMaskProperty = function (e) { return this.viewData[e].prop }), (MaskElement.prototype.renderFrame = function (e) { var t = this.element.finalTransform.mat, r, o = this.masksProperties.length for (r = 0; r < o; r += 1) if ( ((this.viewData[r].prop._mdf || e) && this.drawPath( this.masksProperties[r], this.viewData[r].prop.v, this.viewData[r] ), (this.viewData[r].op._mdf || e) && this.viewData[r].elem.setAttribute( 'fill-opacity', this.viewData[r].op.v ), this.masksProperties[r].mode !== 'n' && (this.viewData[r].invRect && (this.element.finalTransform.mProp._mdf || e) && this.viewData[r].invRect.setAttribute( 'transform', t.getInverseMatrix().to2dCSS() ), this.storedData[r].x && (this.storedData[r].x._mdf || e))) ) { var n = this.storedData[r].expan this.storedData[r].x.v < 0 ? (this.storedData[r].lastOperator !== 'erode' && ((this.storedData[r].lastOperator = 'erode'), this.storedData[r].elem.setAttribute( 'filter', 'url(' + getLocationHref() + '#' + this.storedData[r].filterId + ')' )), n.setAttribute('radius', -this.storedData[r].x.v)) : (this.storedData[r].lastOperator !== 'dilate' && ((this.storedData[r].lastOperator = 'dilate'), this.storedData[r].elem.setAttribute('filter', null)), this.storedData[r].elem.setAttribute( 'stroke-width', this.storedData[r].x.v * 2 )) } }), (MaskElement.prototype.getMaskelement = function () { return this.maskElement }), (MaskElement.prototype.createLayerSolidPath = function () { var e = 'M0,0 ' return ( (e += ' h' + this.globalData.compSize.w), (e += ' v' + this.globalData.compSize.h), (e += ' h-' + this.globalData.compSize.w), (e += ' v-' + this.globalData.compSize.h + ' '), e ) }), (MaskElement.prototype.drawPath = function (e, t, r) { var o = ' M' + t.v[0][0] + ',' + t.v[0][1], n, a for (a = t._length, n = 1; n < a; n += 1) o += ' C' + t.o[n - 1][0] + ',' + t.o[n - 1][1] + ' ' + t.i[n][0] + ',' + t.i[n][1] + ' ' + t.v[n][0] + ',' + t.v[n][1] if ( (t.c && a > 1 && (o += ' C' + t.o[n - 1][0] + ',' + t.o[n - 1][1] + ' ' + t.i[0][0] + ',' + t.i[0][1] + ' ' + t.v[0][0] + ',' + t.v[0][1]), r.lastPath !== o) ) { var l = '' r.elem && (t.c && (l = e.inv ? this.solidPath + o : o), r.elem.setAttribute('d', l)), (r.lastPath = o) } }), (MaskElement.prototype.destroy = function () { ;(this.element = null), (this.globalData = null), (this.maskElement = null), (this.data = null), (this.masksProperties = null) }) var filtersFactory = (function () { var e = {} ;(e.createFilter = t), (e.createAlphaToLuminanceFilter = r) function t(o, n) { var a = createNS('filter') return ( a.setAttribute('id', o), n !== !0 && (a.setAttribute('filterUnits', 'objectBoundingBox'), a.setAttribute('x', '0%'), a.setAttribute('y', '0%'), a.setAttribute('width', '100%'), a.setAttribute('height', '100%')), a ) } function r() { var o = createNS('feColorMatrix') return ( o.setAttribute('type', 'matrix'), o.setAttribute('color-interpolation-filters', 'sRGB'), o.setAttribute( 'values', '0 0 0 1 0 0 0 0 1 0 0 0 0 1 0 0 0 0 1 1' ), o ) } return e })(), featureSupport = (function () { var e = { maskType: !0 } return ( (/MSIE 10/i.test(navigator.userAgent) || /MSIE 9/i.test(navigator.userAgent) || /rv:11.0/i.test(navigator.userAgent) || /Edge\/\d./i.test(navigator.userAgent)) && (e.maskType = !1), e ) })(), registeredEffects = {}, idPrefix = 'filter_result_' function SVGEffects(e) { var t, r = 'SourceGraphic', o = e.data.ef ? e.data.ef.length : 0, n = createElementID(), a = filtersFactory.createFilter(n, !0), l = 0 this.filters = [] var s for (t = 0; t < o; t += 1) { s = null var c = e.data.ef[t].ty if (registeredEffects[c]) { var d = registeredEffects[c].effect ;(s = new d( a, e.effectsManager.effectElements[t], e, idPrefix + l, r )), (r = idPrefix + l), registeredEffects[c].countsAsEffect && (l += 1) } s && this.filters.push(s) } l && (e.globalData.defs.appendChild(a), e.layerElement.setAttribute( 'filter', 'url(' + getLocationHref() + '#' + n + ')' )), this.filters.length && e.addRenderableComponent(this) } SVGEffects.prototype.renderFrame = function (e) { var t, r = this.filters.length for (t = 0; t < r; t += 1) this.filters[t].renderFrame(e) } function registerEffect(e, t, r) { registeredEffects[e] = { effect: t, countsAsEffect: r } } function SVGBaseElement() {} SVGBaseElement.prototype = { initRendererElement: function () { this.layerElement = createNS('g') }, createContainerElements: function () { ;(this.matteElement = createNS('g')), (this.transformedElement = this.layerElement), (this.maskedElement = this.layerElement), (this._sizeChanged = !1) var t = null, r, o, n if (this.data.td) { if (this.data.td == 3 || this.data.td == 1) { var a = createNS('mask') a.setAttribute('id', this.layerId), a.setAttribute( 'mask-type', this.data.td == 3 ? 'luminance' : 'alpha' ), a.appendChild(this.layerElement), (t = a), this.globalData.defs.appendChild(a), !featureSupport.maskType && this.data.td == 1 && (a.setAttribute('mask-type', 'luminance'), (r = createElementID()), (o = filtersFactory.createFilter(r)), this.globalData.defs.appendChild(o), o.appendChild(filtersFactory.createAlphaToLuminanceFilter()), (n = createNS('g')), n.appendChild(this.layerElement), (t = n), a.appendChild(n), n.setAttribute( 'filter', 'url(' + getLocationHref() + '#' + r + ')' )) } else if (this.data.td == 2) { var l = createNS('mask') l.setAttribute('id', this.layerId), l.setAttribute('mask-type', 'alpha') var s = createNS('g') l.appendChild(s), (r = createElementID()), (o = filtersFactory.createFilter(r)) var c = createNS('feComponentTransfer') c.setAttribute('in', 'SourceGraphic'), o.appendChild(c) var d = createNS('feFuncA') d.setAttribute('type', 'table'), d.setAttribute('tableValues', '1.0 0.0'), c.appendChild(d), this.globalData.defs.appendChild(o) var u = createNS('rect') u.setAttribute('width', this.comp.data.w), u.setAttribute('height', this.comp.data.h), u.setAttribute('x', '0'), u.setAttribute('y', '0'), u.setAttribute('fill', '#ffffff'), u.setAttribute('opacity', '0'), s.setAttribute( 'filter', 'url(' + getLocationHref() + '#' + r + ')' ), s.appendChild(u), s.appendChild(this.layerElement), (t = s), featureSupport.maskType || (l.setAttribute('mask-type', 'luminance'), o.appendChild(filtersFactory.createAlphaToLuminanceFilter()), (n = createNS('g')), s.appendChild(u), n.appendChild(this.layerElement), (t = n), s.appendChild(n)), this.globalData.defs.appendChild(l) } } else this.data.tt ? (this.matteElement.appendChild(this.layerElement), (t = this.matteElement), (this.baseElement = this.matteElement)) : (this.baseElement = this.layerElement) if ( (this.data.ln && this.layerElement.setAttribute('id', this.data.ln), this.data.cl && this.layerElement.setAttribute('class', this.data.cl), this.data.ty === 0 && !this.data.hd) ) { var m = createNS('clipPath'), f = createNS('path') f.setAttribute( 'd', 'M0,0 L' + this.data.w + ',0 L' + this.data.w + ',' + this.data.h + ' L0,' + this.data.h + 'z' ) var _ = createElementID() if ( (m.setAttribute('id', _), m.appendChild(f), this.globalData.defs.appendChild(m), this.checkMasks()) ) { var b = createNS('g') b.setAttribute( 'clip-path', 'url(' + getLocationHref() + '#' + _ + ')' ), b.appendChild(this.layerElement), (this.transformedElement = b), t ? t.appendChild(this.transformedElement) : (this.baseElement = this.transformedElement) } else this.layerElement.setAttribute( 'clip-path', 'url(' + getLocationHref() + '#' + _ + ')' ) } this.data.bm !== 0 && this.setBlendMode() }, renderElement: function () { this.finalTransform._matMdf && this.transformedElement.setAttribute( 'transform', this.finalTransform.mat.to2dCSS() ), this.finalTransform._opMdf && this.transformedElement.setAttribute( 'opacity', this.finalTransform.mProp.o.v ) }, destroyBaseElement: function () { ;(this.layerElement = null), (this.matteElement = null), this.maskManager.destroy() }, getBaseElement: function () { return this.data.hd ? null : this.baseElement }, createRenderableComponents: function () { ;(this.maskManager = new MaskElement( this.data, this, this.globalData )), (this.renderableEffectsManager = new SVGEffects(this)) }, setMatte: function (t) { !this.matteElement || this.matteElement.setAttribute( 'mask', 'url(' + getLocationHref() + '#' + t + ')' ) } } function HierarchyElement() {} HierarchyElement.prototype = { initHierarchy: function () { ;(this.hierarchy = []), (this._isParent = !1), this.checkParenting() }, setHierarchy: function (t) { this.hierarchy = t }, setAsParent: function () { this._isParent = !0 }, checkParenting: function () { this.data.parent !== void 0 && this.comp.buildElementParenting(this, this.data.parent, []) } } function RenderableDOMElement() {} ;(function () { var e = { initElement: function (r, o, n) { this.initFrame(), this.initBaseData(r, o, n), this.initTransform(r, o, n), this.initHierarchy(), this.initRenderable(), this.initRendererElement(), this.createContainerElements(), this.createRenderableComponents(), this.createContent(), this.hide() }, hide: function () { if (!this.hidden && (!this.isInRange || this.isTransparent)) { var r = this.baseElement || this.layerElement ;(r.style.display = 'none'), (this.hidden = !0) } }, show: function () { if (this.isInRange && !this.isTransparent) { if (!this.data.hd) { var r = this.baseElement || this.layerElement r.style.display = 'block' } ;(this.hidden = !1), (this._isFirstFrame = !0) } }, renderFrame: function () { this.data.hd || this.hidden || (this.renderTransform(), this.renderRenderable(), this.renderElement(), this.renderInnerContent(), this._isFirstFrame && (this._isFirstFrame = !1)) }, renderInnerContent: function () {}, prepareFrame: function (r) { ;(this._mdf = !1), this.prepareRenderableFrame(r), this.prepareProperties(r, this.isInRange), this.checkTransparency() }, destroy: function () { ;(this.innerElem = null), this.destroyBaseElement() } } extendPrototype( [RenderableElement, createProxyFunction(e)], RenderableDOMElement ) })() function IImageElement(e, t, r) { ;(this.assetData = t.getAssetData(e.refId)), this.initElement(e, t, r), (this.sourceRect = { top: 0, left: 0, width: this.assetData.w, height: this.assetData.h }) } extendPrototype( [ BaseElement, TransformElement, SVGBaseElement, HierarchyElement, FrameElement, RenderableDOMElement ], IImageElement ), (IImageElement.prototype.createContent = function () { var e = this.globalData.getAssetsPath(this.assetData) ;(this.innerElem = createNS('image')), this.innerElem.setAttribute('width', this.assetData.w + 'px'), this.innerElem.setAttribute('height', this.assetData.h + 'px'), this.innerElem.setAttribute( 'preserveAspectRatio', this.assetData.pr || this.globalData.renderConfig.imagePreserveAspectRatio ), this.innerElem.setAttributeNS( 'http://www.w3.org/1999/xlink', 'href', e ), this.layerElement.appendChild(this.innerElem) }), (IImageElement.prototype.sourceRectAtTime = function () { return this.sourceRect }) function ProcessedElement(e, t) { ;(this.elem = e), (this.pos = t) } function IShapeElement() {} IShapeElement.prototype = { addShapeToModifiers: function (t) { var r, o = this.shapeModifiers.length for (r = 0; r < o; r += 1) this.shapeModifiers[r].addShape(t) }, isShapeInAnimatedModifiers: function (t) { for (var r = 0, o = this.shapeModifiers.length; r < o; ) if (this.shapeModifiers[r].isAnimatedWithShape(t)) return !0 return !1 }, renderModifiers: function () { if (!!this.shapeModifiers.length) { var t, r = this.shapes.length for (t = 0; t < r; t += 1) this.shapes[t].sh.reset() r = this.shapeModifiers.length var o for ( t = r - 1; t >= 0 && ((o = this.shapeModifiers[t].processShapes(this._isFirstFrame)), !o); t -= 1 ); } }, searchProcessedElement: function (t) { for (var r = this.processedElements, o = 0, n = r.length; o < n; ) { if (r[o].elem === t) return r[o].pos o += 1 } return 0 }, addProcessedElement: function (t, r) { for (var o = this.processedElements, n = o.length; n; ) if (((n -= 1), o[n].elem === t)) { o[n].pos = r return } o.push(new ProcessedElement(t, r)) }, prepareFrame: function (t) { this.prepareRenderableFrame(t), this.prepareProperties(t, this.isInRange) } } var lineCapEnum = { 1: 'butt', 2: 'round', 3: 'square' }, lineJoinEnum = { 1: 'miter', 2: 'round', 3: 'bevel' } function SVGShapeData(e, t, r) { ;(this.caches = []), (this.styles = []), (this.transformers = e), (this.lStr = ''), (this.sh = r), (this.lvl = t), (this._isAnimated = !!r.k) for (var o = 0, n = e.length; o < n; ) { if (e[o].mProps.dynamicProperties.length) { this._isAnimated = !0 break } o += 1 } } SVGShapeData.prototype.setAsAnimated = function () { this._isAnimated = !0 } function SVGStyleData(e, t) { ;(this.data = e), (this.type = e.ty), (this.d = ''), (this.lvl = t), (this._mdf = !1), (this.closed = e.hd === !0), (this.pElem = createNS('path')), (this.msElem = null) } SVGStyleData.prototype.reset = function () { ;(this.d = ''), (this._mdf = !1) } function DashProperty(e, t, r, o) { ;(this.elem = e), (this.frameId = -1), (this.dataProps = createSizedArray(t.length)), (this.renderer = r), (this.k = !1), (this.dashStr = ''), (this.dashArray = createTypedArray( 'float32', t.length ? t.length - 1 : 0 )), (this.dashoffset = createTypedArray('float32', 1)), this.initDynamicPropertyContainer(o) var n, a = t.length || 0, l for (n = 0; n < a; n += 1) (l = PropertyFactory.getProp(e, t[n].v, 0, 0, this)), (this.k = l.k || this.k), (this.dataProps[n] = { n: t[n].n, p: l }) this.k || this.getValue(!0), (this._isAnimated = this.k) } ;(DashProperty.prototype.getValue = function (e) { if ( !(this.elem.globalData.frameId === this.frameId && !e) && ((this.frameId = this.elem.globalData.frameId), this.iterateDynamicProperties(), (this._mdf = this._mdf || e), this._mdf) ) { var t = 0, r = this.dataProps.length for ( this.renderer === 'svg' && (this.dashStr = ''), t = 0; t < r; t += 1 ) this.dataProps[t].n !== 'o' ? this.renderer === 'svg' ? (this.dashStr += ' ' + this.dataProps[t].p.v) : (this.dashArray[t] = this.dataProps[t].p.v) : (this.dashoffset[0] = this.dataProps[t].p.v) } }), extendPrototype([DynamicPropertyContainer], DashProperty) function SVGStrokeStyleData(e, t, r) { this.initDynamicPropertyContainer(e), (this.getValue = this.iterateDynamicProperties), (this.o = PropertyFactory.getProp(e, t.o, 0, 0.01, this)), (this.w = PropertyFactory.getProp(e, t.w, 0, null, this)), (this.d = new DashProperty(e, t.d || {}, 'svg', this)), (this.c = PropertyFactory.getProp(e, t.c, 1, 255, this)), (this.style = r), (this._isAnimated = !!this._isAnimated) } extendPrototype([DynamicPropertyContainer], SVGStrokeStyleData) function SVGFillStyleData(e, t, r) { this.initDynamicPropertyContainer(e), (this.getValue = this.iterateDynamicProperties), (this.o = PropertyFactory.getProp(e, t.o, 0, 0.01, this)), (this.c = PropertyFactory.getProp(e, t.c, 1, 255, this)), (this.style = r) } extendPrototype([DynamicPropertyContainer], SVGFillStyleData) function SVGNoStyleData(e, t, r) { this.initDynamicPropertyContainer(e), (this.getValue = this.iterateDynamicProperties), (this.style = r) } extendPrototype([DynamicPropertyContainer], SVGNoStyleData) function GradientProperty(e, t, r) { ;(this.data = t), (this.c = createTypedArray('uint8c', t.p * 4)) var o = t.k.k[0].s ? t.k.k[0].s.length - t.p * 4 : t.k.k.length - t.p * 4 ;(this.o = createTypedArray('float32', o)), (this._cmdf = !1), (this._omdf = !1), (this._collapsable = this.checkCollapsable()), (this._hasOpacity = o), this.initDynamicPropertyContainer(r), (this.prop = PropertyFactory.getProp(e, t.k, 1, null, this)), (this.k = this.prop.k), this.getValue(!0) } ;(GradientProperty.prototype.comparePoints = function (e, t) { for (var r = 0, o = this.o.length / 2, n; r < o; ) { if (((n = Math.abs(e[r * 4] - e[t * 4 + r * 2])), n > 0.01)) return !1 r += 1 } return !0 }), (GradientProperty.prototype.checkCollapsable = function () { if (this.o.length / 2 !== this.c.length / 4) return !1 if (this.data.k.k[0].s) for (var e = 0, t = this.data.k.k.length; e < t; ) { if (!this.comparePoints(this.data.k.k[e].s, this.data.p)) return !1 e += 1 } else if (!this.comparePoints(this.data.k.k, this.data.p)) return !1 return !0 }), (GradientProperty.prototype.getValue = function (e) { if ( (this.prop.getValue(), (this._mdf = !1), (this._cmdf = !1), (this._omdf = !1), this.prop._mdf || e) ) { var t, r = this.data.p * 4, o, n for (t = 0; t < r; t += 1) (o = t % 4 === 0 ? 100 : 255), (n = Math.round(this.prop.v[t] * o)), this.c[t] !== n && ((this.c[t] = n), (this._cmdf = !e)) if (this.o.length) for (r = this.prop.v.length, t = this.data.p * 4; t < r; t += 1) (o = t % 2 === 0 ? 100 : 1), (n = t % 2 === 0 ? Math.round(this.prop.v[t] * 100) : this.prop.v[t]), this.o[t - this.data.p * 4] !== n && ((this.o[t - this.data.p * 4] = n), (this._omdf = !e)) this._mdf = !e } }), extendPrototype([DynamicPropertyContainer], GradientProperty) function SVGGradientFillStyleData(e, t, r) { this.initDynamicPropertyContainer(e), (this.getValue = this.iterateDynamicProperties), this.initGradientData(e, t, r) } ;(SVGGradientFillStyleData.prototype.initGradientData = function ( e, t, r ) { ;(this.o = PropertyFactory.getProp(e, t.o, 0, 0.01, this)), (this.s = PropertyFactory.getProp(e, t.s, 1, null, this)), (this.e = PropertyFactory.getProp(e, t.e, 1, null, this)), (this.h = PropertyFactory.getProp(e, t.h || { k: 0 }, 0, 0.01, this)), (this.a = PropertyFactory.getProp( e, t.a || { k: 0 }, 0, degToRads, this )), (this.g = new GradientProperty(e, t.g, this)), (this.style = r), (this.stops = []), this.setGradientData(r.pElem, t), this.setGradientOpacity(t, r), (this._isAnimated = !!this._isAnimated) }), (SVGGradientFillStyleData.prototype.setGradientData = function (e, t) { var r = createElementID(), o = createNS(t.t === 1 ? 'linearGradient' : 'radialGradient') o.setAttribute('id', r), o.setAttribute('spreadMethod', 'pad'), o.setAttribute('gradientUnits', 'userSpaceOnUse') var n = [], a, l, s for (s = t.g.p * 4, l = 0; l < s; l += 4) (a = createNS('stop')), o.appendChild(a), n.push(a) e.setAttribute( t.ty === 'gf' ? 'fill' : 'stroke', 'url(' + getLocationHref() + '#' + r + ')' ), (this.gf = o), (this.cst = n) }), (SVGGradientFillStyleData.prototype.setGradientOpacity = function ( e, t ) { if (this.g._hasOpacity && !this.g._collapsable) { var r, o, n, a = createNS('mask'), l = createNS('path') a.appendChild(l) var s = createElementID(), c = createElementID() a.setAttribute('id', c) var d = createNS(e.t === 1 ? 'linearGradient' : 'radialGradient') d.setAttribute('id', s), d.setAttribute('spreadMethod', 'pad'), d.setAttribute('gradientUnits', 'userSpaceOnUse'), (n = e.g.k.k[0].s ? e.g.k.k[0].s.length : e.g.k.k.length) var u = this.stops for (o = e.g.p * 4; o < n; o += 2) (r = createNS('stop')), r.setAttribute('stop-color', 'rgb(255,255,255)'), d.appendChild(r), u.push(r) l.setAttribute( e.ty === 'gf' ? 'fill' : 'stroke', 'url(' + getLocationHref() + '#' + s + ')' ), e.ty === 'gs' && (l.setAttribute('stroke-linecap', lineCapEnum[e.lc || 2]), l.setAttribute('stroke-linejoin', lineJoinEnum[e.lj || 2]), e.lj === 1 && l.setAttribute('stroke-miterlimit', e.ml)), (this.of = d), (this.ms = a), (this.ost = u), (this.maskId = c), (t.msElem = l) } }), extendPrototype([DynamicPropertyContainer], SVGGradientFillStyleData) function SVGGradientStrokeStyleData(e, t, r) { this.initDynamicPropertyContainer(e), (this.getValue = this.iterateDynamicProperties), (this.w = PropertyFactory.getProp(e, t.w, 0, null, this)), (this.d = new DashProperty(e, t.d || {}, 'svg', this)), this.initGradientData(e, t, r), (this._isAnimated = !!this._isAnimated) } extendPrototype( [SVGGradientFillStyleData, DynamicPropertyContainer], SVGGradientStrokeStyleData ) function ShapeGroupData() { ;(this.it = []), (this.prevViewData = []), (this.gr = createNS('g')) } function SVGTransformData(e, t, r) { ;(this.transform = { mProps: e, op: t, container: r }), (this.elements = []), (this._isAnimated = this.transform.mProps.dynamicProperties.length || this.transform.op.effectsSequence.length) } var buildShapeString = function (t, r, o, n) { if (r === 0) return '' var a = t.o, l = t.i, s = t.v, c, d = ' M' + n.applyToPointStringified(s[0][0], s[0][1]) for (c = 1; c < r; c += 1) d += ' C' + n.applyToPointStringified(a[c - 1][0], a[c - 1][1]) + ' ' + n.applyToPointStringified(l[c][0], l[c][1]) + ' ' + n.applyToPointStringified(s[c][0], s[c][1]) return ( o && r && ((d += ' C' + n.applyToPointStringified(a[c - 1][0], a[c - 1][1]) + ' ' + n.applyToPointStringified(l[0][0], l[0][1]) + ' ' + n.applyToPointStringified(s[0][0], s[0][1])), (d += 'z')), d ) }, SVGElementsRenderer = (function () { var e = new Matrix(), t = new Matrix(), r = { createRenderFunction: o } function o(m) { switch (m.ty) { case 'fl': return s case 'gf': return d case 'gs': return c case 'st': return u case 'sh': case 'el': case 'rc': case 'sr': return l case 'tr': return n case 'no': return a default: return null } } function n(m, f, _) { ;(_ || f.transform.op._mdf) && f.transform.container.setAttribute('opacity', f.transform.op.v), (_ || f.transform.mProps._mdf) && f.transform.container.setAttribute( 'transform', f.transform.mProps.v.to2dCSS() ) } function a() {} function l(m, f, _) { var b, v, k, g, x, y, w = f.styles.length, S = f.lvl, T, A, $, F, Y for (y = 0; y < w; y += 1) { if (((g = f.sh._mdf || _), f.styles[y].lvl < S)) { for ( A = t.reset(), F = S - f.styles[y].lvl, Y = f.transformers.length - 1; !g && F > 0; ) (g = f.transformers[Y].mProps._mdf || g), (F -= 1), (Y -= 1) if (g) for ( F = S - f.styles[y].lvl, Y = f.transformers.length - 1; F > 0; ) ($ = f.transformers[Y].mProps.v.props), A.transform( $[0], $[1], $[2], $[3], $[4], $[5], $[6], $[7], $[8], $[9], $[10], $[11], $[12], $[13], $[14], $[15] ), (F -= 1), (Y -= 1) } else A = e if (((T = f.sh.paths), (v = T._length), g)) { for (k = '', b = 0; b < v; b += 1) (x = T.shapes[b]), x && x._length && (k += buildShapeString(x, x._length, x.c, A)) f.caches[y] = k } else k = f.caches[y] ;(f.styles[y].d += m.hd === !0 ? '' : k), (f.styles[y]._mdf = g || f.styles[y]._mdf) } } function s(m, f, _) { var b = f.style ;(f.c._mdf || _) && b.pElem.setAttribute( 'fill', 'rgb(' + bmFloor(f.c.v[0]) + ',' + bmFloor(f.c.v[1]) + ',' + bmFloor(f.c.v[2]) + ')' ), (f.o._mdf || _) && b.pElem.setAttribute('fill-opacity', f.o.v) } function c(m, f, _) { d(m, f, _), u(m, f, _) } function d(m, f, _) { var b = f.gf, v = f.g._hasOpacity, k = f.s.v, g = f.e.v if (f.o._mdf || _) { var x = m.ty === 'gf' ? 'fill-opacity' : 'stroke-opacity' f.style.pElem.setAttribute(x, f.o.v) } if (f.s._mdf || _) { var y = m.t === 1 ? 'x1' : 'cx', w = y === 'x1' ? 'y1' : 'cy' b.setAttribute(y, k[0]), b.setAttribute(w, k[1]), v && !f.g._collapsable && (f.of.setAttribute(y, k[0]), f.of.setAttribute(w, k[1])) } var S, T, A, $ if (f.g._cmdf || _) { S = f.cst var F = f.g.c for (A = S.length, T = 0; T < A; T += 1) ($ = S[T]), $.setAttribute('offset', F[T * 4] + '%'), $.setAttribute( 'stop-color', 'rgb(' + F[T * 4 + 1] + ',' + F[T * 4 + 2] + ',' + F[T * 4 + 3] + ')' ) } if (v && (f.g._omdf || _)) { var Y = f.g.o for ( f.g._collapsable ? (S = f.cst) : (S = f.ost), A = S.length, T = 0; T < A; T += 1 ) ($ = S[T]), f.g._collapsable || $.setAttribute('offset', Y[T * 2] + '%'), $.setAttribute('stop-opacity', Y[T * 2 + 1]) } if (m.t === 1) (f.e._mdf || _) && (b.setAttribute('x2', g[0]), b.setAttribute('y2', g[1]), v && !f.g._collapsable && (f.of.setAttribute('x2', g[0]), f.of.setAttribute('y2', g[1]))) else { var ae if ( ((f.s._mdf || f.e._mdf || _) && ((ae = Math.sqrt( Math.pow(k[0] - g[0], 2) + Math.pow(k[1] - g[1], 2) )), b.setAttribute('r', ae), v && !f.g._collapsable && f.of.setAttribute('r', ae)), f.e._mdf || f.h._mdf || f.a._mdf || _) ) { ae || (ae = Math.sqrt( Math.pow(k[0] - g[0], 2) + Math.pow(k[1] - g[1], 2) )) var re = Math.atan2(g[1] - k[1], g[0] - k[0]), ie = f.h.v ie >= 1 ? (ie = 0.99) : ie <= -1 && (ie = -0.99) var oe = ae * ie, j = Math.cos(re + f.a.v) * oe + k[0], V = Math.sin(re + f.a.v) * oe + k[1] b.setAttribute('fx', j), b.setAttribute('fy', V), v && !f.g._collapsable && (f.of.setAttribute('fx', j), f.of.setAttribute('fy', V)) } } } function u(m, f, _) { var b = f.style, v = f.d v && (v._mdf || _) && v.dashStr && (b.pElem.setAttribute('stroke-dasharray', v.dashStr), b.pElem.setAttribute('stroke-dashoffset', v.dashoffset[0])), f.c && (f.c._mdf || _) && b.pElem.setAttribute( 'stroke', 'rgb(' + bmFloor(f.c.v[0]) + ',' + bmFloor(f.c.v[1]) + ',' + bmFloor(f.c.v[2]) + ')' ), (f.o._mdf || _) && b.pElem.setAttribute('stroke-opacity', f.o.v), (f.w._mdf || _) && (b.pElem.setAttribute('stroke-width', f.w.v), b.msElem && b.msElem.setAttribute('stroke-width', f.w.v)) } return r })() function SVGShapeElement(e, t, r) { ;(this.shapes = []), (this.shapesData = e.shapes), (this.stylesList = []), (this.shapeModifiers = []), (this.itemsData = []), (this.processedElements = []), (this.animatedContents = []), this.initElement(e, t, r), (this.prevViewData = []) } extendPrototype( [ BaseElement, TransformElement, SVGBaseElement, IShapeElement, HierarchyElement, FrameElement, RenderableDOMElement ], SVGShapeElement ), (SVGShapeElement.prototype.initSecondaryElement = function () {}), (SVGShapeElement.prototype.identityMatrix = new Matrix()), (SVGShapeElement.prototype.buildExpressionInterface = function () {}), (SVGShapeElement.prototype.createContent = function () { this.searchShapes( this.shapesData, this.itemsData, this.prevViewData, this.layerElement, 0, [], !0 ), this.filterUniqueShapes() }), (SVGShapeElement.prototype.filterUniqueShapes = function () { var e, t = this.shapes.length, r, o, n = this.stylesList.length, a, l = [], s = !1 for (o = 0; o < n; o += 1) { for ( a = this.stylesList[o], s = !1, l.length = 0, e = 0; e < t; e += 1 ) (r = this.shapes[e]), r.styles.indexOf(a) !== -1 && (l.push(r), (s = r._isAnimated || s)) l.length > 1 && s && this.setShapesAsAnimated(l) } }), (SVGShapeElement.prototype.setShapesAsAnimated = function (e) { var t, r = e.length for (t = 0; t < r; t += 1) e[t].setAsAnimated() }), (SVGShapeElement.prototype.createStyleElement = function (e, t) { var r, o = new SVGStyleData(e, t), n = o.pElem if (e.ty === 'st') r = new SVGStrokeStyleData(this, e, o) else if (e.ty === 'fl') r = new SVGFillStyleData(this, e, o) else if (e.ty === 'gf' || e.ty === 'gs') { var a = e.ty === 'gf' ? SVGGradientFillStyleData : SVGGradientStrokeStyleData ;(r = new a(this, e, o)), this.globalData.defs.appendChild(r.gf), r.maskId && (this.globalData.defs.appendChild(r.ms), this.globalData.defs.appendChild(r.of), n.setAttribute( 'mask', 'url(' + getLocationHref() + '#' + r.maskId + ')' )) } else e.ty === 'no' && (r = new SVGNoStyleData(this, e, o)) return ( (e.ty === 'st' || e.ty === 'gs') && (n.setAttribute('stroke-linecap', lineCapEnum[e.lc || 2]), n.setAttribute('stroke-linejoin', lineJoinEnum[e.lj || 2]), n.setAttribute('fill-opacity', '0'), e.lj === 1 && n.setAttribute('stroke-miterlimit', e.ml)), e.r === 2 && n.setAttribute('fill-rule', 'evenodd'), e.ln && n.setAttribute('id', e.ln), e.cl && n.setAttribute('class', e.cl), e.bm && (n.style['mix-blend-mode'] = getBlendMode(e.bm)), this.stylesList.push(o), this.addToAnimatedContents(e, r), r ) }), (SVGShapeElement.prototype.createGroupElement = function (e) { var t = new ShapeGroupData() return ( e.ln && t.gr.setAttribute('id', e.ln), e.cl && t.gr.setAttribute('class', e.cl), e.bm && (t.gr.style['mix-blend-mode'] = getBlendMode(e.bm)), t ) }), (SVGShapeElement.prototype.createTransformElement = function (e, t) { var r = TransformPropertyFactory.getTransformProperty(this, e, this), o = new SVGTransformData(r, r.o, t) return this.addToAnimatedContents(e, o), o }), (SVGShapeElement.prototype.createShapeElement = function (e, t, r) { var o = 4 e.ty === 'rc' ? (o = 5) : e.ty === 'el' ? (o = 6) : e.ty === 'sr' && (o = 7) var n = ShapePropertyFactory.getShapeProp(this, e, o, this), a = new SVGShapeData(t, r, n) return ( this.shapes.push(a), this.addShapeToModifiers(a), this.addToAnimatedContents(e, a), a ) }), (SVGShapeElement.prototype.addToAnimatedContents = function (e, t) { for (var r = 0, o = this.animatedContents.length; r < o; ) { if (this.animatedContents[r].element === t) return r += 1 } this.animatedContents.push({ fn: SVGElementsRenderer.createRenderFunction(e), element: t, data: e }) }), (SVGShapeElement.prototype.setElementStyles = function (e) { var t = e.styles, r, o = this.stylesList.length for (r = 0; r < o; r += 1) this.stylesList[r].closed || t.push(this.stylesList[r]) }), (SVGShapeElement.prototype.reloadShapes = function () { this._isFirstFrame = !0 var e, t = this.itemsData.length for (e = 0; e < t; e += 1) this.prevViewData[e] = this.itemsData[e] for ( this.searchShapes( this.shapesData, this.itemsData, this.prevViewData, this.layerElement, 0, [], !0 ), this.filterUniqueShapes(), t = this.dynamicProperties.length, e = 0; e < t; e += 1 ) this.dynamicProperties[e].getValue() this.renderModifiers() }), (SVGShapeElement.prototype.searchShapes = function ( e, t, r, o, n, a, l ) { var s = [].concat(a), c, d = e.length - 1, u, m, f = [], _ = [], b, v, k for (c = d; c >= 0; c -= 1) { if ( ((k = this.searchProcessedElement(e[c])), k ? (t[c] = r[k - 1]) : (e[c]._render = l), e[c].ty === 'fl' || e[c].ty === 'st' || e[c].ty === 'gf' || e[c].ty === 'gs' || e[c].ty === 'no') ) k ? (t[c].style.closed = !1) : (t[c] = this.createStyleElement(e[c], n)), e[c]._render && t[c].style.pElem.parentNode !== o && o.appendChild(t[c].style.pElem), f.push(t[c].style) else if (e[c].ty === 'gr') { if (!k) t[c] = this.createGroupElement(e[c]) else for (m = t[c].it.length, u = 0; u < m; u += 1) t[c].prevViewData[u] = t[c].it[u] this.searchShapes( e[c].it, t[c].it, t[c].prevViewData, t[c].gr, n + 1, s, l ), e[c]._render && t[c].gr.parentNode !== o && o.appendChild(t[c].gr) } else e[c].ty === 'tr' ? (k || (t[c] = this.createTransformElement(e[c], o)), (b = t[c].transform), s.push(b)) : e[c].ty === 'sh' || e[c].ty === 'rc' || e[c].ty === 'el' || e[c].ty === 'sr' ? (k || (t[c] = this.createShapeElement(e[c], s, n)), this.setElementStyles(t[c])) : e[c].ty === 'tm' || e[c].ty === 'rd' || e[c].ty === 'ms' || e[c].ty === 'pb' ? (k ? ((v = t[c]), (v.closed = !1)) : ((v = ShapeModifiers.getModifier(e[c].ty)), v.init(this, e[c]), (t[c] = v), this.shapeModifiers.push(v)), _.push(v)) : e[c].ty === 'rp' && (k ? ((v = t[c]), (v.closed = !0)) : ((v = ShapeModifiers.getModifier(e[c].ty)), (t[c] = v), v.init(this, e, c, t), this.shapeModifiers.push(v), (l = !1)), _.push(v)) this.addProcessedElement(e[c], c + 1) } for (d = f.length, c = 0; c < d; c += 1) f[c].closed = !0 for (d = _.length, c = 0; c < d; c += 1) _[c].closed = !0 }), (SVGShapeElement.prototype.renderInnerContent = function () { this.renderModifiers() var e, t = this.stylesList.length for (e = 0; e < t; e += 1) this.stylesList[e].reset() for (this.renderShape(), e = 0; e < t; e += 1) (this.stylesList[e]._mdf || this._isFirstFrame) && (this.stylesList[e].msElem && (this.stylesList[e].msElem.setAttribute( 'd', this.stylesList[e].d ), (this.stylesList[e].d = 'M0 0' + this.stylesList[e].d)), this.stylesList[e].pElem.setAttribute( 'd', this.stylesList[e].d || 'M0 0' )) }), (SVGShapeElement.prototype.renderShape = function () { var e, t = this.animatedContents.length, r for (e = 0; e < t; e += 1) (r = this.animatedContents[e]), (this._isFirstFrame || r.element._isAnimated) && r.data !== !0 && r.fn(r.data, r.element, this._isFirstFrame) }), (SVGShapeElement.prototype.destroy = function () { this.destroyBaseElement(), (this.shapesData = null), (this.itemsData = null) }) function LetterProps(e, t, r, o, n, a) { ;(this.o = e), (this.sw = t), (this.sc = r), (this.fc = o), (this.m = n), (this.p = a), (this._mdf = { o: !0, sw: !!t, sc: !!r, fc: !!o, m: !0, p: !0 }) } LetterProps.prototype.update = function (e, t, r, o, n, a) { ;(this._mdf.o = !1), (this._mdf.sw = !1), (this._mdf.sc = !1), (this._mdf.fc = !1), (this._mdf.m = !1), (this._mdf.p = !1) var l = !1 return ( this.o !== e && ((this.o = e), (this._mdf.o = !0), (l = !0)), this.sw !== t && ((this.sw = t), (this._mdf.sw = !0), (l = !0)), this.sc !== r && ((this.sc = r), (this._mdf.sc = !0), (l = !0)), this.fc !== o && ((this.fc = o), (this._mdf.fc = !0), (l = !0)), this.m !== n && ((this.m = n), (this._mdf.m = !0), (l = !0)), a.length && (this.p[0] !== a[0] || this.p[1] !== a[1] || this.p[4] !== a[4] || this.p[5] !== a[5] || this.p[12] !== a[12] || this.p[13] !== a[13]) && ((this.p = a), (this._mdf.p = !0), (l = !0)), l ) } function TextProperty(e, t) { ;(this._frameId = initialDefaultFrame), (this.pv = ''), (this.v = ''), (this.kf = !1), (this._isFirstFrame = !0), (this._mdf = !1), (this.data = t), (this.elem = e), (this.comp = this.elem.comp), (this.keysIndex = 0), (this.canResize = !1), (this.minimumFontSize = 1), (this.effectsSequence = []), (this.currentData = { ascent: 0, boxWidth: this.defaultBoxWidth, f: '', fStyle: '', fWeight: '', fc: '', j: '', justifyOffset: '', l: [], lh: 0, lineWidths: [], ls: '', of: '', s: '', sc: '', sw: 0, t: 0, tr: 0, sz: 0, ps: null, fillColorAnim: !1, strokeColorAnim: !1, strokeWidthAnim: !1, yOffset: 0, finalSize: 0, finalText: [], finalLineHeight: 0, __complete: !1 }), this.copyData(this.currentData, this.data.d.k[0].s), this.searchProperty() || this.completeTextData(this.currentData) } ;(TextProperty.prototype.defaultBoxWidth = [0, 0]), (TextProperty.prototype.copyData = function (e, t) { for (var r in t) Object.prototype.hasOwnProperty.call(t, r) && (e[r] = t[r]) return e }), (TextProperty.prototype.setCurrentData = function (e) { e.__complete || this.completeTextData(e), (this.currentData = e), (this.currentData.boxWidth = this.currentData.boxWidth || this.defaultBoxWidth), (this._mdf = !0) }), (TextProperty.prototype.searchProperty = function () { return this.searchKeyframes() }), (TextProperty.prototype.searchKeyframes = function () { return ( (this.kf = this.data.d.k.length > 1), this.kf && this.addEffect(this.getKeyframeValue.bind(this)), this.kf ) }), (TextProperty.prototype.addEffect = function (e) { this.effectsSequence.push(e), this.elem.addDynamicProperty(this) }), (TextProperty.prototype.getValue = function (e) { if ( !( (this.elem.globalData.frameId === this.frameId || !this.effectsSequence.length) && !e ) ) { this.currentData.t = this.data.d.k[this.keysIndex].s.t var t = this.currentData, r = this.keysIndex if (this.lock) { this.setCurrentData(this.currentData) return } ;(this.lock = !0), (this._mdf = !1) var o, n = this.effectsSequence.length, a = e || this.data.d.k[this.keysIndex].s for (o = 0; o < n; o += 1) r !== this.keysIndex ? (a = this.effectsSequence[o](a, a.t)) : (a = this.effectsSequence[o](this.currentData, a.t)) t !== a && this.setCurrentData(a), (this.v = this.currentData), (this.pv = this.v), (this.lock = !1), (this.frameId = this.elem.globalData.frameId) } }), (TextProperty.prototype.getKeyframeValue = function () { for ( var e = this.data.d.k, t = this.elem.comp.renderedFrame, r = 0, o = e.length; r <= o - 1 && !(r === o - 1 || e[r + 1].t > t); ) r += 1 return ( this.keysIndex !== r && (this.keysIndex = r), this.data.d.k[this.keysIndex].s ) }), (TextProperty.prototype.buildFinalText = function (e) { for (var t = [], r = 0, o = e.length, n, a, l = !1; r < o; ) (n = e.charCodeAt(r)), FontManager.isCombinedCharacter(n) ? (t[t.length - 1] += e.charAt(r)) : n >= 55296 && n <= 56319 ? ((a = e.charCodeAt(r + 1)), a >= 56320 && a <= 57343 ? (l || FontManager.isModifier(n, a) ? ((t[t.length - 1] += e.substr(r, 2)), (l = !1)) : t.push(e.substr(r, 2)), (r += 1)) : t.push(e.charAt(r))) : n > 56319 ? ((a = e.charCodeAt(r + 1)), FontManager.isZeroWidthJoiner(n, a) ? ((l = !0), (t[t.length - 1] += e.substr(r, 2)), (r += 1)) : t.push(e.charAt(r))) : FontManager.isZeroWidthJoiner(n) ? ((t[t.length - 1] += e.charAt(r)), (l = !0)) : t.push(e.charAt(r)), (r += 1) return t }), (TextProperty.prototype.completeTextData = function (e) { e.__complete = !0 var t = this.elem.globalData.fontManager, r = this.data, o = [], n, a, l, s = 0, c, d = r.m.g, u = 0, m = 0, f = 0, _ = [], b = 0, v = 0, k, g, x = t.getFontByName(e.f), y, w = 0, S = getFontProperties(x) ;(e.fWeight = S.weight), (e.fStyle = S.style), (e.finalSize = e.s), (e.finalText = this.buildFinalText(e.t)), (a = e.finalText.length), (e.finalLineHeight = e.lh) var T = (e.tr / 1e3) * e.finalSize, A if (e.sz) for (var $ = !0, F = e.sz[0], Y = e.sz[1], ae, re; $; ) { ;(re = this.buildFinalText(e.t)), (ae = 0), (b = 0), (a = re.length), (T = (e.tr / 1e3) * e.finalSize) var ie = -1 for (n = 0; n < a; n += 1) (A = re[n].charCodeAt(0)), (l = !1), re[n] === ' ' ? (ie = n) : (A === 13 || A === 3) && ((b = 0), (l = !0), (ae += e.finalLineHeight || e.finalSize * 1.2)), t.chars ? ((y = t.getCharData(re[n], x.fStyle, x.fFamily)), (w = l ? 0 : (y.w * e.finalSize) / 100)) : (w = t.measureText(re[n], e.f, e.finalSize)), b + w > F && re[n] !== ' ' ? (ie === -1 ? (a += 1) : (n = ie), (ae += e.finalLineHeight || e.finalSize * 1.2), re.splice(n, ie === n ? 1 : 0, '\r'), (ie = -1), (b = 0)) : ((b += w), (b += T)) ;(ae += (x.ascent * e.finalSize) / 100), this.canResize && e.finalSize > this.minimumFontSize && Y < ae ? ((e.finalSize -= 1), (e.finalLineHeight = (e.finalSize * e.lh) / e.s)) : ((e.finalText = re), (a = e.finalText.length), ($ = !1)) } ;(b = -T), (w = 0) var oe = 0, j for (n = 0; n < a; n += 1) if ( ((l = !1), (j = e.finalText[n]), (A = j.charCodeAt(0)), A === 13 || A === 3 ? ((oe = 0), _.push(b), (v = b > v ? b : v), (b = -2 * T), (c = ''), (l = !0), (f += 1)) : (c = j), t.chars ? ((y = t.getCharData( j, x.fStyle, t.getFontByName(e.f).fFamily )), (w = l ? 0 : (y.w * e.finalSize) / 100)) : (w = t.measureText(c, e.f, e.finalSize)), j === ' ' ? (oe += w + T) : ((b += w + T + oe), (oe = 0)), o.push({ l: w, an: w, add: u, n: l, anIndexes: [], val: c, line: f, animatorJustifyOffset: 0 }), d == 2) ) { if (((u += w), c === '' || c === ' ' || n === a - 1)) { for ((c === '' || c === ' ') && (u -= w); m <= n; ) (o[m].an = u), (o[m].ind = s), (o[m].extra = w), (m += 1) ;(s += 1), (u = 0) } } else if (d == 3) { if (((u += w), c === '' || n === a - 1)) { for (c === '' && (u -= w); m <= n; ) (o[m].an = u), (o[m].ind = s), (o[m].extra = w), (m += 1) ;(u = 0), (s += 1) } } else (o[s].ind = s), (o[s].extra = 0), (s += 1) if (((e.l = o), (v = b > v ? b : v), _.push(b), e.sz)) (e.boxWidth = e.sz[0]), (e.justifyOffset = 0) else switch (((e.boxWidth = v), e.j)) { case 1: e.justifyOffset = -e.boxWidth break case 2: e.justifyOffset = -e.boxWidth / 2 break default: e.justifyOffset = 0 } e.lineWidths = _ var V = r.a, z, M g = V.length var L, pe, ue = [] for (k = 0; k < g; k += 1) { for ( z = V[k], z.a.sc && (e.strokeColorAnim = !0), z.a.sw && (e.strokeWidthAnim = !0), (z.a.fc || z.a.fh || z.a.fs || z.a.fb) && (e.fillColorAnim = !0), pe = 0, L = z.s.b, n = 0; n < a; n += 1 ) (M = o[n]), (M.anIndexes[k] = pe), ((L == 1 && M.val !== '') || (L == 2 && M.val !== '' && M.val !== ' ') || (L == 3 && (M.n || M.val == ' ' || n == a - 1)) || (L == 4 && (M.n || n == a - 1))) && (z.s.rn === 1 && ue.push(pe), (pe += 1)) r.a[k].s.totalChars = pe var Ie = -1, Pt if (z.s.rn === 1) for (n = 0; n < a; n += 1) (M = o[n]), Ie != M.anIndexes[k] && ((Ie = M.anIndexes[k]), (Pt = ue.splice( Math.floor(Math.random() * ue.length), 1 )[0])), (M.anIndexes[k] = Pt) } ;(e.yOffset = e.finalLineHeight || e.finalSize * 1.2), (e.ls = e.ls || 0), (e.ascent = (x.ascent * e.finalSize) / 100) }), (TextProperty.prototype.updateDocumentData = function (e, t) { t = t === void 0 ? this.keysIndex : t var r = this.copyData({}, this.data.d.k[t].s) ;(r = this.copyData(r, e)), (this.data.d.k[t].s = r), this.recalculate(t), this.elem.addDynamicProperty(this) }), (TextProperty.prototype.recalculate = function (e) { var t = this.data.d.k[e].s ;(t.__complete = !1), (this.keysIndex = 0), (this._isFirstFrame = !0), this.getValue(t) }), (TextProperty.prototype.canResizeFont = function (e) { ;(this.canResize = e), this.recalculate(this.keysIndex), this.elem.addDynamicProperty(this) }), (TextProperty.prototype.setMinimumFontSize = function (e) { ;(this.minimumFontSize = Math.floor(e) || 1), this.recalculate(this.keysIndex), this.elem.addDynamicProperty(this) }) var TextSelectorProp = (function () { var e = Math.max, t = Math.min, r = Math.floor function o(a, l) { ;(this._currentTextLength = -1), (this.k = !1), (this.data = l), (this.elem = a), (this.comp = a.comp), (this.finalS = 0), (this.finalE = 0), this.initDynamicPropertyContainer(a), (this.s = PropertyFactory.getProp(a, l.s || { k: 0 }, 0, 0, this)), 'e' in l ? (this.e = PropertyFactory.getProp(a, l.e, 0, 0, this)) : (this.e = { v: 100 }), (this.o = PropertyFactory.getProp(a, l.o || { k: 0 }, 0, 0, this)), (this.xe = PropertyFactory.getProp( a, l.xe || { k: 0 }, 0, 0, this )), (this.ne = PropertyFactory.getProp( a, l.ne || { k: 0 }, 0, 0, this )), (this.sm = PropertyFactory.getProp( a, l.sm || { k: 100 }, 0, 0, this )), (this.a = PropertyFactory.getProp(a, l.a, 0, 0.01, this)), this.dynamicProperties.length || this.getValue() } ;(o.prototype = { getMult: function (l) { this._currentTextLength !== this.elem.textProperty.currentData.l.length && this.getValue() var s = 0, c = 0, d = 1, u = 1 this.ne.v > 0 ? (s = this.ne.v / 100) : (c = -this.ne.v / 100), this.xe.v > 0 ? (d = 1 - this.xe.v / 100) : (u = 1 + this.xe.v / 100) var m = BezierFactory.getBezierEasing(s, c, d, u).get, f = 0, _ = this.finalS, b = this.finalE, v = this.data.sh if (v === 2) b === _ ? (f = l >= b ? 1 : 0) : (f = e(0, t(0.5 / (b - _) + (l - _) / (b - _), 1))), (f = m(f)) else if (v === 3) b === _ ? (f = l >= b ? 0 : 1) : (f = 1 - e(0, t(0.5 / (b - _) + (l - _) / (b - _), 1))), (f = m(f)) else if (v === 4) b === _ ? (f = 0) : ((f = e(0, t(0.5 / (b - _) + (l - _) / (b - _), 1))), f < 0.5 ? (f *= 2) : (f = 1 - 2 * (f - 0.5))), (f = m(f)) else if (v === 5) { if (b === _) f = 0 else { var k = b - _ l = t(e(0, l + 0.5 - _), b - _) var g = -k / 2 + l, x = k / 2 f = Math.sqrt(1 - (g * g) / (x * x)) } f = m(f) } else v === 6 ? (b === _ ? (f = 0) : ((l = t(e(0, l + 0.5 - _), b - _)), (f = (1 + Math.cos(Math.PI + (Math.PI * 2 * l) / (b - _))) / 2)), (f = m(f))) : (l >= r(_) && (l - _ < 0 ? (f = e(0, t(t(b, 1) - (_ - l), 1))) : (f = e(0, t(b - l, 1)))), (f = m(f))) if (this.sm.v !== 100) { var y = this.sm.v * 0.01 y === 0 && (y = 1e-8) var w = 0.5 - y * 0.5 f < w ? (f = 0) : ((f = (f - w) / y), f > 1 && (f = 1)) } return f * this.a.v }, getValue: function (l) { this.iterateDynamicProperties(), (this._mdf = l || this._mdf), (this._currentTextLength = this.elem.textProperty.currentData.l.length || 0), l && this.data.r === 2 && (this.e.v = this._currentTextLength) var s = this.data.r === 2 ? 1 : 100 / this.data.totalChars, c = this.o.v / s, d = this.s.v / s + c, u = this.e.v / s + c if (d > u) { var m = d ;(d = u), (u = m) } ;(this.finalS = d), (this.finalE = u) } }), extendPrototype([DynamicPropertyContainer], o) function n(a, l, s) { return new o(a, l) } return { getTextSelectorProp: n } })() function TextAnimatorDataProperty(e, t, r) { var o = { propType: !1 }, n = PropertyFactory.getProp, a = t.a ;(this.a = { r: a.r ? n(e, a.r, 0, degToRads, r) : o, rx: a.rx ? n(e, a.rx, 0, degToRads, r) : o, ry: a.ry ? n(e, a.ry, 0, degToRads, r) : o, sk: a.sk ? n(e, a.sk, 0, degToRads, r) : o, sa: a.sa ? n(e, a.sa, 0, degToRads, r) : o, s: a.s ? n(e, a.s, 1, 0.01, r) : o, a: a.a ? n(e, a.a, 1, 0, r) : o, o: a.o ? n(e, a.o, 0, 0.01, r) : o, p: a.p ? n(e, a.p, 1, 0, r) : o, sw: a.sw ? n(e, a.sw, 0, 0, r) : o, sc: a.sc ? n(e, a.sc, 1, 0, r) : o, fc: a.fc ? n(e, a.fc, 1, 0, r) : o, fh: a.fh ? n(e, a.fh, 0, 0, r) : o, fs: a.fs ? n(e, a.fs, 0, 0.01, r) : o, fb: a.fb ? n(e, a.fb, 0, 0.01, r) : o, t: a.t ? n(e, a.t, 0, 0, r) : o }), (this.s = TextSelectorProp.getTextSelectorProp(e, t.s, r)), (this.s.t = t.s.t) } function TextAnimatorProperty(e, t, r) { ;(this._isFirstFrame = !0), (this._hasMaskedPath = !1), (this._frameId = -1), (this._textData = e), (this._renderType = t), (this._elem = r), (this._animatorsData = createSizedArray(this._textData.a.length)), (this._pathData = {}), (this._moreOptions = { alignment: {} }), (this.renderedLetters = []), (this.lettersChangedFlag = !1), this.initDynamicPropertyContainer(r) } ;(TextAnimatorProperty.prototype.searchProperties = function () { var e, t = this._textData.a.length, r, o = PropertyFactory.getProp for (e = 0; e < t; e += 1) (r = this._textData.a[e]), (this._animatorsData[e] = new TextAnimatorDataProperty( this._elem, r, this )) this._textData.p && 'm' in this._textData.p ? ((this._pathData = { a: o(this._elem, this._textData.p.a, 0, 0, this), f: o(this._elem, this._textData.p.f, 0, 0, this), l: o(this._elem, this._textData.p.l, 0, 0, this), r: o(this._elem, this._textData.p.r, 0, 0, this), p: o(this._elem, this._textData.p.p, 0, 0, this), m: this._elem.maskManager.getMaskProperty(this._textData.p.m) }), (this._hasMaskedPath = !0)) : (this._hasMaskedPath = !1), (this._moreOptions.alignment = o( this._elem, this._textData.m.a, 1, 0, this )) }), (TextAnimatorProperty.prototype.getMeasures = function (e, t) { if ( ((this.lettersChangedFlag = t), !( !this._mdf && !this._isFirstFrame && !t && (!this._hasMaskedPath || !this._pathData.m._mdf) )) ) { this._isFirstFrame = !1 var r = this._moreOptions.alignment.v, o = this._animatorsData, n = this._textData, a = this.mHelper, l = this._renderType, s = this.renderedLetters.length, c, d, u, m, f = e.l, _, b, v, k, g, x, y, w, S, T, A, $, F, Y, ae if (this._hasMaskedPath) { if ( ((ae = this._pathData.m), !this._pathData.n || this._pathData._mdf) ) { var re = ae.v this._pathData.r.v && (re = re.reverse()), (_ = { tLength: 0, segments: [] }), (m = re._length - 1) var ie for ($ = 0, u = 0; u < m; u += 1) (ie = bez.buildBezierData( re.v[u], re.v[u + 1], [re.o[u][0] - re.v[u][0], re.o[u][1] - re.v[u][1]], [ re.i[u + 1][0] - re.v[u + 1][0], re.i[u + 1][1] - re.v[u + 1][1] ] )), (_.tLength += ie.segmentLength), _.segments.push(ie), ($ += ie.segmentLength) ;(u = m), ae.v.c && ((ie = bez.buildBezierData( re.v[u], re.v[0], [re.o[u][0] - re.v[u][0], re.o[u][1] - re.v[u][1]], [re.i[0][0] - re.v[0][0], re.i[0][1] - re.v[0][1]] )), (_.tLength += ie.segmentLength), _.segments.push(ie), ($ += ie.segmentLength)), (this._pathData.pi = _) } if ( ((_ = this._pathData.pi), (b = this._pathData.f.v), (y = 0), (x = 1), (k = 0), (g = !0), (T = _.segments), b < 0 && ae.v.c) ) for ( _.tLength < Math.abs(b) && (b = -Math.abs(b) % _.tLength), y = T.length - 1, S = T[y].points, x = S.length - 1; b < 0; ) (b += S[x].partialLength), (x -= 1), x < 0 && ((y -= 1), (S = T[y].points), (x = S.length - 1)) ;(S = T[y].points), (w = S[x - 1]), (v = S[x]), (A = v.partialLength) } ;(m = f.length), (c = 0), (d = 0) var oe = e.finalSize * 1.2 * 0.714, j = !0, V, z, M, L, pe L = o.length var ue, Ie = -1, Pt, rr, _e, Oe = b, xe = y, $e = x, jt = -1, or, er, tr, D, de, Ce, Ne, Ve, Et = '', Lt = this.defaultPropsArray, Ue if (e.j === 2 || e.j === 1) { var kt = 0, qe = 0, ir = e.j === 2 ? -0.5 : -1, he = 0, At = !0 for (u = 0; u < m; u += 1) if (f[u].n) { for (kt && (kt += qe); he < u; ) (f[he].animatorJustifyOffset = kt), (he += 1) ;(kt = 0), (At = !0) } else { for (M = 0; M < L; M += 1) (V = o[M].a), V.t.propType && (At && e.j === 2 && (qe += V.t.v * ir), (z = o[M].s), (ue = z.getMult( f[u].anIndexes[M], n.a[M].s.totalChars )), ue.length ? (kt += V.t.v * ue[0] * ir) : (kt += V.t.v * ue * ir)) At = !1 } for (kt && (kt += qe); he < u; ) (f[he].animatorJustifyOffset = kt), (he += 1) } for (u = 0; u < m; u += 1) { if ((a.reset(), (or = 1), f[u].n)) (c = 0), (d += e.yOffset), (d += j ? 1 : 0), (b = Oe), (j = !1), this._hasMaskedPath && ((y = xe), (x = $e), (S = T[y].points), (w = S[x - 1]), (v = S[x]), (A = v.partialLength), (k = 0)), (Et = ''), (Ve = ''), (Ce = ''), (Ue = ''), (Lt = this.defaultPropsArray) else { if (this._hasMaskedPath) { if (jt !== f[u].line) { switch (e.j) { case 1: b += $ - e.lineWidths[f[u].line] break case 2: b += ($ - e.lineWidths[f[u].line]) / 2 break } jt = f[u].line } Ie !== f[u].ind && (f[Ie] && (b += f[Ie].extra), (b += f[u].an / 2), (Ie = f[u].ind)), (b += r[0] * f[u].an * 0.005) var nr = 0 for (M = 0; M < L; M += 1) (V = o[M].a), V.p.propType && ((z = o[M].s), (ue = z.getMult( f[u].anIndexes[M], n.a[M].s.totalChars )), ue.length ? (nr += V.p.v[0] * ue[0]) : (nr += V.p.v[0] * ue)), V.a.propType && ((z = o[M].s), (ue = z.getMult( f[u].anIndexes[M], n.a[M].s.totalChars )), ue.length ? (nr += V.a.v[0] * ue[0]) : (nr += V.a.v[0] * ue)) for ( g = !0, this._pathData.a.v && ((b = f[0].an * 0.5 + (($ - this._pathData.f.v - f[0].an * 0.5 - f[f.length - 1].an * 0.5) * Ie) / (m - 1)), (b += this._pathData.f.v)); g; ) k + A >= b + nr || !S ? ((F = (b + nr - k) / v.partialLength), (rr = w.point[0] + (v.point[0] - w.point[0]) * F), (_e = w.point[1] + (v.point[1] - w.point[1]) * F), a.translate( -r[0] * f[u].an * 0.005, -(r[1] * oe) * 0.01 ), (g = !1)) : S && ((k += v.partialLength), (x += 1), x >= S.length && ((x = 0), (y += 1), T[y] ? (S = T[y].points) : ae.v.c ? ((x = 0), (y = 0), (S = T[y].points)) : ((k -= v.partialLength), (S = null))), S && ((w = v), (v = S[x]), (A = v.partialLength))) ;(Pt = f[u].an / 2 - f[u].add), a.translate(-Pt, 0, 0) } else (Pt = f[u].an / 2 - f[u].add), a.translate(-Pt, 0, 0), a.translate(-r[0] * f[u].an * 0.005, -r[1] * oe * 0.01, 0) for (M = 0; M < L; M += 1) (V = o[M].a), V.t.propType && ((z = o[M].s), (ue = z.getMult(f[u].anIndexes[M], n.a[M].s.totalChars)), (c !== 0 || e.j !== 0) && (this._hasMaskedPath ? ue.length ? (b += V.t.v * ue[0]) : (b += V.t.v * ue) : ue.length ? (c += V.t.v * ue[0]) : (c += V.t.v * ue))) for ( e.strokeWidthAnim && (tr = e.sw || 0), e.strokeColorAnim && (e.sc ? (er = [e.sc[0], e.sc[1], e.sc[2]]) : (er = [0, 0, 0])), e.fillColorAnim && e.fc && (D = [e.fc[0], e.fc[1], e.fc[2]]), M = 0; M < L; M += 1 ) (V = o[M].a), V.a.propType && ((z = o[M].s), (ue = z.getMult(f[u].anIndexes[M], n.a[M].s.totalChars)), ue.length ? a.translate( -V.a.v[0] * ue[0], -V.a.v[1] * ue[1], V.a.v[2] * ue[2] ) : a.translate( -V.a.v[0] * ue, -V.a.v[1] * ue, V.a.v[2] * ue )) for (M = 0; M < L; M += 1) (V = o[M].a), V.s.propType && ((z = o[M].s), (ue = z.getMult(f[u].anIndexes[M], n.a[M].s.totalChars)), ue.length ? a.scale( 1 + (V.s.v[0] - 1) * ue[0], 1 + (V.s.v[1] - 1) * ue[1], 1 ) : a.scale( 1 + (V.s.v[0] - 1) * ue, 1 + (V.s.v[1] - 1) * ue, 1 )) for (M = 0; M < L; M += 1) { if ( ((V = o[M].a), (z = o[M].s), (ue = z.getMult(f[u].anIndexes[M], n.a[M].s.totalChars)), V.sk.propType && (ue.length ? a.skewFromAxis(-V.sk.v * ue[0], V.sa.v * ue[1]) : a.skewFromAxis(-V.sk.v * ue, V.sa.v * ue)), V.r.propType && (ue.length ? a.rotateZ(-V.r.v * ue[2]) : a.rotateZ(-V.r.v * ue)), V.ry.propType && (ue.length ? a.rotateY(V.ry.v * ue[1]) : a.rotateY(V.ry.v * ue)), V.rx.propType && (ue.length ? a.rotateX(V.rx.v * ue[0]) : a.rotateX(V.rx.v * ue)), V.o.propType && (ue.length ? (or += (V.o.v * ue[0] - or) * ue[0]) : (or += (V.o.v * ue - or) * ue)), e.strokeWidthAnim && V.sw.propType && (ue.length ? (tr += V.sw.v * ue[0]) : (tr += V.sw.v * ue)), e.strokeColorAnim && V.sc.propType) ) for (de = 0; de < 3; de += 1) ue.length ? (er[de] += (V.sc.v[de] - er[de]) * ue[0]) : (er[de] += (V.sc.v[de] - er[de]) * ue) if (e.fillColorAnim && e.fc) { if (V.fc.propType) for (de = 0; de < 3; de += 1) ue.length ? (D[de] += (V.fc.v[de] - D[de]) * ue[0]) : (D[de] += (V.fc.v[de] - D[de]) * ue) V.fh.propType && (ue.length ? (D = addHueToRGB(D, V.fh.v * ue[0])) : (D = addHueToRGB(D, V.fh.v * ue))), V.fs.propType && (ue.length ? (D = addSaturationToRGB(D, V.fs.v * ue[0])) : (D = addSaturationToRGB(D, V.fs.v * ue))), V.fb.propType && (ue.length ? (D = addBrightnessToRGB(D, V.fb.v * ue[0])) : (D = addBrightnessToRGB(D, V.fb.v * ue))) } } for (M = 0; M < L; M += 1) (V = o[M].a), V.p.propType && ((z = o[M].s), (ue = z.getMult(f[u].anIndexes[M], n.a[M].s.totalChars)), this._hasMaskedPath ? ue.length ? a.translate(0, V.p.v[1] * ue[0], -V.p.v[2] * ue[1]) : a.translate(0, V.p.v[1] * ue, -V.p.v[2] * ue) : ue.length ? a.translate( V.p.v[0] * ue[0], V.p.v[1] * ue[1], -V.p.v[2] * ue[2] ) : a.translate( V.p.v[0] * ue, V.p.v[1] * ue, -V.p.v[2] * ue )) if ( (e.strokeWidthAnim && (Ce = tr < 0 ? 0 : tr), e.strokeColorAnim && (Ne = 'rgb(' + Math.round(er[0] * 255) + ',' + Math.round(er[1] * 255) + ',' + Math.round(er[2] * 255) + ')'), e.fillColorAnim && e.fc && (Ve = 'rgb(' + Math.round(D[0] * 255) + ',' + Math.round(D[1] * 255) + ',' + Math.round(D[2] * 255) + ')'), this._hasMaskedPath) ) { if ( (a.translate(0, -e.ls), a.translate(0, r[1] * oe * 0.01 + d, 0), this._pathData.p.v) ) { Y = (v.point[1] - w.point[1]) / (v.point[0] - w.point[0]) var cr = (Math.atan(Y) * 180) / Math.PI v.point[0] < w.point[0] && (cr += 180), a.rotate((-cr * Math.PI) / 180) } a.translate(rr, _e, 0), (b -= r[0] * f[u].an * 0.005), f[u + 1] && Ie !== f[u + 1].ind && ((b += f[u].an / 2), (b += e.tr * 0.001 * e.finalSize)) } else { switch ( (a.translate(c, d, 0), e.ps && a.translate(e.ps[0], e.ps[1] + e.ascent, 0), e.j) ) { case 1: a.translate( f[u].animatorJustifyOffset + e.justifyOffset + (e.boxWidth - e.lineWidths[f[u].line]), 0, 0 ) break case 2: a.translate( f[u].animatorJustifyOffset + e.justifyOffset + (e.boxWidth - e.lineWidths[f[u].line]) / 2, 0, 0 ) break } a.translate(0, -e.ls), a.translate(Pt, 0, 0), a.translate(r[0] * f[u].an * 0.005, r[1] * oe * 0.01, 0), (c += f[u].l + e.tr * 0.001 * e.finalSize) } l === 'html' ? (Et = a.toCSS()) : l === 'svg' ? (Et = a.to2dCSS()) : (Lt = [ a.props[0], a.props[1], a.props[2], a.props[3], a.props[4], a.props[5], a.props[6], a.props[7], a.props[8], a.props[9], a.props[10], a.props[11], a.props[12], a.props[13], a.props[14], a.props[15] ]), (Ue = or) } s <= u ? ((pe = new LetterProps(Ue, Ce, Ne, Ve, Et, Lt)), this.renderedLetters.push(pe), (s += 1), (this.lettersChangedFlag = !0)) : ((pe = this.renderedLetters[u]), (this.lettersChangedFlag = pe.update(Ue, Ce, Ne, Ve, Et, Lt) || this.lettersChangedFlag)) } } }), (TextAnimatorProperty.prototype.getValue = function () { this._elem.globalData.frameId !== this._frameId && ((this._frameId = this._elem.globalData.frameId), this.iterateDynamicProperties()) }), (TextAnimatorProperty.prototype.mHelper = new Matrix()), (TextAnimatorProperty.prototype.defaultPropsArray = []), extendPrototype([DynamicPropertyContainer], TextAnimatorProperty) function ITextElement() {} ;(ITextElement.prototype.initElement = function (e, t, r) { ;(this.lettersChangedFlag = !0), this.initFrame(), this.initBaseData(e, t, r), (this.textProperty = new TextProperty( this, e.t, this.dynamicProperties )), (this.textAnimator = new TextAnimatorProperty( e.t, this.renderType, this )), this.initTransform(e, t, r), this.initHierarchy(), this.initRenderable(), this.initRendererElement(), this.createContainerElements(), this.createRenderableComponents(), this.createContent(), this.hide(), this.textAnimator.searchProperties(this.dynamicProperties) }), (ITextElement.prototype.prepareFrame = function (e) { ;(this._mdf = !1), this.prepareRenderableFrame(e), this.prepareProperties(e, this.isInRange), (this.textProperty._mdf || this.textProperty._isFirstFrame) && (this.buildNewText(), (this.textProperty._isFirstFrame = !1), (this.textProperty._mdf = !1)) }), (ITextElement.prototype.createPathShape = function (e, t) { var r, o = t.length, n, a = '' for (r = 0; r < o; r += 1) t[r].ty === 'sh' && ((n = t[r].ks.k), (a += buildShapeString(n, n.i.length, !0, e))) return a }), (ITextElement.prototype.updateDocumentData = function (e, t) { this.textProperty.updateDocumentData(e, t) }), (ITextElement.prototype.canResizeFont = function (e) { this.textProperty.canResizeFont(e) }), (ITextElement.prototype.setMinimumFontSize = function (e) { this.textProperty.setMinimumFontSize(e) }), (ITextElement.prototype.applyTextPropertiesToMatrix = function ( e, t, r, o, n ) { switch ( (e.ps && t.translate(e.ps[0], e.ps[1] + e.ascent, 0), t.translate(0, -e.ls, 0), e.j) ) { case 1: t.translate( e.justifyOffset + (e.boxWidth - e.lineWidths[r]), 0, 0 ) break case 2: t.translate( e.justifyOffset + (e.boxWidth - e.lineWidths[r]) / 2, 0, 0 ) break } t.translate(o, n, 0) }), (ITextElement.prototype.buildColor = function (e) { return ( 'rgb(' + Math.round(e[0] * 255) + ',' + Math.round(e[1] * 255) + ',' + Math.round(e[2] * 255) + ')' ) }), (ITextElement.prototype.emptyProp = new LetterProps()), (ITextElement.prototype.destroy = function () {}) var emptyShapeData = { shapes: [] } function SVGTextLottieElement(e, t, r) { ;(this.textSpans = []), (this.renderType = 'svg'), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, SVGBaseElement, HierarchyElement, FrameElement, RenderableDOMElement, ITextElement ], SVGTextLottieElement ), (SVGTextLottieElement.prototype.createContent = function () { this.data.singleShape && !this.globalData.fontManager.chars && (this.textContainer = createNS('text')) }), (SVGTextLottieElement.prototype.buildTextContents = function (e) { for (var t = 0, r = e.length, o = [], n = ''; t < r; ) e[t] === String.fromCharCode(13) || e[t] === String.fromCharCode(3) ? (o.push(n), (n = '')) : (n += e[t]), (t += 1) return o.push(n), o }), (SVGTextLottieElement.prototype.buildShapeData = function (e, t) { if (e.shapes && e.shapes.length) { var r = e.shapes[0] if (r.it) { var o = r.it[r.it.length - 1] o.s && ((o.s.k[0] = t), (o.s.k[1] = t)) } } return e }), (SVGTextLottieElement.prototype.buildNewText = function () { this.addDynamicProperty(this) var e, t, r = this.textProperty.currentData ;(this.renderedLetters = createSizedArray(r ? r.l.length : 0)), r.fc ? this.layerElement.setAttribute('fill', this.buildColor(r.fc)) : this.layerElement.setAttribute('fill', 'rgba(0,0,0,0)'), r.sc && (this.layerElement.setAttribute('stroke', this.buildColor(r.sc)), this.layerElement.setAttribute('stroke-width', r.sw)), this.layerElement.setAttribute('font-size', r.finalSize) var o = this.globalData.fontManager.getFontByName(r.f) if (o.fClass) this.layerElement.setAttribute('class', o.fClass) else { this.layerElement.setAttribute('font-family', o.fFamily) var n = r.fWeight, a = r.fStyle this.layerElement.setAttribute('font-style', a), this.layerElement.setAttribute('font-weight', n) } this.layerElement.setAttribute('aria-label', r.t) var l = r.l || [], s = !!this.globalData.fontManager.chars t = l.length var c, d = this.mHelper, u = '', m = this.data.singleShape, f = 0, _ = 0, b = !0, v = r.tr * 0.001 * r.finalSize if (m && !s && !r.sz) { var k = this.textContainer, g = 'start' switch (r.j) { case 1: g = 'end' break case 2: g = 'middle' break default: g = 'start' break } k.setAttribute('text-anchor', g), k.setAttribute('letter-spacing', v) var x = this.buildTextContents(r.finalText) for ( t = x.length, _ = r.ps ? r.ps[1] + r.ascent : 0, e = 0; e < t; e += 1 ) (c = this.textSpans[e].span || createNS('tspan')), (c.textContent = x[e]), c.setAttribute('x', 0), c.setAttribute('y', _), (c.style.display = 'inherit'), k.appendChild(c), this.textSpans[e] || (this.textSpans[e] = { span: null, glyph: null }), (this.textSpans[e].span = c), (_ += r.finalLineHeight) this.layerElement.appendChild(k) } else { var y = this.textSpans.length, w for (e = 0; e < t; e += 1) { if ( (this.textSpans[e] || (this.textSpans[e] = { span: null, childSpan: null, glyph: null }), !s || !m || e === 0) ) { if ( ((c = y > e ? this.textSpans[e].span : createNS(s ? 'g' : 'text')), y <= e) ) { if ( (c.setAttribute('stroke-linecap', 'butt'), c.setAttribute('stroke-linejoin', 'round'), c.setAttribute('stroke-miterlimit', '4'), (this.textSpans[e].span = c), s) ) { var S = createNS('g') c.appendChild(S), (this.textSpans[e].childSpan = S) } ;(this.textSpans[e].span = c), this.layerElement.appendChild(c) } c.style.display = 'inherit' } if ( (d.reset(), m && (l[e].n && ((f = -v), (_ += r.yOffset), (_ += b ? 1 : 0), (b = !1)), this.applyTextPropertiesToMatrix(r, d, l[e].line, f, _), (f += l[e].l || 0), (f += v)), s) ) { w = this.globalData.fontManager.getCharData( r.finalText[e], o.fStyle, this.globalData.fontManager.getFontByName(r.f).fFamily ) var T if (w.t === 1) T = new SVGCompElement(w.data, this.globalData, this) else { var A = emptyShapeData w.data && w.data.shapes && (A = this.buildShapeData(w.data, r.finalSize)), (T = new SVGShapeElement(A, this.globalData, this)) } if (this.textSpans[e].glyph) { var $ = this.textSpans[e].glyph this.textSpans[e].childSpan.removeChild($.layerElement), $.destroy() } ;(this.textSpans[e].glyph = T), (T._debug = !0), T.prepareFrame(0), T.renderFrame(), this.textSpans[e].childSpan.appendChild(T.layerElement), w.t === 1 && this.textSpans[e].childSpan.setAttribute( 'transform', 'scale(' + r.finalSize / 100 + ',' + r.finalSize / 100 + ')' ) } else m && c.setAttribute( 'transform', 'translate(' + d.props[12] + ',' + d.props[13] + ')' ), (c.textContent = l[e].val), c.setAttributeNS( 'http://www.w3.org/XML/1998/namespace', 'xml:space', 'preserve' ) } m && c && c.setAttribute('d', u) } for (; e < this.textSpans.length; ) (this.textSpans[e].span.style.display = 'none'), (e += 1) this._sizeChanged = !0 }), (SVGTextLottieElement.prototype.sourceRectAtTime = function () { if ( (this.prepareFrame(this.comp.renderedFrame - this.data.st), this.renderInnerContent(), this._sizeChanged) ) { this._sizeChanged = !1 var e = this.layerElement.getBBox() this.bbox = { top: e.y, left: e.x, width: e.width, height: e.height } } return this.bbox }), (SVGTextLottieElement.prototype.getValue = function () { var e, t = this.textSpans.length, r for ( this.renderedFrame = this.comp.renderedFrame, e = 0; e < t; e += 1 ) (r = this.textSpans[e].glyph), r && (r.prepareFrame(this.comp.renderedFrame - this.data.st), r._mdf && (this._mdf = !0)) }), (SVGTextLottieElement.prototype.renderInnerContent = function () { if ( (!this.data.singleShape || this._mdf) && (this.textAnimator.getMeasures( this.textProperty.currentData, this.lettersChangedFlag ), this.lettersChangedFlag || this.textAnimator.lettersChangedFlag) ) { this._sizeChanged = !0 var e, t, r = this.textAnimator.renderedLetters, o = this.textProperty.currentData.l t = o.length var n, a, l for (e = 0; e < t; e += 1) o[e].n || ((n = r[e]), (a = this.textSpans[e].span), (l = this.textSpans[e].glyph), l && l.renderFrame(), n._mdf.m && a.setAttribute('transform', n.m), n._mdf.o && a.setAttribute('opacity', n.o), n._mdf.sw && a.setAttribute('stroke-width', n.sw), n._mdf.sc && a.setAttribute('stroke', n.sc), n._mdf.fc && a.setAttribute('fill', n.fc)) } }) function ISolidElement(e, t, r) { this.initElement(e, t, r) } extendPrototype([IImageElement], ISolidElement), (ISolidElement.prototype.createContent = function () { var e = createNS('rect') e.setAttribute('width', this.data.sw), e.setAttribute('height', this.data.sh), e.setAttribute('fill', this.data.sc), this.layerElement.appendChild(e) }) function NullElement(e, t, r) { this.initFrame(), this.initBaseData(e, t, r), this.initFrame(), this.initTransform(e, t, r), this.initHierarchy() } ;(NullElement.prototype.prepareFrame = function (e) { this.prepareProperties(e, !0) }), (NullElement.prototype.renderFrame = function () {}), (NullElement.prototype.getBaseElement = function () { return null }), (NullElement.prototype.destroy = function () {}), (NullElement.prototype.sourceRectAtTime = function () {}), (NullElement.prototype.hide = function () {}), extendPrototype( [BaseElement, TransformElement, HierarchyElement, FrameElement], NullElement ) function SVGRendererBase() {} extendPrototype([BaseRenderer], SVGRendererBase), (SVGRendererBase.prototype.createNull = function (e) { return new NullElement(e, this.globalData, this) }), (SVGRendererBase.prototype.createShape = function (e) { return new SVGShapeElement(e, this.globalData, this) }), (SVGRendererBase.prototype.createText = function (e) { return new SVGTextLottieElement(e, this.globalData, this) }), (SVGRendererBase.prototype.createImage = function (e) { return new IImageElement(e, this.globalData, this) }), (SVGRendererBase.prototype.createSolid = function (e) { return new ISolidElement(e, this.globalData, this) }), (SVGRendererBase.prototype.configAnimation = function (e) { this.svgElement.setAttribute('xmlns', 'http://www.w3.org/2000/svg'), this.renderConfig.viewBoxSize ? this.svgElement.setAttribute( 'viewBox', this.renderConfig.viewBoxSize ) : this.svgElement.setAttribute( 'viewBox', '0 0 ' + e.w + ' ' + e.h ), this.renderConfig.viewBoxOnly || (this.svgElement.setAttribute('width', e.w), this.svgElement.setAttribute('height', e.h), (this.svgElement.style.width = '100%'), (this.svgElement.style.height = '100%'), (this.svgElement.style.transform = 'translate3d(0,0,0)'), (this.svgElement.style.contentVisibility = this.renderConfig.contentVisibility)), this.renderConfig.width && this.svgElement.setAttribute('width', this.renderConfig.width), this.renderConfig.height && this.svgElement.setAttribute('height', this.renderConfig.height), this.renderConfig.className && this.svgElement.setAttribute( 'class', this.renderConfig.className ), this.renderConfig.id && this.svgElement.setAttribute('id', this.renderConfig.id), this.renderConfig.focusable !== void 0 && this.svgElement.setAttribute( 'focusable', this.renderConfig.focusable ), this.svgElement.setAttribute( 'preserveAspectRatio', this.renderConfig.preserveAspectRatio ), this.animationItem.wrapper.appendChild(this.svgElement) var t = this.globalData.defs this.setupGlobalData(e, t), (this.globalData.progressiveLoad = this.renderConfig.progressiveLoad), (this.data = e) var r = createNS('clipPath'), o = createNS('rect') o.setAttribute('width', e.w), o.setAttribute('height', e.h), o.setAttribute('x', 0), o.setAttribute('y', 0) var n = createElementID() r.setAttribute('id', n), r.appendChild(o), this.layerElement.setAttribute( 'clip-path', 'url(' + getLocationHref() + '#' + n + ')' ), t.appendChild(r), (this.layers = e.layers), (this.elements = createSizedArray(e.layers.length)) }), (SVGRendererBase.prototype.destroy = function () { this.animationItem.wrapper && (this.animationItem.wrapper.innerText = ''), (this.layerElement = null), (this.globalData.defs = null) var e, t = this.layers ? this.layers.length : 0 for (e = 0; e < t; e += 1) this.elements[e] && this.elements[e].destroy() ;(this.elements.length = 0), (this.destroyed = !0), (this.animationItem = null) }), (SVGRendererBase.prototype.updateContainerSize = function () {}), (SVGRendererBase.prototype.buildItem = function (e) { var t = this.elements if (!(t[e] || this.layers[e].ty === 99)) { t[e] = !0 var r = this.createItem(this.layers[e]) ;(t[e] = r), getExpressionsPlugin() && (this.layers[e].ty === 0 && this.globalData.projectInterface.registerComposition(r), r.initExpressions()), this.appendElementInPos(r, e), this.layers[e].tt && (!this.elements[e - 1] || this.elements[e - 1] === !0 ? (this.buildItem(e - 1), this.addPendingElement(r)) : r.setMatte(t[e - 1].layerId)) } }), (SVGRendererBase.prototype.checkPendingElements = function () { for (; this.pendingElements.length; ) { var e = this.pendingElements.pop() if ((e.checkParenting(), e.data.tt)) for (var t = 0, r = this.elements.length; t < r; ) { if (this.elements[t] === e) { e.setMatte(this.elements[t - 1].layerId) break } t += 1 } } }), (SVGRendererBase.prototype.renderFrame = function (e) { if (!(this.renderedFrame === e || this.destroyed)) { e === null ? (e = this.renderedFrame) : (this.renderedFrame = e), (this.globalData.frameNum = e), (this.globalData.frameId += 1), (this.globalData.projectInterface.currentFrame = e), (this.globalData._mdf = !1) var t, r = this.layers.length for ( this.completeLayers || this.checkLayers(e), t = r - 1; t >= 0; t -= 1 ) (this.completeLayers || this.elements[t]) && this.elements[t].prepareFrame(e - this.layers[t].st) if (this.globalData._mdf) for (t = 0; t < r; t += 1) (this.completeLayers || this.elements[t]) && this.elements[t].renderFrame() } }), (SVGRendererBase.prototype.appendElementInPos = function (e, t) { var r = e.getBaseElement() if (!!r) { for (var o = 0, n; o < t; ) this.elements[o] && this.elements[o] !== !0 && this.elements[o].getBaseElement() && (n = this.elements[o].getBaseElement()), (o += 1) n ? this.layerElement.insertBefore(r, n) : this.layerElement.appendChild(r) } }), (SVGRendererBase.prototype.hide = function () { this.layerElement.style.display = 'none' }), (SVGRendererBase.prototype.show = function () { this.layerElement.style.display = 'block' }) function ICompElement() {} extendPrototype( [ BaseElement, TransformElement, HierarchyElement, FrameElement, RenderableDOMElement ], ICompElement ), (ICompElement.prototype.initElement = function (e, t, r) { this.initFrame(), this.initBaseData(e, t, r), this.initTransform(e, t, r), this.initRenderable(), this.initHierarchy(), this.initRendererElement(), this.createContainerElements(), this.createRenderableComponents(), (this.data.xt || !t.progressiveLoad) && this.buildAllItems(), this.hide() }), (ICompElement.prototype.prepareFrame = function (e) { if ( ((this._mdf = !1), this.prepareRenderableFrame(e), this.prepareProperties(e, this.isInRange), !(!this.isInRange && !this.data.xt)) ) { if (this.tm._placeholder) this.renderedFrame = e / this.data.sr else { var t = this.tm.v t === this.data.op && (t = this.data.op - 1), (this.renderedFrame = t) } var r, o = this.elements.length for ( this.completeLayers || this.checkLayers(this.renderedFrame), r = o - 1; r >= 0; r -= 1 ) (this.completeLayers || this.elements[r]) && (this.elements[r].prepareFrame( this.renderedFrame - this.layers[r].st ), this.elements[r]._mdf && (this._mdf = !0)) } }), (ICompElement.prototype.renderInnerContent = function () { var e, t = this.layers.length for (e = 0; e < t; e += 1) (this.completeLayers || this.elements[e]) && this.elements[e].renderFrame() }), (ICompElement.prototype.setElements = function (e) { this.elements = e }), (ICompElement.prototype.getElements = function () { return this.elements }), (ICompElement.prototype.destroyElements = function () { var e, t = this.layers.length for (e = 0; e < t; e += 1) this.elements[e] && this.elements[e].destroy() }), (ICompElement.prototype.destroy = function () { this.destroyElements(), this.destroyBaseElement() }) function SVGCompElement(e, t, r) { ;(this.layers = e.layers), (this.supports3d = !0), (this.completeLayers = !1), (this.pendingElements = []), (this.elements = this.layers ? createSizedArray(this.layers.length) : []), this.initElement(e, t, r), (this.tm = e.tm ? PropertyFactory.getProp(this, e.tm, 0, t.frameRate, this) : { _placeholder: !0 }) } extendPrototype( [SVGRendererBase, ICompElement, SVGBaseElement], SVGCompElement ), (SVGCompElement.prototype.createComp = function (e) { return new SVGCompElement(e, this.globalData, this) }) function SVGRenderer(e, t) { ;(this.animationItem = e), (this.layers = null), (this.renderedFrame = -1), (this.svgElement = createNS('svg')) var r = '' if (t && t.title) { var o = createNS('title'), n = createElementID() o.setAttribute('id', n), (o.textContent = t.title), this.svgElement.appendChild(o), (r += n) } if (t && t.description) { var a = createNS('desc'), l = createElementID() a.setAttribute('id', l), (a.textContent = t.description), this.svgElement.appendChild(a), (r += ' ' + l) } r && this.svgElement.setAttribute('aria-labelledby', r) var s = createNS('defs') this.svgElement.appendChild(s) var c = createNS('g') this.svgElement.appendChild(c), (this.layerElement = c), (this.renderConfig = { preserveAspectRatio: (t && t.preserveAspectRatio) || 'xMidYMid meet', imagePreserveAspectRatio: (t && t.imagePreserveAspectRatio) || 'xMidYMid slice', contentVisibility: (t && t.contentVisibility) || 'visible', progressiveLoad: (t && t.progressiveLoad) || !1, hideOnTransparent: !(t && t.hideOnTransparent === !1), viewBoxOnly: (t && t.viewBoxOnly) || !1, viewBoxSize: (t && t.viewBoxSize) || !1, className: (t && t.className) || '', id: (t && t.id) || '', focusable: t && t.focusable, filterSize: { width: (t && t.filterSize && t.filterSize.width) || '100%', height: (t && t.filterSize && t.filterSize.height) || '100%', x: (t && t.filterSize && t.filterSize.x) || '0%', y: (t && t.filterSize && t.filterSize.y) || '0%' }, width: t && t.width, height: t && t.height }), (this.globalData = { _mdf: !1, frameNum: -1, defs: s, renderConfig: this.renderConfig }), (this.elements = []), (this.pendingElements = []), (this.destroyed = !1), (this.rendererType = 'svg') } extendPrototype([SVGRendererBase], SVGRenderer), (SVGRenderer.prototype.createComp = function (e) { return new SVGCompElement(e, this.globalData, this) }) function CVContextData() { ;(this.saved = []), (this.cArrPos = 0), (this.cTr = new Matrix()), (this.cO = 1) var e, t = 15 for ( this.savedOp = createTypedArray('float32', t), e = 0; e < t; e += 1 ) this.saved[e] = createTypedArray('float32', 16) this._length = t } ;(CVContextData.prototype.duplicate = function () { var e = this._length * 2, t = this.savedOp ;(this.savedOp = createTypedArray('float32', e)), this.savedOp.set(t) var r = 0 for (r = this._length; r < e; r += 1) this.saved[r] = createTypedArray('float32', 16) this._length = e }), (CVContextData.prototype.reset = function () { ;(this.cArrPos = 0), this.cTr.reset(), (this.cO = 1) }) function ShapeTransformManager() { ;(this.sequences = {}), (this.sequenceList = []), (this.transform_key_count = 0) } ShapeTransformManager.prototype = { addTransformSequence: function (t) { var r, o = t.length, n = '_' for (r = 0; r < o; r += 1) n += t[r].transform.key + '_' var a = this.sequences[n] return ( a || ((a = { transforms: [].concat(t), finalTransform: new Matrix(), _mdf: !1 }), (this.sequences[n] = a), this.sequenceList.push(a)), a ) }, processSequence: function (t, r) { for (var o = 0, n = t.transforms.length, a = r; o < n && !r; ) { if (t.transforms[o].transform.mProps._mdf) { a = !0 break } o += 1 } if (a) { var l for (t.finalTransform.reset(), o = n - 1; o >= 0; o -= 1) (l = t.transforms[o].transform.mProps.v.props), t.finalTransform.transform( l[0], l[1], l[2], l[3], l[4], l[5], l[6], l[7], l[8], l[9], l[10], l[11], l[12], l[13], l[14], l[15] ) } t._mdf = a }, processSequences: function (t) { var r, o = this.sequenceList.length for (r = 0; r < o; r += 1) this.processSequence(this.sequenceList[r], t) }, getNewKey: function () { return (this.transform_key_count += 1), '_' + this.transform_key_count } } function CVEffects() {} CVEffects.prototype.renderFrame = function () {} function CVMaskElement(e, t) { ;(this.data = e), (this.element = t), (this.masksProperties = this.data.masksProperties || []), (this.viewData = createSizedArray(this.masksProperties.length)) var r, o = this.masksProperties.length, n = !1 for (r = 0; r < o; r += 1) this.masksProperties[r].mode !== 'n' && (n = !0), (this.viewData[r] = ShapePropertyFactory.getShapeProp( this.element, this.masksProperties[r], 3 )) ;(this.hasMasks = n), n && this.element.addRenderableComponent(this) } ;(CVMaskElement.prototype.renderFrame = function () { if (!!this.hasMasks) { var e = this.element.finalTransform.mat, t = this.element.canvasContext, r, o = this.masksProperties.length, n, a, l for (t.beginPath(), r = 0; r < o; r += 1) if (this.masksProperties[r].mode !== 'n') { this.masksProperties[r].inv && (t.moveTo(0, 0), t.lineTo(this.element.globalData.compSize.w, 0), t.lineTo( this.element.globalData.compSize.w, this.element.globalData.compSize.h ), t.lineTo(0, this.element.globalData.compSize.h), t.lineTo(0, 0)), (l = this.viewData[r].v), (n = e.applyToPointArray(l.v[0][0], l.v[0][1], 0)), t.moveTo(n[0], n[1]) var s, c = l._length for (s = 1; s < c; s += 1) (a = e.applyToTriplePoints(l.o[s - 1], l.i[s], l.v[s])), t.bezierCurveTo(a[0], a[1], a[2], a[3], a[4], a[5]) ;(a = e.applyToTriplePoints(l.o[s - 1], l.i[0], l.v[0])), t.bezierCurveTo(a[0], a[1], a[2], a[3], a[4], a[5]) } this.element.globalData.renderer.save(!0), t.clip() } }), (CVMaskElement.prototype.getMaskProperty = MaskElement.prototype.getMaskProperty), (CVMaskElement.prototype.destroy = function () { this.element = null }) function CVBaseElement() {} ;(CVBaseElement.prototype = { createElements: function () {}, initRendererElement: function () {}, createContainerElements: function () { ;(this.canvasContext = this.globalData.canvasContext), (this.renderableEffectsManager = new CVEffects()) }, createContent: function () {}, setBlendMode: function () { var t = this.globalData if (t.blendMode !== this.data.bm) { t.blendMode = this.data.bm var r = getBlendMode(this.data.bm) t.canvasContext.globalCompositeOperation = r } }, createRenderableComponents: function () { this.maskManager = new CVMaskElement(this.data, this) }, hideElement: function () { !this.hidden && (!this.isInRange || this.isTransparent) && (this.hidden = !0) }, showElement: function () { this.isInRange && !this.isTransparent && ((this.hidden = !1), (this._isFirstFrame = !0), (this.maskManager._isFirstFrame = !0)) }, renderFrame: function () { if (!(this.hidden || this.data.hd)) { this.renderTransform(), this.renderRenderable(), this.setBlendMode() var t = this.data.ty === 0 this.globalData.renderer.save(t), this.globalData.renderer.ctxTransform( this.finalTransform.mat.props ), this.globalData.renderer.ctxOpacity( this.finalTransform.mProp.o.v ), this.renderInnerContent(), this.globalData.renderer.restore(t), this.maskManager.hasMasks && this.globalData.renderer.restore(!0), this._isFirstFrame && (this._isFirstFrame = !1) } }, destroy: function () { ;(this.canvasContext = null), (this.data = null), (this.globalData = null), this.maskManager.destroy() }, mHelper: new Matrix() }), (CVBaseElement.prototype.hide = CVBaseElement.prototype.hideElement), (CVBaseElement.prototype.show = CVBaseElement.prototype.showElement) function CVShapeData(e, t, r, o) { ;(this.styledShapes = []), (this.tr = [0, 0, 0, 0, 0, 0]) var n = 4 t.ty === 'rc' ? (n = 5) : t.ty === 'el' ? (n = 6) : t.ty === 'sr' && (n = 7), (this.sh = ShapePropertyFactory.getShapeProp(e, t, n, e)) var a, l = r.length, s for (a = 0; a < l; a += 1) r[a].closed || ((s = { transforms: o.addTransformSequence(r[a].transforms), trNodes: [] }), this.styledShapes.push(s), r[a].elements.push(s)) } CVShapeData.prototype.setAsAnimated = SVGShapeData.prototype.setAsAnimated function CVShapeElement(e, t, r) { ;(this.shapes = []), (this.shapesData = e.shapes), (this.stylesList = []), (this.itemsData = []), (this.prevViewData = []), (this.shapeModifiers = []), (this.processedElements = []), (this.transformsManager = new ShapeTransformManager()), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, CVBaseElement, IShapeElement, HierarchyElement, FrameElement, RenderableElement ], CVShapeElement ), (CVShapeElement.prototype.initElement = RenderableDOMElement.prototype.initElement), (CVShapeElement.prototype.transformHelper = { opacity: 1, _opMdf: !1 }), (CVShapeElement.prototype.dashResetter = []), (CVShapeElement.prototype.createContent = function () { this.searchShapes( this.shapesData, this.itemsData, this.prevViewData, !0, [] ) }), (CVShapeElement.prototype.createStyleElement = function (e, t) { var r = { data: e, type: e.ty, preTransforms: this.transformsManager.addTransformSequence(t), transforms: [], elements: [], closed: e.hd === !0 }, o = {} if ( (e.ty === 'fl' || e.ty === 'st' ? ((o.c = PropertyFactory.getProp(this, e.c, 1, 255, this)), o.c.k || (r.co = 'rgb(' + bmFloor(o.c.v[0]) + ',' + bmFloor(o.c.v[1]) + ',' + bmFloor(o.c.v[2]) + ')')) : (e.ty === 'gf' || e.ty === 'gs') && ((o.s = PropertyFactory.getProp(this, e.s, 1, null, this)), (o.e = PropertyFactory.getProp(this, e.e, 1, null, this)), (o.h = PropertyFactory.getProp( this, e.h || { k: 0 }, 0, 0.01, this )), (o.a = PropertyFactory.getProp( this, e.a || { k: 0 }, 0, degToRads, this )), (o.g = new GradientProperty(this, e.g, this))), (o.o = PropertyFactory.getProp(this, e.o, 0, 0.01, this)), e.ty === 'st' || e.ty === 'gs') ) { if ( ((r.lc = lineCapEnum[e.lc || 2]), (r.lj = lineJoinEnum[e.lj || 2]), e.lj == 1 && (r.ml = e.ml), (o.w = PropertyFactory.getProp(this, e.w, 0, null, this)), o.w.k || (r.wi = o.w.v), e.d) ) { var n = new DashProperty(this, e.d, 'canvas', this) ;(o.d = n), o.d.k || ((r.da = o.d.dashArray), (r.do = o.d.dashoffset[0])) } } else r.r = e.r === 2 ? 'evenodd' : 'nonzero' return this.stylesList.push(r), (o.style = r), o }), (CVShapeElement.prototype.createGroupElement = function () { var e = { it: [], prevViewData: [] } return e }), (CVShapeElement.prototype.createTransformElement = function (e) { var t = { transform: { opacity: 1, _opMdf: !1, key: this.transformsManager.getNewKey(), op: PropertyFactory.getProp(this, e.o, 0, 0.01, this), mProps: TransformPropertyFactory.getTransformProperty( this, e, this ) } } return t }), (CVShapeElement.prototype.createShapeElement = function (e) { var t = new CVShapeData( this, e, this.stylesList, this.transformsManager ) return this.shapes.push(t), this.addShapeToModifiers(t), t }), (CVShapeElement.prototype.reloadShapes = function () { this._isFirstFrame = !0 var e, t = this.itemsData.length for (e = 0; e < t; e += 1) this.prevViewData[e] = this.itemsData[e] for ( this.searchShapes( this.shapesData, this.itemsData, this.prevViewData, !0, [] ), t = this.dynamicProperties.length, e = 0; e < t; e += 1 ) this.dynamicProperties[e].getValue() this.renderModifiers(), this.transformsManager.processSequences(this._isFirstFrame) }), (CVShapeElement.prototype.addTransformToStyleList = function (e) { var t, r = this.stylesList.length for (t = 0; t < r; t += 1) this.stylesList[t].closed || this.stylesList[t].transforms.push(e) }), (CVShapeElement.prototype.removeTransformFromStyleList = function () { var e, t = this.stylesList.length for (e = 0; e < t; e += 1) this.stylesList[e].closed || this.stylesList[e].transforms.pop() }), (CVShapeElement.prototype.closeStyles = function (e) { var t, r = e.length for (t = 0; t < r; t += 1) e[t].closed = !0 }), (CVShapeElement.prototype.searchShapes = function (e, t, r, o, n) { var a, l = e.length - 1, s, c, d = [], u = [], m, f, _, b = [].concat(n) for (a = l; a >= 0; a -= 1) { if ( ((m = this.searchProcessedElement(e[a])), m ? (t[a] = r[m - 1]) : (e[a]._shouldRender = o), e[a].ty === 'fl' || e[a].ty === 'st' || e[a].ty === 'gf' || e[a].ty === 'gs') ) m ? (t[a].style.closed = !1) : (t[a] = this.createStyleElement(e[a], b)), d.push(t[a].style) else if (e[a].ty === 'gr') { if (!m) t[a] = this.createGroupElement(e[a]) else for (c = t[a].it.length, s = 0; s < c; s += 1) t[a].prevViewData[s] = t[a].it[s] this.searchShapes(e[a].it, t[a].it, t[a].prevViewData, o, b) } else e[a].ty === 'tr' ? (m || ((_ = this.createTransformElement(e[a])), (t[a] = _)), b.push(t[a]), this.addTransformToStyleList(t[a])) : e[a].ty === 'sh' || e[a].ty === 'rc' || e[a].ty === 'el' || e[a].ty === 'sr' ? m || (t[a] = this.createShapeElement(e[a])) : e[a].ty === 'tm' || e[a].ty === 'rd' || e[a].ty === 'pb' ? (m ? ((f = t[a]), (f.closed = !1)) : ((f = ShapeModifiers.getModifier(e[a].ty)), f.init(this, e[a]), (t[a] = f), this.shapeModifiers.push(f)), u.push(f)) : e[a].ty === 'rp' && (m ? ((f = t[a]), (f.closed = !0)) : ((f = ShapeModifiers.getModifier(e[a].ty)), (t[a] = f), f.init(this, e, a, t), this.shapeModifiers.push(f), (o = !1)), u.push(f)) this.addProcessedElement(e[a], a + 1) } for ( this.removeTransformFromStyleList(), this.closeStyles(d), l = u.length, a = 0; a < l; a += 1 ) u[a].closed = !0 }), (CVShapeElement.prototype.renderInnerContent = function () { ;(this.transformHelper.opacity = 1), (this.transformHelper._opMdf = !1), this.renderModifiers(), this.transformsManager.processSequences(this._isFirstFrame), this.renderShape( this.transformHelper, this.shapesData, this.itemsData, !0 ) }), (CVShapeElement.prototype.renderShapeTransform = function (e, t) { ;(e._opMdf || t.op._mdf || this._isFirstFrame) && ((t.opacity = e.opacity), (t.opacity *= t.op.v), (t._opMdf = !0)) }), (CVShapeElement.prototype.drawLayer = function () { var e, t = this.stylesList.length, r, o, n, a, l, s, c = this.globalData.renderer, d = this.globalData.canvasContext, u, m for (e = 0; e < t; e += 1) if ( ((m = this.stylesList[e]), (u = m.type), !( ((u === 'st' || u === 'gs') && m.wi === 0) || !m.data._shouldRender || m.coOp === 0 || this.globalData.currentGlobalAlpha === 0 )) ) { for ( c.save(), l = m.elements, u === 'st' || u === 'gs' ? ((d.strokeStyle = u === 'st' ? m.co : m.grd), (d.lineWidth = m.wi), (d.lineCap = m.lc), (d.lineJoin = m.lj), (d.miterLimit = m.ml || 0)) : (d.fillStyle = u === 'fl' ? m.co : m.grd), c.ctxOpacity(m.coOp), u !== 'st' && u !== 'gs' && d.beginPath(), c.ctxTransform(m.preTransforms.finalTransform.props), o = l.length, r = 0; r < o; r += 1 ) { for ( (u === 'st' || u === 'gs') && (d.beginPath(), m.da && (d.setLineDash(m.da), (d.lineDashOffset = m.do))), s = l[r].trNodes, a = s.length, n = 0; n < a; n += 1 ) s[n].t === 'm' ? d.moveTo(s[n].p[0], s[n].p[1]) : s[n].t === 'c' ? d.bezierCurveTo( s[n].pts[0], s[n].pts[1], s[n].pts[2], s[n].pts[3], s[n].pts[4], s[n].pts[5] ) : d.closePath() ;(u === 'st' || u === 'gs') && (d.stroke(), m.da && d.setLineDash(this.dashResetter)) } u !== 'st' && u !== 'gs' && d.fill(m.r), c.restore() } }), (CVShapeElement.prototype.renderShape = function (e, t, r, o) { var n, a = t.length - 1, l for (l = e, n = a; n >= 0; n -= 1) t[n].ty === 'tr' ? ((l = r[n].transform), this.renderShapeTransform(e, l)) : t[n].ty === 'sh' || t[n].ty === 'el' || t[n].ty === 'rc' || t[n].ty === 'sr' ? this.renderPath(t[n], r[n]) : t[n].ty === 'fl' ? this.renderFill(t[n], r[n], l) : t[n].ty === 'st' ? this.renderStroke(t[n], r[n], l) : t[n].ty === 'gf' || t[n].ty === 'gs' ? this.renderGradientFill(t[n], r[n], l) : t[n].ty === 'gr' ? this.renderShape(l, t[n].it, r[n].it) : t[n].ty o && this.drawLayer() }), (CVShapeElement.prototype.renderStyledShape = function (e, t) { if (this._isFirstFrame || t._mdf || e.transforms._mdf) { var r = e.trNodes, o = t.paths, n, a, l, s = o._length r.length = 0 var c = e.transforms.finalTransform for (l = 0; l < s; l += 1) { var d = o.shapes[l] if (d && d.v) { for (a = d._length, n = 1; n < a; n += 1) n === 1 && r.push({ t: 'm', p: c.applyToPointArray(d.v[0][0], d.v[0][1], 0) }), r.push({ t: 'c', pts: c.applyToTriplePoints(d.o[n - 1], d.i[n], d.v[n]) }) a === 1 && r.push({ t: 'm', p: c.applyToPointArray(d.v[0][0], d.v[0][1], 0) }), d.c && a && (r.push({ t: 'c', pts: c.applyToTriplePoints(d.o[n - 1], d.i[0], d.v[0]) }), r.push({ t: 'z' })) } } e.trNodes = r } }), (CVShapeElement.prototype.renderPath = function (e, t) { if (e.hd !== !0 && e._shouldRender) { var r, o = t.styledShapes.length for (r = 0; r < o; r += 1) this.renderStyledShape(t.styledShapes[r], t.sh) } }), (CVShapeElement.prototype.renderFill = function (e, t, r) { var o = t.style ;(t.c._mdf || this._isFirstFrame) && (o.co = 'rgb(' + bmFloor(t.c.v[0]) + ',' + bmFloor(t.c.v[1]) + ',' + bmFloor(t.c.v[2]) + ')'), (t.o._mdf || r._opMdf || this._isFirstFrame) && (o.coOp = t.o.v * r.opacity) }), (CVShapeElement.prototype.renderGradientFill = function (e, t, r) { var o = t.style, n if ( !o.grd || t.g._mdf || t.s._mdf || t.e._mdf || (e.t !== 1 && (t.h._mdf || t.a._mdf)) ) { var a = this.globalData.canvasContext, l = t.s.v, s = t.e.v if (e.t === 1) n = a.createLinearGradient(l[0], l[1], s[0], s[1]) else { var c = Math.sqrt( Math.pow(l[0] - s[0], 2) + Math.pow(l[1] - s[1], 2) ), d = Math.atan2(s[1] - l[1], s[0] - l[0]), u = t.h.v u >= 1 ? (u = 0.99) : u <= -1 && (u = -0.99) var m = c * u, f = Math.cos(d + t.a.v) * m + l[0], _ = Math.sin(d + t.a.v) * m + l[1] n = a.createRadialGradient(f, _, 0, l[0], l[1], c) } var b, v = e.g.p, k = t.g.c, g = 1 for (b = 0; b < v; b += 1) t.g._hasOpacity && t.g._collapsable && (g = t.g.o[b * 2 + 1]), n.addColorStop( k[b * 4] / 100, 'rgba(' + k[b * 4 + 1] + ',' + k[b * 4 + 2] + ',' + k[b * 4 + 3] + ',' + g + ')' ) o.grd = n } o.coOp = t.o.v * r.opacity }), (CVShapeElement.prototype.renderStroke = function (e, t, r) { var o = t.style, n = t.d n && (n._mdf || this._isFirstFrame) && ((o.da = n.dashArray), (o.do = n.dashoffset[0])), (t.c._mdf || this._isFirstFrame) && (o.co = 'rgb(' + bmFloor(t.c.v[0]) + ',' + bmFloor(t.c.v[1]) + ',' + bmFloor(t.c.v[2]) + ')'), (t.o._mdf || r._opMdf || this._isFirstFrame) && (o.coOp = t.o.v * r.opacity), (t.w._mdf || this._isFirstFrame) && (o.wi = t.w.v) }), (CVShapeElement.prototype.destroy = function () { ;(this.shapesData = null), (this.globalData = null), (this.canvasContext = null), (this.stylesList.length = 0), (this.itemsData.length = 0) }) function CVTextElement(e, t, r) { ;(this.textSpans = []), (this.yOffset = 0), (this.fillColorAnim = !1), (this.strokeColorAnim = !1), (this.strokeWidthAnim = !1), (this.stroke = !1), (this.fill = !1), (this.justifyOffset = 0), (this.currentRender = null), (this.renderType = 'canvas'), (this.values = { fill: 'rgba(0,0,0,0)', stroke: 'rgba(0,0,0,0)', sWidth: 0, fValue: '' }), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, CVBaseElement, HierarchyElement, FrameElement, RenderableElement, ITextElement ], CVTextElement ), (CVTextElement.prototype.tHelper = createTag('canvas').getContext('2d')), (CVTextElement.prototype.buildNewText = function () { var e = this.textProperty.currentData this.renderedLetters = createSizedArray(e.l ? e.l.length : 0) var t = !1 e.fc ? ((t = !0), (this.values.fill = this.buildColor(e.fc))) : (this.values.fill = 'rgba(0,0,0,0)'), (this.fill = t) var r = !1 e.sc && ((r = !0), (this.values.stroke = this.buildColor(e.sc)), (this.values.sWidth = e.sw)) var o = this.globalData.fontManager.getFontByName(e.f), n, a, l = e.l, s = this.mHelper ;(this.stroke = r), (this.values.fValue = e.finalSize + 'px ' + this.globalData.fontManager.getFontByName(e.f).fFamily), (a = e.finalText.length) var c, d, u, m, f, _, b, v, k, g, x = this.data.singleShape, y = e.tr * 0.001 * e.finalSize, w = 0, S = 0, T = !0, A = 0 for (n = 0; n < a; n += 1) { ;(c = this.globalData.fontManager.getCharData( e.finalText[n], o.fStyle, this.globalData.fontManager.getFontByName(e.f).fFamily )), (d = (c && c.data) || {}), s.reset(), x && l[n].n && ((w = -y), (S += e.yOffset), (S += T ? 1 : 0), (T = !1)), (f = d.shapes ? d.shapes[0].it : []), (b = f.length), s.scale(e.finalSize / 100, e.finalSize / 100), x && this.applyTextPropertiesToMatrix(e, s, l[n].line, w, S), (k = createSizedArray(b - 1)) var $ = 0 for (_ = 0; _ < b; _ += 1) if (f[_].ty === 'sh') { for ( m = f[_].ks.k.i.length, v = f[_].ks.k, g = [], u = 1; u < m; u += 1 ) u === 1 && g.push( s.applyToX(v.v[0][0], v.v[0][1], 0), s.applyToY(v.v[0][0], v.v[0][1], 0) ), g.push( s.applyToX(v.o[u - 1][0], v.o[u - 1][1], 0), s.applyToY(v.o[u - 1][0], v.o[u - 1][1], 0), s.applyToX(v.i[u][0], v.i[u][1], 0), s.applyToY(v.i[u][0], v.i[u][1], 0), s.applyToX(v.v[u][0], v.v[u][1], 0), s.applyToY(v.v[u][0], v.v[u][1], 0) ) g.push( s.applyToX(v.o[u - 1][0], v.o[u - 1][1], 0), s.applyToY(v.o[u - 1][0], v.o[u - 1][1], 0), s.applyToX(v.i[0][0], v.i[0][1], 0), s.applyToY(v.i[0][0], v.i[0][1], 0), s.applyToX(v.v[0][0], v.v[0][1], 0), s.applyToY(v.v[0][0], v.v[0][1], 0) ), (k[$] = g), ($ += 1) } x && ((w += l[n].l), (w += y)), this.textSpans[A] ? (this.textSpans[A].elem = k) : (this.textSpans[A] = { elem: k }), (A += 1) } }), (CVTextElement.prototype.renderInnerContent = function () { var e = this.canvasContext ;(e.font = this.values.fValue), (e.lineCap = 'butt'), (e.lineJoin = 'miter'), (e.miterLimit = 4), this.data.singleShape || this.textAnimator.getMeasures( this.textProperty.currentData, this.lettersChangedFlag ) var t, r, o, n, a, l, s = this.textAnimator.renderedLetters, c = this.textProperty.currentData.l r = c.length var d, u = null, m = null, f = null, _, b for (t = 0; t < r; t += 1) if (!c[t].n) { if ( ((d = s[t]), d && (this.globalData.renderer.save(), this.globalData.renderer.ctxTransform(d.p), this.globalData.renderer.ctxOpacity(d.o)), this.fill) ) { for ( d && d.fc ? u !== d.fc && ((u = d.fc), (e.fillStyle = d.fc)) : u !== this.values.fill && ((u = this.values.fill), (e.fillStyle = this.values.fill)), _ = this.textSpans[t].elem, n = _.length, this.globalData.canvasContext.beginPath(), o = 0; o < n; o += 1 ) for ( b = _[o], l = b.length, this.globalData.canvasContext.moveTo(b[0], b[1]), a = 2; a < l; a += 6 ) this.globalData.canvasContext.bezierCurveTo( b[a], b[a + 1], b[a + 2], b[a + 3], b[a + 4], b[a + 5] ) this.globalData.canvasContext.closePath(), this.globalData.canvasContext.fill() } if (this.stroke) { for ( d && d.sw ? f !== d.sw && ((f = d.sw), (e.lineWidth = d.sw)) : f !== this.values.sWidth && ((f = this.values.sWidth), (e.lineWidth = this.values.sWidth)), d && d.sc ? m !== d.sc && ((m = d.sc), (e.strokeStyle = d.sc)) : m !== this.values.stroke && ((m = this.values.stroke), (e.strokeStyle = this.values.stroke)), _ = this.textSpans[t].elem, n = _.length, this.globalData.canvasContext.beginPath(), o = 0; o < n; o += 1 ) for ( b = _[o], l = b.length, this.globalData.canvasContext.moveTo(b[0], b[1]), a = 2; a < l; a += 6 ) this.globalData.canvasContext.bezierCurveTo( b[a], b[a + 1], b[a + 2], b[a + 3], b[a + 4], b[a + 5] ) this.globalData.canvasContext.closePath(), this.globalData.canvasContext.stroke() } d && this.globalData.renderer.restore() } }) function CVImageElement(e, t, r) { ;(this.assetData = t.getAssetData(e.refId)), (this.img = t.imageLoader.getAsset(this.assetData)), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, CVBaseElement, HierarchyElement, FrameElement, RenderableElement ], CVImageElement ), (CVImageElement.prototype.initElement = SVGShapeElement.prototype.initElement), (CVImageElement.prototype.prepareFrame = IImageElement.prototype.prepareFrame), (CVImageElement.prototype.createContent = function () { if ( this.img.width && (this.assetData.w !== this.img.width || this.assetData.h !== this.img.height) ) { var e = createTag('canvas') ;(e.width = this.assetData.w), (e.height = this.assetData.h) var t = e.getContext('2d'), r = this.img.width, o = this.img.height, n = r / o, a = this.assetData.w / this.assetData.h, l, s, c = this.assetData.pr || this.globalData.renderConfig.imagePreserveAspectRatio ;(n > a && c === 'xMidYMid slice') || (n < a && c !== 'xMidYMid slice') ? ((s = o), (l = s * a)) : ((l = r), (s = l / a)), t.drawImage( this.img, (r - l) / 2, (o - s) / 2, l, s, 0, 0, this.assetData.w, this.assetData.h ), (this.img = e) } }), (CVImageElement.prototype.renderInnerContent = function () { this.canvasContext.drawImage(this.img, 0, 0) }), (CVImageElement.prototype.destroy = function () { this.img = null }) function CVSolidElement(e, t, r) { this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, CVBaseElement, HierarchyElement, FrameElement, RenderableElement ], CVSolidElement ), (CVSolidElement.prototype.initElement = SVGShapeElement.prototype.initElement), (CVSolidElement.prototype.prepareFrame = IImageElement.prototype.prepareFrame), (CVSolidElement.prototype.renderInnerContent = function () { var e = this.canvasContext ;(e.fillStyle = this.data.sc), e.fillRect(0, 0, this.data.sw, this.data.sh) }) function CanvasRendererBase(e, t) { ;(this.animationItem = e), (this.renderConfig = { clearCanvas: t && t.clearCanvas !== void 0 ? t.clearCanvas : !0, context: (t && t.context) || null, progressiveLoad: (t && t.progressiveLoad) || !1, preserveAspectRatio: (t && t.preserveAspectRatio) || 'xMidYMid meet', imagePreserveAspectRatio: (t && t.imagePreserveAspectRatio) || 'xMidYMid slice', contentVisibility: (t && t.contentVisibility) || 'visible', className: (t && t.className) || '', id: (t && t.id) || '' }), (this.renderConfig.dpr = (t && t.dpr) || 1), this.animationItem.wrapper && (this.renderConfig.dpr = (t && t.dpr) || window.devicePixelRatio || 1), (this.renderedFrame = -1), (this.globalData = { frameNum: -1, _mdf: !1, renderConfig: this.renderConfig, currentGlobalAlpha: -1 }), (this.contextData = new CVContextData()), (this.elements = []), (this.pendingElements = []), (this.transformMat = new Matrix()), (this.completeLayers = !1), (this.rendererType = 'canvas') } extendPrototype([BaseRenderer], CanvasRendererBase), (CanvasRendererBase.prototype.createShape = function (e) { return new CVShapeElement(e, this.globalData, this) }), (CanvasRendererBase.prototype.createText = function (e) { return new CVTextElement(e, this.globalData, this) }), (CanvasRendererBase.prototype.createImage = function (e) { return new CVImageElement(e, this.globalData, this) }), (CanvasRendererBase.prototype.createSolid = function (e) { return new CVSolidElement(e, this.globalData, this) }), (CanvasRendererBase.prototype.createNull = SVGRenderer.prototype.createNull), (CanvasRendererBase.prototype.ctxTransform = function (e) { if ( !( e[0] === 1 && e[1] === 0 && e[4] === 0 && e[5] === 1 && e[12] === 0 && e[13] === 0 ) ) { if (!this.renderConfig.clearCanvas) { this.canvasContext.transform(e[0], e[1], e[4], e[5], e[12], e[13]) return } this.transformMat.cloneFromProps(e) var t = this.contextData.cTr.props this.transformMat.transform( t[0], t[1], t[2], t[3], t[4], t[5], t[6], t[7], t[8], t[9], t[10], t[11], t[12], t[13], t[14], t[15] ), this.contextData.cTr.cloneFromProps(this.transformMat.props) var r = this.contextData.cTr.props this.canvasContext.setTransform( r[0], r[1], r[4], r[5], r[12], r[13] ) } }), (CanvasRendererBase.prototype.ctxOpacity = function (e) { if (!this.renderConfig.clearCanvas) { ;(this.canvasContext.globalAlpha *= e < 0 ? 0 : e), (this.globalData.currentGlobalAlpha = this.contextData.cO) return } ;(this.contextData.cO *= e < 0 ? 0 : e), this.globalData.currentGlobalAlpha !== this.contextData.cO && ((this.canvasContext.globalAlpha = this.contextData.cO), (this.globalData.currentGlobalAlpha = this.contextData.cO)) }), (CanvasRendererBase.prototype.reset = function () { if (!this.renderConfig.clearCanvas) { this.canvasContext.restore() return } this.contextData.reset() }), (CanvasRendererBase.prototype.save = function (e) { if (!this.renderConfig.clearCanvas) { this.canvasContext.save() return } e && this.canvasContext.save() var t = this.contextData.cTr.props this.contextData._length <= this.contextData.cArrPos && this.contextData.duplicate() var r, o = this.contextData.saved[this.contextData.cArrPos] for (r = 0; r < 16; r += 1) o[r] = t[r] ;(this.contextData.savedOp[this.contextData.cArrPos] = this.contextData.cO), (this.contextData.cArrPos += 1) }), (CanvasRendererBase.prototype.restore = function (e) { if (!this.renderConfig.clearCanvas) { this.canvasContext.restore() return } e && (this.canvasContext.restore(), (this.globalData.blendMode = 'source-over')), (this.contextData.cArrPos -= 1) var t = this.contextData.saved[this.contextData.cArrPos], r, o = this.contextData.cTr.props for (r = 0; r < 16; r += 1) o[r] = t[r] this.canvasContext.setTransform(t[0], t[1], t[4], t[5], t[12], t[13]), (t = this.contextData.savedOp[this.contextData.cArrPos]), (this.contextData.cO = t), this.globalData.currentGlobalAlpha !== t && ((this.canvasContext.globalAlpha = t), (this.globalData.currentGlobalAlpha = t)) }), (CanvasRendererBase.prototype.configAnimation = function (e) { if (this.animationItem.wrapper) { this.animationItem.container = createTag('canvas') var t = this.animationItem.container.style ;(t.width = '100%'), (t.height = '100%') var r = '0px 0px 0px' ;(t.transformOrigin = r), (t.mozTransformOrigin = r), (t.webkitTransformOrigin = r), (t['-webkit-transform'] = r), (t.contentVisibility = this.renderConfig.contentVisibility), this.animationItem.wrapper.appendChild( this.animationItem.container ), (this.canvasContext = this.animationItem.container.getContext('2d')), this.renderConfig.className && this.animationItem.container.setAttribute( 'class', this.renderConfig.className ), this.renderConfig.id && this.animationItem.container.setAttribute( 'id', this.renderConfig.id ) } else this.canvasContext = this.renderConfig.context ;(this.data = e), (this.layers = e.layers), (this.transformCanvas = { w: e.w, h: e.h, sx: 0, sy: 0, tx: 0, ty: 0 }), this.setupGlobalData(e, document.body), (this.globalData.canvasContext = this.canvasContext), (this.globalData.renderer = this), (this.globalData.isDashed = !1), (this.globalData.progressiveLoad = this.renderConfig.progressiveLoad), (this.globalData.transformCanvas = this.transformCanvas), (this.elements = createSizedArray(e.layers.length)), this.updateContainerSize() }), (CanvasRendererBase.prototype.updateContainerSize = function () { this.reset() var e, t this.animationItem.wrapper && this.animationItem.container ? ((e = this.animationItem.wrapper.offsetWidth), (t = this.animationItem.wrapper.offsetHeight), this.animationItem.container.setAttribute( 'width', e * this.renderConfig.dpr ), this.animationItem.container.setAttribute( 'height', t * this.renderConfig.dpr )) : ((e = this.canvasContext.canvas.width * this.renderConfig.dpr), (t = this.canvasContext.canvas.height * this.renderConfig.dpr)) var r, o if ( this.renderConfig.preserveAspectRatio.indexOf('meet') !== -1 || this.renderConfig.preserveAspectRatio.indexOf('slice') !== -1 ) { var n = this.renderConfig.preserveAspectRatio.split(' '), a = n[1] || 'meet', l = n[0] || 'xMidYMid', s = l.substr(0, 4), c = l.substr(4) ;(r = e / t), (o = this.transformCanvas.w / this.transformCanvas.h), (o > r && a === 'meet') || (o < r && a === 'slice') ? ((this.transformCanvas.sx = e / (this.transformCanvas.w / this.renderConfig.dpr)), (this.transformCanvas.sy = e / (this.transformCanvas.w / this.renderConfig.dpr))) : ((this.transformCanvas.sx = t / (this.transformCanvas.h / this.renderConfig.dpr)), (this.transformCanvas.sy = t / (this.transformCanvas.h / this.renderConfig.dpr))), s === 'xMid' && ((o < r && a === 'meet') || (o > r && a === 'slice')) ? (this.transformCanvas.tx = ((e - this.transformCanvas.w * (t / this.transformCanvas.h)) / 2) * this.renderConfig.dpr) : s === 'xMax' && ((o < r && a === 'meet') || (o > r && a === 'slice')) ? (this.transformCanvas.tx = (e - this.transformCanvas.w * (t / this.transformCanvas.h)) * this.renderConfig.dpr) : (this.transformCanvas.tx = 0), c === 'YMid' && ((o > r && a === 'meet') || (o < r && a === 'slice')) ? (this.transformCanvas.ty = ((t - this.transformCanvas.h * (e / this.transformCanvas.w)) / 2) * this.renderConfig.dpr) : c === 'YMax' && ((o > r && a === 'meet') || (o < r && a === 'slice')) ? (this.transformCanvas.ty = (t - this.transformCanvas.h * (e / this.transformCanvas.w)) * this.renderConfig.dpr) : (this.transformCanvas.ty = 0) } else this.renderConfig.preserveAspectRatio === 'none' ? ((this.transformCanvas.sx = e / (this.transformCanvas.w / this.renderConfig.dpr)), (this.transformCanvas.sy = t / (this.transformCanvas.h / this.renderConfig.dpr)), (this.transformCanvas.tx = 0), (this.transformCanvas.ty = 0)) : ((this.transformCanvas.sx = this.renderConfig.dpr), (this.transformCanvas.sy = this.renderConfig.dpr), (this.transformCanvas.tx = 0), (this.transformCanvas.ty = 0)) ;(this.transformCanvas.props = [ this.transformCanvas.sx, 0, 0, 0, 0, this.transformCanvas.sy, 0, 0, 0, 0, 1, 0, this.transformCanvas.tx, this.transformCanvas.ty, 0, 1 ]), this.ctxTransform(this.transformCanvas.props), this.canvasContext.beginPath(), this.canvasContext.rect( 0, 0, this.transformCanvas.w, this.transformCanvas.h ), this.canvasContext.closePath(), this.canvasContext.clip(), this.renderFrame(this.renderedFrame, !0) }), (CanvasRendererBase.prototype.destroy = function () { this.renderConfig.clearCanvas && this.animationItem.wrapper && (this.animationItem.wrapper.innerText = '') var e, t = this.layers ? this.layers.length : 0 for (e = t - 1; e >= 0; e -= 1) this.elements[e] && this.elements[e].destroy() ;(this.elements.length = 0), (this.globalData.canvasContext = null), (this.animationItem.container = null), (this.destroyed = !0) }), (CanvasRendererBase.prototype.renderFrame = function (e, t) { if ( !( (this.renderedFrame === e && this.renderConfig.clearCanvas === !0 && !t) || this.destroyed || e === -1 ) ) { ;(this.renderedFrame = e), (this.globalData.frameNum = e - this.animationItem._isFirstFrame), (this.globalData.frameId += 1), (this.globalData._mdf = !this.renderConfig.clearCanvas || t), (this.globalData.projectInterface.currentFrame = e) var r, o = this.layers.length for ( this.completeLayers || this.checkLayers(e), r = 0; r < o; r += 1 ) (this.completeLayers || this.elements[r]) && this.elements[r].prepareFrame(e - this.layers[r].st) if (this.globalData._mdf) { for ( this.renderConfig.clearCanvas === !0 ? this.canvasContext.clearRect( 0, 0, this.transformCanvas.w, this.transformCanvas.h ) : this.save(), r = o - 1; r >= 0; r -= 1 ) (this.completeLayers || this.elements[r]) && this.elements[r].renderFrame() this.renderConfig.clearCanvas !== !0 && this.restore() } } }), (CanvasRendererBase.prototype.buildItem = function (e) { var t = this.elements if (!(t[e] || this.layers[e].ty === 99)) { var r = this.createItem(this.layers[e], this, this.globalData) ;(t[e] = r), r.initExpressions() } }), (CanvasRendererBase.prototype.checkPendingElements = function () { for (; this.pendingElements.length; ) { var e = this.pendingElements.pop() e.checkParenting() } }), (CanvasRendererBase.prototype.hide = function () { this.animationItem.container.style.display = 'none' }), (CanvasRendererBase.prototype.show = function () { this.animationItem.container.style.display = 'block' }) function CVCompElement(e, t, r) { ;(this.completeLayers = !1), (this.layers = e.layers), (this.pendingElements = []), (this.elements = createSizedArray(this.layers.length)), this.initElement(e, t, r), (this.tm = e.tm ? PropertyFactory.getProp(this, e.tm, 0, t.frameRate, this) : { _placeholder: !0 }) } extendPrototype( [CanvasRendererBase, ICompElement, CVBaseElement], CVCompElement ), (CVCompElement.prototype.renderInnerContent = function () { var e = this.canvasContext e.beginPath(), e.moveTo(0, 0), e.lineTo(this.data.w, 0), e.lineTo(this.data.w, this.data.h), e.lineTo(0, this.data.h), e.lineTo(0, 0), e.clip() var t, r = this.layers.length for (t = r - 1; t >= 0; t -= 1) (this.completeLayers || this.elements[t]) && this.elements[t].renderFrame() }), (CVCompElement.prototype.destroy = function () { var e, t = this.layers.length for (e = t - 1; e >= 0; e -= 1) this.elements[e] && this.elements[e].destroy() ;(this.layers = null), (this.elements = null) }), (CVCompElement.prototype.createComp = function (e) { return new CVCompElement(e, this.globalData, this) }) function CanvasRenderer(e, t) { ;(this.animationItem = e), (this.renderConfig = { clearCanvas: t && t.clearCanvas !== void 0 ? t.clearCanvas : !0, context: (t && t.context) || null, progressiveLoad: (t && t.progressiveLoad) || !1, preserveAspectRatio: (t && t.preserveAspectRatio) || 'xMidYMid meet', imagePreserveAspectRatio: (t && t.imagePreserveAspectRatio) || 'xMidYMid slice', contentVisibility: (t && t.contentVisibility) || 'visible', className: (t && t.className) || '', id: (t && t.id) || '' }), (this.renderConfig.dpr = (t && t.dpr) || 1), this.animationItem.wrapper && (this.renderConfig.dpr = (t && t.dpr) || window.devicePixelRatio || 1), (this.renderedFrame = -1), (this.globalData = { frameNum: -1, _mdf: !1, renderConfig: this.renderConfig, currentGlobalAlpha: -1 }), (this.contextData = new CVContextData()), (this.elements = []), (this.pendingElements = []), (this.transformMat = new Matrix()), (this.completeLayers = !1), (this.rendererType = 'canvas') } extendPrototype([CanvasRendererBase], CanvasRenderer), (CanvasRenderer.prototype.createComp = function (e) { return new CVCompElement(e, this.globalData, this) }) function HBaseElement() {} ;(HBaseElement.prototype = { checkBlendMode: function () {}, initRendererElement: function () { ;(this.baseElement = createTag(this.data.tg || 'div')), this.data.hasMask ? ((this.svgElement = createNS('svg')), (this.layerElement = createNS('g')), (this.maskedElement = this.layerElement), this.svgElement.appendChild(this.layerElement), this.baseElement.appendChild(this.svgElement)) : (this.layerElement = this.baseElement), styleDiv(this.baseElement) }, createContainerElements: function () { ;(this.renderableEffectsManager = new CVEffects()), (this.transformedElement = this.baseElement), (this.maskedElement = this.layerElement), this.data.ln && this.layerElement.setAttribute('id', this.data.ln), this.data.cl && this.layerElement.setAttribute('class', this.data.cl), this.data.bm !== 0 && this.setBlendMode() }, renderElement: function () { var t = this.transformedElement ? this.transformedElement.style : {} if (this.finalTransform._matMdf) { var r = this.finalTransform.mat.toCSS() ;(t.transform = r), (t.webkitTransform = r) } this.finalTransform._opMdf && (t.opacity = this.finalTransform.mProp.o.v) }, renderFrame: function () { this.data.hd || this.hidden || (this.renderTransform(), this.renderRenderable(), this.renderElement(), this.renderInnerContent(), this._isFirstFrame && (this._isFirstFrame = !1)) }, destroy: function () { ;(this.layerElement = null), (this.transformedElement = null), this.matteElement && (this.matteElement = null), this.maskManager && (this.maskManager.destroy(), (this.maskManager = null)) }, createRenderableComponents: function () { this.maskManager = new MaskElement(this.data, this, this.globalData) }, addEffects: function () {}, setMatte: function () {} }), (HBaseElement.prototype.getBaseElement = SVGBaseElement.prototype.getBaseElement), (HBaseElement.prototype.destroyBaseElement = HBaseElement.prototype.destroy), (HBaseElement.prototype.buildElementParenting = BaseRenderer.prototype.buildElementParenting) function HSolidElement(e, t, r) { this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, HBaseElement, HierarchyElement, FrameElement, RenderableDOMElement ], HSolidElement ), (HSolidElement.prototype.createContent = function () { var e this.data.hasMask ? ((e = createNS('rect')), e.setAttribute('width', this.data.sw), e.setAttribute('height', this.data.sh), e.setAttribute('fill', this.data.sc), this.svgElement.setAttribute('width', this.data.sw), this.svgElement.setAttribute('height', this.data.sh)) : ((e = createTag('div')), (e.style.width = this.data.sw + 'px'), (e.style.height = this.data.sh + 'px'), (e.style.backgroundColor = this.data.sc)), this.layerElement.appendChild(e) }) function HShapeElement(e, t, r) { ;(this.shapes = []), (this.shapesData = e.shapes), (this.stylesList = []), (this.shapeModifiers = []), (this.itemsData = []), (this.processedElements = []), (this.animatedContents = []), (this.shapesContainer = createNS('g')), this.initElement(e, t, r), (this.prevViewData = []), (this.currentBBox = { x: 999999, y: -999999, h: 0, w: 0 }) } extendPrototype( [ BaseElement, TransformElement, HSolidElement, SVGShapeElement, HBaseElement, HierarchyElement, FrameElement, RenderableElement ], HShapeElement ), (HShapeElement.prototype._renderShapeFrame = HShapeElement.prototype.renderInnerContent), (HShapeElement.prototype.createContent = function () { var e if (((this.baseElement.style.fontSize = 0), this.data.hasMask)) this.layerElement.appendChild(this.shapesContainer), (e = this.svgElement) else { e = createNS('svg') var t = this.comp.data ? this.comp.data : this.globalData.compSize e.setAttribute('width', t.w), e.setAttribute('height', t.h), e.appendChild(this.shapesContainer), this.layerElement.appendChild(e) } this.searchShapes( this.shapesData, this.itemsData, this.prevViewData, this.shapesContainer, 0, [], !0 ), this.filterUniqueShapes(), (this.shapeCont = e) }), (HShapeElement.prototype.getTransformedPoint = function (e, t) { var r, o = e.length for (r = 0; r < o; r += 1) t = e[r].mProps.v.applyToPointArray(t[0], t[1], 0) return t }), (HShapeElement.prototype.calculateShapeBoundingBox = function (e, t) { var r = e.sh.v, o = e.transformers, n, a = r._length, l, s, c, d if (!(a <= 1)) { for (n = 0; n < a - 1; n += 1) (l = this.getTransformedPoint(o, r.v[n])), (s = this.getTransformedPoint(o, r.o[n])), (c = this.getTransformedPoint(o, r.i[n + 1])), (d = this.getTransformedPoint(o, r.v[n + 1])), this.checkBounds(l, s, c, d, t) r.c && ((l = this.getTransformedPoint(o, r.v[n])), (s = this.getTransformedPoint(o, r.o[n])), (c = this.getTransformedPoint(o, r.i[0])), (d = this.getTransformedPoint(o, r.v[0])), this.checkBounds(l, s, c, d, t)) } }), (HShapeElement.prototype.checkBounds = function (e, t, r, o, n) { this.getBoundsOfCurve(e, t, r, o) var a = this.shapeBoundingBox ;(n.x = bmMin(a.left, n.x)), (n.xMax = bmMax(a.right, n.xMax)), (n.y = bmMin(a.top, n.y)), (n.yMax = bmMax(a.bottom, n.yMax)) }), (HShapeElement.prototype.shapeBoundingBox = { left: 0, right: 0, top: 0, bottom: 0 }), (HShapeElement.prototype.tempBoundingBox = { x: 0, xMax: 0, y: 0, yMax: 0, width: 0, height: 0 }), (HShapeElement.prototype.getBoundsOfCurve = function (e, t, r, o) { for ( var n = [ [e[0], o[0]], [e[1], o[1]] ], a, l, s, c, d, u, m, f = 0; f < 2; ++f ) (l = 6 * e[f] - 12 * t[f] + 6 * r[f]), (a = -3 * e[f] + 9 * t[f] - 9 * r[f] + 3 * o[f]), (s = 3 * t[f] - 3 * e[f]), (l |= 0), (a |= 0), (s |= 0), (a === 0 && l === 0) || (a === 0 ? ((c = -s / l), c > 0 && c < 1 && n[f].push(this.calculateF(c, e, t, r, o, f))) : ((d = l * l - 4 * s * a), d >= 0 && ((u = (-l + bmSqrt(d)) / (2 * a)), u > 0 && u < 1 && n[f].push(this.calculateF(u, e, t, r, o, f)), (m = (-l - bmSqrt(d)) / (2 * a)), m > 0 && m < 1 && n[f].push(this.calculateF(m, e, t, r, o, f))))) ;(this.shapeBoundingBox.left = bmMin.apply(null, n[0])), (this.shapeBoundingBox.top = bmMin.apply(null, n[1])), (this.shapeBoundingBox.right = bmMax.apply(null, n[0])), (this.shapeBoundingBox.bottom = bmMax.apply(null, n[1])) }), (HShapeElement.prototype.calculateF = function (e, t, r, o, n, a) { return ( bmPow(1 - e, 3) * t[a] + 3 * bmPow(1 - e, 2) * e * r[a] + 3 * (1 - e) * bmPow(e, 2) * o[a] + bmPow(e, 3) * n[a] ) }), (HShapeElement.prototype.calculateBoundingBox = function (e, t) { var r, o = e.length for (r = 0; r < o; r += 1) e[r] && e[r].sh ? this.calculateShapeBoundingBox(e[r], t) : e[r] && e[r].it ? this.calculateBoundingBox(e[r].it, t) : e[r] && e[r].style && e[r].w && this.expandStrokeBoundingBox(e[r].w, t) }), (HShapeElement.prototype.expandStrokeBoundingBox = function (e, t) { var r = 0 if (e.keyframes) { for (var o = 0; o < e.keyframes.length; o += 1) { var n = e.keyframes[o].s n > r && (r = n) } r *= e.mult } else r = e.v * e.mult ;(t.x -= r), (t.xMax += r), (t.y -= r), (t.yMax += r) }), (HShapeElement.prototype.currentBoxContains = function (e) { return ( this.currentBBox.x <= e.x && this.currentBBox.y <= e.y && this.currentBBox.width + this.currentBBox.x >= e.x + e.width && this.currentBBox.height + this.currentBBox.y >= e.y + e.height ) }), (HShapeElement.prototype.renderInnerContent = function () { if ( (this._renderShapeFrame(), !this.hidden && (this._isFirstFrame || this._mdf)) ) { var e = this.tempBoundingBox, t = 999999 if ( ((e.x = t), (e.xMax = -t), (e.y = t), (e.yMax = -t), this.calculateBoundingBox(this.itemsData, e), (e.width = e.xMax < e.x ? 0 : e.xMax - e.x), (e.height = e.yMax < e.y ? 0 : e.yMax - e.y), this.currentBoxContains(e)) ) return var r = !1 if ( (this.currentBBox.w !== e.width && ((this.currentBBox.w = e.width), this.shapeCont.setAttribute('width', e.width), (r = !0)), this.currentBBox.h !== e.height && ((this.currentBBox.h = e.height), this.shapeCont.setAttribute('height', e.height), (r = !0)), r || this.currentBBox.x !== e.x || this.currentBBox.y !== e.y) ) { ;(this.currentBBox.w = e.width), (this.currentBBox.h = e.height), (this.currentBBox.x = e.x), (this.currentBBox.y = e.y), this.shapeCont.setAttribute( 'viewBox', this.currentBBox.x + ' ' + this.currentBBox.y + ' ' + this.currentBBox.w + ' ' + this.currentBBox.h ) var o = this.shapeCont.style, n = 'translate(' + this.currentBBox.x + 'px,' + this.currentBBox.y + 'px)' ;(o.transform = n), (o.webkitTransform = n) } } }) function HTextElement(e, t, r) { ;(this.textSpans = []), (this.textPaths = []), (this.currentBBox = { x: 999999, y: -999999, h: 0, w: 0 }), (this.renderType = 'svg'), (this.isMasked = !1), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, HBaseElement, HierarchyElement, FrameElement, RenderableDOMElement, ITextElement ], HTextElement ), (HTextElement.prototype.createContent = function () { if (((this.isMasked = this.checkMasks()), this.isMasked)) { ;(this.renderType = 'svg'), (this.compW = this.comp.data.w), (this.compH = this.comp.data.h), this.svgElement.setAttribute('width', this.compW), this.svgElement.setAttribute('height', this.compH) var e = createNS('g') this.maskedElement.appendChild(e), (this.innerElem = e) } else (this.renderType = 'html'), (this.innerElem = this.layerElement) this.checkParenting() }), (HTextElement.prototype.buildNewText = function () { var e = this.textProperty.currentData this.renderedLetters = createSizedArray(e.l ? e.l.length : 0) var t = this.innerElem.style, r = e.fc ? this.buildColor(e.fc) : 'rgba(0,0,0,0)' ;(t.fill = r), (t.color = r), e.sc && ((t.stroke = this.buildColor(e.sc)), (t.strokeWidth = e.sw + 'px')) var o = this.globalData.fontManager.getFontByName(e.f) if (!this.globalData.fontManager.chars) if ( ((t.fontSize = e.finalSize + 'px'), (t.lineHeight = e.finalSize + 'px'), o.fClass) ) this.innerElem.className = o.fClass else { t.fontFamily = o.fFamily var n = e.fWeight, a = e.fStyle ;(t.fontStyle = a), (t.fontWeight = n) } var l, s, c = e.l s = c.length var d, u, m, f = this.mHelper, _, b = '', v = 0 for (l = 0; l < s; l += 1) { if ( (this.globalData.fontManager.chars ? (this.textPaths[v] ? (d = this.textPaths[v]) : ((d = createNS('path')), d.setAttribute('stroke-linecap', lineCapEnum[1]), d.setAttribute('stroke-linejoin', lineJoinEnum[2]), d.setAttribute('stroke-miterlimit', '4')), this.isMasked || (this.textSpans[v] ? ((u = this.textSpans[v]), (m = u.children[0])) : ((u = createTag('div')), (u.style.lineHeight = 0), (m = createNS('svg')), m.appendChild(d), styleDiv(u)))) : this.isMasked ? (d = this.textPaths[v] ? this.textPaths[v] : createNS('text')) : this.textSpans[v] ? ((u = this.textSpans[v]), (d = this.textPaths[v])) : ((u = createTag('span')), styleDiv(u), (d = createTag('span')), styleDiv(d), u.appendChild(d)), this.globalData.fontManager.chars) ) { var k = this.globalData.fontManager.getCharData( e.finalText[l], o.fStyle, this.globalData.fontManager.getFontByName(e.f).fFamily ), g if ( (k ? (g = k.data) : (g = null), f.reset(), g && g.shapes && g.shapes.length && ((_ = g.shapes[0].it), f.scale(e.finalSize / 100, e.finalSize / 100), (b = this.createPathShape(f, _)), d.setAttribute('d', b)), this.isMasked) ) this.innerElem.appendChild(d) else { if ((this.innerElem.appendChild(u), g && g.shapes)) { document.body.appendChild(m) var x = m.getBBox() m.setAttribute('width', x.width + 2), m.setAttribute('height', x.height + 2), m.setAttribute( 'viewBox', x.x - 1 + ' ' + (x.y - 1) + ' ' + (x.width + 2) + ' ' + (x.height + 2) ) var y = m.style, w = 'translate(' + (x.x - 1) + 'px,' + (x.y - 1) + 'px)' ;(y.transform = w), (y.webkitTransform = w), (c[l].yOffset = x.y - 1) } else m.setAttribute('width', 1), m.setAttribute('height', 1) u.appendChild(m) } } else if ( ((d.textContent = c[l].val), d.setAttributeNS( 'http://www.w3.org/XML/1998/namespace', 'xml:space', 'preserve' ), this.isMasked) ) this.innerElem.appendChild(d) else { this.innerElem.appendChild(u) var S = d.style, T = 'translate3d(0,' + -e.finalSize / 1.2 + 'px,0)' ;(S.transform = T), (S.webkitTransform = T) } this.isMasked ? (this.textSpans[v] = d) : (this.textSpans[v] = u), (this.textSpans[v].style.display = 'block'), (this.textPaths[v] = d), (v += 1) } for (; v < this.textSpans.length; ) (this.textSpans[v].style.display = 'none'), (v += 1) }), (HTextElement.prototype.renderInnerContent = function () { var e if (this.data.singleShape) { if (!this._isFirstFrame && !this.lettersChangedFlag) return if (this.isMasked && this.finalTransform._matMdf) { this.svgElement.setAttribute( 'viewBox', -this.finalTransform.mProp.p.v[0] + ' ' + -this.finalTransform.mProp.p.v[1] + ' ' + this.compW + ' ' + this.compH ), (e = this.svgElement.style) var t = 'translate(' + -this.finalTransform.mProp.p.v[0] + 'px,' + -this.finalTransform.mProp.p.v[1] + 'px)' ;(e.transform = t), (e.webkitTransform = t) } } if ( (this.textAnimator.getMeasures( this.textProperty.currentData, this.lettersChangedFlag ), !( !this.lettersChangedFlag && !this.textAnimator.lettersChangedFlag )) ) { var r, o, n = 0, a = this.textAnimator.renderedLetters, l = this.textProperty.currentData.l o = l.length var s, c, d for (r = 0; r < o; r += 1) l[r].n ? (n += 1) : ((c = this.textSpans[r]), (d = this.textPaths[r]), (s = a[n]), (n += 1), s._mdf.m && (this.isMasked ? c.setAttribute('transform', s.m) : ((c.style.webkitTransform = s.m), (c.style.transform = s.m))), (c.style.opacity = s.o), s.sw && s._mdf.sw && d.setAttribute('stroke-width', s.sw), s.sc && s._mdf.sc && d.setAttribute('stroke', s.sc), s.fc && s._mdf.fc && (d.setAttribute('fill', s.fc), (d.style.color = s.fc))) if ( this.innerElem.getBBox && !this.hidden && (this._isFirstFrame || this._mdf) ) { var u = this.innerElem.getBBox() this.currentBBox.w !== u.width && ((this.currentBBox.w = u.width), this.svgElement.setAttribute('width', u.width)), this.currentBBox.h !== u.height && ((this.currentBBox.h = u.height), this.svgElement.setAttribute('height', u.height)) var m = 1 if ( this.currentBBox.w !== u.width + m * 2 || this.currentBBox.h !== u.height + m * 2 || this.currentBBox.x !== u.x - m || this.currentBBox.y !== u.y - m ) { ;(this.currentBBox.w = u.width + m * 2), (this.currentBBox.h = u.height + m * 2), (this.currentBBox.x = u.x - m), (this.currentBBox.y = u.y - m), this.svgElement.setAttribute( 'viewBox', this.currentBBox.x + ' ' + this.currentBBox.y + ' ' + this.currentBBox.w + ' ' + this.currentBBox.h ), (e = this.svgElement.style) var f = 'translate(' + this.currentBBox.x + 'px,' + this.currentBBox.y + 'px)' ;(e.transform = f), (e.webkitTransform = f) } } } }) function HCameraElement(e, t, r) { this.initFrame(), this.initBaseData(e, t, r), this.initHierarchy() var o = PropertyFactory.getProp if ( ((this.pe = o(this, e.pe, 0, 0, this)), e.ks.p.s ? ((this.px = o(this, e.ks.p.x, 1, 0, this)), (this.py = o(this, e.ks.p.y, 1, 0, this)), (this.pz = o(this, e.ks.p.z, 1, 0, this))) : (this.p = o(this, e.ks.p, 1, 0, this)), e.ks.a && (this.a = o(this, e.ks.a, 1, 0, this)), e.ks.or.k.length && e.ks.or.k[0].to) ) { var n, a = e.ks.or.k.length for (n = 0; n < a; n += 1) (e.ks.or.k[n].to = null), (e.ks.or.k[n].ti = null) } ;(this.or = o(this, e.ks.or, 1, degToRads, this)), (this.or.sh = !0), (this.rx = o(this, e.ks.rx, 0, degToRads, this)), (this.ry = o(this, e.ks.ry, 0, degToRads, this)), (this.rz = o(this, e.ks.rz, 0, degToRads, this)), (this.mat = new Matrix()), (this._prevMat = new Matrix()), (this._isFirstFrame = !0), (this.finalTransform = { mProp: this }) } extendPrototype( [BaseElement, FrameElement, HierarchyElement], HCameraElement ), (HCameraElement.prototype.setup = function () { var e, t = this.comp.threeDElements.length, r, o, n for (e = 0; e < t; e += 1) if (((r = this.comp.threeDElements[e]), r.type === '3d')) { ;(o = r.perspectiveElem.style), (n = r.container.style) var a = this.pe.v + 'px', l = '0px 0px 0px', s = 'matrix3d(1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1)' ;(o.perspective = a), (o.webkitPerspective = a), (n.transformOrigin = l), (n.mozTransformOrigin = l), (n.webkitTransformOrigin = l), (o.transform = s), (o.webkitTransform = s) } }), (HCameraElement.prototype.createElements = function () {}), (HCameraElement.prototype.hide = function () {}), (HCameraElement.prototype.renderFrame = function () { var e = this._isFirstFrame, t, r if (this.hierarchy) for (r = this.hierarchy.length, t = 0; t < r; t += 1) e = this.hierarchy[t].finalTransform.mProp._mdf || e if ( e || this.pe._mdf || (this.p && this.p._mdf) || (this.px && (this.px._mdf || this.py._mdf || this.pz._mdf)) || this.rx._mdf || this.ry._mdf || this.rz._mdf || this.or._mdf || (this.a && this.a._mdf) ) { if ((this.mat.reset(), this.hierarchy)) for (r = this.hierarchy.length - 1, t = r; t >= 0; t -= 1) { var o = this.hierarchy[t].finalTransform.mProp this.mat.translate(-o.p.v[0], -o.p.v[1], o.p.v[2]), this.mat .rotateX(-o.or.v[0]) .rotateY(-o.or.v[1]) .rotateZ(o.or.v[2]), this.mat.rotateX(-o.rx.v).rotateY(-o.ry.v).rotateZ(o.rz.v), this.mat.scale(1 / o.s.v[0], 1 / o.s.v[1], 1 / o.s.v[2]), this.mat.translate(o.a.v[0], o.a.v[1], o.a.v[2]) } if ( (this.p ? this.mat.translate(-this.p.v[0], -this.p.v[1], this.p.v[2]) : this.mat.translate(-this.px.v, -this.py.v, this.pz.v), this.a) ) { var n this.p ? (n = [ this.p.v[0] - this.a.v[0], this.p.v[1] - this.a.v[1], this.p.v[2] - this.a.v[2] ]) : (n = [ this.px.v - this.a.v[0], this.py.v - this.a.v[1], this.pz.v - this.a.v[2] ]) var a = Math.sqrt( Math.pow(n[0], 2) + Math.pow(n[1], 2) + Math.pow(n[2], 2) ), l = [n[0] / a, n[1] / a, n[2] / a], s = Math.sqrt(l[2] * l[2] + l[0] * l[0]), c = Math.atan2(l[1], s), d = Math.atan2(l[0], -l[2]) this.mat.rotateY(d).rotateX(-c) } this.mat.rotateX(-this.rx.v).rotateY(-this.ry.v).rotateZ(this.rz.v), this.mat .rotateX(-this.or.v[0]) .rotateY(-this.or.v[1]) .rotateZ(this.or.v[2]), this.mat.translate( this.globalData.compSize.w / 2, this.globalData.compSize.h / 2, 0 ), this.mat.translate(0, 0, this.pe.v) var u = !this._prevMat.equals(this.mat) if ((u || this.pe._mdf) && this.comp.threeDElements) { r = this.comp.threeDElements.length var m, f, _ for (t = 0; t < r; t += 1) if (((m = this.comp.threeDElements[t]), m.type === '3d')) { if (u) { var b = this.mat.toCSS() ;(_ = m.container.style), (_.transform = b), (_.webkitTransform = b) } this.pe._mdf && ((f = m.perspectiveElem.style), (f.perspective = this.pe.v + 'px'), (f.webkitPerspective = this.pe.v + 'px')) } this.mat.clone(this._prevMat) } } this._isFirstFrame = !1 }), (HCameraElement.prototype.prepareFrame = function (e) { this.prepareProperties(e, !0) }), (HCameraElement.prototype.destroy = function () {}), (HCameraElement.prototype.getBaseElement = function () { return null }) function HImageElement(e, t, r) { ;(this.assetData = t.getAssetData(e.refId)), this.initElement(e, t, r) } extendPrototype( [ BaseElement, TransformElement, HBaseElement, HSolidElement, HierarchyElement, FrameElement, RenderableElement ], HImageElement ), (HImageElement.prototype.createContent = function () { var e = this.globalData.getAssetsPath(this.assetData), t = new Image() this.data.hasMask ? ((this.imageElem = createNS('image')), this.imageElem.setAttribute('width', this.assetData.w + 'px'), this.imageElem.setAttribute('height', this.assetData.h + 'px'), this.imageElem.setAttributeNS( 'http://www.w3.org/1999/xlink', 'href', e ), this.layerElement.appendChild(this.imageElem), this.baseElement.setAttribute('width', this.assetData.w), this.baseElement.setAttribute('height', this.assetData.h)) : this.layerElement.appendChild(t), (t.crossOrigin = 'anonymous'), (t.src = e), this.data.ln && this.baseElement.setAttribute('id', this.data.ln) }) function HybridRendererBase(e, t) { ;(this.animationItem = e), (this.layers = null), (this.renderedFrame = -1), (this.renderConfig = { className: (t && t.className) || '', imagePreserveAspectRatio: (t && t.imagePreserveAspectRatio) || 'xMidYMid slice', hideOnTransparent: !(t && t.hideOnTransparent === !1), filterSize: { width: (t && t.filterSize && t.filterSize.width) || '400%', height: (t && t.filterSize && t.filterSize.height) || '400%', x: (t && t.filterSize && t.filterSize.x) || '-100%', y: (t && t.filterSize && t.filterSize.y) || '-100%' } }), (this.globalData = { _mdf: !1, frameNum: -1, renderConfig: this.renderConfig }), (this.pendingElements = []), (this.elements = []), (this.threeDElements = []), (this.destroyed = !1), (this.camera = null), (this.supports3d = !0), (this.rendererType = 'html') } extendPrototype([BaseRenderer], HybridRendererBase), (HybridRendererBase.prototype.buildItem = SVGRenderer.prototype.buildItem), (HybridRendererBase.prototype.checkPendingElements = function () { for (; this.pendingElements.length; ) { var e = this.pendingElements.pop() e.checkParenting() } }), (HybridRendererBase.prototype.appendElementInPos = function (e, t) { var r = e.getBaseElement() if (!!r) { var o = this.layers[t] if (!o.ddd || !this.supports3d) if (this.threeDElements) this.addTo3dContainer(r, t) else { for (var n = 0, a, l, s; n < t; ) this.elements[n] && this.elements[n] !== !0 && this.elements[n].getBaseElement && ((l = this.elements[n]), (s = this.layers[n].ddd ? this.getThreeDContainerByPos(n) : l.getBaseElement()), (a = s || a)), (n += 1) a ? (!o.ddd || !this.supports3d) && this.layerElement.insertBefore(r, a) : (!o.ddd || !this.supports3d) && this.layerElement.appendChild(r) } else this.addTo3dContainer(r, t) } }), (HybridRendererBase.prototype.createShape = function (e) { return this.supports3d ? new HShapeElement(e, this.globalData, this) : new SVGShapeElement(e, this.globalData, this) }), (HybridRendererBase.prototype.createText = function (e) { return this.supports3d ? new HTextElement(e, this.globalData, this) : new SVGTextLottieElement(e, this.globalData, this) }), (HybridRendererBase.prototype.createCamera = function (e) { return ( (this.camera = new HCameraElement(e, this.globalData, this)), this.camera ) }), (HybridRendererBase.prototype.createImage = function (e) { return this.supports3d ? new HImageElement(e, this.globalData, this) : new IImageElement(e, this.globalData, this) }), (HybridRendererBase.prototype.createSolid = function (e) { return this.supports3d ? new HSolidElement(e, this.globalData, this) : new ISolidElement(e, this.globalData, this) }), (HybridRendererBase.prototype.createNull = SVGRenderer.prototype.createNull), (HybridRendererBase.prototype.getThreeDContainerByPos = function (e) { for (var t = 0, r = this.threeDElements.length; t < r; ) { if ( this.threeDElements[t].startPos <= e && this.threeDElements[t].endPos >= e ) return this.threeDElements[t].perspectiveElem t += 1 } return null }), (HybridRendererBase.prototype.createThreeDContainer = function (e, t) { var r = createTag('div'), o, n styleDiv(r) var a = createTag('div') if ((styleDiv(a), t === '3d')) { ;(o = r.style), (o.width = this.globalData.compSize.w + 'px'), (o.height = this.globalData.compSize.h + 'px') var l = '50% 50%' ;(o.webkitTransformOrigin = l), (o.mozTransformOrigin = l), (o.transformOrigin = l), (n = a.style) var s = 'matrix3d(1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1)' ;(n.transform = s), (n.webkitTransform = s) } r.appendChild(a) var c = { container: a, perspectiveElem: r, startPos: e, endPos: e, type: t } return this.threeDElements.push(c), c }), (HybridRendererBase.prototype.build3dContainers = function () { var e, t = this.layers.length, r, o = '' for (e = 0; e < t; e += 1) this.layers[e].ddd && this.layers[e].ty !== 3 ? (o !== '3d' && ((o = '3d'), (r = this.createThreeDContainer(e, '3d'))), (r.endPos = Math.max(r.endPos, e))) : (o !== '2d' && ((o = '2d'), (r = this.createThreeDContainer(e, '2d'))), (r.endPos = Math.max(r.endPos, e))) for (t = this.threeDElements.length, e = t - 1; e >= 0; e -= 1) this.resizerElem.appendChild(this.threeDElements[e].perspectiveElem) }), (HybridRendererBase.prototype.addTo3dContainer = function (e, t) { for (var r = 0, o = this.threeDElements.length; r < o; ) { if (t <= this.threeDElements[r].endPos) { for (var n = this.threeDElements[r].startPos, a; n < t; ) this.elements[n] && this.elements[n].getBaseElement && (a = this.elements[n].getBaseElement()), (n += 1) a ? this.threeDElements[r].container.insertBefore(e, a) : this.threeDElements[r].container.appendChild(e) break } r += 1 } }), (HybridRendererBase.prototype.configAnimation = function (e) { var t = createTag('div'), r = this.animationItem.wrapper, o = t.style ;(o.width = e.w + 'px'), (o.height = e.h + 'px'), (this.resizerElem = t), styleDiv(t), (o.transformStyle = 'flat'), (o.mozTransformStyle = 'flat'), (o.webkitTransformStyle = 'flat'), this.renderConfig.className && t.setAttribute('class', this.renderConfig.className), r.appendChild(t), (o.overflow = 'hidden') var n = createNS('svg') n.setAttribute('width', '1'), n.setAttribute('height', '1'), styleDiv(n), this.resizerElem.appendChild(n) var a = createNS('defs') n.appendChild(a), (this.data = e), this.setupGlobalData(e, n), (this.globalData.defs = a), (this.layers = e.layers), (this.layerElement = this.resizerElem), this.build3dContainers(), this.updateContainerSize() }), (HybridRendererBase.prototype.destroy = function () { this.animationItem.wrapper && (this.animationItem.wrapper.innerText = ''), (this.animationItem.container = null), (this.globalData.defs = null) var e, t = this.layers ? this.layers.length : 0 for (e = 0; e < t; e += 1) this.elements[e].destroy() ;(this.elements.length = 0), (this.destroyed = !0), (this.animationItem = null) }), (HybridRendererBase.prototype.updateContainerSize = function () { var e = this.animationItem.wrapper.offsetWidth, t = this.animationItem.wrapper.offsetHeight, r = e / t, o = this.globalData.compSize.w / this.globalData.compSize.h, n, a, l, s o > r ? ((n = e / this.globalData.compSize.w), (a = e / this.globalData.compSize.w), (l = 0), (s = (t - this.globalData.compSize.h * (e / this.globalData.compSize.w)) / 2)) : ((n = t / this.globalData.compSize.h), (a = t / this.globalData.compSize.h), (l = (e - this.globalData.compSize.w * (t / this.globalData.compSize.h)) / 2), (s = 0)) var c = this.resizerElem.style ;(c.webkitTransform = 'matrix3d(' + n + ',0,0,0,0,' + a + ',0,0,0,0,1,0,' + l + ',' + s + ',0,1)'), (c.transform = c.webkitTransform) }), (HybridRendererBase.prototype.renderFrame = SVGRenderer.prototype.renderFrame), (HybridRendererBase.prototype.hide = function () { this.resizerElem.style.display = 'none' }), (HybridRendererBase.prototype.show = function () { this.resizerElem.style.display = 'block' }), (HybridRendererBase.prototype.initItems = function () { if ((this.buildAllItems(), this.camera)) this.camera.setup() else { var e = this.globalData.compSize.w, t = this.globalData.compSize.h, r, o = this.threeDElements.length for (r = 0; r < o; r += 1) { var n = this.threeDElements[r].perspectiveElem.style ;(n.webkitPerspective = Math.sqrt(Math.pow(e, 2) + Math.pow(t, 2)) + 'px'), (n.perspective = n.webkitPerspective) } } }), (HybridRendererBase.prototype.searchExtraCompositions = function (e) { var t, r = e.length, o = createTag('div') for (t = 0; t < r; t += 1) if (e[t].xt) { var n = this.createComp(e[t], o, this.globalData.comp, null) n.initExpressions(), this.globalData.projectInterface.registerComposition(n) } }) function HCompElement(e, t, r) { ;(this.layers = e.layers), (this.supports3d = !e.hasMask), (this.completeLayers = !1), (this.pendingElements = []), (this.elements = this.layers ? createSizedArray(this.layers.length) : []), this.initElement(e, t, r), (this.tm = e.tm ? PropertyFactory.getProp(this, e.tm, 0, t.frameRate, this) : { _placeholder: !0 }) } extendPrototype( [HybridRendererBase, ICompElement, HBaseElement], HCompElement ), (HCompElement.prototype._createBaseContainerElements = HCompElement.prototype.createContainerElements), (HCompElement.prototype.createContainerElements = function () { this._createBaseContainerElements(), this.data.hasMask ? (this.svgElement.setAttribute('width', this.data.w), this.svgElement.setAttribute('height', this.data.h), (this.transformedElement = this.baseElement)) : (this.transformedElement = this.layerElement) }), (HCompElement.prototype.addTo3dContainer = function (e, t) { for (var r = 0, o; r < t; ) this.elements[r] && this.elements[r].getBaseElement && (o = this.elements[r].getBaseElement()), (r += 1) o ? this.layerElement.insertBefore(e, o) : this.layerElement.appendChild(e) }), (HCompElement.prototype.createComp = function (e) { return this.supports3d ? new HCompElement(e, this.globalData, this) : new SVGCompElement(e, this.globalData, this) }) function HybridRenderer(e, t) { ;(this.animationItem = e), (this.layers = null), (this.renderedFrame = -1), (this.renderConfig = { className: (t && t.className) || '', imagePreserveAspectRatio: (t && t.imagePreserveAspectRatio) || 'xMidYMid slice', hideOnTransparent: !(t && t.hideOnTransparent === !1), filterSize: { width: (t && t.filterSize && t.filterSize.width) || '400%', height: (t && t.filterSize && t.filterSize.height) || '400%', x: (t && t.filterSize && t.filterSize.x) || '-100%', y: (t && t.filterSize && t.filterSize.y) || '-100%' } }), (this.globalData = { _mdf: !1, frameNum: -1, renderConfig: this.renderConfig }), (this.pendingElements = []), (this.elements = []), (this.threeDElements = []), (this.destroyed = !1), (this.camera = null), (this.supports3d = !0), (this.rendererType = 'html') } extendPrototype([HybridRendererBase], HybridRenderer), (HybridRenderer.prototype.createComp = function (e) { return this.supports3d ? new HCompElement(e, this.globalData, this) : new SVGCompElement(e, this.globalData, this) }) var Expressions = (function () { var e = {} e.initExpressions = t function t(r) { var o = 0, n = [] function a() { o += 1 } function l() { ;(o -= 1), o === 0 && c() } function s(d) { n.indexOf(d) === -1 && n.push(d) } function c() { var d, u = n.length for (d = 0; d < u; d += 1) n[d].release() n.length = 0 } ;(r.renderer.compInterface = CompExpressionInterface(r.renderer)), r.renderer.globalData.projectInterface.registerComposition( r.renderer ), (r.renderer.globalData.pushExpression = a), (r.renderer.globalData.popExpression = l), (r.renderer.globalData.registerExpressionProperty = s) } return e })() function _typeof$1(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof$1 = function (r) { return typeof r }) : (_typeof$1 = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof$1(e) ) } function seedRandom(e, t) { var r = this, o = 256, n = 6, a = 52, l = 'random', s = t.pow(o, n), c = t.pow(2, a), d = c * 2, u = o - 1, m function f(y, w, S) { var T = [] w = w === !0 ? { entropy: !0 } : w || {} var A = k(v(w.entropy ? [y, x(e)] : y === null ? g() : y, 3), T), $ = new _(T), F = function () { for (var ae = $.g(n), re = s, ie = 0; ae < c; ) (ae = (ae + ie) * o), (re *= o), (ie = $.g(1)) for (; ae >= d; ) (ae /= 2), (re /= 2), (ie >>>= 1) return (ae + ie) / re } return ( (F.int32 = function () { return $.g(4) | 0 }), (F.quick = function () { return $.g(4) / 4294967296 }), (F.double = F), k(x($.S), e), ( w.pass || S || function (Y, ae, re, ie) { return ( ie && (ie.S && b(ie, $), (Y.state = function () { return b($, {}) })), re ? ((t[l] = Y), ae) : Y ) } )(F, A, 'global' in w ? w.global : this == t, w.state) ) } t['seed' + l] = f function _(y) { var w, S = y.length, T = this, A = 0, $ = (T.i = T.j = 0), F = (T.S = []) for (S || (y = [S++]); A < o; ) F[A] = A++ for (A = 0; A < o; A++) (F[A] = F[($ = u & ($ + y[A % S] + (w = F[A])))]), (F[$] = w) T.g = function (Y) { for (var ae, re = 0, ie = T.i, oe = T.j, j = T.S; Y--; ) (ae = j[(ie = u & (ie + 1))]), (re = re * o + j[u & ((j[ie] = j[(oe = u & (oe + ae))]) + (j[oe] = ae))]) return (T.i = ie), (T.j = oe), re } } function b(y, w) { return (w.i = y.i), (w.j = y.j), (w.S = y.S.slice()), w } function v(y, w) { var S = [], T = _typeof$1(y), A if (w && T == 'object') for (A in y) try { S.push(v(y[A], w - 1)) } catch {} return S.length ? S : T == 'string' ? y : y + '\0' } function k(y, w) { for (var S = y + '', T, A = 0; A < S.length; ) w[u & A] = u & ((T ^= w[u & A] * 19) + S.charCodeAt(A++)) return x(w) } function g() { try { var y = new Uint8Array(o) return (r.crypto || r.msCrypto).getRandomValues(y), x(y) } catch { var w = r.navigator, S = w && w.plugins return [+new Date(), r, S, r.screen, x(e)] } } function x(y) { return String.fromCharCode.apply(0, y) } k(t.random(), e) } function initialize$2(e) { seedRandom([], e) } var propTypes = { SHAPE: 'shape' } function _typeof(e) { return ( typeof Symbol == 'function' && typeof Symbol.iterator == 'symbol' ? (_typeof = function (r) { return typeof r }) : (_typeof = function (r) { return r && typeof Symbol == 'function' && r.constructor === Symbol && r !== Symbol.prototype ? 'symbol' : typeof r }), _typeof(e) ) } var ExpressionManager = (function () { var ob = {}, Math = BMMath, window = null, document = null, XMLHttpRequest = null, fetch = null, frames = null initialize$2(BMMath) function $bm_isInstanceOfArray(e) { return e.constructor === Array || e.constructor === Float32Array } function isNumerable(e, t) { return ( e === 'number' || e === 'boolean' || e === 'string' || t instanceof Number ) } function $bm_neg(e) { var t = _typeof(e) if (t === 'number' || t === 'boolean' || e instanceof Number) return -e if ($bm_isInstanceOfArray(e)) { var r, o = e.length, n = [] for (r = 0; r < o; r += 1) n[r] = -e[r] return n } return e.propType ? e.v : -e } var easeInBez = BezierFactory.getBezierEasing( 0.333, 0, 0.833, 0.833, 'easeIn' ).get, easeOutBez = BezierFactory.getBezierEasing( 0.167, 0.167, 0.667, 1, 'easeOut' ).get, easeInOutBez = BezierFactory.getBezierEasing( 0.33, 0, 0.667, 1, 'easeInOut' ).get function sum(e, t) { var r = _typeof(e), o = _typeof(t) if ( r === 'string' || o === 'string' || (isNumerable(r, e) && isNumerable(o, t)) ) return e + t if ($bm_isInstanceOfArray(e) && isNumerable(o, t)) return (e = e.slice(0)), (e[0] += t), e if (isNumerable(r, e) && $bm_isInstanceOfArray(t)) return (t = t.slice(0)), (t[0] = e + t[0]), t if ($bm_isInstanceOfArray(e) && $bm_isInstanceOfArray(t)) { for ( var n = 0, a = e.length, l = t.length, s = []; n < a || n < l; ) (typeof e[n] == 'number' || e[n] instanceof Number) && (typeof t[n] == 'number' || t[n] instanceof Number) ? (s[n] = e[n] + t[n]) : (s[n] = t[n] === void 0 ? e[n] : e[n] || t[n]), (n += 1) return s } return 0 } var add = sum function sub(e, t) { var r = _typeof(e), o = _typeof(t) if (isNumerable(r, e) && isNumerable(o, t)) return ( r === 'string' && (e = parseInt(e, 10)), o === 'string' && (t = parseInt(t, 10)), e - t ) if ($bm_isInstanceOfArray(e) && isNumerable(o, t)) return (e = e.slice(0)), (e[0] -= t), e if (isNumerable(r, e) && $bm_isInstanceOfArray(t)) return (t = t.slice(0)), (t[0] = e - t[0]), t if ($bm_isInstanceOfArray(e) && $bm_isInstanceOfArray(t)) { for ( var n = 0, a = e.length, l = t.length, s = []; n < a || n < l; ) (typeof e[n] == 'number' || e[n] instanceof Number) && (typeof t[n] == 'number' || t[n] instanceof Number) ? (s[n] = e[n] - t[n]) : (s[n] = t[n] === void 0 ? e[n] : e[n] || t[n]), (n += 1) return s } return 0 } function mul(e, t) { var r = _typeof(e), o = _typeof(t), n if (isNumerable(r, e) && isNumerable(o, t)) return e * t var a, l if ($bm_isInstanceOfArray(e) && isNumerable(o, t)) { for ( l = e.length, n = createTypedArray('float32', l), a = 0; a < l; a += 1 ) n[a] = e[a] * t return n } if (isNumerable(r, e) && $bm_isInstanceOfArray(t)) { for ( l = t.length, n = createTypedArray('float32', l), a = 0; a < l; a += 1 ) n[a] = e * t[a] return n } return 0 } function div(e, t) { var r = _typeof(e), o = _typeof(t), n if (isNumerable(r, e) && isNumerable(o, t)) return e / t var a, l if ($bm_isInstanceOfArray(e) && isNumerable(o, t)) { for ( l = e.length, n = createTypedArray('float32', l), a = 0; a < l; a += 1 ) n[a] = e[a] / t return n } if (isNumerable(r, e) && $bm_isInstanceOfArray(t)) { for ( l = t.length, n = createTypedArray('float32', l), a = 0; a < l; a += 1 ) n[a] = e / t[a] return n } return 0 } function mod(e, t) { return ( typeof e == 'string' && (e = parseInt(e, 10)), typeof t == 'string' && (t = parseInt(t, 10)), e % t ) } var $bm_sum = sum, $bm_sub = sub, $bm_mul = mul, $bm_div = div, $bm_mod = mod function clamp(e, t, r) { if (t > r) { var o = r ;(r = t), (t = o) } return Math.min(Math.max(e, t), r) } function radiansToDegrees(e) { return e / degToRads } var radians_to_degrees = radiansToDegrees function degreesToRadians(e) { return e * degToRads } var degrees_to_radians = radiansToDegrees, helperLengthArray = [0, 0, 0, 0, 0, 0] function length(e, t) { if (typeof e == 'number' || e instanceof Number) return (t = t || 0), Math.abs(e - t) t || (t = helperLengthArray) var r, o = Math.min(e.length, t.length), n = 0 for (r = 0; r < o; r += 1) n += Math.pow(t[r] - e[r], 2) return Math.sqrt(n) } function normalize(e) { return div(e, length(e)) } function rgbToHsl(e) { var t = e[0], r = e[1], o = e[2], n = Math.max(t, r, o), a = Math.min(t, r, o), l, s, c = (n + a) / 2 if (n === a) (l = 0), (s = 0) else { var d = n - a switch (((s = c > 0.5 ? d / (2 - n - a) : d / (n + a)), n)) { case t: l = (r - o) / d + (r < o ? 6 : 0) break case r: l = (o - t) / d + 2 break case o: l = (t - r) / d + 4 break } l /= 6 } return [l, s, c, e[3]] } function hue2rgb(e, t, r) { return ( r < 0 && (r += 1), r > 1 && (r -= 1), r < 1 / 6 ? e + (t - e) * 6 * r : r < 1 / 2 ? t : r < 2 / 3 ? e + (t - e) * (2 / 3 - r) * 6 : e ) } function hslToRgb(e) { var t = e[0], r = e[1], o = e[2], n, a, l if (r === 0) (n = o), (l = o), (a = o) else { var s = o < 0.5 ? o * (1 + r) : o + r - o * r, c = 2 * o - s ;(n = hue2rgb(c, s, t + 1 / 3)), (a = hue2rgb(c, s, t)), (l = hue2rgb(c, s, t - 1 / 3)) } return [n, a, l, e[3]] } function linear(e, t, r, o, n) { if ( ((o === void 0 || n === void 0) && ((o = t), (n = r), (t = 0), (r = 1)), r < t) ) { var a = r ;(r = t), (t = a) } if (e <= t) return o if (e >= r) return n var l = r === t ? 0 : (e - t) / (r - t) if (!o.length) return o + (n - o) * l var s, c = o.length, d = createTypedArray('float32', c) for (s = 0; s < c; s += 1) d[s] = o[s] + (n[s] - o[s]) * l return d } function random(e, t) { if ( (t === void 0 && (e === void 0 ? ((e = 0), (t = 1)) : ((t = e), (e = void 0))), t.length) ) { var r, o = t.length e || (e = createTypedArray('float32', o)) var n = createTypedArray('float32', o), a = BMMath.random() for (r = 0; r < o; r += 1) n[r] = e[r] + a * (t[r] - e[r]) return n } e === void 0 && (e = 0) var l = BMMath.random() return e + l * (t - e) } function createPath(e, t, r, o) { var n, a = e.length, l = shapePool.newElement() l.setPathData(!!o, a) var s = [0, 0], c, d for (n = 0; n < a; n += 1) (c = t && t[n] ? t[n] : s), (d = r && r[n] ? r[n] : s), l.setTripleAt( e[n][0], e[n][1], d[0] + e[n][0], d[1] + e[n][1], c[0] + e[n][0], c[1] + e[n][1], n, !0 ) return l } function initiateExpression(elem, data, property) { var val = data.x, needsVelocity = /velocity(?![\w\d])/.test(val), _needsRandom = val.indexOf('random') !== -1, elemType = elem.data.ty, transform, $bm_transform, content, effect, thisProperty = property ;(thisProperty.valueAtTime = thisProperty.getValueAtTime), Object.defineProperty(thisProperty, 'value', { get: function () { return thisProperty.v } }), (elem.comp.frameDuration = 1 / elem.comp.globalData.frameRate), (elem.comp.displayStartTime = 0) var inPoint = elem.data.ip / elem.comp.globalData.frameRate, outPoint = elem.data.op / elem.comp.globalData.frameRate, width = elem.data.sw ? elem.data.sw : 0, height = elem.data.sh ? elem.data.sh : 0, name = elem.data.nm, loopIn, loop_in, loopOut, loop_out, smooth, toWorld, fromWorld, fromComp, toComp, fromCompToSurface, position, rotation, anchorPoint, scale, thisLayer, thisComp, mask, valueAtTime, velocityAtTime, scoped_bm_rt, expression_function = eval( '[function _expression_function(){' + val + ';scoped_bm_rt=$bm_rt}]' )[0], numKeys = property.kf ? data.k.length : 0, active = !this.data || this.data.hd !== !0, wiggle = function e(t, r) { var o, n, a = this.pv.length ? this.pv.length : 1, l = createTypedArray('float32', a) t = 5 var s = Math.floor(time * t) for (o = 0, n = 0; o < s; ) { for (n = 0; n < a; n += 1) l[n] += -r + r * 2 * BMMath.random() o += 1 } var c = time * t, d = c - Math.floor(c), u = createTypedArray('float32', a) if (a > 1) { for (n = 0; n < a; n += 1) u[n] = this.pv[n] + l[n] + (-r + r * 2 * BMMath.random()) * d return u } return this.pv + l[0] + (-r + r * 2 * BMMath.random()) * d }.bind(this) thisProperty.loopIn && ((loopIn = thisProperty.loopIn.bind(thisProperty)), (loop_in = loopIn)), thisProperty.loopOut && ((loopOut = thisProperty.loopOut.bind(thisProperty)), (loop_out = loopOut)), thisProperty.smooth && (smooth = thisProperty.smooth.bind(thisProperty)) function loopInDuration(e, t) { return loopIn(e, t, !0) } function loopOutDuration(e, t) { return loopOut(e, t, !0) } this.getValueAtTime && (valueAtTime = this.getValueAtTime.bind(this)), this.getVelocityAtTime && (velocityAtTime = this.getVelocityAtTime.bind(this)) var comp = elem.comp.globalData.projectInterface.bind( elem.comp.globalData.projectInterface ) function lookAt(e, t) { var r = [t[0] - e[0], t[1] - e[1], t[2] - e[2]], o = Math.atan2(r[0], Math.sqrt(r[1] * r[1] + r[2] * r[2])) / degToRads, n = -Math.atan2(r[1], r[2]) / degToRads return [n, o, 0] } function easeOut(e, t, r, o, n) { return applyEase(easeOutBez, e, t, r, o, n) } function easeIn(e, t, r, o, n) { return applyEase(easeInBez, e, t, r, o, n) } function ease(e, t, r, o, n) { return applyEase(easeInOutBez, e, t, r, o, n) } function applyEase(e, t, r, o, n, a) { n === void 0 ? ((n = r), (a = o)) : (t = (t - r) / (o - r)), t > 1 ? (t = 1) : t < 0 && (t = 0) var l = e(t) if ($bm_isInstanceOfArray(n)) { var s, c = n.length, d = createTypedArray('float32', c) for (s = 0; s < c; s += 1) d[s] = (a[s] - n[s]) * l + n[s] return d } return (a - n) * l + n } function nearestKey(e) { var t, r = data.k.length, o, n if (!data.k.length || typeof data.k[0] == 'number') (o = 0), (n = 0) else if ( ((o = -1), (e *= elem.comp.globalData.frameRate), e < data.k[0].t) ) (o = 1), (n = data.k[0].t) else { for (t = 0; t < r - 1; t += 1) if (e === data.k[t].t) { ;(o = t + 1), (n = data.k[t].t) break } else if (e > data.k[t].t && e < data.k[t + 1].t) { e - data.k[t].t > data.k[t + 1].t - e ? ((o = t + 2), (n = data.k[t + 1].t)) : ((o = t + 1), (n = data.k[t].t)) break } o === -1 && ((o = t + 1), (n = data.k[t].t)) } var a = {} return ( (a.index = o), (a.time = n / elem.comp.globalData.frameRate), a ) } function key(e) { var t, r, o if (!data.k.length || typeof data.k[0] == 'number') throw new Error('The property has no keyframe at index ' + e) ;(e -= 1), (t = { time: data.k[e].t / elem.comp.globalData.frameRate, value: [] }) var n = Object.prototype.hasOwnProperty.call(data.k[e], 's') ? data.k[e].s : data.k[e - 1].e for (o = n.length, r = 0; r < o; r += 1) (t[r] = n[r]), (t.value[r] = n[r]) return t } function framesToTime(e, t) { return t || (t = elem.comp.globalData.frameRate), e / t } function timeToFrames(e, t) { return ( !e && e !== 0 && (e = time), t || (t = elem.comp.globalData.frameRate), e * t ) } function seedRandom(e) { BMMath.seedrandom(randSeed + e) } function sourceRectAtTime() { return elem.sourceRectAtTime() } function substring(e, t) { return typeof value == 'string' ? t === void 0 ? value.substring(e) : value.substring(e, t) : '' } function substr(e, t) { return typeof value == 'string' ? t === void 0 ? value.substr(e) : value.substr(e, t) : '' } function posterizeTime(e) { ;(time = e === 0 ? 0 : Math.floor(time * e) / e), (value = valueAtTime(time)) } var time, velocity, value, text, textIndex, textTotal, selectorValue, index = elem.data.ind, hasParent = !!(elem.hierarchy && elem.hierarchy.length), parent, randSeed = Math.floor(Math.random() * 1e6), globalData = elem.globalData function executeExpression(e) { return ( (value = e), this.frameExpressionId === elem.globalData.frameId && this.propType !== 'textSelector' ? value : (this.propType === 'textSelector' && ((textIndex = this.textIndex), (textTotal = this.textTotal), (selectorValue = this.selectorValue)), thisLayer || ((text = elem.layerInterface.text), (thisLayer = elem.layerInterface), (thisComp = elem.comp.compInterface), (toWorld = thisLayer.toWorld.bind(thisLayer)), (fromWorld = thisLayer.fromWorld.bind(thisLayer)), (fromComp = thisLayer.fromComp.bind(thisLayer)), (toComp = thisLayer.toComp.bind(thisLayer)), (mask = thisLayer.mask ? thisLayer.mask.bind(thisLayer) : null), (fromCompToSurface = fromComp)), transform || ((transform = elem.layerInterface( 'ADBE Transform Group' )), ($bm_transform = transform), transform && (anchorPoint = transform.anchorPoint)), elemType === 4 && !content && (content = thisLayer('ADBE Root Vectors Group')), effect || (effect = thisLayer(4)), (hasParent = !!(elem.hierarchy && elem.hierarchy.length)), hasParent && !parent && (parent = elem.hierarchy[0].layerInterface), (time = this.comp.renderedFrame / this.comp.globalData.frameRate), _needsRandom && seedRandom(randSeed + time), needsVelocity && (velocity = velocityAtTime(time)), expression_function(), (this.frameExpressionId = elem.globalData.frameId), (scoped_bm_rt = scoped_bm_rt.propType === propTypes.SHAPE ? scoped_bm_rt.v : scoped_bm_rt), scoped_bm_rt) ) } return ( (executeExpression.__preventDeadCodeRemoval = [ $bm_transform, anchorPoint, time, velocity, inPoint, outPoint, width, height, name, loop_in, loop_out, smooth, toComp, fromCompToSurface, toWorld, fromWorld, mask, position, rotation, scale, thisComp, numKeys, active, wiggle, loopInDuration, loopOutDuration, comp, lookAt, easeOut, easeIn, ease, nearestKey, key, text, textIndex, textTotal, selectorValue, framesToTime, timeToFrames, sourceRectAtTime, substring, substr, posterizeTime, index, globalData ]), executeExpression ) } return ( (ob.initiateExpression = initiateExpression), (ob.__preventDeadCodeRemoval = [ window, document, XMLHttpRequest, fetch, frames, $bm_neg, add, $bm_sum, $bm_sub, $bm_mul, $bm_div, $bm_mod, clamp, radians_to_degrees, degreesToRadians, degrees_to_radians, normalize, rgbToHsl, hslToRgb, linear, random, createPath ]), ob ) })(), expressionHelpers = (function () { function e(l, s, c) { s.x && ((c.k = !0), (c.x = !0), (c.initiateExpression = ExpressionManager.initiateExpression), c.effectsSequence.push(c.initiateExpression(l, s, c).bind(c))) } function t(l) { return ( (l *= this.elem.globalData.frameRate), (l -= this.offsetTime), l !== this._cachingAtTime.lastFrame && ((this._cachingAtTime.lastIndex = this._cachingAtTime.lastFrame < l ? this._cachingAtTime.lastIndex : 0), (this._cachingAtTime.value = this.interpolateValue( l, this._cachingAtTime )), (this._cachingAtTime.lastFrame = l)), this._cachingAtTime.value ) } function r(l) { var s = -0.01, c = this.getValueAtTime(l), d = this.getValueAtTime(l + s), u = 0 if (c.length) { var m for (m = 0; m < c.length; m += 1) u += Math.pow(d[m] - c[m], 2) u = Math.sqrt(u) * 100 } else u = 0 return u } function o(l) { if (this.vel !== void 0) return this.vel var s = -0.001, c = this.getValueAtTime(l), d = this.getValueAtTime(l + s), u if (c.length) { u = createTypedArray('float32', c.length) var m for (m = 0; m < c.length; m += 1) u[m] = (d[m] - c[m]) / s } else u = (d - c) / s return u } function n() { return this.pv } function a(l) { this.propertyGroup = l } return { searchExpressions: e, getSpeedAtTime: r, getVelocityAtTime: o, getValueAtTime: t, getStaticValueAtTime: n, setGroupProperty: a } })() function addPropertyDecorator() { function e(f, _, b) { if (!this.k || !this.keyframes) return this.pv f = f ? f.toLowerCase() : '' var v = this.comp.renderedFrame, k = this.keyframes, g = k[k.length - 1].t if (v <= g) return this.pv var x, y b ? (_ ? (x = Math.abs(g - this.elem.comp.globalData.frameRate * _)) : (x = Math.max(0, g - this.elem.data.ip)), (y = g - x)) : ((!_ || _ > k.length - 1) && (_ = k.length - 1), (y = k[k.length - 1 - _].t), (x = g - y)) var w, S, T if (f === 'pingpong') { var A = Math.floor((v - y) / x) if (A % 2 !== 0) return this.getValueAtTime( (x - ((v - y) % x) + y) / this.comp.globalData.frameRate, 0 ) } else if (f === 'offset') { var $ = this.getValueAtTime(y / this.comp.globalData.frameRate, 0), F = this.getValueAtTime(g / this.comp.globalData.frameRate, 0), Y = this.getValueAtTime( (((v - y) % x) + y) / this.comp.globalData.frameRate, 0 ), ae = Math.floor((v - y) / x) if (this.pv.length) { for (T = new Array($.length), S = T.length, w = 0; w < S; w += 1) T[w] = (F[w] - $[w]) * ae + Y[w] return T } return (F - $) * ae + Y } else if (f === 'continue') { var re = this.getValueAtTime(g / this.comp.globalData.frameRate, 0), ie = this.getValueAtTime( (g - 0.001) / this.comp.globalData.frameRate, 0 ) if (this.pv.length) { for (T = new Array(re.length), S = T.length, w = 0; w < S; w += 1) T[w] = re[w] + ((re[w] - ie[w]) * ((v - g) / this.comp.globalData.frameRate)) / 5e-4 return T } return re + (re - ie) * ((v - g) / 0.001) } return this.getValueAtTime( (((v - y) % x) + y) / this.comp.globalData.frameRate, 0 ) } function t(f, _, b) { if (!this.k) return this.pv f = f ? f.toLowerCase() : '' var v = this.comp.renderedFrame, k = this.keyframes, g = k[0].t if (v >= g) return this.pv var x, y b ? (_ ? (x = Math.abs(this.elem.comp.globalData.frameRate * _)) : (x = Math.max(0, this.elem.data.op - g)), (y = g + x)) : ((!_ || _ > k.length - 1) && (_ = k.length - 1), (y = k[_].t), (x = y - g)) var w, S, T if (f === 'pingpong') { var A = Math.floor((g - v) / x) if (A % 2 === 0) return this.getValueAtTime( (((g - v) % x) + g) / this.comp.globalData.frameRate, 0 ) } else if (f === 'offset') { var $ = this.getValueAtTime(g / this.comp.globalData.frameRate, 0), F = this.getValueAtTime(y / this.comp.globalData.frameRate, 0), Y = this.getValueAtTime( (x - ((g - v) % x) + g) / this.comp.globalData.frameRate, 0 ), ae = Math.floor((g - v) / x) + 1 if (this.pv.length) { for (T = new Array($.length), S = T.length, w = 0; w < S; w += 1) T[w] = Y[w] - (F[w] - $[w]) * ae return T } return Y - (F - $) * ae } else if (f === 'continue') { var re = this.getValueAtTime(g / this.comp.globalData.frameRate, 0), ie = this.getValueAtTime( (g + 0.001) / this.comp.globalData.frameRate, 0 ) if (this.pv.length) { for (T = new Array(re.length), S = T.length, w = 0; w < S; w += 1) T[w] = re[w] + ((re[w] - ie[w]) * (g - v)) / 0.001 return T } return re + ((re - ie) * (g - v)) / 0.001 } return this.getValueAtTime( (x - (((g - v) % x) + g)) / this.comp.globalData.frameRate, 0 ) } function r(f, _) { if (!this.k) return this.pv if (((f = (f || 0.4) * 0.5), (_ = Math.floor(_ || 5)), _ <= 1)) return this.pv var b = this.comp.renderedFrame / this.comp.globalData.frameRate, v = b - f, k = b + f, g = _ > 1 ? (k - v) / (_ - 1) : 1, x = 0, y = 0, w this.pv.length ? (w = createTypedArray('float32', this.pv.length)) : (w = 0) for (var S; x < _; ) { if (((S = this.getValueAtTime(v + x * g)), this.pv.length)) for (y = 0; y < this.pv.length; y += 1) w[y] += S[y] else w += S x += 1 } if (this.pv.length) for (y = 0; y < this.pv.length; y += 1) w[y] /= _ else w /= _ return w } function o(f) { this._transformCachingAtTime || (this._transformCachingAtTime = { v: new Matrix() }) var _ = this._transformCachingAtTime.v if ( (_.cloneFromProps(this.pre.props), this.appliedTransformations < 1) ) { var b = this.a.getValueAtTime(f) _.translate( -b[0] * this.a.mult, -b[1] * this.a.mult, b[2] * this.a.mult ) } if (this.appliedTransformations < 2) { var v = this.s.getValueAtTime(f) _.scale(v[0] * this.s.mult, v[1] * this.s.mult, v[2] * this.s.mult) } if (this.sk && this.appliedTransformations < 3) { var k = this.sk.getValueAtTime(f), g = this.sa.getValueAtTime(f) _.skewFromAxis(-k * this.sk.mult, g * this.sa.mult) } if (this.r && this.appliedTransformations < 4) { var x = this.r.getValueAtTime(f) _.rotate(-x * this.r.mult) } else if (!this.r && this.appliedTransformations < 4) { var y = this.rz.getValueAtTime(f), w = this.ry.getValueAtTime(f), S = this.rx.getValueAtTime(f), T = this.or.getValueAtTime(f) _.rotateZ(-y * this.rz.mult) .rotateY(w * this.ry.mult) .rotateX(S * this.rx.mult) .rotateZ(-T[2] * this.or.mult) .rotateY(T[1] * this.or.mult) .rotateX(T[0] * this.or.mult) } if (this.data.p && this.data.p.s) { var A = this.px.getValueAtTime(f), $ = this.py.getValueAtTime(f) if (this.data.p.z) { var F = this.pz.getValueAtTime(f) _.translate(A * this.px.mult, $ * this.py.mult, -F * this.pz.mult) } else _.translate(A * this.px.mult, $ * this.py.mult, 0) } else { var Y = this.p.getValueAtTime(f) _.translate( Y[0] * this.p.mult, Y[1] * this.p.mult, -Y[2] * this.p.mult ) } return _ } function n() { return this.v.clone(new Matrix()) } var a = TransformPropertyFactory.getTransformProperty TransformPropertyFactory.getTransformProperty = function (f, _, b) { var v = a(f, _, b) return ( v.dynamicProperties.length ? (v.getValueAtTime = o.bind(v)) : (v.getValueAtTime = n.bind(v)), (v.setGroupProperty = expressionHelpers.setGroupProperty), v ) } var l = PropertyFactory.getProp PropertyFactory.getProp = function (f, _, b, v, k) { var g = l(f, _, b, v, k) g.kf ? (g.getValueAtTime = expressionHelpers.getValueAtTime.bind(g)) : (g.getValueAtTime = expressionHelpers.getStaticValueAtTime.bind(g)), (g.setGroupProperty = expressionHelpers.setGroupProperty), (g.loopOut = e), (g.loopIn = t), (g.smooth = r), (g.getVelocityAtTime = expressionHelpers.getVelocityAtTime.bind(g)), (g.getSpeedAtTime = expressionHelpers.getSpeedAtTime.bind(g)), (g.numKeys = _.a === 1 ? _.k.length : 0), (g.propertyIndex = _.ix) var x = 0 return ( b !== 0 && (x = createTypedArray( 'float32', _.a === 1 ? _.k[0].s.length : _.k.length )), (g._cachingAtTime = { lastFrame: initialDefaultFrame, lastIndex: 0, value: x }), expressionHelpers.searchExpressions(f, _, g), g.k && k.addDynamicProperty(g), g ) } function s(f) { return ( this._cachingAtTime || (this._cachingAtTime = { shapeValue: shapePool.clone(this.pv), lastIndex: 0, lastTime: initialDefaultFrame }), (f *= this.elem.globalData.frameRate), (f -= this.offsetTime), f !== this._cachingAtTime.lastTime && ((this._cachingAtTime.lastIndex = this._cachingAtTime.lastTime < f ? this._caching.lastIndex : 0), (this._cachingAtTime.lastTime = f), this.interpolateShape( f, this._cachingAtTime.shapeValue, this._cachingAtTime )), this._cachingAtTime.shapeValue ) } var c = ShapePropertyFactory.getConstructorFunction(), d = ShapePropertyFactory.getKeyframedConstructorFunction() function u() {} ;(u.prototype = { vertices: function (_, b) { this.k && this.getValue() var v = this.v b !== void 0 && (v = this.getValueAtTime(b, 0)) var k, g = v._length, x = v[_], y = v.v, w = createSizedArray(g) for (k = 0; k < g; k += 1) _ === 'i' || _ === 'o' ? (w[k] = [x[k][0] - y[k][0], x[k][1] - y[k][1]]) : (w[k] = [x[k][0], x[k][1]]) return w }, points: function (_) { return this.vertices('v', _) }, inTangents: function (_) { return this.vertices('i', _) }, outTangents: function (_) { return this.vertices('o', _) }, isClosed: function () { return this.v.c }, pointOnPath: function (_, b) { var v = this.v b !== void 0 && (v = this.getValueAtTime(b, 0)), this._segmentsLength || (this._segmentsLength = bez.getSegmentsLength(v)) for ( var k = this._segmentsLength, g = k.lengths, x = k.totalLength * _, y = 0, w = g.length, S = 0, T; y < w; ) { if (S + g[y].addedLength > x) { var A = y, $ = v.c && y === w - 1 ? 0 : y + 1, F = (x - S) / g[y].addedLength T = bez.getPointInSegment( v.v[A], v.v[$], v.o[A], v.i[$], F, g[y] ) break } else S += g[y].addedLength y += 1 } return ( T || (T = v.c ? [v.v[0][0], v.v[0][1]] : [v.v[v._length - 1][0], v.v[v._length - 1][1]]), T ) }, vectorOnPath: function (_, b, v) { _ == 1 ? (_ = this.v.c) : _ == 0 && (_ = 0.999) var k = this.pointOnPath(_, b), g = this.pointOnPath(_ + 0.001, b), x = g[0] - k[0], y = g[1] - k[1], w = Math.sqrt(Math.pow(x, 2) + Math.pow(y, 2)) if (w === 0) return [0, 0] var S = v === 'tangent' ? [x / w, y / w] : [-y / w, x / w] return S }, tangentOnPath: function (_, b) { return this.vectorOnPath(_, b, 'tangent') }, normalOnPath: function (_, b) { return this.vectorOnPath(_, b, 'normal') }, setGroupProperty: expressionHelpers.setGroupProperty, getValueAtTime: expressionHelpers.getStaticValueAtTime }), extendPrototype([u], c), extendPrototype([u], d), (d.prototype.getValueAtTime = s), (d.prototype.initiateExpression = ExpressionManager.initiateExpression) var m = ShapePropertyFactory.getShapeProp ShapePropertyFactory.getShapeProp = function (f, _, b, v, k) { var g = m(f, _, b, v, k) return ( (g.propertyIndex = _.ix), (g.lock = !1), b === 3 ? expressionHelpers.searchExpressions(f, _.pt, g) : b === 4 && expressionHelpers.searchExpressions(f, _.ks, g), g.k && f.addDynamicProperty(g), g ) } } function initialize$1() { addPropertyDecorator() } function addDecorator() { function e() { return this.data.d.x ? ((this.calculateExpression = ExpressionManager.initiateExpression.bind(this)( this.elem, this.data.d, this )), this.addEffect(this.getExpressionValue.bind(this)), !0) : null } ;(TextProperty.prototype.getExpressionValue = function (t, r) { var o = this.calculateExpression(r) if (t.t !== o) { var n = {} return ( this.copyData(n, t), (n.t = o.toString()), (n.__complete = !1), n ) } return t }), (TextProperty.prototype.searchProperty = function () { var t = this.searchKeyframes(), r = this.searchExpressions() return (this.kf = t || r), this.kf }), (TextProperty.prototype.searchExpressions = e) } function initialize() { addDecorator() } function SVGComposableEffect() {} SVGComposableEffect.prototype = { createMergeNode: function e(t, r) { var o = createNS('feMerge') o.setAttribute('result', t) var n, a for (a = 0; a < r.length; a += 1) (n = createNS('feMergeNode')), n.setAttribute('in', r[a]), o.appendChild(n), o.appendChild(n) return o } } function SVGTintFilter(e, t, r, o, n) { this.filterManager = t var a = createNS('feColorMatrix') a.setAttribute('type', 'matrix'), a.setAttribute('color-interpolation-filters', 'linearRGB'), a.setAttribute( 'values', '0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0 0 0 1 0' ), a.setAttribute('result', o + '_tint_1'), e.appendChild(a), (a = createNS('feColorMatrix')), a.setAttribute('type', 'matrix'), a.setAttribute('color-interpolation-filters', 'sRGB'), a.setAttribute('values', '1 0 0 0 0 0 1 0 0 0 0 0 1 0 0 0 0 0 1 0'), a.setAttribute('result', o + '_tint_2'), e.appendChild(a), (this.matrixFilter = a) var l = this.createMergeNode(o, [n, o + '_tint_1', o + '_tint_2']) e.appendChild(l) } extendPrototype([SVGComposableEffect], SVGTintFilter), (SVGTintFilter.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { var t = this.filterManager.effectElements[0].p.v, r = this.filterManager.effectElements[1].p.v, o = this.filterManager.effectElements[2].p.v / 100 this.matrixFilter.setAttribute( 'values', r[0] - t[0] + ' 0 0 0 ' + t[0] + ' ' + (r[1] - t[1]) + ' 0 0 0 ' + t[1] + ' ' + (r[2] - t[2]) + ' 0 0 0 ' + t[2] + ' 0 0 0 ' + o + ' 0' ) } }) function SVGFillFilter(e, t, r, o) { this.filterManager = t var n = createNS('feColorMatrix') n.setAttribute('type', 'matrix'), n.setAttribute('color-interpolation-filters', 'sRGB'), n.setAttribute('values', '1 0 0 0 0 0 1 0 0 0 0 0 1 0 0 0 0 0 1 0'), n.setAttribute('result', o), e.appendChild(n), (this.matrixFilter = n) } SVGFillFilter.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { var t = this.filterManager.effectElements[2].p.v, r = this.filterManager.effectElements[6].p.v this.matrixFilter.setAttribute( 'values', '0 0 0 0 ' + t[0] + ' 0 0 0 0 ' + t[1] + ' 0 0 0 0 ' + t[2] + ' 0 0 0 ' + r + ' 0' ) } } function SVGStrokeEffect(e, t, r) { ;(this.initialized = !1), (this.filterManager = t), (this.elem = r), (this.paths = []) } ;(SVGStrokeEffect.prototype.initialize = function () { var e = this.elem.layerElement.children || this.elem.layerElement.childNodes, t, r, o, n for ( this.filterManager.effectElements[1].p.v === 1 ? ((n = this.elem.maskManager.masksProperties.length), (o = 0)) : ((o = this.filterManager.effectElements[0].p.v - 1), (n = o + 1)), r = createNS('g'), r.setAttribute('fill', 'none'), r.setAttribute('stroke-linecap', 'round'), r.setAttribute('stroke-dashoffset', 1), o; o < n; o += 1 ) (t = createNS('path')), r.appendChild(t), this.paths.push({ p: t, m: o }) if (this.filterManager.effectElements[10].p.v === 3) { var a = createNS('mask'), l = createElementID() a.setAttribute('id', l), a.setAttribute('mask-type', 'alpha'), a.appendChild(r), this.elem.globalData.defs.appendChild(a) var s = createNS('g') for ( s.setAttribute('mask', 'url(' + getLocationHref() + '#' + l + ')'); e[0]; ) s.appendChild(e[0]) this.elem.layerElement.appendChild(s), (this.masker = a), r.setAttribute('stroke', '#fff') } else if ( this.filterManager.effectElements[10].p.v === 1 || this.filterManager.effectElements[10].p.v === 2 ) { if (this.filterManager.effectElements[10].p.v === 2) for ( e = this.elem.layerElement.children || this.elem.layerElement.childNodes; e.length; ) this.elem.layerElement.removeChild(e[0]) this.elem.layerElement.appendChild(r), this.elem.layerElement.removeAttribute('mask'), r.setAttribute('stroke', '#fff') } ;(this.initialized = !0), (this.pathMasker = r) }), (SVGStrokeEffect.prototype.renderFrame = function (e) { this.initialized || this.initialize() var t, r = this.paths.length, o, n for (t = 0; t < r; t += 1) if ( this.paths[t].m !== -1 && ((o = this.elem.maskManager.viewData[this.paths[t].m]), (n = this.paths[t].p), (e || this.filterManager._mdf || o.prop._mdf) && n.setAttribute('d', o.lastPath), e || this.filterManager.effectElements[9].p._mdf || this.filterManager.effectElements[4].p._mdf || this.filterManager.effectElements[7].p._mdf || this.filterManager.effectElements[8].p._mdf || o.prop._mdf) ) { var a if ( this.filterManager.effectElements[7].p.v !== 0 || this.filterManager.effectElements[8].p.v !== 100 ) { var l = Math.min( this.filterManager.effectElements[7].p.v, this.filterManager.effectElements[8].p.v ) * 0.01, s = Math.max( this.filterManager.effectElements[7].p.v, this.filterManager.effectElements[8].p.v ) * 0.01, c = n.getTotalLength() a = '0 0 0 ' + c * l + ' ' var d = c * (s - l), u = 1 + this.filterManager.effectElements[4].p.v * 2 * this.filterManager.effectElements[9].p.v * 0.01, m = Math.floor(d / u), f for (f = 0; f < m; f += 1) a += '1 ' + this.filterManager.effectElements[4].p.v * 2 * this.filterManager.effectElements[9].p.v * 0.01 + ' ' a += '0 ' + c * 10 + ' 0 0' } else a = '1 ' + this.filterManager.effectElements[4].p.v * 2 * this.filterManager.effectElements[9].p.v * 0.01 n.setAttribute('stroke-dasharray', a) } if ( ((e || this.filterManager.effectElements[4].p._mdf) && this.pathMasker.setAttribute( 'stroke-width', this.filterManager.effectElements[4].p.v * 2 ), (e || this.filterManager.effectElements[6].p._mdf) && this.pathMasker.setAttribute( 'opacity', this.filterManager.effectElements[6].p.v ), (this.filterManager.effectElements[10].p.v === 1 || this.filterManager.effectElements[10].p.v === 2) && (e || this.filterManager.effectElements[3].p._mdf)) ) { var _ = this.filterManager.effectElements[3].p.v this.pathMasker.setAttribute( 'stroke', 'rgb(' + bmFloor(_[0] * 255) + ',' + bmFloor(_[1] * 255) + ',' + bmFloor(_[2] * 255) + ')' ) } }) function SVGTritoneFilter(e, t, r, o) { this.filterManager = t var n = createNS('feColorMatrix') n.setAttribute('type', 'matrix'), n.setAttribute('color-interpolation-filters', 'linearRGB'), n.setAttribute( 'values', '0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0 0 0 1 0' ), e.appendChild(n) var a = createNS('feComponentTransfer') a.setAttribute('color-interpolation-filters', 'sRGB'), a.setAttribute('result', o), (this.matrixFilter = a) var l = createNS('feFuncR') l.setAttribute('type', 'table'), a.appendChild(l), (this.feFuncR = l) var s = createNS('feFuncG') s.setAttribute('type', 'table'), a.appendChild(s), (this.feFuncG = s) var c = createNS('feFuncB') c.setAttribute('type', 'table'), a.appendChild(c), (this.feFuncB = c), e.appendChild(a) } SVGTritoneFilter.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { var t = this.filterManager.effectElements[0].p.v, r = this.filterManager.effectElements[1].p.v, o = this.filterManager.effectElements[2].p.v, n = o[0] + ' ' + r[0] + ' ' + t[0], a = o[1] + ' ' + r[1] + ' ' + t[1], l = o[2] + ' ' + r[2] + ' ' + t[2] this.feFuncR.setAttribute('tableValues', n), this.feFuncG.setAttribute('tableValues', a), this.feFuncB.setAttribute('tableValues', l) } } function SVGProLevelsFilter(e, t, r, o) { this.filterManager = t var n = this.filterManager.effectElements, a = createNS('feComponentTransfer') ;(n[10].p.k || n[10].p.v !== 0 || n[11].p.k || n[11].p.v !== 1 || n[12].p.k || n[12].p.v !== 1 || n[13].p.k || n[13].p.v !== 0 || n[14].p.k || n[14].p.v !== 1) && (this.feFuncR = this.createFeFunc('feFuncR', a)), (n[17].p.k || n[17].p.v !== 0 || n[18].p.k || n[18].p.v !== 1 || n[19].p.k || n[19].p.v !== 1 || n[20].p.k || n[20].p.v !== 0 || n[21].p.k || n[21].p.v !== 1) && (this.feFuncG = this.createFeFunc('feFuncG', a)), (n[24].p.k || n[24].p.v !== 0 || n[25].p.k || n[25].p.v !== 1 || n[26].p.k || n[26].p.v !== 1 || n[27].p.k || n[27].p.v !== 0 || n[28].p.k || n[28].p.v !== 1) && (this.feFuncB = this.createFeFunc('feFuncB', a)), (n[31].p.k || n[31].p.v !== 0 || n[32].p.k || n[32].p.v !== 1 || n[33].p.k || n[33].p.v !== 1 || n[34].p.k || n[34].p.v !== 0 || n[35].p.k || n[35].p.v !== 1) && (this.feFuncA = this.createFeFunc('feFuncA', a)), (this.feFuncR || this.feFuncG || this.feFuncB || this.feFuncA) && (a.setAttribute('color-interpolation-filters', 'sRGB'), e.appendChild(a)), (n[3].p.k || n[3].p.v !== 0 || n[4].p.k || n[4].p.v !== 1 || n[5].p.k || n[5].p.v !== 1 || n[6].p.k || n[6].p.v !== 0 || n[7].p.k || n[7].p.v !== 1) && ((a = createNS('feComponentTransfer')), a.setAttribute('color-interpolation-filters', 'sRGB'), a.setAttribute('result', o), e.appendChild(a), (this.feFuncRComposed = this.createFeFunc('feFuncR', a)), (this.feFuncGComposed = this.createFeFunc('feFuncG', a)), (this.feFuncBComposed = this.createFeFunc('feFuncB', a))) } ;(SVGProLevelsFilter.prototype.createFeFunc = function (e, t) { var r = createNS(e) return r.setAttribute('type', 'table'), t.appendChild(r), r }), (SVGProLevelsFilter.prototype.getTableValue = function (e, t, r, o, n) { for ( var a = 0, l = 256, s, c = Math.min(e, t), d = Math.max(e, t), u = Array.call(null, { length: l }), m, f = 0, _ = n - o, b = t - e; a <= 256; ) (s = a / 256), s <= c ? (m = b < 0 ? n : o) : s >= d ? (m = b < 0 ? o : n) : (m = o + _ * Math.pow((s - e) / b, 1 / r)), (u[f] = m), (f += 1), (a += 256 / (l - 1)) return u.join(' ') }), (SVGProLevelsFilter.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { var t, r = this.filterManager.effectElements this.feFuncRComposed && (e || r[3].p._mdf || r[4].p._mdf || r[5].p._mdf || r[6].p._mdf || r[7].p._mdf) && ((t = this.getTableValue( r[3].p.v, r[4].p.v, r[5].p.v, r[6].p.v, r[7].p.v )), this.feFuncRComposed.setAttribute('tableValues', t), this.feFuncGComposed.setAttribute('tableValues', t), this.feFuncBComposed.setAttribute('tableValues', t)), this.feFuncR && (e || r[10].p._mdf || r[11].p._mdf || r[12].p._mdf || r[13].p._mdf || r[14].p._mdf) && ((t = this.getTableValue( r[10].p.v, r[11].p.v, r[12].p.v, r[13].p.v, r[14].p.v )), this.feFuncR.setAttribute('tableValues', t)), this.feFuncG && (e || r[17].p._mdf || r[18].p._mdf || r[19].p._mdf || r[20].p._mdf || r[21].p._mdf) && ((t = this.getTableValue( r[17].p.v, r[18].p.v, r[19].p.v, r[20].p.v, r[21].p.v )), this.feFuncG.setAttribute('tableValues', t)), this.feFuncB && (e || r[24].p._mdf || r[25].p._mdf || r[26].p._mdf || r[27].p._mdf || r[28].p._mdf) && ((t = this.getTableValue( r[24].p.v, r[25].p.v, r[26].p.v, r[27].p.v, r[28].p.v )), this.feFuncB.setAttribute('tableValues', t)), this.feFuncA && (e || r[31].p._mdf || r[32].p._mdf || r[33].p._mdf || r[34].p._mdf || r[35].p._mdf) && ((t = this.getTableValue( r[31].p.v, r[32].p.v, r[33].p.v, r[34].p.v, r[35].p.v )), this.feFuncA.setAttribute('tableValues', t)) } }) function SVGDropShadowEffect(e, t, r, o, n) { var a = t.container.globalData.renderConfig.filterSize, l = t.data.fs || a e.setAttribute('x', l.x || a.x), e.setAttribute('y', l.y || a.y), e.setAttribute('width', l.width || a.width), e.setAttribute('height', l.height || a.height), (this.filterManager = t) var s = createNS('feGaussianBlur') s.setAttribute('in', 'SourceAlpha'), s.setAttribute('result', o + '_drop_shadow_1'), s.setAttribute('stdDeviation', '0'), (this.feGaussianBlur = s), e.appendChild(s) var c = createNS('feOffset') c.setAttribute('dx', '25'), c.setAttribute('dy', '0'), c.setAttribute('in', o + '_drop_shadow_1'), c.setAttribute('result', o + '_drop_shadow_2'), (this.feOffset = c), e.appendChild(c) var d = createNS('feFlood') d.setAttribute('flood-color', '#00ff00'), d.setAttribute('flood-opacity', '1'), d.setAttribute('result', o + '_drop_shadow_3'), (this.feFlood = d), e.appendChild(d) var u = createNS('feComposite') u.setAttribute('in', o + '_drop_shadow_3'), u.setAttribute('in2', o + '_drop_shadow_2'), u.setAttribute('operator', 'in'), u.setAttribute('result', o + '_drop_shadow_4'), e.appendChild(u) var m = this.createMergeNode(o, [o + '_drop_shadow_4', n]) e.appendChild(m) } extendPrototype([SVGComposableEffect], SVGDropShadowEffect), (SVGDropShadowEffect.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { if ( ((e || this.filterManager.effectElements[4].p._mdf) && this.feGaussianBlur.setAttribute( 'stdDeviation', this.filterManager.effectElements[4].p.v / 4 ), e || this.filterManager.effectElements[0].p._mdf) ) { var t = this.filterManager.effectElements[0].p.v this.feFlood.setAttribute( 'flood-color', rgbToHex( Math.round(t[0] * 255), Math.round(t[1] * 255), Math.round(t[2] * 255) ) ) } if ( ((e || this.filterManager.effectElements[1].p._mdf) && this.feFlood.setAttribute( 'flood-opacity', this.filterManager.effectElements[1].p.v / 255 ), e || this.filterManager.effectElements[2].p._mdf || this.filterManager.effectElements[3].p._mdf) ) { var r = this.filterManager.effectElements[3].p.v, o = (this.filterManager.effectElements[2].p.v - 90) * degToRads, n = r * Math.cos(o), a = r * Math.sin(o) this.feOffset.setAttribute('dx', n), this.feOffset.setAttribute('dy', a) } } }) var _svgMatteSymbols = [] function SVGMatte3Effect(e, t, r) { ;(this.initialized = !1), (this.filterManager = t), (this.filterElem = e), (this.elem = r), (r.matteElement = createNS('g')), r.matteElement.appendChild(r.layerElement), r.matteElement.appendChild(r.transformedElement), (r.baseElement = r.matteElement) } ;(SVGMatte3Effect.prototype.findSymbol = function (e) { for (var t = 0, r = _svgMatteSymbols.length; t < r; ) { if (_svgMatteSymbols[t] === e) return _svgMatteSymbols[t] t += 1 } return null }), (SVGMatte3Effect.prototype.replaceInParent = function (e, t) { var r = e.layerElement.parentNode if (!!r) { for ( var o = r.children, n = 0, a = o.length; n < a && o[n] !== e.layerElement; ) n += 1 var l n <= a - 2 && (l = o[n + 1]) var s = createNS('use') s.setAttribute('href', '#' + t), l ? r.insertBefore(s, l) : r.appendChild(s) } }), (SVGMatte3Effect.prototype.setElementAsMask = function (e, t) { if (!this.findSymbol(t)) { var r = createElementID(), o = createNS('mask') o.setAttribute('id', t.layerId), o.setAttribute('mask-type', 'alpha'), _svgMatteSymbols.push(t) var n = e.globalData.defs n.appendChild(o) var a = createNS('symbol') a.setAttribute('id', r), this.replaceInParent(t, r), a.appendChild(t.layerElement), n.appendChild(a) var l = createNS('use') l.setAttribute('href', '#' + r), o.appendChild(l), (t.data.hd = !1), t.show() } e.setMatte(t.layerId) }), (SVGMatte3Effect.prototype.initialize = function () { for ( var e = this.filterManager.effectElements[0].p.v, t = this.elem.comp.elements, r = 0, o = t.length; r < o; ) t[r] && t[r].data.ind === e && this.setElementAsMask(this.elem, t[r]), (r += 1) this.initialized = !0 }), (SVGMatte3Effect.prototype.renderFrame = function () { this.initialized || this.initialize() }) function SVGGaussianBlurEffect(e, t, r, o) { e.setAttribute('x', '-100%'), e.setAttribute('y', '-100%'), e.setAttribute('width', '300%'), e.setAttribute('height', '300%'), (this.filterManager = t) var n = createNS('feGaussianBlur') n.setAttribute('result', o), e.appendChild(n), (this.feGaussianBlur = n) } return ( (SVGGaussianBlurEffect.prototype.renderFrame = function (e) { if (e || this.filterManager._mdf) { var t = 0.3, r = this.filterManager.effectElements[0].p.v * t, o = this.filterManager.effectElements[1].p.v, n = o == 3 ? 0 : r, a = o == 2 ? 0 : r this.feGaussianBlur.setAttribute('stdDeviation', n + ' ' + a) var l = this.filterManager.effectElements[2].p.v == 1 ? 'wrap' : 'duplicate' this.feGaussianBlur.setAttribute('edgeMode', l) } }), registerRenderer('canvas', CanvasRenderer), registerRenderer('html', HybridRenderer), registerRenderer('svg', SVGRenderer), ShapeModifiers.registerModifier('tm', TrimModifier), ShapeModifiers.registerModifier('pb', PuckerAndBloatModifier), ShapeModifiers.registerModifier('rp', RepeaterModifier), ShapeModifiers.registerModifier('rd', RoundCornersModifier), setExpressionsPlugin(Expressions), initialize$1(), initialize(), registerEffect(20, SVGTintFilter, !0), registerEffect(21, SVGFillFilter, !0), registerEffect(22, SVGStrokeEffect, !1), registerEffect(23, SVGTritoneFilter, !0), registerEffect(24, SVGProLevelsFilter, !0), registerEffect(25, SVGDropShadowEffect, !0), registerEffect(28, SVGMatte3Effect, !1), registerEffect(29, SVGGaussianBlurEffect, !0), lottie ) }) })(lottie, lottie.exports) var Lottie = lottie.exports, _export_sfc = (e, t) => { const r = e.__vccOpts || e for (const [o, n] of t) r[o] = n return r } const _sfc_main = defineComponent({ props: { animationData: { type: Object, default: () => ({}) }, animationLink: { type: String, default: '' }, loop: { type: [Boolean, Number], default: !0 }, autoPlay: { type: Boolean, default: !0 }, width: { type: [Number, String], default: '100%' }, height: { type: [Number, String], default: '100%' }, speed: { type: Number, default: 1 }, delay: { type: Number, default: 0 }, direction: { type: String, default: 'forward' }, pauseOnHover: { type: Boolean, default: !1 }, playOnHover: { type: Boolean, default: !1 }, backgroundColor: { type: String, default: 'transparent' }, pauseAnimation: { type: Boolean, default: !1 } }, emits: { onComplete: null, onLoopComplete: null, onEnterFrame: null, onSegmentStart: null, onAnimationLoaded: null }, setup(e, { emit: t }) { let r = ref(null) const o = ref('') let n = 1 const a = A => document.querySelector(`[data-id="${A}" ]`) !== null, l = async A => { let $ = e.autoPlay e.playOnHover && ($ = !1) let F = {} if ( (e.animationData !== {} && (F = JSON.parse(JSON.stringify(e.animationData))), e.animationLink != '') ) try { F = await (await fetch(e.animationLink)).json() } catch (ae) { console.error(ae) return } let Y = e.loop typeof Y == 'number' && Y > 0 && (Y = Y - 1), e.delay > 0 && ($ = !1), (r = Lottie.loadAnimation({ container: A, renderer: 'svg', loop: Y, autoplay: $, animationData: F })), setTimeout(() => { ;($ = e.autoPlay), e.playOnHover ? r.pause() : $ ? r.play() : r.pause(), t('onAnimationLoaded') }, e.delay), r.setSpeed(e.speed), e.direction === 'reverse' && r.setDirection(-1), e.direction === 'normal' && r.setDirection(1), (e.pauseAnimation || e.playOnHover) && r.pause(), r.addEventListener('loopComplete', () => { e.direction === 'alternate' && (r.stop(), (n = n * -1), r.setDirection(n), r.play()), t('onLoopComplete') }), r.addEventListener('complete', () => { t('onComplete') }), r.addEventListener('enterFrame', () => { t('onEnterFrame') }), r.addEventListener('segmentStart', () => { t('onSegmentStart') }) }, s = computed(() => { let A = e.width, $ = e.height return ( typeof e.width == 'number' && (A = `${e.width}px`), typeof e.height == 'number' && ($ = `${e.height}px`), { '--lottie-animation-container-width': A, '--lottie-animation-container-height': $, '--lottie-animation-container-background-color': e.backgroundColor } ) }), c = () => { r && e.pauseOnHover && r.pause(), r && e.playOnHover && r.play() }, d = () => { r && e.pauseOnHover && r.play(), r && e.playOnHover && r.pause() } watch( () => e.pauseAnimation, () => { if ((e.pauseOnHover || e.playOnHover) && e.pauseAnimation) { console.error( 'If you are using pauseAnimation prop for Vue3-Lottie, please remove the props pauseOnHover and playOnHover' ) return } r && (e.pauseAnimation ? r.pause() : r.play()) } ) const u = () => { r && r.play() }, m = () => { r && r.pause() }, f = () => { r && (console.log(r), r.stop()) }, _ = () => { r && r.destroy() }, b = (A = 1) => { if (A <= 0) throw new Error('Speed must be greater than 0') r && r.setSpeed(A) }, v = A => { r && (A === 'forward' ? r.setDirection(1) : A === 'reverse' && r.setDirection(-1)) }, k = (A, $ = !0) => { r && r.goToAndStop(A, $) }, g = (A, $ = !0) => { r && r.goToAndPlay(A, $) }, x = (A, $ = !1) => { r && r.playSegments(A, $) }, y = (A = !0) => { r && r.setSubframe(A) }, w = (A = !0) => { if (r) return r.getDuration(A) }, S = A => { for ( var $ = '', F = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789', Y = F.length, ae = 0; ae < A; ae++ ) $ += F.charAt(Math.floor(Math.random() * Y)) return $ }, T = A => { if (e.pauseOnHover && e.playOnHover) throw new Error( 'You cannot set pauseOnHover and playOnHover for Vue3-Lottie at the same time.' ) if (e.animationLink === '' && e.animationData === {}) throw new Error( 'You must provide either animationLink or animationData' ) const $ = setInterval(() => { if (a(A)) { clearInterval($) const F = document.querySelector(`[data-id="${A}" ]`) F && l(F) } }, 0) } return ( onMounted(async () => { ;(o.value = S(20)), T(o.value) }), { elementid: o, hoverEnded: d, hoverStarted: c, getCurrentStyle: s, play: u, pause: m, stop: f, destroy: _, setSpeed: b, setDirection: v, goToAndStop: k, goToAndPlay: g, playSegments: x, setSubFrame: y, getDuration: w } ) } }), _hoisted_1 = ['data-id'] function _sfc_render(e, t, r, o, n, a) { return ( openBlock(), createElementBlock( 'div', { 'data-id': e.elementid, class: 'lottie-animation-container', style: normalizeStyle(e.getCurrentStyle), onMouseenter: t[0] || (t[0] = (...l) => e.hoverStarted && e.hoverStarted(...l)), onMouseleave: t[1] || (t[1] = (...l) => e.hoverEnded && e.hoverEnded(...l)) }, null, 44, _hoisted_1 ) ) } var Vue3Lottie = _export_sfc(_sfc_main, [['render', _sfc_render]]) function install(e, t) { const r = Object.assign({}, { name: 'Vue3Lottie' }, t) e.component(`${r.name}`, Vue3Lottie) } const plugin = { version: '2.2.4', install } var style = (() => `.lottie-animation-container{width:var(--lottie-animation-container-width);height:var(--lottie-animation-container-height);background-color:var(--lottie-animation-container-background-color);overflow:hidden;margin:0 auto} `)() const app = createApp(App) for (const [e, t] of Object.entries(ElementPlusIconsVue)) app.component(e, t) app.use(router) app.use(plugin) app.mount('#app') export { withDirectives as $, unref as A, createBlock as B, withCtx as C, withModifiers as D, ElIcon as E, Fragment as F, createCommentVNode as G, normalizeStyle as H, close_default as I, withInstall as J, studentCode as K, teacherCode as L, silder as M, ElInput as N, ElButton as O, search_default as P, componentSizeMap as Q, isClient as R, isElement$1 as S, Transition as T, inject as U, Vue3Lottie as V, get as W, toRaw as X, getCurrentInstance as Y, toRefs as Z, _export_sfc$1 as _, __vite_legacy_guard, createTextVNode as a, dayjs as a$, vShow as a0, toDisplayString as a1, useResizeObserver as a2, useLocale as a3, shallowRef as a4, formContextKey as a5, formItemContextKey as a6, isEqual as a7, debugWarn as a8, triggerRef as a9, vaildTeachingUrl as aA, ElTabs as aB, ElTabPane as aC, arrow_left_default as aD, arrow_right_default as aE, definePropType as aF, mutable as aG, watchEffect as aH, d_arrow_left_default as aI, more_filled_default as aJ, d_arrow_right_default as aK, scrollAnimation as aL, QrcodeVue as aM, register_bg as aN, ElDialog as aO, useSizeProp as aP, useFormItemInputId as aQ, isString$2 as aR, isNumber$1 as aS, isBoolean$1 as aT, toTypeString as aU, useSlots as aV, vModelCheckbox as aW, isRef as aX, ElForm as aY, ElFormItem as aZ, state as a_, toRawType as aa, debounce as ab, isObject$2 as ac, UPDATE_MODEL_EVENT as ad, scrollIntoView as ae, EVENT_CODE as af, isKorean as ag, CHANGE_EVENT as ah, ElScrollbar as ai, ElTooltip as aj, isValidComponentSize as ak, useTooltipContentProps as al, circle_close_default as am, arrow_up_default as an, resolveDirective as ao, renderList as ap, withKeys as aq, vModelText as ar, createSlots as as, resolveDynamicComponent as at, withNoopInstall as au, useRoute as av, getUserType as aw, isVNode as ax, iconClose$1 as ay, iconTeacher as az, request as b, checkIDCard as b0, ElMessage as b1, getUserInfo as b2, ElRow as b3, ElCol as b4, useDisabled as b5, vModelRadio as b6, useId as b7, useFormItem as b8, commonjsGlobal as b9, check_default as bA, throwError as bB, isNil as bC, NOOP as bD, zoom_in_default as bE, delete_default as bF, TransitionGroup as bG, entriesOf as bH, RouterLink as bI, RouterView as bJ, picture_filled_default as bK, normalizeProps as bL, onActivated as bM, onUnmounted as bN, onDeactivated as bO, Teleport as bP, ElMessageBox as bQ, getWeekCh as bR, request$1$1 as bS, circle_plus_default as bT, remove_default as bU, ElBadge as bV, isEmpty$1 as ba, isDate$2 as bb, isArray$7 as bc, clock_default as bd, calendar_default as be, onClickOutside as bf, mergeProps as bg, on$1 as bh, once as bi, arrow_down_default as bj, isUndefined as bk, hasClass as bl, useAttrs$1 as bm, TOOLTIP_INJECTION_KEY as bn, toRef as bo, isFunction$1 as bp, createApp as bq, removeClass as br, useZIndex as bs, getStyle as bt, addClass as bu, hyphenate as bv, ElImage as bw, document_default as bx, warning_filled_default as by, circle_check_default as bz, createVNode as c, defineComponent as d, ref as e, onUpdated as f, onBeforeUnmount as g, h, onBeforeUpdate as i, computed as j, resolveComponent as k, buildProps as l, componentSizes as m, nextTick as n, onMounted as o, provide as p, useSize as q, reactive as r, useNamespace as s, openBlock as t, useRouter as u, createElementBlock as v, watch as w, createBaseVNode as x, renderSlot as y, normalizeClass as z }